From 02c09a25210eb543d27cc64e4fccae412a51ddd7 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Mon, 24 Nov 2025 18:23:21 -0800 Subject: [PATCH 01/30] work but slow --- Cargo.lock | 9 - Cargo.toml | 26 +-- python/egglog/builtins.py | 6 + python/egglog/egraph_state.py | 19 +-- python/egglog/exp/polynomials.py | 275 +++++++++++++++++++++++++++++++ 5 files changed, 301 insertions(+), 34 deletions(-) create mode 100644 python/egglog/exp/polynomials.py diff --git a/Cargo.lock b/Cargo.lock index 90841891..8c93e722 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -317,7 +317,6 @@ checksum = "d0881ea181b1df73ff77ffaaf9c7544ecc11e82fba9b5f27b262a3c73a332555" [[package]] name = "egglog" version = "1.0.0" -source = "git+https://github.com/saulshanabrook/egg-smol.git?branch=fix-fn-bug#fdc03716d3acc47d603a9797bb50330025db0269" dependencies = [ "csv", "dyn-clone", @@ -344,7 +343,6 @@ dependencies = [ [[package]] name = "egglog-add-primitive" version = "1.0.0" -source = "git+https://github.com/saulshanabrook/egg-smol.git?branch=fix-fn-bug#fdc03716d3acc47d603a9797bb50330025db0269" dependencies = [ "quote", "syn 2.0.107", @@ -353,7 +351,6 @@ dependencies = [ [[package]] name = "egglog-ast" version = "1.0.0" -source = "git+https://github.com/saulshanabrook/egg-smol.git?branch=fix-fn-bug#fdc03716d3acc47d603a9797bb50330025db0269" dependencies = [ "ordered-float", ] @@ -361,7 +358,6 @@ dependencies = [ [[package]] name = "egglog-bridge" version = "1.0.0" -source = "git+https://github.com/saulshanabrook/egg-smol.git?branch=fix-fn-bug#fdc03716d3acc47d603a9797bb50330025db0269" dependencies = [ "anyhow", "dyn-clone", @@ -385,7 +381,6 @@ dependencies = [ [[package]] name = "egglog-concurrency" version = "1.0.0" -source = "git+https://github.com/saulshanabrook/egg-smol.git?branch=fix-fn-bug#fdc03716d3acc47d603a9797bb50330025db0269" dependencies = [ "arc-swap", "rayon", @@ -394,7 +389,6 @@ dependencies = [ [[package]] name = "egglog-core-relations" version = "1.0.0" -source = "git+https://github.com/saulshanabrook/egg-smol.git?branch=fix-fn-bug#fdc03716d3acc47d603a9797bb50330025db0269" dependencies = [ "anyhow", "bumpalo", @@ -437,7 +431,6 @@ dependencies = [ [[package]] name = "egglog-numeric-id" version = "1.0.0" -source = "git+https://github.com/saulshanabrook/egg-smol.git?branch=fix-fn-bug#fdc03716d3acc47d603a9797bb50330025db0269" dependencies = [ "rayon", ] @@ -445,7 +438,6 @@ dependencies = [ [[package]] name = "egglog-reports" version = "1.0.0" -source = "git+https://github.com/saulshanabrook/egg-smol.git?branch=fix-fn-bug#fdc03716d3acc47d603a9797bb50330025db0269" dependencies = [ "clap", "hashbrown 0.16.0", @@ -459,7 +451,6 @@ dependencies = [ [[package]] name = "egglog-union-find" version = "1.0.0" -source = "git+https://github.com/saulshanabrook/egg-smol.git?branch=fix-fn-bug#fdc03716d3acc47d603a9797bb50330025db0269" dependencies = [ "crossbeam", "egglog-concurrency", diff --git a/Cargo.toml b/Cargo.toml index 4d468878..3b8eacd5 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -13,12 +13,12 @@ crate-type = ["cdylib"] pyo3 = { version = "0.27", features = ["extension-module", "num-bigint", "num-rational"] } num-bigint = "*" num-rational = "*" -egglog = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug", default-features = false } -egglog-bridge = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } -egglog-core-relations = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } +egglog = { path = "../egg-smol", default-features = false } +egglog-bridge = { path = "../egg-smol/egglog-bridge" } +egglog-core-relations = { path = "../egg-smol/core-relations" } egglog-experimental = { git = "https://github.com/egraphs-good/egglog-experimental", branch = "main", default-features = false } -egglog-ast = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } -egglog-reports = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } +egglog-ast = { path = "../egg-smol/egglog-ast" } +egglog-reports = { path = "../egg-smol/egglog-reports" } egraph-serialize = { version = "0.3", features = ["serde", "graphviz"] } serde_json = "1" pyo3-log = "*" @@ -31,11 +31,17 @@ base64 = "0.22.1" # Use patched version of egglog in experimental [patch.'https://github.com/egraphs-good/egglog'] -egglog = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } -egglog-ast = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } -egglog-core-relations = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } -egglog-bridge = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } -egglog-reports = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } +egglog = { path = "../egg-smol" } +egglog-core-relations = { path = "../egg-smol/core-relations" } +egglog-ast = { path = "../egg-smol/egglog-ast" } +egglog-reports = { path = "../egg-smol/egglog-reports" } +egglog-bridge = { path = "../egg-smol/egglog-bridge" } + +# egglog = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } +# egglog-ast = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } +# egglog-core-relations = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } +# egglog-bridge = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } +# egglog-reports = { git = "https://github.com/saulshanabrook/egg-smol.git", branch = "fix-fn-bug" } # enable debug symbols for easier profiling [profile.release] diff --git a/python/egglog/builtins.py b/python/egglog/builtins.py index a9c75f69..c13bd34d 100644 --- a/python/egglog/builtins.py +++ b/python/egglog/builtins.py @@ -583,6 +583,12 @@ def __add__(self, other: MultiSet[T]) -> MultiSet[T]: ... @method(egg_fn="unstable-multiset-map", reverse_args=True) def map(self, f: Callable[[T], T]) -> MultiSet[T]: ... + @method(egg_fn="unstable-multiset-fill-index") + def fill_index(self, f: Callable[[MultiSet[T], T], i64]) -> Unit: ... + + @method(egg_fn="unstable-multiset-clear-index") + def clear_index(self, f: Callable[[MultiSet[T], T], i64]) -> Unit: ... + converter( tuple, diff --git a/python/egglog/egraph_state.py b/python/egglog/egraph_state.py index c82e38ff..a1284914 100644 --- a/python/egglog/egraph_state.py +++ b/python/egglog/egraph_state.py @@ -449,9 +449,10 @@ def _signature_to_egg_schema(self, signature: FunctionSignature) -> bindings.Sch self.type_ref_to_egg(signature.semantic_return_type.to_just()), ) - def type_ref_to_egg(self, ref: JustTypeRef) -> str: # noqa: C901, PLR0912 + def type_ref_to_egg(self, ref: JustTypeRef) -> str: """ - Returns the egg sort name for a type reference, registering it if it is not already registered. + Returns the egg sort name for a type reference, registering it not already registered, and also recursively + any type args are registered. """ try: return self.type_ref_to_egg_sort[ref] @@ -476,18 +477,6 @@ def type_ref_to_egg(self, ref: JustTypeRef) -> str: # noqa: C901, PLR0912 bindings.Var(span(), self.type_ref_to_egg(ref.args[0])), ] else: - # If any of methods have another type ref in them process all those first with substituted vars - # so that things like multiset - mapp will be added. Function type must be added first. - # Find all args of all methods and find any with type args themselves that are not this type and add them - tcs = TypeConstraintSolver(self.__egg_decls__) - tcs.bind_class(ref) - for method in decl.methods.values(): - if not isinstance((signature := method.signature), FunctionSignature): - continue - for arg_tp in signature.arg_types: - if isinstance(arg_tp, TypeRefWithVars) and arg_tp.args and arg_tp.ident != ref.ident: - self.type_ref_to_egg(tcs.substitute_typevars(arg_tp, ref.ident)) - type_args = [bindings.Var(span(), self.type_ref_to_egg(a)) for a in ref.args] args = (self.type_ref_to_egg(JustTypeRef(ref.ident)), type_args) else: @@ -964,7 +953,7 @@ def from_call( args, # Don't include bound type params if this is just a method, we only needed them for type resolution # but dont need to store them - bound_tp_params if isinstance(callable_ref, ClassMethodRef | InitRef) else (), + bound_tp_params if isinstance(callable_ref, ClassMethodRef | InitRef) and not args else (), ) raise ValueError( f"Could not find callable ref for call {term}. None of these refs matched the types: {self.state.egg_fn_to_callable_refs[term.name]}" diff --git a/python/egglog/exp/polynomials.py b/python/egglog/exp/polynomials.py new file mode 100644 index 00000000..5363d6d8 --- /dev/null +++ b/python/egglog/exp/polynomials.py @@ -0,0 +1,275 @@ +# mypy: disable-error-code="empty-body" +from __future__ import annotations + +from typing import TypeAlias + +from egglog import * + + +class Number(Expr): + def __init__(self, value: i64Like) -> None: ... + def __add__(self, other: NumberLike) -> Number: ... + def __radd__(self, other: NumberLike) -> Number: ... + def __sub__(self, other: NumberLike) -> Number: ... + def __rsub__(self, other: NumberLike) -> Number: ... + def __mul__(self, other: NumberLike) -> Number: ... + def __rmul__(self, other: NumberLike) -> Number: ... + def __truediv__(self, other: NumberLike) -> Number: ... + def __rtruediv__(self, other: NumberLike) -> Number: ... + def __pow__(self, power: NumberLike) -> Number: ... + def __neg__(self) -> Number: ... + + +NumberLike: TypeAlias = Number | i64Like +converter(i64, Number, Number) + +bpp1 = constant("bpp1", Number) +bpp2 = constant("bpp2", Number) +bpp3 = constant("bpp3", Number) +bpp4 = constant("bpp4", Number) +bp1 = constant("bp1", Number) +bp2 = constant("bp2", Number) +bp3 = constant("bp3", Number) +bp4 = constant("bp4", Number) +q1 = constant("q1", Number) +q2 = constant("q2", Number) +q3 = constant("q3", Number) +q4 = constant("q4", Number) +q5 = constant("q5", Number) +q6 = constant("q6", Number) +q7 = constant("q7", Number) +q8 = constant("q8", Number) +q9 = constant("q9", Number) +q10 = constant("q10", Number) +q11 = constant("q11", Number) +q12 = constant("q12", Number) + +res = ( + ( + -bp4 * bpp1 * q1 * q11 + + bp1 * bpp4 * q1 * q11 + + bp4 * bpp1 * q10 * q2 + - bp1 * bpp4 * q10 * q2 + - bp4 * bpp2 * q11 * q4 + + bp2 * bpp4 * q11 * q4 + + bp2 * bpp1 * q2 * q4 + - bp1 * bpp2 * q2 * q4 + - bp2 * bpp1 * q1 * q5 + + bp1 * bpp2 * q1 * q5 + + bp4 * bpp2 * q10 * q5 + - bp2 * bpp4 * q10 * q5 + - bp4 * bpp3 * q11 * q7 + + bp3 * bpp4 * q11 * q7 + + bp3 * bpp1 * q2 * q7 + - bp1 * bpp3 * q2 * q7 + + bp3 * bpp2 * q5 * q7 + - bp2 * bpp3 * q5 * q7 + - bp3 * bpp1 * q1 * q8 + + bp1 * bpp3 * q1 * q8 + + bp4 * bpp3 * q10 * q8 + - bp3 * bpp4 * q10 * q8 + - bp3 * bpp2 * q4 * q8 + + bp2 * bpp3 * q4 * q8 + ) + ** 2 + + ( + bp4 * bpp1 * q1 * q12 + - bp1 * bpp4 * q1 * q12 + - bp4 * bpp1 * q10 * q3 + + bp1 * bpp4 * q10 * q3 + + bp4 * bpp2 * q12 * q4 + - bp2 * bpp4 * q12 * q4 + - bp2 * bpp1 * q3 * q4 + + bp1 * bpp2 * q3 * q4 + + bp2 * bpp1 * q1 * q6 + - bp1 * bpp2 * q1 * q6 + - bp4 * bpp2 * q10 * q6 + + bp2 * bpp4 * q10 * q6 + + bp4 * bpp3 * q12 * q7 + - bp3 * bpp4 * q12 * q7 + - bp3 * bpp1 * q3 * q7 + + bp1 * bpp3 * q3 * q7 + - bp3 * bpp2 * q6 * q7 + + bp2 * bpp3 * q6 * q7 + + bp3 * bpp1 * q1 * q9 + - bp1 * bpp3 * q1 * q9 + - bp4 * bpp3 * q10 * q9 + + bp3 * bpp4 * q10 * q9 + + bp3 * bpp2 * q4 * q9 + - bp2 * bpp3 * q4 * q9 + ) + ** 2 + + ( + -bp4 * bpp1 * q12 * q2 + + bp1 * bpp4 * q12 * q2 + + bp4 * bpp1 * q11 * q3 + - bp1 * bpp4 * q11 * q3 + - bp4 * bpp2 * q12 * q5 + + bp2 * bpp4 * q12 * q5 + + bp2 * bpp1 * q3 * q5 + - bp1 * bpp2 * q3 * q5 + + bp4 * bpp2 * q11 * q6 + - bp2 * bpp4 * q11 * q6 + - bp2 * bpp1 * q2 * q6 + + bp1 * bpp2 * q2 * q6 + - bp4 * bpp3 * q12 * q8 + + bp3 * bpp4 * q12 * q8 + + bp3 * bpp1 * q3 * q8 + - bp1 * bpp3 * q3 * q8 + + bp3 * bpp2 * q6 * q8 + - bp2 * bpp3 * q6 * q8 + + bp4 * bpp3 * q11 * q9 + - bp3 * bpp4 * q11 * q9 + - bp3 * bpp1 * q2 * q9 + + bp1 * bpp3 * q2 * q9 + - bp3 * bpp2 * q5 * q9 + + bp2 * bpp3 * q5 * q9 + ) + ** 2 +) / ( + (bp1 * q1 + bp4 * q10 + bp2 * q4 + bp3 * q7) ** 2 + + (bp4 * q11 + bp1 * q2 + bp2 * q5 + bp3 * q8) ** 2 + + (bp4 * q12 + bp1 * q3 + bp2 * q6 + bp3 * q9) ** 2 +) ** 3 +# print(res) + + +# 1. Convert to polynomial(MultiSet[MultiSet[Number]]) + +MultiSet[MultiSet[Number]] + + +n1 = constant("n1", Number) +n2 = constant("n2", Number) +n3 = constant("n3", Number) + + +@function +def monomial(x: MultiSetLike[Number, NumberLike]) -> Number: ... + + +@function +def polynomial(x: MultiSetLike[MultiSet[Number], MultiSetLike[Number, NumberLike]]) -> Number: ... + + +@function(merge=i64.__add__) +def ms_index(xs: MultiSet[Number], x: Number) -> i64: ... + + +@function(merge=i64.__add__) +def mss_index(xss: MultiSet[MultiSet[Number]], xs: MultiSet[Number]) -> i64: ... + + +@ruleset +def to_polynomial( + n1: Number, + n2: Number, + n3: Number, + ms: MultiSet[Number], + ms1: MultiSet[Number], + ms2: MultiSet[Number], + mss: MultiSet[MultiSet[Number]], + mss1: MultiSet[MultiSet[Number]], + mss2: MultiSet[MultiSet[Number]], +): + yield rule( + n3 == n1 - n2, + name="subtract", + ).then( + union(n3).with_(polynomial(MultiSet(MultiSet(n1), MultiSet(n2, Number(-1))))), + subsume(n1 - n2), + MultiSet(n1).fill_index(ms_index), + MultiSet(n2, Number(-1)).fill_index(ms_index), + MultiSet(MultiSet(n1), MultiSet(n2, Number(-1))).fill_index(mss_index), + ) + yield rule( + n3 == n1 + n2, + name="add", + ).then( + union(n3).with_(polynomial(MultiSet(MultiSet(n1), MultiSet(n2)))), + subsume(n1 + n2), + MultiSet(MultiSet(n1), MultiSet(n2)).fill_index(mss_index), + MultiSet(n1).fill_index(ms_index), + MultiSet(n2).fill_index(ms_index), + ) + yield rule( + n3 == n1 * n2, + name="mul", + ).then( + union(n3).with_(monomial(MultiSet(n1, n2))), + subsume(n1 * n2), + monomial(MultiSet(n1, n2)), + MultiSet(n1, n2).fill_index(ms_index), + ) + yield rule( + n1 == polynomial(mss), + mss_index(mss, ms), + ms_index(ms, monomial(ms1)), + ms2 == ms.remove(monomial(ms1)) + ms1, + mss1 == mss.remove(ms).insert(ms2), + name="unwrap monomial", + ).then( + union(n1).with_(polynomial(mss1)), + subsume(polynomial(mss)), + mss.clear_index(mss_index), + # ms.clear_index(ms_index), + ms2.fill_index(ms_index), + mss1.fill_index(mss_index), + ) + # If polynomial inside polynomial, unwrap + yield rule( + n1 == polynomial(mss), + mss_index(mss, ms), + ms_index(ms, polynomial(mss1)), + ms2 == ms.remove(polynomial(mss1)), + mss2 == mss.remove(ms).insert(ms2) + mss1, + name="unwrap polynomial", + ).then( + union(n1).with_(polynomial(mss2)), + subsume(polynomial(mss)), + mss.clear_index(mss_index), + # ms.clear_index(ms_index), + ms2.fill_index(ms_index), + mss2.fill_index(mss_index), + ) + + +# _MultiSet_1 = MultiSet[Number]() +# res = polynomial( +# MultiSet(_MultiSet_1, MultiSet(-bp4, bpp1, q12, q2), MultiSet(bp1, bpp4, q12, q2), MultiSet(bp4, bpp1, q11, q3)) +# ) - monomial(MultiSet(q3, monomial(MultiSet(q11, monomial(MultiSet(bp1, bpp4)))))) + +res = ( + -bp4 * bpp1 * q12 * q2 + bp1 * bpp4 * q12 * q2 + bp4 * bpp1 * q11 * q3 + # - bp1 * bpp4 * q11 * q3 + # - bp4 * bpp2 * q12 * q5 + # + bp2 * bpp4 * q12 * q5 + # + bp2 * bpp1 * q3 * q5 + # - bp1 * bpp2 * q3 * q5 + # + bp4 * bpp2 * q11 * q6 + # - bp2 * bpp4 * q11 * q6 + # - bp2 * bpp1 * q2 * q6 + # + bp1 * bpp2 * q2 * q6 + # - bp4 * bpp3 * q12 * q8 + # + bp3 * bpp4 * q12 * q8 + # + bp3 * bpp1 * q3 * q8 + # - bp1 * bpp3 * q3 * q8 + # + bp3 * bpp2 * q6 * q8 + # - bp2 * bpp3 * q6 * q8 + # + bp4 * bpp3 * q11 * q9 + # - bp3 * bpp4 * q11 * q9 + # - bp3 * bpp1 * q2 * q9 + # + bp1 * bpp3 * q2 * q9 + # - bp3 * bpp2 * q5 * q9 + # + bp2 * bpp3 * q5 * q9 +) +egraph = EGraph() +print("Registering") +egraph.register(res) +print("Running") +print(egraph.run(to_polynomial.saturate())) +print("Extracting") +# egraph.display(n_inline_leaves=1) +finished = egraph.extract(res) +print("printing") +print(finished) From 8fd7bbc9dcfbbe92ceb063d2edda548c7ec0336d Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Mon, 24 Nov 2025 19:56:19 -0800 Subject: [PATCH 02/30] Got working quickly! Added flat map and dummy value to infer things properly --- python/egglog/builtins.py | 6 ++ python/egglog/conversion.py | 4 +- python/egglog/declarations.py | 16 +++- python/egglog/egraph.py | 2 + python/egglog/egraph_state.py | 3 + python/egglog/exp/polynomials.py | 118 ++++++++++++++---------- python/egglog/pretty.py | 4 + python/egglog/runtime.py | 17 +++- python/egglog/type_constraint_solver.py | 2 +- 9 files changed, 114 insertions(+), 58 deletions(-) diff --git a/python/egglog/builtins.py b/python/egglog/builtins.py index c13bd34d..a54f93fe 100644 --- a/python/egglog/builtins.py +++ b/python/egglog/builtins.py @@ -56,6 +56,7 @@ "i64", "i64Like", "join", + "multiset_flat_map", "py_eval", "py_eval_fn", "py_exec", @@ -590,6 +591,11 @@ def fill_index(self, f: Callable[[MultiSet[T], T], i64]) -> Unit: ... def clear_index(self, f: Callable[[MultiSet[T], T], i64]) -> Unit: ... +# TODO: Move to method when partial suppors reverse_args +@function(egg_fn="unstable-multiset-flat-map", builtin=True) +def multiset_flat_map(f: Callable[[T], MultiSet[T]], xs: MultiSet[T]) -> MultiSet[T]: ... + + converter( tuple, MultiSet, diff --git a/python/egglog/conversion.py b/python/egglog/conversion.py index 3690df1b..88f70f0b 100644 --- a/python/egglog/conversion.py +++ b/python/egglog/conversion.py @@ -243,7 +243,7 @@ def resolve_literal( tp_just = tcs.substitute_typevars(tp, cls_ident) # If we can't resolve the type var yet, then just assume it is the right value except TypeConstraintError: - assert isinstance(arg, RuntimeExpr), f"Expected a runtime expression, got {arg}" + assert isinstance(arg, RuntimeExpr), f"Expected a runtime expression, got {type(arg)}" tp_just = arg.__egg_typed_expr__.tp else: # If this is a var, it has to be a runtime expession @@ -255,6 +255,8 @@ def resolve_literal( # If the type is an egg type, it has to be a runtime expr assert isinstance(arg, RuntimeExpr) return arg + if arg is DUMMY_VALUE: + return RuntimeExpr.__from_values__(decls(), TypedExprDecl(tp_just, DummyDecl())) if (conversion := _lookup_conversion(arg_type, tp_just)) is not None: with with_type_args(tp_just.args, decls): return conversion[1](arg) diff --git a/python/egglog/declarations.py b/python/egglog/declarations.py index e2ffa08f..a7e62392 100644 --- a/python/egglog/declarations.py +++ b/python/egglog/declarations.py @@ -53,6 +53,7 @@ "DeclerationsLike", "DefaultRewriteDecl", "DelayedDeclerations", + "DummyDecl", "EqDecl", "ExprActionDecl", "ExprDecl", @@ -620,6 +621,11 @@ class UnboundVarDecl: egg_name: str | None = None +@dataclass(frozen=True) +class DummyDecl: + pass + + @dataclass(frozen=True) class LetRefDecl: name: str @@ -729,7 +735,15 @@ class ValueDecl: ExprDecl: TypeAlias = ( - UnboundVarDecl | LetRefDecl | LitDecl | CallDecl | PyObjectDecl | PartialCallDecl | ValueDecl | GetCostDecl + DummyDecl + | UnboundVarDecl + | LetRefDecl + | LitDecl + | CallDecl + | PyObjectDecl + | PartialCallDecl + | ValueDecl + | GetCostDecl ) diff --git a/python/egglog/egraph.py b/python/egglog/egraph.py index ed9b69ba..fa5cceb4 100644 --- a/python/egglog/egraph.py +++ b/python/egglog/egraph.py @@ -660,6 +660,8 @@ def _fn_decl( doc=doc, ) decls.set_function_decl(ref, decl) + if is_builtin: + return lambda: None return Thunk.fn( _add_default_rewrite_function, decls, diff --git a/python/egglog/egraph_state.py b/python/egglog/egraph_state.py index a1284914..b720f038 100644 --- a/python/egglog/egraph_state.py +++ b/python/egglog/egraph_state.py @@ -606,6 +606,9 @@ def _expr_to_egg(self, expr_decl: ExprDecl) -> bindings._Expr: # noqa: PLR0912, case ValueDecl(): msg = "Cannot turn a Value into an expression" raise ValueError(msg) + case DummyDecl(): + msg = "Cannot turn a DummyDecl into an expression" + raise ValueError(msg) case _: assert_never(expr_decl.expr) self.expr_to_egg_cache[expr_decl] = res diff --git a/python/egglog/exp/polynomials.py b/python/egglog/exp/polynomials.py index 5363d6d8..8771ef73 100644 --- a/python/egglog/exp/polynomials.py +++ b/python/egglog/exp/polynomials.py @@ -1,6 +1,7 @@ # mypy: disable-error-code="empty-body" from __future__ import annotations +from functools import partial from typing import TypeAlias from egglog import * @@ -148,6 +149,24 @@ def __neg__(self) -> Number: ... def monomial(x: MultiSetLike[Number, NumberLike]) -> Number: ... +@function(merge=lambda old, new: new) +def get_monomial(x: Number) -> MultiSet[Number]: + """ + Only defined on monomials: + + get_monomial(monomial(xs)) => xs + """ + + +@function(merge=lambda old, new: new) +def get_sole_polynomial(xs: MultiSet[Number]) -> MultiSet[MultiSet[Number]]: + """ + Only defined on monomials that contain a single polynomial: + + get_sole_polynomial(MultiSet(polynomial(xs))) => xs + """ + + @function def polynomial(x: MultiSetLike[MultiSet[Number], MultiSetLike[Number, NumberLike]]) -> Number: ... @@ -177,60 +196,57 @@ def to_polynomial( name="subtract", ).then( union(n3).with_(polynomial(MultiSet(MultiSet(n1), MultiSet(n2, Number(-1))))), + set_(get_sole_polynomial(MultiSet(n3))).to(MultiSet(MultiSet(n1), MultiSet(n2, Number(-1)))), subsume(n1 - n2), - MultiSet(n1).fill_index(ms_index), - MultiSet(n2, Number(-1)).fill_index(ms_index), - MultiSet(MultiSet(n1), MultiSet(n2, Number(-1))).fill_index(mss_index), + # MultiSet(n1).fill_index(ms_index), + # MultiSet(n2, Number(-1)).fill_index(ms_index), + # MultiSet(MultiSet(n1), MultiSet(n2, Number(-1))).fill_index(mss_index), ) yield rule( n3 == n1 + n2, name="add", ).then( union(n3).with_(polynomial(MultiSet(MultiSet(n1), MultiSet(n2)))), + set_(get_sole_polynomial(MultiSet(n3))).to(MultiSet(MultiSet(n1), MultiSet(n2))), subsume(n1 + n2), - MultiSet(MultiSet(n1), MultiSet(n2)).fill_index(mss_index), - MultiSet(n1).fill_index(ms_index), - MultiSet(n2).fill_index(ms_index), + # MultiSet(MultiSet(n1), MultiSet(n2)).fill_index(mss_index), + # MultiSet(n1).fill_index(ms_index), + # MultiSet(n2).fill_index(ms_index), ) yield rule( n3 == n1 * n2, name="mul", ).then( union(n3).with_(monomial(MultiSet(n1, n2))), + set_(get_monomial(n3)).to(MultiSet(n1, n2)), subsume(n1 * n2), - monomial(MultiSet(n1, n2)), - MultiSet(n1, n2).fill_index(ms_index), + # MultiSet(n1, n2).fill_index(ms_index), ) yield rule( n1 == polynomial(mss), - mss_index(mss, ms), - ms_index(ms, monomial(ms1)), - ms2 == ms.remove(monomial(ms1)) + ms1, - mss1 == mss.remove(ms).insert(ms2), + mss1 == mss.map(partial(multiset_flat_map, UnstableFn(get_monomial))), + mss != mss1, name="unwrap monomial", ).then( union(n1).with_(polynomial(mss1)), subsume(polynomial(mss)), - mss.clear_index(mss_index), - # ms.clear_index(ms_index), - ms2.fill_index(ms_index), - mss1.fill_index(mss_index), + set_(get_sole_polynomial(MultiSet(n1))).to(mss1), + # mss.clear_index(mss_index), + # mss1.fill_index(mss_index), ) - # If polynomial inside polynomial, unwrap yield rule( n1 == polynomial(mss), - mss_index(mss, ms), - ms_index(ms, polynomial(mss1)), - ms2 == ms.remove(polynomial(mss1)), - mss2 == mss.remove(ms).insert(ms2) + mss1, + mss1 == multiset_flat_map(UnstableFn(get_sole_polynomial), mss), + mss != mss1, name="unwrap polynomial", ).then( - union(n1).with_(polynomial(mss2)), + union(n1).with_(polynomial(mss1)), subsume(polynomial(mss)), - mss.clear_index(mss_index), + set_(get_sole_polynomial(MultiSet(n1))).to(mss1), + # mss.clear_index(mss_index), # ms.clear_index(ms_index), - ms2.fill_index(ms_index), - mss2.fill_index(mss_index), + # ms2.fill_index(ms_index), + # mss2.fill_index(mss_index), ) @@ -239,35 +255,37 @@ def to_polynomial( # MultiSet(_MultiSet_1, MultiSet(-bp4, bpp1, q12, q2), MultiSet(bp1, bpp4, q12, q2), MultiSet(bp4, bpp1, q11, q3)) # ) - monomial(MultiSet(q3, monomial(MultiSet(q11, monomial(MultiSet(bp1, bpp4)))))) -res = ( - -bp4 * bpp1 * q12 * q2 + bp1 * bpp4 * q12 * q2 + bp4 * bpp1 * q11 * q3 - # - bp1 * bpp4 * q11 * q3 - # - bp4 * bpp2 * q12 * q5 - # + bp2 * bpp4 * q12 * q5 - # + bp2 * bpp1 * q3 * q5 - # - bp1 * bpp2 * q3 * q5 - # + bp4 * bpp2 * q11 * q6 - # - bp2 * bpp4 * q11 * q6 - # - bp2 * bpp1 * q2 * q6 - # + bp1 * bpp2 * q2 * q6 - # - bp4 * bpp3 * q12 * q8 - # + bp3 * bpp4 * q12 * q8 - # + bp3 * bpp1 * q3 * q8 - # - bp1 * bpp3 * q3 * q8 - # + bp3 * bpp2 * q6 * q8 - # - bp2 * bpp3 * q6 * q8 - # + bp4 * bpp3 * q11 * q9 - # - bp3 * bpp4 * q11 * q9 - # - bp3 * bpp1 * q2 * q9 - # + bp1 * bpp3 * q2 * q9 - # - bp3 * bpp2 * q5 * q9 - # + bp2 * bpp3 * q5 * q9 -) +# res = ( +# -bp4 * bpp1 * q12 * q2 +# + bp1 * bpp4 * q12 * q2 +# + bp4 * bpp1 * q11 * q3 +# - bp1 * bpp4 * q11 * q3 +# - bp4 * bpp2 * q12 * q5 +# + bp2 * bpp4 * q12 * q5 +# + bp2 * bpp1 * q3 * q5 +# - bp1 * bpp2 * q3 * q5 +# + bp4 * bpp2 * q11 * q6 +# - bp2 * bpp4 * q11 * q6 +# - bp2 * bpp1 * q2 * q6 +# + bp1 * bpp2 * q2 * q6 +# - bp4 * bpp3 * q12 * q8 +# + bp3 * bpp4 * q12 * q8 +# + bp3 * bpp1 * q3 * q8 +# - bp1 * bpp3 * q3 * q8 +# + bp3 * bpp2 * q6 * q8 +# - bp2 * bpp3 * q6 * q8 +# + bp4 * bpp3 * q11 * q9 +# - bp3 * bpp4 * q11 * q9 +# - bp3 * bpp1 * q2 * q9 +# + bp1 * bpp3 * q2 * q9 +# - bp3 * bpp2 * q5 * q9 +# + bp2 * bpp3 * q5 * q9 +# ) egraph = EGraph() print("Registering") egraph.register(res) print("Running") -print(egraph.run(to_polynomial.saturate())) +egraph.run(to_polynomial.saturate()) print("Extracting") # egraph.display(n_inline_leaves=1) finished = egraph.extract(res) diff --git a/python/egglog/pretty.py b/python/egglog/pretty.py index 556d629e..6b80b860 100644 --- a/python/egglog/pretty.py +++ b/python/egglog/pretty.py @@ -221,6 +221,8 @@ def __call__(self, decl: AllDecls, toplevel: bool = False) -> None: # noqa: C90 self(schedule) case GetCostDecl(ref, args): self(CallDecl(ref, args)) + case DummyDecl(): + pass case _: assert_never(decl) @@ -373,6 +375,8 @@ def uncached( # noqa: C901, PLR0911, PLR0912 return f"back_off({', '.join(list_args)})", "scheduler" case ValueDecl(value): return str(value), "value" + case DummyDecl(): + return "__InternalDummyValueShouldNotBeSeenOpenAnIssue()", "dummy" case GetCostDecl(ref, args): return f"get_cost({self(CallDecl(ref, args))})", "get_cost" assert_never(decl) diff --git a/python/egglog/runtime.py b/python/egglog/runtime.py index 56f68ea7..7464b4b7 100644 --- a/python/egglog/runtime.py +++ b/python/egglog/runtime.py @@ -34,6 +34,7 @@ __all__ = [ "ALWAYS_MUTATES_SELF", "ALWAYS_PRESERVED", + "DUMMY_VALUE", "LIT_IDENTS", "NUMERIC_BINARY_METHODS", "RuntimeClass", @@ -309,6 +310,7 @@ def __call__(self, *args: object, **kwargs: object) -> RuntimeExpr | None: call = (res_typed_expr := res.__egg_typed_expr__).expr return_tp = res_typed_expr.tp assert isinstance(call, CallDecl), "partial function must be a call" + # Clip off the remaining arguments n_args = len(partial_args) value = PartialCallDecl(replace(call, args=call.args[:n_args])) remaining_arg_types = [a.tp for a in call.args[n_args:]] @@ -532,7 +534,8 @@ def __call__(self, *args: object, _egg_partial_function: bool = False, **kwargs: try: bound = py_signature.bind(*args, **kwargs) except TypeError as err: - raise TypeError(f"Failed to bind arguments for {self} with args {args} and kwargs {kwargs}: {err}") from err + err.add_note(f"when calling {self} with args {args} and kwargs {kwargs}") + raise del kwargs bound.apply_defaults() assert not bound.kwargs @@ -598,12 +601,16 @@ def __doc__(self) -> str | None: # type: ignore[override] return None +# sentinel that will be upcasted to any type with a DummyDecl value +DUMMY_VALUE = object() + + def to_py_signature(sig: FunctionSignature, decls: Declarations, optional_args: bool) -> Signature: """ Convert to a Python signature. If optional_args is true, then all args will be treated as optional, as if a default was provided that makes them - a var with that arg name as the value. + `DUMMY_VALUE` Used for partial application to try binding a function with only some of its args. """ @@ -611,9 +618,9 @@ def to_py_signature(sig: FunctionSignature, decls: Declarations, optional_args: Parameter( n, Parameter.POSITIONAL_OR_KEYWORD, - default=RuntimeExpr.__from_values__(decls, TypedExprDecl(t.to_just(), d or LetRefDecl(n))) - if d is not None or optional_args - else Parameter.empty, + default=RuntimeExpr.__from_values__(decls, TypedExprDecl(t.to_just(), d)) + if d is not None + else (DUMMY_VALUE if optional_args else Parameter.empty), ) for n, d, t in zip(sig.arg_names, sig.arg_defaults, sig.arg_types, strict=True) ] diff --git a/python/egglog/type_constraint_solver.py b/python/egglog/type_constraint_solver.py index 4a333179..cfc46d4b 100644 --- a/python/egglog/type_constraint_solver.py +++ b/python/egglog/type_constraint_solver.py @@ -107,5 +107,5 @@ def substitute_typevars(self, tp: TypeOrVarRef, cls_ident: Ident | None = None) except KeyError as e: raise TypeConstraintError(f"Not enough bound typevars for {tp!r} in class {cls_ident}") from e case TypeRefWithVars(name, args): - return JustTypeRef(name, tuple(self.substitute_typevars(arg, cls_ident) for arg in args)) + return JustTypeRef(name, tuple(self.substitute_typevars(arg, cls_ident or name) for arg in args)) assert_never(tp) From daec3ae449dbf4eb2e91d430aa91914eb985ea1f Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Mon, 24 Nov 2025 19:58:09 -0800 Subject: [PATCH 03/30] Add negative --- python/egglog/exp/polynomials.py | 15 ++------------- 1 file changed, 2 insertions(+), 13 deletions(-) diff --git a/python/egglog/exp/polynomials.py b/python/egglog/exp/polynomials.py index 8771ef73..61173f6a 100644 --- a/python/egglog/exp/polynomials.py +++ b/python/egglog/exp/polynomials.py @@ -137,8 +137,6 @@ def __neg__(self) -> Number: ... # 1. Convert to polynomial(MultiSet[MultiSet[Number]]) -MultiSet[MultiSet[Number]] - n1 = constant("n1", Number) n2 = constant("n2", Number) @@ -191,17 +189,8 @@ def to_polynomial( mss1: MultiSet[MultiSet[Number]], mss2: MultiSet[MultiSet[Number]], ): - yield rule( - n3 == n1 - n2, - name="subtract", - ).then( - union(n3).with_(polynomial(MultiSet(MultiSet(n1), MultiSet(n2, Number(-1))))), - set_(get_sole_polynomial(MultiSet(n3))).to(MultiSet(MultiSet(n1), MultiSet(n2, Number(-1)))), - subsume(n1 - n2), - # MultiSet(n1).fill_index(ms_index), - # MultiSet(n2, Number(-1)).fill_index(ms_index), - # MultiSet(MultiSet(n1), MultiSet(n2, Number(-1))).fill_index(mss_index), - ) + yield rewrite(-n1, subsume=True).to(-1 * n1) + yield rewrite(n1 - n2, subsume=True).to(n1 + (-1 * n2)) yield rule( n3 == n1 + n2, name="add", From fbdaef74d24a6cfe0059164455acc3586d6f09a4 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Mon, 24 Nov 2025 22:28:13 -0800 Subject: [PATCH 04/30] Factoring working partially --- python/egglog/builtins.py | 32 ++++++++++++++-- python/egglog/exp/polynomials.py | 64 +++++++++++++++++++++++++++----- python/egglog/runtime.py | 29 ++++++++++++--- 3 files changed, 107 insertions(+), 18 deletions(-) diff --git a/python/egglog/builtins.py b/python/egglog/builtins.py index a54f93fe..f52e6dfd 100644 --- a/python/egglog/builtins.py +++ b/python/egglog/builtins.py @@ -57,6 +57,8 @@ "i64Like", "join", "multiset_flat_map", + "multiset_not_contains_swapped", + "multiset_remove_swapped", "py_eval", "py_eval_fn", "py_exec", @@ -560,6 +562,10 @@ def __contains__(self, key: T) -> bool: @method(egg_fn="multiset-of") def __init__(self, *args: T) -> None: ... + @method(egg_fn="multiset-sum-multisets") + @classmethod + def sum_multisets(cls, xs: MultiSet[MultiSet[T]]) -> MultiSet[T]: ... + @method(egg_fn="multiset-insert") def insert(self, value: T) -> MultiSet[T]: ... @@ -590,12 +596,32 @@ def fill_index(self, f: Callable[[MultiSet[T], T], i64]) -> Unit: ... @method(egg_fn="unstable-multiset-clear-index") def clear_index(self, f: Callable[[MultiSet[T], T], i64]) -> Unit: ... + @method(egg_fn="multiset-pick-max") + def pick_max(self) -> T: ... + + @method(egg_fn="multiset-count") + def count(self, value: T) -> i64: ... + + @method(egg_fn="unstable-multiset-filter", reverse_args=True) + def filter(self, f: Callable[[T], Unit]) -> MultiSet[T]: ... + + @method(egg_fn="multiset-reset-counts") + def reset_counts(self) -> MultiSet[T]: ... + # TODO: Move to method when partial suppors reverse_args @function(egg_fn="unstable-multiset-flat-map", builtin=True) def multiset_flat_map(f: Callable[[T], MultiSet[T]], xs: MultiSet[T]) -> MultiSet[T]: ... +@function(egg_fn="multiset-remove-swapped", builtin=True) +def multiset_remove_swapped(x: T, xs: MultiSet[T]) -> MultiSet[T]: ... + + +@function(egg_fn="multiset-not-contains-swapped", builtin=True) +def multiset_not_contains_swapped(x: T, xs: MultiSet[T]) -> Unit: ... + + converter( tuple, MultiSet, @@ -1124,9 +1150,9 @@ def __call__(self, *args: *TS) -> T: ... # Method Type is for builtins like __getitem__ -converter(MethodType, UnstableFn, lambda m: UnstableFn(m.__func__, m.__self__)) -converter(RuntimeFunction, UnstableFn, UnstableFn) -converter(partial, UnstableFn, lambda p: UnstableFn(p.func, *p.args)) +converter(MethodType, UnstableFn, lambda m: UnstableFn[*get_type_args()](m.__func__, m.__self__)) +converter(RuntimeFunction, UnstableFn, lambda rf: UnstableFn[*get_type_args()](rf)) +converter(partial, UnstableFn, lambda p: UnstableFn[*get_type_args()](p.func, *p.args)) def _convert_function(fn: FunctionType) -> UnstableFn: diff --git a/python/egglog/exp/polynomials.py b/python/egglog/exp/polynomials.py index 61173f6a..e51826e3 100644 --- a/python/egglog/exp/polynomials.py +++ b/python/egglog/exp/polynomials.py @@ -169,25 +169,26 @@ def get_sole_polynomial(xs: MultiSet[Number]) -> MultiSet[MultiSet[Number]]: def polynomial(x: MultiSetLike[MultiSet[Number], MultiSetLike[Number, NumberLike]]) -> Number: ... -@function(merge=i64.__add__) -def ms_index(xs: MultiSet[Number], x: Number) -> i64: ... +# TODO: simplify MultiSet(bp3, polynomial(MultiSet(MultiSet(q7, _Number_6)))) +# @function(merge=i64.__add__) +# def ms_index(xs: MultiSet[Number], x: Number) -> i64: ... -@function(merge=i64.__add__) -def mss_index(xss: MultiSet[MultiSet[Number]], xs: MultiSet[Number]) -> i64: ... +# @function(merge=i64.__add__) +# def mss_index(xss: MultiSet[MultiSet[Number]], xs: MultiSet[Number]) -> i64: ... @ruleset -def to_polynomial( +def to_polynomial_ruleset( n1: Number, n2: Number, n3: Number, - ms: MultiSet[Number], - ms1: MultiSet[Number], - ms2: MultiSet[Number], + # ms: MultiSet[Number], + # ms1: MultiSet[Number], + # ms2: MultiSet[Number], mss: MultiSet[MultiSet[Number]], mss1: MultiSet[MultiSet[Number]], - mss2: MultiSet[MultiSet[Number]], + # mss2: MultiSet[MultiSet[Number]], ): yield rewrite(-n1, subsume=True).to(-1 * n1) yield rewrite(n1 - n2, subsume=True).to(n1 + (-1 * n2)) @@ -239,6 +240,31 @@ def to_polynomial( ) +@ruleset +def factor_ruleset( + n: Number, + mss: MultiSet[MultiSet[Number]], + counts: MultiSet[Number], + factor: Number, + divided: MultiSet[MultiSet[Number]], + remainder: MultiSet[MultiSet[Number]], +): + yield rule( + n == polynomial(mss), + # TODO: Could replace with to_set and them from _sets + counts == MultiSet.sum_multisets(mss.map(MultiSet[Number].reset_counts)), + factor == counts.pick_max(), + # Only factor out if it term appears in more than one monomial + counts.count(factor) > 1, + divided == mss.map(partial(multiset_remove_swapped, factor)), + remainder == mss.filter(partial(multiset_not_contains_swapped, factor)), + name="factor", + ).then( + union(n).with_(polynomial(MultiSet(MultiSet(factor, polynomial(divided))) + remainder)), + subsume(polynomial(mss)), + ) + + # _MultiSet_1 = MultiSet[Number]() # res = polynomial( # MultiSet(_MultiSet_1, MultiSet(-bp4, bpp1, q12, q2), MultiSet(bp1, bpp4, q12, q2), MultiSet(bp4, bpp1, q11, q3)) @@ -274,9 +300,27 @@ def to_polynomial( print("Registering") egraph.register(res) print("Running") -egraph.run(to_polynomial.saturate()) +egraph.run(to_polynomial_ruleset.saturate()) print("Extracting") # egraph.display(n_inline_leaves=1) finished = egraph.extract(res) print("printing") print(finished) +print("factoring") +egraph.run(factor_ruleset.saturate()) +print("extracting factored") +finished_factored = egraph.extract(finished) +print("printing factored") +print(finished_factored) +# egraph.run(to_polynomial_ruleset.saturate()) +# print("extracting fully simplified") +# finished_simplified = egraph.extract(finished_factored) +# print("printing fully simplified") +# print(finished_simplified) + +MultiSet( + bpp2, + polynomial( + MultiSet(MultiSet(q4, polynomial(MultiSet(MultiSet(bp4, q11), MultiSet(bp1, q2))))), + ), +) diff --git a/python/egglog/runtime.py b/python/egglog/runtime.py index 7464b4b7..fa43947b 100644 --- a/python/egglog/runtime.py +++ b/python/egglog/runtime.py @@ -303,7 +303,7 @@ def __call__(self, *args: object, **kwargs: object) -> RuntimeExpr | None: # Assumes we don't have types set for UnstableFn w/ generics, that they have to be inferred # 1. Call it with the partial args, and use untyped vars for the rest of the args - res = cast("Callable", fn_arg)(*partial_args, _egg_partial_function=True) + res = cast("Callable", fn_arg)(*partial_args, _egg_function_types=self.__egg_tp__.args) assert res is not None, "Mutable partial functions not supported" # 2. Use the inferred return type and inferred rest arg types as the types of the function, and # the partially applied args as the args. @@ -406,9 +406,15 @@ def __getattr__(self, name: str) -> RuntimeFunction | RuntimeExpr | Callable: ) # allow referencing properties and methods as class variables as well if name in cls_decl.properties: - return RuntimeFunction(self.__egg_decls_thunk__, Thunk.value(PropertyRef(self.__egg_tp__.ident, name))) + return RuntimeFunction( + self.__egg_decls_thunk__, + Thunk.value(PropertyRef(self.__egg_tp__.ident, name)), + self.__egg_tp__.to_just(), + ) if name in cls_decl.methods: - return RuntimeFunction(self.__egg_decls_thunk__, Thunk.value(MethodRef(self.__egg_tp__.ident, name))) + return RuntimeFunction( + self.__egg_decls_thunk__, Thunk.value(MethodRef(self.__egg_tp__.ident, name)), self.__egg_tp__.to_just() + ) msg = f"Class {self.__egg_tp__.ident} has no method {name}" raise AttributeError(msg) from None @@ -497,7 +503,9 @@ def __hash__(self) -> int: def __egg_ref__(self) -> CallableRef: return self.__egg_ref_thunk__() - def __call__(self, *args: object, _egg_partial_function: bool = False, **kwargs: object) -> RuntimeExpr | None: + def __call__( # noqa: C901 + self, *args: object, _egg_function_types: tuple[TypeOrVarRef, ...] | None = None, **kwargs: object + ) -> RuntimeExpr | None: from .conversion import resolve_literal # noqa: PLC0415 if isinstance(self.__egg_bound__, RuntimeExpr): @@ -530,7 +538,7 @@ def __call__(self, *args: object, _egg_partial_function: bool = False, **kwargs: assert isinstance(signature, FunctionSignature) # Turn all keyword args into positional args - py_signature = to_py_signature(signature, self.__egg_decls__, _egg_partial_function) + py_signature = to_py_signature(signature, self.__egg_decls__, optional_args=_egg_function_types is not None) try: bound = py_signature.bind(*args, **kwargs) except TypeError as err: @@ -557,7 +565,18 @@ def __call__(self, *args: object, _egg_partial_function: bool = False, **kwargs: ): tcs.bind_class(bound_tp) assert (operator.ge if signature.var_arg_type else operator.eq)(len(args), len(signature.arg_types)) + # Hack to allow being explicit on function types when casting. # noqa: FIX004 + # TODO: Replace type analysis class binding stuff + # with instead binders of location per call origination cls_ident = bound_tp.ident if bound_tp else None + for _fn_tp in _egg_function_types or (): + try: + _fn_tp_just = _fn_tp.to_just() + except TypeVarError: + continue + tcs.bind_class(_fn_tp_just) + if _fn_tp_just.args: + cls_ident = _fn_tp_just.ident upcasted_args = [ resolve_literal(cast("TypeOrVarRef", tp), arg, Thunk.value(decls), tcs=tcs, cls_ident=cls_ident) for arg, tp in zip_longest(args, signature.arg_types, fillvalue=signature.var_arg_type) From 1f1d8032a9bc5457578f3f27196f2ebf89e1e215 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Tue, 25 Nov 2025 15:19:26 -0800 Subject: [PATCH 05/30] Save failing commands and also desugar first --- src/egraph.rs | 10 ++++++---- 1 file changed, 6 insertions(+), 4 deletions(-) diff --git a/src/egraph.rs b/src/egraph.rs index 19e9f172..dac71e43 100644 --- a/src/egraph.rs +++ b/src/egraph.rs @@ -58,11 +58,16 @@ impl EGraph { py: Python<'_>, commands: Vec, ) -> EggResult> { - let commands: Vec = commands.into_iter().map(|x| x.into()).collect(); + let mut commands: Vec = commands.into_iter().map(|x| x.into()).collect(); let mut cmds_str = String::new(); for cmd in &commands { cmds_str = cmds_str + &cmd.to_string() + "\n"; } + // Parse all commands so that type analysis works properly + commands = self.egraph.parser.get_program_from_string(None, &cmds_str).unwrap(); + if let Some(cmds) = &mut self.cmds { + cmds.push_str(&cmds_str); + } info!