From 1dc37147325a69b3782a9ae6795295eaf120f417 Mon Sep 17 00:00:00 2001 From: Winicius Silva Date: Sat, 29 Nov 2025 18:26:29 -0300 Subject: [PATCH 1/2] endpoint: generate code with scaffolding tool go run ./cmd/scaffold-controller \ -interactive=false \ -kind Endpoint \ -gophercloud-client NewIdentityV3 \ -gophercloud-module github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints \ -required-create-dependency Service Signed-off-by: Winicius Silva --- api/v1alpha1/endpoint_types.go | 88 +++++ .../zz_generated.endpoint-resource.go | 177 ++++++++++ .../openstack.k-orc.cloud_endpoints.yaml | 322 ++++++++++++++++++ .../samples/openstack_v1alpha1_endpoint.yaml | 14 + internal/controllers/endpoint/actuator.go | 283 +++++++++++++++ .../controllers/endpoint/actuator_test.go | 119 +++++++ internal/controllers/endpoint/controller.go | 114 +++++++ internal/controllers/endpoint/status.go | 64 ++++ .../tests/endpoint-create-full/00-assert.yaml | 33 ++ .../00-create-resource.yaml | 29 ++ .../tests/endpoint-create-full/00-secret.yaml | 6 + .../tests/endpoint-create-full/README.md | 11 + .../endpoint-create-minimal/00-assert.yaml | 32 ++ .../00-create-resource.yaml | 28 ++ .../endpoint-create-minimal/00-secret.yaml | 6 + .../endpoint-create-minimal/01-assert.yaml | 11 + .../01-delete-secret.yaml | 7 + .../tests/endpoint-create-minimal/README.md | 15 + .../endpoint-import-dependency/00-assert.yaml | 17 + .../00-import-resource.yaml | 26 ++ .../endpoint-import-dependency/00-secret.yaml | 6 + .../endpoint-import-dependency/01-assert.yaml | 32 ++ .../01-create-trap-resource.yaml | 42 +++ .../endpoint-import-dependency/02-assert.yaml | 34 ++ .../02-create-resource.yaml | 41 +++ .../endpoint-import-dependency/03-assert.yaml | 6 + .../03-delete-import-dependencies.yaml | 7 + .../endpoint-import-dependency/04-assert.yaml | 6 + .../04-delete-resource.yaml | 7 + .../endpoint-import-dependency/README.md | 29 ++ .../endpoint-import-error/00-assert.yaml | 30 ++ .../00-create-resources.yaml | 43 +++ .../endpoint-import-error/00-secret.yaml | 6 + .../endpoint-import-error/01-assert.yaml | 15 + .../01-import-resource.yaml | 13 + .../tests/endpoint-import-error/README.md | 13 + .../tests/endpoint-import/00-assert.yaml | 15 + .../endpoint-import/00-import-resource.yaml | 15 + .../tests/endpoint-import/00-secret.yaml | 6 + .../tests/endpoint-import/01-assert.yaml | 34 ++ .../01-create-trap-resource.yaml | 31 ++ .../tests/endpoint-import/02-assert.yaml | 33 ++ .../endpoint-import/02-create-resource.yaml | 28 ++ .../endpoint/tests/endpoint-import/README.md | 18 + .../tests/endpoint-update/00-assert.yaml | 26 ++ .../endpoint-update/00-minimal-resource.yaml | 28 ++ .../endpoint-update/00-prerequisites.yaml | 6 + .../tests/endpoint-update/01-assert.yaml | 17 + .../endpoint-update/01-updated-resource.yaml | 10 + .../tests/endpoint-update/02-assert.yaml | 26 ++ .../endpoint-update/02-reverted-resource.yaml | 7 + .../endpoint/tests/endpoint-update/README.md | 17 + .../endpoint/zz_generated.adapter.go | 88 +++++ .../endpoint/zz_generated.controller.go | 45 +++ internal/osclients/endpoint.go | 104 ++++++ internal/osclients/mock/endpoint.go | 131 +++++++ .../api/v1alpha1/endpoint.go | 281 +++++++++++++++ .../api/v1alpha1/endpointfilter.go | 61 ++++ .../api/v1alpha1/endpointimport.go | 48 +++ .../api/v1alpha1/endpointresourcespec.go | 79 +++++ .../api/v1alpha1/endpointresourcestatus.go | 75 ++++ .../api/v1alpha1/endpointspec.go | 79 +++++ .../api/v1alpha1/endpointstatus.go | 66 ++++ .../clientset/typed/api/v1alpha1/endpoint.go | 74 ++++ .../typed/api/v1alpha1/fake/fake_endpoint.go | 51 +++ .../externalversions/api/v1alpha1/endpoint.go | 102 ++++++ pkg/clients/listers/api/v1alpha1/endpoint.go | 70 ++++ 67 files changed, 3403 insertions(+) create mode 100644 api/v1alpha1/endpoint_types.go create mode 100644 api/v1alpha1/zz_generated.endpoint-resource.go create mode 100644 config/crd/bases/openstack.k-orc.cloud_endpoints.yaml create mode 100644 config/samples/openstack_v1alpha1_endpoint.yaml create mode 100644 internal/controllers/endpoint/actuator.go create mode 100644 internal/controllers/endpoint/actuator_test.go create mode 100644 internal/controllers/endpoint/controller.go create mode 100644 internal/controllers/endpoint/status.go create mode 100644 internal/controllers/endpoint/tests/endpoint-create-full/00-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-create-full/00-create-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-create-full/00-secret.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-create-full/README.md create mode 100644 internal/controllers/endpoint/tests/endpoint-create-minimal/00-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-create-minimal/00-create-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-create-minimal/00-secret.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-create-minimal/01-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-create-minimal/01-delete-secret.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-create-minimal/README.md create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/00-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/00-import-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/00-secret.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/01-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/01-create-trap-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/02-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/02-create-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/03-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/03-delete-import-dependencies.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/04-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/04-delete-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-dependency/README.md create mode 100644 internal/controllers/endpoint/tests/endpoint-import-error/00-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-error/00-create-resources.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-error/00-secret.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-error/01-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-error/01-import-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import-error/README.md create mode 100644 internal/controllers/endpoint/tests/endpoint-import/00-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import/00-import-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import/00-secret.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import/01-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import/01-create-trap-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import/02-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import/02-create-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-import/README.md create mode 100644 internal/controllers/endpoint/tests/endpoint-update/00-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-update/00-minimal-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-update/00-prerequisites.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-update/01-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-update/01-updated-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-update/02-assert.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-update/02-reverted-resource.yaml create mode 100644 internal/controllers/endpoint/tests/endpoint-update/README.md create mode 100644 internal/controllers/endpoint/zz_generated.adapter.go create mode 100644 internal/controllers/endpoint/zz_generated.controller.go create mode 100644 internal/osclients/endpoint.go create mode 100644 internal/osclients/mock/endpoint.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/endpoint.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/endpointfilter.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/endpointimport.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcespec.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcestatus.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/endpointspec.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/endpointstatus.go create mode 100644 pkg/clients/clientset/clientset/typed/api/v1alpha1/endpoint.go create mode 100644 pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_endpoint.go create mode 100644 pkg/clients/informers/externalversions/api/v1alpha1/endpoint.go create mode 100644 pkg/clients/listers/api/v1alpha1/endpoint.go diff --git a/api/v1alpha1/endpoint_types.go b/api/v1alpha1/endpoint_types.go new file mode 100644 index 000000000..39271d1c2 --- /dev/null +++ b/api/v1alpha1/endpoint_types.go @@ -0,0 +1,88 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package v1alpha1 + +// EndpointResourceSpec contains the desired state of the resource. +type EndpointResourceSpec struct { + // name will be the name of the created resource. If not specified, the + // name of the ORC object will be used. + // +optional + Name *OpenStackName `json:"name,omitempty"` + + // description is a human-readable description for the resource. + // +kubebuilder:validation:MinLength:=1 + // +kubebuilder:validation:MaxLength:=255 + // +optional + Description *string `json:"description,omitempty"` + + // serviceRef is a reference to the ORC Service which this resource is associated with. + // +required + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="serviceRef is immutable" + ServiceRef KubernetesNameRef `json:"serviceRef,omitempty"` + + // TODO(scaffolding): Add more types. + // To see what is supported, you can take inspiration from the CreateOpts structure from + // github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints + // + // Until you have implemented mutability for the field, you must add a CEL validation + // preventing the field being modified: + // `// +kubebuilder:validation:XValidation:rule="self == oldSelf",message=" is immutable"` +} + +// EndpointFilter defines an existing resource by its properties +// +kubebuilder:validation:MinProperties:=1 +type EndpointFilter struct { + // name of the existing resource + // +optional + Name *OpenStackName `json:"name,omitempty"` + + // description of the existing resource + // +kubebuilder:validation:MinLength:=1 + // +kubebuilder:validation:MaxLength:=255 + // +optional + Description *string `json:"description,omitempty"` + + // serviceRef is a reference to the ORC Service which this resource is associated with. + // +optional + ServiceRef *KubernetesNameRef `json:"serviceRef,omitempty"` + + // TODO(scaffolding): Add more types. + // To see what is supported, you can take inspiration from the ListOpts structure from + // github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints +} + +// EndpointResourceStatus represents the observed state of the resource. +type EndpointResourceStatus struct { + // name is a Human-readable name for the resource. Might not be unique. + // +kubebuilder:validation:MaxLength=1024 + // +optional + Name string `json:"name,omitempty"` + + // description is a human-readable description for the resource. + // +kubebuilder:validation:MaxLength=1024 + // +optional + Description string `json:"description,omitempty"` + + // serviceID is the ID of the Service to which the resource is associated. + // +kubebuilder:validation:MaxLength=1024 + // +optional + ServiceID string `json:"serviceID,omitempty"` + + // TODO(scaffolding): Add more types. + // To see what is supported, you can take inspiration from the Endpoint structure from + // github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints +} diff --git a/api/v1alpha1/zz_generated.endpoint-resource.go b/api/v1alpha1/zz_generated.endpoint-resource.go new file mode 100644 index 000000000..33bebc76d --- /dev/null +++ b/api/v1alpha1/zz_generated.endpoint-resource.go @@ -0,0 +1,177 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package v1alpha1 + +import ( + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" +) + +// EndpointImport specifies an existing resource which will be imported instead of +// creating a new one +// +kubebuilder:validation:MinProperties:=1 +// +kubebuilder:validation:MaxProperties:=1 +type EndpointImport struct { + // id contains the unique identifier of an existing OpenStack resource. Note + // that when specifying an import by ID, the resource MUST already exist. + // The ORC object will enter an error state if the resource does not exist. + // +optional + // +kubebuilder:validation:Format:=uuid + ID *string `json:"id,omitempty"` + + // filter contains a resource query which is expected to return a single + // result. The controller will continue to retry if filter returns no + // results. If filter returns multiple results the controller will set an + // error state and will not continue to retry. + // +optional + Filter *EndpointFilter `json:"filter,omitempty"` +} + +// EndpointSpec defines the desired state of an ORC object. +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'managed' ? has(self.resource) : true",message="resource must be specified when policy is managed" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'managed' ? !has(self.__import__) : true",message="import may not be specified when policy is managed" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'unmanaged' ? !has(self.resource) : true",message="resource may not be specified when policy is unmanaged" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'unmanaged' ? has(self.__import__) : true",message="import must be specified when policy is unmanaged" +// +kubebuilder:validation:XValidation:rule="has(self.managedOptions) ? self.managementPolicy == 'managed' : true",message="managedOptions may only be provided when policy is managed" +type EndpointSpec struct { + // import refers to an existing OpenStack resource which will be imported instead of + // creating a new one. + // +optional + Import *EndpointImport `json:"import,omitempty"` + + // resource specifies the desired state of the resource. + // + // resource may not be specified if the management policy is `unmanaged`. + // + // resource must be specified if the management policy is `managed`. + // +optional + Resource *EndpointResourceSpec `json:"resource,omitempty"` + + // managementPolicy defines how ORC will treat the object. Valid values are + // `managed`: ORC will create, update, and delete the resource; `unmanaged`: + // ORC will import an existing resource, and will not apply updates to it or + // delete it. + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="managementPolicy is immutable" + // +kubebuilder:default:=managed + // +optional + ManagementPolicy ManagementPolicy `json:"managementPolicy,omitempty"` + + // managedOptions specifies options which may be applied to managed objects. + // +optional + ManagedOptions *ManagedOptions `json:"managedOptions,omitempty"` + + // cloudCredentialsRef points to a secret containing OpenStack credentials + // +required + CloudCredentialsRef CloudCredentialsReference `json:"cloudCredentialsRef"` +} + +// EndpointStatus defines the observed state of an ORC resource. +type EndpointStatus struct { + // conditions represents the observed status of the object. + // Known .status.conditions.type are: "Available", "Progressing" + // + // Available represents the availability of the OpenStack resource. If it is + // true then the resource is ready for use. + // + // Progressing indicates whether the controller is still attempting to + // reconcile the current state of the OpenStack resource to the desired + // state. Progressing will be False either because the desired state has + // been achieved, or because some terminal error prevents it from ever being + // achieved and the controller is no longer attempting to reconcile. If + // Progressing is True, an observer waiting on the resource should continue + // to wait. + // + // +kubebuilder:validation:MaxItems:=32 + // +patchMergeKey=type + // +patchStrategy=merge + // +listType=map + // +listMapKey=type + // +optional + Conditions []metav1.Condition `json:"conditions,omitempty" patchStrategy:"merge" patchMergeKey:"type"` + + // id is the unique identifier of the OpenStack resource. + // +optional + ID *string `json:"id,omitempty"` + + // resource contains the observed state of the OpenStack resource. + // +optional + Resource *EndpointResourceStatus `json:"resource,omitempty"` +} + +var _ ObjectWithConditions = &Endpoint{} + +func (i *Endpoint) GetConditions() []metav1.Condition { + return i.Status.Conditions +} + +// +genclient +// +kubebuilder:object:root=true +// +kubebuilder:resource:categories=openstack +// +kubebuilder:subresource:status +// +kubebuilder:printcolumn:name="ID",type="string",JSONPath=".status.id",description="Resource ID" +// +kubebuilder:printcolumn:name="Available",type="string",JSONPath=".status.conditions[?(@.type=='Available')].status",description="Availability status of resource" +// +kubebuilder:printcolumn:name="Message",type="string",JSONPath=".status.conditions[?(@.type=='Progressing')].message",description="Message describing current progress status" + +// Endpoint is the Schema for an ORC resource. +type Endpoint struct { + metav1.TypeMeta `json:",inline"` + + // metadata contains the object metadata + // +optional + metav1.ObjectMeta `json:"metadata,omitempty"` + + // spec specifies the desired state of the resource. + // +optional + Spec EndpointSpec `json:"spec,omitempty"` + + // status defines the observed state of the resource. + // +optional + Status EndpointStatus `json:"status,omitempty"` +} + +// +kubebuilder:object:root=true + +// EndpointList contains a list of Endpoint. +type EndpointList struct { + metav1.TypeMeta `json:",inline"` + + // metadata contains the list metadata + // +optional + metav1.ListMeta `json:"metadata,omitempty"` + + // items contains a list of Endpoint. + // +required + Items []Endpoint `json:"items"` +} + +func (l *EndpointList) GetItems() []Endpoint { + return l.Items +} + +func init() { + SchemeBuilder.Register(&Endpoint{}, &EndpointList{}) +} + +func (i *Endpoint) GetCloudCredentialsRef() (*string, *CloudCredentialsReference) { + if i == nil { + return nil, nil + } + + return &i.Namespace, &i.Spec.CloudCredentialsRef +} + +var _ CloudCredentialsRefProvider = &Endpoint{} diff --git a/config/crd/bases/openstack.k-orc.cloud_endpoints.yaml b/config/crd/bases/openstack.k-orc.cloud_endpoints.yaml new file mode 100644 index 000000000..34a49522b --- /dev/null +++ b/config/crd/bases/openstack.k-orc.cloud_endpoints.yaml @@ -0,0 +1,322 @@ +--- +apiVersion: apiextensions.k8s.io/v1 +kind: CustomResourceDefinition +metadata: + annotations: + controller-gen.kubebuilder.io/version: v0.17.1 + name: endpoints.openstack.k-orc.cloud +spec: + group: openstack.k-orc.cloud + names: + categories: + - openstack + kind: Endpoint + listKind: EndpointList + plural: endpoints + singular: endpoint + scope: Namespaced + versions: + - additionalPrinterColumns: + - description: Resource ID + jsonPath: .status.id + name: ID + type: string + - description: Availability status of resource + jsonPath: .status.conditions[?(@.type=='Available')].status + name: Available + type: string + - description: Message describing current progress status + jsonPath: .status.conditions[?(@.type=='Progressing')].message + name: Message + type: string + name: v1alpha1 + schema: + openAPIV3Schema: + description: Endpoint is the Schema for an ORC resource. + properties: + apiVersion: + description: |- + APIVersion defines the versioned schema of this representation of an object. + Servers should convert recognized schemas to the latest internal value, and + may reject unrecognized values. + More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources + type: string + kind: + description: |- + Kind is a string value representing the REST resource this object represents. + Servers may infer this from the endpoint the client submits requests to. + Cannot be updated. + In CamelCase. + More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds + type: string + metadata: + type: object + spec: + description: spec specifies the desired state of the resource. + properties: + cloudCredentialsRef: + description: cloudCredentialsRef points to a secret containing OpenStack + credentials + properties: + cloudName: + description: cloudName specifies the name of the entry in the + clouds.yaml file to use. + maxLength: 256 + minLength: 1 + type: string + secretName: + description: |- + secretName is the name of a secret in the same namespace as the resource being provisioned. + The secret must contain a key named `clouds.yaml` which contains an OpenStack clouds.yaml file. + The secret may optionally contain a key named `cacert` containing a PEM-encoded CA certificate. + maxLength: 253 + minLength: 1 + type: string + required: + - cloudName + - secretName + type: object + import: + description: |- + import refers to an existing OpenStack resource which will be imported instead of + creating a new one. + maxProperties: 1 + minProperties: 1 + properties: + filter: + description: |- + filter contains a resource query which is expected to return a single + result. The controller will continue to retry if filter returns no + results. If filter returns multiple results the controller will set an + error state and will not continue to retry. + minProperties: 1 + properties: + interface: + description: interface of the existing endpoint. + type: string + serviceRef: + description: serviceRef is a reference to which the endpoint + belongs. + maxLength: 253 + minLength: 1 + type: string + url: + description: url is the URL of the existing endpoint. + type: string + type: object + id: + description: |- + id contains the unique identifier of an existing OpenStack resource. Note + that when specifying an import by ID, the resource MUST already exist. + The ORC object will enter an error state if the resource does not exist. + format: uuid + type: string + type: object + managedOptions: + description: managedOptions specifies options which may be applied + to managed objects. + properties: + onDelete: + default: delete + description: |- + onDelete specifies the behaviour of the controller when the ORC + object is deleted. Options are `delete` - delete the OpenStack resource; + `detach` - do not delete the OpenStack resource. If not specified, the + default is `delete`. + enum: + - delete + - detach + type: string + type: object + managementPolicy: + default: managed + description: |- + managementPolicy defines how ORC will treat the object. Valid values are + `managed`: ORC will create, update, and delete the resource; `unmanaged`: + ORC will import an existing resource, and will not apply updates to it or + delete it. + enum: + - managed + - unmanaged + type: string + x-kubernetes-validations: + - message: managementPolicy is immutable + rule: self == oldSelf + resource: + description: |- + resource specifies the desired state of the resource. + + resource may not be specified if the management policy is `unmanaged`. + + resource must be specified if the management policy is `managed`. + properties: + enabled: + default: true + description: enabled indicates whether the endpoint is enabled + or not. + type: boolean + interface: + description: interface indicates the visibility of the endpoint. + enum: + - admin + - internal + - public + type: string + name: + description: |- + name will be the name of the created resource. If not specified, the + name of the ORC object will be used. + maxLength: 255 + minLength: 1 + pattern: ^[^,]+$ + type: string + serviceRef: + description: serviceRef is a reference to the ORC Service which + this resource is associated with. + maxLength: 253 + minLength: 1 + type: string + x-kubernetes-validations: + - message: serviceRef is immutable + rule: self == oldSelf + url: + description: url is the endpoint URL. + type: string + required: + - interface + - serviceRef + - url + type: object + required: + - cloudCredentialsRef + type: object + x-kubernetes-validations: + - message: resource must be specified when policy is managed + rule: 'self.managementPolicy == ''managed'' ? has(self.resource) : true' + - message: import may not be specified when policy is managed + rule: 'self.managementPolicy == ''managed'' ? !has(self.__import__) + : true' + - message: resource may not be specified when policy is unmanaged + rule: 'self.managementPolicy == ''unmanaged'' ? !has(self.resource) + : true' + - message: import must be specified when policy is unmanaged + rule: 'self.managementPolicy == ''unmanaged'' ? has(self.__import__) + : true' + - message: managedOptions may only be provided when policy is managed + rule: 'has(self.managedOptions) ? self.managementPolicy == ''managed'' + : true' + status: + description: status defines the observed state of the resource. + properties: + conditions: + description: |- + conditions represents the observed status of the object. + Known .status.conditions.type are: "Available", "Progressing" + + Available represents the availability of the OpenStack resource. If it is + true then the resource is ready for use. + + Progressing indicates whether the controller is still attempting to + reconcile the current state of the OpenStack resource to the desired + state. Progressing will be False either because the desired state has + been achieved, or because some terminal error prevents it from ever being + achieved and the controller is no longer attempting to reconcile. If + Progressing is True, an observer waiting on the resource should continue + to wait. + items: + description: Condition contains details for one aspect of the current + state of this API Resource. + properties: + lastTransitionTime: + description: |- + lastTransitionTime is the last time the condition transitioned from one status to another. + This should be when the underlying condition changed. If that is not known, then using the time when the API field changed is acceptable. + format: date-time + type: string + message: + description: |- + message is a human readable message indicating details about the transition. + This may be an empty string. + maxLength: 32768 + type: string + observedGeneration: + description: |- + observedGeneration represents the .metadata.generation that the condition was set based upon. + For instance, if .metadata.generation is currently 12, but the .status.conditions[x].observedGeneration is 9, the condition is out of date + with respect to the current state of the instance. + format: int64 + minimum: 0 + type: integer + reason: + description: |- + reason contains a programmatic identifier indicating the reason for the condition's last transition. + Producers of specific condition types may define expected values and meanings for this field, + and whether the values are considered a guaranteed API. + The value should be a CamelCase string. + This field may not be empty. + maxLength: 1024 + minLength: 1 + pattern: ^[A-Za-z]([A-Za-z0-9_,:]*[A-Za-z0-9_])?$ + type: string + status: + description: status of the condition, one of True, False, Unknown. + enum: + - "True" + - "False" + - Unknown + type: string + type: + description: type of condition in CamelCase or in foo.example.com/CamelCase. + maxLength: 316 + pattern: ^([a-z0-9]([-a-z0-9]*[a-z0-9])?(\.[a-z0-9]([-a-z0-9]*[a-z0-9])?)*/)?(([A-Za-z0-9][-A-Za-z0-9_.]*)?[A-Za-z0-9])$ + type: string + required: + - lastTransitionTime + - message + - reason + - status + - type + type: object + maxItems: 32 + type: array + x-kubernetes-list-map-keys: + - type + x-kubernetes-list-type: map + id: + description: id is the unique identifier of the OpenStack resource. + type: string + resource: + description: resource contains the observed state of the OpenStack + resource. + properties: + enabled: + description: enabled indicates whether the endpoint is enabled + or not. + type: boolean + interface: + description: interface indicates the visibility of the endpoint. + enum: + - admin + - internal + - public + type: string + name: + description: name is a Human-readable name for the resource. Might + not be unique. + maxLength: 1024 + type: string + serviceID: + description: serviceID is the ID of the Service to which the resource + is associated. + maxLength: 1024 + type: string + url: + description: url is the endpoint URL. + type: string + type: object + type: object + type: object + served: true + storage: true + subresources: + status: {} diff --git a/config/samples/openstack_v1alpha1_endpoint.yaml b/config/samples/openstack_v1alpha1_endpoint.yaml new file mode 100644 index 000000000..a45971790 --- /dev/null +++ b/config/samples/openstack_v1alpha1_endpoint.yaml @@ -0,0 +1,14 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-sample +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Sample Endpoint + # TODO(scaffolding): Add all fields the resource supports diff --git a/internal/controllers/endpoint/actuator.go b/internal/controllers/endpoint/actuator.go new file mode 100644 index 000000000..7416577a2 --- /dev/null +++ b/internal/controllers/endpoint/actuator.go @@ -0,0 +1,283 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package endpoint + +import ( + "context" + "iter" + + "github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints" + corev1 "k8s.io/api/core/v1" + apierrors "k8s.io/apimachinery/pkg/api/errors" + "k8s.io/utils/ptr" + ctrl "sigs.k8s.io/controller-runtime" + "sigs.k8s.io/controller-runtime/pkg/client" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/progress" + "github.com/k-orc/openstack-resource-controller/v2/internal/logging" + "github.com/k-orc/openstack-resource-controller/v2/internal/osclients" + orcerrors "github.com/k-orc/openstack-resource-controller/v2/internal/util/errors" +) + +// OpenStack resource types +type ( + osResourceT = endpoints.Endpoint + + createResourceActuator = interfaces.CreateResourceActuator[orcObjectPT, orcObjectT, filterT, osResourceT] + deleteResourceActuator = interfaces.DeleteResourceActuator[orcObjectPT, orcObjectT, osResourceT] + resourceReconciler = interfaces.ResourceReconciler[orcObjectPT, osResourceT] + helperFactory = interfaces.ResourceHelperFactory[orcObjectPT, orcObjectT, resourceSpecT, filterT, osResourceT] +) + +type endpointActuator struct { + osClient osclients.EndpointClient + k8sClient client.Client +} + +var _ createResourceActuator = endpointActuator{} +var _ deleteResourceActuator = endpointActuator{} + +func (endpointActuator) GetResourceID(osResource *osResourceT) string { + return osResource.ID +} + +func (actuator endpointActuator) GetOSResourceByID(ctx context.Context, id string) (*osResourceT, progress.ReconcileStatus) { + resource, err := actuator.osClient.GetEndpoint(ctx, id) + if err != nil { + return nil, progress.WrapError(err) + } + return resource, nil +} + +func (actuator endpointActuator) ListOSResourcesForAdoption(ctx context.Context, orcObject orcObjectPT) (iter.Seq2[*osResourceT, error], bool) { + resourceSpec := orcObject.Spec.Resource + if resourceSpec == nil { + return nil, false + } + + // TODO(scaffolding) If you need to filter resources on fields that the List() function + // of gophercloud does not support, it's possible to perform client-side filtering. + // Check osclients.ResourceFilter + + listOpts := endpoints.ListOpts{ + Name: getResourceName(orcObject), + Description: ptr.Deref(resourceSpec.Description, ""), + } + + return actuator.osClient.ListEndpoints(ctx, listOpts), true +} + +func (actuator endpointActuator) ListOSResourcesForImport(ctx context.Context, obj orcObjectPT, filter filterT) (iter.Seq2[*osResourceT, error], progress.ReconcileStatus) { + // TODO(scaffolding) If you need to filter resources on fields that the List() function + // of gophercloud does not support, it's possible to perform client-side filtering. + // Check osclients.ResourceFilter + var reconcileStatus progress.ReconcileStatus + + service := &orcv1alpha1.Service{} + if filter.ServiceRef != nil { + serviceKey := client.ObjectKey{Name: string(*filter.ServiceRef), Namespace: obj.Namespace} + if err := actuator.k8sClient.Get(ctx, serviceKey, service); err != nil { + if apierrors.IsNotFound(err) { + reconcileStatus = reconcileStatus.WithReconcileStatus( + progress.WaitingOnObject("Service", serviceKey.Name, progress.WaitingOnCreation)) + } else { + reconcileStatus = reconcileStatus.WithReconcileStatus( + progress.WrapError(fmt.Errorf("fetching service %s: %w", serviceKey.Name, err))) + } + } else { + if !orcv1alpha1.IsAvailable(service) || service.Status.ID == nil { + reconcileStatus = reconcileStatus.WithReconcileStatus( + progress.WaitingOnObject("Service", serviceKey.Name, progress.WaitingOnReady)) + } + } + } + + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return nil, reconcileStatus + } + + listOpts := endpoints.ListOpts{ + Name: string(ptr.Deref(filter.Name, "")), + Description: string(ptr.Deref(filter.Description, "")), + Service: ptr.Deref(service.Status.ID, ""), + // TODO(scaffolding): Add more import filters + } + + return actuator.osClient.ListEndpoints(ctx, listOpts), nil +} + +func (actuator endpointActuator) CreateResource(ctx context.Context, obj orcObjectPT) (*osResourceT, progress.ReconcileStatus) { + resource := obj.Spec.Resource + + if resource == nil { + // Should have been caught by API validation + return nil, progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "Creation requested, but spec.resource is not set")) + } + var reconcileStatus progress.ReconcileStatus + + var serviceID string + service, serviceDepRS := serviceDependency.GetDependency( + ctx, actuator.k8sClient, obj, func(dep *orcv1alpha1.Service) bool { + return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil + }, + ) + reconcileStatus = reconcileStatus.WithReconcileStatus(serviceDepRS) + if service != nil { + serviceID = ptr.Deref(service.Status.ID, "") + } + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return nil, reconcileStatus + } + createOpts := endpoints.CreateOpts{ + Name: getResourceName(obj), + Description: ptr.Deref(resource.Description, ""), + ServiceID: serviceID, + // TODO(scaffolding): Add more fields + } + + osResource, err := actuator.osClient.CreateEndpoint(ctx, createOpts) + if err != nil { + // We should require the spec to be updated before retrying a create which returned a conflict + if !orcerrors.IsRetryable(err) { + err = orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration creating resource: "+err.Error(), err) + } + return nil, progress.WrapError(err) + } + + return osResource, nil +} + +func (actuator endpointActuator) DeleteResource(ctx context.Context, _ orcObjectPT, resource *osResourceT) progress.ReconcileStatus { + return progress.WrapError(actuator.osClient.DeleteEndpoint(ctx, resource.ID)) +} + +func (actuator endpointActuator) updateResource(ctx context.Context, obj orcObjectPT, osResource *osResourceT) progress.ReconcileStatus { + log := ctrl.LoggerFrom(ctx) + resource := obj.Spec.Resource + if resource == nil { + // Should have been caught by API validation + return progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "Update requested, but spec.resource is not set")) + } + + updateOpts := endpoints.UpdateOpts{} + + handleNameUpdate(&updateOpts, obj, osResource) + handleDescriptionUpdate(&updateOpts, resource, osResource) + + // TODO(scaffolding): add handler for all fields supporting mutability + + needsUpdate, err := needsUpdate(updateOpts) + if err != nil { + return progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration updating resource: "+err.Error(), err)) + } + if !needsUpdate { + log.V(logging.Debug).Info("No changes") + return nil + } + + _, err = actuator.osClient.UpdateEndpoint(ctx, osResource.ID, updateOpts) + + // We should require the spec to be updated before retrying an update which returned a conflict + if orcerrors.IsConflict(err) { + err = orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration updating resource: "+err.Error(), err) + } + + if err != nil { + return progress.WrapError(err) + } + + return progress.NeedsRefresh() +} + +func needsUpdate(updateOpts endpoints.UpdateOpts) (bool, error) { + updateOptsMap, err := updateOpts.ToEndpointUpdateMap() + if err != nil { + return false, err + } + + updateMap, ok := updateOptsMap["endpoint"].(map[string]any) + if !ok { + updateMap = make(map[string]any) + } + + return len(updateMap) > 0, nil +} + +func handleNameUpdate(updateOpts *endpoints.UpdateOpts, obj orcObjectPT, osResource *osResourceT) { + name := getResourceName(obj) + if osResource.Name != name { + updateOpts.Name = &name + } +} + +func handleDescriptionUpdate(updateOpts *endpoints.UpdateOpts, resource *resourceSpecT, osResource *osResourceT) { + description := ptr.Deref(resource.Description, "") + if osResource.Description != description { + updateOpts.Description = &description + } +} + +func (actuator endpointActuator) GetResourceReconcilers(ctx context.Context, orcObject orcObjectPT, osResource *osResourceT, controller interfaces.ResourceController) ([]resourceReconciler, progress.ReconcileStatus) { + return []resourceReconciler{ + actuator.updateResource, + }, nil +} + +type endpointHelperFactory struct{} + +var _ helperFactory = endpointHelperFactory{} + +func newActuator(ctx context.Context, orcObject *orcv1alpha1.Endpoint, controller interfaces.ResourceController) (endpointActuator, progress.ReconcileStatus) { + log := ctrl.LoggerFrom(ctx) + + // Ensure credential secrets exist and have our finalizer + _, reconcileStatus := credentialsDependency.GetDependencies(ctx, controller.GetK8sClient(), orcObject, func(*corev1.Secret) bool { return true }) + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return endpointActuator{}, reconcileStatus + } + + clientScope, err := controller.GetScopeFactory().NewClientScopeFromObject(ctx, controller.GetK8sClient(), log, orcObject) + if err != nil { + return endpointActuator{}, progress.WrapError(err) + } + osClient, err := clientScope.NewEndpointClient() + if err != nil { + return endpointActuator{}, progress.WrapError(err) + } + + return endpointActuator{ + osClient: osClient, + k8sClient: controller.GetK8sClient(), + }, nil +} + +func (endpointHelperFactory) NewAPIObjectAdapter(obj orcObjectPT) adapterI { + return endpointAdapter{obj} +} + +func (endpointHelperFactory) NewCreateActuator(ctx context.Context, orcObject orcObjectPT, controller interfaces.ResourceController) (createResourceActuator, progress.ReconcileStatus) { + return newActuator(ctx, orcObject, controller) +} + +func (endpointHelperFactory) NewDeleteActuator(ctx context.Context, orcObject orcObjectPT, controller interfaces.ResourceController) (deleteResourceActuator, progress.ReconcileStatus) { + return newActuator(ctx, orcObject, controller) +} diff --git a/internal/controllers/endpoint/actuator_test.go b/internal/controllers/endpoint/actuator_test.go new file mode 100644 index 000000000..ed7fdce2c --- /dev/null +++ b/internal/controllers/endpoint/actuator_test.go @@ -0,0 +1,119 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package endpoint + +import ( + "testing" + + "github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints" + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "k8s.io/utils/ptr" +) + +func TestNeedsUpdate(t *testing.T) { + testCases := []struct { + name string + updateOpts endpoints.UpdateOpts + expectChange bool + }{ + { + name: "Empty base opts", + updateOpts: endpoints.UpdateOpts{}, + expectChange: false, + }, + { + name: "Updated opts", + updateOpts: endpoints.UpdateOpts{Name: ptr.To("updated")}, + expectChange: true, + }, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + got, _ := needsUpdate(tt.updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + } +} + +func TestHandleNameUpdate(t *testing.T) { + ptrToName := ptr.To[orcv1alpha1.OpenStackName] + testCases := []struct { + name string + newValue *orcv1alpha1.OpenStackName + existingValue string + expectChange bool + }{ + {name: "Identical", newValue: ptrToName("name"), existingValue: "name", expectChange: false}, + {name: "Different", newValue: ptrToName("new-name"), existingValue: "name", expectChange: true}, + {name: "No value provided, existing is identical to object name", newValue: nil, existingValue: "object-name", expectChange: false}, + {name: "No value provided, existing is different from object name", newValue: nil, existingValue: "different-from-object-name", expectChange: true}, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + resource := &orcv1alpha1.Endpoint{} + resource.Name = "object-name" + resource.Spec = orcv1alpha1.EndpointSpec{ + Resource: &orcv1alpha1.EndpointResourceSpec{Name: tt.newValue}, + } + osResource := &osResourceT{Name: tt.existingValue} + + updateOpts := endpoints.UpdateOpts{} + handleNameUpdate(&updateOpts, resource, osResource) + + got, _ := needsUpdate(updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + + } +} + +func TestHandleDescriptionUpdate(t *testing.T) { + ptrToDescription := ptr.To[string] + testCases := []struct { + name string + newValue *string + existingValue string + expectChange bool + }{ + {name: "Identical", newValue: ptrToDescription("desc"), existingValue: "desc", expectChange: false}, + {name: "Different", newValue: ptrToDescription("new-desc"), existingValue: "desc", expectChange: true}, + {name: "No value provided, existing is set", newValue: nil, existingValue: "desc", expectChange: true}, + {name: "No value provided, existing is empty", newValue: nil, existingValue: "", expectChange: false}, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + resource := &orcv1alpha1.EndpointResourceSpec{Description: tt.newValue} + osResource := &osResourceT{Description: tt.existingValue} + + updateOpts := endpoints.UpdateOpts{} + handleDescriptionUpdate(&updateOpts, resource, osResource) + + got, _ := needsUpdate(updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + + } +} diff --git a/internal/controllers/endpoint/controller.go b/internal/controllers/endpoint/controller.go new file mode 100644 index 000000000..5f4a3a342 --- /dev/null +++ b/internal/controllers/endpoint/controller.go @@ -0,0 +1,114 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package endpoint + +import ( + "context" + "errors" + + ctrl "sigs.k8s.io/controller-runtime" + "sigs.k8s.io/controller-runtime/pkg/builder" + "sigs.k8s.io/controller-runtime/pkg/controller" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/reconciler" + "github.com/k-orc/openstack-resource-controller/v2/internal/scope" + "github.com/k-orc/openstack-resource-controller/v2/internal/util/credentials" + "github.com/k-orc/openstack-resource-controller/v2/internal/util/dependency" + "github.com/k-orc/openstack-resource-controller/v2/pkg/predicates" +) + +const controllerName = "endpoint" + +// +kubebuilder:rbac:groups=openstack.k-orc.cloud,resources=endpoints,verbs=get;list;watch;create;update;patch;delete +// +kubebuilder:rbac:groups=openstack.k-orc.cloud,resources=endpoints/status,verbs=get;update;patch + +type endpointReconcilerConstructor struct { + scopeFactory scope.Factory +} + +func New(scopeFactory scope.Factory) interfaces.Controller { + return endpointReconcilerConstructor{scopeFactory: scopeFactory} +} + +func (endpointReconcilerConstructor) GetName() string { + return controllerName +} + +var serviceDependency = dependency.NewDeletionGuardDependency[*orcv1alpha1.EndpointList, *orcv1alpha1.Service]( + "spec.resource.serviceRef", + func(endpoint *orcv1alpha1.Endpoint) []string { + resource := endpoint.Spec.Resource + if resource == nil { + return nil + } + return []string{string(resource.ServiceRef)} + }, + finalizer, externalObjectFieldOwner, +) + +var serviceImportDependency = dependency.NewDependency[*orcv1alpha1.EndpointList, *orcv1alpha1.Service]( + "spec.import.filter.serviceRef", + func(endpoint *orcv1alpha1.Endpoint) []string { + resource := endpoint.Spec.Import + if resource == nil || resource.Filter == nil || resource.Filter.ServiceRef == nil { + return nil + } + return []string{string(*resource.Filter.ServiceRef)} + }, +) + +// SetupWithManager sets up the controller with the Manager. +func (c endpointReconcilerConstructor) SetupWithManager(ctx context.Context, mgr ctrl.Manager, options controller.Options) error { + log := ctrl.LoggerFrom(ctx) + k8sClient := mgr.GetClient() + + serviceWatchEventHandler, err := serviceDependency.WatchEventHandler(log, k8sClient) + if err != nil { + return err + } + + serviceImportWatchEventHandler, err := serviceImportDependency.WatchEventHandler(log, k8sClient) + if err != nil { + return err + } + + builder := ctrl.NewControllerManagedBy(mgr). + WithOptions(options). + Watches(&orcv1alpha1.Service{}, serviceWatchEventHandler, + builder.WithPredicates(predicates.NewBecameAvailable(log, &orcv1alpha1.Service{})), + ). + // A second watch is necessary because we need a different handler that omits deletion guards + Watches(&orcv1alpha1.Service{}, serviceImportWatchEventHandler, + builder.WithPredicates(predicates.NewBecameAvailable(log, &orcv1alpha1.Service{})), + ). + For(&orcv1alpha1.Endpoint{}) + + if err := errors.Join( + serviceDependency.AddToManager(ctx, mgr), + serviceImportDependency.AddToManager(ctx, mgr), + credentialsDependency.AddToManager(ctx, mgr), + credentials.AddCredentialsWatch(log, mgr.GetClient(), builder, credentialsDependency), + ); err != nil { + return err + } + + r := reconciler.NewController(controllerName, mgr.GetClient(), c.scopeFactory, endpointHelperFactory{}, endpointStatusWriter{}) + return builder.Complete(&r) +} diff --git a/internal/controllers/endpoint/status.go b/internal/controllers/endpoint/status.go new file mode 100644 index 000000000..e4e4a104f --- /dev/null +++ b/internal/controllers/endpoint/status.go @@ -0,0 +1,64 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package endpoint + +import ( + "github.com/go-logr/logr" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/progress" + orcapplyconfigv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" +) + +type endpointStatusWriter struct{} + +type objectApplyT = orcapplyconfigv1alpha1.EndpointApplyConfiguration +type statusApplyT = orcapplyconfigv1alpha1.EndpointStatusApplyConfiguration + +var _ interfaces.ResourceStatusWriter[*orcv1alpha1.Endpoint, *osResourceT, *objectApplyT, *statusApplyT] = endpointStatusWriter{} + +func (endpointStatusWriter) GetApplyConfig(name, namespace string) *objectApplyT { + return orcapplyconfigv1alpha1.Endpoint(name, namespace) +} + +func (endpointStatusWriter) ResourceAvailableStatus(orcObject *orcv1alpha1.Endpoint, osResource *osResourceT) (metav1.ConditionStatus, progress.ReconcileStatus) { + if osResource == nil { + if orcObject.Status.ID == nil { + return metav1.ConditionFalse, nil + } else { + return metav1.ConditionUnknown, nil + } + } + return metav1.ConditionTrue, nil +} + +func (endpointStatusWriter) ApplyResourceStatus(log logr.Logger, osResource *osResourceT, statusApply *statusApplyT) { + resourceStatus := orcapplyconfigv1alpha1.EndpointResourceStatus(). + WithServiceID(osResource.ServiceID). + WithName(osResource.Name) + + // TODO(scaffolding): add all of the fields supported in the EndpointResourceStatus struct + // If a zero-value isn't expected in the response, place it behind a conditional + + if osResource.Description != "" { + resourceStatus.WithDescription(osResource.Description) + } + + statusApply.WithResource(resourceStatus) +} diff --git a/internal/controllers/endpoint/tests/endpoint-create-full/00-assert.yaml b/internal/controllers/endpoint/tests/endpoint-create-full/00-assert.yaml new file mode 100644 index 000000000..881c9a9f4 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-create-full/00-assert.yaml @@ -0,0 +1,33 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-create-full +status: + resource: + name: endpoint-create-full-override + description: Endpoint from "create full" test + # TODO(scaffolding): Add all fields the resource supports + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Endpoint + name: endpoint-create-full + ref: endpoint + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Service + name: endpoint-create-full + ref: service +assertAll: + - celExpr: "endpoint.status.id != ''" + - celExpr: "endpoint.status.resource.serviceID == service.status.id" + # TODO(scaffolding): Add more checks diff --git a/internal/controllers/endpoint/tests/endpoint-create-full/00-create-resource.yaml b/internal/controllers/endpoint/tests/endpoint-create-full/00-create-resource.yaml new file mode 100644 index 000000000..ee7772a11 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-create-full/00-create-resource.yaml @@ -0,0 +1,29 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-create-full +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-create-full +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + name: endpoint-create-full-override + description: Endpoint from "create full" test + serviceRef: endpoint-create-full + # TODO(scaffolding): Add all fields the resource supports diff --git a/internal/controllers/endpoint/tests/endpoint-create-full/00-secret.yaml b/internal/controllers/endpoint/tests/endpoint-create-full/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-create-full/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/endpoint/tests/endpoint-create-full/README.md b/internal/controllers/endpoint/tests/endpoint-create-full/README.md new file mode 100644 index 000000000..d625e7b61 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-create-full/README.md @@ -0,0 +1,11 @@ +# Create a Endpoint with all the options + +## Step 00 + +Create a Endpoint using all available fields, and verify that the observed state corresponds to the spec. + +Also validate that the OpenStack resource uses the name from the spec when it is specified. + +## Reference + +https://k-orc.cloud/development/writing-tests/#create-full diff --git a/internal/controllers/endpoint/tests/endpoint-create-minimal/00-assert.yaml b/internal/controllers/endpoint/tests/endpoint-create-minimal/00-assert.yaml new file mode 100644 index 000000000..76d25598b --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-create-minimal/00-assert.yaml @@ -0,0 +1,32 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-create-minimal +status: + resource: + name: endpoint-create-minimal + # TODO(scaffolding): Add all fields the resource supports + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Endpoint + name: endpoint-create-minimal + ref: endpoint + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Service + name: endpoint-create-minimal + ref: service +assertAll: + - celExpr: "endpoint.status.id != ''" + - celExpr: "endpoint.status.resource.serviceID == service.status.id" + # TODO(scaffolding): Add more checks diff --git a/internal/controllers/endpoint/tests/endpoint-create-minimal/00-create-resource.yaml b/internal/controllers/endpoint/tests/endpoint-create-minimal/00-create-resource.yaml new file mode 100644 index 000000000..9087fb49d --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-create-minimal/00-create-resource.yaml @@ -0,0 +1,28 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-create-minimal +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-create-minimal +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Only add the mandatory fields. It's possible the resource + # doesn't have mandatory fields, in that case, leave it empty. + resource: + serviceRef: endpoint-create-full diff --git a/internal/controllers/endpoint/tests/endpoint-create-minimal/00-secret.yaml b/internal/controllers/endpoint/tests/endpoint-create-minimal/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-create-minimal/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/endpoint/tests/endpoint-create-minimal/01-assert.yaml b/internal/controllers/endpoint/tests/endpoint-create-minimal/01-assert.yaml new file mode 100644 index 000000000..e724dcbaa --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-create-minimal/01-assert.yaml @@ -0,0 +1,11 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: v1 + kind: Secret + name: openstack-clouds + ref: secret +assertAll: + - celExpr: "secret.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/endpoint' in secret.metadata.finalizers" diff --git a/internal/controllers/endpoint/tests/endpoint-create-minimal/01-delete-secret.yaml b/internal/controllers/endpoint/tests/endpoint-create-minimal/01-delete-secret.yaml new file mode 100644 index 000000000..1620791b9 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-create-minimal/01-delete-secret.yaml @@ -0,0 +1,7 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + # We expect the deletion to hang due to the finalizer, so use --wait=false + - command: kubectl delete secret openstack-clouds --wait=false + namespaced: true diff --git a/internal/controllers/endpoint/tests/endpoint-create-minimal/README.md b/internal/controllers/endpoint/tests/endpoint-create-minimal/README.md new file mode 100644 index 000000000..b9644e32d --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-create-minimal/README.md @@ -0,0 +1,15 @@ +# Create a Endpoint with the minimum options + +## Step 00 + +Create a minimal Endpoint, that sets only the required fields, and verify that the observed state corresponds to the spec. + +Also validate that the OpenStack resource uses the name of the ORC object when it is not specified. + +## Step 01 + +Try deleting the secret and ensure that it is not deleted thanks to the finalizer. + +## Reference + +https://k-orc.cloud/development/writing-tests/#create-minimal diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/00-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/00-assert.yaml new file mode 100644 index 000000000..17743d6e9 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/00-assert.yaml @@ -0,0 +1,17 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-dependency +status: + conditions: + - type: Available + message: |- + Waiting for Service/endpoint-import-dependency to be ready + status: "False" + reason: Progressing + - type: Progressing + message: |- + Waiting for Service/endpoint-import-dependency to be ready + status: "True" + reason: Progressing diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/00-import-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/00-import-resource.yaml new file mode 100644 index 000000000..6a5c8737b --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/00-import-resource.yaml @@ -0,0 +1,26 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-import-dependency +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + name: endpoint-import-dependency-external +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-dependency +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + serviceRef: endpoint-import-dependency diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/00-secret.