("Running commands:\n{}", cmds_str); let res = py.detach(|| self.egraph.run_program(commands)); if let Some(err) = PyErr::take(py) { @@ -71,9 +76,6 @@ impl EGraph { match res { Err(e) => Err(WrappedError::Egglog(e)), Ok(outputs) => { - if let Some(cmds) = &mut self.cmds { - cmds.push_str(&cmds_str); - } Ok(outputs.into_iter().map(|o| o.into()).collect()) } } From cc8489dc8520da93bc78b498cf6b93281ca2229e Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Tue, 25 Nov 2025 15:19:54 -0800 Subject: [PATCH 06/30] Start adding simplification and delete not subsume --- python/egglog/exp/polynomials.py | 134 ++++++++++++++++++++++++------- 1 file changed, 107 insertions(+), 27 deletions(-) diff --git a/python/egglog/exp/polynomials.py b/python/egglog/exp/polynomials.py index e51826e3..3943830a 100644 --- a/python/egglog/exp/polynomials.py +++ b/python/egglog/exp/polynomials.py @@ -198,7 +198,7 @@ def to_polynomial_ruleset( ).then( union(n3).with_(polynomial(MultiSet(MultiSet(n1), MultiSet(n2)))), set_(get_sole_polynomial(MultiSet(n3))).to(MultiSet(MultiSet(n1), MultiSet(n2))), - subsume(n1 + n2), + delete(n1 + n2), # MultiSet(MultiSet(n1), MultiSet(n2)).fill_index(mss_index), # MultiSet(n1).fill_index(ms_index), # MultiSet(n2).fill_index(ms_index), @@ -209,17 +209,17 @@ def to_polynomial_ruleset( ).then( union(n3).with_(monomial(MultiSet(n1, n2))), set_(get_monomial(n3)).to(MultiSet(n1, n2)), - subsume(n1 * n2), + delete(n1 * n2), # MultiSet(n1, n2).fill_index(ms_index), ) yield rule( n1 == polynomial(mss), - mss1 == mss.map(partial(multiset_flat_map, UnstableFn(get_monomial))), + mss1 == mss.map(partial(multiset_flat_map, get_monomial)), mss != mss1, name="unwrap monomial", ).then( union(n1).with_(polynomial(mss1)), - subsume(polynomial(mss)), + delete(polynomial(mss)), set_(get_sole_polynomial(MultiSet(n1))).to(mss1), # mss.clear_index(mss_index), # mss1.fill_index(mss_index), @@ -231,7 +231,7 @@ def to_polynomial_ruleset( name="unwrap polynomial", ).then( union(n1).with_(polynomial(mss1)), - subsume(polynomial(mss)), + delete(polynomial(mss)), set_(get_sole_polynomial(MultiSet(n1))).to(mss1), # mss.clear_index(mss_index), # ms.clear_index(ms_index), @@ -251,20 +251,95 @@ def factor_ruleset( ): yield rule( n == polynomial(mss), - # TODO: Could replace with to_set and them from _sets + # Find factor that shows up in most monomials, at least two of them counts == MultiSet.sum_multisets(mss.map(MultiSet[Number].reset_counts)), factor == counts.pick_max(), # Only factor out if it term appears in more than one monomial counts.count(factor) > 1, + # map, including only those factor that contain the factor, removing them from that + # other items are omitted from the map divided == mss.map(partial(multiset_remove_swapped, factor)), + # remainder is those monomials that do not contain the factor remainder == mss.filter(partial(multiset_not_contains_swapped, factor)), name="factor", ).then( union(n).with_(polynomial(MultiSet(MultiSet(factor, polynomial(divided))) + remainder)), + delete(polynomial(mss)), + ) + + +@function(merge=lambda old, new: new) +def get_polynomial_sole_monomial(x: Number) -> MultiSet[Number]: + """ + Only defined on polynomials that contain a single monomial: + + get_polynomial_sole_monomial(polynomial(MultiSet(xs))) => xs + """ + + +@ruleset +def simplified_factor_ruleset( + n: Number, + mss: MultiSet[MultiSet[Number]], + mss1: MultiSet[MultiSet[Number]], + ms: MultiSet[Number], +): + # replace all monomial with polyomials with one monomial with just monomials + + # a = polynomial( + # MultiSet( + # MultiSet(bp1, bpp4, q12, q1), + # MultiSet(q7, polynomial(MultiSet(MultiSet(bp3, _Number_10)))), + # MultiSet(q9, polynomial(MultiSet(MultiSet(bpp3, _Number_8)))), + # ) + # ) + # replace_with = polynomial( + # MultiSet( + # MultiSet(bp1, bpp4, q12, q1), + # MultiSet(q7, bp3, _Number_10), + # MultiSet(q9, bpp3, _Number_8), + # ) + # ) + + yield rule( + n == polynomial(mss), + mss.length() == i64(1), + ms == mss.pick(), + name="set polynomial sole monomial", + ).then( + set_(get_polynomial_sole_monomial(n)).to(ms), + ) + yield rule( + n == polynomial(mss), + mss1 == mss.map(partial(multiset_flat_map, get_polynomial_sole_monomial)), + mss != mss1, + name="unwrap polynomial sole monomial", + ).then( + union(n).with_(polynomial(mss1)), subsume(polynomial(mss)), ) +# _Number_8 = polynomial(MultiSet(MultiSet(bp1, q1), MultiSet(bp4, q10), MultiSet(bp2, q4))) +# _Number_10 = polynomial(MultiSet(MultiSet(bpp4, q12), MultiSet(bpp1, q3), MultiSet(bpp2, q6))) + +# a = polynomial( +# MultiSet( +# MultiSet(bp1, bpp4, q12, q1), +# MultiSet(q7, polynomial(MultiSet(MultiSet(bp3, _Number_10)))), +# MultiSet(q9, polynomial(MultiSet(MultiSet(bpp3, _Number_8)))), +# ) +# ) +# replace_with = polynomial( +# MultiSet( +# MultiSet(bp1, bpp4, q12, q1), +# MultiSet(q7, bp3, _Number_10), +# MultiSet(q9, bpp3, _Number_8), +# ) +# ) +# map then flatmap of get polynomial + + # _MultiSet_1 = MultiSet[Number]() # res = polynomial( # MultiSet(_MultiSet_1, MultiSet(-bp4, bpp1, q12, q2), MultiSet(bp1, bpp4, q12, q2), MultiSet(bp4, bpp1, q11, q3)) @@ -296,31 +371,36 @@ def factor_ruleset( # - bp3 * bpp2 * q5 * q9 # + bp2 * bpp3 * q5 * q9 # ) -egraph = EGraph() -print("Registering") -egraph.register(res) + +from pathlib import Path + +INITIAL_STR = "from egglog.exp.polynomials import *\n\n" + +print("saving initial expression to initial.py") +Path("initial.py").write_text(INITIAL_STR + str(res)) + +egraph = EGraph(save_egglog_string=True) +res = egraph.let("res", res) print("Running") egraph.run(to_polynomial_ruleset.saturate()) print("Extracting") -# egraph.display(n_inline_leaves=1) finished = egraph.extract(res) -print("printing") -print(finished) +print("saving polynomial expression to polynomial.py") +Path("polynomial.py").write_text(INITIAL_STR + str(finished)) + + print("factoring") egraph.run(factor_ruleset.saturate()) print("extracting factored") -finished_factored = egraph.extract(finished) -print("printing factored") -print(finished_factored) -# egraph.run(to_polynomial_ruleset.saturate()) -# print("extracting fully simplified") -# finished_simplified = egraph.extract(finished_factored) -# print("printing fully simplified") -# print(finished_simplified) - -MultiSet( - bpp2, - polynomial( - MultiSet(MultiSet(q4, polynomial(MultiSet(MultiSet(bp4, q11), MultiSet(bp1, q2))))), - ), -) +finished_factored = egraph.extract(res) +print("saving factored expression to factored.py") +Path("factored.py").write_text(INITIAL_STR + str(finished_factored)) + +# print("simplifying factored") +# egraph.run(simplified_factor_ruleset.saturate()) +# print("extracting simplified factored") +# finished_simplified = egraph.extract(res) +# print("saving simplified factored expression to simplified_factored.py") +# Path("simplified_factored.py").write_text(INITIAL_STR + str(finished_simplified)) + +Path("polynomials.egg").write_text(egraph.get_egglog_string) From fc1f276c1a7e740eb6e7c524aebdf3202309872f Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Fri, 5 Dec 2025 15:30:40 -0800 Subject: [PATCH 07/30] simplify and add sympy example --- polynomials_sympy.py | 33 + pyproject.toml | 1 + python/egglog/exp/polynomials.py | 227 +- uv.lock | 3483 +++++++++++++++--------------- 4 files changed, 1864 insertions(+), 1880 deletions(-) create mode 100644 polynomials_sympy.py diff --git a/polynomials_sympy.py b/polynomials_sympy.py new file mode 100644 index 00000000..afdeac7e --- /dev/null +++ b/polynomials_sympy.py @@ -0,0 +1,33 @@ +from sympy import Array, Symbol, tensorcontraction, tensorproduct + +# Parameters +Bp = Array([Symbol(f"bp{i}") for i in range(1, 5)]) +Bpp = Array([Symbol(f"bpp{i}") for i in range(1, 5)]) + +Q = Array([Symbol(f"q{i}") for i in range(1, 13)]) +QM = Q.reshape(4, 3).transpose() + +# Projections (3-vector each) +yip = tensorcontraction(tensorproduct(QM, Bp), (1, 2)) +yipp = tensorcontraction(tensorproduct(QM, Bpp), (1, 2)) + + +def cross(a: Array, b: Array): + """ + 3d cross product + https://reference.wolfram.com/language/ref/Cross.html + """ + return Array([ + a[1] * b[2] - a[2] * b[1], + a[2] * b[0] - a[0] * b[2], + a[0] * b[1] - a[1] * b[0], + ]) + + +def norm3(arr: Array): + x, y, z = arr[0], arr[1], arr[2] + return (x**2 + y**2 + z**2) ** (0.5) + + +FunctionBending = (norm3(cross(yip, yipp)) / (norm3(yip) ** 3)) ** 2 +print(FunctionBending) diff --git a/pyproject.toml b/pyproject.toml index c7ec173b..bc3cc972 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -282,4 +282,5 @@ members = ["egglog"] [dependency-groups] dev = [ "py-spy>=0.4.1", + "sympy>=1.14.0", ] diff --git a/python/egglog/exp/polynomials.py b/python/egglog/exp/polynomials.py index 3943830a..ebc2429c 100644 --- a/python/egglog/exp/polynomials.py +++ b/python/egglog/exp/polynomials.py @@ -2,12 +2,13 @@ from __future__ import annotations from functools import partial +from pathlib import Path from typing import TypeAlias from egglog import * -class Number(Expr): +class Number(Expr, egg_sort="Number"): def __init__(self, value: i64Like) -> None: ... def __add__(self, other: NumberLike) -> Number: ... def __radd__(self, other: NumberLike) -> Number: ... @@ -132,15 +133,13 @@ def __neg__(self) -> Number: ... + (bp4 * q11 + bp1 * q2 + bp2 * q5 + bp3 * q8) ** 2 + (bp4 * q12 + bp1 * q3 + bp2 * q6 + bp3 * q9) ** 2 ) ** 3 -# print(res) - - -# 1. Convert to polynomial(MultiSet[MultiSet[Number]]) +print("saving initial expression to initial.py") +INITIAL_STR = "from egglog.exp.polynomials import *\n\n" +Path("tmp/initial.py").write_text(INITIAL_STR + str(res)) -n1 = constant("n1", Number) -n2 = constant("n2", Number) -n3 = constant("n3", Number) +egraph = EGraph(save_egglog_string=True) +res = egraph.let("res", res) @function @@ -165,17 +164,14 @@ def get_sole_polynomial(xs: MultiSet[Number]) -> MultiSet[MultiSet[Number]]: """ +# MultiSet[MultiSet[Number]] @function def polynomial(x: MultiSetLike[MultiSet[Number], MultiSetLike[Number, NumberLike]]) -> Number: ... -# TODO: simplify MultiSet(bp3, polynomial(MultiSet(MultiSet(q7, _Number_6)))) -# @function(merge=i64.__add__) -# def ms_index(xs: MultiSet[Number], x: Number) -> i64: ... +# a + x * y - -# @function(merge=i64.__add__) -# def mss_index(xss: MultiSet[MultiSet[Number]], xs: MultiSet[Number]) -> i64: ... +# polynomial(multiset(multiset(a), multiset(x, y))) @ruleset @@ -183,12 +179,8 @@ def to_polynomial_ruleset( n1: Number, n2: Number, n3: Number, - # ms: MultiSet[Number], - # ms1: MultiSet[Number], - # ms2: MultiSet[Number], mss: MultiSet[MultiSet[Number]], mss1: MultiSet[MultiSet[Number]], - # mss2: MultiSet[MultiSet[Number]], ): yield rewrite(-n1, subsume=True).to(-1 * n1) yield rewrite(n1 - n2, subsume=True).to(n1 + (-1 * n2)) @@ -199,9 +191,6 @@ def to_polynomial_ruleset( union(n3).with_(polynomial(MultiSet(MultiSet(n1), MultiSet(n2)))), set_(get_sole_polynomial(MultiSet(n3))).to(MultiSet(MultiSet(n1), MultiSet(n2))), delete(n1 + n2), - # MultiSet(MultiSet(n1), MultiSet(n2)).fill_index(mss_index), - # MultiSet(n1).fill_index(ms_index), - # MultiSet(n2).fill_index(ms_index), ) yield rule( n3 == n1 * n2, @@ -221,8 +210,6 @@ def to_polynomial_ruleset( union(n1).with_(polynomial(mss1)), delete(polynomial(mss)), set_(get_sole_polynomial(MultiSet(n1))).to(mss1), - # mss.clear_index(mss_index), - # mss1.fill_index(mss_index), ) yield rule( n1 == polynomial(mss), @@ -233,13 +220,14 @@ def to_polynomial_ruleset( union(n1).with_(polynomial(mss1)), delete(polynomial(mss)), set_(get_sole_polynomial(MultiSet(n1))).to(mss1), - # mss.clear_index(mss_index), - # ms.clear_index(ms_index), - # ms2.fill_index(ms_index), - # mss2.fill_index(mss_index), ) +egraph.run(to_polynomial_ruleset.saturate()) +print("saving polynomial expression to polynomial.py") +Path("tmp/polynomial.py").write_text(INITIAL_STR + str(egraph.extract(res))) + + @ruleset def factor_ruleset( n: Number, @@ -264,137 +252,70 @@ def factor_ruleset( name="factor", ).then( union(n).with_(polynomial(MultiSet(MultiSet(factor, polynomial(divided))) + remainder)), - delete(polynomial(mss)), - ) - - -@function(merge=lambda old, new: new) -def get_polynomial_sole_monomial(x: Number) -> MultiSet[Number]: - """ - Only defined on polynomials that contain a single monomial: - - get_polynomial_sole_monomial(polynomial(MultiSet(xs))) => xs - """ - - -@ruleset -def simplified_factor_ruleset( - n: Number, - mss: MultiSet[MultiSet[Number]], - mss1: MultiSet[MultiSet[Number]], - ms: MultiSet[Number], -): - # replace all monomial with polyomials with one monomial with just monomials - - # a = polynomial( - # MultiSet( - # MultiSet(bp1, bpp4, q12, q1), - # MultiSet(q7, polynomial(MultiSet(MultiSet(bp3, _Number_10)))), - # MultiSet(q9, polynomial(MultiSet(MultiSet(bpp3, _Number_8)))), - # ) - # ) - # replace_with = polynomial( - # MultiSet( - # MultiSet(bp1, bpp4, q12, q1), - # MultiSet(q7, bp3, _Number_10), - # MultiSet(q9, bpp3, _Number_8), - # ) - # ) - - yield rule( - n == polynomial(mss), - mss.length() == i64(1), - ms == mss.pick(), - name="set polynomial sole monomial", - ).then( - set_(get_polynomial_sole_monomial(n)).to(ms), - ) - yield rule( - n == polynomial(mss), - mss1 == mss.map(partial(multiset_flat_map, get_polynomial_sole_monomial)), - mss != mss1, - name="unwrap polynomial sole monomial", - ).then( - union(n).with_(polynomial(mss1)), - subsume(polynomial(mss)), + # delete(polynomial(mss)), ) -# _Number_8 = polynomial(MultiSet(MultiSet(bp1, q1), MultiSet(bp4, q10), MultiSet(bp2, q4))) -# _Number_10 = polynomial(MultiSet(MultiSet(bpp4, q12), MultiSet(bpp1, q3), MultiSet(bpp2, q6))) - -# a = polynomial( -# MultiSet( -# MultiSet(bp1, bpp4, q12, q1), -# MultiSet(q7, polynomial(MultiSet(MultiSet(bp3, _Number_10)))), -# MultiSet(q9, polynomial(MultiSet(MultiSet(bpp3, _Number_8)))), +egraph.run(factor_ruleset.saturate()) +print("saving factored expression to factored.py") +Path("tmp/factored.py").write_text(INITIAL_STR + str(egraph.extract(res))) + + +print("saving egraph to polynomials.egg") +Path("tmp/polynomials.egg").write_text(egraph.as_egglog_string) + +# simplifying polynomials + +# @function(merge=lambda old, new: new) +# def get_polynomial_sole_monomial(x: Number) -> MultiSet[Number]: +# """ +# Only defined on polynomials that contain a single monomial: + +# get_polynomial_sole_monomial(polynomial(MultiSet(xs))) => xs +# """ + + +# @ruleset +# def simplified_factor_ruleset( +# n: Number, +# mss: MultiSet[MultiSet[Number]], +# mss1: MultiSet[MultiSet[Number]], +# ms: MultiSet[Number], +# ): +# # replace all monomial with polyomials with one monomial with just monomials +# # a = polynomial( +# # MultiSet( +# # MultiSet(bp1, bpp4, q12, q1), +# # MultiSet(q7, polynomial(MultiSet(MultiSet(bp3, _Number_10)))), +# # MultiSet(q9, polynomial(MultiSet(MultiSet(bpp3, _Number_8)))), +# # ) +# # ) +# # replace_with = polynomial( +# # MultiSet( +# # MultiSet(bp1, bpp4, q12, q1), +# # MultiSet(q7, bp3, _Number_10), +# # MultiSet(q9, bpp3, _Number_8), +# # ) +# # ) + +# yield rule( +# n == polynomial(mss), +# mss.length() == i64(1), +# ms == mss.pick(), +# name="set polynomial sole monomial", +# ).then( +# set_(get_polynomial_sole_monomial(n)).to(ms), # ) -# ) -# replace_with = polynomial( -# MultiSet( -# MultiSet(bp1, bpp4, q12, q1), -# MultiSet(q7, bp3, _Number_10), -# MultiSet(q9, bpp3, _Number_8), +# yield rule( +# n == polynomial(mss), +# mss1 == mss.map(partial(multiset_flat_map, get_polynomial_sole_monomial)), +# mss != mss1, +# name="unwrap polynomial sole monomial", +# ).then( +# union(n).with_(polynomial(mss1)), +# subsume(polynomial(mss)), # ) -# ) -# map then flatmap of get polynomial - - -# _MultiSet_1 = MultiSet[Number]() -# res = polynomial( -# MultiSet(_MultiSet_1, MultiSet(-bp4, bpp1, q12, q2), MultiSet(bp1, bpp4, q12, q2), MultiSet(bp4, bpp1, q11, q3)) -# ) - monomial(MultiSet(q3, monomial(MultiSet(q11, monomial(MultiSet(bp1, bpp4)))))) - -# res = ( -# -bp4 * bpp1 * q12 * q2 -# + bp1 * bpp4 * q12 * q2 -# + bp4 * bpp1 * q11 * q3 -# - bp1 * bpp4 * q11 * q3 -# - bp4 * bpp2 * q12 * q5 -# + bp2 * bpp4 * q12 * q5 -# + bp2 * bpp1 * q3 * q5 -# - bp1 * bpp2 * q3 * q5 -# + bp4 * bpp2 * q11 * q6 -# - bp2 * bpp4 * q11 * q6 -# - bp2 * bpp1 * q2 * q6 -# + bp1 * bpp2 * q2 * q6 -# - bp4 * bpp3 * q12 * q8 -# + bp3 * bpp4 * q12 * q8 -# + bp3 * bpp1 * q3 * q8 -# - bp1 * bpp3 * q3 * q8 -# + bp3 * bpp2 * q6 * q8 -# - bp2 * bpp3 * q6 * q8 -# + bp4 * bpp3 * q11 * q9 -# - bp3 * bpp4 * q11 * q9 -# - bp3 * bpp1 * q2 * q9 -# + bp1 * bpp3 * q2 * q9 -# - bp3 * bpp2 * q5 * q9 -# + bp2 * bpp3 * q5 * q9 -# ) -from pathlib import Path - -INITIAL_STR = "from egglog.exp.polynomials import *\n\n" - -print("saving initial expression to initial.py") -Path("initial.py").write_text(INITIAL_STR + str(res)) - -egraph = EGraph(save_egglog_string=True) -res = egraph.let("res", res) -print("Running") -egraph.run(to_polynomial_ruleset.saturate()) -print("Extracting") -finished = egraph.extract(res) -print("saving polynomial expression to polynomial.py") -Path("polynomial.py").write_text(INITIAL_STR + str(finished)) - - -print("factoring") -egraph.run(factor_ruleset.saturate()) -print("extracting factored") -finished_factored = egraph.extract(res) -print("saving factored expression to factored.py") -Path("factored.py").write_text(INITIAL_STR + str(finished_factored)) # print("simplifying factored") # egraph.run(simplified_factor_ruleset.saturate()) @@ -402,5 +323,3 @@ def simplified_factor_ruleset( # finished_simplified = egraph.extract(res) # print("saving simplified factored expression to simplified_factored.py") # Path("simplified_factored.py").write_text(INITIAL_STR + str(finished_simplified)) - -Path("polynomials.egg").write_text(egraph.get_egglog_string) diff --git a/uv.lock b/uv.lock index 2d731d46..36a07e3f 100644 --- a/uv.lock +++ b/uv.lock @@ -1,5 +1,4 @@ version = 1 -revision = 3 requires-python = ">=3.11" resolution-markers = [ "python_full_version >= '3.14'", @@ -20,9 +19,9 @@ dependencies = [ { name = "sphinx" }, { name = "watchdog" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/db/81/d6337121f1ba631f3b832815aa22b32777296dc3d2f208b9c4217e23548f/ablog-0.11.12.tar.gz", hash = "sha256:1e6e1239973382adefc00eacc71125604fbfcb1e768a8a940b25fd078f0cea22", size = 107000, upload-time = "2024-11-01T20:04:36.595Z" } +sdist = { url = "https://files.pythonhosted.org/packages/db/81/d6337121f1ba631f3b832815aa22b32777296dc3d2f208b9c4217e23548f/ablog-0.11.12.tar.gz", hash = "sha256:1e6e1239973382adefc00eacc71125604fbfcb1e768a8a940b25fd078f0cea22", size = 107000 } wheels = [ - { url = "https://files.pythonhosted.org/packages/28/26/201a582abb73f049707458a3d04e7bba42a8638df740557f472cdac4346b/ablog-0.11.12-py3-none-any.whl", hash = "sha256:29228f5126550910b8f7a06a961fb10b6542ed64101c5b4887282555b9582020", size = 74516, upload-time = "2024-11-01T20:04:35.401Z" }, + { url = "https://files.pythonhosted.org/packages/28/26/201a582abb73f049707458a3d04e7bba42a8638df740557f472cdac4346b/ablog-0.11.12-py3-none-any.whl", hash = "sha256:29228f5126550910b8f7a06a961fb10b6542ed64101c5b4887282555b9582020", size = 74516 }, ] [[package]] @@ -32,18 +31,18 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pygments" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/bc/c1/bbac6a50d02774f91572938964c582fff4270eee73ab822a4aeea4d8b11b/accessible_pygments-0.0.5.tar.gz", hash = "sha256:40918d3e6a2b619ad424cb91e556bd3bd8865443d9f22f1dcdf79e33c8046872", size = 1377899, upload-time = "2024-05-10T11:23:10.216Z" } +sdist = { url = "https://files.pythonhosted.org/packages/bc/c1/bbac6a50d02774f91572938964c582fff4270eee73ab822a4aeea4d8b11b/accessible_pygments-0.0.5.tar.gz", hash = "sha256:40918d3e6a2b619ad424cb91e556bd3bd8865443d9f22f1dcdf79e33c8046872", size = 1377899 } wheels = [ - { url = "https://files.pythonhosted.org/packages/8d/3f/95338030883d8c8b91223b4e21744b04d11b161a3ef117295d8241f50ab4/accessible_pygments-0.0.5-py3-none-any.whl", hash = "sha256:88ae3211e68a1d0b011504b2ffc1691feafce124b845bd072ab6f9f66f34d4b7", size = 1395903, upload-time = "2024-05-10T11:23:08.421Z" }, + { url = "https://files.pythonhosted.org/packages/8d/3f/95338030883d8c8b91223b4e21744b04d11b161a3ef117295d8241f50ab4/accessible_pygments-0.0.5-py3-none-any.whl", hash = "sha256:88ae3211e68a1d0b011504b2ffc1691feafce124b845bd072ab6f9f66f34d4b7", size = 1395903 }, ] [[package]] name = "alabaster" version = "1.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a6/f8/d9c74d0daf3f742840fd818d69cfae176fa332022fd44e3469487d5a9420/alabaster-1.0.0.tar.gz", hash = "sha256:c00dca57bca26fa62a6d7d0a9fcce65f3e026e9bfe33e9c538fd3fbb2144fd9e", size = 24210, upload-time = "2024-07-26T18:15:03.762Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a6/f8/d9c74d0daf3f742840fd818d69cfae176fa332022fd44e3469487d5a9420/alabaster-1.0.0.tar.gz", hash = "sha256:c00dca57bca26fa62a6d7d0a9fcce65f3e026e9bfe33e9c538fd3fbb2144fd9e", size = 24210 } wheels = [ - { url = "https://files.pythonhosted.org/packages/7e/b3/6b4067be973ae96ba0d615946e314c5ae35f9f993eca561b356540bb0c2b/alabaster-1.0.0-py3-none-any.whl", hash = "sha256:fc6786402dc3fcb2de3cabd5fe455a2db534b371124f1f21de8731783dec828b", size = 13929, upload-time = "2024-07-26T18:15:02.05Z" }, + { url = "https://files.pythonhosted.org/packages/7e/b3/6b4067be973ae96ba0d615946e314c5ae35f9f993eca561b356540bb0c2b/alabaster-1.0.0-py3-none-any.whl", hash = "sha256:fc6786402dc3fcb2de3cabd5fe455a2db534b371124f1f21de8731783dec828b", size = 13929 }, ] [[package]] @@ -55,9 +54,9 @@ dependencies = [ { name = "sniffio" }, { name = "typing-extensions", marker = "python_full_version < '3.13'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/c6/78/7d432127c41b50bccba979505f272c16cbcadcc33645d5fa3a738110ae75/anyio-4.11.0.tar.gz", hash = "sha256:82a8d0b81e318cc5ce71a5f1f8b5c4e63619620b63141ef8c995fa0db95a57c4", size = 219094, upload-time = "2025-09-23T09:19:12.58Z" } +sdist = { url = "https://files.pythonhosted.org/packages/c6/78/7d432127c41b50bccba979505f272c16cbcadcc33645d5fa3a738110ae75/anyio-4.11.0.tar.gz", hash = "sha256:82a8d0b81e318cc5ce71a5f1f8b5c4e63619620b63141ef8c995fa0db95a57c4", size = 219094 } wheels = [ - { url = "https://files.pythonhosted.org/packages/15/b3/9b1a8074496371342ec1e796a96f99c82c945a339cd81a8e73de28b4cf9e/anyio-4.11.0-py3-none-any.whl", hash = "sha256:0287e96f4d26d4149305414d4e3bc32f0dcd0862365a4bddea19d7a1ec38c4fc", size = 109097, upload-time = "2025-09-23T09:19:10.601Z" }, + { url = "https://files.pythonhosted.org/packages/15/b3/9b1a8074496371342ec1e796a96f99c82c945a339cd81a8e73de28b4cf9e/anyio-4.11.0-py3-none-any.whl", hash = "sha256:0287e96f4d26d4149305414d4e3bc32f0dcd0862365a4bddea19d7a1ec38c4fc", size = 109097 }, ] [[package]] @@ -69,9 +68,9 @@ dependencies = [ { name = "psygnal" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/ed/69/20423d6abd2a57d767d20a9dcf3f816bd4cbbe4813ac7c7158ba16e44c3f/anywidget-0.9.18.tar.gz", hash = "sha256:262cf459b517a7d044d6fbc84b953e9c83f026790b2dd3ce90f21a7f8eded00f", size = 9808509, upload-time = "2025-03-23T20:01:22.358Z" } +sdist = { url = "https://files.pythonhosted.org/packages/ed/69/20423d6abd2a57d767d20a9dcf3f816bd4cbbe4813ac7c7158ba16e44c3f/anywidget-0.9.18.tar.gz", hash = "sha256:262cf459b517a7d044d6fbc84b953e9c83f026790b2dd3ce90f21a7f8eded00f", size = 9808509 } wheels = [ - { url = "https://files.pythonhosted.org/packages/2b/f0/09a30ca0551af20c7cefa7464b7ccb6f5407a550b83c4dcb15c410814849/anywidget-0.9.18-py3-none-any.whl", hash = "sha256:944b82ef1dd17b8ff0fb6d1f199f613caf9111338e6e2857da478f6e73770cb8", size = 220671, upload-time = "2025-03-23T20:01:21.057Z" }, + { url = "https://files.pythonhosted.org/packages/2b/f0/09a30ca0551af20c7cefa7464b7ccb6f5407a550b83c4dcb15c410814849/anywidget-0.9.18-py3-none-any.whl", hash = "sha256:944b82ef1dd17b8ff0fb6d1f199f613caf9111338e6e2857da478f6e73770cb8", size = 220671 }, ] [package.optional-dependencies] @@ -83,9 +82,9 @@ dev = [ name = "appnope" version = "0.1.4" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/35/5d/752690df9ef5b76e169e68d6a129fa6d08a7100ca7f754c89495db3c6019/appnope-0.1.4.tar.gz", hash = "sha256:1de3860566df9caf38f01f86f65e0e13e379af54f9e4bee1e66b48f2efffd1ee", size = 4170, upload-time = "2024-02-06T09:43:11.258Z" } +sdist = { url = "https://files.pythonhosted.org/packages/35/5d/752690df9ef5b76e169e68d6a129fa6d08a7100ca7f754c89495db3c6019/appnope-0.1.4.tar.gz", hash = "sha256:1de3860566df9caf38f01f86f65e0e13e379af54f9e4bee1e66b48f2efffd1ee", size = 4170 } wheels = [ - { url = "https://files.pythonhosted.org/packages/81/29/5ecc3a15d5a33e31b26c11426c45c501e439cb865d0bff96315d86443b78/appnope-0.1.4-py2.py3-none-any.whl", hash = "sha256:502575ee11cd7a28c0205f379b525beefebab9d161b7c964670864014ed7213c", size = 4321, upload-time = "2024-02-06T09:43:09.663Z" }, + { url = "https://files.pythonhosted.org/packages/81/29/5ecc3a15d5a33e31b26c11426c45c501e439cb865d0bff96315d86443b78/appnope-0.1.4-py2.py3-none-any.whl", hash = "sha256:502575ee11cd7a28c0205f379b525beefebab9d161b7c964670864014ed7213c", size = 4321 }, ] [[package]] @@ -95,9 +94,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "argon2-cffi-bindings" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/0e/89/ce5af8a7d472a67cc819d5d998aa8c82c5d860608c4db9f46f1162d7dab9/argon2_cffi-25.1.0.tar.gz", hash = "sha256:694ae5cc8a42f4c4e2bf2ca0e64e51e23a040c6a517a85074683d3959e1346c1", size = 45706, upload-time = "2025-06-03T06:55:32.073Z" } +sdist = { url = "https://files.pythonhosted.org/packages/0e/89/ce5af8a7d472a67cc819d5d998aa8c82c5d860608c4db9f46f1162d7dab9/argon2_cffi-25.1.0.tar.gz", hash = "sha256:694ae5cc8a42f4c4e2bf2ca0e64e51e23a040c6a517a85074683d3959e1346c1", size = 45706 } wheels = [ - { url = "https://files.pythonhosted.org/packages/4f/d3/a8b22fa575b297cd6e3e3b0155c7e25db170edf1c74783d6a31a2490b8d9/argon2_cffi-25.1.0-py3-none-any.whl", hash = "sha256:fdc8b074db390fccb6eb4a3604ae7231f219aa669a2652e0f20e16ba513d5741", size = 14657, upload-time = "2025-06-03T06:55:30.804Z" }, + { url = "https://files.pythonhosted.org/packages/4f/d3/a8b22fa575b297cd6e3e3b0155c7e25db170edf1c74783d6a31a2490b8d9/argon2_cffi-25.1.0-py3-none-any.whl", hash = "sha256:fdc8b074db390fccb6eb4a3604ae7231f219aa669a2652e0f20e16ba513d5741", size = 14657 }, ] [[package]] @@ -107,37 +106,37 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "cffi" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/5c/2d/db8af0df73c1cf454f71b2bbe5e356b8c1f8041c979f505b3d3186e520a9/argon2_cffi_bindings-25.1.0.tar.gz", hash = "sha256:b957f3e6ea4d55d820e40ff76f450952807013d361a65d7f28acc0acbf29229d", size = 1783441, upload-time = "2025-07-30T10:02:05.147Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/60/97/3c0a35f46e52108d4707c44b95cfe2afcafc50800b5450c197454569b776/argon2_cffi_bindings-25.1.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:3d3f05610594151994ca9ccb3c771115bdb4daef161976a266f0dd8aa9996b8f", size = 54393, upload-time = "2025-07-30T10:01:40.97Z" }, - { url = "https://files.pythonhosted.org/packages/9d/f4/98bbd6ee89febd4f212696f13c03ca302b8552e7dbf9c8efa11ea4a388c3/argon2_cffi_bindings-25.1.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:8b8efee945193e667a396cbc7b4fb7d357297d6234d30a489905d96caabde56b", size = 29328, upload-time = "2025-07-30T10:01:41.916Z" }, - { url = "https://files.pythonhosted.org/packages/43/24/90a01c0ef12ac91a6be05969f29944643bc1e5e461155ae6559befa8f00b/argon2_cffi_bindings-25.1.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:3c6702abc36bf3ccba3f802b799505def420a1b7039862014a65db3205967f5a", size = 31269, upload-time = "2025-07-30T10:01:42.716Z" }, - { url = "https://files.pythonhosted.org/packages/d4/d3/942aa10782b2697eee7af5e12eeff5ebb325ccfb86dd8abda54174e377e4/argon2_cffi_bindings-25.1.0-cp314-cp314t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a1c70058c6ab1e352304ac7e3b52554daadacd8d453c1752e547c76e9c99ac44", size = 86558, upload-time = "2025-07-30T10:01:43.943Z" }, - { url = "https://files.pythonhosted.org/packages/0d/82/b484f702fec5536e71836fc2dbc8c5267b3f6e78d2d539b4eaa6f0db8bf8/argon2_cffi_bindings-25.1.0-cp314-cp314t-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:e2fd3bfbff3c5d74fef31a722f729bf93500910db650c925c2d6ef879a7e51cb", size = 92364, upload-time = "2025-07-30T10:01:44.887Z" }, - { url = "https://files.pythonhosted.org/packages/c9/c1/a606ff83b3f1735f3759ad0f2cd9e038a0ad11a3de3b6c673aa41c24bb7b/argon2_cffi_bindings-25.1.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:c4f9665de60b1b0e99bcd6be4f17d90339698ce954cfd8d9cf4f91c995165a92", size = 85637, upload-time = "2025-07-30T10:01:46.225Z" }, - { url = "https://files.pythonhosted.org/packages/44/b4/678503f12aceb0262f84fa201f6027ed77d71c5019ae03b399b97caa2f19/argon2_cffi_bindings-25.1.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:ba92837e4a9aa6a508c8d2d7883ed5a8f6c308c89a4790e1e447a220deb79a85", size = 91934, upload-time = "2025-07-30T10:01:47.203Z" }, - { url = "https://files.pythonhosted.org/packages/f0/c7/f36bd08ef9bd9f0a9cff9428406651f5937ce27b6c5b07b92d41f91ae541/argon2_cffi_bindings-25.1.0-cp314-cp314t-win32.whl", hash = "sha256:84a461d4d84ae1295871329b346a97f68eade8c53b6ed9a7ca2d7467f3c8ff6f", size = 28158, upload-time = "2025-07-30T10:01:48.341Z" }, - { url = "https://files.pythonhosted.org/packages/b3/80/0106a7448abb24a2c467bf7d527fe5413b7fdfa4ad6d6a96a43a62ef3988/argon2_cffi_bindings-25.1.0-cp314-cp314t-win_amd64.whl", hash = "sha256:b55aec3565b65f56455eebc9b9f34130440404f27fe21c3b375bf1ea4d8fbae6", size = 32597, upload-time = "2025-07-30T10:01:49.112Z" }, - { url = "https://files.pythonhosted.org/packages/05/b8/d663c9caea07e9180b2cb662772865230715cbd573ba3b5e81793d580316/argon2_cffi_bindings-25.1.0-cp314-cp314t-win_arm64.whl", hash = "sha256:87c33a52407e4c41f3b70a9c2d3f6056d88b10dad7695be708c5021673f55623", size = 28231, upload-time = "2025-07-30T10:01:49.92Z" }, - { url = "https://files.pythonhosted.org/packages/1d/57/96b8b9f93166147826da5f90376e784a10582dd39a393c99bb62cfcf52f0/argon2_cffi_bindings-25.1.0-cp39-abi3-macosx_10_9_universal2.whl", hash = "sha256:aecba1723ae35330a008418a91ea6cfcedf6d31e5fbaa056a166462ff066d500", size = 54121, upload-time = "2025-07-30T10:01:50.815Z" }, - { url = "https://files.pythonhosted.org/packages/0a/08/a9bebdb2e0e602dde230bdde8021b29f71f7841bd54801bcfd514acb5dcf/argon2_cffi_bindings-25.1.0-cp39-abi3-macosx_10_9_x86_64.whl", hash = "sha256:2630b6240b495dfab90aebe159ff784d08ea999aa4b0d17efa734055a07d2f44", size = 29177, upload-time = "2025-07-30T10:01:51.681Z" }, - { url = "https://files.pythonhosted.org/packages/b6/02/d297943bcacf05e4f2a94ab6f462831dc20158614e5d067c35d4e63b9acb/argon2_cffi_bindings-25.1.0-cp39-abi3-macosx_11_0_arm64.whl", hash = "sha256:7aef0c91e2c0fbca6fc68e7555aa60ef7008a739cbe045541e438373bc54d2b0", size = 31090, upload-time = "2025-07-30T10:01:53.184Z" }, - { url = "https://files.pythonhosted.org/packages/c1/93/44365f3d75053e53893ec6d733e4a5e3147502663554b4d864587c7828a7/argon2_cffi_bindings-25.1.0-cp39-abi3-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1e021e87faa76ae0d413b619fe2b65ab9a037f24c60a1e6cc43457ae20de6dc6", size = 81246, upload-time = "2025-07-30T10:01:54.145Z" }, - { url = "https://files.pythonhosted.org/packages/09/52/94108adfdd6e2ddf58be64f959a0b9c7d4ef2fa71086c38356d22dc501ea/argon2_cffi_bindings-25.1.0-cp39-abi3-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d3e924cfc503018a714f94a49a149fdc0b644eaead5d1f089330399134fa028a", size = 87126, upload-time = "2025-07-30T10:01:55.074Z" }, - { url = "https://files.pythonhosted.org/packages/72/70/7a2993a12b0ffa2a9271259b79cc616e2389ed1a4d93842fac5a1f923ffd/argon2_cffi_bindings-25.1.0-cp39-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:c87b72589133f0346a1cb8d5ecca4b933e3c9b64656c9d175270a000e73b288d", size = 80343, upload-time = "2025-07-30T10:01:56.007Z" }, - { url = "https://files.pythonhosted.org/packages/78/9a/4e5157d893ffc712b74dbd868c7f62365618266982b64accab26bab01edc/argon2_cffi_bindings-25.1.0-cp39-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:1db89609c06afa1a214a69a462ea741cf735b29a57530478c06eb81dd403de99", size = 86777, upload-time = "2025-07-30T10:01:56.943Z" }, - { url = "https://files.pythonhosted.org/packages/74/cd/15777dfde1c29d96de7f18edf4cc94c385646852e7c7b0320aa91ccca583/argon2_cffi_bindings-25.1.0-cp39-abi3-win32.whl", hash = "sha256:473bcb5f82924b1becbb637b63303ec8d10e84c8d241119419897a26116515d2", size = 27180, upload-time = "2025-07-30T10:01:57.759Z" }, - { url = "https://files.pythonhosted.org/packages/e2/c6/a759ece8f1829d1f162261226fbfd2c6832b3ff7657384045286d2afa384/argon2_cffi_bindings-25.1.0-cp39-abi3-win_amd64.whl", hash = "sha256:a98cd7d17e9f7ce244c0803cad3c23a7d379c301ba618a5fa76a67d116618b98", size = 31715, upload-time = "2025-07-30T10:01:58.56Z" }, - { url = "https://files.pythonhosted.org/packages/42/b9/f8d6fa329ab25128b7e98fd83a3cb34d9db5b059a9847eddb840a0af45dd/argon2_cffi_bindings-25.1.0-cp39-abi3-win_arm64.whl", hash = "sha256:b0fdbcf513833809c882823f98dc2f931cf659d9a1429616ac3adebb49f5db94", size = 27149, upload-time = "2025-07-30T10:01:59.329Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/5c/2d/db8af0df73c1cf454f71b2bbe5e356b8c1f8041c979f505b3d3186e520a9/argon2_cffi_bindings-25.1.0.tar.gz", hash = "sha256:b957f3e6ea4d55d820e40ff76f450952807013d361a65d7f28acc0acbf29229d", size = 1783441 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/60/97/3c0a35f46e52108d4707c44b95cfe2afcafc50800b5450c197454569b776/argon2_cffi_bindings-25.1.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:3d3f05610594151994ca9ccb3c771115bdb4daef161976a266f0dd8aa9996b8f", size = 54393 }, + { url = "https://files.pythonhosted.org/packages/9d/f4/98bbd6ee89febd4f212696f13c03ca302b8552e7dbf9c8efa11ea4a388c3/argon2_cffi_bindings-25.1.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:8b8efee945193e667a396cbc7b4fb7d357297d6234d30a489905d96caabde56b", size = 29328 }, + { url = "https://files.pythonhosted.org/packages/43/24/90a01c0ef12ac91a6be05969f29944643bc1e5e461155ae6559befa8f00b/argon2_cffi_bindings-25.1.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:3c6702abc36bf3ccba3f802b799505def420a1b7039862014a65db3205967f5a", size = 31269 }, + { url = "https://files.pythonhosted.org/packages/d4/d3/942aa10782b2697eee7af5e12eeff5ebb325ccfb86dd8abda54174e377e4/argon2_cffi_bindings-25.1.0-cp314-cp314t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a1c70058c6ab1e352304ac7e3b52554daadacd8d453c1752e547c76e9c99ac44", size = 86558 }, + { url = "https://files.pythonhosted.org/packages/0d/82/b484f702fec5536e71836fc2dbc8c5267b3f6e78d2d539b4eaa6f0db8bf8/argon2_cffi_bindings-25.1.0-cp314-cp314t-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:e2fd3bfbff3c5d74fef31a722f729bf93500910db650c925c2d6ef879a7e51cb", size = 92364 }, + { url = "https://files.pythonhosted.org/packages/c9/c1/a606ff83b3f1735f3759ad0f2cd9e038a0ad11a3de3b6c673aa41c24bb7b/argon2_cffi_bindings-25.1.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:c4f9665de60b1b0e99bcd6be4f17d90339698ce954cfd8d9cf4f91c995165a92", size = 85637 }, + { url = "https://files.pythonhosted.org/packages/44/b4/678503f12aceb0262f84fa201f6027ed77d71c5019ae03b399b97caa2f19/argon2_cffi_bindings-25.1.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:ba92837e4a9aa6a508c8d2d7883ed5a8f6c308c89a4790e1e447a220deb79a85", size = 91934 }, + { url = "https://files.pythonhosted.org/packages/f0/c7/f36bd08ef9bd9f0a9cff9428406651f5937ce27b6c5b07b92d41f91ae541/argon2_cffi_bindings-25.1.0-cp314-cp314t-win32.whl", hash = "sha256:84a461d4d84ae1295871329b346a97f68eade8c53b6ed9a7ca2d7467f3c8ff6f", size = 28158 }, + { url = "https://files.pythonhosted.org/packages/b3/80/0106a7448abb24a2c467bf7d527fe5413b7fdfa4ad6d6a96a43a62ef3988/argon2_cffi_bindings-25.1.0-cp314-cp314t-win_amd64.whl", hash = "sha256:b55aec3565b65f56455eebc9b9f34130440404f27fe21c3b375bf1ea4d8fbae6", size = 32597 }, + { url = "https://files.pythonhosted.org/packages/05/b8/d663c9caea07e9180b2cb662772865230715cbd573ba3b5e81793d580316/argon2_cffi_bindings-25.1.0-cp314-cp314t-win_arm64.whl", hash = "sha256:87c33a52407e4c41f3b70a9c2d3f6056d88b10dad7695be708c5021673f55623", size = 28231 }, + { url = "https://files.pythonhosted.org/packages/1d/57/96b8b9f93166147826da5f90376e784a10582dd39a393c99bb62cfcf52f0/argon2_cffi_bindings-25.1.0-cp39-abi3-macosx_10_9_universal2.whl", hash = "sha256:aecba1723ae35330a008418a91ea6cfcedf6d31e5fbaa056a166462ff066d500", size = 54121 }, + { url = "https://files.pythonhosted.org/packages/0a/08/a9bebdb2e0e602dde230bdde8021b29f71f7841bd54801bcfd514acb5dcf/argon2_cffi_bindings-25.1.0-cp39-abi3-macosx_10_9_x86_64.whl", hash = "sha256:2630b6240b495dfab90aebe159ff784d08ea999aa4b0d17efa734055a07d2f44", size = 29177 }, + { url = "https://files.pythonhosted.org/packages/b6/02/d297943bcacf05e4f2a94ab6f462831dc20158614e5d067c35d4e63b9acb/argon2_cffi_bindings-25.1.0-cp39-abi3-macosx_11_0_arm64.whl", hash = "sha256:7aef0c91e2c0fbca6fc68e7555aa60ef7008a739cbe045541e438373bc54d2b0", size = 31090 }, + { url = "https://files.pythonhosted.org/packages/c1/93/44365f3d75053e53893ec6d733e4a5e3147502663554b4d864587c7828a7/argon2_cffi_bindings-25.1.0-cp39-abi3-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1e021e87faa76ae0d413b619fe2b65ab9a037f24c60a1e6cc43457ae20de6dc6", size = 81246 }, + { url = "https://files.pythonhosted.org/packages/09/52/94108adfdd6e2ddf58be64f959a0b9c7d4ef2fa71086c38356d22dc501ea/argon2_cffi_bindings-25.1.0-cp39-abi3-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d3e924cfc503018a714f94a49a149fdc0b644eaead5d1f089330399134fa028a", size = 87126 }, + { url = "https://files.pythonhosted.org/packages/72/70/7a2993a12b0ffa2a9271259b79cc616e2389ed1a4d93842fac5a1f923ffd/argon2_cffi_bindings-25.1.0-cp39-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:c87b72589133f0346a1cb8d5ecca4b933e3c9b64656c9d175270a000e73b288d", size = 80343 }, + { url = "https://files.pythonhosted.org/packages/78/9a/4e5157d893ffc712b74dbd868c7f62365618266982b64accab26bab01edc/argon2_cffi_bindings-25.1.0-cp39-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:1db89609c06afa1a214a69a462ea741cf735b29a57530478c06eb81dd403de99", size = 86777 }, + { url = "https://files.pythonhosted.org/packages/74/cd/15777dfde1c29d96de7f18edf4cc94c385646852e7c7b0320aa91ccca583/argon2_cffi_bindings-25.1.0-cp39-abi3-win32.whl", hash = "sha256:473bcb5f82924b1becbb637b63303ec8d10e84c8d241119419897a26116515d2", size = 27180 }, + { url = "https://files.pythonhosted.org/packages/e2/c6/a759ece8f1829d1f162261226fbfd2c6832b3ff7657384045286d2afa384/argon2_cffi_bindings-25.1.0-cp39-abi3-win_amd64.whl", hash = "sha256:a98cd7d17e9f7ce244c0803cad3c23a7d379c301ba618a5fa76a67d116618b98", size = 31715 }, + { url = "https://files.pythonhosted.org/packages/42/b9/f8d6fa329ab25128b7e98fd83a3cb34d9db5b059a9847eddb840a0af45dd/argon2_cffi_bindings-25.1.0-cp39-abi3-win_arm64.whl", hash = "sha256:b0fdbcf513833809c882823f98dc2f931cf659d9a1429616ac3adebb49f5db94", size = 27149 }, ] [[package]] name = "array-api-compat" version = "1.12.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/8d/bd/9fa5c7c5621698d5632cc852a79fbbdc28024462c9396698e5fdcb395f37/array_api_compat-1.12.0.tar.gz", hash = "sha256:585bc615f650de53ac24b7c012baecfcdd810f50df3573be47e6dd9fa20df974", size = 99883, upload-time = "2025-05-16T08:49:59.897Z" } +sdist = { url = "https://files.pythonhosted.org/packages/8d/bd/9fa5c7c5621698d5632cc852a79fbbdc28024462c9396698e5fdcb395f37/array_api_compat-1.12.0.tar.gz", hash = "sha256:585bc615f650de53ac24b7c012baecfcdd810f50df3573be47e6dd9fa20df974", size = 99883 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e0/b1/0542e0cab6f49f151a2d7a42400f84f706fc0b64e85dc1f56708b2e9fd37/array_api_compat-1.12.0-py3-none-any.whl", hash = "sha256:a0b4795b6944a9507fde54679f9350e2ad2b1e2acf4a2408a098cdc27f890a8b", size = 58156, upload-time = "2025-05-16T08:49:58.129Z" }, + { url = "https://files.pythonhosted.org/packages/e0/b1/0542e0cab6f49f151a2d7a42400f84f706fc0b64e85dc1f56708b2e9fd37/array_api_compat-1.12.0-py3-none-any.whl", hash = "sha256:a0b4795b6944a9507fde54679f9350e2ad2b1e2acf4a2408a098cdc27f890a8b", size = 58156 }, ] [[package]] @@ -148,45 +147,45 @@ dependencies = [ { name = "python-dateutil" }, { name = "tzdata" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/b9/33/032cdc44182491aa708d06a68b62434140d8c50820a087fac7af37703357/arrow-1.4.0.tar.gz", hash = "sha256:ed0cc050e98001b8779e84d461b0098c4ac597e88704a655582b21d116e526d7", size = 152931, upload-time = "2025-10-18T17:46:46.761Z" } +sdist = { url = "https://files.pythonhosted.org/packages/b9/33/032cdc44182491aa708d06a68b62434140d8c50820a087fac7af37703357/arrow-1.4.0.tar.gz", hash = "sha256:ed0cc050e98001b8779e84d461b0098c4ac597e88704a655582b21d116e526d7", size = 152931 } wheels = [ - { url = "https://files.pythonhosted.org/packages/ed/c9/d7977eaacb9df673210491da99e6a247e93df98c715fc43fd136ce1d3d33/arrow-1.4.0-py3-none-any.whl", hash = "sha256:749f0769958ebdc79c173ff0b0670d59051a535fa26e8eba02953dc19eb43205", size = 68797, upload-time = "2025-10-18T17:46:45.663Z" }, + { url = "https://files.pythonhosted.org/packages/ed/c9/d7977eaacb9df673210491da99e6a247e93df98c715fc43fd136ce1d3d33/arrow-1.4.0-py3-none-any.whl", hash = "sha256:749f0769958ebdc79c173ff0b0670d59051a535fa26e8eba02953dc19eb43205", size = 68797 }, ] [[package]] name = "asttokens" version = "3.