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/01-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/01-assert.yaml new file mode 100644 index 000000000..438dd019a --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/01-assert.yaml @@ -0,0 +1,32 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-dependency-not-this-one +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-dependency +status: + conditions: + - type: Available + message: |- + Waiting for Service/endpoint-import-dependency to be ready + status: "False" + reason: Progressing + - type: Progressing + message: |- + Waiting for Service/endpoint-import-dependency to be ready + status: "True" + reason: Progressing diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/01-create-trap-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/01-create-trap-resource.yaml new file mode 100644 index 000000000..01f5e92f2 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/01-create-trap-resource.yaml @@ -0,0 +1,42 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-import-dependency-not-this-one +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-import-dependency-not-this-one +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +# This `endpoint-import-dependency-not-this-one` should not be picked by the import filter +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-dependency-not-this-one +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + serviceRef: endpoint-import-dependency-not-this-one + serviceRef: endpoint-import-dependency-not-this-one + # TODO(scaffolding): Add the necessary fields to create the resource diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/02-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/02-assert.yaml new file mode 100644 index 000000000..76b42d4b6 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/02-assert.yaml @@ -0,0 +1,34 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Endpoint + name: endpoint-import-dependency + ref: endpoint1 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Endpoint + name: endpoint-import-dependency-not-this-one + ref: endpoint2 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Service + name: endpoint-import-dependency + ref: service +assertAll: + - celExpr: "endpoint1.status.id != endpoint2.status.id" + - celExpr: "endpoint1.status.resource.serviceID == service.status.id" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-dependency +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/02-create-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/02-create-resource.yaml new file mode 100644 index 000000000..80e8511a5 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/02-create-resource.yaml @@ -0,0 +1,41 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-import-dependency-external +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-import-dependency-external +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-dependency-external +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: + serviceRef: endpoint-import-dependency-external + serviceRef: endpoint-import-dependency-external + # TODO(scaffolding): Add the necessary fields to create the resource diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/03-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/03-assert.yaml new file mode 100644 index 000000000..dad9764bb --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/03-assert.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +commands: +- script: "! kubectl get service endpoint-import-dependency --namespace $NAMESPACE" + skipLogOutput: true diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/03-delete-import-dependencies.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/03-delete-import-dependencies.yaml new file mode 100644 index 000000000..744da0717 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/03-delete-import-dependencies.yaml @@ -0,0 +1,7 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + # We should be able to delete the import dependencies + - command: kubectl delete service endpoint-import-dependency + namespaced: true diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/04-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/04-assert.yaml new file mode 100644 index 000000000..4155ea163 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/04-assert.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +commands: +- script: "! kubectl get endpoint endpoint-import-dependency --namespace $NAMESPACE" + skipLogOutput: true diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/04-delete-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/04-delete-resource.yaml new file mode 100644 index 000000000..56a973e5b --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/04-delete-resource.yaml @@ -0,0 +1,7 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +delete: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Endpoint + name: endpoint-import-dependency diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/README.md b/internal/controllers/endpoint/tests/endpoint-import-dependency/README.md new file mode 100644 index 000000000..934ab20fe --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/README.md @@ -0,0 +1,29 @@ +# Check dependency handling for imported Endpoint + +## Step 00 + +Import a Endpoint that references other imported resources. The referenced imported resources have no matching resources yet. +Verify the Endpoint is waiting for the dependency to be ready. + +## Step 01 + +Create a Endpoint matching the import filter, except for referenced resources, and verify that it's not being imported. + +## Step 02 + +Create the referenced resources and a Endpoint matching the import filters. + +Verify that the observed status on the imported Endpoint corresponds to the spec of the created Endpoint. + +## Step 03 + +Delete the referenced resources and check that ORC does not prevent deletion. The OpenStack resources still exist because they +were imported resources and we only deleted the ORC representation of it. + +## Step 04 + +Delete the Endpoint and validate that all resources are gone. + +## Reference + +https://k-orc.cloud/development/writing-tests/#import-dependency diff --git a/internal/controllers/endpoint/tests/endpoint-import-error/00-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import-error/00-assert.yaml new file mode 100644 index 000000000..06992d40e --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-error/00-assert.yaml @@ -0,0 +1,30 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-error-external-1 +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-error-external-2 +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success diff --git a/internal/controllers/endpoint/tests/endpoint-import-error/00-create-resources.yaml b/internal/controllers/endpoint/tests/endpoint-import-error/00-create-resources.yaml new file mode 100644 index 000000000..7e68b2f80 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-error/00-create-resources.yaml @@ -0,0 +1,43 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-import-error +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-error-external-1 +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Endpoint from "import error" test + serviceRef: endpoint-import-error + # TODO(scaffolding): add any required field +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-error-external-2 +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Endpoint from "import error" test + serviceRef: endpoint-import-error + # TODO(scaffolding): add any required field diff --git a/internal/controllers/endpoint/tests/endpoint-import-error/00-secret.yaml b/internal/controllers/endpoint/tests/endpoint-import-error/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-error/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/endpoint/tests/endpoint-import-error/01-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import-error/01-assert.yaml new file mode 100644 index 000000000..e9751d908 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-error/01-assert.yaml @@ -0,0 +1,15 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-error +status: + conditions: + - type: Available + message: found more than one matching OpenStack resource during import + status: "False" + reason: InvalidConfiguration + - type: Progressing + message: found more than one matching OpenStack resource during import + status: "False" + reason: InvalidConfiguration diff --git a/internal/controllers/endpoint/tests/endpoint-import-error/01-import-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import-error/01-import-resource.yaml new file mode 100644 index 000000000..df0e2d3a9 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-error/01-import-resource.yaml @@ -0,0 +1,13 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-error +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + description: Endpoint from "import error" test diff --git a/internal/controllers/endpoint/tests/endpoint-import-error/README.md b/internal/controllers/endpoint/tests/endpoint-import-error/README.md new file mode 100644 index 000000000..7a8e80bcf --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import-error/README.md @@ -0,0 +1,13 @@ +# Import Endpoint with more than one matching resources + +## Step 00 + +Create two Endpoints with identical specs. + +## Step 01 + +Ensure that an imported Endpoint with a filter matching the resources returns an error. + +## Reference + +https://k-orc.cloud/development/writing-tests/#import-error diff --git a/internal/controllers/endpoint/tests/endpoint-import/00-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import/00-assert.yaml new file mode 100644 index 000000000..cc87b9a8e --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import/00-assert.yaml @@ -0,0 +1,15 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import +status: + conditions: + - type: Available + message: Waiting for OpenStack resource to be created externally + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for OpenStack resource to be created externally + status: "True" + reason: Progressing diff --git a/internal/controllers/endpoint/tests/endpoint-import/00-import-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import/00-import-resource.yaml new file mode 100644 index 000000000..cdfda600d --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import/00-import-resource.yaml @@ -0,0 +1,15 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + name: endpoint-import-external + description: Endpoint endpoint-import-external from "endpoint-import" test + # TODO(scaffolding): Add all fields supported by the filter diff --git a/internal/controllers/endpoint/tests/endpoint-import/00-secret.yaml b/internal/controllers/endpoint/tests/endpoint-import/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/endpoint/tests/endpoint-import/01-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import/01-assert.yaml new file mode 100644 index 000000000..63a67bdbd --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import/01-assert.yaml @@ -0,0 +1,34 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-external-not-this-one +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success + resource: + name: endpoint-import-external-not-this-one + description: Endpoint endpoint-import-external from "endpoint-import" test + # TODO(scaffolding): Add fields necessary to match filter +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import +status: + conditions: + - type: Available + message: Waiting for OpenStack resource to be created externally + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for OpenStack resource to be created externally + status: "True" + reason: Progressing diff --git a/internal/controllers/endpoint/tests/endpoint-import/01-create-trap-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import/01-create-trap-resource.yaml new file mode 100644 index 000000000..036efd781 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import/01-create-trap-resource.yaml @@ -0,0 +1,31 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-import-external-not-this-one +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +# This `endpoint-import-external-not-this-one` resource serves two purposes: +# - ensure that we can successfully create another resource which name is a substring of it (i.e. it's not being adopted) +# - ensure that importing a resource which name is a substring of it will not pick this one. +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-external-not-this-one +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Endpoint endpoint-import-external from "endpoint-import" test + serviceRef: endpoint-import-external-not-this-one + # TODO(scaffolding): Add fields necessary to match filter diff --git a/internal/controllers/endpoint/tests/endpoint-import/02-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import/02-assert.yaml new file mode 100644 index 000000000..b3c7c0b04 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import/02-assert.yaml @@ -0,0 +1,33 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Endpoint + name: endpoint-import-external + ref: endpoint1 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Endpoint + name: endpoint-import-external-not-this-one + ref: endpoint2 +assertAll: + - celExpr: "endpoint1.status.id != endpoint2.status.id" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success + resource: + name: endpoint-import-external + description: Endpoint endpoint-import-external from "endpoint-import" test + # TODO(scaffolding): Add all fields the resource supports diff --git a/internal/controllers/endpoint/tests/endpoint-import/02-create-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import/02-create-resource.yaml new file mode 100644 index 000000000..5e17eec59 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import/02-create-resource.yaml @@ -0,0 +1,28 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-import +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-import-external +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Endpoint endpoint-import-external from "endpoint-import" test + serviceRef: endpoint-import + # TODO(scaffolding): Add fields necessary to match filter diff --git a/internal/controllers/endpoint/tests/endpoint-import/README.md b/internal/controllers/endpoint/tests/endpoint-import/README.md new file mode 100644 index 000000000..5fbb68b9a --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-import/README.md @@ -0,0 +1,18 @@ +# Import Endpoint + +## Step 00 + +Import a endpoint, matching all of the available filter's fields, and verify it is waiting for the external resource to be created. + +## Step 01 + +Create a endpoint which name is a superstring of the one specified in the import filter, and otherwise matching the filter, and verify that it's not being imported. + +## Step 02 + +Create a endpoint matching the filter and verify that the observed status on the imported endpoint corresponds to the spec of the created endpoint. +Also verify that the created endpoint didn't adopt the one which name is a superstring of it. + +## Reference + +https://k-orc.cloud/development/writing-tests/#import diff --git a/internal/controllers/endpoint/tests/endpoint-update/00-assert.yaml b/internal/controllers/endpoint/tests/endpoint-update/00-assert.yaml new file mode 100644 index 000000000..49cc482c0 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-update/00-assert.yaml @@ -0,0 +1,26 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Endpoint + name: endpoint-update + ref: endpoint +assertAll: + - celExpr: "!has(endpoint.status.resource.description)" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-update +status: + resource: + name: endpoint-update + # TODO(scaffolding): Add matches for more fields + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success diff --git a/internal/controllers/endpoint/tests/endpoint-update/00-minimal-resource.yaml b/internal/controllers/endpoint/tests/endpoint-update/00-minimal-resource.yaml new file mode 100644 index 000000000..d846d67fb --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-update/00-minimal-resource.yaml @@ -0,0 +1,28 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-update +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-update +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created or updated + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Only add the mandatory fields. It's possible the resource + # doesn't have mandatory fields, in that case, leave it empty. + resource: + serviceRef: endpoint-update diff --git a/internal/controllers/endpoint/tests/endpoint-update/00-prerequisites.yaml b/internal/controllers/endpoint/tests/endpoint-update/00-prerequisites.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-update/00-prerequisites.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/endpoint/tests/endpoint-update/01-assert.yaml b/internal/controllers/endpoint/tests/endpoint-update/01-assert.yaml new file mode 100644 index 000000000..e526907c7 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-update/01-assert.yaml @@ -0,0 +1,17 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-update +status: + resource: + name: endpoint-update-updated + description: endpoint-update-updated + # TODO(scaffolding): match all fields that were modified + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success diff --git a/internal/controllers/endpoint/tests/endpoint-update/01-updated-resource.yaml b/internal/controllers/endpoint/tests/endpoint-update/01-updated-resource.yaml new file mode 100644 index 000000000..ea78d64af --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-update/01-updated-resource.yaml @@ -0,0 +1,10 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-update +spec: + resource: + name: endpoint-update-updated + description: endpoint-update-updated + # TODO(scaffolding): update all mutable fields diff --git a/internal/controllers/endpoint/tests/endpoint-update/02-assert.yaml b/internal/controllers/endpoint/tests/endpoint-update/02-assert.yaml new file mode 100644 index 000000000..c3e8f879e --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-update/02-assert.yaml @@ -0,0 +1,26 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Endpoint + name: endpoint-update + ref: endpoint +assertAll: + - celExpr: "!has(endpoint.status.resource.description)" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Endpoint +metadata: + name: endpoint-update +status: + resource: + name: endpoint-update + # TODO(scaffolding): validate that updated fields were all reverted to their original value + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success diff --git a/internal/controllers/endpoint/tests/endpoint-update/02-reverted-resource.yaml b/internal/controllers/endpoint/tests/endpoint-update/02-reverted-resource.yaml new file mode 100644 index 000000000..2c6c253ff --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-update/02-reverted-resource.yaml @@ -0,0 +1,7 @@ +# NOTE: kuttl only does patch updates, which means we can't delete a field. +# We have to use a kubectl apply command instead. +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl replace -f 00-minimal-resource.yaml + namespaced: true diff --git a/internal/controllers/endpoint/tests/endpoint-update/README.md b/internal/controllers/endpoint/tests/endpoint-update/README.md new file mode 100644 index 000000000..3cf396e87 --- /dev/null +++ b/internal/controllers/endpoint/tests/endpoint-update/README.md @@ -0,0 +1,17 @@ +# Update Endpoint + +## Step 00 + +Create a Endpoint using only mandatory fields. + +## Step 01 + +Update all mutable fields. + +## Step 02 + +Revert the resource to its original value and verify the resulting object is similar to when if was first created. + +## Reference + +https://k-orc.cloud/development/writing-tests/#update diff --git a/internal/controllers/endpoint/zz_generated.adapter.go b/internal/controllers/endpoint/zz_generated.adapter.go new file mode 100644 index 000000000..934d9b7da --- /dev/null +++ b/internal/controllers/endpoint/zz_generated.adapter.go @@ -0,0 +1,88 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package endpoint + +import ( + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" +) + +// Fundamental types +type ( + orcObjectT = orcv1alpha1.Endpoint + orcObjectListT = orcv1alpha1.EndpointList + resourceSpecT = orcv1alpha1.EndpointResourceSpec + filterT = orcv1alpha1.EndpointFilter +) + +// Derived types +type ( + orcObjectPT = *orcObjectT + adapterI = interfaces.APIObjectAdapter[orcObjectPT, resourceSpecT, filterT] + adapterT = endpointAdapter +) + +type endpointAdapter struct { + *orcv1alpha1.Endpoint +} + +var _ adapterI = &adapterT{} + +func (f adapterT) GetObject() orcObjectPT { + return f.Endpoint +} + +func (f adapterT) GetManagementPolicy() orcv1alpha1.ManagementPolicy { + return f.Spec.ManagementPolicy +} + +func (f adapterT) GetManagedOptions() *orcv1alpha1.ManagedOptions { + return f.Spec.ManagedOptions +} + +func (f adapterT) GetStatusID() *string { + return f.Status.ID +} + +func (f adapterT) GetResourceSpec() *resourceSpecT { + return f.Spec.Resource +} + +func (f adapterT) GetImportID() *string { + if f.Spec.Import == nil { + return nil + } + return f.Spec.Import.ID +} + +func (f adapterT) GetImportFilter() *filterT { + if f.Spec.Import == nil { + return nil + } + return f.Spec.Import.Filter +} + +// getResourceName returns the name of the OpenStack resource we should use. +// This method is not implemented as part of APIObjectAdapter as it is intended +// to be used by resource actuators, which don't use the adapter. +func getResourceName(orcObject orcObjectPT) string { + if orcObject.Spec.Resource.Name != nil { + return string(*orcObject.Spec.Resource.Name) + } + return orcObject.Name +} diff --git a/internal/controllers/endpoint/zz_generated.controller.go b/internal/controllers/endpoint/zz_generated.controller.go new file mode 100644 index 000000000..1dd55a109 --- /dev/null +++ b/internal/controllers/endpoint/zz_generated.controller.go @@ -0,0 +1,45 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package endpoint + +import ( + corev1 "k8s.io/api/core/v1" + + "github.com/k-orc/openstack-resource-controller/v2/internal/util/dependency" + orcstrings "github.com/k-orc/openstack-resource-controller/v2/internal/util/strings" +) + +var ( + // NOTE: controllerName must be defined in any controller using this template + + // finalizer is the string this controller adds to an object's Finalizers + finalizer = orcstrings.GetFinalizerName(controllerName) + + // externalObjectFieldOwner is the field owner we use when using + // server-side-apply on objects we don't control + externalObjectFieldOwner = orcstrings.GetSSAFieldOwner(controllerName) + + credentialsDependency = dependency.NewDeletionGuardDependency[*orcObjectListT, *corev1.Secret]( + "spec.cloudCredentialsRef.secretName", + func(obj orcObjectPT) []string { + return []string{obj.Spec.CloudCredentialsRef.SecretName} + }, + finalizer, externalObjectFieldOwner, + dependency.OverrideDependencyName("credentials"), + ) +) diff --git a/internal/osclients/endpoint.go b/internal/osclients/endpoint.go new file mode 100644 index 000000000..e99555396 --- /dev/null +++ b/internal/osclients/endpoint.go @@ -0,0 +1,104 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package osclients + +import ( + "context" + "fmt" + "iter" + + "github.com/gophercloud/gophercloud/v2" + "github.com/gophercloud/gophercloud/v2/openstack" + "github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints" + "github.com/gophercloud/utils/v2/openstack/clientconfig" +) + +type EndpointClient interface { + ListEndpoints(ctx context.Context, listOpts endpoints.ListOptsBuilder) iter.Seq2[*endpoints.Endpoint, error] + CreateEndpoint(ctx context.Context, opts endpoints.CreateOptsBuilder) (*endpoints.Endpoint, error) + DeleteEndpoint(ctx context.Context, resourceID string) error + GetEndpoint(ctx context.Context, resourceID string) (*endpoints.Endpoint, error) + UpdateEndpoint(ctx context.Context, id string, opts endpoints.UpdateOptsBuilder) (*endpoints.Endpoint, error) +} + +type endpointClient struct{ client *gophercloud.ServiceClient } + +// NewEndpointClient returns a new OpenStack client. +func NewEndpointClient(providerClient *gophercloud.ProviderClient, providerClientOpts *clientconfig.ClientOpts) (EndpointClient, error) { + client, err := openstack.NewIdentityV3(providerClient, gophercloud.EndpointOpts{ + Region: providerClientOpts.RegionName, + Availability: clientconfig.GetEndpointType(providerClientOpts.EndpointType), + }) + + if err != nil { + return nil, fmt.Errorf("failed to create endpoint service client: %v", err) + } + + return &endpointClient{client}, nil +} + +func (c endpointClient) ListEndpoints(ctx context.Context, listOpts endpoints.ListOptsBuilder) iter.Seq2[*endpoints.Endpoint, error] { + pager := endpoints.List(c.client, listOpts) + return func(yield func(*endpoints.Endpoint, error) bool) { + _ = pager.EachPage(ctx, yieldPage(endpoints.ExtractEndpoints, yield)) + } +} + +func (c endpointClient) CreateEndpoint(ctx context.Context, opts endpoints.CreateOptsBuilder) (*endpoints.Endpoint, error) { + return endpoints.Create(ctx, c.client, opts).Extract() +} + +func (c endpointClient) DeleteEndpoint(ctx context.Context, resourceID string) error { + return endpoints.Delete(ctx, c.client, resourceID).ExtractErr() +} + +func (c endpointClient) GetEndpoint(ctx context.Context, resourceID string) (*endpoints.Endpoint, error) { + return endpoints.Get(ctx, c.client, resourceID).Extract() +} + +func (c endpointClient) UpdateEndpoint(ctx context.Context, id string, opts endpoints.UpdateOptsBuilder) (*endpoints.Endpoint, error) { + return endpoints.Update(ctx, c.client, id, opts).Extract() +} + +type endpointErrorClient struct{ error } + +// NewEndpointErrorClient returns a EndpointClient in which every method returns the given error. +func NewEndpointErrorClient(e error) EndpointClient { + return endpointErrorClient{e} +} + +func (e endpointErrorClient) ListEndpoints(_ context.Context, _ endpoints.ListOptsBuilder) iter.Seq2[*endpoints.Endpoint, error] { + return func(yield func(*endpoints.Endpoint, error) bool) { + yield(nil, e.error) + } +} + +func (e endpointErrorClient) CreateEndpoint(_ context.Context, _ endpoints.CreateOptsBuilder) (*endpoints.Endpoint, error) { + return nil, e.error +} + +func (e endpointErrorClient) DeleteEndpoint(_ context.Context, _ string) error { + return e.error +} + +func (e endpointErrorClient) GetEndpoint(_ context.Context, _ string) (*endpoints.Endpoint, error) { + return nil, e.error +} + +func (e endpointErrorClient) UpdateEndpoint(_ context.Context, _ string, _ endpoints.UpdateOptsBuilder) (*endpoints.Endpoint, error) { + return nil, e.error +} diff --git a/internal/osclients/mock/endpoint.go b/internal/osclients/mock/endpoint.go new file mode 100644 index 000000000..dafc92276 --- /dev/null +++ b/internal/osclients/mock/endpoint.go @@ -0,0 +1,131 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ +// Code generated by MockGen. DO NOT EDIT. +// Source: ../endpoint.go +// +// Generated by this command: +// +// mockgen -package mock -destination=endpoint.go -source=../endpoint.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock EndpointClient +// + +// Package mock is a generated GoMock package. +package mock + +import ( + context "context" + iter "iter" + reflect "reflect" + + endpoints "github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints" + gomock "go.uber.org/mock/gomock" +) + +// MockEndpointClient is a mock of EndpointClient interface. +type MockEndpointClient struct { + ctrl *gomock.Controller + recorder *MockEndpointClientMockRecorder + isgomock struct{} +} + +// MockEndpointClientMockRecorder is the mock recorder for MockEndpointClient. +type MockEndpointClientMockRecorder struct { + mock *MockEndpointClient +} + +// NewMockEndpointClient creates a new mock instance. +func NewMockEndpointClient(ctrl *gomock.Controller) *MockEndpointClient { + mock := &MockEndpointClient{ctrl: ctrl} + mock.recorder = &MockEndpointClientMockRecorder{mock} + return mock +} + +// EXPECT returns an object that allows the caller to indicate expected use. +func (m *MockEndpointClient) EXPECT() *MockEndpointClientMockRecorder { + return m.recorder +} + +// CreateEndpoint mocks base method. +func (m *MockEndpointClient) CreateEndpoint(ctx context.Context, opts endpoints.CreateOptsBuilder) (*endpoints.Endpoint, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "CreateEndpoint", ctx, opts) + ret0, _ := ret[0].(*endpoints.Endpoint) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// CreateEndpoint indicates an expected call of CreateEndpoint. +func (mr *MockEndpointClientMockRecorder) CreateEndpoint(ctx, opts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "CreateEndpoint", reflect.TypeOf((*MockEndpointClient)(nil).CreateEndpoint), ctx, opts) +} + +// DeleteEndpoint mocks base method. +func (m *MockEndpointClient) DeleteEndpoint(ctx context.Context, resourceID string) error { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "DeleteEndpoint", ctx, resourceID) + ret0, _ := ret[0].(error) + return ret0 +} + +// DeleteEndpoint indicates an expected call of DeleteEndpoint. +func (mr *MockEndpointClientMockRecorder) DeleteEndpoint(ctx, resourceID any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeleteEndpoint", reflect.TypeOf((*MockEndpointClient)(nil).DeleteEndpoint), ctx, resourceID) +} + +// GetEndpoint mocks base method. +func (m *MockEndpointClient) GetEndpoint(ctx context.Context, resourceID string) (*endpoints.Endpoint, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "GetEndpoint", ctx, resourceID) + ret0, _ := ret[0].(*endpoints.Endpoint) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// GetEndpoint indicates an expected call of GetEndpoint. +func (mr *MockEndpointClientMockRecorder) GetEndpoint(ctx, resourceID any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetEndpoint", reflect.TypeOf((*MockEndpointClient)(nil).GetEndpoint), ctx, resourceID) +} + +// ListEndpoints mocks base method. +func (m *MockEndpointClient) ListEndpoints(ctx context.Context, listOpts endpoints.ListOptsBuilder) iter.Seq2[*endpoints.Endpoint, error] { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "ListEndpoints", ctx, listOpts) + ret0, _ := ret[0].(iter.Seq2[*endpoints.Endpoint, error]) + return ret0 +} + +// ListEndpoints indicates an expected call of ListEndpoints. +func (mr *MockEndpointClientMockRecorder) ListEndpoints(ctx, listOpts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "ListEndpoints", reflect.TypeOf((*MockEndpointClient)(nil).ListEndpoints), ctx, listOpts) +} + +// UpdateEndpoint mocks base method. +func (m *MockEndpointClient) UpdateEndpoint(ctx context.Context, id string, opts endpoints.UpdateOptsBuilder) (*endpoints.Endpoint, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "UpdateEndpoint", ctx, id, opts) + ret0, _ := ret[0].(*endpoints.Endpoint) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// UpdateEndpoint indicates an expected call of UpdateEndpoint. +func (mr *MockEndpointClientMockRecorder) UpdateEndpoint(ctx, id, opts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "UpdateEndpoint", reflect.TypeOf((*MockEndpointClient)(nil).UpdateEndpoint), ctx, id, opts) +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpoint.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpoint.go new file mode 100644 index 000000000..a099f728f --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpoint.go @@ -0,0 +1,281 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + internal "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/internal" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + types "k8s.io/apimachinery/pkg/types" + managedfields "k8s.io/apimachinery/pkg/util/managedfields" + v1 "k8s.io/client-go/applyconfigurations/meta/v1" +) + +// EndpointApplyConfiguration represents a declarative configuration of the Endpoint type for use +// with apply. +type EndpointApplyConfiguration struct { + v1.TypeMetaApplyConfiguration `json:",inline"` + *v1.ObjectMetaApplyConfiguration `json:"metadata,omitempty"` + Spec *EndpointSpecApplyConfiguration `json:"spec,omitempty"` + Status *EndpointStatusApplyConfiguration `json:"status,omitempty"` +} + +// Endpoint constructs a declarative configuration of the Endpoint type for use with +// apply. +func Endpoint(name, namespace string) *EndpointApplyConfiguration { + b := &EndpointApplyConfiguration{} + b.WithName(name) + b.WithNamespace(namespace) + b.WithKind("Endpoint") + b.WithAPIVersion("openstack.k-orc.cloud/v1alpha1") + return b +} + +// ExtractEndpoint extracts the applied configuration owned by fieldManager from +// endpoint. If no managedFields are found in endpoint for fieldManager, a +// EndpointApplyConfiguration is returned with only the Name, Namespace (if applicable), +// APIVersion and Kind populated. It is possible that no managed fields were found for because other +// field managers have taken ownership of all the fields previously owned by fieldManager, or because +// the fieldManager never owned fields any fields. +// endpoint must be a unmodified Endpoint API object that was retrieved from the Kubernetes API. +// ExtractEndpoint provides a way to perform a extract/modify-in-place/apply workflow. +// Note that an extracted apply configuration will contain fewer fields than what the fieldManager previously +// applied if another fieldManager has updated or force applied any of the previously applied fields. +// Experimental! +func ExtractEndpoint(endpoint *apiv1alpha1.Endpoint, fieldManager string) (*EndpointApplyConfiguration, error) { + return extractEndpoint(endpoint, fieldManager, "") +} + +// ExtractEndpointStatus is the same as ExtractEndpoint except +// that it extracts the status subresource applied configuration. +// Experimental! +func ExtractEndpointStatus(endpoint *apiv1alpha1.Endpoint, fieldManager string) (*EndpointApplyConfiguration, error) { + return extractEndpoint(endpoint, fieldManager, "status") +} + +func extractEndpoint(endpoint *apiv1alpha1.Endpoint, fieldManager string, subresource string) (*EndpointApplyConfiguration, error) { + b := &EndpointApplyConfiguration{} + err := managedfields.ExtractInto(endpoint, internal.Parser().Type("com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.Endpoint"), fieldManager, b, subresource) + if err != nil { + return nil, err + } + b.WithName(endpoint.Name) + b.WithNamespace(endpoint.Namespace) + + b.WithKind("Endpoint") + b.WithAPIVersion("openstack.k-orc.cloud/v1alpha1") + return b, nil +} +func (b EndpointApplyConfiguration) IsApplyConfiguration() {} + +// WithKind sets the Kind field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Kind field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithKind(value string) *EndpointApplyConfiguration { + b.TypeMetaApplyConfiguration.Kind = &value + return b +} + +// WithAPIVersion sets the APIVersion field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the APIVersion field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithAPIVersion(value string) *EndpointApplyConfiguration { + b.TypeMetaApplyConfiguration.APIVersion = &value + return b +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithName(value string) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Name = &value + return b +} + +// WithGenerateName sets the GenerateName field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the GenerateName field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithGenerateName(value string) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.GenerateName = &value + return b +} + +// WithNamespace sets the Namespace field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Namespace field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithNamespace(value string) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Namespace = &value + return b +} + +// WithUID sets the UID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the UID field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithUID(value types.UID) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.UID = &value + return b +} + +// WithResourceVersion sets the ResourceVersion field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ResourceVersion field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithResourceVersion(value string) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.ResourceVersion = &value + return b +} + +// WithGeneration sets the Generation field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Generation field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithGeneration(value int64) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Generation = &value + return b +} + +// WithCreationTimestamp sets the CreationTimestamp field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the CreationTimestamp field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithCreationTimestamp(value metav1.Time) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.CreationTimestamp = &value + return b +} + +// WithDeletionTimestamp sets the DeletionTimestamp field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the DeletionTimestamp field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithDeletionTimestamp(value metav1.Time) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.DeletionTimestamp = &value + return b +} + +// WithDeletionGracePeriodSeconds sets the DeletionGracePeriodSeconds field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the DeletionGracePeriodSeconds field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithDeletionGracePeriodSeconds(value int64) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.DeletionGracePeriodSeconds = &value + return b +} + +// WithLabels puts the entries into the Labels field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, the entries provided by each call will be put on the Labels field, +// overwriting an existing map entries in Labels field with the same key. +func (b *EndpointApplyConfiguration) WithLabels(entries map[string]string) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + if b.ObjectMetaApplyConfiguration.Labels == nil && len(entries) > 0 { + b.ObjectMetaApplyConfiguration.Labels = make(map[string]string, len(entries)) + } + for k, v := range entries { + b.ObjectMetaApplyConfiguration.Labels[k] = v + } + return b +} + +// WithAnnotations puts the entries into the Annotations field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, the entries provided by each call will be put on the Annotations field, +// overwriting an existing map entries in Annotations field with the same key. +func (b *EndpointApplyConfiguration) WithAnnotations(entries map[string]string) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + if b.ObjectMetaApplyConfiguration.Annotations == nil && len(entries) > 0 { + b.ObjectMetaApplyConfiguration.Annotations = make(map[string]string, len(entries)) + } + for k, v := range entries { + b.ObjectMetaApplyConfiguration.Annotations[k] = v + } + return b +} + +// WithOwnerReferences adds the given value to the OwnerReferences field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the OwnerReferences field. +func (b *EndpointApplyConfiguration) WithOwnerReferences(values ...*v1.OwnerReferenceApplyConfiguration) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + for i := range values { + if values[i] == nil { + panic("nil value passed to WithOwnerReferences") + } + b.ObjectMetaApplyConfiguration.OwnerReferences = append(b.ObjectMetaApplyConfiguration.OwnerReferences, *values[i]) + } + return b +} + +// WithFinalizers adds the given value to the Finalizers field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Finalizers field. +func (b *EndpointApplyConfiguration) WithFinalizers(values ...string) *EndpointApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + for i := range values { + b.ObjectMetaApplyConfiguration.Finalizers = append(b.ObjectMetaApplyConfiguration.Finalizers, values[i]) + } + return b +} + +func (b *EndpointApplyConfiguration) ensureObjectMetaApplyConfigurationExists() { + if b.ObjectMetaApplyConfiguration == nil { + b.ObjectMetaApplyConfiguration = &v1.ObjectMetaApplyConfiguration{} + } +} + +// WithSpec sets the Spec field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Spec field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithSpec(value *EndpointSpecApplyConfiguration) *EndpointApplyConfiguration { + b.Spec = value + return b +} + +// WithStatus sets the Status field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Status field is set to the value of the last call. +func (b *EndpointApplyConfiguration) WithStatus(value *EndpointStatusApplyConfiguration) *EndpointApplyConfiguration { + b.Status = value + return b +} + +// GetKind retrieves the value of the Kind field in the declarative configuration. +func (b *EndpointApplyConfiguration) GetKind() *string { + return b.TypeMetaApplyConfiguration.Kind +} + +// GetAPIVersion retrieves the value of the APIVersion field in the declarative configuration. +func (b *EndpointApplyConfiguration) GetAPIVersion() *string { + return b.TypeMetaApplyConfiguration.APIVersion +} + +// GetName retrieves the value of the Name field in the declarative configuration. +func (b *EndpointApplyConfiguration) GetName() *string { + b.ensureObjectMetaApplyConfigurationExists() + return b.ObjectMetaApplyConfiguration.Name +} + +// GetNamespace retrieves the value of the Namespace field in the declarative configuration. +func (b *EndpointApplyConfiguration) GetNamespace() *string { + b.ensureObjectMetaApplyConfigurationExists() + return b.ObjectMetaApplyConfiguration.Namespace +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointfilter.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointfilter.go new file mode 100644 index 000000000..0908e2c55 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointfilter.go @@ -0,0 +1,61 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// EndpointFilterApplyConfiguration represents a declarative configuration of the EndpointFilter type for use +// with apply. +type EndpointFilterApplyConfiguration struct { + ServiceRef *apiv1alpha1.KubernetesNameRef `json:"serviceRef,omitempty"` + Interface *string `json:"interface,omitempty"` + URL *string `json:"url,omitempty"` +} + +// EndpointFilterApplyConfiguration constructs a declarative configuration of the EndpointFilter type for use with +// apply. +func EndpointFilter() *EndpointFilterApplyConfiguration { + return &EndpointFilterApplyConfiguration{} +} + +// WithServiceRef sets the ServiceRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ServiceRef field is set to the value of the last call. +func (b *EndpointFilterApplyConfiguration) WithServiceRef(value apiv1alpha1.KubernetesNameRef) *EndpointFilterApplyConfiguration { + b.ServiceRef = &value + return b +} + +// WithInterface sets the Interface field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Interface field is set to the value of the last call. +func (b *EndpointFilterApplyConfiguration) WithInterface(value string) *EndpointFilterApplyConfiguration { + b.Interface = &value + return b +} + +// WithURL sets the URL field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the URL field is set to the value of the last call. +func (b *EndpointFilterApplyConfiguration) WithURL(value string) *EndpointFilterApplyConfiguration { + b.URL = &value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointimport.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointimport.go new file mode 100644 index 000000000..e20a99cd7 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointimport.go @@ -0,0 +1,48 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +// EndpointImportApplyConfiguration represents a declarative configuration of the EndpointImport type for use +// with apply. +type EndpointImportApplyConfiguration struct { + ID *string `json:"id,omitempty"` + Filter *EndpointFilterApplyConfiguration `json:"filter,omitempty"` +} + +// EndpointImportApplyConfiguration constructs a declarative configuration of the EndpointImport type for use with +// apply. +func EndpointImport() *EndpointImportApplyConfiguration { + return &EndpointImportApplyConfiguration{} +} + +// WithID sets the ID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ID field is set to the value of the last call. +func (b *EndpointImportApplyConfiguration) WithID(value string) *EndpointImportApplyConfiguration { + b.ID = &value + return b +} + +// WithFilter sets the Filter field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Filter field is set to the value of the last call. +func (b *EndpointImportApplyConfiguration) WithFilter(value *EndpointFilterApplyConfiguration) *EndpointImportApplyConfiguration { + b.Filter = value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcespec.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcespec.go new file mode 100644 index 000000000..b9f157902 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcespec.go @@ -0,0 +1,79 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// EndpointResourceSpecApplyConfiguration represents a declarative configuration of the EndpointResourceSpec type for use +// with apply. +type EndpointResourceSpecApplyConfiguration struct { + Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` + Enabled *bool `json:"enabled,omitempty"` + Interface *string `json:"interface,omitempty"` + URL *string `json:"url,omitempty"` + ServiceRef *apiv1alpha1.KubernetesNameRef `json:"serviceRef,omitempty"` +} + +// EndpointResourceSpecApplyConfiguration constructs a declarative configuration of the EndpointResourceSpec type for use with +// apply. +func EndpointResourceSpec() *EndpointResourceSpecApplyConfiguration { + return &EndpointResourceSpecApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *EndpointResourceSpecApplyConfiguration) WithName(value apiv1alpha1.OpenStackName) *EndpointResourceSpecApplyConfiguration { + b.Name = &value + return b +} + +// WithEnabled sets the Enabled field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Enabled field is set to the value of the last call. +func (b *EndpointResourceSpecApplyConfiguration) WithEnabled(value bool) *EndpointResourceSpecApplyConfiguration { + b.Enabled = &value + return b +} + +// WithInterface sets the Interface field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Interface field is set to the value of the last call. +func (b *EndpointResourceSpecApplyConfiguration) WithInterface(value string) *EndpointResourceSpecApplyConfiguration { + b.Interface = &value + return b +} + +// WithURL sets the URL field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the URL field is set to the value of the last call. +func (b *EndpointResourceSpecApplyConfiguration) WithURL(value string) *EndpointResourceSpecApplyConfiguration { + b.URL = &value + return b +} + +// WithServiceRef sets the ServiceRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ServiceRef field is set to the value of the last call. +func (b *EndpointResourceSpecApplyConfiguration) WithServiceRef(value apiv1alpha1.KubernetesNameRef) *EndpointResourceSpecApplyConfiguration { + b.ServiceRef = &value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcestatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcestatus.go new file mode 100644 index 000000000..8a0b7c87c --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcestatus.go @@ -0,0 +1,75 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +// EndpointResourceStatusApplyConfiguration represents a declarative configuration of the EndpointResourceStatus type for use +// with apply. +type EndpointResourceStatusApplyConfiguration struct { + Name *string `json:"name,omitempty"` + Enabled *bool `json:"enabled,omitempty"` + Interface *string `json:"interface,omitempty"` + URL *string `json:"url,omitempty"` + ServiceID *string `json:"serviceID,omitempty"` +} + +// EndpointResourceStatusApplyConfiguration constructs a declarative configuration of the EndpointResourceStatus type for use with +// apply. +func EndpointResourceStatus() *EndpointResourceStatusApplyConfiguration { + return &EndpointResourceStatusApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *EndpointResourceStatusApplyConfiguration) WithName(value string) *EndpointResourceStatusApplyConfiguration { + b.Name = &value + return b +} + +// WithEnabled sets the Enabled field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Enabled field is set to the value of the last call. +func (b *EndpointResourceStatusApplyConfiguration) WithEnabled(value bool) *EndpointResourceStatusApplyConfiguration { + b.Enabled = &value + return b +} + +// WithInterface sets the Interface field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Interface field is set to the value of the last call. +func (b *EndpointResourceStatusApplyConfiguration) WithInterface(value string) *EndpointResourceStatusApplyConfiguration { + b.Interface = &value + return b +} + +// WithURL sets the URL field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the URL field is set to the value of the last call. +func (b *EndpointResourceStatusApplyConfiguration) WithURL(value string) *EndpointResourceStatusApplyConfiguration { + b.URL = &value + return b +} + +// WithServiceID sets the ServiceID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ServiceID field is set to the value of the last call. +func (b *EndpointResourceStatusApplyConfiguration) WithServiceID(value string) *EndpointResourceStatusApplyConfiguration { + b.ServiceID = &value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointspec.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointspec.go new file mode 100644 index 000000000..fbe73d129 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointspec.go @@ -0,0 +1,79 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// EndpointSpecApplyConfiguration represents a declarative configuration of the EndpointSpec type for use +// with apply. +type EndpointSpecApplyConfiguration struct { + Import *EndpointImportApplyConfiguration `json:"import,omitempty"` + Resource *EndpointResourceSpecApplyConfiguration `json:"resource,omitempty"` + ManagementPolicy *apiv1alpha1.ManagementPolicy `json:"managementPolicy,omitempty"` + ManagedOptions *ManagedOptionsApplyConfiguration `json:"managedOptions,omitempty"` + CloudCredentialsRef *CloudCredentialsReferenceApplyConfiguration `json:"cloudCredentialsRef,omitempty"` +} + +// EndpointSpecApplyConfiguration constructs a declarative configuration of the EndpointSpec type for use with +// apply. +func EndpointSpec() *EndpointSpecApplyConfiguration { + return &EndpointSpecApplyConfiguration{} +} + +// WithImport sets the Import field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Import field is set to the value of the last call. +func (b *EndpointSpecApplyConfiguration) WithImport(value *EndpointImportApplyConfiguration) *EndpointSpecApplyConfiguration { + b.Import = value + return b +} + +// WithResource sets the Resource field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Resource field is set to the value of the last call. +func (b *EndpointSpecApplyConfiguration) WithResource(value *EndpointResourceSpecApplyConfiguration) *EndpointSpecApplyConfiguration { + b.Resource = value + return b +} + +// WithManagementPolicy sets the ManagementPolicy field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ManagementPolicy field is set to the value of the last call. +func (b *EndpointSpecApplyConfiguration) WithManagementPolicy(value apiv1alpha1.ManagementPolicy) *EndpointSpecApplyConfiguration { + b.ManagementPolicy = &value + return b +} + +// WithManagedOptions sets the ManagedOptions field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ManagedOptions field is set to the value of the last call. +func (b *EndpointSpecApplyConfiguration) WithManagedOptions(value *ManagedOptionsApplyConfiguration) *EndpointSpecApplyConfiguration { + b.ManagedOptions = value + return b +} + +// WithCloudCredentialsRef sets the CloudCredentialsRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the CloudCredentialsRef field is set to the value of the last call. +func (b *EndpointSpecApplyConfiguration) WithCloudCredentialsRef(value *CloudCredentialsReferenceApplyConfiguration) *EndpointSpecApplyConfiguration { + b.CloudCredentialsRef = value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointstatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointstatus.go new file mode 100644 index 000000000..ab14837ef --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointstatus.go @@ -0,0 +1,66 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + v1 "k8s.io/client-go/applyconfigurations/meta/v1" +) + +// EndpointStatusApplyConfiguration represents a declarative configuration of the EndpointStatus type for use +// with apply. +type EndpointStatusApplyConfiguration struct { + Conditions []v1.ConditionApplyConfiguration `json:"conditions,omitempty"` + ID *string `json:"id,omitempty"` + Resource *EndpointResourceStatusApplyConfiguration `json:"resource,omitempty"` +} + +// EndpointStatusApplyConfiguration constructs a declarative configuration of the EndpointStatus type for use with +// apply. +func EndpointStatus() *EndpointStatusApplyConfiguration { + return &EndpointStatusApplyConfiguration{} +} + +// WithConditions adds the given value to the Conditions field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Conditions field. +func (b *EndpointStatusApplyConfiguration) WithConditions(values ...*v1.ConditionApplyConfiguration) *EndpointStatusApplyConfiguration { + for i := range values { + if values[i] == nil { + panic("nil value passed to WithConditions") + } + b.Conditions = append(b.Conditions, *values[i]) + } + return b +} + +// WithID sets the ID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ID field is set to the value of the last call. +func (b *EndpointStatusApplyConfiguration) WithID(value string) *EndpointStatusApplyConfiguration { + b.ID = &value + return b +} + +// WithResource sets the Resource field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Resource field is set to the value of the last call. +func (b *EndpointStatusApplyConfiguration) WithResource(value *EndpointResourceStatusApplyConfiguration) *EndpointStatusApplyConfiguration { + b.Resource = value + return b +} diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/endpoint.