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/4a/e7/82da0a03e7ba5141f05cce0d302e6eed121ae055e0456ca228bf693984bc/asttokens-3.0.0.tar.gz", hash = "sha256:0dcd8baa8d62b0c1d118b399b2ddba3c4aff271d0d7a9e0d4c1681c79035bbc7", size = 61978, upload-time = "2024-11-30T04:30:14.439Z" } +sdist = { url = "https://files.pythonhosted.org/packages/4a/e7/82da0a03e7ba5141f05cce0d302e6eed121ae055e0456ca228bf693984bc/asttokens-3.0.0.tar.gz", hash = "sha256:0dcd8baa8d62b0c1d118b399b2ddba3c4aff271d0d7a9e0d4c1681c79035bbc7", size = 61978 } wheels = [ - { url = "https://files.pythonhosted.org/packages/25/8a/c46dcc25341b5bce5472c718902eb3d38600a903b14fa6aeecef3f21a46f/asttokens-3.0.0-py3-none-any.whl", hash = "sha256:e3078351a059199dd5138cb1c706e6430c05eff2ff136af5eb4790f9d28932e2", size = 26918, upload-time = "2024-11-30T04:30:10.946Z" }, + { url = "https://files.pythonhosted.org/packages/25/8a/c46dcc25341b5bce5472c718902eb3d38600a903b14fa6aeecef3f21a46f/asttokens-3.0.0-py3-none-any.whl", hash = "sha256:e3078351a059199dd5138cb1c706e6430c05eff2ff136af5eb4790f9d28932e2", size = 26918 }, ] [[package]] name = "async-lru" version = "2.0.5" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/b2/4d/71ec4d3939dc755264f680f6c2b4906423a304c3d18e96853f0a595dfe97/async_lru-2.0.5.tar.gz", hash = "sha256:481d52ccdd27275f42c43a928b4a50c3bfb2d67af4e78b170e3e0bb39c66e5bb", size = 10380, upload-time = "2025-03-16T17:25:36.919Z" } +sdist = { url = "https://files.pythonhosted.org/packages/b2/4d/71ec4d3939dc755264f680f6c2b4906423a304c3d18e96853f0a595dfe97/async_lru-2.0.5.tar.gz", hash = "sha256:481d52ccdd27275f42c43a928b4a50c3bfb2d67af4e78b170e3e0bb39c66e5bb", size = 10380 } wheels = [ - { url = "https://files.pythonhosted.org/packages/03/49/d10027df9fce941cb8184e78a02857af36360d33e1721df81c5ed2179a1a/async_lru-2.0.5-py3-none-any.whl", hash = "sha256:ab95404d8d2605310d345932697371a5f40def0487c03d6d0ad9138de52c9943", size = 6069, upload-time = "2025-03-16T17:25:35.422Z" }, + { url = "https://files.pythonhosted.org/packages/03/49/d10027df9fce941cb8184e78a02857af36360d33e1721df81c5ed2179a1a/async_lru-2.0.5-py3-none-any.whl", hash = "sha256:ab95404d8d2605310d345932697371a5f40def0487c03d6d0ad9138de52c9943", size = 6069 }, ] [[package]] name = "attrs" version = "25.4.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/6b/5c/685e6633917e101e5dcb62b9dd76946cbb57c26e133bae9e0cd36033c0a9/attrs-25.4.0.tar.gz", hash = "sha256:16d5969b87f0859ef33a48b35d55ac1be6e42ae49d5e853b597db70c35c57e11", size = 934251, upload-time = "2025-10-06T13:54:44.725Z" } +sdist = { url = "https://files.pythonhosted.org/packages/6b/5c/685e6633917e101e5dcb62b9dd76946cbb57c26e133bae9e0cd36033c0a9/attrs-25.4.0.tar.gz", hash = "sha256:16d5969b87f0859ef33a48b35d55ac1be6e42ae49d5e853b597db70c35c57e11", size = 934251 } wheels = [ - { url = "https://files.pythonhosted.org/packages/3a/2a/7cc015f5b9f5db42b7d48157e23356022889fc354a2813c15934b7cb5c0e/attrs-25.4.0-py3-none-any.whl", hash = "sha256:adcf7e2a1fb3b36ac48d97835bb6d8ade15b8dcce26aba8bf1d14847b57a3373", size = 67615, upload-time = "2025-10-06T13:54:43.17Z" }, + { url = "https://files.pythonhosted.org/packages/3a/2a/7cc015f5b9f5db42b7d48157e23356022889fc354a2813c15934b7cb5c0e/attrs-25.4.0-py3-none-any.whl", hash = "sha256:adcf7e2a1fb3b36ac48d97835bb6d8ade15b8dcce26aba8bf1d14847b57a3373", size = 67615 }, ] [[package]] name = "babel" version = "2.17.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/7d/6b/d52e42361e1aa00709585ecc30b3f9684b3ab62530771402248b1b1d6240/babel-2.17.0.tar.gz", hash = "sha256:0c54cffb19f690cdcc52a3b50bcbf71e07a808d1c80d549f2459b9d2cf0afb9d", size = 9951852, upload-time = "2025-02-01T15:17:41.026Z" } +sdist = { url = "https://files.pythonhosted.org/packages/7d/6b/d52e42361e1aa00709585ecc30b3f9684b3ab62530771402248b1b1d6240/babel-2.17.0.tar.gz", hash = "sha256:0c54cffb19f690cdcc52a3b50bcbf71e07a808d1c80d549f2459b9d2cf0afb9d", size = 9951852 } wheels = [ - { url = "https://files.pythonhosted.org/packages/b7/b8/3fe70c75fe32afc4bb507f75563d39bc5642255d1d94f1f23604725780bf/babel-2.17.0-py3-none-any.whl", hash = "sha256:4d0b53093fdfb4b21c92b5213dba5a1b23885afa8383709427046b21c366e5f2", size = 10182537, upload-time = "2025-02-01T15:17:37.39Z" }, + { url = "https://files.pythonhosted.org/packages/b7/b8/3fe70c75fe32afc4bb507f75563d39bc5642255d1d94f1f23604725780bf/babel-2.17.0-py3-none-any.whl", hash = "sha256:4d0b53093fdfb4b21c92b5213dba5a1b23885afa8383709427046b21c366e5f2", size = 10182537 }, ] [[package]] @@ -197,9 +196,9 @@ dependencies = [ { name = "soupsieve" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/77/e9/df2358efd7659577435e2177bfa69cba6c33216681af51a707193dec162a/beautifulsoup4-4.14.2.tar.gz", hash = "sha256:2a98ab9f944a11acee9cc848508ec28d9228abfd522ef0fad6a02a72e0ded69e", size = 625822, upload-time = "2025-09-29T10:05:42.613Z" } +sdist = { url = "https://files.pythonhosted.org/packages/77/e9/df2358efd7659577435e2177bfa69cba6c33216681af51a707193dec162a/beautifulsoup4-4.14.2.tar.gz", hash = "sha256:2a98ab9f944a11acee9cc848508ec28d9228abfd522ef0fad6a02a72e0ded69e", size = 625822 } wheels = [ - { url = "https://files.pythonhosted.org/packages/94/fe/3aed5d0be4d404d12d36ab97e2f1791424d9ca39c2f754a6285d59a3b01d/beautifulsoup4-4.14.2-py3-none-any.whl", hash = "sha256:5ef6fa3a8cbece8488d66985560f97ed091e22bbc4e9c2338508a9d5de6d4515", size = 106392, upload-time = "2025-09-29T10:05:43.771Z" }, + { url = "https://files.pythonhosted.org/packages/94/fe/3aed5d0be4d404d12d36ab97e2f1791424d9ca39c2f754a6285d59a3b01d/beautifulsoup4-4.14.2-py3-none-any.whl", hash = "sha256:5ef6fa3a8cbece8488d66985560f97ed091e22bbc4e9c2338508a9d5de6d4515", size = 106392 }, ] [[package]] @@ -214,21 +213,21 @@ dependencies = [ { name = "platformdirs" }, { name = "pytokens" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/4b/43/20b5c90612d7bdb2bdbcceeb53d588acca3bb8f0e4c5d5c751a2c8fdd55a/black-25.9.0.tar.gz", hash = "sha256:0474bca9a0dd1b51791fcc507a4e02078a1c63f6d4e4ae5544b9848c7adfb619", size = 648393, upload-time = "2025-09-19T00:27:37.758Z" } +sdist = { url = "https://files.pythonhosted.org/packages/4b/43/20b5c90612d7bdb2bdbcceeb53d588acca3bb8f0e4c5d5c751a2c8fdd55a/black-25.9.0.tar.gz", hash = "sha256:0474bca9a0dd1b51791fcc507a4e02078a1c63f6d4e4ae5544b9848c7adfb619", size = 648393 } wheels = [ - { url = "https://files.pythonhosted.org/packages/b7/f4/7531d4a336d2d4ac6cc101662184c8e7d068b548d35d874415ed9f4116ef/black-25.9.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:456386fe87bad41b806d53c062e2974615825c7a52159cde7ccaeb0695fa28fa", size = 1698727, upload-time = "2025-09-19T00:31:14.264Z" }, - { url = "https://files.pythonhosted.org/packages/28/f9/66f26bfbbf84b949cc77a41a43e138d83b109502cd9c52dfc94070ca51f2/black-25.9.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:a16b14a44c1af60a210d8da28e108e13e75a284bf21a9afa6b4571f96ab8bb9d", size = 1555679, upload-time = "2025-09-19T00:31:29.265Z" }, - { url = "https://files.pythonhosted.org/packages/bf/59/61475115906052f415f518a648a9ac679d7afbc8da1c16f8fdf68a8cebed/black-25.9.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:aaf319612536d502fdd0e88ce52d8f1352b2c0a955cc2798f79eeca9d3af0608", size = 1617453, upload-time = "2025-09-19T00:30:42.24Z" }, - { url = "https://files.pythonhosted.org/packages/7f/5b/20fd5c884d14550c911e4fb1b0dae00d4abb60a4f3876b449c4d3a9141d5/black-25.9.0-cp311-cp311-win_amd64.whl", hash = "sha256:c0372a93e16b3954208417bfe448e09b0de5cc721d521866cd9e0acac3c04a1f", size = 1333655, upload-time = "2025-09-19T00:30:56.715Z" }, - { url = "https://files.pythonhosted.org/packages/fb/8e/319cfe6c82f7e2d5bfb4d3353c6cc85b523d677ff59edc61fdb9ee275234/black-25.9.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:1b9dc70c21ef8b43248f1d86aedd2aaf75ae110b958a7909ad8463c4aa0880b0", size = 1742012, upload-time = "2025-09-19T00:33:08.678Z" }, - { url = "https://files.pythonhosted.org/packages/94/cc/f562fe5d0a40cd2a4e6ae3f685e4c36e365b1f7e494af99c26ff7f28117f/black-25.9.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:8e46eecf65a095fa62e53245ae2795c90bdecabd53b50c448d0a8bcd0d2e74c4", size = 1581421, upload-time = "2025-09-19T00:35:25.937Z" }, - { url = "https://files.pythonhosted.org/packages/84/67/6db6dff1ebc8965fd7661498aea0da5d7301074b85bba8606a28f47ede4d/black-25.9.0-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9101ee58ddc2442199a25cb648d46ba22cd580b00ca4b44234a324e3ec7a0f7e", size = 1655619, upload-time = "2025-09-19T00:30:49.241Z" }, - { url = "https://files.pythonhosted.org/packages/10/10/3faef9aa2a730306cf469d76f7f155a8cc1f66e74781298df0ba31f8b4c8/black-25.9.0-cp312-cp312-win_amd64.whl", hash = "sha256:77e7060a00c5ec4b3367c55f39cf9b06e68965a4f2e61cecacd6d0d9b7ec945a", size = 1342481, upload-time = "2025-09-19T00:31:29.625Z" }, - { url = "https://files.pythonhosted.org/packages/48/99/3acfea65f5e79f45472c45f87ec13037b506522719cd9d4ac86484ff51ac/black-25.9.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:0172a012f725b792c358d57fe7b6b6e8e67375dd157f64fa7a3097b3ed3e2175", size = 1742165, upload-time = "2025-09-19T00:34:10.402Z" }, - { url = "https://files.pythonhosted.org/packages/3a/18/799285282c8236a79f25d590f0222dbd6850e14b060dfaa3e720241fd772/black-25.9.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:3bec74ee60f8dfef564b573a96b8930f7b6a538e846123d5ad77ba14a8d7a64f", size = 1581259, upload-time = "2025-09-19T00:32:49.685Z" }, - { url = "https://files.pythonhosted.org/packages/f1/ce/883ec4b6303acdeca93ee06b7622f1fa383c6b3765294824165d49b1a86b/black-25.9.0-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b756fc75871cb1bcac5499552d771822fd9db5a2bb8db2a7247936ca48f39831", size = 1655583, upload-time = "2025-09-19T00:30:44.505Z" }, - { url = "https://files.pythonhosted.org/packages/21/17/5c253aa80a0639ccc427a5c7144534b661505ae2b5a10b77ebe13fa25334/black-25.9.0-cp313-cp313-win_amd64.whl", hash = "sha256:846d58e3ce7879ec1ffe816bb9df6d006cd9590515ed5d17db14e17666b2b357", size = 1343428, upload-time = "2025-09-19T00:32:13.839Z" }, - { url = "https://files.pythonhosted.org/packages/1b/46/863c90dcd3f9d41b109b7f19032ae0db021f0b2a81482ba0a1e28c84de86/black-25.9.0-py3-none-any.whl", hash = "sha256:474b34c1342cdc157d307b56c4c65bce916480c4a8f6551fdc6bf9b486a7c4ae", size = 203363, upload-time = "2025-09-19T00:27:35.724Z" }, + { url = "https://files.pythonhosted.org/packages/b7/f4/7531d4a336d2d4ac6cc101662184c8e7d068b548d35d874415ed9f4116ef/black-25.9.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:456386fe87bad41b806d53c062e2974615825c7a52159cde7ccaeb0695fa28fa", size = 1698727 }, + { url = "https://files.pythonhosted.org/packages/28/f9/66f26bfbbf84b949cc77a41a43e138d83b109502cd9c52dfc94070ca51f2/black-25.9.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:a16b14a44c1af60a210d8da28e108e13e75a284bf21a9afa6b4571f96ab8bb9d", size = 1555679 }, + { url = "https://files.pythonhosted.org/packages/bf/59/61475115906052f415f518a648a9ac679d7afbc8da1c16f8fdf68a8cebed/black-25.9.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:aaf319612536d502fdd0e88ce52d8f1352b2c0a955cc2798f79eeca9d3af0608", size = 1617453 }, + { url = "https://files.pythonhosted.org/packages/7f/5b/20fd5c884d14550c911e4fb1b0dae00d4abb60a4f3876b449c4d3a9141d5/black-25.9.0-cp311-cp311-win_amd64.whl", hash = "sha256:c0372a93e16b3954208417bfe448e09b0de5cc721d521866cd9e0acac3c04a1f", size = 1333655 }, + { url = "https://files.pythonhosted.org/packages/fb/8e/319cfe6c82f7e2d5bfb4d3353c6cc85b523d677ff59edc61fdb9ee275234/black-25.9.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:1b9dc70c21ef8b43248f1d86aedd2aaf75ae110b958a7909ad8463c4aa0880b0", size = 1742012 }, + { url = "https://files.pythonhosted.org/packages/94/cc/f562fe5d0a40cd2a4e6ae3f685e4c36e365b1f7e494af99c26ff7f28117f/black-25.9.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:8e46eecf65a095fa62e53245ae2795c90bdecabd53b50c448d0a8bcd0d2e74c4", size = 1581421 }, + { url = "https://files.pythonhosted.org/packages/84/67/6db6dff1ebc8965fd7661498aea0da5d7301074b85bba8606a28f47ede4d/black-25.9.0-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9101ee58ddc2442199a25cb648d46ba22cd580b00ca4b44234a324e3ec7a0f7e", size = 1655619 }, + { url = "https://files.pythonhosted.org/packages/10/10/3faef9aa2a730306cf469d76f7f155a8cc1f66e74781298df0ba31f8b4c8/black-25.9.0-cp312-cp312-win_amd64.whl", hash = "sha256:77e7060a00c5ec4b3367c55f39cf9b06e68965a4f2e61cecacd6d0d9b7ec945a", size = 1342481 }, + { url = "https://files.pythonhosted.org/packages/48/99/3acfea65f5e79f45472c45f87ec13037b506522719cd9d4ac86484ff51ac/black-25.9.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:0172a012f725b792c358d57fe7b6b6e8e67375dd157f64fa7a3097b3ed3e2175", size = 1742165 }, + { url = "https://files.pythonhosted.org/packages/3a/18/799285282c8236a79f25d590f0222dbd6850e14b060dfaa3e720241fd772/black-25.9.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:3bec74ee60f8dfef564b573a96b8930f7b6a538e846123d5ad77ba14a8d7a64f", size = 1581259 }, + { url = "https://files.pythonhosted.org/packages/f1/ce/883ec4b6303acdeca93ee06b7622f1fa383c6b3765294824165d49b1a86b/black-25.9.0-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b756fc75871cb1bcac5499552d771822fd9db5a2bb8db2a7247936ca48f39831", size = 1655583 }, + { url = "https://files.pythonhosted.org/packages/21/17/5c253aa80a0639ccc427a5c7144534b661505ae2b5a10b77ebe13fa25334/black-25.9.0-cp313-cp313-win_amd64.whl", hash = "sha256:846d58e3ce7879ec1ffe816bb9df6d006cd9590515ed5d17db14e17666b2b357", size = 1343428 }, + { url = "https://files.pythonhosted.org/packages/1b/46/863c90dcd3f9d41b109b7f19032ae0db021f0b2a81482ba0a1e28c84de86/black-25.9.0-py3-none-any.whl", hash = "sha256:474b34c1342cdc157d307b56c4c65bce916480c4a8f6551fdc6bf9b486a7c4ae", size = 203363 }, ] [[package]] @@ -238,9 +237,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "webencodings" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/07/18/3c8523962314be6bf4c8989c79ad9531c825210dd13a8669f6b84336e8bd/bleach-6.3.0.tar.gz", hash = "sha256:6f3b91b1c0a02bb9a78b5a454c92506aa0fdf197e1d5e114d2e00c6f64306d22", size = 203533, upload-time = "2025-10-27T17:57:39.211Z" } +sdist = { url = "https://files.pythonhosted.org/packages/07/18/3c8523962314be6bf4c8989c79ad9531c825210dd13a8669f6b84336e8bd/bleach-6.3.0.tar.gz", hash = "sha256:6f3b91b1c0a02bb9a78b5a454c92506aa0fdf197e1d5e114d2e00c6f64306d22", size = 203533 } wheels = [ - { url = "https://files.pythonhosted.org/packages/cd/3a/577b549de0cc09d95f11087ee63c739bba856cd3952697eec4c4bb91350a/bleach-6.3.0-py3-none-any.whl", hash = "sha256:fe10ec77c93ddf3d13a73b035abaac7a9f5e436513864ccdad516693213c65d6", size = 164437, upload-time = "2025-10-27T17:57:37.538Z" }, + { url = "https://files.pythonhosted.org/packages/cd/3a/577b549de0cc09d95f11087ee63c739bba856cd3952697eec4c4bb91350a/bleach-6.3.0-py3-none-any.whl", hash = "sha256:fe10ec77c93ddf3d13a73b035abaac7a9f5e436513864ccdad516693213c65d6", size = 164437 }, ] [package.optional-dependencies] @@ -252,9 +251,9 @@ css = [ name = "certifi" version = "2025.10.5" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/4c/5b/b6ce21586237c77ce67d01dc5507039d444b630dd76611bbca2d8e5dcd91/certifi-2025.10.5.tar.gz", hash = "sha256:47c09d31ccf2acf0be3f701ea53595ee7e0b8fa08801c6624be771df09ae7b43", size = 164519, upload-time = "2025-10-05T04:12:15.808Z" } +sdist = { url = "https://files.pythonhosted.org/packages/4c/5b/b6ce21586237c77ce67d01dc5507039d444b630dd76611bbca2d8e5dcd91/certifi-2025.10.5.tar.gz", hash = "sha256:47c09d31ccf2acf0be3f701ea53595ee7e0b8fa08801c6624be771df09ae7b43", size = 164519 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e4/37/af0d2ef3967ac0d6113837b44a4f0bfe1328c2b9763bd5b1744520e5cfed/certifi-2025.10.5-py3-none-any.whl", hash = "sha256:0f212c2744a9bb6de0c56639a6f68afe01ecd92d91f14ae897c4fe7bbeeef0de", size = 163286, upload-time = "2025-10-05T04:12:14.03Z" }, + { url = "https://files.pythonhosted.org/packages/e4/37/af0d2ef3967ac0d6113837b44a4f0bfe1328c2b9763bd5b1744520e5cfed/certifi-2025.10.5-py3-none-any.whl", hash = "sha256:0f212c2744a9bb6de0c56639a6f68afe01ecd92d91f14ae897c4fe7bbeeef0de", size = 163286 }, ] [[package]] @@ -264,149 +263,149 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pycparser", marker = "implementation_name != 'PyPy'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/eb/56/b1ba7935a17738ae8453301356628e8147c79dbb825bcbc73dc7401f9846/cffi-2.0.0.tar.gz", hash = "sha256:44d1b5909021139fe36001ae048dbdde8214afa20200eda0f64c068cac5d5529", size = 523588, upload-time = "2025-09-08T23:24:04.541Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/12/4a/3dfd5f7850cbf0d06dc84ba9aa00db766b52ca38d8b86e3a38314d52498c/cffi-2.0.0-cp311-cp311-macosx_10_13_x86_64.whl", hash = "sha256:b4c854ef3adc177950a8dfc81a86f5115d2abd545751a304c5bcf2c2c7283cfe", size = 184344, upload-time = "2025-09-08T23:22:26.456Z" }, - { url = "https://files.pythonhosted.org/packages/4f/8b/f0e4c441227ba756aafbe78f117485b25bb26b1c059d01f137fa6d14896b/cffi-2.0.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:2de9a304e27f7596cd03d16f1b7c72219bd944e99cc52b84d0145aefb07cbd3c", size = 180560, upload-time = "2025-09-08T23:22:28.197Z" }, - { url = "https://files.pythonhosted.org/packages/b1/b7/1200d354378ef52ec227395d95c2576330fd22a869f7a70e88e1447eb234/cffi-2.0.0-cp311-cp311-manylinux1_i686.manylinux2014_i686.manylinux_2_17_i686.manylinux_2_5_i686.whl", hash = "sha256:baf5215e0ab74c16e2dd324e8ec067ef59e41125d3eade2b863d294fd5035c92", size = 209613, upload-time = "2025-09-08T23:22:29.475Z" }, - { url = "https://files.pythonhosted.org/packages/b8/56/6033f5e86e8cc9bb629f0077ba71679508bdf54a9a5e112a3c0b91870332/cffi-2.0.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:730cacb21e1bdff3ce90babf007d0a0917cc3e6492f336c2f0134101e0944f93", size = 216476, upload-time = "2025-09-08T23:22:31.063Z" }, - { url = "https://files.pythonhosted.org/packages/dc/7f/55fecd70f7ece178db2f26128ec41430d8720f2d12ca97bf8f0a628207d5/cffi-2.0.0-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:6824f87845e3396029f3820c206e459ccc91760e8fa24422f8b0c3d1731cbec5", size = 203374, upload-time = "2025-09-08T23:22:32.507Z" }, - { url = "https://files.pythonhosted.org/packages/84/ef/a7b77c8bdc0f77adc3b46888f1ad54be8f3b7821697a7b89126e829e676a/cffi-2.0.0-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:9de40a7b0323d889cf8d23d1ef214f565ab154443c42737dfe52ff82cf857664", size = 202597, upload-time = "2025-09-08T23:22:34.132Z" }, - { url = "https://files.pythonhosted.org/packages/d7/91/500d892b2bf36529a75b77958edfcd5ad8e2ce4064ce2ecfeab2125d72d1/cffi-2.0.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:8941aaadaf67246224cee8c3803777eed332a19d909b47e29c9842ef1e79ac26", size = 215574, upload-time = "2025-09-08T23:22:35.443Z" }, - { url = "https://files.pythonhosted.org/packages/44/64/58f6255b62b101093d5df22dcb752596066c7e89dd725e0afaed242a61be/cffi-2.0.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:a05d0c237b3349096d3981b727493e22147f934b20f6f125a3eba8f994bec4a9", size = 218971, upload-time = "2025-09-08T23:22:36.805Z" }, - { url = "https://files.pythonhosted.org/packages/ab/49/fa72cebe2fd8a55fbe14956f9970fe8eb1ac59e5df042f603ef7c8ba0adc/cffi-2.0.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:94698a9c5f91f9d138526b48fe26a199609544591f859c870d477351dc7b2414", size = 211972, upload-time = "2025-09-08T23:22:38.436Z" }, - { url = "https://files.pythonhosted.org/packages/0b/28/dd0967a76aab36731b6ebfe64dec4e981aff7e0608f60c2d46b46982607d/cffi-2.0.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:5fed36fccc0612a53f1d4d9a816b50a36702c28a2aa880cb8a122b3466638743", size = 217078, upload-time = "2025-09-08T23:22:39.776Z" }, - { url = "https://files.pythonhosted.org/packages/2b/c0/015b25184413d7ab0a410775fdb4a50fca20f5589b5dab1dbbfa3baad8ce/cffi-2.0.0-cp311-cp311-win32.whl", hash = "sha256:c649e3a33450ec82378822b3dad03cc228b8f5963c0c12fc3b1e0ab940f768a5", size = 172076, upload-time = "2025-09-08T23:22:40.95Z" }, - { url = "https://files.pythonhosted.org/packages/ae/8f/dc5531155e7070361eb1b7e4c1a9d896d0cb21c49f807a6c03fd63fc877e/cffi-2.0.0-cp311-cp311-win_amd64.whl", hash = "sha256:66f011380d0e49ed280c789fbd08ff0d40968ee7b665575489afa95c98196ab5", size = 182820, upload-time = "2025-09-08T23:22:42.463Z" }, - { url = "https://files.pythonhosted.org/packages/95/5c/1b493356429f9aecfd56bc171285a4c4ac8697f76e9bbbbb105e537853a1/cffi-2.0.0-cp311-cp311-win_arm64.whl", hash = "sha256:c6638687455baf640e37344fe26d37c404db8b80d037c3d29f58fe8d1c3b194d", size = 177635, upload-time = "2025-09-08T23:22:43.623Z" }, - { url = "https://files.pythonhosted.org/packages/ea/47/4f61023ea636104d4f16ab488e268b93008c3d0bb76893b1b31db1f96802/cffi-2.0.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:6d02d6655b0e54f54c4ef0b94eb6be0607b70853c45ce98bd278dc7de718be5d", size = 185271, upload-time = "2025-09-08T23:22:44.795Z" }, - { url = "https://files.pythonhosted.org/packages/df/a2/781b623f57358e360d62cdd7a8c681f074a71d445418a776eef0aadb4ab4/cffi-2.0.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:8eca2a813c1cb7ad4fb74d368c2ffbbb4789d377ee5bb8df98373c2cc0dee76c", size = 181048, upload-time = "2025-09-08T23:22:45.938Z" }, - { url = "https://files.pythonhosted.org/packages/ff/df/a4f0fbd47331ceeba3d37c2e51e9dfc9722498becbeec2bd8bc856c9538a/cffi-2.0.0-cp312-cp312-manylinux1_i686.manylinux2014_i686.manylinux_2_17_i686.manylinux_2_5_i686.whl", hash = "sha256:21d1152871b019407d8ac3985f6775c079416c282e431a4da6afe7aefd2bccbe", size = 212529, upload-time = "2025-09-08T23:22:47.349Z" }, - { url = "https://files.pythonhosted.org/packages/d5/72/12b5f8d3865bf0f87cf1404d8c374e7487dcf097a1c91c436e72e6badd83/cffi-2.0.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:b21e08af67b8a103c71a250401c78d5e0893beff75e28c53c98f4de42f774062", size = 220097, upload-time = "2025-09-08T23:22:48.677Z" }, - { url = "https://files.pythonhosted.org/packages/c2/95/7a135d52a50dfa7c882ab0ac17e8dc11cec9d55d2c18dda414c051c5e69e/cffi-2.0.0-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:1e3a615586f05fc4065a8b22b8152f0c1b00cdbc60596d187c2a74f9e3036e4e", size = 207983, upload-time = "2025-09-08T23:22:50.06Z" }, - { url = "https://files.pythonhosted.org/packages/3a/c8/15cb9ada8895957ea171c62dc78ff3e99159ee7adb13c0123c001a2546c1/cffi-2.0.0-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:81afed14892743bbe14dacb9e36d9e0e504cd204e0b165062c488942b9718037", size = 206519, upload-time = "2025-09-08T23:22:51.364Z" }, - { url = "https://files.pythonhosted.org/packages/78/2d/7fa73dfa841b5ac06c7b8855cfc18622132e365f5b81d02230333ff26e9e/cffi-2.0.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:3e17ed538242334bf70832644a32a7aae3d83b57567f9fd60a26257e992b79ba", size = 219572, upload-time = "2025-09-08T23:22:52.902Z" }, - { url = "https://files.pythonhosted.org/packages/07/e0/267e57e387b4ca276b90f0434ff88b2c2241ad72b16d31836adddfd6031b/cffi-2.0.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:3925dd22fa2b7699ed2617149842d2e6adde22b262fcbfada50e3d195e4b3a94", size = 222963, upload-time = "2025-09-08T23:22:54.518Z" }, - { url = "https://files.pythonhosted.org/packages/b6/75/1f2747525e06f53efbd878f4d03bac5b859cbc11c633d0fb81432d98a795/cffi-2.0.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:2c8f814d84194c9ea681642fd164267891702542f028a15fc97d4674b6206187", size = 221361, upload-time = "2025-09-08T23:22:55.867Z" }, - { url = "https://files.pythonhosted.org/packages/7b/2b/2b6435f76bfeb6bbf055596976da087377ede68df465419d192acf00c437/cffi-2.0.0-cp312-cp312-win32.whl", hash = "sha256:da902562c3e9c550df360bfa53c035b2f241fed6d9aef119048073680ace4a18", size = 172932, upload-time = "2025-09-08T23:22:57.188Z" }, - { url = "https://files.pythonhosted.org/packages/f8/ed/13bd4418627013bec4ed6e54283b1959cf6db888048c7cf4b4c3b5b36002/cffi-2.0.0-cp312-cp312-win_amd64.whl", hash = "sha256:da68248800ad6320861f129cd9c1bf96ca849a2771a59e0344e88681905916f5", size = 183557, upload-time = "2025-09-08T23:22:58.351Z" }, - { url = "https://files.pythonhosted.org/packages/95/31/9f7f93ad2f8eff1dbc1c3656d7ca5bfd8fb52c9d786b4dcf19b2d02217fa/cffi-2.0.0-cp312-cp312-win_arm64.whl", hash = "sha256:4671d9dd5ec934cb9a73e7ee9676f9362aba54f7f34910956b84d727b0d73fb6", size = 177762, upload-time = "2025-09-08T23:22:59.668Z" }, - { url = "https://files.pythonhosted.org/packages/4b/8d/a0a47a0c9e413a658623d014e91e74a50cdd2c423f7ccfd44086ef767f90/cffi-2.0.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:00bdf7acc5f795150faa6957054fbbca2439db2f775ce831222b66f192f03beb", size = 185230, upload-time = "2025-09-08T23:23:00.879Z" }, - { url = "https://files.pythonhosted.org/packages/4a/d2/a6c0296814556c68ee32009d9c2ad4f85f2707cdecfd7727951ec228005d/cffi-2.0.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:45d5e886156860dc35862657e1494b9bae8dfa63bf56796f2fb56e1679fc0bca", size = 181043, upload-time = "2025-09-08T23:23:02.231Z" }, - { url = "https://files.pythonhosted.org/packages/b0/1e/d22cc63332bd59b06481ceaac49d6c507598642e2230f201649058a7e704/cffi-2.0.0-cp313-cp313-manylinux1_i686.manylinux2014_i686.manylinux_2_17_i686.manylinux_2_5_i686.whl", hash = "sha256:07b271772c100085dd28b74fa0cd81c8fb1a3ba18b21e03d7c27f3436a10606b", size = 212446, upload-time = "2025-09-08T23:23:03.472Z" }, - { url = "https://files.pythonhosted.org/packages/a9/f5/a2c23eb03b61a0b8747f211eb716446c826ad66818ddc7810cc2cc19b3f2/cffi-2.0.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:d48a880098c96020b02d5a1f7d9251308510ce8858940e6fa99ece33f610838b", size = 220101, upload-time = "2025-09-08T23:23:04.792Z" }, - { url = "https://files.pythonhosted.org/packages/f2/7f/e6647792fc5850d634695bc0e6ab4111ae88e89981d35ac269956605feba/cffi-2.0.0-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:f93fd8e5c8c0a4aa1f424d6173f14a892044054871c771f8566e4008eaa359d2", size = 207948, upload-time = "2025-09-08T23:23:06.127Z" }, - { url = "https://files.pythonhosted.org/packages/cb/1e/a5a1bd6f1fb30f22573f76533de12a00bf274abcdc55c8edab639078abb6/cffi-2.0.0-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:dd4f05f54a52fb558f1ba9f528228066954fee3ebe629fc1660d874d040ae5a3", size = 206422, upload-time = "2025-09-08T23:23:07.753Z" }, - { url = "https://files.pythonhosted.org/packages/98/df/0a1755e750013a2081e863e7cd37e0cdd02664372c754e5560099eb7aa44/cffi-2.0.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:c8d3b5532fc71b7a77c09192b4a5a200ea992702734a2e9279a37f2478236f26", size = 219499, upload-time = "2025-09-08T23:23:09.648Z" }, - { url = "https://files.pythonhosted.org/packages/50/e1/a969e687fcf9ea58e6e2a928ad5e2dd88cc12f6f0ab477e9971f2309b57c/cffi-2.0.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:d9b29c1f0ae438d5ee9acb31cadee00a58c46cc9c0b2f9038c6b0b3470877a8c", size = 222928, upload-time = "2025-09-08T23:23:10.928Z" }, - { url = "https://files.pythonhosted.org/packages/36/54/0362578dd2c9e557a28ac77698ed67323ed5b9775ca9d3fe73fe191bb5d8/cffi-2.0.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:6d50360be4546678fc1b79ffe7a66265e28667840010348dd69a314145807a1b", size = 221302, upload-time = "2025-09-08T23:23:12.42Z" }, - { url = "https://files.pythonhosted.org/packages/eb/6d/bf9bda840d5f1dfdbf0feca87fbdb64a918a69bca42cfa0ba7b137c48cb8/cffi-2.0.0-cp313-cp313-win32.whl", hash = "sha256:74a03b9698e198d47562765773b4a8309919089150a0bb17d829ad7b44b60d27", size = 172909, upload-time = "2025-09-08T23:23:14.32Z" }, - { url = "https://files.pythonhosted.org/packages/37/18/6519e1ee6f5a1e579e04b9ddb6f1676c17368a7aba48299c3759bbc3c8b3/cffi-2.0.0-cp313-cp313-win_amd64.whl", hash = "sha256:19f705ada2530c1167abacb171925dd886168931e0a7b78f5bffcae5c6b5be75", size = 183402, upload-time = "2025-09-08T23:23:15.535Z" }, - { url = "https://files.pythonhosted.org/packages/cb/0e/02ceeec9a7d6ee63bb596121c2c8e9b3a9e150936f4fbef6ca1943e6137c/cffi-2.0.0-cp313-cp313-win_arm64.whl", hash = "sha256:256f80b80ca3853f90c21b23ee78cd008713787b1b1e93eae9f3d6a7134abd91", size = 177780, upload-time = "2025-09-08T23:23:16.761Z" }, - { url = "https://files.pythonhosted.org/packages/92/c4/3ce07396253a83250ee98564f8d7e9789fab8e58858f35d07a9a2c78de9f/cffi-2.0.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:fc33c5141b55ed366cfaad382df24fe7dcbc686de5be719b207bb248e3053dc5", size = 185320, upload-time = "2025-09-08T23:23:18.087Z" }, - { url = "https://files.pythonhosted.org/packages/59/dd/27e9fa567a23931c838c6b02d0764611c62290062a6d4e8ff7863daf9730/cffi-2.0.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:c654de545946e0db659b3400168c9ad31b5d29593291482c43e3564effbcee13", size = 181487, upload-time = "2025-09-08T23:23:19.622Z" }, - { url = "https://files.pythonhosted.org/packages/d6/43/0e822876f87ea8a4ef95442c3d766a06a51fc5298823f884ef87aaad168c/cffi-2.0.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:24b6f81f1983e6df8db3adc38562c83f7d4a0c36162885ec7f7b77c7dcbec97b", size = 220049, upload-time = "2025-09-08T23:23:20.853Z" }, - { url = "https://files.pythonhosted.org/packages/b4/89/76799151d9c2d2d1ead63c2429da9ea9d7aac304603de0c6e8764e6e8e70/cffi-2.0.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:12873ca6cb9b0f0d3a0da705d6086fe911591737a59f28b7936bdfed27c0d47c", size = 207793, upload-time = "2025-09-08T23:23:22.08Z" }, - { url = "https://files.pythonhosted.org/packages/bb/dd/3465b14bb9e24ee24cb88c9e3730f6de63111fffe513492bf8c808a3547e/cffi-2.0.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:d9b97165e8aed9272a6bb17c01e3cc5871a594a446ebedc996e2397a1c1ea8ef", size = 206300, upload-time = "2025-09-08T23:23:23.314Z" }, - { url = "https://files.pythonhosted.org/packages/47/d9/d83e293854571c877a92da46fdec39158f8d7e68da75bf73581225d28e90/cffi-2.0.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:afb8db5439b81cf9c9d0c80404b60c3cc9c3add93e114dcae767f1477cb53775", size = 219244, upload-time = "2025-09-08T23:23:24.541Z" }, - { url = "https://files.pythonhosted.org/packages/2b/0f/1f177e3683aead2bb00f7679a16451d302c436b5cbf2505f0ea8146ef59e/cffi-2.0.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:737fe7d37e1a1bffe70bd5754ea763a62a066dc5913ca57e957824b72a85e205", size = 222828, upload-time = "2025-09-08T23:23:26.143Z" }, - { url = "https://files.pythonhosted.org/packages/c6/0f/cafacebd4b040e3119dcb32fed8bdef8dfe94da653155f9d0b9dc660166e/cffi-2.0.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:38100abb9d1b1435bc4cc340bb4489635dc2f0da7456590877030c9b3d40b0c1", size = 220926, upload-time = "2025-09-08T23:23:27.873Z" }, - { url = "https://files.pythonhosted.org/packages/3e/aa/df335faa45b395396fcbc03de2dfcab242cd61a9900e914fe682a59170b1/cffi-2.0.0-cp314-cp314-win32.whl", hash = "sha256:087067fa8953339c723661eda6b54bc98c5625757ea62e95eb4898ad5e776e9f", size = 175328, upload-time = "2025-09-08T23:23:44.61Z" }, - { url = "https://files.pythonhosted.org/packages/bb/92/882c2d30831744296ce713f0feb4c1cd30f346ef747b530b5318715cc367/cffi-2.0.0-cp314-cp314-win_amd64.whl", hash = "sha256:203a48d1fb583fc7d78a4c6655692963b860a417c0528492a6bc21f1aaefab25", size = 185650, upload-time = "2025-09-08T23:23:45.848Z" }, - { url = "https://files.pythonhosted.org/packages/9f/2c/98ece204b9d35a7366b5b2c6539c350313ca13932143e79dc133ba757104/cffi-2.0.0-cp314-cp314-win_arm64.whl", hash = "sha256:dbd5c7a25a7cb98f5ca55d258b103a2054f859a46ae11aaf23134f9cc0d356ad", size = 180687, upload-time = "2025-09-08T23:23:47.105Z" }, - { url = "https://files.pythonhosted.org/packages/3e/61/c768e4d548bfa607abcda77423448df8c471f25dbe64fb2ef6d555eae006/cffi-2.0.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:9a67fc9e8eb39039280526379fb3a70023d77caec1852002b4da7e8b270c4dd9", size = 188773, upload-time = "2025-09-08T23:23:29.347Z" }, - { url = "https://files.pythonhosted.org/packages/2c/ea/5f76bce7cf6fcd0ab1a1058b5af899bfbef198bea4d5686da88471ea0336/cffi-2.0.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:7a66c7204d8869299919db4d5069a82f1561581af12b11b3c9f48c584eb8743d", size = 185013, upload-time = "2025-09-08T23:23:30.63Z" }, - { url = "https://files.pythonhosted.org/packages/be/b4/c56878d0d1755cf9caa54ba71e5d049479c52f9e4afc230f06822162ab2f/cffi-2.0.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:7cc09976e8b56f8cebd752f7113ad07752461f48a58cbba644139015ac24954c", size = 221593, upload-time = "2025-09-08T23:23:31.91Z" }, - { url = "https://files.pythonhosted.org/packages/e0/0d/eb704606dfe8033e7128df5e90fee946bbcb64a04fcdaa97321309004000/cffi-2.0.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:92b68146a71df78564e4ef48af17551a5ddd142e5190cdf2c5624d0c3ff5b2e8", size = 209354, upload-time = "2025-09-08T23:23:33.214Z" }, - { url = "https://files.pythonhosted.org/packages/d8/19/3c435d727b368ca475fb8742ab97c9cb13a0de600ce86f62eab7fa3eea60/cffi-2.0.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:b1e74d11748e7e98e2f426ab176d4ed720a64412b6a15054378afdb71e0f37dc", size = 208480, upload-time = "2025-09-08T23:23:34.495Z" }, - { url = "https://files.pythonhosted.org/packages/d0/44/681604464ed9541673e486521497406fadcc15b5217c3e326b061696899a/cffi-2.0.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:28a3a209b96630bca57cce802da70c266eb08c6e97e5afd61a75611ee6c64592", size = 221584, upload-time = "2025-09-08T23:23:36.096Z" }, - { url = "https://files.pythonhosted.org/packages/25/8e/342a504ff018a2825d395d44d63a767dd8ebc927ebda557fecdaca3ac33a/cffi-2.0.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:7553fb2090d71822f02c629afe6042c299edf91ba1bf94951165613553984512", size = 224443, upload-time = "2025-09-08T23:23:37.328Z" }, - { url = "https://files.pythonhosted.org/packages/e1/5e/b666bacbbc60fbf415ba9988324a132c9a7a0448a9a8f125074671c0f2c3/cffi-2.0.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:6c6c373cfc5c83a975506110d17457138c8c63016b563cc9ed6e056a82f13ce4", size = 223437, upload-time = "2025-09-08T23:23:38.945Z" }, - { url = "https://files.pythonhosted.org/packages/a0/1d/ec1a60bd1a10daa292d3cd6bb0b359a81607154fb8165f3ec95fe003b85c/cffi-2.0.0-cp314-cp314t-win32.whl", hash = "sha256:1fc9ea04857caf665289b7a75923f2c6ed559b8298a1b8c49e59f7dd95c8481e", size = 180487, upload-time = "2025-09-08T23:23:40.423Z" }, - { url = "https://files.pythonhosted.org/packages/bf/41/4c1168c74fac325c0c8156f04b6749c8b6a8f405bbf91413ba088359f60d/cffi-2.0.0-cp314-cp314t-win_amd64.whl", hash = "sha256:d68b6cef7827e8641e8ef16f4494edda8b36104d79773a334beaa1e3521430f6", size = 191726, upload-time = "2025-09-08T23:23:41.742Z" }, - { url = "https://files.pythonhosted.org/packages/ae/3a/dbeec9d1ee0844c679f6bb5d6ad4e9f198b1224f4e7a32825f47f6192b0c/cffi-2.0.0-cp314-cp314t-win_arm64.whl", hash = "sha256:0a1527a803f0a659de1af2e1fd700213caba79377e27e4693648c2923da066f9", size = 184195, upload-time = "2025-09-08T23:23:43.004Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/eb/56/b1ba7935a17738ae8453301356628e8147c79dbb825bcbc73dc7401f9846/cffi-2.0.0.tar.gz", hash = "sha256:44d1b5909021139fe36001ae048dbdde8214afa20200eda0f64c068cac5d5529", size = 523588 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/12/4a/3dfd5f7850cbf0d06dc84ba9aa00db766b52ca38d8b86e3a38314d52498c/cffi-2.0.0-cp311-cp311-macosx_10_13_x86_64.whl", hash = "sha256:b4c854ef3adc177950a8dfc81a86f5115d2abd545751a304c5bcf2c2c7283cfe", size = 184344 }, + { url = "https://files.pythonhosted.org/packages/4f/8b/f0e4c441227ba756aafbe78f117485b25bb26b1c059d01f137fa6d14896b/cffi-2.0.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:2de9a304e27f7596cd03d16f1b7c72219bd944e99cc52b84d0145aefb07cbd3c", size = 180560 }, + { url = "https://files.pythonhosted.org/packages/b1/b7/1200d354378ef52ec227395d95c2576330fd22a869f7a70e88e1447eb234/cffi-2.0.0-cp311-cp311-manylinux1_i686.manylinux2014_i686.manylinux_2_17_i686.manylinux_2_5_i686.whl", hash = "sha256:baf5215e0ab74c16e2dd324e8ec067ef59e41125d3eade2b863d294fd5035c92", size = 209613 }, + { url = "https://files.pythonhosted.org/packages/b8/56/6033f5e86e8cc9bb629f0077ba71679508bdf54a9a5e112a3c0b91870332/cffi-2.0.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:730cacb21e1bdff3ce90babf007d0a0917cc3e6492f336c2f0134101e0944f93", size = 216476 }, + { url = "https://files.pythonhosted.org/packages/dc/7f/55fecd70f7ece178db2f26128ec41430d8720f2d12ca97bf8f0a628207d5/cffi-2.0.0-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:6824f87845e3396029f3820c206e459ccc91760e8fa24422f8b0c3d1731cbec5", size = 203374 }, + { url = "https://files.pythonhosted.org/packages/84/ef/a7b77c8bdc0f77adc3b46888f1ad54be8f3b7821697a7b89126e829e676a/cffi-2.0.0-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:9de40a7b0323d889cf8d23d1ef214f565ab154443c42737dfe52ff82cf857664", size = 202597 }, + { url = "https://files.pythonhosted.org/packages/d7/91/500d892b2bf36529a75b77958edfcd5ad8e2ce4064ce2ecfeab2125d72d1/cffi-2.0.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:8941aaadaf67246224cee8c3803777eed332a19d909b47e29c9842ef1e79ac26", size = 215574 }, + { url = "https://files.pythonhosted.org/packages/44/64/58f6255b62b101093d5df22dcb752596066c7e89dd725e0afaed242a61be/cffi-2.0.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:a05d0c237b3349096d3981b727493e22147f934b20f6f125a3eba8f994bec4a9", size = 218971 }, + { url = "https://files.pythonhosted.org/packages/ab/49/fa72cebe2fd8a55fbe14956f9970fe8eb1ac59e5df042f603ef7c8ba0adc/cffi-2.0.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:94698a9c5f91f9d138526b48fe26a199609544591f859c870d477351dc7b2414", size = 211972 }, + { url = "https://files.pythonhosted.org/packages/0b/28/dd0967a76aab36731b6ebfe64dec4e981aff7e0608f60c2d46b46982607d/cffi-2.0.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:5fed36fccc0612a53f1d4d9a816b50a36702c28a2aa880cb8a122b3466638743", size = 217078 }, + { url = "https://files.pythonhosted.org/packages/2b/c0/015b25184413d7ab0a410775fdb4a50fca20f5589b5dab1dbbfa3baad8ce/cffi-2.0.0-cp311-cp311-win32.whl", hash = "sha256:c649e3a33450ec82378822b3dad03cc228b8f5963c0c12fc3b1e0ab940f768a5", size = 172076 }, + { url = "https://files.pythonhosted.org/packages/ae/8f/dc5531155e7070361eb1b7e4c1a9d896d0cb21c49f807a6c03fd63fc877e/cffi-2.0.0-cp311-cp311-win_amd64.whl", hash = "sha256:66f011380d0e49ed280c789fbd08ff0d40968ee7b665575489afa95c98196ab5", size = 182820 }, + { url = "https://files.pythonhosted.org/packages/95/5c/1b493356429f9aecfd56bc171285a4c4ac8697f76e9bbbbb105e537853a1/cffi-2.0.0-cp311-cp311-win_arm64.whl", hash = "sha256:c6638687455baf640e37344fe26d37c404db8b80d037c3d29f58fe8d1c3b194d", size = 177635 }, + { url = "https://files.pythonhosted.org/packages/ea/47/4f61023ea636104d4f16ab488e268b93008c3d0bb76893b1b31db1f96802/cffi-2.0.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:6d02d6655b0e54f54c4ef0b94eb6be0607b70853c45ce98bd278dc7de718be5d", size = 185271 }, + { url = "https://files.pythonhosted.org/packages/df/a2/781b623f57358e360d62cdd7a8c681f074a71d445418a776eef0aadb4ab4/cffi-2.0.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:8eca2a813c1cb7ad4fb74d368c2ffbbb4789d377ee5bb8df98373c2cc0dee76c", size = 181048 }, + { url = "https://files.pythonhosted.org/packages/ff/df/a4f0fbd47331ceeba3d37c2e51e9dfc9722498becbeec2bd8bc856c9538a/cffi-2.0.0-cp312-cp312-manylinux1_i686.manylinux2014_i686.manylinux_2_17_i686.manylinux_2_5_i686.whl", hash = "sha256:21d1152871b019407d8ac3985f6775c079416c282e431a4da6afe7aefd2bccbe", size = 212529 }, + { url = "https://files.pythonhosted.org/packages/d5/72/12b5f8d3865bf0f87cf1404d8c374e7487dcf097a1c91c436e72e6badd83/cffi-2.0.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:b21e08af67b8a103c71a250401c78d5e0893beff75e28c53c98f4de42f774062", size = 220097 }, + { url = "https://files.pythonhosted.org/packages/c2/95/7a135d52a50dfa7c882ab0ac17e8dc11cec9d55d2c18dda414c051c5e69e/cffi-2.0.0-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:1e3a615586f05fc4065a8b22b8152f0c1b00cdbc60596d187c2a74f9e3036e4e", size = 207983 }, + { url = "https://files.pythonhosted.org/packages/3a/c8/15cb9ada8895957ea171c62dc78ff3e99159ee7adb13c0123c001a2546c1/cffi-2.0.0-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:81afed14892743bbe14dacb9e36d9e0e504cd204e0b165062c488942b9718037", size = 206519 }, + { url = "https://files.pythonhosted.org/packages/78/2d/7fa73dfa841b5ac06c7b8855cfc18622132e365f5b81d02230333ff26e9e/cffi-2.0.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:3e17ed538242334bf70832644a32a7aae3d83b57567f9fd60a26257e992b79ba", size = 219572 }, + { url = "https://files.pythonhosted.org/packages/07/e0/267e57e387b4ca276b90f0434ff88b2c2241ad72b16d31836adddfd6031b/cffi-2.0.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:3925dd22fa2b7699ed2617149842d2e6adde22b262fcbfada50e3d195e4b3a94", size = 222963 }, + { url = "https://files.pythonhosted.org/packages/b6/75/1f2747525e06f53efbd878f4d03bac5b859cbc11c633d0fb81432d98a795/cffi-2.0.