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/endpoint.go new file mode 100644 index 000000000..8c0f3c58b --- /dev/null +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/endpoint.go @@ -0,0 +1,74 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by client-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + context "context" + + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + applyconfigurationapiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" + scheme "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset/scheme" + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" + types "k8s.io/apimachinery/pkg/types" + watch "k8s.io/apimachinery/pkg/watch" + gentype "k8s.io/client-go/gentype" +) + +// EndpointsGetter has a method to return a EndpointInterface. +// A group's client should implement this interface. +type EndpointsGetter interface { + Endpoints(namespace string) EndpointInterface +} + +// EndpointInterface has methods to work with Endpoint resources. +type EndpointInterface interface { + Create(ctx context.Context, endpoint *apiv1alpha1.Endpoint, opts v1.CreateOptions) (*apiv1alpha1.Endpoint, error) + Update(ctx context.Context, endpoint *apiv1alpha1.Endpoint, opts v1.UpdateOptions) (*apiv1alpha1.Endpoint, error) + // Add a +genclient:noStatus comment above the type to avoid generating UpdateStatus(). + UpdateStatus(ctx context.Context, endpoint *apiv1alpha1.Endpoint, opts v1.UpdateOptions) (*apiv1alpha1.Endpoint, error) + Delete(ctx context.Context, name string, opts v1.DeleteOptions) error + DeleteCollection(ctx context.Context, opts v1.DeleteOptions, listOpts v1.ListOptions) error + Get(ctx context.Context, name string, opts v1.GetOptions) (*apiv1alpha1.Endpoint, error) + List(ctx context.Context, opts v1.ListOptions) (*apiv1alpha1.EndpointList, error) + Watch(ctx context.Context, opts v1.ListOptions) (watch.Interface, error) + Patch(ctx context.Context, name string, pt types.PatchType, data []byte, opts v1.PatchOptions, subresources ...string) (result *apiv1alpha1.Endpoint, err error) + Apply(ctx context.Context, endpoint *applyconfigurationapiv1alpha1.EndpointApplyConfiguration, opts v1.ApplyOptions) (result *apiv1alpha1.Endpoint, err error) + // Add a +genclient:noStatus comment above the type to avoid generating ApplyStatus(). + ApplyStatus(ctx context.Context, endpoint *applyconfigurationapiv1alpha1.EndpointApplyConfiguration, opts v1.ApplyOptions) (result *apiv1alpha1.Endpoint, err error) + EndpointExpansion +} + +// endpoints implements EndpointInterface +type endpoints struct { + *gentype.ClientWithListAndApply[*apiv1alpha1.Endpoint, *apiv1alpha1.EndpointList, *applyconfigurationapiv1alpha1.EndpointApplyConfiguration] +} + +// newEndpoints returns a Endpoints +func newEndpoints(c *OpenstackV1alpha1Client, namespace string) *endpoints { + return &endpoints{ + gentype.NewClientWithListAndApply[*apiv1alpha1.Endpoint, *apiv1alpha1.EndpointList, *applyconfigurationapiv1alpha1.EndpointApplyConfiguration]( + "endpoints", + c.RESTClient(), + scheme.ParameterCodec, + namespace, + func() *apiv1alpha1.Endpoint { return &apiv1alpha1.Endpoint{} }, + func() *apiv1alpha1.EndpointList { return &apiv1alpha1.EndpointList{} }, + ), + } +} diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_endpoint.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_endpoint.go new file mode 100644 index 000000000..bc2842cde --- /dev/null +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_endpoint.go @@ -0,0 +1,51 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by client-gen. DO NOT EDIT. + +package fake + +import ( + v1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" + typedapiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset/typed/api/v1alpha1" + gentype "k8s.io/client-go/gentype" +) + +// fakeEndpoints implements EndpointInterface +type fakeEndpoints struct { + *gentype.FakeClientWithListAndApply[*v1alpha1.Endpoint, *v1alpha1.EndpointList, *apiv1alpha1.EndpointApplyConfiguration] + Fake *FakeOpenstackV1alpha1 +} + +func newFakeEndpoints(fake *FakeOpenstackV1alpha1, namespace string) typedapiv1alpha1.EndpointInterface { + return &fakeEndpoints{ + gentype.NewFakeClientWithListAndApply[*v1alpha1.Endpoint, *v1alpha1.EndpointList, *apiv1alpha1.EndpointApplyConfiguration]( + fake.Fake, + namespace, + v1alpha1.SchemeGroupVersion.WithResource("endpoints"), + v1alpha1.SchemeGroupVersion.WithKind("Endpoint"), + func() *v1alpha1.Endpoint { return &v1alpha1.Endpoint{} }, + func() *v1alpha1.EndpointList { return &v1alpha1.EndpointList{} }, + func(dst, src *v1alpha1.EndpointList) { dst.ListMeta = src.ListMeta }, + func(list *v1alpha1.EndpointList) []*v1alpha1.Endpoint { return gentype.ToPointerSlice(list.Items) }, + func(list *v1alpha1.EndpointList, items []*v1alpha1.Endpoint) { + list.Items = gentype.FromPointerSlice(items) + }, + ), + fake, + } +} diff --git a/pkg/clients/informers/externalversions/api/v1alpha1/endpoint.go b/pkg/clients/informers/externalversions/api/v1alpha1/endpoint.go new file mode 100644 index 000000000..496b05405 --- /dev/null +++ b/pkg/clients/informers/externalversions/api/v1alpha1/endpoint.go @@ -0,0 +1,102 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by informer-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + context "context" + time "time" + + v2apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + clientset "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset" + internalinterfaces "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/informers/externalversions/internalinterfaces" + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/listers/api/v1alpha1" + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" + runtime "k8s.io/apimachinery/pkg/runtime" + watch "k8s.io/apimachinery/pkg/watch" + cache "k8s.io/client-go/tools/cache" +) + +// EndpointInformer provides access to a shared informer and lister for +// Endpoints. +type EndpointInformer interface { + Informer() cache.SharedIndexInformer + Lister() apiv1alpha1.EndpointLister +} + +type endpointInformer struct { + factory internalinterfaces.SharedInformerFactory + tweakListOptions internalinterfaces.TweakListOptionsFunc + namespace string +} + +// NewEndpointInformer constructs a new informer for Endpoint type. +// Always prefer using an informer factory to get a shared informer instead of getting an independent +// one. This reduces memory footprint and number of connections to the server. +func NewEndpointInformer(client clientset.Interface, namespace string, resyncPeriod time.Duration, indexers cache.Indexers) cache.SharedIndexInformer { + return NewFilteredEndpointInformer(client, namespace, resyncPeriod, indexers, nil) +} + +// NewFilteredEndpointInformer constructs a new informer for Endpoint type. +// Always prefer using an informer factory to get a shared informer instead of getting an independent +// one. This reduces memory footprint and number of connections to the server. +func NewFilteredEndpointInformer(client clientset.Interface, namespace string, resyncPeriod time.Duration, indexers cache.Indexers, tweakListOptions internalinterfaces.TweakListOptionsFunc) cache.SharedIndexInformer { + return cache.NewSharedIndexInformer( + &cache.ListWatch{ + ListFunc: func(options v1.ListOptions) (runtime.Object, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().Endpoints(namespace).List(context.Background(), options) + }, + WatchFunc: func(options v1.ListOptions) (watch.Interface, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().Endpoints(namespace).Watch(context.Background(), options) + }, + ListWithContextFunc: func(ctx context.Context, options v1.ListOptions) (runtime.Object, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().Endpoints(namespace).List(ctx, options) + }, + WatchFuncWithContext: func(ctx context.Context, options v1.ListOptions) (watch.Interface, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().Endpoints(namespace).Watch(ctx, options) + }, + }, + &v2apiv1alpha1.Endpoint{}, + resyncPeriod, + indexers, + ) +} + +func (f *endpointInformer) defaultInformer(client clientset.Interface, resyncPeriod time.Duration) cache.SharedIndexInformer { + return NewFilteredEndpointInformer(client, f.namespace, resyncPeriod, cache.Indexers{cache.NamespaceIndex: cache.MetaNamespaceIndexFunc}, f.tweakListOptions) +} + +func (f *endpointInformer) Informer() cache.SharedIndexInformer { + return f.factory.InformerFor(&v2apiv1alpha1.Endpoint{}, f.defaultInformer) +} + +func (f *endpointInformer) Lister() apiv1alpha1.EndpointLister { + return apiv1alpha1.NewEndpointLister(f.Informer().GetIndexer()) +} diff --git a/pkg/clients/listers/api/v1alpha1/endpoint.go b/pkg/clients/listers/api/v1alpha1/endpoint.go new file mode 100644 index 000000000..427f09149 --- /dev/null +++ b/pkg/clients/listers/api/v1alpha1/endpoint.go @@ -0,0 +1,70 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by lister-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + labels "k8s.io/apimachinery/pkg/labels" + listers "k8s.io/client-go/listers" + cache "k8s.io/client-go/tools/cache" +) + +// EndpointLister helps list Endpoints. +// All objects returned here must be treated as read-only. +type EndpointLister interface { + // List lists all Endpoints in the indexer. + // Objects returned here must be treated as read-only. + List(selector labels.Selector) (ret []*apiv1alpha1.Endpoint, err error) + // Endpoints returns an object that can list and get Endpoints. + Endpoints(namespace string) EndpointNamespaceLister + EndpointListerExpansion +} + +// endpointLister implements the EndpointLister interface. +type endpointLister struct { + listers.ResourceIndexer[*apiv1alpha1.Endpoint] +} + +// NewEndpointLister returns a new EndpointLister. +func NewEndpointLister(indexer cache.Indexer) EndpointLister { + return &endpointLister{listers.New[*apiv1alpha1.Endpoint](indexer, apiv1alpha1.Resource("endpoint"))} +} + +// Endpoints returns an object that can list and get Endpoints. +func (s *endpointLister) Endpoints(namespace string) EndpointNamespaceLister { + return endpointNamespaceLister{listers.NewNamespaced[*apiv1alpha1.Endpoint](s.ResourceIndexer, namespace)} +} + +// EndpointNamespaceLister helps list and get Endpoints. +// All objects returned here must be treated as read-only. +type EndpointNamespaceLister interface { + // List lists all Endpoints in the indexer for a given namespace. + // Objects returned here must be treated as read-only. + List(selector labels.Selector) (ret []*apiv1alpha1.Endpoint, err error) + // Get retrieves the Endpoint from the indexer for a given namespace and name. + // Objects returned here must be treated as read-only. + Get(name string) (*apiv1alpha1.Endpoint, error) + EndpointNamespaceListerExpansion +} + +// endpointNamespaceLister implements the EndpointNamespaceLister +// interface. +type endpointNamespaceLister struct { + listers.ResourceIndexer[*apiv1alpha1.Endpoint] +} From 4d3e5dbff816cf64be4e642eccba15f473a60564 Mon Sep 17 00:00:00 2001 From: Winicius Silva Date: Wed, 17 Dec 2025 11:09:17 -0300 Subject: [PATCH 2/2] keystone: endpoint controller implementation Signed-off-by: Winicius Silva --- PROJECT | 8 + README.md | 2 +- api/v1alpha1/endpoint_types.go | 70 ++-- api/v1alpha1/zz_generated.deepcopy.go | 207 ++++++++++ .../zz_generated.endpoint-resource.go | 12 +- cmd/manager/main.go | 2 + cmd/models-schema/zz_generated.openapi.go | 370 ++++++++++++++++++ cmd/resource-generator/main.go | 4 + .../openstack.k-orc.cloud_endpoints.yaml | 45 ++- config/crd/kustomization.yaml | 1 + .../bases/orc.clusterserviceversion.yaml | 5 + config/rbac/role.yaml | 2 + config/samples/kustomization.yaml | 1 + .../samples/openstack_v1alpha1_endpoint.yaml | 9 +- internal/controllers/endpoint/actuator.go | 109 ++++-- .../controllers/endpoint/actuator_test.go | 41 +- internal/controllers/endpoint/status.go | 7 +- .../tests/endpoint-create-full/00-assert.yaml | 9 +- .../00-create-resource.yaml | 17 +- .../endpoint-create-minimal/00-assert.yaml | 7 +- .../00-create-resource.yaml | 16 +- .../00-import-resource.yaml | 6 +- .../01-create-trap-resource.yaml | 27 +- .../02-create-resource.yaml | 25 +- .../03-delete-import-dependencies.yaml | 2 +- .../00-create-resources.yaml | 21 +- .../01-import-resource.yaml | 5 +- .../endpoint-import/00-import-resource.yaml | 21 +- .../tests/endpoint-import/01-assert.yaml | 5 +- .../01-create-trap-resource.yaml | 15 +- .../tests/endpoint-import/02-assert.yaml | 10 +- .../endpoint-import/02-create-resource.yaml | 21 +- .../tests/endpoint-update/00-assert.yaml | 31 +- .../endpoint-update/00-minimal-resource.yaml | 17 +- .../tests/endpoint-update/01-assert.yaml | 6 +- .../endpoint-update/01-updated-resource.yaml | 6 +- .../tests/endpoint-update/02-assert.yaml | 11 +- .../endpoint/zz_generated.adapter.go | 12 +- .../endpoint/zz_generated.controller.go | 2 +- .../port/tests/port-update/00-assert.yaml | 20 +- .../port/tests/port-update/01-assert.yaml | 2 +- internal/osclients/mock/doc.go | 3 + internal/osclients/mock/endpoint.go | 2 +- internal/scope/mock.go | 7 + internal/scope/provider.go | 4 + internal/scope/scope.go | 1 + kuttl-test.yaml | 1 + .../api/v1alpha1/endpoint.go | 2 +- .../api/v1alpha1/endpointfilter.go | 20 +- .../api/v1alpha1/endpointimport.go | 2 +- .../api/v1alpha1/endpointresourcespec.go | 20 +- .../api/v1alpha1/endpointresourcestatus.go | 20 +- .../api/v1alpha1/endpointspec.go | 2 +- .../api/v1alpha1/endpointstatus.go | 2 +- .../applyconfiguration/internal/internal.go | 115 ++++++ pkg/clients/applyconfiguration/utils.go | 14 + .../typed/api/v1alpha1/api_client.go | 5 + .../clientset/typed/api/v1alpha1/endpoint.go | 2 +- .../api/v1alpha1/fake/fake_api_client.go | 4 + .../typed/api/v1alpha1/fake/fake_endpoint.go | 2 +- .../typed/api/v1alpha1/generated_expansion.go | 2 + .../externalversions/api/v1alpha1/endpoint.go | 2 +- .../api/v1alpha1/interface.go | 7 + .../informers/externalversions/generic.go | 2 + pkg/clients/listers/api/v1alpha1/endpoint.go | 2 +- .../api/v1alpha1/expansion_generated.go | 8 + website/docs/crd-reference.md | 142 +++++++ 67 files changed, 1265 insertions(+), 337 deletions(-) diff --git a/PROJECT b/PROJECT index 3d09e3c30..54fc55950 100644 --- a/PROJECT +++ b/PROJECT @@ -16,6 +16,14 @@ resources: kind: Domain path: github.com/k-orc/openstack-resource-controller/api/v1alpha1 version: v1alpha1 +- api: + crdVersion: v1 + namespaced: true + domain: k-orc.cloud + group: openstack + kind: Endpoint + path: github.com/k-orc/openstack-resource-controller/api/v1alpha1 + version: v1alpha1 - api: crdVersion: v1 namespaced: true diff --git a/README.md b/README.md index 63d59ba73..c05143838 100644 --- a/README.md +++ b/README.md @@ -71,6 +71,7 @@ kubectl delete -f $ORC_RELEASE | **controller** | **1.x** | **2.x** | **main** | |:---------------------------:|:-------:|:-------:|:--------:| | domain | | ✔ | ✔ | +| endpoint | | ◐ | ◐ | | flavor | | ✔ | ✔ | | floating ip | | ◐ | ◐ | | group | | ✔ | ✔ | @@ -91,7 +92,6 @@ kubectl delete -f $ORC_RELEASE | volume type | | ◐ | ◐ | - ✔: mostly implemented ◐: partially implemented diff --git a/api/v1alpha1/endpoint_types.go b/api/v1alpha1/endpoint_types.go index 39271d1c2..550b3e4cd 100644 --- a/api/v1alpha1/endpoint_types.go +++ b/api/v1alpha1/endpoint_types.go @@ -18,71 +18,75 @@ package v1alpha1 // EndpointResourceSpec contains the desired state of the resource. type EndpointResourceSpec struct { - // name will be the name of the created resource. If not specified, the - // name of the ORC object will be used. - // +optional - Name *OpenStackName `json:"name,omitempty"` - // description is a human-readable description for the resource. // +kubebuilder:validation:MinLength:=1 // +kubebuilder:validation:MaxLength:=255 // +optional Description *string `json:"description,omitempty"` + // enabled indicates whether the endpoint is enabled or not. + // +kubebuilder:default:=true + // +optional + Enabled *bool `json:"enabled,omitempty"` + + // interface indicates the visibility of the endpoint. + // +kubebuilder:validation:Enum:=admin;internal;public + // +required + Interface string `json:"interface,omitempty"` + + // url is the endpoint URL. + // +kubebuilder:validation:MaxLength=1024 + // +required + URL string `json:"url"` + // serviceRef is a reference to the ORC Service which this resource is associated with. // +required // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="serviceRef is immutable" ServiceRef KubernetesNameRef `json:"serviceRef,omitempty"` - - // TODO(scaffolding): Add more types. - // To see what is supported, you can take inspiration from the CreateOpts structure from - // github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints - // - // Until you have implemented mutability for the field, you must add a CEL validation - // preventing the field being modified: - // `// +kubebuilder:validation:XValidation:rule="self == oldSelf",message=" is immutable"` } // EndpointFilter defines an existing resource by its properties // +kubebuilder:validation:MinProperties:=1 type EndpointFilter struct { - // name of the existing resource + // interface of the existing endpoint. + // +kubebuilder:validation:Enum:=admin;internal;public // +optional - Name *OpenStackName `json:"name,omitempty"` - - // description of the existing resource - // +kubebuilder:validation:MinLength:=1 - // +kubebuilder:validation:MaxLength:=255 - // +optional - Description *string `json:"description,omitempty"` + Interface string `json:"interface,omitempty"` // serviceRef is a reference to the ORC Service which this resource is associated with. // +optional ServiceRef *KubernetesNameRef `json:"serviceRef,omitempty"` - // TODO(scaffolding): Add more types. - // To see what is supported, you can take inspiration from the ListOpts structure from - // github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints + // url is the URL of the existing endpoint. + // +kubebuilder:validation:MaxLength=1024 + // +optional + URL string `json:"url,omitempty"` } // EndpointResourceStatus represents the observed state of the resource. type EndpointResourceStatus struct { - // name is a Human-readable name for the resource. Might not be unique. - // +kubebuilder:validation:MaxLength=1024 + // description is a human-readable description for the resource. + // +kubebuilder:validation:MinLength:=1 + // +kubebuilder:validation:MaxLength:=255 + // +optional + Description string `json:"description,omitempty"` + + // enabled indicates whether the endpoint is enabled or not. // +optional - Name string `json:"name,omitempty"` + Enabled bool `json:"enabled,omitempty"` - // description is a human-readable description for the resource. + // interface indicates the visibility of the endpoint. + // +kubebuilder:validation:MaxLength=128 + // +optional + Interface string `json:"interface,omitempty"` + + // url is the endpoint URL. // +kubebuilder:validation:MaxLength=1024 // +optional - Description string `json:"description,omitempty"` + URL string `json:"url,omitempty"` // serviceID is the ID of the Service to which the resource is associated. // +kubebuilder:validation:MaxLength=1024 // +optional ServiceID string `json:"serviceID,omitempty"` - - // TODO(scaffolding): Add more types. - // To see what is supported, you can take inspiration from the Endpoint structure from - // github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints } diff --git a/api/v1alpha1/zz_generated.deepcopy.go b/api/v1alpha1/zz_generated.deepcopy.go index ef1494716..28d1a6e95 100644 --- a/api/v1alpha1/zz_generated.deepcopy.go +++ b/api/v1alpha1/zz_generated.deepcopy.go @@ -347,6 +347,213 @@ func (in *DomainStatus) DeepCopy() *DomainStatus { return out } +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Endpoint) DeepCopyInto(out *Endpoint) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + in.Status.DeepCopyInto(&out.Status) +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Endpoint. +func (in *Endpoint) DeepCopy() *Endpoint { + if in == nil { + return nil + } + out := new(Endpoint) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *Endpoint) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EndpointFilter) DeepCopyInto(out *EndpointFilter) { + *out = *in + if in.ServiceRef != nil { + in, out := &in.ServiceRef, &out.ServiceRef + *out = new(KubernetesNameRef) + **out = **in + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EndpointFilter. +func (in *EndpointFilter) DeepCopy() *EndpointFilter { + if in == nil { + return nil + } + out := new(EndpointFilter) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EndpointImport) DeepCopyInto(out *EndpointImport) { + *out = *in + if in.ID != nil { + in, out := &in.ID, &out.ID + *out = new(string) + **out = **in + } + if in.Filter != nil { + in, out := &in.Filter, &out.Filter + *out = new(EndpointFilter) + (*in).DeepCopyInto(*out) + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EndpointImport. +func (in *EndpointImport) DeepCopy() *EndpointImport { + if in == nil { + return nil + } + out := new(EndpointImport) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EndpointList) DeepCopyInto(out *EndpointList) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ListMeta.DeepCopyInto(&out.ListMeta) + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]Endpoint, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EndpointList. +func (in *EndpointList) DeepCopy() *EndpointList { + if in == nil { + return nil + } + out := new(EndpointList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *EndpointList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EndpointResourceSpec) DeepCopyInto(out *EndpointResourceSpec) { + *out = *in + if in.Description != nil { + in, out := &in.Description, &out.Description + *out = new(string) + **out = **in + } + if in.Enabled != nil { + in, out := &in.Enabled, &out.Enabled + *out = new(bool) + **out = **in + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EndpointResourceSpec. +func (in *EndpointResourceSpec) DeepCopy() *EndpointResourceSpec { + if in == nil { + return nil + } + out := new(EndpointResourceSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EndpointResourceStatus) DeepCopyInto(out *EndpointResourceStatus) { + *out = *in +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EndpointResourceStatus. +func (in *EndpointResourceStatus) DeepCopy() *EndpointResourceStatus { + if in == nil { + return nil + } + out := new(EndpointResourceStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EndpointSpec) DeepCopyInto(out *EndpointSpec) { + *out = *in + if in.Import != nil { + in, out := &in.Import, &out.Import + *out = new(EndpointImport) + (*in).DeepCopyInto(*out) + } + if in.Resource != nil { + in, out := &in.Resource, &out.Resource + *out = new(EndpointResourceSpec) + (*in).DeepCopyInto(*out) + } + if in.ManagedOptions != nil { + in, out := &in.ManagedOptions, &out.ManagedOptions + *out = new(ManagedOptions) + **out = **in + } + out.CloudCredentialsRef = in.CloudCredentialsRef +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EndpointSpec. +func (in *EndpointSpec) DeepCopy() *EndpointSpec { + if in == nil { + return nil + } + out := new(EndpointSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *EndpointStatus) DeepCopyInto(out *EndpointStatus) { + *out = *in + if in.Conditions != nil { + in, out := &in.Conditions, &out.Conditions + *out = make([]v1.Condition, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.ID != nil { + in, out := &in.ID, &out.ID + *out = new(string) + **out = **in + } + if in.Resource != nil { + in, out := &in.Resource, &out.Resource + *out = new(EndpointResourceStatus) + **out = **in + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new EndpointStatus. +func (in *EndpointStatus) DeepCopy() *EndpointStatus { + if in == nil { + return nil + } + out := new(EndpointStatus) + in.DeepCopyInto(out) + return out +} + // DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. func (in *ExternalGateway) DeepCopyInto(out *ExternalGateway) { *out = *in diff --git a/api/v1alpha1/zz_generated.endpoint-resource.go b/api/v1alpha1/zz_generated.endpoint-resource.go index 33bebc76d..71189fb9b 100644 --- a/api/v1alpha1/zz_generated.endpoint-resource.go +++ b/api/v1alpha1/zz_generated.endpoint-resource.go @@ -1,6 +1,6 @@ // Code generated by resource-generator. DO NOT EDIT. /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. @@ -29,8 +29,9 @@ type EndpointImport struct { // id contains the unique identifier of an existing OpenStack resource. Note // that when specifying an import by ID, the resource MUST already exist. // The ORC object will enter an error state if the resource does not exist. - // +optional // +kubebuilder:validation:Format:=uuid + // +kubebuilder:validation:MaxLength:=36 + // +optional ID *string `json:"id,omitempty"` // filter contains a resource query which is expected to return a single @@ -76,7 +77,7 @@ type EndpointSpec struct { // cloudCredentialsRef points to a secret containing OpenStack credentials // +required - CloudCredentialsRef CloudCredentialsReference `json:"cloudCredentialsRef"` + CloudCredentialsRef CloudCredentialsReference `json:"cloudCredentialsRef,omitzero"` } // EndpointStatus defines the observed state of an ORC resource. @@ -104,6 +105,7 @@ type EndpointStatus struct { Conditions []metav1.Condition `json:"conditions,omitempty" patchStrategy:"merge" patchMergeKey:"type"` // id is the unique identifier of the OpenStack resource. + // +kubebuilder:validation:MaxLength:=1024 // +optional ID *string `json:"id,omitempty"` @@ -135,8 +137,8 @@ type Endpoint struct { metav1.ObjectMeta `json:"metadata,omitempty"` // spec specifies the desired state of the resource. - // +optional - Spec EndpointSpec `json:"spec,omitempty"` + // +required + Spec EndpointSpec `json:"spec,omitzero"` // status defines the observed state of the resource. // +optional diff --git a/cmd/manager/main.go b/cmd/manager/main.go index bf9bc38ca..bb5b27c69 100644 --- a/cmd/manager/main.go +++ b/cmd/manager/main.go @@ -28,6 +28,7 @@ import ( "sigs.k8s.io/controller-runtime/pkg/log/zap" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/domain" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/endpoint" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/flavor" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/floatingip" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" @@ -108,6 +109,7 @@ func main() { scopeFactory := scope.NewFactory(orcOpts.ScopeCacheMaxSize, caCerts) controllers := []interfaces.Controller{ + endpoint.New(scopeFactory), image.New(scopeFactory), network.New(scopeFactory), subnet.New(scopeFactory), diff --git a/cmd/models-schema/zz_generated.openapi.go b/cmd/models-schema/zz_generated.openapi.go index f47211048..d00ee16e4 100644 --- a/cmd/models-schema/zz_generated.openapi.go +++ b/cmd/models-schema/zz_generated.openapi.go @@ -44,6 +44,14 @@ func GetOpenAPIDefinitions(ref common.ReferenceCallback) map[string]common.OpenA "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.DomainResourceStatus": schema_openstack_resource_controller_v2_api_v1alpha1_DomainResourceStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.DomainSpec": schema_openstack_resource_controller_v2_api_v1alpha1_DomainSpec(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.DomainStatus": schema_openstack_resource_controller_v2_api_v1alpha1_DomainStatus(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.Endpoint": schema_openstack_resource_controller_v2_api_v1alpha1_Endpoint(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointFilter": schema_openstack_resource_controller_v2_api_v1alpha1_EndpointFilter(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointImport": schema_openstack_resource_controller_v2_api_v1alpha1_EndpointImport(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointList": schema_openstack_resource_controller_v2_api_v1alpha1_EndpointList(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointResourceSpec": schema_openstack_resource_controller_v2_api_v1alpha1_EndpointResourceSpec(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointResourceStatus": schema_openstack_resource_controller_v2_api_v1alpha1_EndpointResourceStatus(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointSpec": schema_openstack_resource_controller_v2_api_v1alpha1_EndpointSpec(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointStatus": schema_openstack_resource_controller_v2_api_v1alpha1_EndpointStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.ExternalGateway": schema_openstack_resource_controller_v2_api_v1alpha1_ExternalGateway(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.ExternalGatewayStatus": schema_openstack_resource_controller_v2_api_v1alpha1_ExternalGatewayStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.FilterByKeystoneTags": schema_openstack_resource_controller_v2_api_v1alpha1_FilterByKeystoneTags(ref), @@ -1012,6 +1020,368 @@ func schema_openstack_resource_controller_v2_api_v1alpha1_DomainStatus(ref commo } } +func schema_openstack_resource_controller_v2_api_v1alpha1_Endpoint(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "Endpoint is the Schema for an ORC resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "kind": { + SchemaProps: spec.SchemaProps{ + Description: "Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds", + Type: []string{"string"}, + Format: "", + }, + }, + "apiVersion": { + SchemaProps: spec.SchemaProps{ + Description: "APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources", + Type: []string{"string"}, + Format: "", + }, + }, + "metadata": { + SchemaProps: spec.SchemaProps{ + Description: "metadata contains the object metadata", + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.ObjectMeta"), + }, + }, + "spec": { + SchemaProps: spec.SchemaProps{ + Description: "spec specifies the desired state of the resource.", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointSpec"), + }, + }, + "status": { + SchemaProps: spec.SchemaProps{ + Description: "status defines the observed state of the resource.", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointStatus"), + }, + }, + }, + Required: []string{"spec"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointSpec", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointStatus", "k8s.io/apimachinery/pkg/apis/meta/v1.ObjectMeta"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_EndpointFilter(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "EndpointFilter defines an existing resource by its properties", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "interface": { + SchemaProps: spec.SchemaProps{ + Description: "interface of the existing endpoint.", + Type: []string{"string"}, + Format: "", + }, + }, + "serviceRef": { + SchemaProps: spec.SchemaProps{ + Description: "serviceRef is a reference to the ORC Service which this resource is associated with.", + Type: []string{"string"}, + Format: "", + }, + }, + "url": { + SchemaProps: spec.SchemaProps{ + Description: "url is the URL of the existing endpoint.", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_EndpointImport(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "EndpointImport specifies an existing resource which will be imported instead of creating a new one", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "id": { + SchemaProps: spec.SchemaProps{ + Description: "id contains the unique identifier of an existing OpenStack resource. Note that when specifying an import by ID, the resource MUST already exist. The ORC object will enter an error state if the resource does not exist.", + Type: []string{"string"}, + Format: "", + }, + }, + "filter": { + SchemaProps: spec.SchemaProps{ + Description: "filter contains a resource query which is expected to return a single result. The controller will continue to retry if filter returns no results. If filter returns multiple results the controller will set an error state and will not continue to retry.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointFilter"), + }, + }, + }, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointFilter"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_EndpointList(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "EndpointList contains a list of Endpoint.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "kind": { + SchemaProps: spec.SchemaProps{ + Description: "Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds", + Type: []string{"string"}, + Format: "", + }, + }, + "apiVersion": { + SchemaProps: spec.SchemaProps{ + Description: "APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources", + Type: []string{"string"}, + Format: "", + }, + }, + "metadata": { + SchemaProps: spec.SchemaProps{ + Description: "metadata contains the list metadata", + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.ListMeta"), + }, + }, + "items": { + SchemaProps: spec.SchemaProps{ + Description: "items contains a list of Endpoint.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.Endpoint"), + }, + }, + }, + }, + }, + }, + Required: []string{"items"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.Endpoint", "k8s.io/apimachinery/pkg/apis/meta/v1.ListMeta"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_EndpointResourceSpec(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "EndpointResourceSpec contains the desired state of the resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "description": { + SchemaProps: spec.SchemaProps{ + Description: "description is a human-readable description for the resource.", + Type: []string{"string"}, + Format: "", + }, + }, + "enabled": { + SchemaProps: spec.SchemaProps{ + Description: "enabled indicates whether the endpoint is enabled or not.", + Type: []string{"boolean"}, + Format: "", + }, + }, + "interface": { + SchemaProps: spec.SchemaProps{ + Description: "interface indicates the visibility of the endpoint.", + Type: []string{"string"}, + Format: "", + }, + }, + "url": { + SchemaProps: spec.SchemaProps{ + Description: "url is the endpoint URL.", + Default: "", + Type: []string{"string"}, + Format: "", + }, + }, + "serviceRef": { + SchemaProps: spec.SchemaProps{ + Description: "serviceRef is a reference to the ORC Service which this resource is associated with.", + Type: []string{"string"}, + Format: "", + }, + }, + }, + Required: []string{"interface", "url", "serviceRef"}, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_EndpointResourceStatus(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "EndpointResourceStatus represents the observed state of the resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "description": { + SchemaProps: spec.SchemaProps{ + Description: "description is a human-readable description for the resource.", + Type: []string{"string"}, + Format: "", + }, + }, + "enabled": { + SchemaProps: spec.SchemaProps{ + Description: "enabled indicates whether the endpoint is enabled or not.", + Type: []string{"boolean"}, + Format: "", + }, + }, + "interface": { + SchemaProps: spec.SchemaProps{ + Description: "interface indicates the visibility of the endpoint.", + Type: []string{"string"}, + Format: "", + }, + }, + "url": { + SchemaProps: spec.SchemaProps{ + Description: "url is the endpoint URL.", + Type: []string{"string"}, + Format: "", + }, + }, + "serviceID": { + SchemaProps: spec.SchemaProps{ + Description: "serviceID is the ID of the Service to which the resource is associated.", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_EndpointSpec(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "EndpointSpec defines the desired state of an ORC object.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "import": { + SchemaProps: spec.SchemaProps{ + Description: "import refers to an existing OpenStack resource which will be imported instead of creating a new one.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointImport"), + }, + }, + "resource": { + SchemaProps: spec.SchemaProps{ + Description: "resource specifies the desired state of the resource.\n\nresource may not be specified if the management policy is `unmanaged`.\n\nresource must be specified if the management policy is `managed`.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointResourceSpec"), + }, + }, + "managementPolicy": { + SchemaProps: spec.SchemaProps{ + Description: "managementPolicy defines how ORC will treat the object. Valid values are `managed`: ORC will create, update, and delete the resource; `unmanaged`: ORC will import an existing resource, and will not apply updates to it or delete it.", + Type: []string{"string"}, + Format: "", + }, + }, + "managedOptions": { + SchemaProps: spec.SchemaProps{ + Description: "managedOptions specifies options which may be applied to managed objects.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.ManagedOptions"), + }, + }, + "cloudCredentialsRef": { + SchemaProps: spec.SchemaProps{ + Description: "cloudCredentialsRef points to a secret containing OpenStack credentials", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.CloudCredentialsReference"), + }, + }, + }, + Required: []string{"cloudCredentialsRef"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.CloudCredentialsReference", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointImport", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointResourceSpec", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.ManagedOptions"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_EndpointStatus(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "EndpointStatus defines the observed state of an ORC resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "conditions": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-map-keys": []interface{}{ + "type", + }, + "x-kubernetes-list-type": "map", + "x-kubernetes-patch-merge-key": "type", + "x-kubernetes-patch-strategy": "merge", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "conditions represents the observed status of the object. Known .status.conditions.type are: \"Available\", \"Progressing\"\n\nAvailable represents the availability of the OpenStack resource. If it is true then the resource is ready for use.\n\nProgressing indicates whether the controller is still attempting to reconcile the current state of the OpenStack resource to the desired state. Progressing will be False either because the desired state has been achieved, or because some terminal error prevents it from ever being achieved and the controller is no longer attempting to reconcile. If Progressing is True, an observer waiting on the resource should continue to wait.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.Condition"), + }, + }, + }, + }, + }, + "id": { + SchemaProps: spec.SchemaProps{ + Description: "id is the unique identifier of the OpenStack resource.", + Type: []string{"string"}, + Format: "", + }, + }, + "resource": { + SchemaProps: spec.SchemaProps{ + Description: "resource contains the observed state of the OpenStack resource.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointResourceStatus"), + }, + }, + }, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.EndpointResourceStatus", "k8s.io/apimachinery/pkg/apis/meta/v1.Condition"}, + } +} + func schema_openstack_resource_controller_v2_api_v1alpha1_ExternalGateway(ref common.ReferenceCallback) common.OpenAPIDefinition { return common.OpenAPIDefinition{ Schema: spec.Schema{ diff --git a/cmd/resource-generator/main.go b/cmd/resource-generator/main.go index 45e9d364b..0e7444cc1 100644 --- a/cmd/resource-generator/main.go +++ b/cmd/resource-generator/main.go @@ -164,6 +164,10 @@ var resources []templateFields = []templateFields{ { Name: "Group", }, + { + Name: "Endpoint", + IsNotNamed: true, + }, } // These resources won't be generated diff --git a/config/crd/bases/openstack.k-orc.cloud_endpoints.yaml b/config/crd/bases/openstack.k-orc.cloud_endpoints.yaml index 34a49522b..a4ba70a10 100644 --- a/config/crd/bases/openstack.k-orc.cloud_endpoints.yaml +++ b/config/crd/bases/openstack.k-orc.cloud_endpoints.yaml @@ -93,15 +93,20 @@ spec: properties: interface: description: interface of the existing endpoint. + enum: + - admin + - internal + - public type: string serviceRef: - description: serviceRef is a reference to which the endpoint - belongs. + description: serviceRef is a reference to the ORC Service + which this resource is associated with. maxLength: 253 minLength: 1 type: string url: description: url is the URL of the existing endpoint. + maxLength: 1024 type: string type: object id: @@ -110,6 +115,7 @@ spec: that when specifying an import by ID, the resource MUST already exist. The ORC object will enter an error state if the resource does not exist. format: uuid + maxLength: 36 type: string type: object managedOptions: @@ -150,6 +156,12 @@ spec: resource must be specified if the management policy is `managed`. properties: + description: + description: description is a human-readable description for the + resource. + maxLength: 255 + minLength: 1 + type: string enabled: default: true description: enabled indicates whether the endpoint is enabled @@ -162,14 +174,6 @@ spec: - internal - public type: string - name: - description: |- - name will be the name of the created resource. If not specified, the - name of the ORC object will be used. - maxLength: 255 - minLength: 1 - pattern: ^[^,]+$ - type: string serviceRef: description: serviceRef is a reference to the ORC Service which this resource is associated with. @@ -181,6 +185,7 @@ spec: rule: self == oldSelf url: description: url is the endpoint URL. + maxLength: 1024 type: string required: - interface @@ -284,26 +289,25 @@ spec: x-kubernetes-list-type: map id: description: id is the unique identifier of the OpenStack resource. + maxLength: 1024 type: string resource: description: resource contains the observed state of the OpenStack resource. properties: + description: + description: description is a human-readable description for the + resource. + maxLength: 255 + minLength: 1 + type: string enabled: description: enabled indicates whether the endpoint is enabled or not. type: boolean interface: description: interface indicates the visibility of the endpoint. - enum: - - admin - - internal - - public - type: string - name: - description: name is a Human-readable name for the resource. Might - not be unique. - maxLength: 1024 + maxLength: 128 type: string serviceID: description: serviceID is the ID of the Service to which the resource @@ -312,9 +316,12 @@ spec: type: string url: description: url is the endpoint URL. + maxLength: 1024 type: string type: object type: object + required: + - spec type: object served: true storage: true diff --git a/config/crd/kustomization.yaml b/config/crd/kustomization.yaml index b73dcac05..319e67e8a 100644 --- a/config/crd/kustomization.yaml +++ b/config/crd/kustomization.yaml @@ -4,6 +4,7 @@ # It should be run by config/default resources: - bases/openstack.k-orc.cloud_domains.yaml +- bases/openstack.k-orc.cloud_endpoints.yaml - bases/openstack.k-orc.cloud_flavors.yaml - bases/openstack.k-orc.cloud_floatingips.yaml - bases/openstack.k-orc.cloud_groups.yaml diff --git a/config/manifests/bases/orc.clusterserviceversion.yaml b/config/manifests/bases/orc.clusterserviceversion.yaml index 0c5f1c0ea..0b7164e78 100644 --- a/config/manifests/bases/orc.clusterserviceversion.yaml +++ b/config/manifests/bases/orc.clusterserviceversion.yaml @@ -24,6 +24,11 @@ spec: kind: Domain name: domains.openstack.k-orc.cloud version: v1alpha1 + - description: Endpoint is the Schema for an ORC resource. + displayName: Endpoint + kind: Endpoint + name: endpoints.openstack.k-orc.cloud + version: v1alpha1 - description: Flavor is the Schema for an ORC resource. displayName: Flavor kind: Flavor diff --git a/config/rbac/role.yaml b/config/rbac/role.yaml index 5545c52a6..1bb68f2b9 100644 --- a/config/rbac/role.yaml +++ b/config/rbac/role.yaml @@ -18,6 +18,7 @@ rules: - openstack.k-orc.cloud resources: - domains + - endpoints - flavors - floatingips - groups @@ -49,6 +50,7 @@ rules: - openstack.k-orc.cloud resources: - domains/status + - endpoints/status - flavors/status - floatingips/status - groups/status diff --git a/config/samples/kustomization.yaml b/config/samples/kustomization.yaml index aa2a75e43..488fa1eb7 100644 --- a/config/samples/kustomization.yaml +++ b/config/samples/kustomization.yaml @@ -2,6 +2,7 @@ ## Append samples of your project ## resources: - openstack_v1alpha1_domain.yaml +- openstack_v1alpha1_endpoint.yaml - openstack_v1alpha1_flavor.yaml - openstack_v1alpha1_floatingip.yaml - openstack_v1alpha1_group.yaml diff --git a/config/samples/openstack_v1alpha1_endpoint.yaml b/config/samples/openstack_v1alpha1_endpoint.yaml index a45971790..783789298 100644 --- a/config/samples/openstack_v1alpha1_endpoint.yaml +++ b/config/samples/openstack_v1alpha1_endpoint.yaml @@ -5,10 +5,11 @@ metadata: name: endpoint-sample spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: - description: Sample Endpoint - # TODO(scaffolding): Add all fields the resource supports + interface: internal + url: "https://example.com" + serviceRef: service-sample + diff --git a/internal/controllers/endpoint/actuator.go b/internal/controllers/endpoint/actuator.go index 7416577a2..ba68d9be1 100644 --- a/internal/controllers/endpoint/actuator.go +++ b/internal/controllers/endpoint/actuator.go @@ -18,8 +18,10 @@ package endpoint import ( "context" + "fmt" "iter" + "github.com/gophercloud/gophercloud/v2" "github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints" corev1 "k8s.io/api/core/v1" apierrors "k8s.io/apimachinery/pkg/api/errors" @@ -71,22 +73,30 @@ func (actuator endpointActuator) ListOSResourcesForAdoption(ctx context.Context, return nil, false } - // TODO(scaffolding) If you need to filter resources on fields that the List() function - // of gophercloud does not support, it's possible to perform client-side filtering. - // Check osclients.ResourceFilter + service, _ := serviceDependency.GetDependency( + ctx, actuator.k8sClient, orcObject, func(dep *orcv1alpha1.Service) bool { + return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil + }, + ) + + if service == nil { + return nil, false + } + + var filters []osclients.ResourceFilter[osResourceT] + filters = append(filters, func(e *endpoints.Endpoint) bool { + return e.URL == resourceSpec.URL + }) listOpts := endpoints.ListOpts{ - Name: getResourceName(orcObject), - Description: ptr.Deref(resourceSpec.Description, ""), + Availability: gophercloud.Availability(resourceSpec.Interface), + ServiceID: ptr.Deref(service.Status.ID, ""), } - return actuator.osClient.ListEndpoints(ctx, listOpts), true + return actuator.listOsResources(ctx, listOpts, filters), true } func (actuator endpointActuator) ListOSResourcesForImport(ctx context.Context, obj orcObjectPT, filter filterT) (iter.Seq2[*osResourceT, error], progress.ReconcileStatus) { - // TODO(scaffolding) If you need to filter resources on fields that the List() function - // of gophercloud does not support, it's possible to perform client-side filtering. - // Check osclients.ResourceFilter var reconcileStatus progress.ReconcileStatus service := &orcv1alpha1.Service{} @@ -112,14 +122,24 @@ func (actuator endpointActuator) ListOSResourcesForImport(ctx context.Context, o return nil, reconcileStatus } + var resourceFilters []osclients.ResourceFilter[osResourceT] + if filter.URL != "" { + resourceFilters = append(resourceFilters, func(e *endpoints.Endpoint) bool { + return e.URL == filter.URL + }) + } + listOpts := endpoints.ListOpts{ - Name: string(ptr.Deref(filter.Name, "")), - Description: string(ptr.Deref(filter.Description, "")), - Service: ptr.Deref(service.Status.ID, ""), - // TODO(scaffolding): Add more import filters + ServiceID: ptr.Deref(service.Status.ID, ""), + Availability: gophercloud.Availability(filter.Interface), } - return actuator.osClient.ListEndpoints(ctx, listOpts), nil + return actuator.listOsResources(ctx, listOpts, resourceFilters), nil +} + +func (actuator endpointActuator) listOsResources(ctx context.Context, listOpts endpoints.ListOpts, filter []osclients.ResourceFilter[osResourceT]) iter.Seq2[*osResourceT, error] { + endpoints := actuator.osClient.ListEndpoints(ctx, listOpts) + return osclients.Filter(endpoints, filter...) } func (actuator endpointActuator) CreateResource(ctx context.Context, obj orcObjectPT) (*osResourceT, progress.ReconcileStatus) { @@ -133,23 +153,25 @@ func (actuator endpointActuator) CreateResource(ctx context.Context, obj orcObje var reconcileStatus progress.ReconcileStatus var serviceID string - service, serviceDepRS := serviceDependency.GetDependency( - ctx, actuator.k8sClient, obj, func(dep *orcv1alpha1.Service) bool { - return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil - }, - ) - reconcileStatus = reconcileStatus.WithReconcileStatus(serviceDepRS) - if service != nil { - serviceID = ptr.Deref(service.Status.ID, "") - } + service, serviceDepRS := serviceDependency.GetDependency( + ctx, actuator.k8sClient, obj, func(dep *orcv1alpha1.Service) bool { + return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil + }, + ) + + reconcileStatus = reconcileStatus.WithReconcileStatus(serviceDepRS) + if service != nil { + serviceID = ptr.Deref(service.Status.ID, "") + } if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { return nil, reconcileStatus } createOpts := endpoints.CreateOpts{ - Name: getResourceName(obj), - Description: ptr.Deref(resource.Description, ""), - ServiceID: serviceID, - // TODO(scaffolding): Add more fields + Availability: gophercloud.Availability(resource.Interface), + Description: ptr.Deref(resource.Description, ""), + Enabled: resource.Enabled, + ServiceID: serviceID, + URL: resource.URL, } osResource, err := actuator.osClient.CreateEndpoint(ctx, createOpts) @@ -179,10 +201,9 @@ func (actuator endpointActuator) updateResource(ctx context.Context, obj orcObje updateOpts := endpoints.UpdateOpts{} - handleNameUpdate(&updateOpts, obj, osResource) - handleDescriptionUpdate(&updateOpts, resource, osResource) - - // TODO(scaffolding): add handler for all fields supporting mutability + handleEnabledUpdate(&updateOpts, resource, osResource) + handleURLUpdate(&updateOpts, resource, osResource) + handleInterfaceUpdate(&updateOpts, resource, osResource) needsUpdate, err := needsUpdate(updateOpts) if err != nil { @@ -219,20 +240,30 @@ func needsUpdate(updateOpts endpoints.UpdateOpts) (bool, error) { updateMap = make(map[string]any) } + log := ctrl.LoggerFrom(context.Background()) + log.Info("Description", "updateMap", updateMap) + return len(updateMap) > 0, nil } -func handleNameUpdate(updateOpts *endpoints.UpdateOpts, obj orcObjectPT, osResource *osResourceT) { - name := getResourceName(obj) - if osResource.Name != name { - updateOpts.Name = &name +func handleURLUpdate(updateOpts *endpoints.UpdateOpts, resource *resourceSpecT, osResource *osResourceT) { + url := resource.URL + if osResource.URL != url { + updateOpts.URL = url + } +} + +func handleInterfaceUpdate(updateOpts *endpoints.UpdateOpts, resource *resourceSpecT, osResource *osResourceT) { + endpointInterface := gophercloud.Availability(resource.Interface) + if osResource.Availability != endpointInterface { + updateOpts.Availability = endpointInterface } } -func handleDescriptionUpdate(updateOpts *endpoints.UpdateOpts, resource *resourceSpecT, osResource *osResourceT) { - description := ptr.Deref(resource.Description, "") - if osResource.Description != description { - updateOpts.Description = &description +func handleEnabledUpdate(updateOpts *endpoints.UpdateOpts, resource *resourceSpecT, osResource *osResourceT) { + enabled := resource.Enabled + if enabled != nil && osResource.Enabled != *enabled { + updateOpts.Enabled = enabled } } diff --git a/internal/controllers/endpoint/actuator_test.go b/internal/controllers/endpoint/actuator_test.go index ed7fdce2c..d322f0ca4 100644 --- a/internal/controllers/endpoint/actuator_test.go +++ b/internal/controllers/endpoint/actuator_test.go @@ -19,6 +19,7 @@ package endpoint import ( "testing" + "github.com/gophercloud/gophercloud/v2" "github.com/gophercloud/gophercloud/v2/openstack/identity/v3/endpoints" orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" "k8s.io/utils/ptr" @@ -37,7 +38,7 @@ func TestNeedsUpdate(t *testing.T) { }, { name: "Updated opts", - updateOpts: endpoints.UpdateOpts{Name: ptr.To("updated")}, + updateOpts: endpoints.UpdateOpts{URL: "http://updated.com"}, expectChange: true, }, } @@ -52,31 +53,25 @@ func TestNeedsUpdate(t *testing.T) { } } -func TestHandleNameUpdate(t *testing.T) { - ptrToName := ptr.To[orcv1alpha1.OpenStackName] +func TestHandleInterfaceUpdate(t *testing.T) { testCases := []struct { name string - newValue *orcv1alpha1.OpenStackName + newValue *string existingValue string expectChange bool }{ - {name: "Identical", newValue: ptrToName("name"), existingValue: "name", expectChange: false}, - {name: "Different", newValue: ptrToName("new-name"), existingValue: "name", expectChange: true}, - {name: "No value provided, existing is identical to object name", newValue: nil, existingValue: "object-name", expectChange: false}, - {name: "No value provided, existing is different from object name", newValue: nil, existingValue: "different-from-object-name", expectChange: true}, + {name: "Identical", newValue: ptr.To("internal"), existingValue: "internal", expectChange: false}, + {name: "Different", newValue: ptr.To("public"), existingValue: "internal", expectChange: true}, + {name: "No value provided, existing is kept", newValue: nil, existingValue: "internal", expectChange: false}, } for _, tt := range testCases { t.Run(tt.name, func(t *testing.T) { - resource := &orcv1alpha1.Endpoint{} - resource.Name = "object-name" - resource.Spec = orcv1alpha1.EndpointSpec{ - Resource: &orcv1alpha1.EndpointResourceSpec{Name: tt.newValue}, - } - osResource := &osResourceT{Name: tt.existingValue} + resourceSpec := &orcv1alpha1.EndpointResourceSpec{Interface: ptr.Deref(tt.newValue, "")} + osResource := &osResourceT{Availability: gophercloud.Availability(tt.existingValue)} updateOpts := endpoints.UpdateOpts{} - handleNameUpdate(&updateOpts, resource, osResource) + handleInterfaceUpdate(&updateOpts, resourceSpec, osResource) got, _ := needsUpdate(updateOpts) if got != tt.expectChange { @@ -87,27 +82,25 @@ func TestHandleNameUpdate(t *testing.T) { } } -func TestHandleDescriptionUpdate(t *testing.T) { - ptrToDescription := ptr.To[string] +func TestHandleURLUpdate(t *testing.T) { testCases := []struct { name string newValue *string existingValue string expectChange bool }{ - {name: "Identical", newValue: ptrToDescription("desc"), existingValue: "desc", expectChange: false}, - {name: "Different", newValue: ptrToDescription("new-desc"), existingValue: "desc", expectChange: true}, - {name: "No value provided, existing is set", newValue: nil, existingValue: "desc", expectChange: true}, - {name: "No value provided, existing is empty", newValue: nil, existingValue: "", expectChange: false}, + {name: "Identical", newValue: ptr.To("http://same.com"), existingValue: "http://same.com", expectChange: false}, + {name: "Different", newValue: ptr.To("http://different.com"), existingValue: "http://same.com", expectChange: true}, + {name: "No value provided, existing is kept", newValue: nil, existingValue: "http://same.com", expectChange: false}, } for _, tt := range testCases { t.Run(tt.name, func(t *testing.T) { - resource := &orcv1alpha1.EndpointResourceSpec{Description: tt.newValue} - osResource := &osResourceT{Description: tt.existingValue} + resourceSpec := &orcv1alpha1.EndpointResourceSpec{URL: ptr.Deref(tt.newValue, "")} + osResource := &osResourceT{URL: tt.existingValue} updateOpts := endpoints.UpdateOpts{} - handleDescriptionUpdate(&updateOpts, resource, osResource) + handleURLUpdate(&updateOpts, resourceSpec, osResource) got, _ := needsUpdate(updateOpts) if got != tt.expectChange { diff --git a/internal/controllers/endpoint/status.go b/internal/controllers/endpoint/status.go index e4e4a104f..2e570f0cb 100644 --- a/internal/controllers/endpoint/status.go +++ b/internal/controllers/endpoint/status.go @@ -51,10 +51,9 @@ func (endpointStatusWriter) ResourceAvailableStatus(orcObject *orcv1alpha1.Endpo func (endpointStatusWriter) ApplyResourceStatus(log logr.Logger, osResource *osResourceT, statusApply *statusApplyT) { resourceStatus := orcapplyconfigv1alpha1.EndpointResourceStatus(). WithServiceID(osResource.ServiceID). - WithName(osResource.Name) - - // TODO(scaffolding): add all of the fields supported in the EndpointResourceStatus struct - // If a zero-value isn't expected in the response, place it behind a conditional + WithEnabled(osResource.Enabled). + WithInterface(string(osResource.Availability)). + WithURL(osResource.URL) if osResource.Description != "" { resourceStatus.WithDescription(osResource.Description) diff --git a/internal/controllers/endpoint/tests/endpoint-create-full/00-assert.yaml b/internal/controllers/endpoint/tests/endpoint-create-full/00-assert.yaml index 881c9a9f4..0c962cfe7 100644 --- a/internal/controllers/endpoint/tests/endpoint-create-full/00-assert.yaml +++ b/internal/controllers/endpoint/tests/endpoint-create-full/00-assert.yaml @@ -5,9 +5,10 @@ metadata: name: endpoint-create-full status: resource: - name: endpoint-create-full-override - description: Endpoint from "create full" test - # TODO(scaffolding): Add all fields the resource supports + description: "Endpoint description" + interface: internal + url: https://example.com + enabled: false conditions: - type: Available status: "True" @@ -30,4 +31,4 @@ resourceRefs: assertAll: - celExpr: "endpoint.status.id != ''" - celExpr: "endpoint.status.resource.serviceID == service.status.id" - # TODO(scaffolding): Add more checks + - celExpr: "!has(endpoint.status.resource.name)" diff --git a/internal/controllers/endpoint/tests/endpoint-create-full/00-create-resource.yaml b/internal/controllers/endpoint/tests/endpoint-create-full/00-create-resource.yaml index ee7772a11..aa7360418 100644 --- a/internal/controllers/endpoint/tests/endpoint-create-full/00-create-resource.yaml +++ b/internal/controllers/endpoint/tests/endpoint-create-full/00-create-resource.yaml @@ -5,12 +5,11 @@ metadata: name: endpoint-create-full spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + type: endpoint-test --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: Endpoint @@ -18,12 +17,12 @@ metadata: name: endpoint-create-full spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: - name: endpoint-create-full-override - description: Endpoint from "create full" test + description: "Endpoint description" serviceRef: endpoint-create-full - # TODO(scaffolding): Add all fields the resource supports + interface: internal + url: https://example.com + enabled: false diff --git a/internal/controllers/endpoint/tests/endpoint-create-minimal/00-assert.yaml b/internal/controllers/endpoint/tests/endpoint-create-minimal/00-assert.yaml index 76d25598b..3924e2cf7 100644 --- a/internal/controllers/endpoint/tests/endpoint-create-minimal/00-assert.yaml +++ b/internal/controllers/endpoint/tests/endpoint-create-minimal/00-assert.yaml @@ -5,8 +5,9 @@ metadata: name: endpoint-create-minimal status: resource: - name: endpoint-create-minimal - # TODO(scaffolding): Add all fields the resource supports + url: http://example.com + interface: internal + enabled: true conditions: - type: Available status: "True" @@ -29,4 +30,4 @@ resourceRefs: assertAll: - celExpr: "endpoint.status.id != ''" - celExpr: "endpoint.status.resource.serviceID == service.status.id" - # TODO(scaffolding): Add more checks + - celExpr: "!has(endpoint.status.resource.name)" diff --git a/internal/controllers/endpoint/tests/endpoint-create-minimal/00-create-resource.yaml b/internal/controllers/endpoint/tests/endpoint-create-minimal/00-create-resource.yaml index 9087fb49d..48b59dc12 100644 --- a/internal/controllers/endpoint/tests/endpoint-create-minimal/00-create-resource.yaml +++ b/internal/controllers/endpoint/tests/endpoint-create-minimal/00-create-resource.yaml @@ -5,12 +5,11 @@ metadata: name: endpoint-create-minimal spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + type: endpoint-test --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: Endpoint @@ -18,11 +17,10 @@ metadata: name: endpoint-create-minimal spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Only add the mandatory fields. It's possible the resource - # doesn't have mandatory fields, in that case, leave it empty. resource: - serviceRef: endpoint-create-full + serviceRef: endpoint-create-minimal + interface: internal + url: http://example.com diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/00-import-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/00-import-resource.yaml index 6a5c8737b..76cddcd65 100644 --- a/internal/controllers/endpoint/tests/endpoint-import-dependency/00-import-resource.yaml +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/00-import-resource.yaml @@ -5,7 +5,7 @@ metadata: name: endpoint-import-dependency spec: cloudCredentialsRef: - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: unmanaged import: @@ -18,9 +18,11 @@ metadata: name: endpoint-import-dependency spec: cloudCredentialsRef: - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: unmanaged import: filter: serviceRef: endpoint-import-dependency + interface: internal + url: http://example.com diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/01-create-trap-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/01-create-trap-resource.yaml index 01f5e92f2..a7c71eceb 100644 --- a/internal/controllers/endpoint/tests/endpoint-import-dependency/01-create-trap-resource.yaml +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/01-create-trap-resource.yaml @@ -5,25 +5,11 @@ metadata: name: endpoint-import-dependency-not-this-one spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} ---- -apiVersion: openstack.k-orc.cloud/v1alpha1 -kind: Service -metadata: - name: endpoint-import-dependency-not-this-one -spec: - cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack - secretName: openstack-clouds - managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + type: endpoint-import-dependency-not-this-one --- # This `endpoint-import-dependency-not-this-one` should not be picked by the import filter apiVersion: openstack.k-orc.cloud/v1alpha1 @@ -32,11 +18,10 @@ metadata: name: endpoint-import-dependency-not-this-one spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: serviceRef: endpoint-import-dependency-not-this-one - serviceRef: endpoint-import-dependency-not-this-one - # TODO(scaffolding): Add the necessary fields to create the resource + interface: internal + url: http://example.com diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/02-create-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/02-create-resource.yaml index 80e8511a5..65786fa03 100644 --- a/internal/controllers/endpoint/tests/endpoint-import-dependency/02-create-resource.yaml +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/02-create-resource.yaml @@ -5,25 +5,11 @@ metadata: name: endpoint-import-dependency-external spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack - secretName: openstack-clouds - managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} ---- -apiVersion: openstack.k-orc.cloud/v1alpha1 -kind: Service -metadata: - name: endpoint-import-dependency-external -spec: - cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + type: endpoint-import-dependency-external --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: Endpoint @@ -31,11 +17,10 @@ metadata: name: endpoint-import-dependency-external spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: serviceRef: endpoint-import-dependency-external - serviceRef: endpoint-import-dependency-external - # TODO(scaffolding): Add the necessary fields to create the resource + interface: internal + url: http://example.com diff --git a/internal/controllers/endpoint/tests/endpoint-import-dependency/03-delete-import-dependencies.yaml b/internal/controllers/endpoint/tests/endpoint-import-dependency/03-delete-import-dependencies.yaml index 744da0717..a102aa7e2 100644 --- a/internal/controllers/endpoint/tests/endpoint-import-dependency/03-delete-import-dependencies.yaml +++ b/internal/controllers/endpoint/tests/endpoint-import-dependency/03-delete-import-dependencies.yaml @@ -3,5 +3,5 @@ apiVersion: kuttl.dev/v1beta1 kind: TestStep commands: # We should be able to delete the import dependencies - - command: kubectl delete service endpoint-import-dependency + - command: kubectl delete services.openstack.k-orc.cloud endpoint-import-dependency namespaced: true diff --git a/internal/controllers/endpoint/tests/endpoint-import-error/00-create-resources.yaml b/internal/controllers/endpoint/tests/endpoint-import-error/00-create-resources.yaml index 7e68b2f80..43afeab6f 100644 --- a/internal/controllers/endpoint/tests/endpoint-import-error/00-create-resources.yaml +++ b/internal/controllers/endpoint/tests/endpoint-import-error/00-create-resources.yaml @@ -5,12 +5,11 @@ metadata: name: endpoint-import-error spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + type: endpoint-import-error --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: Endpoint @@ -18,14 +17,13 @@ metadata: name: endpoint-import-error-external-1 spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: - description: Endpoint from "import error" test serviceRef: endpoint-import-error - # TODO(scaffolding): add any required field + interface: internal + url: http://example1.com --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: Endpoint @@ -33,11 +31,10 @@ metadata: name: endpoint-import-error-external-2 spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: - description: Endpoint from "import error" test serviceRef: endpoint-import-error - # TODO(scaffolding): add any required field + interface: internal + url: http://example2.com diff --git a/internal/controllers/endpoint/tests/endpoint-import-error/01-import-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import-error/01-import-resource.yaml index df0e2d3a9..0b106e2cd 100644 --- a/internal/controllers/endpoint/tests/endpoint-import-error/01-import-resource.yaml +++ b/internal/controllers/endpoint/tests/endpoint-import-error/01-import-resource.yaml @@ -5,9 +5,10 @@ metadata: name: endpoint-import-error spec: cloudCredentialsRef: - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: unmanaged import: filter: - description: Endpoint from "import error" test + serviceRef: endpoint-import-error + interface: internal diff --git a/internal/controllers/endpoint/tests/endpoint-import/00-import-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import/00-import-resource.yaml index cdfda600d..e42eeedd3 100644 --- a/internal/controllers/endpoint/tests/endpoint-import/00-import-resource.yaml +++ b/internal/controllers/endpoint/tests/endpoint-import/00-import-resource.yaml @@ -1,15 +1,28 @@ --- apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Service +metadata: + name: endpoint-import +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: + type: endpoint-import +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 kind: Endpoint metadata: name: endpoint-import spec: cloudCredentialsRef: - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: unmanaged import: filter: - name: endpoint-import-external - description: Endpoint endpoint-import-external from "endpoint-import" test - # TODO(scaffolding): Add all fields supported by the filter + serviceRef: endpoint-import + interface: internal + url: http://example.com + enabled: false diff --git a/internal/controllers/endpoint/tests/endpoint-import/01-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import/01-assert.yaml index 63a67bdbd..a7983cc2c 100644 --- a/internal/controllers/endpoint/tests/endpoint-import/01-assert.yaml +++ b/internal/controllers/endpoint/tests/endpoint-import/01-assert.yaml @@ -14,9 +14,8 @@ status: status: "False" reason: Success resource: - name: endpoint-import-external-not-this-one - description: Endpoint endpoint-import-external from "endpoint-import" test - # TODO(scaffolding): Add fields necessary to match filter + interface: internal + url: http://example.com --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: Endpoint diff --git a/internal/controllers/endpoint/tests/endpoint-import/01-create-trap-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import/01-create-trap-resource.yaml index 036efd781..2e41c1cff 100644 --- a/internal/controllers/endpoint/tests/endpoint-import/01-create-trap-resource.yaml +++ b/internal/controllers/endpoint/tests/endpoint-import/01-create-trap-resource.yaml @@ -5,12 +5,11 @@ metadata: name: endpoint-import-external-not-this-one spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + type: endpoint-import-external-not-this-one --- # This `endpoint-import-external-not-this-one` resource serves two purposes: # - ensure that we can successfully create another resource which name is a substring of it (i.e. it's not being adopted) @@ -21,11 +20,11 @@ metadata: name: endpoint-import-external-not-this-one spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: - description: Endpoint endpoint-import-external from "endpoint-import" test serviceRef: endpoint-import-external-not-this-one - # TODO(scaffolding): Add fields necessary to match filter + interface: internal + url: http://example.com + diff --git a/internal/controllers/endpoint/tests/endpoint-import/02-assert.yaml b/internal/controllers/endpoint/tests/endpoint-import/02-assert.yaml index b3c7c0b04..a776882ab 100644 --- a/internal/controllers/endpoint/tests/endpoint-import/02-assert.yaml +++ b/internal/controllers/endpoint/tests/endpoint-import/02-assert.yaml @@ -10,6 +10,10 @@ resourceRefs: kind: Endpoint name: endpoint-import-external-not-this-one ref: endpoint2 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Service + name: endpoint-import + ref: service assertAll: - celExpr: "endpoint1.status.id != endpoint2.status.id" --- @@ -28,6 +32,6 @@ status: status: "False" reason: Success resource: - name: endpoint-import-external - description: Endpoint endpoint-import-external from "endpoint-import" test - # TODO(scaffolding): Add all fields the resource supports + interface: internal + url: http://example.com + enabled: false diff --git a/internal/controllers/endpoint/tests/endpoint-import/02-create-resource.yaml b/internal/controllers/endpoint/tests/endpoint-import/02-create-resource.yaml index 5e17eec59..499ff7783 100644 --- a/internal/controllers/endpoint/tests/endpoint-import/02-create-resource.yaml +++ b/internal/controllers/endpoint/tests/endpoint-import/02-create-resource.yaml @@ -1,28 +1,15 @@ --- apiVersion: openstack.k-orc.cloud/v1alpha1 -kind: Service -metadata: - name: endpoint-import -spec: - cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack - secretName: openstack-clouds - managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} ---- -apiVersion: openstack.k-orc.cloud/v1alpha1 kind: Endpoint metadata: name: endpoint-import-external spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: - description: Endpoint endpoint-import-external from "endpoint-import" test serviceRef: endpoint-import - # TODO(scaffolding): Add fields necessary to match filter + interface: internal + url: http://example.com + enabled: false diff --git a/internal/controllers/endpoint/tests/endpoint-update/00-assert.yaml b/internal/controllers/endpoint/tests/endpoint-update/00-assert.yaml index 49cc482c0..0714459c2 100644 --- a/internal/controllers/endpoint/tests/endpoint-update/00-assert.yaml +++ b/internal/controllers/endpoint/tests/endpoint-update/00-assert.yaml @@ -1,22 +1,13 @@ --- -apiVersion: kuttl.dev/v1beta1 -kind: TestAssert -resourceRefs: - - apiVersion: openstack.k-orc.cloud/v1alpha1 - kind: Endpoint - name: endpoint-update - ref: endpoint -assertAll: - - celExpr: "!has(endpoint.status.resource.description)" ---- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: Endpoint metadata: name: endpoint-update status: resource: - name: endpoint-update - # TODO(scaffolding): Add matches for more fields + interface: internal + url: http://example.com + enabled: false conditions: - type: Available status: "True" @@ -24,3 +15,19 @@ status: - type: Progressing status: "False" reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Endpoint + name: endpoint-update + ref: endpoint + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Service + name: endpoint-update + ref: service +assertAll: + - celExpr: "endpoint.status.resource.serviceID == service.status.id" + - celExpr: "!has(endpoint.status.resource.name)" + - celExpr: "!has(endpoint.status.resource.description)" diff --git a/internal/controllers/endpoint/tests/endpoint-update/00-minimal-resource.yaml b/internal/controllers/endpoint/tests/endpoint-update/00-minimal-resource.yaml index d846d67fb..535c94d1a 100644 --- a/internal/controllers/endpoint/tests/endpoint-update/00-minimal-resource.yaml +++ b/internal/controllers/endpoint/tests/endpoint-update/00-minimal-resource.yaml @@ -5,12 +5,11 @@ metadata: name: endpoint-update spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + type: endpoint-test-update --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: Endpoint @@ -18,11 +17,13 @@ metadata: name: endpoint-update spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resouce needs admin credentials to be created or updated - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Only add the mandatory fields. It's possible the resource - # doesn't have mandatory fields, in that case, leave it empty. resource: serviceRef: endpoint-update + interface: internal + url: http://example.com + # Set a different value than the default so we can update it + # later. + enabled: false diff --git a/internal/controllers/endpoint/tests/endpoint-update/01-assert.yaml b/internal/controllers/endpoint/tests/endpoint-update/01-assert.yaml index e526907c7..4d03c34d6 100644 --- a/internal/controllers/endpoint/tests/endpoint-update/01-assert.yaml +++ b/internal/controllers/endpoint/tests/endpoint-update/01-assert.yaml @@ -5,9 +5,9 @@ metadata: name: endpoint-update status: resource: - name: endpoint-update-updated - description: endpoint-update-updated - # TODO(scaffolding): match all fields that were modified + interface: public + url: http://example.com/updated + enabled: true conditions: - type: Available status: "True" diff --git a/internal/controllers/endpoint/tests/endpoint-update/01-updated-resource.yaml b/internal/controllers/endpoint/tests/endpoint-update/01-updated-resource.yaml index ea78d64af..c95d344e3 100644 --- a/internal/controllers/endpoint/tests/endpoint-update/01-updated-resource.yaml +++ b/internal/controllers/endpoint/tests/endpoint-update/01-updated-resource.yaml @@ -5,6 +5,6 @@ metadata: name: endpoint-update spec: resource: - name: endpoint-update-updated - description: endpoint-update-updated - # TODO(scaffolding): update all mutable fields + interface: public + url: http://example.com/updated + enabled: true diff --git a/internal/controllers/endpoint/tests/endpoint-update/02-assert.yaml b/internal/controllers/endpoint/tests/endpoint-update/02-assert.yaml index c3e8f879e..f41c5016e 100644 --- a/internal/controllers/endpoint/tests/endpoint-update/02-assert.yaml +++ b/internal/controllers/endpoint/tests/endpoint-update/02-assert.yaml @@ -6,7 +6,13 @@ resourceRefs: kind: Endpoint name: endpoint-update ref: endpoint + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Service + name: endpoint-update + ref: service assertAll: + - celExpr: "endpoint.status.resource.serviceID == service.status.id" + - celExpr: "!has(endpoint.status.resource.name)" - celExpr: "!has(endpoint.status.resource.description)" --- apiVersion: openstack.k-orc.cloud/v1alpha1 @@ -15,8 +21,9 @@ metadata: name: endpoint-update status: resource: - name: endpoint-update - # TODO(scaffolding): validate that updated fields were all reverted to their original value + interface: internal + url: http://example.com + enabled: false conditions: - type: Available status: "True" diff --git a/internal/controllers/endpoint/zz_generated.adapter.go b/internal/controllers/endpoint/zz_generated.adapter.go index 934d9b7da..fe95ab43f 100644 --- a/internal/controllers/endpoint/zz_generated.adapter.go +++ b/internal/controllers/endpoint/zz_generated.adapter.go @@ -1,6 +1,6 @@ // Code generated by resource-generator. DO NOT EDIT. /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. @@ -76,13 +76,3 @@ func (f adapterT) GetImportFilter() *filterT { } return f.Spec.Import.Filter } - -// getResourceName returns the name of the OpenStack resource we should use. -// This method is not implemented as part of APIObjectAdapter as it is intended -// to be used by resource actuators, which don't use the adapter. -func getResourceName(orcObject orcObjectPT) string { - if orcObject.Spec.Resource.Name != nil { - return string(*orcObject.Spec.Resource.Name) - } - return orcObject.Name -} diff --git a/internal/controllers/endpoint/zz_generated.controller.go b/internal/controllers/endpoint/zz_generated.controller.go index 1dd55a109..e0ccac2f9 100644 --- a/internal/controllers/endpoint/zz_generated.controller.go +++ b/internal/controllers/endpoint/zz_generated.controller.go @@ -1,6 +1,6 @@ // Code generated by resource-generator. DO NOT EDIT. /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/internal/controllers/port/tests/port-update/00-assert.yaml b/internal/controllers/port/tests/port-update/00-assert.yaml index fef380932..9a20be882 100644 --- a/internal/controllers/port/tests/port-update/00-assert.yaml +++ b/internal/controllers/port/tests/port-update/00-assert.yaml @@ -2,17 +2,17 @@ apiVersion: kuttl.dev/v1beta1 kind: TestAssert resourceRefs: - - apiVersion: openstack.k-orc.cloud/v1alpha1 - kind: port - name: port-update - ref: port + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: port + name: port-update + ref: port assertAll: - - celExpr: "port.status.id != ''" - - celExpr: "port.status.resource.createdAt != ''" - - celExpr: "port.status.resource.updatedAt != ''" - - celExpr: "port.status.resource.macAddress != ''" - - celExpr: "!has(port.status.resource.fixedIPs)" - - celExpr: "!has(port.status.resource.description)" + - celExpr: "port.status.id != ''" + - celExpr: "port.status.resource.createdAt != ''" + - celExpr: "port.status.resource.updatedAt != ''" + - celExpr: "port.status.resource.macAddress != ''" + - celExpr: "!has(port.status.resource.fixedIPs)" + - celExpr: "!has(port.status.resource.description)" --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: Port diff --git a/internal/controllers/port/tests/port-update/01-assert.yaml b/internal/controllers/port/tests/port-update/01-assert.yaml index c8f79187b..37a622ec7 100644 --- a/internal/controllers/port/tests/port-update/01-assert.yaml +++ b/internal/controllers/port/tests/port-update/01-assert.yaml @@ -48,4 +48,4 @@ status: reason: Success - type: Progressing status: "False" - reason: Success + reason: Success diff --git a/internal/osclients/mock/doc.go b/internal/osclients/mock/doc.go index 0da3b97ba..176f3bc93 100644 --- a/internal/osclients/mock/doc.go +++ b/internal/osclients/mock/doc.go @@ -38,6 +38,9 @@ import ( //go:generate mockgen -package mock -destination=domain.go -source=../domain.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock DomainClient //go:generate /usr/bin/env bash -c "cat ../../../hack/boilerplate.go.txt domain.go > _domain.go && mv _domain.go domain.go" +//go:generate mockgen -package mock -destination=endpoint.go -source=../endpoint.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock EndpointClient +//go:generate /usr/bin/env bash -c "cat ../../../hack/boilerplate.go.txt endpoint.go > _endpoint.go && mv _endpoint.go endpoint.go" + //go:generate mockgen -package mock -destination=group.go -source=../group.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock GroupClient //go:generate /usr/bin/env bash -c "cat ../../../hack/boilerplate.go.txt group.go > _group.go && mv _group.go group.go" diff --git a/internal/osclients/mock/endpoint.go b/internal/osclients/mock/endpoint.go index dafc92276..ed4ea1be4 100644 --- a/internal/osclients/mock/endpoint.go +++ b/internal/osclients/mock/endpoint.