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:2c8f814d84194c9ea681642fd164267891702542f028a15fc97d4674b6206187", size = 221361 }, + { url = "https://files.pythonhosted.org/packages/7b/2b/2b6435f76bfeb6bbf055596976da087377ede68df465419d192acf00c437/cffi-2.0.0-cp312-cp312-win32.whl", hash = "sha256:da902562c3e9c550df360bfa53c035b2f241fed6d9aef119048073680ace4a18", size = 172932 }, + { url = "https://files.pythonhosted.org/packages/f8/ed/13bd4418627013bec4ed6e54283b1959cf6db888048c7cf4b4c3b5b36002/cffi-2.0.0-cp312-cp312-win_amd64.whl", hash = "sha256:da68248800ad6320861f129cd9c1bf96ca849a2771a59e0344e88681905916f5", size = 183557 }, + { url = "https://files.pythonhosted.org/packages/95/31/9f7f93ad2f8eff1dbc1c3656d7ca5bfd8fb52c9d786b4dcf19b2d02217fa/cffi-2.0.0-cp312-cp312-win_arm64.whl", hash = "sha256:4671d9dd5ec934cb9a73e7ee9676f9362aba54f7f34910956b84d727b0d73fb6", size = 177762 }, + { url = "https://files.pythonhosted.org/packages/4b/8d/a0a47a0c9e413a658623d014e91e74a50cdd2c423f7ccfd44086ef767f90/cffi-2.0.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:00bdf7acc5f795150faa6957054fbbca2439db2f775ce831222b66f192f03beb", size = 185230 }, + { url = "https://files.pythonhosted.org/packages/4a/d2/a6c0296814556c68ee32009d9c2ad4f85f2707cdecfd7727951ec228005d/cffi-2.0.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:45d5e886156860dc35862657e1494b9bae8dfa63bf56796f2fb56e1679fc0bca", size = 181043 }, + { url = "https://files.pythonhosted.org/packages/b0/1e/d22cc63332bd59b06481ceaac49d6c507598642e2230f201649058a7e704/cffi-2.0.0-cp313-cp313-manylinux1_i686.manylinux2014_i686.manylinux_2_17_i686.manylinux_2_5_i686.whl", hash = "sha256:07b271772c100085dd28b74fa0cd81c8fb1a3ba18b21e03d7c27f3436a10606b", size = 212446 }, + { url = "https://files.pythonhosted.org/packages/a9/f5/a2c23eb03b61a0b8747f211eb716446c826ad66818ddc7810cc2cc19b3f2/cffi-2.0.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:d48a880098c96020b02d5a1f7d9251308510ce8858940e6fa99ece33f610838b", size = 220101 }, + { url = "https://files.pythonhosted.org/packages/f2/7f/e6647792fc5850d634695bc0e6ab4111ae88e89981d35ac269956605feba/cffi-2.0.0-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:f93fd8e5c8c0a4aa1f424d6173f14a892044054871c771f8566e4008eaa359d2", size = 207948 }, + { url = "https://files.pythonhosted.org/packages/cb/1e/a5a1bd6f1fb30f22573f76533de12a00bf274abcdc55c8edab639078abb6/cffi-2.0.0-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:dd4f05f54a52fb558f1ba9f528228066954fee3ebe629fc1660d874d040ae5a3", size = 206422 }, + { url = "https://files.pythonhosted.org/packages/98/df/0a1755e750013a2081e863e7cd37e0cdd02664372c754e5560099eb7aa44/cffi-2.0.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:c8d3b5532fc71b7a77c09192b4a5a200ea992702734a2e9279a37f2478236f26", size = 219499 }, + { url = "https://files.pythonhosted.org/packages/50/e1/a969e687fcf9ea58e6e2a928ad5e2dd88cc12f6f0ab477e9971f2309b57c/cffi-2.0.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:d9b29c1f0ae438d5ee9acb31cadee00a58c46cc9c0b2f9038c6b0b3470877a8c", size = 222928 }, + { url = "https://files.pythonhosted.org/packages/36/54/0362578dd2c9e557a28ac77698ed67323ed5b9775ca9d3fe73fe191bb5d8/cffi-2.0.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:6d50360be4546678fc1b79ffe7a66265e28667840010348dd69a314145807a1b", size = 221302 }, + { url = "https://files.pythonhosted.org/packages/eb/6d/bf9bda840d5f1dfdbf0feca87fbdb64a918a69bca42cfa0ba7b137c48cb8/cffi-2.0.0-cp313-cp313-win32.whl", hash = "sha256:74a03b9698e198d47562765773b4a8309919089150a0bb17d829ad7b44b60d27", size = 172909 }, + { url = "https://files.pythonhosted.org/packages/37/18/6519e1ee6f5a1e579e04b9ddb6f1676c17368a7aba48299c3759bbc3c8b3/cffi-2.0.0-cp313-cp313-win_amd64.whl", hash = "sha256:19f705ada2530c1167abacb171925dd886168931e0a7b78f5bffcae5c6b5be75", size = 183402 }, + { url = "https://files.pythonhosted.org/packages/cb/0e/02ceeec9a7d6ee63bb596121c2c8e9b3a9e150936f4fbef6ca1943e6137c/cffi-2.0.0-cp313-cp313-win_arm64.whl", hash = "sha256:256f80b80ca3853f90c21b23ee78cd008713787b1b1e93eae9f3d6a7134abd91", size = 177780 }, + { url = "https://files.pythonhosted.org/packages/92/c4/3ce07396253a83250ee98564f8d7e9789fab8e58858f35d07a9a2c78de9f/cffi-2.0.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:fc33c5141b55ed366cfaad382df24fe7dcbc686de5be719b207bb248e3053dc5", size = 185320 }, + { url = "https://files.pythonhosted.org/packages/59/dd/27e9fa567a23931c838c6b02d0764611c62290062a6d4e8ff7863daf9730/cffi-2.0.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:c654de545946e0db659b3400168c9ad31b5d29593291482c43e3564effbcee13", size = 181487 }, + { url = "https://files.pythonhosted.org/packages/d6/43/0e822876f87ea8a4ef95442c3d766a06a51fc5298823f884ef87aaad168c/cffi-2.0.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:24b6f81f1983e6df8db3adc38562c83f7d4a0c36162885ec7f7b77c7dcbec97b", size = 220049 }, + { url = "https://files.pythonhosted.org/packages/b4/89/76799151d9c2d2d1ead63c2429da9ea9d7aac304603de0c6e8764e6e8e70/cffi-2.0.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:12873ca6cb9b0f0d3a0da705d6086fe911591737a59f28b7936bdfed27c0d47c", size = 207793 }, + { url = "https://files.pythonhosted.org/packages/bb/dd/3465b14bb9e24ee24cb88c9e3730f6de63111fffe513492bf8c808a3547e/cffi-2.0.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:d9b97165e8aed9272a6bb17c01e3cc5871a594a446ebedc996e2397a1c1ea8ef", size = 206300 }, + { url = "https://files.pythonhosted.org/packages/47/d9/d83e293854571c877a92da46fdec39158f8d7e68da75bf73581225d28e90/cffi-2.0.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:afb8db5439b81cf9c9d0c80404b60c3cc9c3add93e114dcae767f1477cb53775", size = 219244 }, + { url = "https://files.pythonhosted.org/packages/2b/0f/1f177e3683aead2bb00f7679a16451d302c436b5cbf2505f0ea8146ef59e/cffi-2.0.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:737fe7d37e1a1bffe70bd5754ea763a62a066dc5913ca57e957824b72a85e205", size = 222828 }, + { url = "https://files.pythonhosted.org/packages/c6/0f/cafacebd4b040e3119dcb32fed8bdef8dfe94da653155f9d0b9dc660166e/cffi-2.0.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:38100abb9d1b1435bc4cc340bb4489635dc2f0da7456590877030c9b3d40b0c1", size = 220926 }, + { url = "https://files.pythonhosted.org/packages/3e/aa/df335faa45b395396fcbc03de2dfcab242cd61a9900e914fe682a59170b1/cffi-2.0.0-cp314-cp314-win32.whl", hash = "sha256:087067fa8953339c723661eda6b54bc98c5625757ea62e95eb4898ad5e776e9f", size = 175328 }, + { url = "https://files.pythonhosted.org/packages/bb/92/882c2d30831744296ce713f0feb4c1cd30f346ef747b530b5318715cc367/cffi-2.0.0-cp314-cp314-win_amd64.whl", hash = "sha256:203a48d1fb583fc7d78a4c6655692963b860a417c0528492a6bc21f1aaefab25", size = 185650 }, + { url = "https://files.pythonhosted.org/packages/9f/2c/98ece204b9d35a7366b5b2c6539c350313ca13932143e79dc133ba757104/cffi-2.0.0-cp314-cp314-win_arm64.whl", hash = "sha256:dbd5c7a25a7cb98f5ca55d258b103a2054f859a46ae11aaf23134f9cc0d356ad", size = 180687 }, + { url = "https://files.pythonhosted.org/packages/3e/61/c768e4d548bfa607abcda77423448df8c471f25dbe64fb2ef6d555eae006/cffi-2.0.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:9a67fc9e8eb39039280526379fb3a70023d77caec1852002b4da7e8b270c4dd9", size = 188773 }, + { url = "https://files.pythonhosted.org/packages/2c/ea/5f76bce7cf6fcd0ab1a1058b5af899bfbef198bea4d5686da88471ea0336/cffi-2.0.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:7a66c7204d8869299919db4d5069a82f1561581af12b11b3c9f48c584eb8743d", size = 185013 }, + { url = "https://files.pythonhosted.org/packages/be/b4/c56878d0d1755cf9caa54ba71e5d049479c52f9e4afc230f06822162ab2f/cffi-2.0.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:7cc09976e8b56f8cebd752f7113ad07752461f48a58cbba644139015ac24954c", size = 221593 }, + { url = "https://files.pythonhosted.org/packages/e0/0d/eb704606dfe8033e7128df5e90fee946bbcb64a04fcdaa97321309004000/cffi-2.0.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:92b68146a71df78564e4ef48af17551a5ddd142e5190cdf2c5624d0c3ff5b2e8", size = 209354 }, + { url = "https://files.pythonhosted.org/packages/d8/19/3c435d727b368ca475fb8742ab97c9cb13a0de600ce86f62eab7fa3eea60/cffi-2.0.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:b1e74d11748e7e98e2f426ab176d4ed720a64412b6a15054378afdb71e0f37dc", size = 208480 }, + { url = "https://files.pythonhosted.org/packages/d0/44/681604464ed9541673e486521497406fadcc15b5217c3e326b061696899a/cffi-2.0.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:28a3a209b96630bca57cce802da70c266eb08c6e97e5afd61a75611ee6c64592", size = 221584 }, + { url = "https://files.pythonhosted.org/packages/25/8e/342a504ff018a2825d395d44d63a767dd8ebc927ebda557fecdaca3ac33a/cffi-2.0.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:7553fb2090d71822f02c629afe6042c299edf91ba1bf94951165613553984512", size = 224443 }, + { url = "https://files.pythonhosted.org/packages/e1/5e/b666bacbbc60fbf415ba9988324a132c9a7a0448a9a8f125074671c0f2c3/cffi-2.0.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:6c6c373cfc5c83a975506110d17457138c8c63016b563cc9ed6e056a82f13ce4", size = 223437 }, + { url = "https://files.pythonhosted.org/packages/a0/1d/ec1a60bd1a10daa292d3cd6bb0b359a81607154fb8165f3ec95fe003b85c/cffi-2.0.0-cp314-cp314t-win32.whl", hash = "sha256:1fc9ea04857caf665289b7a75923f2c6ed559b8298a1b8c49e59f7dd95c8481e", size = 180487 }, + { url = "https://files.pythonhosted.org/packages/bf/41/4c1168c74fac325c0c8156f04b6749c8b6a8f405bbf91413ba088359f60d/cffi-2.0.0-cp314-cp314t-win_amd64.whl", hash = "sha256:d68b6cef7827e8641e8ef16f4494edda8b36104d79773a334beaa1e3521430f6", size = 191726 }, + { url = "https://files.pythonhosted.org/packages/ae/3a/dbeec9d1ee0844c679f6bb5d6ad4e9f198b1224f4e7a32825f47f6192b0c/cffi-2.0.0-cp314-cp314t-win_arm64.whl", hash = "sha256:0a1527a803f0a659de1af2e1fd700213caba79377e27e4693648c2923da066f9", size = 184195 }, ] [[package]] name = "cfgv" version = "3.4.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/11/74/539e56497d9bd1d484fd863dd69cbbfa653cd2aa27abfe35653494d85e94/cfgv-3.4.0.tar.gz", hash = "sha256:e52591d4c5f5dead8e0f673fb16db7949d2cfb3f7da4582893288f0ded8fe560", size = 7114, upload-time = "2023-08-12T20:38:17.776Z" } +sdist = { url = "https://files.pythonhosted.org/packages/11/74/539e56497d9bd1d484fd863dd69cbbfa653cd2aa27abfe35653494d85e94/cfgv-3.4.0.tar.gz", hash = "sha256:e52591d4c5f5dead8e0f673fb16db7949d2cfb3f7da4582893288f0ded8fe560", size = 7114 } wheels = [ - { url = "https://files.pythonhosted.org/packages/c5/55/51844dd50c4fc7a33b653bfaba4c2456f06955289ca770a5dbd5fd267374/cfgv-3.4.0-py2.py3-none-any.whl", hash = "sha256:b7265b1f29fd3316bfcd2b330d63d024f2bfd8bcb8b0272f8e19a504856c48f9", size = 7249, upload-time = "2023-08-12T20:38:16.269Z" }, + { url = "https://files.pythonhosted.org/packages/c5/55/51844dd50c4fc7a33b653bfaba4c2456f06955289ca770a5dbd5fd267374/cfgv-3.4.0-py2.py3-none-any.whl", hash = "sha256:b7265b1f29fd3316bfcd2b330d63d024f2bfd8bcb8b0272f8e19a504856c48f9", size = 7249 }, ] [[package]] name = "charset-normalizer" version = "3.4.4" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/13/69/33ddede1939fdd074bce5434295f38fae7136463422fe4fd3e0e89b98062/charset_normalizer-3.4.4.tar.gz", hash = "sha256:94537985111c35f28720e43603b8e7b43a6ecfb2ce1d3058bbe955b73404e21a", size = 129418, upload-time = "2025-10-14T04:42:32.879Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/ed/27/c6491ff4954e58a10f69ad90aca8a1b6fe9c5d3c6f380907af3c37435b59/charset_normalizer-3.4.4-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:6e1fcf0720908f200cd21aa4e6750a48ff6ce4afe7ff5a79a90d5ed8a08296f8", size = 206988, upload-time = "2025-10-14T04:40:33.79Z" }, - { url = "https://files.pythonhosted.org/packages/94/59/2e87300fe67ab820b5428580a53cad894272dbb97f38a7a814a2a1ac1011/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5f819d5fe9234f9f82d75bdfa9aef3a3d72c4d24a6e57aeaebba32a704553aa0", size = 147324, upload-time = "2025-10-14T04:40:34.961Z" }, - { url = "https://files.pythonhosted.org/packages/07/fb/0cf61dc84b2b088391830f6274cb57c82e4da8bbc2efeac8c025edb88772/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:a59cb51917aa591b1c4e6a43c132f0cdc3c76dbad6155df4e28ee626cc77a0a3", size = 142742, upload-time = "2025-10-14T04:40:36.105Z" }, - { url = "https://files.pythonhosted.org/packages/62/8b/171935adf2312cd745d290ed93cf16cf0dfe320863ab7cbeeae1dcd6535f/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:8ef3c867360f88ac904fd3f5e1f902f13307af9052646963ee08ff4f131adafc", size = 160863, upload-time = "2025-10-14T04:40:37.188Z" }, - { url = "https://files.pythonhosted.org/packages/09/73/ad875b192bda14f2173bfc1bc9a55e009808484a4b256748d931b6948442/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d9e45d7faa48ee908174d8fe84854479ef838fc6a705c9315372eacbc2f02897", size = 157837, upload-time = "2025-10-14T04:40:38.435Z" }, - { url = "https://files.pythonhosted.org/packages/6d/fc/de9cce525b2c5b94b47c70a4b4fb19f871b24995c728e957ee68ab1671ea/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:840c25fb618a231545cbab0564a799f101b63b9901f2569faecd6b222ac72381", size = 151550, upload-time = "2025-10-14T04:40:40.053Z" }, - { url = "https://files.pythonhosted.org/packages/55/c2/43edd615fdfba8c6f2dfbd459b25a6b3b551f24ea21981e23fb768503ce1/charset_normalizer-3.4.4-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:ca5862d5b3928c4940729dacc329aa9102900382fea192fc5e52eb69d6093815", size = 149162, upload-time = "2025-10-14T04:40:41.163Z" }, - { url = "https://files.pythonhosted.org/packages/03/86/bde4ad8b4d0e9429a4e82c1e8f5c659993a9a863ad62c7df05cf7b678d75/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:d9c7f57c3d666a53421049053eaacdd14bbd0a528e2186fcb2e672effd053bb0", size = 150019, upload-time = "2025-10-14T04:40:42.276Z" }, - { url = "https://files.pythonhosted.org/packages/1f/86/a151eb2af293a7e7bac3a739b81072585ce36ccfb4493039f49f1d3cae8c/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:277e970e750505ed74c832b4bf75dac7476262ee2a013f5574dd49075879e161", size = 143310, upload-time = "2025-10-14T04:40:43.439Z" }, - { url = "https://files.pythonhosted.org/packages/b5/fe/43dae6144a7e07b87478fdfc4dbe9efd5defb0e7ec29f5f58a55aeef7bf7/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:31fd66405eaf47bb62e8cd575dc621c56c668f27d46a61d975a249930dd5e2a4", size = 162022, upload-time = "2025-10-14T04:40:44.547Z" }, - { url = "https://files.pythonhosted.org/packages/80/e6/7aab83774f5d2bca81f42ac58d04caf44f0cc2b65fc6db2b3b2e8a05f3b3/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:0d3d8f15c07f86e9ff82319b3d9ef6f4bf907608f53fe9d92b28ea9ae3d1fd89", size = 149383, upload-time = "2025-10-14T04:40:46.018Z" }, - { url = "https://files.pythonhosted.org/packages/4f/e8/b289173b4edae05c0dde07f69f8db476a0b511eac556dfe0d6bda3c43384/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:9f7fcd74d410a36883701fafa2482a6af2ff5ba96b9a620e9e0721e28ead5569", size = 159098, upload-time = "2025-10-14T04:40:47.081Z" }, - { url = "https://files.pythonhosted.org/packages/d8/df/fe699727754cae3f8478493c7f45f777b17c3ef0600e28abfec8619eb49c/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:ebf3e58c7ec8a8bed6d66a75d7fb37b55e5015b03ceae72a8e7c74495551e224", size = 152991, upload-time = "2025-10-14T04:40:48.246Z" }, - { url = "https://files.pythonhosted.org/packages/1a/86/584869fe4ddb6ffa3bd9f491b87a01568797fb9bd8933f557dba9771beaf/charset_normalizer-3.4.4-cp311-cp311-win32.whl", hash = "sha256:eecbc200c7fd5ddb9a7f16c7decb07b566c29fa2161a16cf67b8d068bd21690a", size = 99456, upload-time = "2025-10-14T04:40:49.376Z" }, - { url = "https://files.pythonhosted.org/packages/65/f6/62fdd5feb60530f50f7e38b4f6a1d5203f4d16ff4f9f0952962c044e919a/charset_normalizer-3.4.4-cp311-cp311-win_amd64.whl", hash = "sha256:5ae497466c7901d54b639cf42d5b8c1b6a4fead55215500d2f486d34db48d016", size = 106978, upload-time = "2025-10-14T04:40:50.844Z" }, - { url = "https://files.pythonhosted.org/packages/7a/9d/0710916e6c82948b3be62d9d398cb4fcf4e97b56d6a6aeccd66c4b2f2bd5/charset_normalizer-3.4.4-cp311-cp311-win_arm64.whl", hash = "sha256:65e2befcd84bc6f37095f5961e68a6f077bf44946771354a28ad434c2cce0ae1", size = 99969, upload-time = "2025-10-14T04:40:52.272Z" }, - { url = "https://files.pythonhosted.org/packages/f3/85/1637cd4af66fa687396e757dec650f28025f2a2f5a5531a3208dc0ec43f2/charset_normalizer-3.4.4-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:0a98e6759f854bd25a58a73fa88833fba3b7c491169f86ce1180c948ab3fd394", size = 208425, upload-time = "2025-10-14T04:40:53.353Z" }, - { url = "https://files.pythonhosted.org/packages/9d/6a/04130023fef2a0d9c62d0bae2649b69f7b7d8d24ea5536feef50551029df/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b5b290ccc2a263e8d185130284f8501e3e36c5e02750fc6b6bdeb2e9e96f1e25", size = 148162, upload-time = "2025-10-14T04:40:54.558Z" }, - { url = "https://files.pythonhosted.org/packages/78/29/62328d79aa60da22c9e0b9a66539feae06ca0f5a4171ac4f7dc285b83688/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:74bb723680f9f7a6234dcf67aea57e708ec1fbdf5699fb91dfd6f511b0a320ef", size = 144558, upload-time = "2025-10-14T04:40:55.677Z" }, - { url = "https://files.pythonhosted.org/packages/86/bb/b32194a4bf15b88403537c2e120b817c61cd4ecffa9b6876e941c3ee38fe/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f1e34719c6ed0b92f418c7c780480b26b5d9c50349e9a9af7d76bf757530350d", size = 161497, upload-time = "2025-10-14T04:40:57.217Z" }, - { url = "https://files.pythonhosted.org/packages/19/89/a54c82b253d5b9b111dc74aca196ba5ccfcca8242d0fb64146d4d3183ff1/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:2437418e20515acec67d86e12bf70056a33abdacb5cb1655042f6538d6b085a8", size = 159240, upload-time = "2025-10-14T04:40:58.358Z" }, - { url = "https://files.pythonhosted.org/packages/c0/10/d20b513afe03acc89ec33948320a5544d31f21b05368436d580dec4e234d/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:11d694519d7f29d6cd09f6ac70028dba10f92f6cdd059096db198c283794ac86", size = 153471, upload-time = "2025-10-14T04:40:59.468Z" }, - { url = "https://files.pythonhosted.org/packages/61/fa/fbf177b55bdd727010f9c0a3c49eefa1d10f960e5f09d1d887bf93c2e698/charset_normalizer-3.4.4-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:ac1c4a689edcc530fc9d9aa11f5774b9e2f33f9a0c6a57864e90908f5208d30a", size = 150864, upload-time = "2025-10-14T04:41:00.623Z" }, - { url = "https://files.pythonhosted.org/packages/05/12/9fbc6a4d39c0198adeebbde20b619790e9236557ca59fc40e0e3cebe6f40/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:21d142cc6c0ec30d2efee5068ca36c128a30b0f2c53c1c07bd78cb6bc1d3be5f", size = 150647, upload-time = "2025-10-14T04:41:01.754Z" }, - { url = "https://files.pythonhosted.org/packages/ad/1f/6a9a593d52e3e8c5d2b167daf8c6b968808efb57ef4c210acb907c365bc4/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:5dbe56a36425d26d6cfb40ce79c314a2e4dd6211d51d6d2191c00bed34f354cc", size = 145110, upload-time = "2025-10-14T04:41:03.231Z" }, - { url = "https://files.pythonhosted.org/packages/30/42/9a52c609e72471b0fc54386dc63c3781a387bb4fe61c20231a4ebcd58bdd/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:5bfbb1b9acf3334612667b61bd3002196fe2a1eb4dd74d247e0f2a4d50ec9bbf", size = 162839, upload-time = "2025-10-14T04:41:04.715Z" }, - { url = "https://files.pythonhosted.org/packages/c4/5b/c0682bbf9f11597073052628ddd38344a3d673fda35a36773f7d19344b23/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:d055ec1e26e441f6187acf818b73564e6e6282709e9bcb5b63f5b23068356a15", size = 150667, upload-time = "2025-10-14T04:41:05.827Z" }, - { url = "https://files.pythonhosted.org/packages/e4/24/a41afeab6f990cf2daf6cb8c67419b63b48cf518e4f56022230840c9bfb2/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:af2d8c67d8e573d6de5bc30cdb27e9b95e49115cd9baad5ddbd1a6207aaa82a9", size = 160535, upload-time = "2025-10-14T04:41:06.938Z" }, - { url = "https://files.pythonhosted.org/packages/2a/e5/6a4ce77ed243c4a50a1fecca6aaaab419628c818a49434be428fe24c9957/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:780236ac706e66881f3b7f2f32dfe90507a09e67d1d454c762cf642e6e1586e0", size = 154816, upload-time = "2025-10-14T04:41:08.101Z" }, - { url = "https://files.pythonhosted.org/packages/a8/ef/89297262b8092b312d29cdb2517cb1237e51db8ecef2e9af5edbe7b683b1/charset_normalizer-3.4.4-cp312-cp312-win32.whl", hash = "sha256:5833d2c39d8896e4e19b689ffc198f08ea58116bee26dea51e362ecc7cd3ed26", size = 99694, upload-time = "2025-10-14T04:41:09.23Z" }, - { url = "https://files.pythonhosted.org/packages/3d/2d/1e5ed9dd3b3803994c155cd9aacb60c82c331bad84daf75bcb9c91b3295e/charset_normalizer-3.4.4-cp312-cp312-win_amd64.whl", hash = "sha256:a79cfe37875f822425b89a82333404539ae63dbdddf97f84dcbc3d339aae9525", size = 107131, upload-time = "2025-10-14T04:41:10.467Z" }, - { url = "https://files.pythonhosted.org/packages/d0/d9/0ed4c7098a861482a7b6a95603edce4c0d9db2311af23da1fb2b75ec26fc/charset_normalizer-3.4.4-cp312-cp312-win_arm64.whl", hash = "sha256:376bec83a63b8021bb5c8ea75e21c4ccb86e7e45ca4eb81146091b56599b80c3", size = 100390, upload-time = "2025-10-14T04:41:11.915Z" }, - { url = "https://files.pythonhosted.org/packages/97/45/4b3a1239bbacd321068ea6e7ac28875b03ab8bc0aa0966452db17cd36714/charset_normalizer-3.4.4-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:e1f185f86a6f3403aa2420e815904c67b2f9ebc443f045edd0de921108345794", size = 208091, upload-time = "2025-10-14T04:41:13.346Z" }, - { url = "https://files.pythonhosted.org/packages/7d/62/73a6d7450829655a35bb88a88fca7d736f9882a27eacdca2c6d505b57e2e/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6b39f987ae8ccdf0d2642338faf2abb1862340facc796048b604ef14919e55ed", size = 147936, upload-time = "2025-10-14T04:41:14.461Z" }, - { url = "https://files.pythonhosted.org/packages/89/c5/adb8c8b3d6625bef6d88b251bbb0d95f8205831b987631ab0c8bb5d937c2/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:3162d5d8ce1bb98dd51af660f2121c55d0fa541b46dff7bb9b9f86ea1d87de72", size = 144180, upload-time = "2025-10-14T04:41:15.588Z" }, - { url = "https://files.pythonhosted.org/packages/91/ed/9706e4070682d1cc219050b6048bfd293ccf67b3d4f5a4f39207453d4b99/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:81d5eb2a312700f4ecaa977a8235b634ce853200e828fbadf3a9c50bab278328", size = 161346, upload-time = "2025-10-14T04:41:16.738Z" }, - { url = "https://files.pythonhosted.org/packages/d5/0d/031f0d95e4972901a2f6f09ef055751805ff541511dc1252ba3ca1f80cf5/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5bd2293095d766545ec1a8f612559f6b40abc0eb18bb2f5d1171872d34036ede", size = 158874, upload-time = "2025-10-14T04:41:17.923Z" }, - { url = "https://files.pythonhosted.org/packages/f5/83/6ab5883f57c9c801ce5e5677242328aa45592be8a00644310a008d04f922/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a8a8b89589086a25749f471e6a900d3f662d1d3b6e2e59dcecf787b1cc3a1894", size = 153076, upload-time = "2025-10-14T04:41:19.106Z" }, - { url = "https://files.pythonhosted.org/packages/75/1e/5ff781ddf5260e387d6419959ee89ef13878229732732ee73cdae01800f2/charset_normalizer-3.4.4-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:bc7637e2f80d8530ee4a78e878bce464f70087ce73cf7c1caf142416923b98f1", size = 150601, upload-time = "2025-10-14T04:41:20.245Z" }, - { url = "https://files.pythonhosted.org/packages/d7/57/71be810965493d3510a6ca79b90c19e48696fb1ff964da319334b12677f0/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:f8bf04158c6b607d747e93949aa60618b61312fe647a6369f88ce2ff16043490", size = 150376, upload-time = "2025-10-14T04:41:21.398Z" }, - { url = "https://files.pythonhosted.org/packages/e5/d5/c3d057a78c181d007014feb7e9f2e65905a6c4ef182c0ddf0de2924edd65/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:554af85e960429cf30784dd47447d5125aaa3b99a6f0683589dbd27e2f45da44", size = 144825, upload-time = "2025-10-14T04:41:22.583Z" }, - { url = "https://files.pythonhosted.org/packages/e6/8c/d0406294828d4976f275ffbe66f00266c4b3136b7506941d87c00cab5272/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:74018750915ee7ad843a774364e13a3db91682f26142baddf775342c3f5b1133", size = 162583, upload-time = "2025-10-14T04:41:23.754Z" }, - { url = "https://files.pythonhosted.org/packages/d7/24/e2aa1f18c8f15c4c0e932d9287b8609dd30ad56dbe41d926bd846e22fb8d/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:c0463276121fdee9c49b98908b3a89c39be45d86d1dbaa22957e38f6321d4ce3", size = 150366, upload-time = "2025-10-14T04:41:25.27Z" }, - { url = "https://files.pythonhosted.org/packages/e4/5b/1e6160c7739aad1e2df054300cc618b06bf784a7a164b0f238360721ab86/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:362d61fd13843997c1c446760ef36f240cf81d3ebf74ac62652aebaf7838561e", size = 160300, upload-time = "2025-10-14T04:41:26.725Z" }, - { url = "https://files.pythonhosted.org/packages/7a/10/f882167cd207fbdd743e55534d5d9620e095089d176d55cb22d5322f2afd/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:9a26f18905b8dd5d685d6d07b0cdf98a79f3c7a918906af7cc143ea2e164c8bc", size = 154465, upload-time = "2025-10-14T04:41:28.322Z" }, - { url = "https://files.pythonhosted.org/packages/89/66/c7a9e1b7429be72123441bfdbaf2bc13faab3f90b933f664db506dea5915/charset_normalizer-3.4.4-cp313-cp313-win32.whl", hash = "sha256:9b35f4c90079ff2e2edc5b26c0c77925e5d2d255c42c74fdb70fb49b172726ac", size = 99404, upload-time = "2025-10-14T04:41:29.95Z" }, - { url = "https://files.pythonhosted.org/packages/c4/26/b9924fa27db384bdcd97ab83b4f0a8058d96ad9626ead570674d5e737d90/charset_normalizer-3.4.4-cp313-cp313-win_amd64.whl", hash = "sha256:b435cba5f4f750aa6c0a0d92c541fb79f69a387c91e61f1795227e4ed9cece14", size = 107092, upload-time = "2025-10-14T04:41:31.188Z" }, - { url = "https://files.pythonhosted.org/packages/af/8f/3ed4bfa0c0c72a7ca17f0380cd9e4dd842b09f664e780c13cff1dcf2ef1b/charset_normalizer-3.4.4-cp313-cp313-win_arm64.whl", hash = "sha256:542d2cee80be6f80247095cc36c418f7bddd14f4a6de45af91dfad36d817bba2", size = 100408, upload-time = "2025-10-14T04:41:32.624Z" }, - { url = "https://files.pythonhosted.org/packages/2a/35/7051599bd493e62411d6ede36fd5af83a38f37c4767b92884df7301db25d/charset_normalizer-3.4.4-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:da3326d9e65ef63a817ecbcc0df6e94463713b754fe293eaa03da99befb9a5bd", size = 207746, upload-time = "2025-10-14T04:41:33.773Z" }, - { url = "https://files.pythonhosted.org/packages/10/9a/97c8d48ef10d6cd4fcead2415523221624bf58bcf68a802721a6bc807c8f/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8af65f14dc14a79b924524b1e7fffe304517b2bff5a58bf64f30b98bbc5079eb", size = 147889, upload-time = "2025-10-14T04:41:34.897Z" }, - { url = "https://files.pythonhosted.org/packages/10/bf/979224a919a1b606c82bd2c5fa49b5c6d5727aa47b4312bb27b1734f53cd/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:74664978bb272435107de04e36db5a9735e78232b85b77d45cfb38f758efd33e", size = 143641, upload-time = "2025-10-14T04:41:36.116Z" }, - { url = "https://files.pythonhosted.org/packages/ba/33/0ad65587441fc730dc7bd90e9716b30b4702dc7b617e6ba4997dc8651495/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:752944c7ffbfdd10c074dc58ec2d5a8a4cd9493b314d367c14d24c17684ddd14", size = 160779, upload-time = "2025-10-14T04:41:37.229Z" }, - { url = "https://files.pythonhosted.org/packages/67/ed/331d6b249259ee71ddea93f6f2f0a56cfebd46938bde6fcc6f7b9a3d0e09/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d1f13550535ad8cff21b8d757a3257963e951d96e20ec82ab44bc64aeb62a191", size = 159035, upload-time = "2025-10-14T04:41:38.368Z" }, - { url = "https://files.pythonhosted.org/packages/67/ff/f6b948ca32e4f2a4576aa129d8bed61f2e0543bf9f5f2b7fc3758ed005c9/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ecaae4149d99b1c9e7b88bb03e3221956f68fd6d50be2ef061b2381b61d20838", size = 152542, upload-time = "2025-10-14T04:41:39.862Z" }, - { url = "https://files.pythonhosted.org/packages/16/85/276033dcbcc369eb176594de22728541a925b2632f9716428c851b149e83/charset_normalizer-3.4.4-cp314-cp314-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:cb6254dc36b47a990e59e1068afacdcd02958bdcce30bb50cc1700a8b9d624a6", size = 149524, upload-time = "2025-10-14T04:41:41.319Z" }, - { url = "https://files.pythonhosted.org/packages/9e/f2/6a2a1f722b6aba37050e626530a46a68f74e63683947a8acff92569f979a/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:c8ae8a0f02f57a6e61203a31428fa1d677cbe50c93622b4149d5c0f319c1d19e", size = 150395, upload-time = "2025-10-14T04:41:42.539Z" }, - { url = "https://files.pythonhosted.org/packages/60/bb/2186cb2f2bbaea6338cad15ce23a67f9b0672929744381e28b0592676824/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:47cc91b2f4dd2833fddaedd2893006b0106129d4b94fdb6af1f4ce5a9965577c", size = 143680, upload-time = "2025-10-14T04:41:43.661Z" }, - { url = "https://files.pythonhosted.org/packages/7d/a5/bf6f13b772fbb2a90360eb620d52ed8f796f3c5caee8398c3b2eb7b1c60d/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:82004af6c302b5d3ab2cfc4cc5f29db16123b1a8417f2e25f9066f91d4411090", size = 162045, upload-time = "2025-10-14T04:41:44.821Z" }, - { url = "https://files.pythonhosted.org/packages/df/c5/d1be898bf0dc3ef9030c3825e5d3b83f2c528d207d246cbabe245966808d/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:2b7d8f6c26245217bd2ad053761201e9f9680f8ce52f0fcd8d0755aeae5b2152", size = 149687, upload-time = "2025-10-14T04:41:46.442Z" }, - { url = "https://files.pythonhosted.org/packages/a5/42/90c1f7b9341eef50c8a1cb3f098ac43b0508413f33affd762855f67a410e/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:799a7a5e4fb2d5898c60b640fd4981d6a25f1c11790935a44ce38c54e985f828", size = 160014, upload-time = "2025-10-14T04:41:47.631Z" }, - { url = "https://files.pythonhosted.org/packages/76/be/4d3ee471e8145d12795ab655ece37baed0929462a86e72372fd25859047c/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:99ae2cffebb06e6c22bdc25801d7b30f503cc87dbd283479e7b606f70aff57ec", size = 154044, upload-time = "2025-10-14T04:41:48.81Z" }, - { url = "https://files.pythonhosted.org/packages/b0/6f/8f7af07237c34a1defe7defc565a9bc1807762f672c0fde711a4b22bf9c0/charset_normalizer-3.4.4-cp314-cp314-win32.whl", hash = "sha256:f9d332f8c2a2fcbffe1378594431458ddbef721c1769d78e2cbc06280d8155f9", size = 99940, upload-time = "2025-10-14T04:41:49.946Z" }, - { url = "https://files.pythonhosted.org/packages/4b/51/8ade005e5ca5b0d80fb4aff72a3775b325bdc3d27408c8113811a7cbe640/charset_normalizer-3.4.4-cp314-cp314-win_amd64.whl", hash = "sha256:8a6562c3700cce886c5be75ade4a5db4214fda19fede41d9792d100288d8f94c", size = 107104, upload-time = "2025-10-14T04:41:51.051Z" }, - { url = "https://files.pythonhosted.org/packages/da/5f/6b8f83a55bb8278772c5ae54a577f3099025f9ade59d0136ac24a0df4bde/charset_normalizer-3.4.4-cp314-cp314-win_arm64.whl", hash = "sha256:de00632ca48df9daf77a2c65a484531649261ec9f25489917f09e455cb09ddb2", size = 100743, upload-time = "2025-10-14T04:41:52.122Z" }, - { url = "https://files.pythonhosted.org/packages/0a/4c/925909008ed5a988ccbb72dcc897407e5d6d3bd72410d69e051fc0c14647/charset_normalizer-3.4.4-py3-none-any.whl", hash = "sha256:7a32c560861a02ff789ad905a2fe94e3f840803362c84fecf1851cb4cf3dc37f", size = 53402, upload-time = "2025-10-14T04:42:31.76Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/13/69/33ddede1939fdd074bce5434295f38fae7136463422fe4fd3e0e89b98062/charset_normalizer-3.4.4.tar.gz", hash = "sha256:94537985111c35f28720e43603b8e7b43a6ecfb2ce1d3058bbe955b73404e21a", size = 129418 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ed/27/c6491ff4954e58a10f69ad90aca8a1b6fe9c5d3c6f380907af3c37435b59/charset_normalizer-3.4.4-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:6e1fcf0720908f200cd21aa4e6750a48ff6ce4afe7ff5a79a90d5ed8a08296f8", size = 206988 }, + { url = "https://files.pythonhosted.org/packages/94/59/2e87300fe67ab820b5428580a53cad894272dbb97f38a7a814a2a1ac1011/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5f819d5fe9234f9f82d75bdfa9aef3a3d72c4d24a6e57aeaebba32a704553aa0", size = 147324 }, + { url = "https://files.pythonhosted.org/packages/07/fb/0cf61dc84b2b088391830f6274cb57c82e4da8bbc2efeac8c025edb88772/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:a59cb51917aa591b1c4e6a43c132f0cdc3c76dbad6155df4e28ee626cc77a0a3", size = 142742 }, + { url = "https://files.pythonhosted.org/packages/62/8b/171935adf2312cd745d290ed93cf16cf0dfe320863ab7cbeeae1dcd6535f/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:8ef3c867360f88ac904fd3f5e1f902f13307af9052646963ee08ff4f131adafc", size = 160863 }, + { url = "https://files.pythonhosted.org/packages/09/73/ad875b192bda14f2173bfc1bc9a55e009808484a4b256748d931b6948442/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d9e45d7faa48ee908174d8fe84854479ef838fc6a705c9315372eacbc2f02897", size = 157837 }, + { url = "https://files.pythonhosted.org/packages/6d/fc/de9cce525b2c5b94b47c70a4b4fb19f871b24995c728e957ee68ab1671ea/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:840c25fb618a231545cbab0564a799f101b63b9901f2569faecd6b222ac72381", size = 151550 }, + { url = "https://files.pythonhosted.org/packages/55/c2/43edd615fdfba8c6f2dfbd459b25a6b3b551f24ea21981e23fb768503ce1/charset_normalizer-3.4.4-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:ca5862d5b3928c4940729dacc329aa9102900382fea192fc5e52eb69d6093815", size = 149162 }, + { url = "https://files.pythonhosted.org/packages/03/86/bde4ad8b4d0e9429a4e82c1e8f5c659993a9a863ad62c7df05cf7b678d75/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:d9c7f57c3d666a53421049053eaacdd14bbd0a528e2186fcb2e672effd053bb0", size = 150019 }, + { url = "https://files.pythonhosted.org/packages/1f/86/a151eb2af293a7e7bac3a739b81072585ce36ccfb4493039f49f1d3cae8c/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:277e970e750505ed74c832b4bf75dac7476262ee2a013f5574dd49075879e161", size = 143310 }, + { url = "https://files.pythonhosted.org/packages/b5/fe/43dae6144a7e07b87478fdfc4dbe9efd5defb0e7ec29f5f58a55aeef7bf7/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:31fd66405eaf47bb62e8cd575dc621c56c668f27d46a61d975a249930dd5e2a4", size = 162022 }, + { url = "https://files.pythonhosted.org/packages/80/e6/7aab83774f5d2bca81f42ac58d04caf44f0cc2b65fc6db2b3b2e8a05f3b3/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:0d3d8f15c07f86e9ff82319b3d9ef6f4bf907608f53fe9d92b28ea9ae3d1fd89", size = 149383 }, + { url = "https://files.pythonhosted.org/packages/4f/e8/b289173b4edae05c0dde07f69f8db476a0b511eac556dfe0d6bda3c43384/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:9f7fcd74d410a36883701fafa2482a6af2ff5ba96b9a620e9e0721e28ead5569", size = 159098 }, + { url = "https://files.pythonhosted.org/packages/d8/df/fe699727754cae3f8478493c7f45f777b17c3ef0600e28abfec8619eb49c/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:ebf3e58c7ec8a8bed6d66a75d7fb37b55e5015b03ceae72a8e7c74495551e224", size = 152991 }, + { url = "https://files.pythonhosted.org/packages/1a/86/584869fe4ddb6ffa3bd9f491b87a01568797fb9bd8933f557dba9771beaf/charset_normalizer-3.4.4-cp311-cp311-win32.whl", hash = "sha256:eecbc200c7fd5ddb9a7f16c7decb07b566c29fa2161a16cf67b8d068bd21690a", size = 99456 }, + { url = "https://files.pythonhosted.org/packages/65/f6/62fdd5feb60530f50f7e38b4f6a1d5203f4d16ff4f9f0952962c044e919a/charset_normalizer-3.4.4-cp311-cp311-win_amd64.whl", hash = "sha256:5ae497466c7901d54b639cf42d5b8c1b6a4fead55215500d2f486d34db48d016", size = 106978 }, + { url = "https://files.pythonhosted.org/packages/7a/9d/0710916e6c82948b3be62d9d398cb4fcf4e97b56d6a6aeccd66c4b2f2bd5/charset_normalizer-3.4.4-cp311-cp311-win_arm64.whl", hash = "sha256:65e2befcd84bc6f37095f5961e68a6f077bf44946771354a28ad434c2cce0ae1", size = 99969 }, + { url = "https://files.pythonhosted.org/packages/f3/85/1637cd4af66fa687396e757dec650f28025f2a2f5a5531a3208dc0ec43f2/charset_normalizer-3.4.4-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:0a98e6759f854bd25a58a73fa88833fba3b7c491169f86ce1180c948ab3fd394", size = 208425 }, + { url = "https://files.pythonhosted.org/packages/9d/6a/04130023fef2a0d9c62d0bae2649b69f7b7d8d24ea5536feef50551029df/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b5b290ccc2a263e8d185130284f8501e3e36c5e02750fc6b6bdeb2e9e96f1e25", size = 148162 }, + { url = "https://files.pythonhosted.org/packages/78/29/62328d79aa60da22c9e0b9a66539feae06ca0f5a4171ac4f7dc285b83688/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:74bb723680f9f7a6234dcf67aea57e708ec1fbdf5699fb91dfd6f511b0a320ef", size = 144558 }, + { url = "https://files.pythonhosted.org/packages/86/bb/b32194a4bf15b88403537c2e120b817c61cd4ecffa9b6876e941c3ee38fe/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f1e34719c6ed0b92f418c7c780480b26b5d9c50349e9a9af7d76bf757530350d", size = 161497 }, + { url = "https://files.pythonhosted.org/packages/19/89/a54c82b253d5b9b111dc74aca196ba5ccfcca8242d0fb64146d4d3183ff1/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:2437418e20515acec67d86e12bf70056a33abdacb5cb1655042f6538d6b085a8", size = 159240 }, + { url = "https://files.pythonhosted.org/packages/c0/10/d20b513afe03acc89ec33948320a5544d31f21b05368436d580dec4e234d/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:11d694519d7f29d6cd09f6ac70028dba10f92f6cdd059096db198c283794ac86", size = 153471 }, + { url = "https://files.pythonhosted.org/packages/61/fa/fbf177b55bdd727010f9c0a3c49eefa1d10f960e5f09d1d887bf93c2e698/charset_normalizer-3.4.4-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:ac1c4a689edcc530fc9d9aa11f5774b9e2f33f9a0c6a57864e90908f5208d30a", size = 150864 }, + { url = "https://files.pythonhosted.org/packages/05/12/9fbc6a4d39c0198adeebbde20b619790e9236557ca59fc40e0e3cebe6f40/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:21d142cc6c0ec30d2efee5068ca36c128a30b0f2c53c1c07bd78cb6bc1d3be5f", size = 150647 }, + { url = "https://files.pythonhosted.org/packages/ad/1f/6a9a593d52e3e8c5d2b167daf8c6b968808efb57ef4c210acb907c365bc4/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:5dbe56a36425d26d6cfb40ce79c314a2e4dd6211d51d6d2191c00bed34f354cc", size = 145110 }, + { url = "https://files.pythonhosted.org/packages/30/42/9a52c609e72471b0fc54386dc63c3781a387bb4fe61c20231a4ebcd58bdd/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:5bfbb1b9acf3334612667b61bd3002196fe2a1eb4dd74d247e0f2a4d50ec9bbf", size = 162839 }, + { url = "https://files.pythonhosted.org/packages/c4/5b/c0682bbf9f11597073052628ddd38344a3d673fda35a36773f7d19344b23/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:d055ec1e26e441f6187acf818b73564e6e6282709e9bcb5b63f5b23068356a15", size = 150667 }, + { url = "https://files.pythonhosted.org/packages/e4/24/a41afeab6f990cf2daf6cb8c67419b63b48cf518e4f56022230840c9bfb2/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:af2d8c67d8e573d6de5bc30cdb27e9b95e49115cd9baad5ddbd1a6207aaa82a9", size = 160535 }, + { url = "https://files.pythonhosted.org/packages/2a/e5/6a4ce77ed243c4a50a1fecca6aaaab419628c818a49434be428fe24c9957/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:780236ac706e66881f3b7f2f32dfe90507a09e67d1d454c762cf642e6e1586e0", size = 154816 }, + { url = "https://files.pythonhosted.org/packages/a8/ef/89297262b8092b312d29cdb2517cb1237e51db8ecef2e9af5edbe7b683b1/charset_normalizer-3.4.4-cp312-cp312-win32.whl", hash = "sha256:5833d2c39d8896e4e19b689ffc198f08ea58116bee26dea51e362ecc7cd3ed26", size = 99694 }, + { url = "https://files.pythonhosted.org/packages/3d/2d/1e5ed9dd3b3803994c155cd9aacb60c82c331bad84daf75bcb9c91b3295e/charset_normalizer-3.4.4-cp312-cp312-win_amd64.whl", hash = "sha256:a79cfe37875f822425b89a82333404539ae63dbdddf97f84dcbc3d339aae9525", size = 107131 }, + { url = "https://files.pythonhosted.org/packages/d0/d9/0ed4c7098a861482a7b6a95603edce4c0d9db2311af23da1fb2b75ec26fc/charset_normalizer-3.4.4-cp312-cp312-win_arm64.whl", hash = "sha256:376bec83a63b8021bb5c8ea75e21c4ccb86e7e45ca4eb81146091b56599b80c3", size = 100390 }, + { url = "https://files.pythonhosted.org/packages/97/45/4b3a1239bbacd321068ea6e7ac28875b03ab8bc0aa0966452db17cd36714/charset_normalizer-3.4.4-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:e1f185f86a6f3403aa2420e815904c67b2f9ebc443f045edd0de921108345794", size = 208091 }, + { url = "https://files.pythonhosted.org/packages/7d/62/73a6d7450829655a35bb88a88fca7d736f9882a27eacdca2c6d505b57e2e/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6b39f987ae8ccdf0d2642338faf2abb1862340facc796048b604ef14919e55ed", size = 147936 }, + { url = "https://files.pythonhosted.org/packages/89/c5/adb8c8b3d6625bef6d88b251bbb0d95f8205831b987631ab0c8bb5d937c2/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:3162d5d8ce1bb98dd51af660f2121c55d0fa541b46dff7bb9b9f86ea1d87de72", size = 144180 }, + { url = "https://files.pythonhosted.org/packages/91/ed/9706e4070682d1cc219050b6048bfd293ccf67b3d4f5a4f39207453d4b99/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:81d5eb2a312700f4ecaa977a8235b634ce853200e828fbadf3a9c50bab278328", size = 161346 }, + { url = "https://files.pythonhosted.org/packages/d5/0d/031f0d95e4972901a2f6f09ef055751805ff541511dc1252ba3ca1f80cf5/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5bd2293095d766545ec1a8f612559f6b40abc0eb18bb2f5d1171872d34036ede", size = 158874 }, + { url = "https://files.pythonhosted.org/packages/f5/83/6ab5883f57c9c801ce5e5677242328aa45592be8a00644310a008d04f922/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a8a8b89589086a25749f471e6a900d3f662d1d3b6e2e59dcecf787b1cc3a1894", size = 153076 }, + { url = "https://files.pythonhosted.org/packages/75/1e/5ff781ddf5260e387d6419959ee89ef13878229732732ee73cdae01800f2/charset_normalizer-3.4.4-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:bc7637e2f80d8530ee4a78e878bce464f70087ce73cf7c1caf142416923b98f1", size = 150601 }, + { url = "https://files.pythonhosted.org/packages/d7/57/71be810965493d3510a6ca79b90c19e48696fb1ff964da319334b12677f0/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:f8bf04158c6b607d747e93949aa60618b61312fe647a6369f88ce2ff16043490", size = 150376 }, + { url = "https://files.pythonhosted.org/packages/e5/d5/c3d057a78c181d007014feb7e9f2e65905a6c4ef182c0ddf0de2924edd65/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:554af85e960429cf30784dd47447d5125aaa3b99a6f0683589dbd27e2f45da44", size = 144825 }, + { url = "https://files.pythonhosted.org/packages/e6/8c/d0406294828d4976f275ffbe66f00266c4b3136b7506941d87c00cab5272/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:74018750915ee7ad843a774364e13a3db91682f26142baddf775342c3f5b1133", size = 162583 }, + { url = "https://files.pythonhosted.org/packages/d7/24/e2aa1f18c8f15c4c0e932d9287b8609dd30ad56dbe41d926bd846e22fb8d/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:c0463276121fdee9c49b98908b3a89c39be45d86d1dbaa22957e38f6321d4ce3", size = 150366 }, + { url = "https://files.pythonhosted.org/packages/e4/5b/1e6160c7739aad1e2df054300cc618b06bf784a7a164b0f238360721ab86/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:362d61fd13843997c1c446760ef36f240cf81d3ebf74ac62652aebaf7838561e", size = 160300 }, + { url = "https://files.pythonhosted.org/packages/7a/10/f882167cd207fbdd743e55534d5d9620e095089d176d55cb22d5322f2afd/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:9a26f18905b8dd5d685d6d07b0cdf98a79f3c7a918906af7cc143ea2e164c8bc", size = 154465 }, + { url = "https://files.pythonhosted.org/packages/89/66/c7a9e1b7429be72123441bfdbaf2bc13faab3f90b933f664db506dea5915/charset_normalizer-3.4.4-cp313-cp313-win32.whl", hash = "sha256:9b35f4c90079ff2e2edc5b26c0c77925e5d2d255c42c74fdb70fb49b172726ac", size = 99404 }, + { url = "https://files.pythonhosted.org/packages/c4/26/b9924fa27db384bdcd97ab83b4f0a8058d96ad9626ead570674d5e737d90/charset_normalizer-3.4.4-cp313-cp313-win_amd64.whl", hash = "sha256:b435cba5f4f750aa6c0a0d92c541fb79f69a387c91e61f1795227e4ed9cece14", size = 107092 }, + { url = "https://files.pythonhosted.org/packages/af/8f/3ed4bfa0c0c72a7ca17f0380cd9e4dd842b09f664e780c13cff1dcf2ef1b/charset_normalizer-3.4.4-cp313-cp313-win_arm64.whl", hash = "sha256:542d2cee80be6f80247095cc36c418f7bddd14f4a6de45af91dfad36d817bba2", size = 100408 }, + { url = "https://files.pythonhosted.org/packages/2a/35/7051599bd493e62411d6ede36fd5af83a38f37c4767b92884df7301db25d/charset_normalizer-3.4.4-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:da3326d9e65ef63a817ecbcc0df6e94463713b754fe293eaa03da99befb9a5bd", size = 207746 }, + { url = "https://files.pythonhosted.org/packages/10/9a/97c8d48ef10d6cd4fcead2415523221624bf58bcf68a802721a6bc807c8f/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8af65f14dc14a79b924524b1e7fffe304517b2bff5a58bf64f30b98bbc5079eb", size = 147889 }, + { url = "https://files.pythonhosted.org/packages/10/bf/979224a919a1b606c82bd2c5fa49b5c6d5727aa47b4312bb27b1734f53cd/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:74664978bb272435107de04e36db5a9735e78232b85b77d45cfb38f758efd33e", size = 143641 }, + { url = "https://files.pythonhosted.org/packages/ba/33/0ad65587441fc730dc7bd90e9716b30b4702dc7b617e6ba4997dc8651495/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:752944c7ffbfdd10c074dc58ec2d5a8a4cd9493b314d367c14d24c17684ddd14", size = 160779 }, + { url = "https://files.pythonhosted.org/packages/67/ed/331d6b249259ee71ddea93f6f2f0a56cfebd46938bde6fcc6f7b9a3d0e09/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d1f13550535ad8cff21b8d757a3257963e951d96e20ec82ab44bc64aeb62a191", size = 159035 }, + { url = "https://files.pythonhosted.org/packages/67/ff/f6b948ca32e4f2a4576aa129d8bed61f2e0543bf9f5f2b7fc3758ed005c9/charset_normalizer-3.4.4-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ecaae4149d99b1c9e7b88bb03e3221956f68fd6d50be2ef061b2381b61d20838", size = 152542 }, + { url = "https://files.pythonhosted.org/packages/16/85/276033dcbcc369eb176594de22728541a925b2632f9716428c851b149e83/charset_normalizer-3.4.4-cp314-cp314-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:cb6254dc36b47a990e59e1068afacdcd02958bdcce30bb50cc1700a8b9d624a6", size = 149524 }, + { url = "https://files.pythonhosted.org/packages/9e/f2/6a2a1f722b6aba37050e626530a46a68f74e63683947a8acff92569f979a/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:c8ae8a0f02f57a6e61203a31428fa1d677cbe50c93622b4149d5c0f319c1d19e", size = 150395 }, + { url = "https://files.pythonhosted.org/packages/60/bb/2186cb2f2bbaea6338cad15ce23a67f9b0672929744381e28b0592676824/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:47cc91b2f4dd2833fddaedd2893006b0106129d4b94fdb6af1f4ce5a9965577c", size = 143680 }, + { url = "https://files.pythonhosted.org/packages/7d/a5/bf6f13b772fbb2a90360eb620d52ed8f796f3c5caee8398c3b2eb7b1c60d/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:82004af6c302b5d3ab2cfc4cc5f29db16123b1a8417f2e25f9066f91d4411090", size = 162045 }, + { url = "https://files.pythonhosted.org/packages/df/c5/d1be898bf0dc3ef9030c3825e5d3b83f2c528d207d246cbabe245966808d/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:2b7d8f6c26245217bd2ad053761201e9f9680f8ce52f0fcd8d0755aeae5b2152", size = 149687 }, + { url = "https://files.pythonhosted.org/packages/a5/42/90c1f7b9341eef50c8a1cb3f098ac43b0508413f33affd762855f67a410e/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:799a7a5e4fb2d5898c60b640fd4981d6a25f1c11790935a44ce38c54e985f828", size = 160014 }, + { url = "https://files.pythonhosted.org/packages/76/be/4d3ee471e8145d12795ab655ece37baed0929462a86e72372fd25859047c/charset_normalizer-3.4.4-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:99ae2cffebb06e6c22bdc25801d7b30f503cc87dbd283479e7b606f70aff57ec", size = 154044 }, + { url = "https://files.pythonhosted.org/packages/b0/6f/8f7af07237c34a1defe7defc565a9bc1807762f672c0fde711a4b22bf9c0/charset_normalizer-3.4.4-cp314-cp314-win32.whl", hash = "sha256:f9d332f8c2a2fcbffe1378594431458ddbef721c1769d78e2cbc06280d8155f9", size = 99940 }, + { url = "https://files.pythonhosted.org/packages/4b/51/8ade005e5ca5b0d80fb4aff72a3775b325bdc3d27408c8113811a7cbe640/charset_normalizer-3.4.4-cp314-cp314-win_amd64.whl", hash = "sha256:8a6562c3700cce886c5be75ade4a5db4214fda19fede41d9792d100288d8f94c", size = 107104 }, + { url = "https://files.pythonhosted.org/packages/da/5f/6b8f83a55bb8278772c5ae54a577f3099025f9ade59d0136ac24a0df4bde/charset_normalizer-3.4.4-cp314-cp314-win_arm64.whl", hash = "sha256:de00632ca48df9daf77a2c65a484531649261ec9f25489917f09e455cb09ddb2", size = 100743 }, + { url = "https://files.pythonhosted.org/packages/0a/4c/925909008ed5a988ccbb72dcc897407e5d6d3bd72410d69e051fc0c14647/charset_normalizer-3.4.4-py3-none-any.whl", hash = "sha256:7a32c560861a02ff789ad905a2fe94e3f840803362c84fecf1851cb4cf3dc37f", size = 53402 }, ] [[package]] @@ -416,36 +415,36 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "colorama", marker = "sys_platform == 'win32'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/46/61/de6cd827efad202d7057d93e0fed9294b96952e188f7384832791c7b2254/click-8.3.0.tar.gz", hash = "sha256:e7b8232224eba16f4ebe410c25ced9f7875cb5f3263ffc93cc3e8da705e229c4", size = 276943, upload-time = "2025-09-18T17:32:23.696Z" } +sdist = { url = "https://files.pythonhosted.org/packages/46/61/de6cd827efad202d7057d93e0fed9294b96952e188f7384832791c7b2254/click-8.3.0.tar.gz", hash = "sha256:e7b8232224eba16f4ebe410c25ced9f7875cb5f3263ffc93cc3e8da705e229c4", size = 276943 } wheels = [ - { url = "https://files.pythonhosted.org/packages/db/d3/9dcc0f5797f070ec8edf30fbadfb200e71d9db6b84d211e3b2085a7589a0/click-8.3.0-py3-none-any.whl", hash = "sha256:9b9f285302c6e3064f4330c05f05b81945b2a39544279343e6e7c5f27a9baddc", size = 107295, upload-time = "2025-09-18T17:32:22.42Z" }, + { url = "https://files.pythonhosted.org/packages/db/d3/9dcc0f5797f070ec8edf30fbadfb200e71d9db6b84d211e3b2085a7589a0/click-8.3.0-py3-none-any.whl", hash = "sha256:9b9f285302c6e3064f4330c05f05b81945b2a39544279343e6e7c5f27a9baddc", size = 107295 }, ] [[package]] name = "cloudpickle" version = "3.1.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/27/fb/576f067976d320f5f0114a8d9fa1215425441bb35627b1993e5afd8111e5/cloudpickle-3.1.2.tar.gz", hash = "sha256:7fda9eb655c9c230dab534f1983763de5835249750e85fbcef43aaa30a9a2414", size = 22330, upload-time = "2025-11-03T09:25:26.604Z" } +sdist = { url = "https://files.pythonhosted.org/packages/27/fb/576f067976d320f5f0114a8d9fa1215425441bb35627b1993e5afd8111e5/cloudpickle-3.1.2.tar.gz", hash = "sha256:7fda9eb655c9c230dab534f1983763de5835249750e85fbcef43aaa30a9a2414", size = 22330 } wheels = [ - { url = "https://files.pythonhosted.org/packages/88/39/799be3f2f0f38cc727ee3b4f1445fe6d5e4133064ec2e4115069418a5bb6/cloudpickle-3.1.2-py3-none-any.whl", hash = "sha256:9acb47f6afd73f60dc1df93bb801b472f05ff42fa6c84167d25cb206be1fbf4a", size = 22228, upload-time = "2025-11-03T09:25:25.534Z" }, + { url = "https://files.pythonhosted.org/packages/88/39/799be3f2f0f38cc727ee3b4f1445fe6d5e4133064ec2e4115069418a5bb6/cloudpickle-3.1.2-py3-none-any.whl", hash = "sha256:9acb47f6afd73f60dc1df93bb801b472f05ff42fa6c84167d25cb206be1fbf4a", size = 22228 }, ] [[package]] name = "colorama" version = "0.4.6" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/d8/53/6f443c9a4a8358a93a6792e2acffb9d9d5cb0a5cfd8802644b7b1c9a02e4/colorama-0.4.6.tar.gz", hash = "sha256:08695f5cb7ed6e0531a20572697297273c47b8cae5a63ffc6d6ed5c201be6e44", size = 27697, upload-time = "2022-10-25T02:36:22.414Z" } +sdist = { url = "https://files.pythonhosted.org/packages/d8/53/6f443c9a4a8358a93a6792e2acffb9d9d5cb0a5cfd8802644b7b1c9a02e4/colorama-0.4.6.tar.gz", hash = "sha256:08695f5cb7ed6e0531a20572697297273c47b8cae5a63ffc6d6ed5c201be6e44", size = 27697 } wheels = [ - { url = "https://files.pythonhosted.org/packages/d1/d6/3965ed04c63042e047cb6a3e6ed1a63a35087b6a609aa3a15ed8ac56c221/colorama-0.4.6-py2.py3-none-any.whl", hash = "sha256:4f1d9991f5acc0ca119f9d443620b77f9d6b33703e51011c16baf57afb285fc6", size = 25335, upload-time = "2022-10-25T02:36:20.889Z" }, + { url = "https://files.pythonhosted.org/packages/d1/d6/3965ed04c63042e047cb6a3e6ed1a63a35087b6a609aa3a15ed8ac56c221/colorama-0.4.6-py2.py3-none-any.whl", hash = "sha256:4f1d9991f5acc0ca119f9d443620b77f9d6b33703e51011c16baf57afb285fc6", size = 25335 }, ] [[package]] name = "comm" version = "0.2.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/4c/13/7d740c5849255756bc17888787313b61fd38a0a8304fc4f073dfc46122aa/comm-0.2.3.tar.gz", hash = "sha256:2dc8048c10962d55d7ad693be1e7045d891b7ce8d999c97963a5e3e99c055971", size = 6319, upload-time = "2025-07-25T14:02:04.452Z" } +sdist = { url = "https://files.pythonhosted.org/packages/4c/13/7d740c5849255756bc17888787313b61fd38a0a8304fc4f073dfc46122aa/comm-0.2.3.tar.gz", hash = "sha256:2dc8048c10962d55d7ad693be1e7045d891b7ce8d999c97963a5e3e99c055971", size = 6319 } wheels = [ - { url = "https://files.pythonhosted.org/packages/60/97/891a0971e1e4a8c5d2b20bbe0e524dc04548d2307fee33cdeba148fd4fc7/comm-0.2.3-py3-none-any.whl", hash = "sha256:c615d91d75f7f04f095b30d1c1711babd43bdc6419c1be9886a85f2f4e489417", size = 7294, upload-time = "2025-07-25T14:02:02.896Z" }, + { url = "https://files.pythonhosted.org/packages/60/97/891a0971e1e4a8c5d2b20bbe0e524dc04548d2307fee33cdeba148fd4fc7/comm-0.2.3-py3-none-any.whl", hash = "sha256:c615d91d75f7f04f095b30d1c1711babd43bdc6419c1be9886a85f2f4e489417", size = 7294 }, ] [[package]] @@ -455,149 +454,149 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "numpy" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/58/01/1253e6698a07380cd31a736d248a3f2a50a7c88779a1813da27503cadc2a/contourpy-1.3.3.tar.gz", hash = "sha256:083e12155b210502d0bca491432bb04d56dc3432f95a979b429f2848c3dbe880", size = 13466174, upload-time = "2025-07-26T12:03:12.549Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/91/2e/c4390a31919d8a78b90e8ecf87cd4b4c4f05a5b48d05ec17db8e5404c6f4/contourpy-1.3.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:709a48ef9a690e1343202916450bc48b9e51c049b089c7f79a267b46cffcdaa1", size = 288773, upload-time = "2025-07-26T12:01:02.277Z" }, - { url = "https://files.pythonhosted.org/packages/0d/44/c4b0b6095fef4dc9c420e041799591e3b63e9619e3044f7f4f6c21c0ab24/contourpy-1.3.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:23416f38bfd74d5d28ab8429cc4d63fa67d5068bd711a85edb1c3fb0c3e2f381", size = 270149, upload-time = "2025-07-26T12:01:04.072Z" }, - { url = "https://files.pythonhosted.org/packages/30/2e/dd4ced42fefac8470661d7cb7e264808425e6c5d56d175291e93890cce09/contourpy-1.3.3-cp311-cp311-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:929ddf8c4c7f348e4c0a5a3a714b5c8542ffaa8c22954862a46ca1813b667ee7", size = 329222, upload-time = "2025-07-26T12:01:05.688Z" }, - { url = "https://files.pythonhosted.org/packages/f2/74/cc6ec2548e3d276c71389ea4802a774b7aa3558223b7bade3f25787fafc2/contourpy-1.3.3-cp311-cp311-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:9e999574eddae35f1312c2b4b717b7885d4edd6cb46700e04f7f02db454e67c1", size = 377234, upload-time = "2025-07-26T12:01:07.054Z" }, - { url = "https://files.pythonhosted.org/packages/03/b3/64ef723029f917410f75c09da54254c5f9ea90ef89b143ccadb09df14c15/contourpy-1.3.3-cp311-cp311-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:0bf67e0e3f482cb69779dd3061b534eb35ac9b17f163d851e2a547d56dba0a3a", size = 380555, upload-time = "2025-07-26T12:01:08.801Z" }, - { url = "https://files.pythonhosted.org/packages/5f/4b/6157f24ca425b89fe2eb7e7be642375711ab671135be21e6faa100f7448c/contourpy-1.3.3-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:51e79c1f7470158e838808d4a996fa9bac72c498e93d8ebe5119bc1e6becb0db", size = 355238, upload-time = "2025-07-26T12:01:10.319Z" }, - { url = "https://files.pythonhosted.org/packages/98/56/f914f0dd678480708a04cfd2206e7c382533249bc5001eb9f58aa693e200/contourpy-1.3.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:598c3aaece21c503615fd59c92a3598b428b2f01bfb4b8ca9c4edeecc2438620", size = 1326218, upload-time = "2025-07-26T12:01:12.659Z" }, - { url = "https://files.pythonhosted.org/packages/fb/d7/4a972334a0c971acd5172389671113ae82aa7527073980c38d5868ff1161/contourpy-1.3.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:322ab1c99b008dad206d406bb61d014cf0174df491ae9d9d0fac6a6fda4f977f", size = 1392867, upload-time = "2025-07-26T12:01:15.533Z" }, - { url = "https://files.pythonhosted.org/packages/75/3e/f2cc6cd56dc8cff46b1a56232eabc6feea52720083ea71ab15523daab796/contourpy-1.3.3-cp311-cp311-win32.whl", hash = "sha256:fd907ae12cd483cd83e414b12941c632a969171bf90fc937d0c9f268a31cafff", size = 183677, upload-time = "2025-07-26T12:01:17.088Z" }, - { url = "https://files.pythonhosted.org/packages/98/4b/9bd370b004b5c9d8045c6c33cf65bae018b27aca550a3f657cdc99acdbd8/contourpy-1.3.3-cp311-cp311-win_amd64.whl", hash = "sha256:3519428f6be58431c56581f1694ba8e50626f2dd550af225f82fb5f5814d2a42", size = 225234, upload-time = "2025-07-26T12:01:18.256Z" }, - { url = "https://files.pythonhosted.org/packages/d9/b6/71771e02c2e004450c12b1120a5f488cad2e4d5b590b1af8bad060360fe4/contourpy-1.3.3-cp311-cp311-win_arm64.whl", hash = "sha256:15ff10bfada4bf92ec8b31c62bf7c1834c244019b4a33095a68000d7075df470", size = 193123, upload-time = "2025-07-26T12:01:19.848Z" }, - { url = "https://files.pythonhosted.org/packages/be/45/adfee365d9ea3d853550b2e735f9d66366701c65db7855cd07621732ccfc/contourpy-1.3.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:b08a32ea2f8e42cf1d4be3169a98dd4be32bafe4f22b6c4cb4ba810fa9e5d2cb", size = 293419, upload-time = "2025-07-26T12:01:21.16Z" }, - { url = "https://files.pythonhosted.org/packages/53/3e/405b59cfa13021a56bba395a6b3aca8cec012b45bf177b0eaf7a202cde2c/contourpy-1.3.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:556dba8fb6f5d8742f2923fe9457dbdd51e1049c4a43fd3986a0b14a1d815fc6", size = 273979, upload-time = "2025-07-26T12:01:22.448Z" }, - { url = "https://files.pythonhosted.org/packages/d4/1c/a12359b9b2ca3a845e8f7f9ac08bdf776114eb931392fcad91743e2ea17b/contourpy-1.3.3-cp312-cp312-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:92d9abc807cf7d0e047b95ca5d957cf4792fcd04e920ca70d48add15c1a90ea7", size = 332653, upload-time = "2025-07-26T12:01:24.155Z" }, - { url = "https://files.pythonhosted.org/packages/63/12/897aeebfb475b7748ea67b61e045accdfcf0d971f8a588b67108ed7f5512/contourpy-1.3.3-cp312-cp312-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:b2e8faa0ed68cb29af51edd8e24798bb661eac3bd9f65420c1887b6ca89987c8", size = 379536, upload-time = "2025-07-26T12:01:25.91Z" }, - { url = "https://files.pythonhosted.org/packages/43/8a/a8c584b82deb248930ce069e71576fc09bd7174bbd35183b7943fb1064fd/contourpy-1.3.3-cp312-cp312-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:626d60935cf668e70a5ce6ff184fd713e9683fb458898e4249b63be9e28286ea", size = 384397, upload-time = "2025-07-26T12:01:27.152Z" }, - { url = "https://files.pythonhosted.org/packages/cc/8f/ec6289987824b29529d0dfda0d74a07cec60e54b9c92f3c9da4c0ac732de/contourpy-1.3.3-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4d00e655fcef08aba35ec9610536bfe90267d7ab5ba944f7032549c55a146da1", size = 362601, upload-time = "2025-07-26T12:01:28.808Z" }, - { url = "https://files.pythonhosted.org/packages/05/0a/a3fe3be3ee2dceb3e615ebb4df97ae6f3828aa915d3e10549ce016302bd1/contourpy-1.3.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:451e71b5a7d597379ef572de31eeb909a87246974d960049a9848c3bc6c41bf7", size = 1331288, upload-time = "2025-07-26T12:01:31.198Z" }, - { url = "https://files.pythonhosted.org/packages/33/1d/acad9bd4e97f13f3e2b18a3977fe1b4a37ecf3d38d815333980c6c72e963/contourpy-1.3.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:459c1f020cd59fcfe6650180678a9993932d80d44ccde1fa1868977438f0b411", size = 1403386, upload-time = "2025-07-26T12:01:33.947Z" }, - { url = "https://files.pythonhosted.org/packages/cf/8f/5847f44a7fddf859704217a99a23a4f6417b10e5ab1256a179264561540e/contourpy-1.3.3-cp312-cp312-win32.whl", hash = "sha256:023b44101dfe49d7d53932be418477dba359649246075c996866106da069af69", size = 185018, upload-time = "2025-07-26T12:01:35.64Z" }, - { url = "https://files.pythonhosted.org/packages/19/e8/6026ed58a64563186a9ee3f29f41261fd1828f527dd93d33b60feca63352/contourpy-1.3.3-cp312-cp312-win_amd64.whl", hash = "sha256:8153b8bfc11e1e4d75bcb0bff1db232f9e10b274e0929de9d608027e0d34ff8b", size = 226567, upload-time = "2025-07-26T12:01:36.804Z" }, - { url = "https://files.pythonhosted.org/packages/d1/e2/f05240d2c39a1ed228d8328a78b6f44cd695f7ef47beb3e684cf93604f86/contourpy-1.3.3-cp312-cp312-win_arm64.whl", hash = "sha256:07ce5ed73ecdc4a03ffe3e1b3e3c1166db35ae7584be76f65dbbe28a7791b0cc", size = 193655, upload-time = "2025-07-26T12:01:37.999Z" }, - { url = "https://files.pythonhosted.org/packages/68/35/0167aad910bbdb9599272bd96d01a9ec6852f36b9455cf2ca67bd4cc2d23/contourpy-1.3.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:177fb367556747a686509d6fef71d221a4b198a3905fe824430e5ea0fda54eb5", size = 293257, upload-time = "2025-07-26T12:01:39.367Z" }, - { url = "https://files.pythonhosted.org/packages/96/e4/7adcd9c8362745b2210728f209bfbcf7d91ba868a2c5f40d8b58f54c509b/contourpy-1.3.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:d002b6f00d73d69333dac9d0b8d5e84d9724ff9ef044fd63c5986e62b7c9e1b1", size = 274034, upload-time = "2025-07-26T12:01:40.645Z" }, - { url = "https://files.pythonhosted.org/packages/73/23/90e31ceeed1de63058a02cb04b12f2de4b40e3bef5e082a7c18d9c8ae281/contourpy-1.3.3-cp313-cp313-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:348ac1f5d4f1d66d3322420f01d42e43122f43616e0f194fc1c9f5d830c5b286", size = 334672, upload-time = "2025-07-26T12:01:41.942Z" }, - { url = "https://files.pythonhosted.org/packages/ed/93/b43d8acbe67392e659e1d984700e79eb67e2acb2bd7f62012b583a7f1b55/contourpy-1.3.3-cp313-cp313-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:655456777ff65c2c548b7c454af9c6f33f16c8884f11083244b5819cc214f1b5", size = 381234, upload-time = "2025-07-26T12:01:43.499Z" }, - { url = "https://files.pythonhosted.org/packages/46/3b/bec82a3ea06f66711520f75a40c8fc0b113b2a75edb36aa633eb11c4f50f/contourpy-1.3.3-cp313-cp313-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:644a6853d15b2512d67881586bd03f462c7ab755db95f16f14d7e238f2852c67", size = 385169, upload-time = "2025-07-26T12:01:45.219Z" }, - { url = "https://files.pythonhosted.org/packages/4b/32/e0f13a1c5b0f8572d0ec6ae2f6c677b7991fafd95da523159c19eff0696a/contourpy-1.3.3-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4debd64f124ca62069f313a9cb86656ff087786016d76927ae2cf37846b006c9", size = 362859, upload-time = "2025-07-26T12:01:46.519Z" }, - { url = "https://files.pythonhosted.org/packages/33/71/e2a7945b7de4e58af42d708a219f3b2f4cff7386e6b6ab0a0fa0033c49a9/contourpy-1.3.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:a15459b0f4615b00bbd1e91f1b9e19b7e63aea7483d03d804186f278c0af2659", size = 1332062, upload-time = "2025-07-26T12:01:48.964Z" }, - { url = "https://files.pythonhosted.org/packages/12/fc/4e87ac754220ccc0e807284f88e943d6d43b43843614f0a8afa469801db0/contourpy-1.3.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:ca0fdcd73925568ca027e0b17ab07aad764be4706d0a925b89227e447d9737b7", size = 1403932, upload-time = "2025-07-26T12:01:51.979Z" }, - { url = "https://files.pythonhosted.org/packages/a6/2e/adc197a37443f934594112222ac1aa7dc9a98faf9c3842884df9a9d8751d/contourpy-1.3.3-cp313-cp313-win32.whl", hash = "sha256:b20c7c9a3bf701366556e1b1984ed2d0cedf999903c51311417cf5f591d8c78d", size = 185024, upload-time = "2025-07-26T12:01:53.245Z" }, - { url = "https://files.pythonhosted.org/packages/18/0b/0098c214843213759692cc638fce7de5c289200a830e5035d1791d7a2338/contourpy-1.3.3-cp313-cp313-win_amd64.whl", hash = "sha256:1cadd8b8969f060ba45ed7c1b714fe69185812ab43bd6b86a9123fe8f99c3263", size = 226578, upload-time = "2025-07-26T12:01:54.422Z" }, - { url = "https://files.pythonhosted.org/packages/8a/9a/2f6024a0c5995243cd63afdeb3651c984f0d2bc727fd98066d40e141ad73/contourpy-1.3.3-cp313-cp313-win_arm64.whl", hash = "sha256:fd914713266421b7536de2bfa8181aa8c699432b6763a0ea64195ebe28bff6a9", size = 193524, upload-time = "2025-07-26T12:01:55.73Z" }, - { url = "https://files.pythonhosted.org/packages/c0/b3/f8a1a86bd3298513f500e5b1f5fd92b69896449f6cab6a146a5d52715479/contourpy-1.3.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:88df9880d507169449d434c293467418b9f6cbe82edd19284aa0409e7fdb933d", size = 306730, upload-time = "2025-07-26T12:01:57.051Z" }, - { url = "https://files.pythonhosted.org/packages/3f/11/4780db94ae62fc0c2053909b65dc3246bd7cecfc4f8a20d957ad43aa4ad8/contourpy-1.3.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:d06bb1f751ba5d417047db62bca3c8fde202b8c11fb50742ab3ab962c81e8216", size = 287897, upload-time = "2025-07-26T12:01:58.663Z" }, - { url = "https://files.pythonhosted.org/packages/ae/15/e59f5f3ffdd6f3d4daa3e47114c53daabcb18574a26c21f03dc9e4e42ff0/contourpy-1.3.3-cp313-cp313t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e4e6b05a45525357e382909a4c1600444e2a45b4795163d3b22669285591c1ae", size = 326751, upload-time = "2025-07-26T12:02:00.343Z" }, - { url = "https://files.pythonhosted.org/packages/0f/81/03b45cfad088e4770b1dcf72ea78d3802d04200009fb364d18a493857210/contourpy-1.3.3-cp313-cp313t-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ab3074b48c4e2cf1a960e6bbeb7f04566bf36b1861d5c9d4d8ac04b82e38ba20", size = 375486, upload-time = "2025-07-26T12:02:02.128Z" }, - { url = "https://files.pythonhosted.org/packages/0c/ba/49923366492ffbdd4486e970d421b289a670ae8cf539c1ea9a09822b371a/contourpy-1.3.3-cp313-cp313t-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:6c3d53c796f8647d6deb1abe867daeb66dcc8a97e8455efa729516b997b8ed99", size = 388106, upload-time = "2025-07-26T12:02:03.615Z" }, - { url = "https://files.pythonhosted.org/packages/9f/52/5b00ea89525f8f143651f9f03a0df371d3cbd2fccd21ca9b768c7a6500c2/contourpy-1.3.3-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:50ed930df7289ff2a8d7afeb9603f8289e5704755c7e5c3bbd929c90c817164b", size = 352548, upload-time = "2025-07-26T12:02:05.165Z" }, - { url = "https://files.pythonhosted.org/packages/32/1d/a209ec1a3a3452d490f6b14dd92e72280c99ae3d1e73da74f8277d4ee08f/contourpy-1.3.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:4feffb6537d64b84877da813a5c30f1422ea5739566abf0bd18065ac040e120a", size = 1322297, upload-time = "2025-07-26T12:02:07.379Z" }, - { url = "https://files.pythonhosted.org/packages/bc/9e/46f0e8ebdd884ca0e8877e46a3f4e633f6c9c8c4f3f6e72be3fe075994aa/contourpy-1.3.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:2b7e9480ffe2b0cd2e787e4df64270e3a0440d9db8dc823312e2c940c167df7e", size = 1391023, upload-time = "2025-07-26T12:02:10.171Z" }, - { url = "https://files.pythonhosted.org/packages/b9/70/f308384a3ae9cd2209e0849f33c913f658d3326900d0ff5d378d6a1422d2/contourpy-1.3.3-cp313-cp313t-win32.whl", hash = "sha256:283edd842a01e3dcd435b1c5116798d661378d83d36d337b8dde1d16a5fc9ba3", size = 196157, upload-time = "2025-07-26T12:02:11.488Z" }, - { url = "https://files.pythonhosted.org/packages/b2/dd/880f890a6663b84d9e34a6f88cded89d78f0091e0045a284427cb6b18521/contourpy-1.3.3-cp313-cp313t-win_amd64.whl", hash = "sha256:87acf5963fc2b34825e5b6b048f40e3635dd547f590b04d2ab317c2619ef7ae8", size = 240570, upload-time = "2025-07-26T12:02:12.754Z" }, - { url = "https://files.pythonhosted.org/packages/80/99/2adc7d8ffead633234817ef8e9a87115c8a11927a94478f6bb3d3f4d4f7d/contourpy-1.3.3-cp313-cp313t-win_arm64.whl", hash = "sha256:3c30273eb2a55024ff31ba7d052dde990d7d8e5450f4bbb6e913558b3d6c2301", size = 199713, upload-time = "2025-07-26T12:02:14.4Z" }, - { url = "https://files.pythonhosted.org/packages/72/8b/4546f3ab60f78c514ffb7d01a0bd743f90de36f0019d1be84d0a708a580a/contourpy-1.3.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:fde6c716d51c04b1c25d0b90364d0be954624a0ee9d60e23e850e8d48353d07a", size = 292189, upload-time = "2025-07-26T12:02:16.095Z" }, - { url = "https://files.pythonhosted.org/packages/fd/e1/3542a9cb596cadd76fcef413f19c79216e002623158befe6daa03dbfa88c/contourpy-1.3.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:cbedb772ed74ff5be440fa8eee9bd49f64f6e3fc09436d9c7d8f1c287b121d77", size = 273251, upload-time = "2025-07-26T12:02:17.524Z" }, - { url = "https://files.pythonhosted.org/packages/b1/71/f93e1e9471d189f79d0ce2497007731c1e6bf9ef6d1d61b911430c3db4e5/contourpy-1.3.3-cp314-cp314-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:22e9b1bd7a9b1d652cd77388465dc358dafcd2e217d35552424aa4f996f524f5", size = 335810, upload-time = "2025-07-26T12:02:18.9Z" }, - { url = "https://files.pythonhosted.org/packages/91/f9/e35f4c1c93f9275d4e38681a80506b5510e9327350c51f8d4a5a724d178c/contourpy-1.3.3-cp314-cp314-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a22738912262aa3e254e4f3cb079a95a67132fc5a063890e224393596902f5a4", size = 382871, upload-time = "2025-07-26T12:02:20.418Z" }, - { url = "https://files.pythonhosted.org/packages/b5/71/47b512f936f66a0a900d81c396a7e60d73419868fba959c61efed7a8ab46/contourpy-1.3.3-cp314-cp314-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:afe5a512f31ee6bd7d0dda52ec9864c984ca3d66664444f2d72e0dc4eb832e36", size = 386264, upload-time = "2025-07-26T12:02:21.916Z" }, - { url = "https://files.pythonhosted.org/packages/04/5f/9ff93450ba96b09c7c2b3f81c94de31c89f92292f1380261bd7195bea4ea/contourpy-1.3.3-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f64836de09927cba6f79dcd00fdd7d5329f3fccc633468507079c829ca4db4e3", size = 363819, upload-time = "2025-07-26T12:02:23.759Z" }, - { url = "https://files.pythonhosted.org/packages/3e/a6/0b185d4cc480ee494945cde102cb0149ae830b5fa17bf855b95f2e70ad13/contourpy-1.3.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:1fd43c3be4c8e5fd6e4f2baeae35ae18176cf2e5cced681cca908addf1cdd53b", size = 1333650, upload-time = "2025-07-26T12:02:26.181Z" }, - { url = "https://files.pythonhosted.org/packages/43/d7/afdc95580ca56f30fbcd3060250f66cedbde69b4547028863abd8aa3b47e/contourpy-1.3.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:6afc576f7b33cf00996e5c1102dc2a8f7cc89e39c0b55df93a0b78c1bd992b36", size = 1404833, upload-time = "2025-07-26T12:02:28.782Z" }, - { url = "https://files.pythonhosted.org/packages/e2/e2/366af18a6d386f41132a48f033cbd2102e9b0cf6345d35ff0826cd984566/contourpy-1.3.3-cp314-cp314-win32.whl", hash = "sha256:66c8a43a4f7b8df8b71ee1840e4211a3c8d93b214b213f590e18a1beca458f7d", size = 189692, upload-time = "2025-07-26T12:02:30.128Z" }, - { url = "https://files.pythonhosted.org/packages/7d/c2/57f54b03d0f22d4044b8afb9ca0e184f8b1afd57b4f735c2fa70883dc601/contourpy-1.3.3-cp314-cp314-win_amd64.whl", hash = "sha256:cf9022ef053f2694e31d630feaacb21ea24224be1c3ad0520b13d844274614fd", size = 232424, upload-time = "2025-07-26T12:02:31.395Z" }, - { url = "https://files.pythonhosted.org/packages/18/79/a9416650df9b525737ab521aa181ccc42d56016d2123ddcb7b58e926a42c/contourpy-1.3.3-cp314-cp314-win_arm64.whl", hash = "sha256:95b181891b4c71de4bb404c6621e7e2390745f887f2a026b2d99e92c17892339", size = 198300, upload-time = "2025-07-26T12:02:32.956Z" }, - { url = "https://files.pythonhosted.org/packages/1f/42/38c159a7d0f2b7b9c04c64ab317042bb6952b713ba875c1681529a2932fe/contourpy-1.3.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:33c82d0138c0a062380332c861387650c82e4cf1747aaa6938b9b6516762e772", size = 306769, upload-time = "2025-07-26T12:02:34.2Z" }, - { url = "https://files.pythonhosted.org/packages/c3/6c/26a8205f24bca10974e77460de68d3d7c63e282e23782f1239f226fcae6f/contourpy-1.3.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:ea37e7b45949df430fe649e5de8351c423430046a2af20b1c1961cae3afcda77", size = 287892, upload-time = "2025-07-26T12:02:35.807Z" }, - { url = "https://files.pythonhosted.org/packages/66/06/8a475c8ab718ebfd7925661747dbb3c3ee9c82ac834ccb3570be49d129f4/contourpy-1.3.3-cp314-cp314t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d304906ecc71672e9c89e87c4675dc5c2645e1f4269a5063b99b0bb29f232d13", size = 326748, upload-time = "2025-07-26T12:02:37.193Z" }, - { url = "https://files.pythonhosted.org/packages/b4/a3/c5ca9f010a44c223f098fccd8b158bb1cb287378a31ac141f04730dc49be/contourpy-1.3.3-cp314-cp314t-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ca658cd1a680a5c9ea96dc61cdbae1e85c8f25849843aa799dfd3cb370ad4fbe", size = 375554, upload-time = "2025-07-26T12:02:38.894Z" }, - { url = "https://files.pythonhosted.org/packages/80/5b/68bd33ae63fac658a4145088c1e894405e07584a316738710b636c6d0333/contourpy-1.3.3-cp314-cp314t-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:ab2fd90904c503739a75b7c8c5c01160130ba67944a7b77bbf36ef8054576e7f", size = 388118, upload-time = "2025-07-26T12:02:40.642Z" }, - { url = "https://files.pythonhosted.org/packages/40/52/4c285a6435940ae25d7410a6c36bda5145839bc3f0beb20c707cda18b9d2/contourpy-1.3.3-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b7301b89040075c30e5768810bc96a8e8d78085b47d8be6e4c3f5a0b4ed478a0", size = 352555, upload-time = "2025-07-26T12:02:42.25Z" }, - { url = "https://files.pythonhosted.org/packages/24/ee/3e81e1dd174f5c7fefe50e85d0892de05ca4e26ef1c9a59c2a57e43b865a/contourpy-1.3.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:2a2a8b627d5cc6b7c41a4beff6c5ad5eb848c88255fda4a8745f7e901b32d8e4", size = 1322295, upload-time = "2025-07-26T12:02:44.668Z" }, - { url = "https://files.pythonhosted.org/packages/3c/b2/6d913d4d04e14379de429057cd169e5e00f6c2af3bb13e1710bcbdb5da12/contourpy-1.3.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:fd6ec6be509c787f1caf6b247f0b1ca598bef13f4ddeaa126b7658215529ba0f", size = 1391027, upload-time = "2025-07-26T12:02:47.09Z" }, - { url = "https://files.pythonhosted.org/packages/93/8a/68a4ec5c55a2971213d29a9374913f7e9f18581945a7a31d1a39b5d2dfe5/contourpy-1.3.3-cp314-cp314t-win32.whl", hash = "sha256:e74a9a0f5e3fff48fb5a7f2fd2b9b70a3fe014a67522f79b7cca4c0c7e43c9ae", size = 202428, upload-time = "2025-07-26T12:02:48.691Z" }, - { url = "https://files.pythonhosted.org/packages/fa/96/fd9f641ffedc4fa3ace923af73b9d07e869496c9cc7a459103e6e978992f/contourpy-1.3.3-cp314-cp314t-win_amd64.whl", hash = "sha256:13b68d6a62db8eafaebb8039218921399baf6e47bf85006fd8529f2a08ef33fc", size = 250331, upload-time = "2025-07-26T12:02:50.137Z" }, - { url = "https://files.pythonhosted.org/packages/ae/8c/469afb6465b853afff216f9528ffda78a915ff880ed58813ba4faf4ba0b6/contourpy-1.3.3-cp314-cp314t-win_arm64.whl", hash = "sha256:b7448cb5a725bb1e35ce88771b86fba35ef418952474492cf7c764059933ff8b", size = 203831, upload-time = "2025-07-26T12:02:51.449Z" }, - { url = "https://files.pythonhosted.org/packages/a5/29/8dcfe16f0107943fa92388c23f6e05cff0ba58058c4c95b00280d4c75a14/contourpy-1.3.3-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:cd5dfcaeb10f7b7f9dc8941717c6c2ade08f587be2226222c12b25f0483ed497", size = 278809, upload-time = "2025-07-26T12:02:52.74Z" }, - { url = "https://files.pythonhosted.org/packages/85/a9/8b37ef4f7dafeb335daee3c8254645ef5725be4d9c6aa70b50ec46ef2f7e/contourpy-1.3.3-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:0c1fc238306b35f246d61a1d416a627348b5cf0648648a031e14bb8705fcdfe8", size = 261593, upload-time = "2025-07-26T12:02:54.037Z" }, - { url = "https://files.pythonhosted.org/packages/0a/59/ebfb8c677c75605cc27f7122c90313fd2f375ff3c8d19a1694bda74aaa63/contourpy-1.3.3-pp311-pypy311_pp73-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:70f9aad7de812d6541d29d2bbf8feb22ff7e1c299523db288004e3157ff4674e", size = 302202, upload-time = "2025-07-26T12:02:55.947Z" }, - { url = "https://files.pythonhosted.org/packages/3c/37/21972a15834d90bfbfb009b9d004779bd5a07a0ec0234e5ba8f64d5736f4/contourpy-1.3.3-pp311-pypy311_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:5ed3657edf08512fc3fe81b510e35c2012fbd3081d2e26160f27ca28affec989", size = 329207, upload-time = "2025-07-26T12:02:57.468Z" }, - { url = "https://files.pythonhosted.org/packages/0c/58/bd257695f39d05594ca4ad60df5bcb7e32247f9951fd09a9b8edb82d1daa/contourpy-1.3.3-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:3d1a3799d62d45c18bafd41c5fa05120b96a28079f2393af559b843d1a966a77", size = 225315, upload-time = "2025-07-26T12:02:58.801Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/58/01/1253e6698a07380cd31a736d248a3f2a50a7c88779a1813da27503cadc2a/contourpy-1.3.3.tar.gz", hash = "sha256:083e12155b210502d0bca491432bb04d56dc3432f95a979b429f2848c3dbe880", size = 13466174 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/91/2e/c4390a31919d8a78b90e8ecf87cd4b4c4f05a5b48d05ec17db8e5404c6f4/contourpy-1.3.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:709a48ef9a690e1343202916450bc48b9e51c049b089c7f79a267b46cffcdaa1", size = 288773 }, + { url = "https://files.pythonhosted.org/packages/0d/44/c4b0b6095fef4dc9c420e041799591e3b63e9619e3044f7f4f6c21c0ab24/contourpy-1.3.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:23416f38bfd74d5d28ab8429cc4d63fa67d5068bd711a85edb1c3fb0c3e2f381", size = 270149 }, + { url = "https://files.pythonhosted.org/packages/30/2e/dd4ced42fefac8470661d7cb7e264808425e6c5d56d175291e93890cce09/contourpy-1.3.3-cp311-cp311-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:929ddf8c4c7f348e4c0a5a3a714b5c8542ffaa8c22954862a46ca1813b667ee7", size = 329222 }, + { url = "https://files.pythonhosted.org/packages/f2/74/cc6ec2548e3d276c71389ea4802a774b7aa3558223b7bade3f25787fafc2/contourpy-1.3.3-cp311-cp311-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:9e999574eddae35f1312c2b4b717b7885d4edd6cb46700e04f7f02db454e67c1", size = 377234 }, + { url = "https://files.pythonhosted.org/packages/03/b3/64ef723029f917410f75c09da54254c5f9ea90ef89b143ccadb09df14c15/contourpy-1.3.3-cp311-cp311-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:0bf67e0e3f482cb69779dd3061b534eb35ac9b17f163d851e2a547d56dba0a3a", size = 380555 }, + { url = "https://files.pythonhosted.org/packages/5f/4b/6157f24ca425b89fe2eb7e7be642375711ab671135be21e6faa100f7448c/contourpy-1.3.3-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:51e79c1f7470158e838808d4a996fa9bac72c498e93d8ebe5119bc1e6becb0db", size = 355238 }, + { url = "https://files.pythonhosted.org/packages/98/56/f914f0dd678480708a04cfd2206e7c382533249bc5001eb9f58aa693e200/contourpy-1.3.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:598c3aaece21c503615fd59c92a3598b428b2f01bfb4b8ca9c4edeecc2438620", size = 1326218 }, + { url = "https://files.pythonhosted.org/packages/fb/d7/4a972334a0c971acd5172389671113ae82aa7527073980c38d5868ff1161/contourpy-1.3.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:322ab1c99b008dad206d406bb61d014cf0174df491ae9d9d0fac6a6fda4f977f", size = 1392867 }, + { url = "https://files.pythonhosted.org/packages/75/3e/f2cc6cd56dc8cff46b1a56232eabc6feea52720083ea71ab15523daab796/contourpy-1.3.3-cp311-cp311-win32.whl", hash = "sha256:fd907ae12cd483cd83e414b12941c632a969171bf90fc937d0c9f268a31cafff", size = 183677 }, + { url = "https://files.pythonhosted.org/packages/98/4b/9bd370b004b5c9d8045c6c33cf65bae018b27aca550a3f657cdc99acdbd8/contourpy-1.3.3-cp311-cp311-win_amd64.whl", hash = "sha256:3519428f6be58431c56581f1694ba8e50626f2dd550af225f82fb5f5814d2a42", size = 225234 }, + { url = "https://files.pythonhosted.org/packages/d9/b6/71771e02c2e004450c12b1120a5f488cad2e4d5b590b1af8bad060360fe4/contourpy-1.3.3-cp311-cp311-win_arm64.whl", hash = "sha256:15ff10bfada4bf92ec8b31c62bf7c1834c244019b4a33095a68000d7075df470", size = 193123 }, + { url = "https://files.pythonhosted.org/packages/be/45/adfee365d9ea3d853550b2e735f9d66366701c65db7855cd07621732ccfc/contourpy-1.3.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:b08a32ea2f8e42cf1d4be3169a98dd4be32bafe4f22b6c4cb4ba810fa9e5d2cb", size = 293419 }, + { url = "https://files.pythonhosted.org/packages/53/3e/405b59cfa13021a56bba395a6b3aca8cec012b45bf177b0eaf7a202cde2c/contourpy-1.3.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:556dba8fb6f5d8742f2923fe9457dbdd51e1049c4a43fd3986a0b14a1d815fc6", size = 273979 }, + { url = "https://files.pythonhosted.org/packages/d4/1c/a12359b9b2ca3a845e8f7f9ac08bdf776114eb931392fcad91743e2ea17b/contourpy-1.3.3-cp312-cp312-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:92d9abc807cf7d0e047b95ca5d957cf4792fcd04e920ca70d48add15c1a90ea7", size = 332653 }, + { url = "https://files.pythonhosted.org/packages/63/12/897aeebfb475b7748ea67b61e045accdfcf0d971f8a588b67108ed7f5512/contourpy-1.3.3-cp312-cp312-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:b2e8faa0ed68cb29af51edd8e24798bb661eac3bd9f65420c1887b6ca89987c8", size = 379536 }, + { url = "https://files.pythonhosted.org/packages/43/8a/a8c584b82deb248930ce069e71576fc09bd7174bbd35183b7943fb1064fd/contourpy-1.3.3-cp312-cp312-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:626d60935cf668e70a5ce6ff184fd713e9683fb458898e4249b63be9e28286ea", size = 384397 }, + { url = "https://files.pythonhosted.org/packages/cc/8f/ec6289987824b29529d0dfda0d74a07cec60e54b9c92f3c9da4c0ac732de/contourpy-1.3.3-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4d00e655fcef08aba35ec9610536bfe90267d7ab5ba944f7032549c55a146da1", size = 362601 }, + { url = "https://files.pythonhosted.org/packages/05/0a/a3fe3be3ee2dceb3e615ebb4df97ae6f3828aa915d3e10549ce016302bd1/contourpy-1.3.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:451e71b5a7d597379ef572de31eeb909a87246974d960049a9848c3bc6c41bf7", size = 1331288 }, + { url = "https://files.pythonhosted.org/packages/33/1d/acad9bd4e97f13f3e2b18a3977fe1b4a37ecf3d38d815333980c6c72e963/contourpy-1.3.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:459c1f020cd59fcfe6650180678a9993932d80d44ccde1fa1868977438f0b411", size = 1403386 }, + { url = "https://files.pythonhosted.org/packages/cf/8f/5847f44a7fddf859704217a99a23a4f6417b10e5ab1256a179264561540e/contourpy-1.3.3-cp312-cp312-win32.whl", hash = "sha256:023b44101dfe49d7d53932be418477dba359649246075c996866106da069af69", size = 185018 }, + { url = "https://files.pythonhosted.org/packages/19/e8/6026ed58a64563186a9ee3f29f41261fd1828f527dd93d33b60feca63352/contourpy-1.3.3-cp312-cp312-win_amd64.whl", hash = "sha256:8153b8bfc11e1e4d75bcb0bff1db232f9e10b274e0929de9d608027e0d34ff8b", size = 226567 }, + { url = "https://files.pythonhosted.org/packages/d1/e2/f05240d2c39a1ed228d8328a78b6f44cd695f7ef47beb3e684cf93604f86/contourpy-1.3.3-cp312-cp312-win_arm64.whl", hash = "sha256:07ce5ed73ecdc4a03ffe3e1b3e3c1166db35ae7584be76f65dbbe28a7791b0cc", size = 193655 }, + { url = "https://files.pythonhosted.org/packages/68/35/0167aad910bbdb9599272bd96d01a9ec6852f36b9455cf2ca67bd4cc2d23/contourpy-1.3.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:177fb367556747a686509d6fef71d221a4b198a3905fe824430e5ea0fda54eb5", size = 293257 }, + { url = "https://files.pythonhosted.org/packages/96/e4/7adcd9c8362745b2210728f209bfbcf7d91ba868a2c5f40d8b58f54c509b/contourpy-1.3.