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/internal/scope/mock.go b/internal/scope/mock.go index ef959fae5..9cc49cd03 100644 --- a/internal/scope/mock.go +++ b/internal/scope/mock.go @@ -36,6 +36,7 @@ import ( type MockScopeFactory struct { ComputeClient *mock.MockComputeClient DomainClient *mock.MockDomainClient + EndpointClient *mock.MockEndpointClient GroupClient *mock.MockGroupClient IdentityClient *mock.MockIdentityClient ImageClient *mock.MockImageClient @@ -52,6 +53,7 @@ type MockScopeFactory struct { func NewMockScopeFactory(mockCtrl *gomock.Controller) *MockScopeFactory { computeClient := mock.NewMockComputeClient(mockCtrl) domainClient := mock.NewMockDomainClient(mockCtrl) + endpointClient := mock.NewMockEndpointClient(mockCtrl) groupClient := mock.NewMockGroupClient(mockCtrl) identityClient := mock.NewMockIdentityClient(mockCtrl) imageClient := mock.NewMockImageClient(mockCtrl) @@ -65,6 +67,7 @@ func NewMockScopeFactory(mockCtrl *gomock.Controller) *MockScopeFactory { return &MockScopeFactory{ ComputeClient: computeClient, DomainClient: domainClient, + EndpointClient: endpointClient, GroupClient: groupClient, IdentityClient: identityClient, ImageClient: imageClient, @@ -132,6 +135,10 @@ func (f *MockScopeFactory) NewRoleClient() (osclients.RoleClient, error) { return f.RoleClient, nil } +func (f *MockScopeFactory) NewEndpointClient() (osclients.EndpointClient, error) { + return f.EndpointClient, nil +} + func (f *MockScopeFactory) ExtractToken() (*tokens.Token, error) { return &tokens.Token{ExpiresAt: time.Now().Add(24 * time.Hour)}, nil } diff --git a/internal/scope/provider.go b/internal/scope/provider.go index 65670ba60..d9853e381 100644 --- a/internal/scope/provider.go +++ b/internal/scope/provider.go @@ -169,6 +169,10 @@ func (s *providerScope) NewServiceClient() (clients.ServiceClient, error) { return clients.NewServiceClient(s.providerClient, s.providerClientOpts) } +func (s *providerScope) NewEndpointClient() (clients.EndpointClient, error) { + return clients.NewEndpointClient(s.providerClient, s.providerClientOpts) +} + func (s *providerScope) NewKeyPairClient() (clients.KeyPairClient, error) { return clients.NewKeyPairClient(s.providerClient, s.providerClientOpts) } diff --git a/internal/scope/scope.go b/internal/scope/scope.go index 7da50dc8f..8baa7f404 100644 --- a/internal/scope/scope.go +++ b/internal/scope/scope.go @@ -50,6 +50,7 @@ type Factory interface { type Scope interface { NewComputeClient() (osclients.ComputeClient, error) NewDomainClient() (osclients.DomainClient, error) + NewEndpointClient() (osclients.EndpointClient, error) NewGroupClient() (osclients.GroupClient, error) NewIdentityClient() (osclients.IdentityClient, error) NewImageClient() (osclients.ImageClient, error) diff --git a/kuttl-test.yaml b/kuttl-test.yaml index 67828d420..10cedb065 100644 --- a/kuttl-test.yaml +++ b/kuttl-test.yaml @@ -3,6 +3,7 @@ apiVersion: kuttl.dev/v1beta1 kind: TestSuite testDirs: - ./internal/controllers/domain/tests/ +- ./internal/controllers/endpoint/tests/ - ./internal/controllers/flavor/tests/ - ./internal/controllers/floatingip/tests/ - ./internal/controllers/group/tests/ diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpoint.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpoint.go index a099f728f..6c1f5e897 100644 --- a/pkg/clients/applyconfiguration/api/v1alpha1/endpoint.go +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpoint.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointfilter.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointfilter.go index 0908e2c55..fe33276e4 100644 --- a/pkg/clients/applyconfiguration/api/v1alpha1/endpointfilter.go +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointfilter.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. @@ -25,8 +25,8 @@ import ( // EndpointFilterApplyConfiguration represents a declarative configuration of the EndpointFilter type for use // with apply. type EndpointFilterApplyConfiguration struct { - ServiceRef *apiv1alpha1.KubernetesNameRef `json:"serviceRef,omitempty"` Interface *string `json:"interface,omitempty"` + ServiceRef *apiv1alpha1.KubernetesNameRef `json:"serviceRef,omitempty"` URL *string `json:"url,omitempty"` } @@ -36,14 +36,6 @@ func EndpointFilter() *EndpointFilterApplyConfiguration { return &EndpointFilterApplyConfiguration{} } -// WithServiceRef sets the ServiceRef field in the declarative configuration to the given value -// and returns the receiver, so that objects can be built by chaining "With" function invocations. -// If called multiple times, the ServiceRef field is set to the value of the last call. -func (b *EndpointFilterApplyConfiguration) WithServiceRef(value apiv1alpha1.KubernetesNameRef) *EndpointFilterApplyConfiguration { - b.ServiceRef = &value - return b -} - // WithInterface sets the Interface field in the declarative configuration to the given value // and returns the receiver, so that objects can be built by chaining "With" function invocations. // If called multiple times, the Interface field is set to the value of the last call. @@ -52,6 +44,14 @@ func (b *EndpointFilterApplyConfiguration) WithInterface(value string) *Endpoint return b } +// WithServiceRef sets the ServiceRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ServiceRef field is set to the value of the last call. +func (b *EndpointFilterApplyConfiguration) WithServiceRef(value apiv1alpha1.KubernetesNameRef) *EndpointFilterApplyConfiguration { + b.ServiceRef = &value + return b +} + // WithURL sets the URL field in the declarative configuration to the given value // and returns the receiver, so that objects can be built by chaining "With" function invocations. // If called multiple times, the URL field is set to the value of the last call. diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointimport.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointimport.go index e20a99cd7..8d6cae433 100644 --- a/pkg/clients/applyconfiguration/api/v1alpha1/endpointimport.go +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointimport.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcespec.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcespec.go index b9f157902..ff59ccce4 100644 --- a/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcespec.go +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcespec.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. @@ -25,11 +25,11 @@ import ( // EndpointResourceSpecApplyConfiguration represents a declarative configuration of the EndpointResourceSpec type for use // with apply. type EndpointResourceSpecApplyConfiguration struct { - Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` - Enabled *bool `json:"enabled,omitempty"` - Interface *string `json:"interface,omitempty"` - URL *string `json:"url,omitempty"` - ServiceRef *apiv1alpha1.KubernetesNameRef `json:"serviceRef,omitempty"` + Description *string `json:"description,omitempty"` + Enabled *bool `json:"enabled,omitempty"` + Interface *string `json:"interface,omitempty"` + URL *string `json:"url,omitempty"` + ServiceRef *apiv1alpha1.KubernetesNameRef `json:"serviceRef,omitempty"` } // EndpointResourceSpecApplyConfiguration constructs a declarative configuration of the EndpointResourceSpec type for use with @@ -38,11 +38,11 @@ func EndpointResourceSpec() *EndpointResourceSpecApplyConfiguration { return &EndpointResourceSpecApplyConfiguration{} } -// WithName sets the Name field in the declarative configuration to the given value +// WithDescription sets the Description field in the declarative configuration to the given value // and returns the receiver, so that objects can be built by chaining "With" function invocations. -// If called multiple times, the Name field is set to the value of the last call. -func (b *EndpointResourceSpecApplyConfiguration) WithName(value apiv1alpha1.OpenStackName) *EndpointResourceSpecApplyConfiguration { - b.Name = &value +// If called multiple times, the Description field is set to the value of the last call. +func (b *EndpointResourceSpecApplyConfiguration) WithDescription(value string) *EndpointResourceSpecApplyConfiguration { + b.Description = &value return b } diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcestatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcestatus.go index 8a0b7c87c..54a98b5a7 100644 --- a/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcestatus.go +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointresourcestatus.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. @@ -21,11 +21,11 @@ package v1alpha1 // EndpointResourceStatusApplyConfiguration represents a declarative configuration of the EndpointResourceStatus type for use // with apply. type EndpointResourceStatusApplyConfiguration struct { - Name *string `json:"name,omitempty"` - Enabled *bool `json:"enabled,omitempty"` - Interface *string `json:"interface,omitempty"` - URL *string `json:"url,omitempty"` - ServiceID *string `json:"serviceID,omitempty"` + Description *string `json:"description,omitempty"` + Enabled *bool `json:"enabled,omitempty"` + Interface *string `json:"interface,omitempty"` + URL *string `json:"url,omitempty"` + ServiceID *string `json:"serviceID,omitempty"` } // EndpointResourceStatusApplyConfiguration constructs a declarative configuration of the EndpointResourceStatus type for use with @@ -34,11 +34,11 @@ func EndpointResourceStatus() *EndpointResourceStatusApplyConfiguration { return &EndpointResourceStatusApplyConfiguration{} } -// WithName sets the Name field in the declarative configuration to the given value +// WithDescription sets the Description field in the declarative configuration to the given value // and returns the receiver, so that objects can be built by chaining "With" function invocations. -// If called multiple times, the Name field is set to the value of the last call. -func (b *EndpointResourceStatusApplyConfiguration) WithName(value string) *EndpointResourceStatusApplyConfiguration { - b.Name = &value +// If called multiple times, the Description field is set to the value of the last call. +func (b *EndpointResourceStatusApplyConfiguration) WithDescription(value string) *EndpointResourceStatusApplyConfiguration { + b.Description = &value return b } diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointspec.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointspec.go index fbe73d129..198237c30 100644 --- a/pkg/clients/applyconfiguration/api/v1alpha1/endpointspec.go +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointspec.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/endpointstatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/endpointstatus.go index ab14837ef..d620075a5 100644 --- a/pkg/clients/applyconfiguration/api/v1alpha1/endpointstatus.go +++ b/pkg/clients/applyconfiguration/api/v1alpha1/endpointstatus.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/pkg/clients/applyconfiguration/internal/internal.go b/pkg/clients/applyconfiguration/internal/internal.go index 2884d6d23..87e4f6e86 100644 --- a/pkg/clients/applyconfiguration/internal/internal.go +++ b/pkg/clients/applyconfiguration/internal/internal.go @@ -192,6 +192,121 @@ var schemaYAML = typed.YAMLObject(`types: - name: resource type: namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.DomainResourceStatus +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.Endpoint + map: + fields: + - name: apiVersion + type: + scalar: string + - name: kind + type: + scalar: string + - name: metadata + type: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.ObjectMeta + default: {} + - name: spec + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointSpec + default: {} + - name: status + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointStatus + default: {} +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointFilter + map: + fields: + - name: interface + type: + scalar: string + - name: serviceRef + type: + scalar: string + - name: url + type: + scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointImport + map: + fields: + - name: filter + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointFilter + - name: id + type: + scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointResourceSpec + map: + fields: + - name: description + type: + scalar: string + - name: enabled + type: + scalar: boolean + - name: interface + type: + scalar: string + - name: serviceRef + type: + scalar: string + - name: url + type: + scalar: string + default: "" +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointResourceStatus + map: + fields: + - name: description + type: + scalar: string + - name: enabled + type: + scalar: boolean + - name: interface + type: + scalar: string + - name: serviceID + type: + scalar: string + - name: url + type: + scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointSpec + map: + fields: + - name: cloudCredentialsRef + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.CloudCredentialsReference + default: {} + - name: import + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointImport + - name: managedOptions + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.ManagedOptions + - name: managementPolicy + type: + scalar: string + - name: resource + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointResourceSpec +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointStatus + map: + fields: + - name: conditions + type: + list: + elementType: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.Condition + elementRelationship: associative + keys: + - type + - name: id + type: + scalar: string + - name: resource + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.EndpointResourceStatus - name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.ExternalGateway map: fields: diff --git a/pkg/clients/applyconfiguration/utils.go b/pkg/clients/applyconfiguration/utils.go index 882509c7a..1b58223cf 100644 --- a/pkg/clients/applyconfiguration/utils.go +++ b/pkg/clients/applyconfiguration/utils.go @@ -58,6 +58,20 @@ func ForKind(kind schema.GroupVersionKind) interface{} { return &apiv1alpha1.DomainSpecApplyConfiguration{} case v1alpha1.SchemeGroupVersion.WithKind("DomainStatus"): return &apiv1alpha1.DomainStatusApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("Endpoint"): + return &apiv1alpha1.EndpointApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("EndpointFilter"): + return &apiv1alpha1.EndpointFilterApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("EndpointImport"): + return &apiv1alpha1.EndpointImportApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("EndpointResourceSpec"): + return &apiv1alpha1.EndpointResourceSpecApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("EndpointResourceStatus"): + return &apiv1alpha1.EndpointResourceStatusApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("EndpointSpec"): + return &apiv1alpha1.EndpointSpecApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("EndpointStatus"): + return &apiv1alpha1.EndpointStatusApplyConfiguration{} case v1alpha1.SchemeGroupVersion.WithKind("ExternalGateway"): return &apiv1alpha1.ExternalGatewayApplyConfiguration{} case v1alpha1.SchemeGroupVersion.WithKind("ExternalGatewayStatus"): diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go index 91ee2fdb4..7c2e4e67d 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go @@ -29,6 +29,7 @@ import ( type OpenstackV1alpha1Interface interface { RESTClient() rest.Interface DomainsGetter + EndpointsGetter FlavorsGetter FloatingIPsGetter GroupsGetter @@ -59,6 +60,10 @@ func (c *OpenstackV1alpha1Client) Domains(namespace string) DomainInterface { return newDomains(c, namespace) } +func (c *OpenstackV1alpha1Client) Endpoints(namespace string) EndpointInterface { + return newEndpoints(c, namespace) +} + func (c *OpenstackV1alpha1Client) Flavors(namespace string) FlavorInterface { return newFlavors(c, namespace) } diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/endpoint.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/endpoint.go index 8c0f3c58b..4eda9ea43 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/endpoint.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/endpoint.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go index 81e95d4c9..2b7ba89cc 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go @@ -32,6 +32,10 @@ func (c *FakeOpenstackV1alpha1) Domains(namespace string) v1alpha1.DomainInterfa return newFakeDomains(c, namespace) } +func (c *FakeOpenstackV1alpha1) Endpoints(namespace string) v1alpha1.EndpointInterface { + return newFakeEndpoints(c, namespace) +} + func (c *FakeOpenstackV1alpha1) Flavors(namespace string) v1alpha1.FlavorInterface { return newFakeFlavors(c, namespace) } diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_endpoint.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_endpoint.go index bc2842cde..ab36dca23 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_endpoint.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_endpoint.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go index ca41372ee..e34607a4b 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go @@ -20,6 +20,8 @@ package v1alpha1 type DomainExpansion interface{} +type EndpointExpansion interface{} + type FlavorExpansion interface{} type FloatingIPExpansion interface{} diff --git a/pkg/clients/informers/externalversions/api/v1alpha1/endpoint.go b/pkg/clients/informers/externalversions/api/v1alpha1/endpoint.go index 496b05405..7deada74f 100644 --- a/pkg/clients/informers/externalversions/api/v1alpha1/endpoint.go +++ b/pkg/clients/informers/externalversions/api/v1alpha1/endpoint.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/pkg/clients/informers/externalversions/api/v1alpha1/interface.go b/pkg/clients/informers/externalversions/api/v1alpha1/interface.go index 28e76d19c..c9f62ae9c 100644 --- a/pkg/clients/informers/externalversions/api/v1alpha1/interface.go +++ b/pkg/clients/informers/externalversions/api/v1alpha1/interface.go @@ -26,6 +26,8 @@ import ( type Interface interface { // Domains returns a DomainInformer. Domains() DomainInformer + // Endpoints returns a EndpointInformer. + Endpoints() EndpointInformer // Flavors returns a FlavorInformer. Flavors() FlavorInformer // FloatingIPs returns a FloatingIPInformer. @@ -82,6 +84,11 @@ func (v *version) Domains() DomainInformer { return &domainInformer{factory: v.factory, namespace: v.namespace, tweakListOptions: v.tweakListOptions} } +// Endpoints returns a EndpointInformer. +func (v *version) Endpoints() EndpointInformer { + return &endpointInformer{factory: v.factory, namespace: v.namespace, tweakListOptions: v.tweakListOptions} +} + // Flavors returns a FlavorInformer. func (v *version) Flavors() FlavorInformer { return &flavorInformer{factory: v.factory, namespace: v.namespace, tweakListOptions: v.tweakListOptions} diff --git a/pkg/clients/informers/externalversions/generic.go b/pkg/clients/informers/externalversions/generic.go index f83a355c4..a2cd276ae 100644 --- a/pkg/clients/informers/externalversions/generic.go +++ b/pkg/clients/informers/externalversions/generic.go @@ -55,6 +55,8 @@ func (f *sharedInformerFactory) ForResource(resource schema.GroupVersionResource // Group=openstack.k-orc.cloud, Version=v1alpha1 case v1alpha1.SchemeGroupVersion.WithResource("domains"): return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().Domains().Informer()}, nil + case v1alpha1.SchemeGroupVersion.WithResource("endpoints"): + return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().Endpoints().Informer()}, nil case v1alpha1.SchemeGroupVersion.WithResource("flavors"): return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().Flavors().Informer()}, nil case v1alpha1.SchemeGroupVersion.WithResource("floatingips"): diff --git a/pkg/clients/listers/api/v1alpha1/endpoint.go b/pkg/clients/listers/api/v1alpha1/endpoint.go index 427f09149..1d7599408 100644 --- a/pkg/clients/listers/api/v1alpha1/endpoint.go +++ b/pkg/clients/listers/api/v1alpha1/endpoint.go @@ -1,5 +1,5 @@ /* -Copyright 2025 The ORC Authors. +Copyright The ORC Authors. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. diff --git a/pkg/clients/listers/api/v1alpha1/expansion_generated.go b/pkg/clients/listers/api/v1alpha1/expansion_generated.go index 722c92a5b..e2fc3b2d2 100644 --- a/pkg/clients/listers/api/v1alpha1/expansion_generated.go +++ b/pkg/clients/listers/api/v1alpha1/expansion_generated.go @@ -26,6 +26,14 @@ type DomainListerExpansion interface{} // DomainNamespaceLister. type DomainNamespaceListerExpansion interface{} +// EndpointListerExpansion allows custom methods to be added to +// EndpointLister. +type EndpointListerExpansion interface{} + +// EndpointNamespaceListerExpansion allows custom methods to be added to +// EndpointNamespaceLister. +type EndpointNamespaceListerExpansion interface{} + // FlavorListerExpansion allows custom methods to be added to // FlavorLister. type FlavorListerExpansion interface{} diff --git a/website/docs/crd-reference.md b/website/docs/crd-reference.md index 2c2b9b8e8..10a106d0f 100644 --- a/website/docs/crd-reference.md +++ b/website/docs/crd-reference.md @@ -11,6 +11,7 @@ Package v1alpha1 contains API Schema definitions for the openstack v1alpha1 API ### Resource Types - [Domain](#domain) +- [Endpoint](#endpoint) - [Flavor](#flavor) - [FloatingIP](#floatingip) - [Group](#group) @@ -165,6 +166,7 @@ CloudCredentialsReference is a reference to a secret containing OpenStack creden _Appears in:_ - [DomainSpec](#domainspec) +- [EndpointSpec](#endpointspec) - [FlavorSpec](#flavorspec) - [FloatingIPSpec](#floatingipspec) - [GroupSpec](#groupspec) @@ -337,6 +339,142 @@ _Appears in:_ | `resource` _[DomainResourceStatus](#domainresourcestatus)_ | resource contains the observed state of the OpenStack resource. | | | +#### Endpoint + + + +Endpoint is the Schema for an ORC resource. + + + + + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `apiVersion` _string_ | `openstack.k-orc.cloud/v1alpha1` | | | +| `kind` _string_ | `Endpoint` | | | +| `metadata` _[ObjectMeta](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#objectmeta-v1-meta)_ | Refer to Kubernetes API documentation for fields of `metadata`. | | | +| `spec` _[EndpointSpec](#endpointspec)_ | spec specifies the desired state of the resource. | | | +| `status` _[EndpointStatus](#endpointstatus)_ | status defines the observed state of the resource. | | | + + +#### EndpointFilter + + + +EndpointFilter defines an existing resource by its properties + +_Validation:_ +- MinProperties: 1 + +_Appears in:_ +- [EndpointImport](#endpointimport) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `interface` _string_ | interface of the existing endpoint. | | Enum: [admin internal public]
| +| `serviceRef` _[KubernetesNameRef](#kubernetesnameref)_ | serviceRef is a reference to the ORC Service which this resource is associated with. | | MaxLength: 253
MinLength: 1
| +| `url` _string_ | url is the URL of the existing endpoint. | | MaxLength: 1024
| + + +#### EndpointImport + + + +EndpointImport specifies an existing resource which will be imported instead of +creating a new one + +_Validation:_ +- MaxProperties: 1 +- MinProperties: 1 + +_Appears in:_ +- [EndpointSpec](#endpointspec) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `id` _string_ | id contains the unique identifier of an existing OpenStack resource. Note
that when specifying an import by ID, the resource MUST already exist.
The ORC object will enter an error state if the resource does not exist. | | Format: uuid
MaxLength: 36
| +| `filter` _[EndpointFilter](#endpointfilter)_ | filter contains a resource query which is expected to return a single
result. The controller will continue to retry if filter returns no
results. If filter returns multiple results the controller will set an
error state and will not continue to retry. | | MinProperties: 1
| + + +#### EndpointResourceSpec + + + +EndpointResourceSpec contains the desired state of the resource. + + + +_Appears in:_ +- [EndpointSpec](#endpointspec) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `description` _string_ | description is a human-readable description for the resource. | | MaxLength: 255
MinLength: 1
| +| `enabled` _boolean_ | enabled indicates whether the endpoint is enabled or not. | true | | +| `interface` _string_ | interface indicates the visibility of the endpoint. | | Enum: [admin internal public]
| +| `url` _string_ | url is the endpoint URL. | | MaxLength: 1024
| +| `serviceRef` _[KubernetesNameRef](#kubernetesnameref)_ | serviceRef is a reference to the ORC Service which this resource is associated with. | | MaxLength: 253
MinLength: 1
| + + +#### EndpointResourceStatus + + + +EndpointResourceStatus represents the observed state of the resource. + + + +_Appears in:_ +- [EndpointStatus](#endpointstatus) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `description` _string_ | description is a human-readable description for the resource. | | MaxLength: 255
MinLength: 1
| +| `enabled` _boolean_ | enabled indicates whether the endpoint is enabled or not. | | | +| `interface` _string_ | interface indicates the visibility of the endpoint. | | MaxLength: 128
| +| `url` _string_ | url is the endpoint URL. | | MaxLength: 1024
| +| `serviceID` _string_ | serviceID is the ID of the Service to which the resource is associated. | | MaxLength: 1024
| + + +#### EndpointSpec + + + +EndpointSpec defines the desired state of an ORC object. + + + +_Appears in:_ +- [Endpoint](#endpoint) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `import` _[EndpointImport](#endpointimport)_ | import refers to an existing OpenStack resource which will be imported instead of
creating a new one. | | MaxProperties: 1
MinProperties: 1
| +| `resource` _[EndpointResourceSpec](#endpointresourcespec)_ | resource specifies the desired state of the resource.
resource may not be specified if the management policy is `unmanaged`.
resource must be specified if the management policy is `managed`. | | | +| `managementPolicy` _[ManagementPolicy](#managementpolicy)_ | managementPolicy defines how ORC will treat the object. Valid values are
`managed`: ORC will create, update, and delete the resource; `unmanaged`:
ORC will import an existing resource, and will not apply updates to it or
delete it. | managed | Enum: [managed unmanaged]
| +| `managedOptions` _[ManagedOptions](#managedoptions)_ | managedOptions specifies options which may be applied to managed objects. | | | +| `cloudCredentialsRef` _[CloudCredentialsReference](#cloudcredentialsreference)_ | cloudCredentialsRef points to a secret containing OpenStack credentials | | | + + +#### EndpointStatus + + + +EndpointStatus defines the observed state of an ORC resource. + + + +_Appears in:_ +- [Endpoint](#endpoint) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `conditions` _[Condition](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#condition-v1-meta) array_ | conditions represents the observed status of the object.
Known .status.conditions.type are: "Available", "Progressing"
Available represents the availability of the OpenStack resource. If it is
true then the resource is ready for use.
Progressing indicates whether the controller is still attempting to
reconcile the current state of the OpenStack resource to the desired
state. Progressing will be False either because the desired state has
been achieved, or because some terminal error prevents it from ever being
achieved and the controller is no longer attempting to reconcile. If
Progressing is True, an observer waiting on the resource should continue
to wait. | | MaxItems: 32
| +| `id` _string_ | id is the unique identifier of the OpenStack resource. | | MaxLength: 1024
| +| `resource` _[EndpointResourceStatus](#endpointresourcestatus)_ | resource contains the observed state of the OpenStack resource. | | | + + #### Ethertype _Underlying type:_ _string_ @@ -1634,6 +1772,8 @@ _Validation:_ _Appears in:_ - [Address](#address) +- [EndpointFilter](#endpointfilter) +- [EndpointResourceSpec](#endpointresourcespec) - [ExternalGateway](#externalgateway) - [FloatingIPFilter](#floatingipfilter) - [FloatingIPResourceSpec](#floatingipresourcespec) @@ -1704,6 +1844,7 @@ _Appears in:_ _Appears in:_ - [DomainSpec](#domainspec) +- [EndpointSpec](#endpointspec) - [FlavorSpec](#flavorspec) - [FloatingIPSpec](#floatingipspec) - [GroupSpec](#groupspec) @@ -1739,6 +1880,7 @@ _Validation:_ _Appears in:_ - [DomainSpec](#domainspec) +- [EndpointSpec](#endpointspec) - [FlavorSpec](#flavorspec) - [FloatingIPSpec](#floatingipspec) - [GroupSpec](#groupspec)