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:d002b6f00d73d69333dac9d0b8d5e84d9724ff9ef044fd63c5986e62b7c9e1b1", size = 274034 }, + { url = "https://files.pythonhosted.org/packages/73/23/90e31ceeed1de63058a02cb04b12f2de4b40e3bef5e082a7c18d9c8ae281/contourpy-1.3.3-cp313-cp313-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:348ac1f5d4f1d66d3322420f01d42e43122f43616e0f194fc1c9f5d830c5b286", size = 334672 }, + { url = "https://files.pythonhosted.org/packages/ed/93/b43d8acbe67392e659e1d984700e79eb67e2acb2bd7f62012b583a7f1b55/contourpy-1.3.3-cp313-cp313-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:655456777ff65c2c548b7c454af9c6f33f16c8884f11083244b5819cc214f1b5", size = 381234 }, + { url = "https://files.pythonhosted.org/packages/46/3b/bec82a3ea06f66711520f75a40c8fc0b113b2a75edb36aa633eb11c4f50f/contourpy-1.3.3-cp313-cp313-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:644a6853d15b2512d67881586bd03f462c7ab755db95f16f14d7e238f2852c67", size = 385169 }, + { url = "https://files.pythonhosted.org/packages/4b/32/e0f13a1c5b0f8572d0ec6ae2f6c677b7991fafd95da523159c19eff0696a/contourpy-1.3.3-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4debd64f124ca62069f313a9cb86656ff087786016d76927ae2cf37846b006c9", size = 362859 }, + { url = "https://files.pythonhosted.org/packages/33/71/e2a7945b7de4e58af42d708a219f3b2f4cff7386e6b6ab0a0fa0033c49a9/contourpy-1.3.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:a15459b0f4615b00bbd1e91f1b9e19b7e63aea7483d03d804186f278c0af2659", size = 1332062 }, + { url = "https://files.pythonhosted.org/packages/12/fc/4e87ac754220ccc0e807284f88e943d6d43b43843614f0a8afa469801db0/contourpy-1.3.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:ca0fdcd73925568ca027e0b17ab07aad764be4706d0a925b89227e447d9737b7", size = 1403932 }, + { url = "https://files.pythonhosted.org/packages/a6/2e/adc197a37443f934594112222ac1aa7dc9a98faf9c3842884df9a9d8751d/contourpy-1.3.3-cp313-cp313-win32.whl", hash = "sha256:b20c7c9a3bf701366556e1b1984ed2d0cedf999903c51311417cf5f591d8c78d", size = 185024 }, + { url = "https://files.pythonhosted.org/packages/18/0b/0098c214843213759692cc638fce7de5c289200a830e5035d1791d7a2338/contourpy-1.3.3-cp313-cp313-win_amd64.whl", hash = "sha256:1cadd8b8969f060ba45ed7c1b714fe69185812ab43bd6b86a9123fe8f99c3263", size = 226578 }, + { url = "https://files.pythonhosted.org/packages/8a/9a/2f6024a0c5995243cd63afdeb3651c984f0d2bc727fd98066d40e141ad73/contourpy-1.3.3-cp313-cp313-win_arm64.whl", hash = "sha256:fd914713266421b7536de2bfa8181aa8c699432b6763a0ea64195ebe28bff6a9", size = 193524 }, + { url = "https://files.pythonhosted.org/packages/c0/b3/f8a1a86bd3298513f500e5b1f5fd92b69896449f6cab6a146a5d52715479/contourpy-1.3.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:88df9880d507169449d434c293467418b9f6cbe82edd19284aa0409e7fdb933d", size = 306730 }, + { url = "https://files.pythonhosted.org/packages/3f/11/4780db94ae62fc0c2053909b65dc3246bd7cecfc4f8a20d957ad43aa4ad8/contourpy-1.3.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:d06bb1f751ba5d417047db62bca3c8fde202b8c11fb50742ab3ab962c81e8216", size = 287897 }, + { url = "https://files.pythonhosted.org/packages/ae/15/e59f5f3ffdd6f3d4daa3e47114c53daabcb18574a26c21f03dc9e4e42ff0/contourpy-1.3.3-cp313-cp313t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e4e6b05a45525357e382909a4c1600444e2a45b4795163d3b22669285591c1ae", size = 326751 }, + { url = "https://files.pythonhosted.org/packages/0f/81/03b45cfad088e4770b1dcf72ea78d3802d04200009fb364d18a493857210/contourpy-1.3.3-cp313-cp313t-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ab3074b48c4e2cf1a960e6bbeb7f04566bf36b1861d5c9d4d8ac04b82e38ba20", size = 375486 }, + { url = "https://files.pythonhosted.org/packages/0c/ba/49923366492ffbdd4486e970d421b289a670ae8cf539c1ea9a09822b371a/contourpy-1.3.3-cp313-cp313t-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:6c3d53c796f8647d6deb1abe867daeb66dcc8a97e8455efa729516b997b8ed99", size = 388106 }, + { url = "https://files.pythonhosted.org/packages/9f/52/5b00ea89525f8f143651f9f03a0df371d3cbd2fccd21ca9b768c7a6500c2/contourpy-1.3.3-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:50ed930df7289ff2a8d7afeb9603f8289e5704755c7e5c3bbd929c90c817164b", size = 352548 }, + { url = "https://files.pythonhosted.org/packages/32/1d/a209ec1a3a3452d490f6b14dd92e72280c99ae3d1e73da74f8277d4ee08f/contourpy-1.3.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:4feffb6537d64b84877da813a5c30f1422ea5739566abf0bd18065ac040e120a", size = 1322297 }, + { url = "https://files.pythonhosted.org/packages/bc/9e/46f0e8ebdd884ca0e8877e46a3f4e633f6c9c8c4f3f6e72be3fe075994aa/contourpy-1.3.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:2b7e9480ffe2b0cd2e787e4df64270e3a0440d9db8dc823312e2c940c167df7e", size = 1391023 }, + { url = "https://files.pythonhosted.org/packages/b9/70/f308384a3ae9cd2209e0849f33c913f658d3326900d0ff5d378d6a1422d2/contourpy-1.3.3-cp313-cp313t-win32.whl", hash = "sha256:283edd842a01e3dcd435b1c5116798d661378d83d36d337b8dde1d16a5fc9ba3", size = 196157 }, + { url = "https://files.pythonhosted.org/packages/b2/dd/880f890a6663b84d9e34a6f88cded89d78f0091e0045a284427cb6b18521/contourpy-1.3.3-cp313-cp313t-win_amd64.whl", hash = "sha256:87acf5963fc2b34825e5b6b048f40e3635dd547f590b04d2ab317c2619ef7ae8", size = 240570 }, + { url = "https://files.pythonhosted.org/packages/80/99/2adc7d8ffead633234817ef8e9a87115c8a11927a94478f6bb3d3f4d4f7d/contourpy-1.3.3-cp313-cp313t-win_arm64.whl", hash = "sha256:3c30273eb2a55024ff31ba7d052dde990d7d8e5450f4bbb6e913558b3d6c2301", size = 199713 }, + { url = "https://files.pythonhosted.org/packages/72/8b/4546f3ab60f78c514ffb7d01a0bd743f90de36f0019d1be84d0a708a580a/contourpy-1.3.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:fde6c716d51c04b1c25d0b90364d0be954624a0ee9d60e23e850e8d48353d07a", size = 292189 }, + { url = "https://files.pythonhosted.org/packages/fd/e1/3542a9cb596cadd76fcef413f19c79216e002623158befe6daa03dbfa88c/contourpy-1.3.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:cbedb772ed74ff5be440fa8eee9bd49f64f6e3fc09436d9c7d8f1c287b121d77", size = 273251 }, + { url = "https://files.pythonhosted.org/packages/b1/71/f93e1e9471d189f79d0ce2497007731c1e6bf9ef6d1d61b911430c3db4e5/contourpy-1.3.3-cp314-cp314-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:22e9b1bd7a9b1d652cd77388465dc358dafcd2e217d35552424aa4f996f524f5", size = 335810 }, + { url = "https://files.pythonhosted.org/packages/91/f9/e35f4c1c93f9275d4e38681a80506b5510e9327350c51f8d4a5a724d178c/contourpy-1.3.3-cp314-cp314-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a22738912262aa3e254e4f3cb079a95a67132fc5a063890e224393596902f5a4", size = 382871 }, + { url = "https://files.pythonhosted.org/packages/b5/71/47b512f936f66a0a900d81c396a7e60d73419868fba959c61efed7a8ab46/contourpy-1.3.3-cp314-cp314-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:afe5a512f31ee6bd7d0dda52ec9864c984ca3d66664444f2d72e0dc4eb832e36", size = 386264 }, + { url = "https://files.pythonhosted.org/packages/04/5f/9ff93450ba96b09c7c2b3f81c94de31c89f92292f1380261bd7195bea4ea/contourpy-1.3.3-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f64836de09927cba6f79dcd00fdd7d5329f3fccc633468507079c829ca4db4e3", size = 363819 }, + { url = "https://files.pythonhosted.org/packages/3e/a6/0b185d4cc480ee494945cde102cb0149ae830b5fa17bf855b95f2e70ad13/contourpy-1.3.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:1fd43c3be4c8e5fd6e4f2baeae35ae18176cf2e5cced681cca908addf1cdd53b", size = 1333650 }, + { url = "https://files.pythonhosted.org/packages/43/d7/afdc95580ca56f30fbcd3060250f66cedbde69b4547028863abd8aa3b47e/contourpy-1.3.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:6afc576f7b33cf00996e5c1102dc2a8f7cc89e39c0b55df93a0b78c1bd992b36", size = 1404833 }, + { url = "https://files.pythonhosted.org/packages/e2/e2/366af18a6d386f41132a48f033cbd2102e9b0cf6345d35ff0826cd984566/contourpy-1.3.3-cp314-cp314-win32.whl", hash = "sha256:66c8a43a4f7b8df8b71ee1840e4211a3c8d93b214b213f590e18a1beca458f7d", size = 189692 }, + { url = "https://files.pythonhosted.org/packages/7d/c2/57f54b03d0f22d4044b8afb9ca0e184f8b1afd57b4f735c2fa70883dc601/contourpy-1.3.3-cp314-cp314-win_amd64.whl", hash = "sha256:cf9022ef053f2694e31d630feaacb21ea24224be1c3ad0520b13d844274614fd", size = 232424 }, + { url = "https://files.pythonhosted.org/packages/18/79/a9416650df9b525737ab521aa181ccc42d56016d2123ddcb7b58e926a42c/contourpy-1.3.3-cp314-cp314-win_arm64.whl", hash = "sha256:95b181891b4c71de4bb404c6621e7e2390745f887f2a026b2d99e92c17892339", size = 198300 }, + { url = "https://files.pythonhosted.org/packages/1f/42/38c159a7d0f2b7b9c04c64ab317042bb6952b713ba875c1681529a2932fe/contourpy-1.3.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:33c82d0138c0a062380332c861387650c82e4cf1747aaa6938b9b6516762e772", size = 306769 }, + { url = "https://files.pythonhosted.org/packages/c3/6c/26a8205f24bca10974e77460de68d3d7c63e282e23782f1239f226fcae6f/contourpy-1.3.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:ea37e7b45949df430fe649e5de8351c423430046a2af20b1c1961cae3afcda77", size = 287892 }, + { url = "https://files.pythonhosted.org/packages/66/06/8a475c8ab718ebfd7925661747dbb3c3ee9c82ac834ccb3570be49d129f4/contourpy-1.3.3-cp314-cp314t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d304906ecc71672e9c89e87c4675dc5c2645e1f4269a5063b99b0bb29f232d13", size = 326748 }, + { url = "https://files.pythonhosted.org/packages/b4/a3/c5ca9f010a44c223f098fccd8b158bb1cb287378a31ac141f04730dc49be/contourpy-1.3.3-cp314-cp314t-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ca658cd1a680a5c9ea96dc61cdbae1e85c8f25849843aa799dfd3cb370ad4fbe", size = 375554 }, + { url = "https://files.pythonhosted.org/packages/80/5b/68bd33ae63fac658a4145088c1e894405e07584a316738710b636c6d0333/contourpy-1.3.3-cp314-cp314t-manylinux_2_26_s390x.manylinux_2_28_s390x.whl", hash = "sha256:ab2fd90904c503739a75b7c8c5c01160130ba67944a7b77bbf36ef8054576e7f", size = 388118 }, + { url = "https://files.pythonhosted.org/packages/40/52/4c285a6435940ae25d7410a6c36bda5145839bc3f0beb20c707cda18b9d2/contourpy-1.3.3-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b7301b89040075c30e5768810bc96a8e8d78085b47d8be6e4c3f5a0b4ed478a0", size = 352555 }, + { url = "https://files.pythonhosted.org/packages/24/ee/3e81e1dd174f5c7fefe50e85d0892de05ca4e26ef1c9a59c2a57e43b865a/contourpy-1.3.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:2a2a8b627d5cc6b7c41a4beff6c5ad5eb848c88255fda4a8745f7e901b32d8e4", size = 1322295 }, + { url = "https://files.pythonhosted.org/packages/3c/b2/6d913d4d04e14379de429057cd169e5e00f6c2af3bb13e1710bcbdb5da12/contourpy-1.3.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:fd6ec6be509c787f1caf6b247f0b1ca598bef13f4ddeaa126b7658215529ba0f", size = 1391027 }, + { url = "https://files.pythonhosted.org/packages/93/8a/68a4ec5c55a2971213d29a9374913f7e9f18581945a7a31d1a39b5d2dfe5/contourpy-1.3.3-cp314-cp314t-win32.whl", hash = "sha256:e74a9a0f5e3fff48fb5a7f2fd2b9b70a3fe014a67522f79b7cca4c0c7e43c9ae", size = 202428 }, + { url = "https://files.pythonhosted.org/packages/fa/96/fd9f641ffedc4fa3ace923af73b9d07e869496c9cc7a459103e6e978992f/contourpy-1.3.3-cp314-cp314t-win_amd64.whl", hash = "sha256:13b68d6a62db8eafaebb8039218921399baf6e47bf85006fd8529f2a08ef33fc", size = 250331 }, + { url = "https://files.pythonhosted.org/packages/ae/8c/469afb6465b853afff216f9528ffda78a915ff880ed58813ba4faf4ba0b6/contourpy-1.3.3-cp314-cp314t-win_arm64.whl", hash = "sha256:b7448cb5a725bb1e35ce88771b86fba35ef418952474492cf7c764059933ff8b", size = 203831 }, + { url = "https://files.pythonhosted.org/packages/a5/29/8dcfe16f0107943fa92388c23f6e05cff0ba58058c4c95b00280d4c75a14/contourpy-1.3.3-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:cd5dfcaeb10f7b7f9dc8941717c6c2ade08f587be2226222c12b25f0483ed497", size = 278809 }, + { url = "https://files.pythonhosted.org/packages/85/a9/8b37ef4f7dafeb335daee3c8254645ef5725be4d9c6aa70b50ec46ef2f7e/contourpy-1.3.3-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:0c1fc238306b35f246d61a1d416a627348b5cf0648648a031e14bb8705fcdfe8", size = 261593 }, + { url = "https://files.pythonhosted.org/packages/0a/59/ebfb8c677c75605cc27f7122c90313fd2f375ff3c8d19a1694bda74aaa63/contourpy-1.3.3-pp311-pypy311_pp73-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:70f9aad7de812d6541d29d2bbf8feb22ff7e1c299523db288004e3157ff4674e", size = 302202 }, + { url = "https://files.pythonhosted.org/packages/3c/37/21972a15834d90bfbfb009b9d004779bd5a07a0ec0234e5ba8f64d5736f4/contourpy-1.3.3-pp311-pypy311_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:5ed3657edf08512fc3fe81b510e35c2012fbd3081d2e26160f27ca28affec989", size = 329207 }, + { url = "https://files.pythonhosted.org/packages/0c/58/bd257695f39d05594ca4ad60df5bcb7e32247f9951fd09a9b8edb82d1daa/contourpy-1.3.3-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:3d1a3799d62d45c18bafd41c5fa05120b96a28079f2393af559b843d1a966a77", size = 225315 }, ] [[package]] name = "cycler" version = "0.12.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a9/95/a3dbbb5028f35eafb79008e7522a75244477d2838f38cbb722248dabc2a8/cycler-0.12.1.tar.gz", hash = "sha256:88bb128f02ba341da8ef447245a9e138fae777f6a23943da4540077d3601eb1c", size = 7615, upload-time = "2023-10-07T05:32:18.335Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a9/95/a3dbbb5028f35eafb79008e7522a75244477d2838f38cbb722248dabc2a8/cycler-0.12.1.tar.gz", hash = "sha256:88bb128f02ba341da8ef447245a9e138fae777f6a23943da4540077d3601eb1c", size = 7615 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e7/05/c19819d5e3d95294a6f5947fb9b9629efb316b96de511b418c53d245aae6/cycler-0.12.1-py3-none-any.whl", hash = "sha256:85cef7cff222d8644161529808465972e51340599459b8ac3ccbac5a854e0d30", size = 8321, upload-time = "2023-10-07T05:32:16.783Z" }, + { url = "https://files.pythonhosted.org/packages/e7/05/c19819d5e3d95294a6f5947fb9b9629efb316b96de511b418c53d245aae6/cycler-0.12.1-py3-none-any.whl", hash = "sha256:85cef7cff222d8644161529808465972e51340599459b8ac3ccbac5a854e0d30", size = 8321 }, ] [[package]] name = "debugpy" version = "1.8.17" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/15/ad/71e708ff4ca377c4230530d6a7aa7992592648c122a2cd2b321cf8b35a76/debugpy-1.8.17.tar.gz", hash = "sha256:fd723b47a8c08892b1a16b2c6239a8b96637c62a59b94bb5dab4bac592a58a8e", size = 1644129, upload-time = "2025-09-17T16:33:20.633Z" } +sdist = { url = "https://files.pythonhosted.org/packages/15/ad/71e708ff4ca377c4230530d6a7aa7992592648c122a2cd2b321cf8b35a76/debugpy-1.8.17.tar.gz", hash = "sha256:fd723b47a8c08892b1a16b2c6239a8b96637c62a59b94bb5dab4bac592a58a8e", size = 1644129 } wheels = [ - { url = "https://files.pythonhosted.org/packages/d8/53/3af72b5c159278c4a0cf4cffa518675a0e73bdb7d1cac0239b815502d2ce/debugpy-1.8.17-cp311-cp311-macosx_15_0_universal2.whl", hash = "sha256:d3fce3f0e3de262a3b67e69916d001f3e767661c6e1ee42553009d445d1cd840", size = 2207154, upload-time = "2025-09-17T16:33:29.457Z" }, - { url = "https://files.pythonhosted.org/packages/8f/6d/204f407df45600e2245b4a39860ed4ba32552330a0b3f5f160ae4cc30072/debugpy-1.8.17-cp311-cp311-manylinux_2_34_x86_64.whl", hash = "sha256:c6bdf134457ae0cac6fb68205776be635d31174eeac9541e1d0c062165c6461f", size = 3170322, upload-time = "2025-09-17T16:33:30.837Z" }, - { url = "https://files.pythonhosted.org/packages/f2/13/1b8f87d39cf83c6b713de2620c31205299e6065622e7dd37aff4808dd410/debugpy-1.8.17-cp311-cp311-win32.whl", hash = "sha256:e79a195f9e059edfe5d8bf6f3749b2599452d3e9380484cd261f6b7cd2c7c4da", size = 5155078, upload-time = "2025-09-17T16:33:33.331Z" }, - { url = "https://files.pythonhosted.org/packages/c2/c5/c012c60a2922cc91caa9675d0ddfbb14ba59e1e36228355f41cab6483469/debugpy-1.8.17-cp311-cp311-win_amd64.whl", hash = "sha256:b532282ad4eca958b1b2d7dbcb2b7218e02cb934165859b918e3b6ba7772d3f4", size = 5179011, upload-time = "2025-09-17T16:33:35.711Z" }, - { url = "https://files.pythonhosted.org/packages/08/2b/9d8e65beb2751876c82e1aceb32f328c43ec872711fa80257c7674f45650/debugpy-1.8.17-cp312-cp312-macosx_15_0_universal2.whl", hash = "sha256:f14467edef672195c6f6b8e27ce5005313cb5d03c9239059bc7182b60c176e2d", size = 2549522, upload-time = "2025-09-17T16:33:38.466Z" }, - { url = "https://files.pythonhosted.org/packages/b4/78/eb0d77f02971c05fca0eb7465b18058ba84bd957062f5eec82f941ac792a/debugpy-1.8.17-cp312-cp312-manylinux_2_34_x86_64.whl", hash = "sha256:24693179ef9dfa20dca8605905a42b392be56d410c333af82f1c5dff807a64cc", size = 4309417, upload-time = "2025-09-17T16:33:41.299Z" }, - { url = "https://files.pythonhosted.org/packages/37/42/c40f1d8cc1fed1e75ea54298a382395b8b937d923fcf41ab0797a554f555/debugpy-1.8.17-cp312-cp312-win32.whl", hash = "sha256:6a4e9dacf2cbb60d2514ff7b04b4534b0139facbf2abdffe0639ddb6088e59cf", size = 5277130, upload-time = "2025-09-17T16:33:43.554Z" }, - { url = "https://files.pythonhosted.org/packages/72/22/84263b205baad32b81b36eac076de0cdbe09fe2d0637f5b32243dc7c925b/debugpy-1.8.17-cp312-cp312-win_amd64.whl", hash = "sha256:e8f8f61c518952fb15f74a302e068b48d9c4691768ade433e4adeea961993464", size = 5319053, upload-time = "2025-09-17T16:33:53.033Z" }, - { url = "https://files.pythonhosted.org/packages/50/76/597e5cb97d026274ba297af8d89138dfd9e695767ba0e0895edb20963f40/debugpy-1.8.17-cp313-cp313-macosx_15_0_universal2.whl", hash = "sha256:857c1dd5d70042502aef1c6d1c2801211f3ea7e56f75e9c335f434afb403e464", size = 2538386, upload-time = "2025-09-17T16:33:54.594Z" }, - { url = "https://files.pythonhosted.org/packages/5f/60/ce5c34fcdfec493701f9d1532dba95b21b2f6394147234dce21160bd923f/debugpy-1.8.17-cp313-cp313-manylinux_2_34_x86_64.whl", hash = "sha256:3bea3b0b12f3946e098cce9b43c3c46e317b567f79570c3f43f0b96d00788088", size = 4292100, upload-time = "2025-09-17T16:33:56.353Z" }, - { url = "https://files.pythonhosted.org/packages/e8/95/7873cf2146577ef71d2a20bf553f12df865922a6f87b9e8ee1df04f01785/debugpy-1.8.17-cp313-cp313-win32.whl", hash = "sha256:e34ee844c2f17b18556b5bbe59e1e2ff4e86a00282d2a46edab73fd7f18f4a83", size = 5277002, upload-time = "2025-09-17T16:33:58.231Z" }, - { url = "https://files.pythonhosted.org/packages/46/11/18c79a1cee5ff539a94ec4aa290c1c069a5580fd5cfd2fb2e282f8e905da/debugpy-1.8.17-cp313-cp313-win_amd64.whl", hash = "sha256:6c5cd6f009ad4fca8e33e5238210dc1e5f42db07d4b6ab21ac7ffa904a196420", size = 5319047, upload-time = "2025-09-17T16:34:00.586Z" }, - { url = "https://files.pythonhosted.org/packages/de/45/115d55b2a9da6de812696064ceb505c31e952c5d89c4ed1d9bb983deec34/debugpy-1.8.17-cp314-cp314-macosx_15_0_universal2.whl", hash = "sha256:045290c010bcd2d82bc97aa2daf6837443cd52f6328592698809b4549babcee1", size = 2536899, upload-time = "2025-09-17T16:34:02.657Z" }, - { url = "https://files.pythonhosted.org/packages/5a/73/2aa00c7f1f06e997ef57dc9b23d61a92120bec1437a012afb6d176585197/debugpy-1.8.17-cp314-cp314-manylinux_2_34_x86_64.whl", hash = "sha256:b69b6bd9dba6a03632534cdf67c760625760a215ae289f7489a452af1031fe1f", size = 4268254, upload-time = "2025-09-17T16:34:04.486Z" }, - { url = "https://files.pythonhosted.org/packages/86/b5/ed3e65c63c68a6634e3ba04bd10255c8e46ec16ebed7d1c79e4816d8a760/debugpy-1.8.17-cp314-cp314-win32.whl", hash = "sha256:5c59b74aa5630f3a5194467100c3b3d1c77898f9ab27e3f7dc5d40fc2f122670", size = 5277203, upload-time = "2025-09-17T16:34:06.65Z" }, - { url = "https://files.pythonhosted.org/packages/b0/26/394276b71c7538445f29e792f589ab7379ae70fd26ff5577dfde71158e96/debugpy-1.8.17-cp314-cp314-win_amd64.whl", hash = "sha256:893cba7bb0f55161de4365584b025f7064e1f88913551bcd23be3260b231429c", size = 5318493, upload-time = "2025-09-17T16:34:08.483Z" }, - { url = "https://files.pythonhosted.org/packages/b0/d0/89247ec250369fc76db477720a26b2fce7ba079ff1380e4ab4529d2fe233/debugpy-1.8.17-py2.py3-none-any.whl", hash = "sha256:60c7dca6571efe660ccb7a9508d73ca14b8796c4ed484c2002abba714226cfef", size = 5283210, upload-time = "2025-09-17T16:34:25.835Z" }, + { url = "https://files.pythonhosted.org/packages/d8/53/3af72b5c159278c4a0cf4cffa518675a0e73bdb7d1cac0239b815502d2ce/debugpy-1.8.17-cp311-cp311-macosx_15_0_universal2.whl", hash = "sha256:d3fce3f0e3de262a3b67e69916d001f3e767661c6e1ee42553009d445d1cd840", size = 2207154 }, + { url = "https://files.pythonhosted.org/packages/8f/6d/204f407df45600e2245b4a39860ed4ba32552330a0b3f5f160ae4cc30072/debugpy-1.8.17-cp311-cp311-manylinux_2_34_x86_64.whl", hash = "sha256:c6bdf134457ae0cac6fb68205776be635d31174eeac9541e1d0c062165c6461f", size = 3170322 }, + { url = "https://files.pythonhosted.org/packages/f2/13/1b8f87d39cf83c6b713de2620c31205299e6065622e7dd37aff4808dd410/debugpy-1.8.17-cp311-cp311-win32.whl", hash = "sha256:e79a195f9e059edfe5d8bf6f3749b2599452d3e9380484cd261f6b7cd2c7c4da", size = 5155078 }, + { url = "https://files.pythonhosted.org/packages/c2/c5/c012c60a2922cc91caa9675d0ddfbb14ba59e1e36228355f41cab6483469/debugpy-1.8.17-cp311-cp311-win_amd64.whl", hash = "sha256:b532282ad4eca958b1b2d7dbcb2b7218e02cb934165859b918e3b6ba7772d3f4", size = 5179011 }, + { url = "https://files.pythonhosted.org/packages/08/2b/9d8e65beb2751876c82e1aceb32f328c43ec872711fa80257c7674f45650/debugpy-1.8.17-cp312-cp312-macosx_15_0_universal2.whl", hash = "sha256:f14467edef672195c6f6b8e27ce5005313cb5d03c9239059bc7182b60c176e2d", size = 2549522 }, + { url = "https://files.pythonhosted.org/packages/b4/78/eb0d77f02971c05fca0eb7465b18058ba84bd957062f5eec82f941ac792a/debugpy-1.8.17-cp312-cp312-manylinux_2_34_x86_64.whl", hash = "sha256:24693179ef9dfa20dca8605905a42b392be56d410c333af82f1c5dff807a64cc", size = 4309417 }, + { url = "https://files.pythonhosted.org/packages/37/42/c40f1d8cc1fed1e75ea54298a382395b8b937d923fcf41ab0797a554f555/debugpy-1.8.17-cp312-cp312-win32.whl", hash = "sha256:6a4e9dacf2cbb60d2514ff7b04b4534b0139facbf2abdffe0639ddb6088e59cf", size = 5277130 }, + { url = "https://files.pythonhosted.org/packages/72/22/84263b205baad32b81b36eac076de0cdbe09fe2d0637f5b32243dc7c925b/debugpy-1.8.17-cp312-cp312-win_amd64.whl", hash = "sha256:e8f8f61c518952fb15f74a302e068b48d9c4691768ade433e4adeea961993464", size = 5319053 }, + { url = "https://files.pythonhosted.org/packages/50/76/597e5cb97d026274ba297af8d89138dfd9e695767ba0e0895edb20963f40/debugpy-1.8.17-cp313-cp313-macosx_15_0_universal2.whl", hash = "sha256:857c1dd5d70042502aef1c6d1c2801211f3ea7e56f75e9c335f434afb403e464", size = 2538386 }, + { url = "https://files.pythonhosted.org/packages/5f/60/ce5c34fcdfec493701f9d1532dba95b21b2f6394147234dce21160bd923f/debugpy-1.8.17-cp313-cp313-manylinux_2_34_x86_64.whl", hash = "sha256:3bea3b0b12f3946e098cce9b43c3c46e317b567f79570c3f43f0b96d00788088", size = 4292100 }, + { url = "https://files.pythonhosted.org/packages/e8/95/7873cf2146577ef71d2a20bf553f12df865922a6f87b9e8ee1df04f01785/debugpy-1.8.17-cp313-cp313-win32.whl", hash = "sha256:e34ee844c2f17b18556b5bbe59e1e2ff4e86a00282d2a46edab73fd7f18f4a83", size = 5277002 }, + { url = "https://files.pythonhosted.org/packages/46/11/18c79a1cee5ff539a94ec4aa290c1c069a5580fd5cfd2fb2e282f8e905da/debugpy-1.8.17-cp313-cp313-win_amd64.whl", hash = "sha256:6c5cd6f009ad4fca8e33e5238210dc1e5f42db07d4b6ab21ac7ffa904a196420", size = 5319047 }, + { url = "https://files.pythonhosted.org/packages/de/45/115d55b2a9da6de812696064ceb505c31e952c5d89c4ed1d9bb983deec34/debugpy-1.8.17-cp314-cp314-macosx_15_0_universal2.whl", hash = "sha256:045290c010bcd2d82bc97aa2daf6837443cd52f6328592698809b4549babcee1", size = 2536899 }, + { url = "https://files.pythonhosted.org/packages/5a/73/2aa00c7f1f06e997ef57dc9b23d61a92120bec1437a012afb6d176585197/debugpy-1.8.17-cp314-cp314-manylinux_2_34_x86_64.whl", hash = "sha256:b69b6bd9dba6a03632534cdf67c760625760a215ae289f7489a452af1031fe1f", size = 4268254 }, + { url = "https://files.pythonhosted.org/packages/86/b5/ed3e65c63c68a6634e3ba04bd10255c8e46ec16ebed7d1c79e4816d8a760/debugpy-1.8.17-cp314-cp314-win32.whl", hash = "sha256:5c59b74aa5630f3a5194467100c3b3d1c77898f9ab27e3f7dc5d40fc2f122670", size = 5277203 }, + { url = "https://files.pythonhosted.org/packages/b0/26/394276b71c7538445f29e792f589ab7379ae70fd26ff5577dfde71158e96/debugpy-1.8.17-cp314-cp314-win_amd64.whl", hash = "sha256:893cba7bb0f55161de4365584b025f7064e1f88913551bcd23be3260b231429c", size = 5318493 }, + { url = "https://files.pythonhosted.org/packages/b0/d0/89247ec250369fc76db477720a26b2fce7ba079ff1380e4ab4529d2fe233/debugpy-1.8.17-py2.py3-none-any.whl", hash = "sha256:60c7dca6571efe660ccb7a9508d73ca14b8796c4ed484c2002abba714226cfef", size = 5283210 }, ] [[package]] name = "decorator" version = "5.2.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/43/fa/6d96a0978d19e17b68d634497769987b16c8f4cd0a7a05048bec693caa6b/decorator-5.2.1.tar.gz", hash = "sha256:65f266143752f734b0a7cc83c46f4618af75b8c5911b00ccb61d0ac9b6da0360", size = 56711, upload-time = "2025-02-24T04:41:34.073Z" } +sdist = { url = "https://files.pythonhosted.org/packages/43/fa/6d96a0978d19e17b68d634497769987b16c8f4cd0a7a05048bec693caa6b/decorator-5.2.1.tar.gz", hash = "sha256:65f266143752f734b0a7cc83c46f4618af75b8c5911b00ccb61d0ac9b6da0360", size = 56711 } wheels = [ - { url = "https://files.pythonhosted.org/packages/4e/8c/f3147f5c4b73e7550fe5f9352eaa956ae838d5c51eb58e7a25b9f3e2643b/decorator-5.2.1-py3-none-any.whl", hash = "sha256:d316bb415a2d9e2d2b3abcc4084c6502fc09240e292cd76a76afc106a1c8e04a", size = 9190, upload-time = "2025-02-24T04:41:32.565Z" }, + { url = "https://files.pythonhosted.org/packages/4e/8c/f3147f5c4b73e7550fe5f9352eaa956ae838d5c51eb58e7a25b9f3e2643b/decorator-5.2.1-py3-none-any.whl", hash = "sha256:d316bb415a2d9e2d2b3abcc4084c6502fc09240e292cd76a76afc106a1c8e04a", size = 9190 }, ] [[package]] name = "defusedxml" version = "0.7.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/0f/d5/c66da9b79e5bdb124974bfe172b4daf3c984ebd9c2a06e2b8a4dc7331c72/defusedxml-0.7.1.tar.gz", hash = "sha256:1bb3032db185915b62d7c6209c5a8792be6a32ab2fedacc84e01b52c51aa3e69", size = 75520, upload-time = "2021-03-08T10:59:26.269Z" } +sdist = { url = "https://files.pythonhosted.org/packages/0f/d5/c66da9b79e5bdb124974bfe172b4daf3c984ebd9c2a06e2b8a4dc7331c72/defusedxml-0.7.1.tar.gz", hash = "sha256:1bb3032db185915b62d7c6209c5a8792be6a32ab2fedacc84e01b52c51aa3e69", size = 75520 } wheels = [ - { url = "https://files.pythonhosted.org/packages/07/6c/aa3f2f849e01cb6a001cd8554a88d4c77c5c1a31c95bdf1cf9301e6d9ef4/defusedxml-0.7.1-py2.py3-none-any.whl", hash = "sha256:a352e7e428770286cc899e2542b6cdaedb2b4953ff269a210103ec58f6198a61", size = 25604, upload-time = "2021-03-08T10:59:24.45Z" }, + { url = "https://files.pythonhosted.org/packages/07/6c/aa3f2f849e01cb6a001cd8554a88d4c77c5c1a31c95bdf1cf9301e6d9ef4/defusedxml-0.7.1-py2.py3-none-any.whl", hash = "sha256:a352e7e428770286cc899e2542b6cdaedb2b4953ff269a210103ec58f6198a61", size = 25604 }, ] [[package]] name = "distlib" version = "0.4.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/96/8e/709914eb2b5749865801041647dc7f4e6d00b549cfe88b65ca192995f07c/distlib-0.4.0.tar.gz", hash = "sha256:feec40075be03a04501a973d81f633735b4b69f98b05450592310c0f401a4e0d", size = 614605, upload-time = "2025-07-17T16:52:00.465Z" } +sdist = { url = "https://files.pythonhosted.org/packages/96/8e/709914eb2b5749865801041647dc7f4e6d00b549cfe88b65ca192995f07c/distlib-0.4.0.tar.gz", hash = "sha256:feec40075be03a04501a973d81f633735b4b69f98b05450592310c0f401a4e0d", size = 614605 } wheels = [ - { url = "https://files.pythonhosted.org/packages/33/6b/e0547afaf41bf2c42e52430072fa5658766e3d65bd4b03a563d1b6336f57/distlib-0.4.0-py2.py3-none-any.whl", hash = "sha256:9659f7d87e46584a30b5780e43ac7a2143098441670ff0a49d5f9034c54a6c16", size = 469047, upload-time = "2025-07-17T16:51:58.613Z" }, + { url = "https://files.pythonhosted.org/packages/33/6b/e0547afaf41bf2c42e52430072fa5658766e3d65bd4b03a563d1b6336f57/distlib-0.4.0-py2.py3-none-any.whl", hash = "sha256:9659f7d87e46584a30b5780e43ac7a2143098441670ff0a49d5f9034c54a6c16", size = 469047 }, ] [[package]] name = "docutils" version = "0.21.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ae/ed/aefcc8cd0ba62a0560c3c18c33925362d46c6075480bfa4df87b28e169a9/docutils-0.21.2.tar.gz", hash = "sha256:3a6b18732edf182daa3cd12775bbb338cf5691468f91eeeb109deff6ebfa986f", size = 2204444, upload-time = "2024-04-23T18:57:18.24Z" } +sdist = { url = "https://files.pythonhosted.org/packages/ae/ed/aefcc8cd0ba62a0560c3c18c33925362d46c6075480bfa4df87b28e169a9/docutils-0.21.2.tar.gz", hash = "sha256:3a6b18732edf182daa3cd12775bbb338cf5691468f91eeeb109deff6ebfa986f", size = 2204444 } wheels = [ - { url = "https://files.pythonhosted.org/packages/8f/d7/9322c609343d929e75e7e5e6255e614fcc67572cfd083959cdef3b7aad79/docutils-0.21.2-py3-none-any.whl", hash = "sha256:dafca5b9e384f0e419294eb4d2ff9fa826435bf15f15b7bd45723e8ad76811b2", size = 587408, upload-time = "2024-04-23T18:57:14.835Z" }, + { url = "https://files.pythonhosted.org/packages/8f/d7/9322c609343d929e75e7e5e6255e614fcc67572cfd083959cdef3b7aad79/docutils-0.21.2-py3-none-any.whl", hash = "sha256:dafca5b9e384f0e419294eb4d2ff9fa826435bf15f15b7bd45723e8ad76811b2", size = 587408 }, ] [[package]] @@ -687,6 +686,7 @@ test = [ [package.dev-dependencies] dev = [ { name = "py-spy" }, + { name = "sympy" }, ] [package.metadata] @@ -729,36 +729,38 @@ requires-dist = [ { name = "syrupy", marker = "extra == 'test'", specifier = ">=5" }, { name = "typing-extensions" }, ] -provides-extras = ["array", "dev", "test", "docs"] [package.metadata.requires-dev] -dev = [{ name = "py-spy", specifier = ">=0.4.1" }] +dev = [ + { name = "py-spy", specifier = ">=0.4.1" }, + { name = "sympy", specifier = ">=1.14.0" }, +] [[package]] name = "execnet" version = "2.1.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/bb/ff/b4c0dc78fbe20c3e59c0c7334de0c27eb4001a2b2017999af398bf730817/execnet-2.1.1.tar.gz", hash = "sha256:5189b52c6121c24feae288166ab41b32549c7e2348652736540b9e6e7d4e72e3", size = 166524, upload-time = "2024-04-08T09:04:19.245Z" } +sdist = { url = "https://files.pythonhosted.org/packages/bb/ff/b4c0dc78fbe20c3e59c0c7334de0c27eb4001a2b2017999af398bf730817/execnet-2.1.1.tar.gz", hash = "sha256:5189b52c6121c24feae288166ab41b32549c7e2348652736540b9e6e7d4e72e3", size = 166524 } wheels = [ - { url = "https://files.pythonhosted.org/packages/43/09/2aea36ff60d16dd8879bdb2f5b3ee0ba8d08cbbdcdfe870e695ce3784385/execnet-2.1.1-py3-none-any.whl", hash = "sha256:26dee51f1b80cebd6d0ca8e74dd8745419761d3bef34163928cbebbdc4749fdc", size = 40612, upload-time = "2024-04-08T09:04:17.414Z" }, + { url = "https://files.pythonhosted.org/packages/43/09/2aea36ff60d16dd8879bdb2f5b3ee0ba8d08cbbdcdfe870e695ce3784385/execnet-2.1.1-py3-none-any.whl", hash = "sha256:26dee51f1b80cebd6d0ca8e74dd8745419761d3bef34163928cbebbdc4749fdc", size = 40612 }, ] [[package]] name = "executing" version = "2.2.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/cc/28/c14e053b6762b1044f34a13aab6859bbf40456d37d23aa286ac24cfd9a5d/executing-2.2.1.tar.gz", hash = "sha256:3632cc370565f6648cc328b32435bd120a1e4ebb20c77e3fdde9a13cd1e533c4", size = 1129488, upload-time = "2025-09-01T09:48:10.866Z" } +sdist = { url = "https://files.pythonhosted.org/packages/cc/28/c14e053b6762b1044f34a13aab6859bbf40456d37d23aa286ac24cfd9a5d/executing-2.2.1.tar.gz", hash = "sha256:3632cc370565f6648cc328b32435bd120a1e4ebb20c77e3fdde9a13cd1e533c4", size = 1129488 } wheels = [ - { url = "https://files.pythonhosted.org/packages/c1/ea/53f2148663b321f21b5a606bd5f191517cf40b7072c0497d3c92c4a13b1e/executing-2.2.1-py2.py3-none-any.whl", hash = "sha256:760643d3452b4d777d295bb167ccc74c64a81df23fb5e08eff250c425a4b2017", size = 28317, upload-time = "2025-09-01T09:48:08.5Z" }, + { url = "https://files.pythonhosted.org/packages/c1/ea/53f2148663b321f21b5a606bd5f191517cf40b7072c0497d3c92c4a13b1e/executing-2.2.1-py2.py3-none-any.whl", hash = "sha256:760643d3452b4d777d295bb167ccc74c64a81df23fb5e08eff250c425a4b2017", size = 28317 }, ] [[package]] name = "fastjsonschema" version = "2.21.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/20/b5/23b216d9d985a956623b6bd12d4086b60f0059b27799f23016af04a74ea1/fastjsonschema-2.21.2.tar.gz", hash = "sha256:b1eb43748041c880796cd077f1a07c3d94e93ae84bba5ed36800a33554ae05de", size = 374130, upload-time = "2025-08-14T18:49:36.666Z" } +sdist = { url = "https://files.pythonhosted.org/packages/20/b5/23b216d9d985a956623b6bd12d4086b60f0059b27799f23016af04a74ea1/fastjsonschema-2.21.2.tar.gz", hash = "sha256:b1eb43748041c880796cd077f1a07c3d94e93ae84bba5ed36800a33554ae05de", size = 374130 } wheels = [ - { url = "https://files.pythonhosted.org/packages/cb/a8/20d0723294217e47de6d9e2e40fd4a9d2f7c4b6ef974babd482a59743694/fastjsonschema-2.21.2-py3-none-any.whl", hash = "sha256:1c797122d0a86c5cace2e54bf4e819c36223b552017172f32c5c024a6b77e463", size = 24024, upload-time = "2025-08-14T18:49:34.776Z" }, + { url = "https://files.pythonhosted.org/packages/cb/a8/20d0723294217e47de6d9e2e40fd4a9d2f7c4b6ef974babd482a59743694/fastjsonschema-2.21.2-py3-none-any.whl", hash = "sha256:1c797122d0a86c5cace2e54bf4e819c36223b552017172f32c5c024a6b77e463", size = 24024 }, ] [[package]] @@ -769,133 +771,141 @@ dependencies = [ { name = "lxml" }, { name = "python-dateutil" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/6b/59/be0a6f852b5dfbf19e6c8e962c8f41407697f9f52a7902250ed98683ae89/feedgen-1.0.0.tar.gz", hash = "sha256:d9bd51c3b5e956a2a52998c3708c4d2c729f2fcc311188e1e5d3b9726393546a", size = 258496, upload-time = "2023-12-25T18:04:08.421Z" } +sdist = { url = "https://files.pythonhosted.org/packages/6b/59/be0a6f852b5dfbf19e6c8e962c8f41407697f9f52a7902250ed98683ae89/feedgen-1.0.0.tar.gz", hash = "sha256:d9bd51c3b5e956a2a52998c3708c4d2c729f2fcc311188e1e5d3b9726393546a", size = 258496 } [[package]] name = "filelock" version = "3.20.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/58/46/0028a82567109b5ef6e4d2a1f04a583fb513e6cf9527fcdd09afd817deeb/filelock-3.20.0.tar.gz", hash = "sha256:711e943b4ec6be42e1d4e6690b48dc175c822967466bb31c0c293f34334c13f4", size = 18922, upload-time = "2025-10-08T18:03:50.056Z" } +sdist = { url = "https://files.pythonhosted.org/packages/58/46/0028a82567109b5ef6e4d2a1f04a583fb513e6cf9527fcdd09afd817deeb/filelock-3.20.0.tar.gz", hash = "sha256:711e943b4ec6be42e1d4e6690b48dc175c822967466bb31c0c293f34334c13f4", size = 18922 } wheels = [ - { url = "https://files.pythonhosted.org/packages/76/91/7216b27286936c16f5b4d0c530087e4a54eead683e6b0b73dd0c64844af6/filelock-3.20.0-py3-none-any.whl", hash = "sha256:339b4732ffda5cd79b13f4e2711a31b0365ce445d95d243bb996273d072546a2", size = 16054, upload-time = "2025-10-08T18:03:48.35Z" }, + { url = "https://files.pythonhosted.org/packages/76/91/7216b27286936c16f5b4d0c530087e4a54eead683e6b0b73dd0c64844af6/filelock-3.20.0-py3-none-any.whl", hash = "sha256:339b4732ffda5cd79b13f4e2711a31b0365ce445d95d243bb996273d072546a2", size = 16054 }, ] [[package]] name = "fonttools" version = "4.60.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/4b/42/97a13e47a1e51a5a7142475bbcf5107fe3a68fc34aef331c897d5fb98ad0/fonttools-4.60.1.tar.gz", hash = "sha256:ef00af0439ebfee806b25f24c8f92109157ff3fac5731dc7867957812e87b8d9", size = 3559823, upload-time = "2025-09-29T21:13:27.129Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/ea/85/639aa9bface1537e0fb0f643690672dde0695a5bbbc90736bc571b0b1941/fonttools-4.60.1-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:7b4c32e232a71f63a5d00259ca3d88345ce2a43295bb049d21061f338124246f", size = 2831872, upload-time = "2025-09-29T21:11:20.329Z" }, - { url = "https://files.pythonhosted.org/packages/6b/47/3c63158459c95093be9618794acb1067b3f4d30dcc5c3e8114b70e67a092/fonttools-4.60.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:3630e86c484263eaac71d117085d509cbcf7b18f677906824e4bace598fb70d2", size = 2356990, upload-time = "2025-09-29T21:11:22.754Z" }, - { url = "https://files.pythonhosted.org/packages/94/dd/1934b537c86fcf99f9761823f1fc37a98fbd54568e8e613f29a90fed95a9/fonttools-4.60.1-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5c1015318e4fec75dd4943ad5f6a206d9727adf97410d58b7e32ab644a807914", size = 5042189, upload-time = "2025-09-29T21:11:25.061Z" }, - { url = "https://files.pythonhosted.org/packages/d2/d2/9f4e4c4374dd1daa8367784e1bd910f18ba886db1d6b825b12edf6db3edc/fonttools-4.60.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:e6c58beb17380f7c2ea181ea11e7db8c0ceb474c9dd45f48e71e2cb577d146a1", size = 4978683, upload-time = "2025-09-29T21:11:27.693Z" }, - { url = "https://files.pythonhosted.org/packages/cc/c4/0fb2dfd1ecbe9a07954cc13414713ed1eab17b1c0214ef07fc93df234a47/fonttools-4.60.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:ec3681a0cb34c255d76dd9d865a55f260164adb9fa02628415cdc2d43ee2c05d", size = 5021372, upload-time = "2025-09-29T21:11:30.257Z" }, - { url = "https://files.pythonhosted.org/packages/0c/d5/495fc7ae2fab20223cc87179a8f50f40f9a6f821f271ba8301ae12bb580f/fonttools-4.60.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:f4b5c37a5f40e4d733d3bbaaef082149bee5a5ea3156a785ff64d949bd1353fa", size = 5132562, upload-time = "2025-09-29T21:11:32.737Z" }, - { url = "https://files.pythonhosted.org/packages/bc/fa/021dab618526323c744e0206b3f5c8596a2e7ae9aa38db5948a131123e83/fonttools-4.60.1-cp311-cp311-win32.whl", hash = "sha256:398447f3d8c0c786cbf1209711e79080a40761eb44b27cdafffb48f52bcec258", size = 2230288, upload-time = "2025-09-29T21:11:35.015Z" }, - { url = "https://files.pythonhosted.org/packages/bb/78/0e1a6d22b427579ea5c8273e1c07def2f325b977faaf60bb7ddc01456cb1/fonttools-4.60.1-cp311-cp311-win_amd64.whl", hash = "sha256:d066ea419f719ed87bc2c99a4a4bfd77c2e5949cb724588b9dd58f3fd90b92bf", size = 2278184, upload-time = "2025-09-29T21:11:37.434Z" }, - { url = "https://files.pythonhosted.org/packages/e3/f7/a10b101b7a6f8836a5adb47f2791f2075d044a6ca123f35985c42edc82d8/fonttools-4.60.1-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:7b0c6d57ab00dae9529f3faf187f2254ea0aa1e04215cf2f1a8ec277c96661bc", size = 2832953, upload-time = "2025-09-29T21:11:39.616Z" }, - { url = "https://files.pythonhosted.org/packages/ed/fe/7bd094b59c926acf2304d2151354ddbeb74b94812f3dc943c231db09cb41/fonttools-4.60.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:839565cbf14645952d933853e8ade66a463684ed6ed6c9345d0faf1f0e868877", size = 2352706, upload-time = "2025-09-29T21:11:41.826Z" }, - { url = "https://files.pythonhosted.org/packages/c0/ca/4bb48a26ed95a1e7eba175535fe5805887682140ee0a0d10a88e1de84208/fonttools-4.60.1-cp312-cp312-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:8177ec9676ea6e1793c8a084a90b65a9f778771998eb919d05db6d4b1c0b114c", size = 4923716, upload-time = "2025-09-29T21:11:43.893Z" }, - { url = "https://files.pythonhosted.org/packages/b8/9f/2cb82999f686c1d1ddf06f6ae1a9117a880adbec113611cc9d22b2fdd465/fonttools-4.60.1-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:996a4d1834524adbb423385d5a629b868ef9d774670856c63c9a0408a3063401", size = 4968175, upload-time = "2025-09-29T21:11:46.439Z" }, - { url = "https://files.pythonhosted.org/packages/18/79/be569699e37d166b78e6218f2cde8c550204f2505038cdd83b42edc469b9/fonttools-4.60.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:a46b2f450bc79e06ef3b6394f0c68660529ed51692606ad7f953fc2e448bc903", size = 4911031, upload-time = "2025-09-29T21:11:48.977Z" }, - { url = "https://files.pythonhosted.org/packages/cc/9f/89411cc116effaec5260ad519162f64f9c150e5522a27cbb05eb62d0c05b/fonttools-4.60.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:6ec722ee589e89a89f5b7574f5c45604030aa6ae24cb2c751e2707193b466fed", size = 5062966, upload-time = "2025-09-29T21:11:54.344Z" }, - { url = "https://files.pythonhosted.org/packages/62/a1/f888221934b5731d46cb9991c7a71f30cb1f97c0ef5fcf37f8da8fce6c8e/fonttools-4.60.1-cp312-cp312-win32.whl", hash = "sha256:b2cf105cee600d2de04ca3cfa1f74f1127f8455b71dbad02b9da6ec266e116d6", size = 2218750, upload-time = "2025-09-29T21:11:56.601Z" }, - { url = "https://files.pythonhosted.org/packages/88/8f/a55b5550cd33cd1028601df41acd057d4be20efa5c958f417b0c0613924d/fonttools-4.60.1-cp312-cp312-win_amd64.whl", hash = "sha256:992775c9fbe2cf794786fa0ffca7f09f564ba3499b8fe9f2f80bd7197db60383", size = 2267026, upload-time = "2025-09-29T21:11:58.852Z" }, - { url = "https://files.pythonhosted.org/packages/7c/5b/cdd2c612277b7ac7ec8c0c9bc41812c43dc7b2d5f2b0897e15fdf5a1f915/fonttools-4.60.1-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:6f68576bb4bbf6060c7ab047b1574a1ebe5c50a17de62830079967b211059ebb", size = 2825777, upload-time = "2025-09-29T21:12:01.22Z" }, - { url = "https://files.pythonhosted.org/packages/d6/8a/de9cc0540f542963ba5e8f3a1f6ad48fa211badc3177783b9d5cadf79b5d/fonttools-4.60.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:eedacb5c5d22b7097482fa834bda0dafa3d914a4e829ec83cdea2a01f8c813c4", size = 2348080, upload-time = "2025-09-29T21:12:03.785Z" }, - { url = "https://files.pythonhosted.org/packages/2d/8b/371ab3cec97ee3fe1126b3406b7abd60c8fec8975fd79a3c75cdea0c3d83/fonttools-4.60.1-cp313-cp313-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:b33a7884fabd72bdf5f910d0cf46be50dce86a0362a65cfc746a4168c67eb96c", size = 4903082, upload-time = "2025-09-29T21:12:06.382Z" }, - { url = "https://files.pythonhosted.org/packages/04/05/06b1455e4bc653fcb2117ac3ef5fa3a8a14919b93c60742d04440605d058/fonttools-4.60.1-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2409d5fb7b55fd70f715e6d34e7a6e4f7511b8ad29a49d6df225ee76da76dd77", size = 4960125, upload-time = "2025-09-29T21:12:09.314Z" }, - { url = "https://files.pythonhosted.org/packages/8e/37/f3b840fcb2666f6cb97038793606bdd83488dca2d0b0fc542ccc20afa668/fonttools-4.60.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:c8651e0d4b3bdeda6602b85fdc2abbefc1b41e573ecb37b6779c4ca50753a199", size = 4901454, upload-time = "2025-09-29T21:12:11.931Z" }, - { url = "https://files.pythonhosted.org/packages/fd/9e/eb76f77e82f8d4a46420aadff12cec6237751b0fb9ef1de373186dcffb5f/fonttools-4.60.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:145daa14bf24824b677b9357c5e44fd8895c2a8f53596e1b9ea3496081dc692c", size = 5044495, upload-time = "2025-09-29T21:12:15.241Z" }, - { url = "https://files.pythonhosted.org/packages/f8/b3/cede8f8235d42ff7ae891bae8d619d02c8ac9fd0cfc450c5927a6200c70d/fonttools-4.60.1-cp313-cp313-win32.whl", hash = "sha256:2299df884c11162617a66b7c316957d74a18e3758c0274762d2cc87df7bc0272", size = 2217028, upload-time = "2025-09-29T21:12:17.96Z" }, - { url = "https://files.pythonhosted.org/packages/75/4d/b022c1577807ce8b31ffe055306ec13a866f2337ecee96e75b24b9b753ea/fonttools-4.60.1-cp313-cp313-win_amd64.whl", hash = "sha256:a3db56f153bd4c5c2b619ab02c5db5192e222150ce5a1bc10f16164714bc39ac", size = 2266200, upload-time = "2025-09-29T21:12:20.14Z" }, - { url = "https://files.pythonhosted.org/packages/9a/83/752ca11c1aa9a899b793a130f2e466b79ea0cf7279c8d79c178fc954a07b/fonttools-4.60.1-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:a884aef09d45ba1206712c7dbda5829562d3fea7726935d3289d343232ecb0d3", size = 2822830, upload-time = "2025-09-29T21:12:24.406Z" }, - { url = "https://files.pythonhosted.org/packages/57/17/bbeab391100331950a96ce55cfbbff27d781c1b85ebafb4167eae50d9fe3/fonttools-4.60.1-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:8a44788d9d91df72d1a5eac49b31aeb887a5f4aab761b4cffc4196c74907ea85", size = 2345524, upload-time = "2025-09-29T21:12:26.819Z" }, - { url = "https://files.pythonhosted.org/packages/3d/2e/d4831caa96d85a84dd0da1d9f90d81cec081f551e0ea216df684092c6c97/fonttools-4.60.1-cp314-cp314-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:e852d9dda9f93ad3651ae1e3bb770eac544ec93c3807888798eccddf84596537", size = 4843490, upload-time = "2025-09-29T21:12:29.123Z" }, - { url = "https://files.pythonhosted.org/packages/49/13/5e2ea7c7a101b6fc3941be65307ef8df92cbbfa6ec4804032baf1893b434/fonttools-4.60.1-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:154cb6ee417e417bf5f7c42fe25858c9140c26f647c7347c06f0cc2d47eff003", size = 4944184, upload-time = "2025-09-29T21:12:31.414Z" }, - { url = "https://files.pythonhosted.org/packages/0c/2b/cf9603551c525b73fc47c52ee0b82a891579a93d9651ed694e4e2cd08bb8/fonttools-4.60.1-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:5664fd1a9ea7f244487ac8f10340c4e37664675e8667d6fee420766e0fb3cf08", size = 4890218, upload-time = "2025-09-29T21:12:33.936Z" }, - { url = "https://files.pythonhosted.org/packages/fd/2f/933d2352422e25f2376aae74f79eaa882a50fb3bfef3c0d4f50501267101/fonttools-4.60.1-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:583b7f8e3c49486e4d489ad1deacfb8d5be54a8ef34d6df824f6a171f8511d99", size = 4999324, upload-time = "2025-09-29T21:12:36.637Z" }, - { url = "https://files.pythonhosted.org/packages/38/99/234594c0391221f66216bc2c886923513b3399a148defaccf81dc3be6560/fonttools-4.60.1-cp314-cp314-win32.whl", hash = "sha256:66929e2ea2810c6533a5184f938502cfdaea4bc3efb7130d8cc02e1c1b4108d6", size = 2220861, upload-time = "2025-09-29T21:12:39.108Z" }, - { url = "https://files.pythonhosted.org/packages/3e/1d/edb5b23726dde50fc4068e1493e4fc7658eeefcaf75d4c5ffce067d07ae5/fonttools-4.60.1-cp314-cp314-win_amd64.whl", hash = "sha256:f3d5be054c461d6a2268831f04091dc82753176f6ea06dc6047a5e168265a987", size = 2270934, upload-time = "2025-09-29T21:12:41.339Z" }, - { url = "https://files.pythonhosted.org/packages/fb/da/1392aaa2170adc7071fe7f9cfd181a5684a7afcde605aebddf1fb4d76df5/fonttools-4.60.1-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:b6379e7546ba4ae4b18f8ae2b9bc5960936007a1c0e30b342f662577e8bc3299", size = 2894340, upload-time = "2025-09-29T21:12:43.774Z" }, - { url = "https://files.pythonhosted.org/packages/bf/a7/3b9f16e010d536ce567058b931a20b590d8f3177b2eda09edd92e392375d/fonttools-4.60.1-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:9d0ced62b59e0430b3690dbc5373df1c2aa7585e9a8ce38eff87f0fd993c5b01", size = 2375073, upload-time = "2025-09-29T21:12:46.437Z" }, - { url = "https://files.pythonhosted.org/packages/9b/b5/e9bcf51980f98e59bb5bb7c382a63c6f6cac0eec5f67de6d8f2322382065/fonttools-4.60.1-cp314-cp314t-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:875cb7764708b3132637f6c5fb385b16eeba0f7ac9fa45a69d35e09b47045801", size = 4849758, upload-time = "2025-09-29T21:12:48.694Z" }, - { url = "https://files.pythonhosted.org/packages/e3/dc/1d2cf7d1cba82264b2f8385db3f5960e3d8ce756b4dc65b700d2c496f7e9/fonttools-4.60.1-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a184b2ea57b13680ab6d5fbde99ccef152c95c06746cb7718c583abd8f945ccc", size = 5085598, upload-time = "2025-09-29T21:12:51.081Z" }, - { url = "https://files.pythonhosted.org/packages/5d/4d/279e28ba87fb20e0c69baf72b60bbf1c4d873af1476806a7b5f2b7fac1ff/fonttools-4.60.1-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:026290e4ec76583881763fac284aca67365e0be9f13a7fb137257096114cb3bc", size = 4957603, upload-time = "2025-09-29T21:12:53.423Z" }, - { url = "https://files.pythonhosted.org/packages/78/d4/ff19976305e0c05aa3340c805475abb00224c954d3c65e82c0a69633d55d/fonttools-4.60.1-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:f0e8817c7d1a0c2eedebf57ef9a9896f3ea23324769a9a2061a80fe8852705ed", size = 4974184, upload-time = "2025-09-29T21:12:55.962Z" }, - { url = "https://files.pythonhosted.org/packages/63/22/8553ff6166f5cd21cfaa115aaacaa0dc73b91c079a8cfd54a482cbc0f4f5/fonttools-4.60.1-cp314-cp314t-win32.whl", hash = "sha256:1410155d0e764a4615774e5c2c6fc516259fe3eca5882f034eb9bfdbee056259", size = 2282241, upload-time = "2025-09-29T21:12:58.179Z" }, - { url = "https://files.pythonhosted.org/packages/8a/cb/fa7b4d148e11d5a72761a22e595344133e83a9507a4c231df972e657579b/fonttools-4.60.1-cp314-cp314t-win_amd64.whl", hash = "sha256:022beaea4b73a70295b688f817ddc24ed3e3418b5036ffcd5658141184ef0d0c", size = 2345760, upload-time = "2025-09-29T21:13:00.375Z" }, - { url = "https://files.pythonhosted.org/packages/c7/93/0dd45cd283c32dea1545151d8c3637b4b8c53cdb3a625aeb2885b184d74d/fonttools-4.60.1-py3-none-any.whl", hash = "sha256:906306ac7afe2156fcf0042173d6ebbb05416af70f6b370967b47f8f00103bbb", size = 1143175, upload-time = "2025-09-29T21:13:24.134Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/4b/42/97a13e47a1e51a5a7142475bbcf5107fe3a68fc34aef331c897d5fb98ad0/fonttools-4.60.1.tar.gz", hash = "sha256:ef00af0439ebfee806b25f24c8f92109157ff3fac5731dc7867957812e87b8d9", size = 3559823 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ea/85/639aa9bface1537e0fb0f643690672dde0695a5bbbc90736bc571b0b1941/fonttools-4.60.1-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:7b4c32e232a71f63a5d00259ca3d88345ce2a43295bb049d21061f338124246f", size = 2831872 }, + { url = "https://files.pythonhosted.org/packages/6b/47/3c63158459c95093be9618794acb1067b3f4d30dcc5c3e8114b70e67a092/fonttools-4.60.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:3630e86c484263eaac71d117085d509cbcf7b18f677906824e4bace598fb70d2", size = 2356990 }, + { url = "https://files.pythonhosted.org/packages/94/dd/1934b537c86fcf99f9761823f1fc37a98fbd54568e8e613f29a90fed95a9/fonttools-4.60.1-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5c1015318e4fec75dd4943ad5f6a206d9727adf97410d58b7e32ab644a807914", size = 5042189 }, + { url = "https://files.pythonhosted.org/packages/d2/d2/9f4e4c4374dd1daa8367784e1bd910f18ba886db1d6b825b12edf6db3edc/fonttools-4.60.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:e6c58beb17380f7c2ea181ea11e7db8c0ceb474c9dd45f48e71e2cb577d146a1", size = 4978683 }, + { url = "https://files.pythonhosted.org/packages/cc/c4/0fb2dfd1ecbe9a07954cc13414713ed1eab17b1c0214ef07fc93df234a47/fonttools-4.60.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:ec3681a0cb34c255d76dd9d865a55f260164adb9fa02628415cdc2d43ee2c05d", size = 5021372 }, + { url = "https://files.pythonhosted.org/packages/0c/d5/495fc7ae2fab20223cc87179a8f50f40f9a6f821f271ba8301ae12bb580f/fonttools-4.60.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:f4b5c37a5f40e4d733d3bbaaef082149bee5a5ea3156a785ff64d949bd1353fa", size = 5132562 }, + { url = "https://files.pythonhosted.org/packages/bc/fa/021dab618526323c744e0206b3f5c8596a2e7ae9aa38db5948a131123e83/fonttools-4.60.1-cp311-cp311-win32.whl", hash = "sha256:398447f3d8c0c786cbf1209711e79080a40761eb44b27cdafffb48f52bcec258", size = 2230288 }, + { url = "https://files.pythonhosted.org/packages/bb/78/0e1a6d22b427579ea5c8273e1c07def2f325b977faaf60bb7ddc01456cb1/fonttools-4.60.1-cp311-cp311-win_amd64.whl", hash = "sha256:d066ea419f719ed87bc2c99a4a4bfd77c2e5949cb724588b9dd58f3fd90b92bf", size = 2278184 }, + { url = "https://files.pythonhosted.org/packages/e3/f7/a10b101b7a6f8836a5adb47f2791f2075d044a6ca123f35985c42edc82d8/fonttools-4.60.1-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:7b0c6d57ab00dae9529f3faf187f2254ea0aa1e04215cf2f1a8ec277c96661bc", size = 2832953 }, + { url = "https://files.pythonhosted.org/packages/ed/fe/7bd094b59c926acf2304d2151354ddbeb74b94812f3dc943c231db09cb41/fonttools-4.60.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:839565cbf14645952d933853e8ade66a463684ed6ed6c9345d0faf1f0e868877", size = 2352706 }, + { url = "https://files.pythonhosted.org/packages/c0/ca/4bb48a26ed95a1e7eba175535fe5805887682140ee0a0d10a88e1de84208/fonttools-4.60.1-cp312-cp312-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:8177ec9676ea6e1793c8a084a90b65a9f778771998eb919d05db6d4b1c0b114c", size = 4923716 }, + { url = "https://files.pythonhosted.org/packages/b8/9f/2cb82999f686c1d1ddf06f6ae1a9117a880adbec113611cc9d22b2fdd465/fonttools-4.60.1-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:996a4d1834524adbb423385d5a629b868ef9d774670856c63c9a0408a3063401", size = 4968175 }, + { url = "https://files.pythonhosted.org/packages/18/79/be569699e37d166b78e6218f2cde8c550204f2505038cdd83b42edc469b9/fonttools-4.60.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:a46b2f450bc79e06ef3b6394f0c68660529ed51692606ad7f953fc2e448bc903", size = 4911031 }, + { url = "https://files.pythonhosted.org/packages/cc/9f/89411cc116effaec5260ad519162f64f9c150e5522a27cbb05eb62d0c05b/fonttools-4.60.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:6ec722ee589e89a89f5b7574f5c45604030aa6ae24cb2c751e2707193b466fed", size = 5062966 }, + { url = "https://files.pythonhosted.org/packages/62/a1/f888221934b5731d46cb9991c7a71f30cb1f97c0ef5fcf37f8da8fce6c8e/fonttools-4.60.1-cp312-cp312-win32.whl", hash = "sha256:b2cf105cee600d2de04ca3cfa1f74f1127f8455b71dbad02b9da6ec266e116d6", size = 2218750 }, + { url = "https://files.pythonhosted.org/packages/88/8f/a55b5550cd33cd1028601df41acd057d4be20efa5c958f417b0c0613924d/fonttools-4.60.1-cp312-cp312-win_amd64.whl", hash = "sha256:992775c9fbe2cf794786fa0ffca7f09f564ba3499b8fe9f2f80bd7197db60383", size = 2267026 }, + { url = "https://files.pythonhosted.org/packages/7c/5b/cdd2c612277b7ac7ec8c0c9bc41812c43dc7b2d5f2b0897e15fdf5a1f915/fonttools-4.60.1-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:6f68576bb4bbf6060c7ab047b1574a1ebe5c50a17de62830079967b211059ebb", size = 2825777 }, + { url = "https://files.pythonhosted.org/packages/d6/8a/de9cc0540f542963ba5e8f3a1f6ad48fa211badc3177783b9d5cadf79b5d/fonttools-4.60.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:eedacb5c5d22b7097482fa834bda0dafa3d914a4e829ec83cdea2a01f8c813c4", size = 2348080 }, + { url = "https://files.pythonhosted.org/packages/2d/8b/371ab3cec97ee3fe1126b3406b7abd60c8fec8975fd79a3c75cdea0c3d83/fonttools-4.60.1-cp313-cp313-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:b33a7884fabd72bdf5f910d0cf46be50dce86a0362a65cfc746a4168c67eb96c", size = 4903082 }, + { url = "https://files.pythonhosted.org/packages/04/05/06b1455e4bc653fcb2117ac3ef5fa3a8a14919b93c60742d04440605d058/fonttools-4.60.1-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2409d5fb7b55fd70f715e6d34e7a6e4f7511b8ad29a49d6df225ee76da76dd77", size = 4960125 }, + { url = "https://files.pythonhosted.org/packages/8e/37/f3b840fcb2666f6cb97038793606bdd83488dca2d0b0fc542ccc20afa668/fonttools-4.60.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:c8651e0d4b3bdeda6602b85fdc2abbefc1b41e573ecb37b6779c4ca50753a199", size = 4901454 }, + { url = "https://files.pythonhosted.org/packages/fd/9e/eb76f77e82f8d4a46420aadff12cec6237751b0fb9ef1de373186dcffb5f/fonttools-4.60.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:145daa14bf24824b677b9357c5e44fd8895c2a8f53596e1b9ea3496081dc692c", size = 5044495 }, + { url = "https://files.pythonhosted.org/packages/f8/b3/cede8f8235d42ff7ae891bae8d619d02c8ac9fd0cfc450c5927a6200c70d/fonttools-4.60.1-cp313-cp313-win32.whl", hash = "sha256:2299df884c11162617a66b7c316957d74a18e3758c0274762d2cc87df7bc0272", size = 2217028 }, + { url = "https://files.pythonhosted.org/packages/75/4d/b022c1577807ce8b31ffe055306ec13a866f2337ecee96e75b24b9b753ea/fonttools-4.60.1-cp313-cp313-win_amd64.whl", hash = "sha256:a3db56f153bd4c5c2b619ab02c5db5192e222150ce5a1bc10f16164714bc39ac", size = 2266200 }, + { url = "https://files.pythonhosted.org/packages/9a/83/752ca11c1aa9a899b793a130f2e466b79ea0cf7279c8d79c178fc954a07b/fonttools-4.60.1-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:a884aef09d45ba1206712c7dbda5829562d3fea7726935d3289d343232ecb0d3", size = 2822830 }, + { url = "https://files.pythonhosted.org/packages/57/17/bbeab391100331950a96ce55cfbbff27d781c1b85ebafb4167eae50d9fe3/fonttools-4.60.1-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:8a44788d9d91df72d1a5eac49b31aeb887a5f4aab761b4cffc4196c74907ea85", size = 2345524 }, + { url = "https://files.pythonhosted.org/packages/3d/2e/d4831caa96d85a84dd0da1d9f90d81cec081f551e0ea216df684092c6c97/fonttools-4.60.1-cp314-cp314-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:e852d9dda9f93ad3651ae1e3bb770eac544ec93c3807888798eccddf84596537", size = 4843490 }, + { url = "https://files.pythonhosted.org/packages/49/13/5e2ea7c7a101b6fc3941be65307ef8df92cbbfa6ec4804032baf1893b434/fonttools-4.60.1-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:154cb6ee417e417bf5f7c42fe25858c9140c26f647c7347c06f0cc2d47eff003", size = 4944184 }, + { url = "https://files.pythonhosted.org/packages/0c/2b/cf9603551c525b73fc47c52ee0b82a891579a93d9651ed694e4e2cd08bb8/fonttools-4.60.1-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:5664fd1a9ea7f244487ac8f10340c4e37664675e8667d6fee420766e0fb3cf08", size = 4890218 }, + { url = "https://files.pythonhosted.org/packages/fd/2f/933d2352422e25f2376aae74f79eaa882a50fb3bfef3c0d4f50501267101/fonttools-4.60.1-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:583b7f8e3c49486e4d489ad1deacfb8d5be54a8ef34d6df824f6a171f8511d99", size = 4999324 }, + { url = "https://files.pythonhosted.org/packages/38/99/234594c0391221f66216bc2c886923513b3399a148defaccf81dc3be6560/fonttools-4.60.1-cp314-cp314-win32.whl", hash = "sha256:66929e2ea2810c6533a5184f938502cfdaea4bc3efb7130d8cc02e1c1b4108d6", size = 2220861 }, + { url = "https://files.pythonhosted.org/packages/3e/1d/edb5b23726dde50fc4068e1493e4fc7658eeefcaf75d4c5ffce067d07ae5/fonttools-4.60.1-cp314-cp314-win_amd64.whl", hash = "sha256:f3d5be054c461d6a2268831f04091dc82753176f6ea06dc6047a5e168265a987", size = 2270934 }, + { url = "https://files.pythonhosted.org/packages/fb/da/1392aaa2170adc7071fe7f9cfd181a5684a7afcde605aebddf1fb4d76df5/fonttools-4.60.1-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:b6379e7546ba4ae4b18f8ae2b9bc5960936007a1c0e30b342f662577e8bc3299", size = 2894340 }, + { url = "https://files.pythonhosted.org/packages/bf/a7/3b9f16e010d536ce567058b931a20b590d8f3177b2eda09edd92e392375d/fonttools-4.60.1-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:9d0ced62b59e0430b3690dbc5373df1c2aa7585e9a8ce38eff87f0fd993c5b01", size = 2375073 }, + { url = "https://files.pythonhosted.org/packages/9b/b5/e9bcf51980f98e59bb5bb7c382a63c6f6cac0eec5f67de6d8f2322382065/fonttools-4.60.1-cp314-cp314t-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:875cb7764708b3132637f6c5fb385b16eeba0f7ac9fa45a69d35e09b47045801", size = 4849758 }, + { url = "https://files.pythonhosted.org/packages/e3/dc/1d2cf7d1cba82264b2f8385db3f5960e3d8ce756b4dc65b700d2c496f7e9/fonttools-4.60.1-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a184b2ea57b13680ab6d5fbde99ccef152c95c06746cb7718c583abd8f945ccc", size = 5085598 }, + { url = "https://files.pythonhosted.org/packages/5d/4d/279e28ba87fb20e0c69baf72b60bbf1c4d873af1476806a7b5f2b7fac1ff/fonttools-4.60.1-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:026290e4ec76583881763fac284aca67365e0be9f13a7fb137257096114cb3bc", size = 4957603 }, + { url = "https://files.pythonhosted.org/packages/78/d4/ff19976305e0c05aa3340c805475abb00224c954d3c65e82c0a69633d55d/fonttools-4.60.1-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:f0e8817c7d1a0c2eedebf57ef9a9896f3ea23324769a9a2061a80fe8852705ed", size = 4974184 }, + { url = "https://files.pythonhosted.org/packages/63/22/8553ff6166f5cd21cfaa115aaacaa0dc73b91c079a8cfd54a482cbc0f4f5/fonttools-4.60.1-cp314-cp314t-win32.whl", hash = "sha256:1410155d0e764a4615774e5c2c6fc516259fe3eca5882f034eb9bfdbee056259", size = 2282241 }, + { url = "https://files.pythonhosted.org/packages/8a/cb/fa7b4d148e11d5a72761a22e595344133e83a9507a4c231df972e657579b/fonttools-4.60.1-cp314-cp314t-win_amd64.whl", hash = "sha256:022beaea4b73a70295b688f817ddc24ed3e3418b5036ffcd5658141184ef0d0c", size = 2345760 }, + { url = "https://files.pythonhosted.org/packages/c7/93/0dd45cd283c32dea1545151d8c3637b4b8c53cdb3a625aeb2885b184d74d/fonttools-4.60.1-py3-none-any.whl", hash = "sha256:906306ac7afe2156fcf0042173d6ebbb05416af70f6b370967b47f8f00103bbb", size = 1143175 }, ] [[package]] name = "fqdn" version = "1.5.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/30/3e/a80a8c077fd798951169626cde3e239adeba7dab75deb3555716415bd9b0/fqdn-1.5.1.tar.gz", hash = "sha256:105ed3677e767fb5ca086a0c1f4bb66ebc3c100be518f0e0d755d9eae164d89f", size = 6015, upload-time = "2021-03-11T07:16:29.08Z" } +sdist = { url = "https://files.pythonhosted.org/packages/30/3e/a80a8c077fd798951169626cde3e239adeba7dab75deb3555716415bd9b0/fqdn-1.5.1.tar.gz", hash = "sha256:105ed3677e767fb5ca086a0c1f4bb66ebc3c100be518f0e0d755d9eae164d89f", size = 6015 } wheels = [ - { url = "https://files.pythonhosted.org/packages/cf/58/8acf1b3e91c58313ce5cb67df61001fc9dcd21be4fadb76c1a2d540e09ed/fqdn-1.5.1-py3-none-any.whl", hash = "sha256:3a179af3761e4df6eb2e026ff9e1a3033d3587bf980a0b1b2e1e5d08d7358014", size = 9121, upload-time = "2021-03-11T07:16:28.351Z" }, + { url = "https://files.pythonhosted.org/packages/cf/58/8acf1b3e91c58313ce5cb67df61001fc9dcd21be4fadb76c1a2d540e09ed/fqdn-1.5.1-py3-none-any.whl", hash = "sha256:3a179af3761e4df6eb2e026ff9e1a3033d3587bf980a0b1b2e1e5d08d7358014", size = 9121 }, ] [[package]] name = "graphviz" version = "0.21" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f8/b3/3ac91e9be6b761a4b30d66ff165e54439dcd48b83f4e20d644867215f6ca/graphviz-0.21.tar.gz", hash = "sha256:20743e7183be82aaaa8ad6c93f8893c923bd6658a04c32ee115edb3c8a835f78", size = 200434, upload-time = "2025-06-15T09:35:05.824Z" } +sdist = { url = "https://files.pythonhosted.org/packages/f8/b3/3ac91e9be6b761a4b30d66ff165e54439dcd48b83f4e20d644867215f6ca/graphviz-0.21.tar.gz", hash = "sha256:20743e7183be82aaaa8ad6c93f8893c923bd6658a04c32ee115edb3c8a835f78", size = 200434 } wheels = [ - { url = "https://files.pythonhosted.org/packages/91/4c/e0ce1ef95d4000ebc1c11801f9b944fa5910ecc15b5e351865763d8657f8/graphviz-0.21-py3-none-any.whl", hash = "sha256:54f33de9f4f911d7e84e4191749cac8cc5653f815b06738c54db9a15ab8b1e42", size = 47300, upload-time = "2025-06-15T09:35:04.433Z" }, + { url = "https://files.pythonhosted.org/packages/91/4c/e0ce1ef95d4000ebc1c11801f9b944fa5910ecc15b5e351865763d8657f8/graphviz-0.21-py3-none-any.whl", hash = "sha256:54f33de9f4f911d7e84e4191749cac8cc5653f815b06738c54db9a15ab8b1e42", size = 47300 }, ] [[package]] name = "greenlet" version = "3.2.4" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/03/b8/704d753a5a45507a7aab61f18db9509302ed3d0a27ac7e0359ec2905b1a6/greenlet-3.2.4.tar.gz", hash = "sha256:0dca0d95ff849f9a364385f36ab49f50065d76964944638be9691e1832e9f86d", size = 188260, upload-time = "2025-08-07T13:24:33.51Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/a4/de/f28ced0a67749cac23fecb02b694f6473f47686dff6afaa211d186e2ef9c/greenlet-3.2.4-cp311-cp311-macosx_11_0_universal2.whl", hash = "sha256:96378df1de302bc38e99c3a9aa311967b7dc80ced1dcc6f171e99842987882a2", size = 272305, upload-time = "2025-08-07T13:15:41.288Z" }, - { url = "https://files.pythonhosted.org/packages/09/16/2c3792cba130000bf2a31c5272999113f4764fd9d874fb257ff588ac779a/greenlet-3.2.4-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:1ee8fae0519a337f2329cb78bd7a8e128ec0f881073d43f023c7b8d4831d5246", size = 632472, upload-time = "2025-08-07T13:42:55.044Z" }, - { url = "https://files.pythonhosted.org/packages/ae/8f/95d48d7e3d433e6dae5b1682e4292242a53f22df82e6d3dda81b1701a960/greenlet-3.2.4-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:94abf90142c2a18151632371140b3dba4dee031633fe614cb592dbb6c9e17bc3", size = 644646, upload-time = "2025-08-07T13:45:26.523Z" }, - { url = "https://files.pythonhosted.org/packages/d5/5e/405965351aef8c76b8ef7ad370e5da58d57ef6068df197548b015464001a/greenlet-3.2.4-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:4d1378601b85e2e5171b99be8d2dc85f594c79967599328f95c1dc1a40f1c633", size = 640519, upload-time = "2025-08-07T13:53:13.928Z" }, - { url = "https://files.pythonhosted.org/packages/25/5d/382753b52006ce0218297ec1b628e048c4e64b155379331f25a7316eb749/greenlet-3.2.4-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:0db5594dce18db94f7d1650d7489909b57afde4c580806b8d9203b6e79cdc079", size = 639707, upload-time = "2025-08-07T13:18:27.146Z" }, - { url = "https://files.pythonhosted.org/packages/1f/8e/abdd3f14d735b2929290a018ecf133c901be4874b858dd1c604b9319f064/greenlet-3.2.4-cp311-cp311-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2523e5246274f54fdadbce8494458a2ebdcdbc7b802318466ac5606d3cded1f8", size = 587684, upload-time = "2025-08-07T13:18:25.164Z" }, - { url = "https://files.pythonhosted.org/packages/5d/65/deb2a69c3e5996439b0176f6651e0052542bb6c8f8ec2e3fba97c9768805/greenlet-3.2.4-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:1987de92fec508535687fb807a5cea1560f6196285a4cde35c100b8cd632cc52", size = 1116647, upload-time = "2025-08-07T13:42:38.655Z" }, - { url = "https://files.pythonhosted.org/packages/3f/cc/b07000438a29ac5cfb2194bfc128151d52f333cee74dd7dfe3fb733fc16c/greenlet-3.2.4-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:55e9c5affaa6775e2c6b67659f3a71684de4c549b3dd9afca3bc773533d284fa", size = 1142073, upload-time = "2025-08-07T13:18:21.737Z" }, - { url = "https://files.pythonhosted.org/packages/d8/0f/30aef242fcab550b0b3520b8e3561156857c94288f0332a79928c31a52cf/greenlet-3.2.4-cp311-cp311-win_amd64.whl", hash = "sha256:9c40adce87eaa9ddb593ccb0fa6a07caf34015a29bf8d344811665b573138db9", size = 299100, upload-time = "2025-08-07T13:44:12.287Z" }, - { url = "https://files.pythonhosted.org/packages/44/69/9b804adb5fd0671f367781560eb5eb586c4d495277c93bde4307b9e28068/greenlet-3.2.4-cp312-cp312-macosx_11_0_universal2.whl", hash = "sha256:3b67ca49f54cede0186854a008109d6ee71f66bd57bb36abd6d0a0267b540cdd", size = 274079, upload-time = "2025-08-07T13:15:45.033Z" }, - { url = "https://files.pythonhosted.org/packages/46/e9/d2a80c99f19a153eff70bc451ab78615583b8dac0754cfb942223d2c1a0d/greenlet-3.2.4-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:ddf9164e7a5b08e9d22511526865780a576f19ddd00d62f8a665949327fde8bb", size = 640997, upload-time = "2025-08-07T13:42:56.234Z" }, - { url = "https://files.pythonhosted.org/packages/3b/16/035dcfcc48715ccd345f3a93183267167cdd162ad123cd93067d86f27ce4/greenlet-3.2.4-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:f28588772bb5fb869a8eb331374ec06f24a83a9c25bfa1f38b6993afe9c1e968", size = 655185, upload-time = "2025-08-07T13:45:27.624Z" }, - { url = "https://files.pythonhosted.org/packages/31/da/0386695eef69ffae1ad726881571dfe28b41970173947e7c558d9998de0f/greenlet-3.2.4-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:5c9320971821a7cb77cfab8d956fa8e39cd07ca44b6070db358ceb7f8797c8c9", size = 649926, upload-time = "2025-08-07T13:53:15.251Z" }, - { url = "https://files.pythonhosted.org/packages/68/88/69bf19fd4dc19981928ceacbc5fd4bb6bc2215d53199e367832e98d1d8fe/greenlet-3.2.4-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:c60a6d84229b271d44b70fb6e5fa23781abb5d742af7b808ae3f6efd7c9c60f6", size = 651839, upload-time = "2025-08-07T13:18:30.281Z" }, - { url = "https://files.pythonhosted.org/packages/19/0d/6660d55f7373b2ff8152401a83e02084956da23ae58cddbfb0b330978fe9/greenlet-3.2.4-cp312-cp312-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:3b3812d8d0c9579967815af437d96623f45c0f2ae5f04e366de62a12d83a8fb0", size = 607586, upload-time = "2025-08-07T13:18:28.544Z" }, - { url = "https://files.pythonhosted.org/packages/8e/1a/c953fdedd22d81ee4629afbb38d2f9d71e37d23caace44775a3a969147d4/greenlet-3.2.4-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:abbf57b5a870d30c4675928c37278493044d7c14378350b3aa5d484fa65575f0", size = 1123281, upload-time = "2025-08-07T13:42:39.858Z" }, - { url = "https://files.pythonhosted.org/packages/3f/c7/12381b18e21aef2c6bd3a636da1088b888b97b7a0362fac2e4de92405f97/greenlet-3.2.4-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:20fb936b4652b6e307b8f347665e2c615540d4b42b3b4c8a321d8286da7e520f", size = 1151142, upload-time = "2025-08-07T13:18:22.981Z" }, - { url = "https://files.pythonhosted.org/packages/e9/08/b0814846b79399e585f974bbeebf5580fbe59e258ea7be64d9dfb253c84f/greenlet-3.2.4-cp312-cp312-win_amd64.whl", hash = "sha256:a7d4e128405eea3814a12cc2605e0e6aedb4035bf32697f72deca74de4105e02", size = 299899, upload-time = "2025-08-07T13:38:53.448Z" }, - { url = "https://files.pythonhosted.org/packages/49/e8/58c7f85958bda41dafea50497cbd59738c5c43dbbea5ee83d651234398f4/greenlet-3.2.4-cp313-cp313-macosx_11_0_universal2.whl", hash = "sha256:1a921e542453fe531144e91e1feedf12e07351b1cf6c9e8a3325ea600a715a31", size = 272814, upload-time = "2025-08-07T13:15:50.011Z" }, - { url = "https://files.pythonhosted.org/packages/62/dd/b9f59862e9e257a16e4e610480cfffd29e3fae018a68c2332090b53aac3d/greenlet-3.2.4-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:cd3c8e693bff0fff6ba55f140bf390fa92c994083f838fece0f63be121334945", size = 641073, upload-time = "2025-08-07T13:42:57.23Z" }, - { url = "https://files.pythonhosted.org/packages/f7/0b/bc13f787394920b23073ca3b6c4a7a21396301ed75a655bcb47196b50e6e/greenlet-3.2.4-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:710638eb93b1fa52823aa91bf75326f9ecdfd5e0466f00789246a5280f4ba0fc", size = 655191, upload-time = "2025-08-07T13:45:29.752Z" }, - { url = "https://files.pythonhosted.org/packages/f2/d6/6adde57d1345a8d0f14d31e4ab9c23cfe8e2cd39c3baf7674b4b0338d266/greenlet-3.2.4-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:c5111ccdc9c88f423426df3fd1811bfc40ed66264d35aa373420a34377efc98a", size = 649516, upload-time = "2025-08-07T13:53:16.314Z" }, - { url = "https://files.pythonhosted.org/packages/7f/3b/3a3328a788d4a473889a2d403199932be55b1b0060f4ddd96ee7cdfcad10/greenlet-3.2.4-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:d76383238584e9711e20ebe14db6c88ddcedc1829a9ad31a584389463b5aa504", size = 652169, upload-time = "2025-08-07T13:18:32.861Z" }, - { url = "https://files.pythonhosted.org/packages/ee/43/3cecdc0349359e1a527cbf2e3e28e5f8f06d3343aaf82ca13437a9aa290f/greenlet-3.2.4-cp313-cp313-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:23768528f2911bcd7e475210822ffb5254ed10d71f4028387e5a99b4c6699671", size = 610497, upload-time = "2025-08-07T13:18:31.636Z" }, - { url = "https://files.pythonhosted.org/packages/b8/19/06b6cf5d604e2c382a6f31cafafd6f33d5dea706f4db7bdab184bad2b21d/greenlet-3.2.4-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:00fadb3fedccc447f517ee0d3fd8fe49eae949e1cd0f6a611818f4f6fb7dc83b", size = 1121662, upload-time = "2025-08-07T13:42:41.117Z" }, - { url = "https://files.pythonhosted.org/packages/a2/15/0d5e4e1a66fab130d98168fe984c509249c833c1a3c16806b90f253ce7b9/greenlet-3.2.4-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:d25c5091190f2dc0eaa3f950252122edbbadbb682aa7b1ef2f8af0f8c0afefae", size = 1149210, upload-time = "2025-08-07T13:18:24.072Z" }, - { url = "https://files.pythonhosted.org/packages/0b/55/2321e43595e6801e105fcfdee02b34c0f996eb71e6ddffca6b10b7e1d771/greenlet-3.2.4-cp313-cp313-win_amd64.whl", hash = "sha256:554b03b6e73aaabec3745364d6239e9e012d64c68ccd0b8430c64ccc14939a8b", size = 299685, upload-time = "2025-08-07T13:24:38.824Z" }, - { url = "https://files.pythonhosted.org/packages/22/5c/85273fd7cc388285632b0498dbbab97596e04b154933dfe0f3e68156c68c/greenlet-3.2.4-cp314-cp314-macosx_11_0_universal2.whl", hash = "sha256:49a30d5fda2507ae77be16479bdb62a660fa51b1eb4928b524975b3bde77b3c0", size = 273586, upload-time = "2025-08-07T13:16:08.004Z" }, - { url = "https://files.pythonhosted.org/packages/d1/75/10aeeaa3da9332c2e761e4c50d4c3556c21113ee3f0afa2cf5769946f7a3/greenlet-3.2.4-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:299fd615cd8fc86267b47597123e3f43ad79c9d8a22bebdce535e53550763e2f", size = 686346, upload-time = "2025-08-07T13:42:59.944Z" }, - { url = "https://files.pythonhosted.org/packages/c0/aa/687d6b12ffb505a4447567d1f3abea23bd20e73a5bed63871178e0831b7a/greenlet-3.2.4-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:c17b6b34111ea72fc5a4e4beec9711d2226285f0386ea83477cbb97c30a3f3a5", size = 699218, upload-time = "2025-08-07T13:45:30.969Z" }, - { url = "https://files.pythonhosted.org/packages/dc/8b/29aae55436521f1d6f8ff4e12fb676f3400de7fcf27fccd1d4d17fd8fecd/greenlet-3.2.4-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:b4a1870c51720687af7fa3e7cda6d08d801dae660f75a76f3845b642b4da6ee1", size = 694659, upload-time = "2025-08-07T13:53:17.759Z" }, - { url = "https://files.pythonhosted.org/packages/92/2e/ea25914b1ebfde93b6fc4ff46d6864564fba59024e928bdc7de475affc25/greenlet-3.2.4-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:061dc4cf2c34852b052a8620d40f36324554bc192be474b9e9770e8c042fd735", size = 695355, upload-time = "2025-08-07T13:18:34.517Z" }, - { url = "https://files.pythonhosted.org/packages/72/60/fc56c62046ec17f6b0d3060564562c64c862948c9d4bc8aa807cf5bd74f4/greenlet-3.2.4-cp314-cp314-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:44358b9bf66c8576a9f57a590d5f5d6e72fa4228b763d0e43fee6d3b06d3a337", size = 657512, upload-time = "2025-08-07T13:18:33.969Z" }, - { url = "https://files.pythonhosted.org/packages/e3/a5/6ddab2b4c112be95601c13428db1d8b6608a8b6039816f2ba09c346c08fc/greenlet-3.2.4-cp314-cp314-win_amd64.whl", hash = "sha256:e37ab26028f12dbb0ff65f29a8d3d44a765c61e729647bf2ddfbbed621726f01", size = 303425, upload-time = "2025-08-07T13:32:27.59Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/03/b8/704d753a5a45507a7aab61f18db9509302ed3d0a27ac7e0359ec2905b1a6/greenlet-3.2.4.tar.gz", hash = "sha256:0dca0d95ff849f9a364385f36ab49f50065d76964944638be9691e1832e9f86d", size = 188260 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/a4/de/f28ced0a67749cac23fecb02b694f6473f47686dff6afaa211d186e2ef9c/greenlet-3.2.4-cp311-cp311-macosx_11_0_universal2.whl", hash = "sha256:96378df1de302bc38e99c3a9aa311967b7dc80ced1dcc6f171e99842987882a2", size = 272305 }, + { url = "https://files.pythonhosted.org/packages/09/16/2c3792cba130000bf2a31c5272999113f4764fd9d874fb257ff588ac779a/greenlet-3.2.4-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:1ee8fae0519a337f2329cb78bd7a8e128ec0f881073d43f023c7b8d4831d5246", size = 632472 }, + { url = "https://files.pythonhosted.org/packages/ae/8f/95d48d7e3d433e6dae5b1682e4292242a53f22df82e6d3dda81b1701a960/greenlet-3.2.4-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:94abf90142c2a18151632371140b3dba4dee031633fe614cb592dbb6c9e17bc3", size = 644646 }, + { url = "https://files.pythonhosted.org/packages/d5/5e/405965351aef8c76b8ef7ad370e5da58d57ef6068df197548b015464001a/greenlet-3.2.4-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:4d1378601b85e2e5171b99be8d2dc85f594c79967599328f95c1dc1a40f1c633", size = 640519 }, + { url = "https://files.pythonhosted.org/packages/25/5d/382753b52006ce0218297ec1b628e048c4e64b155379331f25a7316eb749/greenlet-3.2.4-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:0db5594dce18db94f7d1650d7489909b57afde4c580806b8d9203b6e79cdc079", size = 639707 }, + { url = "https://files.pythonhosted.org/packages/1f/8e/abdd3f14d735b2929290a018ecf133c901be4874b858dd1c604b9319f064/greenlet-3.2.4-cp311-cp311-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2523e5246274f54fdadbce8494458a2ebdcdbc7b802318466ac5606d3cded1f8", size = 587684 }, + { url = "https://files.pythonhosted.org/packages/5d/65/deb2a69c3e5996439b0176f6651e0052542bb6c8f8ec2e3fba97c9768805/greenlet-3.2.4-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:1987de92fec508535687fb807a5cea1560f6196285a4cde35c100b8cd632cc52", size = 1116647 }, + { url = "https://files.pythonhosted.org/packages/3f/cc/b07000438a29ac5cfb2194bfc128151d52f333cee74dd7dfe3fb733fc16c/greenlet-3.2.4-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:55e9c5affaa6775e2c6b67659f3a71684de4c549b3dd9afca3bc773533d284fa", size = 1142073 }, + { url = "https://files.pythonhosted.org/packages/67/24/28a5b2fa42d12b3d7e5614145f0bd89714c34c08be6aabe39c14dd52db34/greenlet-3.2.4-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:c9c6de1940a7d828635fbd254d69db79e54619f165ee7ce32fda763a9cb6a58c", size = 1548385 }, + { url = "https://files.pythonhosted.org/packages/6a/05/03f2f0bdd0b0ff9a4f7b99333d57b53a7709c27723ec8123056b084e69cd/greenlet-3.2.4-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:03c5136e7be905045160b1b9fdca93dd6727b180feeafda6818e6496434ed8c5", size = 1613329 }, + { url = "https://files.pythonhosted.org/packages/d8/0f/30aef242fcab550b0b3520b8e3561156857c94288f0332a79928c31a52cf/greenlet-3.2.4-cp311-cp311-win_amd64.whl", hash = "sha256:9c40adce87eaa9ddb593ccb0fa6a07caf34015a29bf8d344811665b573138db9", size = 299100 }, + { url = "https://files.pythonhosted.org/packages/44/69/9b804adb5fd0671f367781560eb5eb586c4d495277c93bde4307b9e28068/greenlet-3.2.4-cp312-cp312-macosx_11_0_universal2.whl", hash = "sha256:3b67ca49f54cede0186854a008109d6ee71f66bd57bb36abd6d0a0267b540cdd", size = 274079 }, + { url = "https://files.pythonhosted.org/packages/46/e9/d2a80c99f19a153eff70bc451ab78615583b8dac0754cfb942223d2c1a0d/greenlet-3.2.4-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:ddf9164e7a5b08e9d22511526865780a576f19ddd00d62f8a665949327fde8bb", size = 640997 }, + { url = "https://files.pythonhosted.org/packages/3b/16/035dcfcc48715ccd345f3a93183267167cdd162ad123cd93067d86f27ce4/greenlet-3.2.4-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:f28588772bb5fb869a8eb331374ec06f24a83a9c25bfa1f38b6993afe9c1e968", size = 655185 }, + { url = "https://files.pythonhosted.org/packages/31/da/0386695eef69ffae1ad726881571dfe28b41970173947e7c558d9998de0f/greenlet-3.2.4-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:5c9320971821a7cb77cfab8d956fa8e39cd07ca44b6070db358ceb7f8797c8c9", size = 649926 }, + { url = "https://files.pythonhosted.org/packages/68/88/69bf19fd4dc19981928ceacbc5fd4bb6bc2215d53199e367832e98d1d8fe/greenlet-3.2.4-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:c60a6d84229b271d44b70fb6e5fa23781abb5d742af7b808ae3f6efd7c9c60f6", size = 651839 }, + { url = "https://files.pythonhosted.org/packages/19/0d/6660d55f7373b2ff8152401a83e02084956da23ae58cddbfb0b330978fe9/greenlet-3.2.4-cp312-cp312-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:3b3812d8d0c9579967815af437d96623f45c0f2ae5f04e366de62a12d83a8fb0", size = 607586 }, + { url = "https://files.pythonhosted.org/packages/8e/1a/c953fdedd22d81ee4629afbb38d2f9d71e37d23caace44775a3a969147d4/greenlet-3.2.4-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:abbf57b5a870d30c4675928c37278493044d7c14378350b3aa5d484fa65575f0", size = 1123281 }, + { url = "https://files.pythonhosted.org/packages/3f/c7/12381b18e21aef2c6bd3a636da1088b888b97b7a0362fac2e4de92405f97/greenlet-3.2.4-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:20fb936b4652b6e307b8f347665e2c615540d4b42b3b4c8a321d8286da7e520f", size = 1151142 }, + { url = "https://files.pythonhosted.org/packages/27/45/80935968b53cfd3f33cf99ea5f08227f2646e044568c9b1555b58ffd61c2/greenlet-3.2.4-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:ee7a6ec486883397d70eec05059353b8e83eca9168b9f3f9a361971e77e0bcd0", size = 1564846 }, + { url = "https://files.pythonhosted.org/packages/69/02/b7c30e5e04752cb4db6202a3858b149c0710e5453b71a3b2aec5d78a1aab/greenlet-3.2.4-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:326d234cbf337c9c3def0676412eb7040a35a768efc92504b947b3e9cfc7543d", size = 1633814 }, + { url = "https://files.pythonhosted.org/packages/e9/08/b0814846b79399e585f974bbeebf5580fbe59e258ea7be64d9dfb253c84f/greenlet-3.2.4-cp312-cp312-win_amd64.whl", hash = "sha256:a7d4e128405eea3814a12cc2605e0e6aedb4035bf32697f72deca74de4105e02", size = 299899 }, + { url = "https://files.pythonhosted.org/packages/49/e8/58c7f85958bda41dafea50497cbd59738c5c43dbbea5ee83d651234398f4/greenlet-3.2.4-cp313-cp313-macosx_11_0_universal2.whl", hash = "sha256:1a921e542453fe531144e91e1feedf12e07351b1cf6c9e8a3325ea600a715a31", size = 272814 }, + { url = "https://files.pythonhosted.org/packages/62/dd/b9f59862e9e257a16e4e610480cfffd29e3fae018a68c2332090b53aac3d/greenlet-3.2.4-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:cd3c8e693bff0fff6ba55f140bf390fa92c994083f838fece0f63be121334945", size = 641073 }, + { url = "https://files.pythonhosted.org/packages/f7/0b/bc13f787394920b23073ca3b6c4a7a21396301ed75a655bcb47196b50e6e/greenlet-3.2.4-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:710638eb93b1fa52823aa91bf75326f9ecdfd5e0466f00789246a5280f4ba0fc", size = 655191 }, + { url = "https://files.pythonhosted.org/packages/f2/d6/6adde57d1345a8d0f14d31e4ab9c23cfe8e2cd39c3baf7674b4b0338d266/greenlet-3.2.4-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:c5111ccdc9c88f423426df3fd1811bfc40ed66264d35aa373420a34377efc98a", size = 649516 }, + { url = "https://files.pythonhosted.org/packages/7f/3b/3a3328a788d4a473889a2d403199932be55b1b0060f4ddd96ee7cdfcad10/greenlet-3.2.4-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:d76383238584e9711e20ebe14db6c88ddcedc1829a9ad31a584389463b5aa504", size = 652169 }, + { url = "https://files.pythonhosted.org/packages/ee/43/3cecdc0349359e1a527cbf2e3e28e5f8f06d3343aaf82ca13437a9aa290f/greenlet-3.2.4-cp313-cp313-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:23768528f2911bcd7e475210822ffb5254ed10d71f4028387e5a99b4c6699671", size = 610497 }, + { url = "https://files.pythonhosted.org/packages/b8/19/06b6cf5d604e2c382a6f31cafafd6f33d5dea706f4db7bdab184bad2b21d/greenlet-3.2.4-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:00fadb3fedccc447f517ee0d3fd8fe49eae949e1cd0f6a611818f4f6fb7dc83b", size = 1121662 }, + { url = "https://files.pythonhosted.org/packages/a2/15/0d5e4e1a66fab130d98168fe984c509249c833c1a3c16806b90f253ce7b9/greenlet-3.2.4-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:d25c5091190f2dc0eaa3f950252122edbbadbb682aa7b1ef2f8af0f8c0afefae", size = 1149210 }, + { url = "https://files.pythonhosted.org/packages/1c/53/f9c440463b3057485b8594d7a638bed53ba531165ef0ca0e6c364b5cc807/greenlet-3.2.4-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:6e343822feb58ac4d0a1211bd9399de2b3a04963ddeec21530fc426cc121f19b", size = 1564759 }, + { url = "https://files.pythonhosted.org/packages/47/e4/3bb4240abdd0a8d23f4f88adec746a3099f0d86bfedb623f063b2e3b4df0/greenlet-3.2.4-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:ca7f6f1f2649b89ce02f6f229d7c19f680a6238af656f61e0115b24857917929", size = 1634288 }, + { url = "https://files.pythonhosted.org/packages/0b/55/2321e43595e6801e105fcfdee02b34c0f996eb71e6ddffca6b10b7e1d771/greenlet-3.2.4-cp313-cp313-win_amd64.whl", hash = "sha256:554b03b6e73aaabec3745364d6239e9e012d64c68ccd0b8430c64ccc14939a8b", size = 299685 }, + { url = "https://files.pythonhosted.org/packages/22/5c/85273fd7cc388285632b0498dbbab97596e04b154933dfe0f3e68156c68c/greenlet-3.2.4-cp314-cp314-macosx_11_0_universal2.whl", hash = "sha256:49a30d5fda2507ae77be16479bdb62a660fa51b1eb4928b524975b3bde77b3c0", size = 273586 }, + { url = "https://files.pythonhosted.org/packages/d1/75/10aeeaa3da9332c2e761e4c50d4c3556c21113ee3f0afa2cf5769946f7a3/greenlet-3.2.4-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:299fd615cd8fc86267b47597123e3f43ad79c9d8a22bebdce535e53550763e2f", size = 686346 }, + { url = "https://files.pythonhosted.org/packages/c0/aa/687d6b12ffb505a4447567d1f3abea23bd20e73a5bed63871178e0831b7a/greenlet-3.2.4-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.whl", hash = "sha256:c17b6b34111ea72fc5a4e4beec9711d2226285f0386ea83477cbb97c30a3f3a5", size = 699218 }, + { url = "https://files.pythonhosted.org/packages/dc/8b/29aae55436521f1d6f8ff4e12fb676f3400de7fcf27fccd1d4d17fd8fecd/greenlet-3.2.4-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.whl", hash = "sha256:b4a1870c51720687af7fa3e7cda6d08d801dae660f75a76f3845b642b4da6ee1", size = 694659 }, + { url = "https://files.pythonhosted.org/packages/92/2e/ea25914b1ebfde93b6fc4ff46d6864564fba59024e928bdc7de475affc25/greenlet-3.2.4-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:061dc4cf2c34852b052a8620d40f36324554bc192be474b9e9770e8c042fd735", size = 695355 }, + { url = "https://files.pythonhosted.org/packages/72/60/fc56c62046ec17f6b0d3060564562c64c862948c9d4bc8aa807cf5bd74f4/greenlet-3.2.4-cp314-cp314-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:44358b9bf66c8576a9f57a590d5f5d6e72fa4228b763d0e43fee6d3b06d3a337", size = 657512 }, + { url = "https://files.pythonhosted.org/packages/23/6e/74407aed965a4ab6ddd93a7ded3180b730d281c77b765788419484cdfeef/greenlet-3.2.4-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:2917bdf657f5859fbf3386b12d68ede4cf1f04c90c3a6bc1f013dd68a22e2269", size = 1612508 }, + { url = "https://files.pythonhosted.org/packages/0d/da/343cd760ab2f92bac1845ca07ee3faea9fe52bee65f7bcb19f16ad7de08b/greenlet-3.2.4-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:015d48959d4add5d6c9f6c5210ee3803a830dce46356e3bc326d6776bde54681", size = 1680760 }, + { url = "https://files.pythonhosted.org/packages/e3/a5/6ddab2b4c112be95601c13428db1d8b6608a8b6039816f2ba09c346c08fc/greenlet-3.2.4-cp314-cp314-win_amd64.whl", hash = "sha256:e37ab26028f12dbb0ff65f29a8d3d44a765c61e729647bf2ddfbbed621726f01", size = 303425 }, ] [[package]] name = "h11" version = "0.16.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/01/ee/02a2c011bdab74c6fb3c75474d40b3052059d95df7e73351460c8588d963/h11-0.16.0.tar.gz", hash = "sha256:4e35b956cf45792e4caa5885e69fba00bdbc6ffafbfa020300e549b208ee5ff1", size = 101250, upload-time = "2025-04-24T03:35:25.427Z" } +sdist = { url = "https://files.pythonhosted.org/packages/01/ee/02a2c011bdab74c6fb3c75474d40b3052059d95df7e73351460c8588d963/h11-0.16.0.tar.gz", hash = "sha256:4e35b956cf45792e4caa5885e69fba00bdbc6ffafbfa020300e549b208ee5ff1", size = 101250 } wheels = [ - { url = "https://files.pythonhosted.org/packages/04/4b/29cac41a4d98d144bf5f6d33995617b185d14b22401f75ca86f384e87ff1/h11-0.16.0-py3-none-any.whl", hash = "sha256:63cf8bbe7522de3bf65932fda1d9c2772064ffb3dae62d55932da54b31cb6c86", size = 37515, upload-time = "2025-04-24T03:35:24.344Z" }, + { url = "https://files.pythonhosted.org/packages/04/4b/29cac41a4d98d144bf5f6d33995617b185d14b22401f75ca86f384e87ff1/h11-0.16.0-py3-none-any.whl", hash = "sha256:63cf8bbe7522de3bf65932fda1d9c2772064ffb3dae62d55932da54b31cb6c86", size = 37515 }, ] [[package]] @@ -906,9 +916,9 @@ dependencies = [ { name = "certifi" }, { name = "h11" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/06/94/82699a10bca87a5556c9c59b5963f2d039dbd239f25bc2a63907a05a14cb/httpcore-1.0.9.tar.gz", hash = "sha256:6e34463af53fd2ab5d807f399a9b45ea31c3dfa2276f15a2c3f00afff6e176e8", size = 85484, upload-time = "2025-04-24T22:06:22.219Z" } +sdist = { url = "https://files.pythonhosted.org/packages/06/94/82699a10bca87a5556c9c59b5963f2d039dbd239f25bc2a63907a05a14cb/httpcore-1.0.9.tar.gz", hash = "sha256:6e34463af53fd2ab5d807f399a9b45ea31c3dfa2276f15a2c3f00afff6e176e8", size = 85484 } wheels = [ - { url = "https://files.pythonhosted.org/packages/7e/f5/f66802a942d491edb555dd61e3a9961140fd64c90bce1eafd741609d334d/httpcore-1.0.9-py3-none-any.whl", hash = "sha256:2d400746a40668fc9dec9810239072b40b4484b640a8c38fd654a024c7a1bf55", size = 78784, upload-time = "2025-04-24T22:06:20.566Z" }, + { url = "https://files.pythonhosted.org/packages/7e/f5/f66802a942d491edb555dd61e3a9961140fd64c90bce1eafd741609d334d/httpcore-1.0.9-py3-none-any.whl", hash = "sha256:2d400746a40668fc9dec9810239072b40b4484b640a8c38fd654a024c7a1bf55", size = 78784 }, ] [[package]] @@ -921,36 +931,36 @@ dependencies = [ { name = "httpcore" }, { name = "idna" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/b1/df/48c586a5fe32a0f01324ee087459e112ebb7224f646c0b5023f5e79e9956/httpx-0.28.1.tar.gz", hash = "sha256:75e98c5f16b0f35b567856f597f06ff2270a374470a5c2392242528e3e3e42fc", size = 141406, upload-time = "2024-12-06T15:37:23.222Z" } +sdist = { url = "https://files.pythonhosted.org/packages/b1/df/48c586a5fe32a0f01324ee087459e112ebb7224f646c0b5023f5e79e9956/httpx-0.28.1.tar.gz", hash = "sha256:75e98c5f16b0f35b567856f597f06ff2270a374470a5c2392242528e3e3e42fc", size = 141406 } wheels = [ - { url = "https://files.pythonhosted.org/packages/2a/39/e50c7c3a983047577ee07d2a9e53faf5a69493943ec3f6a384bdc792deb2/httpx-0.28.1-py3-none-any.whl", hash = "sha256:d909fcccc110f8c7faf814ca82a9a4d816bc5a6dbfea25d6591d6985b8ba59ad", size = 73517, upload-time = "2024-12-06T15:37:21.509Z" }, + { url = "https://files.pythonhosted.org/packages/2a/39/e50c7c3a983047577ee07d2a9e53faf5a69493943ec3f6a384bdc792deb2/httpx-0.28.1-py3-none-any.whl", hash = "sha256:d909fcccc110f8c7faf814ca82a9a4d816bc5a6dbfea25d6591d6985b8ba59ad", size = 73517 }, ] [[package]] name = "identify" version = "2.6.15" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ff/e7/685de97986c916a6d93b3876139e00eef26ad5bbbd61925d670ae8013449/identify-2.6.15.tar.gz", hash = "sha256:e4f4864b96c6557ef2a1e1c951771838f4edc9df3a72ec7118b338801b11c7bf", size = 99311, upload-time = "2025-10-02T17:43:40.631Z" } +sdist = { url = "https://files.pythonhosted.org/packages/ff/e7/685de97986c916a6d93b3876139e00eef26ad5bbbd61925d670ae8013449/identify-2.6.15.tar.gz", hash = "sha256:e4f4864b96c6557ef2a1e1c951771838f4edc9df3a72ec7118b338801b11c7bf", size = 99311 } wheels = [ - { url = "https://files.pythonhosted.org/packages/0f/1c/e5fd8f973d4f375adb21565739498e2e9a1e54c858a97b9a8ccfdc81da9b/identify-2.6.15-py2.py3-none-any.whl", hash = "sha256:1181ef7608e00704db228516541eb83a88a9f94433a8c80bb9b5bd54b1d81757", size = 99183, upload-time = "2025-10-02T17:43:39.137Z" }, + { url = "https://files.pythonhosted.org/packages/0f/1c/e5fd8f973d4f375adb21565739498e2e9a1e54c858a97b9a8ccfdc81da9b/identify-2.6.15-py2.py3-none-any.whl", hash = "sha256:1181ef7608e00704db228516541eb83a88a9f94433a8c80bb9b5bd54b1d81757", size = 99183 }, ] [[package]] name = "idna" version = "3.11" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/6f/6d/0703ccc57f3a7233505399edb88de3cbd678da106337b9fcde432b65ed60/idna-3.11.tar.gz", hash = "sha256:795dafcc9c04ed0c1fb032c2aa73654d8e8c5023a7df64a53f39190ada629902", size = 194582, upload-time = "2025-10-12T14:55:20.501Z" } +sdist = { url = "https://files.pythonhosted.org/packages/6f/6d/0703ccc57f3a7233505399edb88de3cbd678da106337b9fcde432b65ed60/idna-3.11.tar.gz", hash = "sha256:795dafcc9c04ed0c1fb032c2aa73654d8e8c5023a7df64a53f39190ada629902", size = 194582 } wheels = [ - { url = "https://files.pythonhosted.org/packages/0e/61/66938bbb5fc52dbdf84594873d5b51fb1f7c7794e9c0f5bd885f30bc507b/idna-3.11-py3-none-any.whl", hash = "sha256:771a87f49d9defaf64091e6e6fe9c18d4833f140bd19464795bc32d966ca37ea", size = 71008, upload-time = "2025-10-12T14:55:18.883Z" }, + { url = "https://files.pythonhosted.org/packages/0e/61/66938bbb5fc52dbdf84594873d5b51fb1f7c7794e9c0f5bd885f30bc507b/idna-3.11-py3-none-any.whl", hash = "sha256:771a87f49d9defaf64091e6e6fe9c18d4833f140bd19464795bc32d966ca37ea", size = 71008 }, ] [[package]] name = "imagesize" version = "1.4.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a7/84/62473fb57d61e31fef6e36d64a179c8781605429fd927b5dd608c997be31/imagesize-1.4.1.tar.gz", hash = "sha256:69150444affb9cb0d5cc5a92b3676f0b2fb7cd9ae39e947a5e11a36b4497cd4a", size = 1280026, upload-time = "2022-07-01T12:21:05.687Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a7/84/62473fb57d61e31fef6e36d64a179c8781605429fd927b5dd608c997be31/imagesize-1.4.1.tar.gz", hash = "sha256:69150444affb9cb0d5cc5a92b3676f0b2fb7cd9ae39e947a5e11a36b4497cd4a", size = 1280026 } wheels = [ - { url = "https://files.pythonhosted.org/packages/ff/62/85c4c919272577931d407be5ba5d71c20f0b616d31a0befe0ae45bb79abd/imagesize-1.4.1-py2.py3-none-any.whl", hash = "sha256:0d8d18d08f840c19d0ee7ca1fd82490fdc3729b7ac93f49870406ddde8ef8d8b", size = 8769, upload-time = "2022-07-01T12:21:02.467Z" }, + { url = "https://files.pythonhosted.org/packages/ff/62/85c4c919272577931d407be5ba5d71c20f0b616d31a0befe0ae45bb79abd/imagesize-1.4.1-py2.py3-none-any.whl", hash = "sha256:0d8d18d08f840c19d0ee7ca1fd82490fdc3729b7ac93f49870406ddde8ef8d8b", size = 8769 }, ] [[package]] @@ -960,27 +970,27 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "zipp" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/76/66/650a33bd90f786193e4de4b3ad86ea60b53c89b669a5c7be931fac31cdb0/importlib_metadata-8.7.0.tar.gz", hash = "sha256:d13b81ad223b890aa16c5471f2ac3056cf76c5f10f82d6f9292f0b415f389000", size = 56641, upload-time = "2025-04-27T15:29:01.736Z" } +sdist = { url = "https://files.pythonhosted.org/packages/76/66/650a33bd90f786193e4de4b3ad86ea60b53c89b669a5c7be931fac31cdb0/importlib_metadata-8.7.0.tar.gz", hash = "sha256:d13b81ad223b890aa16c5471f2ac3056cf76c5f10f82d6f9292f0b415f389000", size = 56641 } wheels = [ - { url = "https://files.pythonhosted.org/packages/20/b0/36bd937216ec521246249be3bf9855081de4c5e06a0c9b4219dbeda50373/importlib_metadata-8.7.0-py3-none-any.whl", hash = "sha256:e5dd1551894c77868a30651cef00984d50e1002d06942a7101d34870c5f02afd", size = 27656, upload-time = "2025-04-27T15:29:00.214Z" }, + { url = "https://files.pythonhosted.org/packages/20/b0/36bd937216ec521246249be3bf9855081de4c5e06a0c9b4219dbeda50373/importlib_metadata-8.7.0-py3-none-any.whl", hash = "sha256:e5dd1551894c77868a30651cef00984d50e1002d06942a7101d34870c5f02afd", size = 27656 }, ] [[package]] name = "iniconfig" version = "2.3.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/72/34/14ca021ce8e5dfedc35312d08ba8bf51fdd999c576889fc2c24cb97f4f10/iniconfig-2.3.0.tar.gz", hash = "sha256:c76315c77db068650d49c5b56314774a7804df16fee4402c1f19d6d15d8c4730", size = 20503, upload-time = "2025-10-18T21:55:43.219Z" } +sdist = { url = "https://files.pythonhosted.org/packages/72/34/14ca021ce8e5dfedc35312d08ba8bf51fdd999c576889fc2c24cb97f4f10/iniconfig-2.3.0.tar.gz", hash = "sha256:c76315c77db068650d49c5b56314774a7804df16fee4402c1f19d6d15d8c4730", size = 20503 } wheels = [ - { url = "https://files.pythonhosted.org/packages/cb/b1/3846dd7f199d53cb17f49cba7e651e9ce294d8497c8c150530ed11865bb8/iniconfig-2.3.0-py3-none-any.whl", hash = "sha256:f631c04d2c48c52b84d0d0549c99ff3859c98df65b3101406327ecc7d53fbf12", size = 7484, upload-time = "2025-10-18T21:55:41.639Z" }, + { url = "https://files.pythonhosted.org/packages/cb/b1/3846dd7f199d53cb17f49cba7e651e9ce294d8497c8c150530ed11865bb8/iniconfig-2.3.0-py3-none-any.whl", hash = "sha256:f631c04d2c48c52b84d0d0549c99ff3859c98df65b3101406327ecc7d53fbf12", size = 7484 }, ] [[package]] name = "invoke" version = "2.2.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/de/bd/b461d3424a24c80490313fd77feeb666ca4f6a28c7e72713e3d9095719b4/invoke-2.2.1.tar.gz", hash = "sha256:515bf49b4a48932b79b024590348da22f39c4942dff991ad1fb8b8baea1be707", size = 304762, upload-time = "2025-10-11T00:36:35.172Z" } +sdist = { url = "https://files.pythonhosted.org/packages/de/bd/b461d3424a24c80490313fd77feeb666ca4f6a28c7e72713e3d9095719b4/invoke-2.2.1.tar.gz", hash = "sha256:515bf49b4a48932b79b024590348da22f39c4942dff991ad1fb8b8baea1be707", size = 304762 } wheels = [ - { url = "https://files.pythonhosted.org/packages/32/4b/b99e37f88336009971405cbb7630610322ed6fbfa31e1d7ab3fbf3049a2d/invoke-2.2.1-py3-none-any.whl", hash = "sha256:2413bc441b376e5cd3f55bb5d364f973ad8bdd7bf87e53c79de3c11bf3feecc8", size = 160287, upload-time = "2025-10-11T00:36:33.703Z" }, + { url = "https://files.pythonhosted.org/packages/32/4b/b99e37f88336009971405cbb7630610322ed6fbfa31e1d7ab3fbf3049a2d/invoke-2.2.1-py3-none-any.whl", hash = "sha256:2413bc441b376e5cd3f55bb5d364f973ad8bdd7bf87e53c79de3c11bf3feecc8", size = 160287 }, ] [[package]] @@ -1002,9 +1012,9 @@ dependencies = [ { name = "tornado" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/b9/a4/4948be6eb88628505b83a1f2f40d90254cab66abf2043b3c40fa07dfce0f/ipykernel-7.1.0.tar.gz", hash = "sha256:58a3fc88533d5930c3546dc7eac66c6d288acde4f801e2001e65edc5dc9cf0db", size = 174579, upload-time = "2025-10-27T09:46:39.471Z" } +sdist = { url = "https://files.pythonhosted.org/packages/b9/a4/4948be6eb88628505b83a1f2f40d90254cab66abf2043b3c40fa07dfce0f/ipykernel-7.1.0.tar.gz", hash = "sha256:58a3fc88533d5930c3546dc7eac66c6d288acde4f801e2001e65edc5dc9cf0db", size = 174579 } wheels = [ - { url = "https://files.pythonhosted.org/packages/a3/17/20c2552266728ceba271967b87919664ecc0e33efca29c3efc6baf88c5f9/ipykernel-7.1.0-py3-none-any.whl", hash = "sha256:763b5ec6c5b7776f6a8d7ce09b267693b4e5ce75cb50ae696aaefb3c85e1ea4c", size = 117968, upload-time = "2025-10-27T09:46:37.805Z" }, + { url = "https://files.pythonhosted.org/packages/a3/17/20c2552266728ceba271967b87919664ecc0e33efca29c3efc6baf88c5f9/ipykernel-7.1.0-py3-none-any.whl", hash = "sha256:763b5ec6c5b7776f6a8d7ce09b267693b4e5ce75cb50ae696aaefb3c85e1ea4c", size = 117968 }, ] [[package]] @@ -1024,9 +1034,9 @@ dependencies = [ { name = "traitlets" }, { name = "typing-extensions", marker = "python_full_version < '3.12'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/2a/34/29b18c62e39ee2f7a6a3bba7efd952729d8aadd45ca17efc34453b717665/ipython-9.6.0.tar.gz", hash = "sha256:5603d6d5d356378be5043e69441a072b50a5b33b4503428c77b04cb8ce7bc731", size = 4396932, upload-time = "2025-09-29T10:55:53.948Z" } +sdist = { url = "https://files.pythonhosted.org/packages/2a/34/29b18c62e39ee2f7a6a3bba7efd952729d8aadd45ca17efc34453b717665/ipython-9.6.0.tar.gz", hash = "sha256:5603d6d5d356378be5043e69441a072b50a5b33b4503428c77b04cb8ce7bc731", size = 4396932 } wheels = [ - { url = "https://files.pythonhosted.org/packages/48/c5/d5e07995077e48220269c28a221e168c91123ad5ceee44d548f54a057fc0/ipython-9.6.0-py3-none-any.whl", hash = "sha256:5f77efafc886d2f023442479b8149e7d86547ad0a979e9da9f045d252f648196", size = 616170, upload-time = "2025-09-29T10:55:47.676Z" }, + { url = "https://files.pythonhosted.org/packages/48/c5/d5e07995077e48220269c28a221e168c91123ad5ceee44d548f54a057fc0/ipython-9.6.0-py3-none-any.whl", hash = "sha256:5f77efafc886d2f023442479b8149e7d86547ad0a979e9da9f045d252f648196", size = 616170 }, ] [[package]] @@ -1036,9 +1046,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pygments" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/ef/4c/5dd1d8af08107f88c7f741ead7a40854b8ac24ddf9ae850afbcf698aa552/ipython_pygments_lexers-1.1.1.tar.gz", hash = "sha256:09c0138009e56b6854f9535736f4171d855c8c08a563a0dcd8022f78355c7e81", size = 8393, upload-time = "2025-01-17T11:24:34.505Z" } +sdist = { url = "https://files.pythonhosted.org/packages/ef/4c/5dd1d8af08107f88c7f741ead7a40854b8ac24ddf9ae850afbcf698aa552/ipython_pygments_lexers-1.1.1.tar.gz", hash = "sha256:09c0138009e56b6854f9535736f4171d855c8c08a563a0dcd8022f78355c7e81", size = 8393 } wheels = [ - { url = "https://files.pythonhosted.org/packages/d9/33/1f075bf72b0b747cb3288d011319aaf64083cf2efef8354174e3ed4540e2/ipython_pygments_lexers-1.1.1-py3-none-any.whl", hash = "sha256:a9462224a505ade19a605f71f8fa63c2048833ce50abc86768a0d81d876dc81c", size = 8074, upload-time = "2025-01-17T11:24:33.271Z" }, + { url = "https://files.pythonhosted.org/packages/d9/33/1f075bf72b0b747cb3288d011319aaf64083cf2efef8354174e3ed4540e2/ipython_pygments_lexers-1.1.1-py3-none-any.whl", hash = "sha256:a9462224a505ade19a605f71f8fa63c2048833ce50abc86768a0d81d876dc81c", size = 8074 }, ] [[package]] @@ -1052,9 +1062,9 @@ dependencies = [ { name = "traitlets" }, { name = "widgetsnbextension" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/4c/ae/c5ce1edc1afe042eadb445e95b0671b03cee61895264357956e61c0d2ac0/ipywidgets-8.1.8.tar.gz", hash = "sha256:61f969306b95f85fba6b6986b7fe45d73124d1d9e3023a8068710d47a22ea668", size = 116739, upload-time = "2025-11-01T21:18:12.393Z" } +sdist = { url = "https://files.pythonhosted.org/packages/4c/ae/c5ce1edc1afe042eadb445e95b0671b03cee61895264357956e61c0d2ac0/ipywidgets-8.1.8.tar.gz", hash = "sha256:61f969306b95f85fba6b6986b7fe45d73124d1d9e3023a8068710d47a22ea668", size = 116739 } wheels = [ - { url = "https://files.pythonhosted.org/packages/56/6d/0d9848617b9f753b87f214f1c682592f7ca42de085f564352f10f0843026/ipywidgets-8.1.8-py3-none-any.whl", hash = "sha256:ecaca67aed704a338f88f67b1181b58f821ab5dc89c1f0f5ef99db43c1c2921e", size = 139808, upload-time = "2025-11-01T21:18:10.956Z" }, + { url = "https://files.pythonhosted.org/packages/56/6d/0d9848617b9f753b87f214f1c682592f7ca42de085f564352f10f0843026/ipywidgets-8.1.8-py3-none-any.whl", hash = "sha256:ecaca67aed704a338f88f67b1181b58f821ab5dc89c1f0f5ef99db43c1c2921e", size = 139808 }, ] [[package]] @@ -1064,9 +1074,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "arrow" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/7c/1a/3c8edc664e06e6bd06cce40c6b22da5f1429aa4224d0c590f3be21c91ead/isoduration-20.11.0.tar.gz", hash = "sha256:ac2f9015137935279eac671f94f89eb00584f940f5dc49462a0c4ee692ba1bd9", size = 11649, upload-time = "2020-11-01T11:00:00.312Z" } +sdist = { url = "https://files.pythonhosted.org/packages/7c/1a/3c8edc664e06e6bd06cce40c6b22da5f1429aa4224d0c590f3be21c91ead/isoduration-20.11.0.tar.gz", hash = "sha256:ac2f9015137935279eac671f94f89eb00584f940f5dc49462a0c4ee692ba1bd9", size = 11649 } wheels = [ - { url = "https://files.pythonhosted.org/packages/7b/55/e5326141505c5d5e34c5e0935d2908a74e4561eca44108fbfb9c13d2911a/isoduration-20.11.0-py3-none-any.whl", hash = "sha256:b2904c2a4228c3d44f409c8ae8e2370eb21a26f7ac2ec5446df141dde3452042", size = 11321, upload-time = "2020-11-01T10:59:58.02Z" }, + { url = "https://files.pythonhosted.org/packages/7b/55/e5326141505c5d5e34c5e0935d2908a74e4561eca44108fbfb9c13d2911a/isoduration-20.11.0-py3-none-any.whl", hash = "sha256:b2904c2a4228c3d44f409c8ae8e2370eb21a26f7ac2ec5446df141dde3452042", size = 11321 }, ] [[package]] @@ -1076,9 +1086,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "parso" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/72/3a/79a912fbd4d8dd6fbb02bf69afd3bb72cf0c729bb3063c6f4498603db17a/jedi-0.19.2.tar.gz", hash = "sha256:4770dc3de41bde3966b02eb84fbcf557fb33cce26ad23da12c742fb50ecb11f0", size = 1231287, upload-time = "2024-11-11T01:41:42.873Z" } +sdist = { url = "https://files.pythonhosted.org/packages/72/3a/79a912fbd4d8dd6fbb02bf69afd3bb72cf0c729bb3063c6f4498603db17a/jedi-0.19.2.tar.gz", hash = "sha256:4770dc3de41bde3966b02eb84fbcf557fb33cce26ad23da12c742fb50ecb11f0", size = 1231287 } wheels = [ - { url = "https://files.pythonhosted.org/packages/c0/5a/9cac0c82afec3d09ccd97c8b6502d48f165f9124db81b4bcb90b4af974ee/jedi-0.19.2-py2.py3-none-any.whl", hash = "sha256:a8ef22bde8490f57fe5c7681a3c83cb58874daf72b4784de3cce5b6ef6edb5b9", size = 1572278, upload-time = "2024-11-11T01:41:40.175Z" }, + { url = "https://files.pythonhosted.org/packages/c0/5a/9cac0c82afec3d09ccd97c8b6502d48f165f9124db81b4bcb90b4af974ee/jedi-0.19.2-py2.py3-none-any.whl", hash = "sha256:a8ef22bde8490f57fe5c7681a3c83cb58874daf72b4784de3cce5b6ef6edb5b9", size = 1572278 }, ] [[package]] @@ -1088,36 +1098,36 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "markupsafe" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/df/bf/f7da0350254c0ed7c72f3e33cef02e048281fec7ecec5f032d4aac52226b/jinja2-3.1.6.tar.gz", hash = "sha256:0137fb05990d35f1275a587e9aee6d56da821fc83491a0fb838183be43f66d6d", size = 245115, upload-time = "2025-03-05T20:05:02.478Z" } +sdist = { url = "https://files.pythonhosted.org/packages/df/bf/f7da0350254c0ed7c72f3e33cef02e048281fec7ecec5f032d4aac52226b/jinja2-3.1.6.tar.gz", hash = "sha256:0137fb05990d35f1275a587e9aee6d56da821fc83491a0fb838183be43f66d6d", size = 245115 } wheels = [ - { url = "https://files.pythonhosted.org/packages/62/a1/3d680cbfd5f4b8f15abc1d571870c5fc3e594bb582bc3b64ea099db13e56/jinja2-3.1.6-py3-none-any.whl", hash = "sha256:85ece4451f492d0c13c5dd7c13a64681a86afae63a5f347908daf103ce6d2f67", size = 134899, upload-time = "2025-03-05T20:05:00.369Z" }, + { url = "https://files.pythonhosted.org/packages/62/a1/3d680cbfd5f4b8f15abc1d571870c5fc3e594bb582bc3b64ea099db13e56/jinja2-3.1.6-py3-none-any.whl", hash = "sha256:85ece4451f492d0c13c5dd7c13a64681a86afae63a5f347908daf103ce6d2f67", size = 134899 }, ] [[package]] name = "joblib" version = "1.5.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e8/5d/447af5ea094b9e4c4054f82e223ada074c552335b9b4b2d14bd9b35a67c4/joblib-1.5.2.tar.gz", hash = "sha256:3faa5c39054b2f03ca547da9b2f52fde67c06240c31853f306aea97f13647b55", size = 331077, upload-time = "2025-08-27T12:15:46.575Z" } +sdist = { url = "https://files.pythonhosted.org/packages/e8/5d/447af5ea094b9e4c4054f82e223ada074c552335b9b4b2d14bd9b35a67c4/joblib-1.5.2.tar.gz", hash = "sha256:3faa5c39054b2f03ca547da9b2f52fde67c06240c31853f306aea97f13647b55", size = 331077 } wheels = [ - { url = "https://files.pythonhosted.org/packages/1e/e8/685f47e0d754320684db4425a0967f7d3fa70126bffd76110b7009a0090f/joblib-1.5.2-py3-none-any.whl", hash = "sha256:4e1f0bdbb987e6d843c70cf43714cb276623def372df3c22fe5266b2670bc241", size = 308396, upload-time = "2025-08-27T12:15:45.188Z" }, + { url = "https://files.pythonhosted.org/packages/1e/e8/685f47e0d754320684db4425a0967f7d3fa70126bffd76110b7009a0090f/joblib-1.5.2-py3-none-any.whl", hash = "sha256:4e1f0bdbb987e6d843c70cf43714cb276623def372df3c22fe5266b2670bc241", size = 308396 }, ] [[package]] name = "json5" version = "0.12.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/12/ae/929aee9619e9eba9015207a9d2c1c54db18311da7eb4dcf6d41ad6f0eb67/json5-0.12.1.tar.gz", hash = "sha256:b2743e77b3242f8d03c143dd975a6ec7c52e2f2afe76ed934e53503dd4ad4990", size = 52191, upload-time = "2025-08-12T19:47:42.583Z" } +sdist = { url = "https://files.pythonhosted.org/packages/12/ae/929aee9619e9eba9015207a9d2c1c54db18311da7eb4dcf6d41ad6f0eb67/json5-0.12.1.tar.gz", hash = "sha256:b2743e77b3242f8d03c143dd975a6ec7c52e2f2afe76ed934e53503dd4ad4990", size = 52191 } wheels = [ - { url = "https://files.pythonhosted.org/packages/85/e2/05328bd2621be49a6fed9e3030b1e51a2d04537d3f816d211b9cc53c5262/json5-0.12.1-py3-none-any.whl", hash = "sha256:d9c9b3bc34a5f54d43c35e11ef7cb87d8bdd098c6ace87117a7b7e83e705c1d5", size = 36119, upload-time = "2025-08-12T19:47:41.131Z" }, + { url = "https://files.pythonhosted.org/packages/85/e2/05328bd2621be49a6fed9e3030b1e51a2d04537d3f816d211b9cc53c5262/json5-0.12.1-py3-none-any.whl", hash = "sha256:d9c9b3bc34a5f54d43c35e11ef7cb87d8bdd098c6ace87117a7b7e83e705c1d5", size = 36119 }, ] [[package]] name = "jsonpointer" version = "3.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/6a/0a/eebeb1fa92507ea94016a2a790b93c2ae41a7e18778f85471dc54475ed25/jsonpointer-3.0.0.tar.gz", hash = "sha256:2b2d729f2091522d61c3b31f82e11870f60b68f43fbc705cb76bf4b832af59ef", size = 9114, upload-time = "2024-06-10T19:24:42.462Z" } +sdist = { url = "https://files.pythonhosted.org/packages/6a/0a/eebeb1fa92507ea94016a2a790b93c2ae41a7e18778f85471dc54475ed25/jsonpointer-3.0.0.tar.gz", hash = "sha256:2b2d729f2091522d61c3b31f82e11870f60b68f43fbc705cb76bf4b832af59ef", size = 9114 } wheels = [ - { url = "https://files.pythonhosted.org/packages/71/92/5e77f98553e9e75130c78900d000368476aed74276eb8ae8796f65f00918/jsonpointer-3.0.0-py2.py3-none-any.whl", hash = "sha256:13e088adc14fca8b6aa8177c044e12701e6ad4b28ff10e65f2267a90109c9942", size = 7595, upload-time = "2024-06-10T19:24:40.698Z" }, + { url = "https://files.pythonhosted.org/packages/71/92/5e77f98553e9e75130c78900d000368476aed74276eb8ae8796f65f00918/jsonpointer-3.0.0-py2.py3-none-any.whl", hash = "sha256:13e088adc14fca8b6aa8177c044e12701e6ad4b28ff10e65f2267a90109c9942", size = 7595 }, ] [[package]] @@ -1130,9 +1140,9 @@ dependencies = [ { name = "referencing" }, { name = "rpds-py" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/74/69/f7185de793a29082a9f3c7728268ffb31cb5095131a9c139a74078e27336/jsonschema-4.25.1.tar.gz", hash = "sha256:e4a9655ce0da0c0b67a085847e00a3a51449e1157f4f75e9fb5aa545e122eb85", size = 357342, upload-time = "2025-08-18T17:03:50.038Z" } +sdist = { url = "https://files.pythonhosted.org/packages/74/69/f7185de793a29082a9f3c7728268ffb31cb5095131a9c139a74078e27336/jsonschema-4.25.1.tar.gz", hash = "sha256:e4a9655ce0da0c0b67a085847e00a3a51449e1157f4f75e9fb5aa545e122eb85", size = 357342 } wheels = [ - { url = "https://files.pythonhosted.org/packages/bf/9c/8c95d856233c1f82500c2450b8c68576b4cf1c871db3afac5c34ff84e6fd/jsonschema-4.25.1-py3-none-any.whl", hash = "sha256:3fba0169e345c7175110351d456342c364814cfcf3b964ba4587f22915230a63", size = 90040, upload-time = "2025-08-18T17:03:48.373Z" }, + { url = "https://files.pythonhosted.org/packages/bf/9c/8c95d856233c1f82500c2450b8c68576b4cf1c871db3afac5c34ff84e6fd/jsonschema-4.25.1-py3-none-any.whl", hash = "sha256:3fba0169e345c7175110351d456342c364814cfcf3b964ba4587f22915230a63", size = 90040 }, ] [package.optional-dependencies] @@ -1155,9 +1165,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "referencing" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/19/74/a633ee74eb36c44aa6d1095e7cc5569bebf04342ee146178e2d36600708b/jsonschema_specifications-2025.9.1.tar.gz", hash = "sha256:b540987f239e745613c7a9176f3edb72b832a4ac465cf02712288397832b5e8d", size = 32855, upload-time = "2025-09-08T01:34:59.186Z" } +sdist = { url = "https://files.pythonhosted.org/packages/19/74/a633ee74eb36c44aa6d1095e7cc5569bebf04342ee146178e2d36600708b/jsonschema_specifications-2025.9.1.tar.gz", hash = "sha256:b540987f239e745613c7a9176f3edb72b832a4ac465cf02712288397832b5e8d", size = 32855 } wheels = [ - { url = "https://files.pythonhosted.org/packages/41/45/1a4ed80516f02155c51f51e8cedb3c1902296743db0bbc66608a0db2814f/jsonschema_specifications-2025.9.1-py3-none-any.whl", hash = "sha256:98802fee3a11ee76ecaca44429fda8a41bff98b00a0f2838151b113f210cc6fe", size = 18437, upload-time = "2025-09-08T01:34:57.871Z" }, + { url = "https://files.pythonhosted.org/packages/41/45/1a4ed80516f02155c51f51e8cedb3c1902296743db0bbc66608a0db2814f/jsonschema_specifications-2025.9.1-py3-none-any.whl", hash = "sha256:98802fee3a11ee76ecaca44429fda8a41bff98b00a0f2838151b113f210cc6fe", size = 18437 }, ] [[package]] @@ -1174,9 +1184,9 @@ dependencies = [ { name = "sqlalchemy" }, { name = "tabulate" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/bb/f7/3627358075f183956e8c4974603232b03afd4ddc7baf72c2bc9fff522291/jupyter_cache-1.0.1.tar.gz", hash = "sha256:16e808eb19e3fb67a223db906e131ea6e01f03aa27f49a7214ce6a5fec186fb9", size = 32048, upload-time = "2024-11-15T16:03:55.322Z" } +sdist = { url = "https://files.pythonhosted.org/packages/bb/f7/3627358075f183956e8c4974603232b03afd4ddc7baf72c2bc9fff522291/jupyter_cache-1.0.1.tar.gz", hash = "sha256:16e808eb19e3fb67a223db906e131ea6e01f03aa27f49a7214ce6a5fec186fb9", size = 32048 } wheels = [ - { url = "https://files.pythonhosted.org/packages/64/6b/67b87da9d36bff9df7d0efbd1a325fa372a43be7158effaf43ed7b22341d/jupyter_cache-1.0.1-py3-none-any.whl", hash = "sha256:9c3cafd825ba7da8b5830485343091143dff903e4d8c69db9349b728b140abf6", size = 33907, upload-time = "2024-11-15T16:03:54.021Z" }, + { url = "https://files.pythonhosted.org/packages/64/6b/67b87da9d36bff9df7d0efbd1a325fa372a43be7158effaf43ed7b22341d/jupyter_cache-1.0.1-py3-none-any.whl", hash = "sha256:9c3cafd825ba7da8b5830485343091143dff903e4d8c69db9349b728b140abf6", size = 33907 }, ] [[package]] @@ -1190,9 +1200,9 @@ dependencies = [ { name = "tornado" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/71/22/bf9f12fdaeae18019a468b68952a60fe6dbab5d67cd2a103cac7659b41ca/jupyter_client-8.6.3.tar.gz", hash = "sha256:35b3a0947c4a6e9d589eb97d7d4cd5e90f910ee73101611f01283732bd6d9419", size = 342019, upload-time = "2024-09-17T10:44:17.613Z" } +sdist = { url = "https://files.pythonhosted.org/packages/71/22/bf9f12fdaeae18019a468b68952a60fe6dbab5d67cd2a103cac7659b41ca/jupyter_client-8.6.3.tar.gz", hash = "sha256:35b3a0947c4a6e9d589eb97d7d4cd5e90f910ee73101611f01283732bd6d9419", size = 342019 } wheels = [ - { url = "https://files.pythonhosted.org/packages/11/85/b0394e0b6fcccd2c1eeefc230978a6f8cb0c5df1e4cd3e7625735a0d7d1e/jupyter_client-8.6.3-py3-none-any.whl", hash = "sha256:e8a19cc986cc45905ac3362915f410f3af85424b4c0905e94fa5f2cb08e8f23f", size = 106105, upload-time = "2024-09-17T10:44:15.218Z" }, + { url = "https://files.pythonhosted.org/packages/11/85/b0394e0b6fcccd2c1eeefc230978a6f8cb0c5df1e4cd3e7625735a0d7d1e/jupyter_client-8.6.3-py3-none-any.whl", hash = "sha256:e8a19cc986cc45905ac3362915f410f3af85424b4c0905e94fa5f2cb08e8f23f", size = 106105 }, ] [[package]] @@ -1203,9 +1213,9 @@ dependencies = [ { name = "platformdirs" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/02/49/9d1284d0dc65e2c757b74c6687b6d319b02f822ad039e5c512df9194d9dd/jupyter_core-5.9.1.tar.gz", hash = "sha256:4d09aaff303b9566c3ce657f580bd089ff5c91f5f89cf7d8846c3cdf465b5508", size = 89814, upload-time = "2025-10-16T19:19:18.444Z" } +sdist = { url = "https://files.pythonhosted.org/packages/02/49/9d1284d0dc65e2c757b74c6687b6d319b02f822ad039e5c512df9194d9dd/jupyter_core-5.9.1.tar.gz", hash = "sha256:4d09aaff303b9566c3ce657f580bd089ff5c91f5f89cf7d8846c3cdf465b5508", size = 89814 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e7/e7/80988e32bf6f73919a113473a604f5a8f09094de312b9d52b79c2df7612b/jupyter_core-5.9.1-py3-none-any.whl", hash = "sha256:ebf87fdc6073d142e114c72c9e29a9d7ca03fad818c5d300ce2adc1fb0743407", size = 29032, upload-time = "2025-10-16T19:19:16.783Z" }, + { url = "https://files.pythonhosted.org/packages/e7/e7/80988e32bf6f73919a113473a604f5a8f09094de312b9d52b79c2df7612b/jupyter_core-5.9.1-py3-none-any.whl", hash = "sha256:ebf87fdc6073d142e114c72c9e29a9d7ca03fad818c5d300ce2adc1fb0743407", size = 29032 }, ] [[package]] @@ -1222,9 +1232,9 @@ dependencies = [ { name = "rfc3986-validator" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/9d/c3/306d090461e4cf3cd91eceaff84bede12a8e52cd821c2d20c9a4fd728385/jupyter_events-0.12.0.tar.gz", hash = "sha256:fc3fce98865f6784c9cd0a56a20644fc6098f21c8c33834a8d9fe383c17e554b", size = 62196, upload-time = "2025-02-03T17:23:41.485Z" } +sdist = { url = "https://files.pythonhosted.org/packages/9d/c3/306d090461e4cf3cd91eceaff84bede12a8e52cd821c2d20c9a4fd728385/jupyter_events-0.12.0.tar.gz", hash = "sha256:fc3fce98865f6784c9cd0a56a20644fc6098f21c8c33834a8d9fe383c17e554b", size = 62196 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e2/48/577993f1f99c552f18a0428731a755e06171f9902fa118c379eb7c04ea22/jupyter_events-0.12.0-py3-none-any.whl", hash = "sha256:6464b2fa5ad10451c3d35fabc75eab39556ae1e2853ad0c0cc31b656731a97fb", size = 19430, upload-time = "2025-02-03T17:23:38.643Z" }, + { url = "https://files.pythonhosted.org/packages/e2/48/577993f1f99c552f18a0428731a755e06171f9902fa118c379eb7c04ea22/jupyter_events-0.12.0-py3-none-any.whl", hash = "sha256:6464b2fa5ad10451c3d35fabc75eab39556ae1e2853ad0c0cc31b656731a97fb", size = 19430 }, ] [[package]] @@ -1234,9 +1244,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "jupyter-server" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/eb/5a/9066c9f8e94ee517133cd98dba393459a16cd48bba71a82f16a65415206c/jupyter_lsp-2.3.0.tar.gz", hash = "sha256:458aa59339dc868fb784d73364f17dbce8836e906cd75fd471a325cba02e0245", size = 54823, upload-time = "2025-08-27T17:47:34.671Z" } +sdist = { url = "https://files.pythonhosted.org/packages/eb/5a/9066c9f8e94ee517133cd98dba393459a16cd48bba71a82f16a65415206c/jupyter_lsp-2.3.0.tar.gz", hash = "sha256:458aa59339dc868fb784d73364f17dbce8836e906cd75fd471a325cba02e0245", size = 54823 } wheels = [ - { url = "https://files.pythonhosted.org/packages/1a/60/1f6cee0c46263de1173894f0fafcb3475ded276c472c14d25e0280c18d6d/jupyter_lsp-2.3.0-py3-none-any.whl", hash = "sha256:e914a3cb2addf48b1c7710914771aaf1819d46b2e5a79b0f917b5478ec93f34f", size = 76687, upload-time = "2025-08-27T17:47:33.15Z" }, + { url = "https://files.pythonhosted.org/packages/1a/60/1f6cee0c46263de1173894f0fafcb3475ded276c472c14d25e0280c18d6d/jupyter_lsp-2.3.0-py3-none-any.whl", hash = "sha256:e914a3cb2addf48b1c7710914771aaf1819d46b2e5a79b0f917b5478ec93f34f", size = 76687 }, ] [[package]] @@ -1264,9 +1274,9 @@ dependencies = [ { name = "traitlets" }, { name = "websocket-client" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/5b/ac/e040ec363d7b6b1f11304cc9f209dac4517ece5d5e01821366b924a64a50/jupyter_server-2.17.0.tar.gz", hash = "sha256:c38ea898566964c888b4772ae1ed58eca84592e88251d2cfc4d171f81f7e99d5", size = 731949, upload-time = "2025-08-21T14:42:54.042Z" } +sdist = { url = "https://files.pythonhosted.org/packages/5b/ac/e040ec363d7b6b1f11304cc9f209dac4517ece5d5e01821366b924a64a50/jupyter_server-2.17.0.tar.gz", hash = "sha256:c38ea898566964c888b4772ae1ed58eca84592e88251d2cfc4d171f81f7e99d5", size = 731949 } wheels = [ - { url = "https://files.pythonhosted.org/packages/92/80/a24767e6ca280f5a49525d987bf3e4d7552bf67c8be07e8ccf20271f8568/jupyter_server-2.17.0-py3-none-any.whl", hash = "sha256:e8cb9c7db4251f51ed307e329b81b72ccf2056ff82d50524debde1ee1870e13f", size = 388221, upload-time = "2025-08-21T14:42:52.034Z" }, + { url = "https://files.pythonhosted.org/packages/92/80/a24767e6ca280f5a49525d987bf3e4d7552bf67c8be07e8ccf20271f8568/jupyter_server-2.17.0-py3-none-any.whl", hash = "sha256:e8cb9c7db4251f51ed307e329b81b72ccf2056ff82d50524debde1ee1870e13f", size = 388221 }, ] [[package]] @@ -1277,9 +1287,9 @@ dependencies = [ { name = "pywinpty", marker = "os_name == 'nt'" }, { name = "terminado" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/fc/d5/562469734f476159e99a55426d697cbf8e7eb5efe89fb0e0b4f83a3d3459/jupyter_server_terminals-0.5.3.tar.gz", hash = "sha256:5ae0295167220e9ace0edcfdb212afd2b01ee8d179fe6f23c899590e9b8a5269", size = 31430, upload-time = "2024-03-12T14:37:03.049Z" } +sdist = { url = "https://files.pythonhosted.org/packages/fc/d5/562469734f476159e99a55426d697cbf8e7eb5efe89fb0e0b4f83a3d3459/jupyter_server_terminals-0.5.3.tar.gz", hash = "sha256:5ae0295167220e9ace0edcfdb212afd2b01ee8d179fe6f23c899590e9b8a5269", size = 31430 } wheels = [ - { url = "https://files.pythonhosted.org/packages/07/2d/2b32cdbe8d2a602f697a649798554e4f072115438e92249624e532e8aca6/jupyter_server_terminals-0.5.3-py3-none-any.whl", hash = "sha256:41ee0d7dc0ebf2809c668e0fc726dfaf258fcd3e769568996ca731b6194ae9aa", size = 13656, upload-time = "2024-03-12T14:37:00.708Z" }, + { url = "https://files.pythonhosted.org/packages/07/2d/2b32cdbe8d2a602f697a649798554e4f072115438e92249624e532e8aca6/jupyter_server_terminals-0.5.3-py3-none-any.whl", hash = "sha256:41ee0d7dc0ebf2809c668e0fc726dfaf258fcd3e769568996ca731b6194ae9aa", size = 13656 }, ] [[package]] @@ -1301,18 +1311,18 @@ dependencies = [ { name = "tornado" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/6a/5d/75c42a48ff5fc826a7dff3fe4004cda47c54f9d981c351efacfbc9139d3c/jupyterlab-4.4.10.tar.gz", hash = "sha256:521c017508af4e1d6d9d8a9d90f47a11c61197ad63b2178342489de42540a615", size = 22969303, upload-time = "2025-10-22T14:50:58.768Z" } +sdist = { url = "https://files.pythonhosted.org/packages/6a/5d/75c42a48ff5fc826a7dff3fe4004cda47c54f9d981c351efacfbc9139d3c/jupyterlab-4.4.10.tar.gz", hash = "sha256:521c017508af4e1d6d9d8a9d90f47a11c61197ad63b2178342489de42540a615", size = 22969303 } wheels = [ - { url = "https://files.pythonhosted.org/packages/f7/46/1eaa5db8d54a594bdade67afbcae42e9a2da676628be3eb39f36dcff6390/jupyterlab-4.4.10-py3-none-any.whl", hash = "sha256:65939ab4c8dcd0c42185c2d0d1a9d60b254dc8c46fc4fdb286b63c51e9358e07", size = 12293385, upload-time = "2025-10-22T14:50:54.075Z" }, + { url = "https://files.pythonhosted.org/packages/f7/46/1eaa5db8d54a594bdade67afbcae42e9a2da676628be3eb39f36dcff6390/jupyterlab-4.4.10-py3-none-any.whl", hash = "sha256:65939ab4c8dcd0c42185c2d0d1a9d60b254dc8c46fc4fdb286b63c51e9358e07", size = 12293385 }, ] [[package]] name = "jupyterlab-pygments" version = "0.3.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/90/51/9187be60d989df97f5f0aba133fa54e7300f17616e065d1ada7d7646b6d6/jupyterlab_pygments-0.3.0.tar.gz", hash = "sha256:721aca4d9029252b11cfa9d185e5b5af4d54772bb8072f9b7036f4170054d35d", size = 512900, upload-time = "2023-11-23T09:26:37.44Z" } +sdist = { url = "https://files.pythonhosted.org/packages/90/51/9187be60d989df97f5f0aba133fa54e7300f17616e065d1ada7d7646b6d6/jupyterlab_pygments-0.3.0.tar.gz", hash = "sha256:721aca4d9029252b11cfa9d185e5b5af4d54772bb8072f9b7036f4170054d35d", size = 512900 } wheels = [ - { url = "https://files.pythonhosted.org/packages/b1/dd/ead9d8ea85bf202d90cc513b533f9c363121c7792674f78e0d8a854b63b4/jupyterlab_pygments-0.3.0-py3-none-any.whl", hash = "sha256:841a89020971da1d8693f1a99997aefc5dc424bb1b251fd6322462a1b8842780", size = 15884, upload-time = "2023-11-23T09:26:34.325Z" }, + { url = "https://files.pythonhosted.org/packages/b1/dd/ead9d8ea85bf202d90cc513b533f9c363121c7792674f78e0d8a854b63b4/jupyterlab_pygments-0.3.0-py3-none-any.whl", hash = "sha256:841a89020971da1d8693f1a99997aefc5dc424bb1b251fd6322462a1b8842780", size = 15884 }, ] [[package]] @@ -1328,18 +1338,18 @@ dependencies = [ { name = "packaging" }, { name = "requests" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/d6/2c/90153f189e421e93c4bb4f9e3f59802a1f01abd2ac5cf40b152d7f735232/jupyterlab_server-2.28.0.tar.gz", hash = "sha256:35baa81898b15f93573e2deca50d11ac0ae407ebb688299d3a5213265033712c", size = 76996, upload-time = "2025-10-22T13:59:18.37Z" } +sdist = { url = "https://files.pythonhosted.org/packages/d6/2c/90153f189e421e93c4bb4f9e3f59802a1f01abd2ac5cf40b152d7f735232/jupyterlab_server-2.28.0.tar.gz", hash = "sha256:35baa81898b15f93573e2deca50d11ac0ae407ebb688299d3a5213265033712c", size = 76996 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e0/07/a000fe835f76b7e1143242ab1122e6362ef1c03f23f83a045c38859c2ae0/jupyterlab_server-2.28.0-py3-none-any.whl", hash = "sha256:e4355b148fdcf34d312bbbc80f22467d6d20460e8b8736bf235577dd18506968", size = 59830, upload-time = "2025-10-22T13:59:16.767Z" }, + { url = "https://files.pythonhosted.org/packages/e0/07/a000fe835f76b7e1143242ab1122e6362ef1c03f23f83a045c38859c2ae0/jupyterlab_server-2.28.0-py3-none-any.whl", hash = "sha256:e4355b148fdcf34d312bbbc80f22467d6d20460e8b8736bf235577dd18506968", size = 59830 }, ] [[package]] name = "jupyterlab-widgets" version = "3.0.16" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/26/2d/ef58fed122b268c69c0aa099da20bc67657cdfb2e222688d5731bd5b971d/jupyterlab_widgets-3.0.16.tar.gz", hash = "sha256:423da05071d55cf27a9e602216d35a3a65a3e41cdf9c5d3b643b814ce38c19e0", size = 897423, upload-time = "2025-11-01T21:11:29.724Z" } +sdist = { url = "https://files.pythonhosted.org/packages/26/2d/ef58fed122b268c69c0aa099da20bc67657cdfb2e222688d5731bd5b971d/jupyterlab_widgets-3.0.16.tar.gz", hash = "sha256:423da05071d55cf27a9e602216d35a3a65a3e41cdf9c5d3b643b814ce38c19e0", size = 897423 } wheels = [ - { url = "https://files.pythonhosted.org/packages/ab/b5/36c712098e6191d1b4e349304ef73a8d06aed77e56ceaac8c0a306c7bda1/jupyterlab_widgets-3.0.16-py3-none-any.whl", hash = "sha256:45fa36d9c6422cf2559198e4db481aa243c7a32d9926b500781c830c80f7ecf8", size = 914926, upload-time = "2025-11-01T21:11:28.008Z" }, + { url = "https://files.pythonhosted.org/packages/ab/b5/36c712098e6191d1b4e349304ef73a8d06aed77e56ceaac8c0a306c7bda1/jupyterlab_widgets-3.0.16-py3-none-any.whl", hash = "sha256:45fa36d9c6422cf2559198e4db481aa243c7a32d9926b500781c830c80f7ecf8", size = 914926 }, ] [[package]] @@ -1353,264 +1363,264 @@ dependencies = [ { name = "packaging" }, { name = "pyyaml" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/9b/5d/82a614a49493fa84b2019a3e03020a8b9927208ae177b81f7e0b30330c82/jupytext-1.18.1.tar.gz", hash = "sha256:5c0962ca8d222db45cbe1848b4805dbbe3ddb957603fc96651b6cd7fd403fafb", size = 4270997, upload-time = "2025-10-19T15:06:30.992Z" } +sdist = { url = "https://files.pythonhosted.org/packages/9b/5d/82a614a49493fa84b2019a3e03020a8b9927208ae177b81f7e0b30330c82/jupytext-1.18.1.tar.gz", hash = "sha256:5c0962ca8d222db45cbe1848b4805dbbe3ddb957603fc96651b6cd7fd403fafb", size = 4270997 } wheels = [ - { url = "https://files.pythonhosted.org/packages/bd/0d/2d240e7098e0cafba4d25e9530e7596b1bb1bd4476e41b10346bcaaa36d6/jupytext-1.18.1-py3-none-any.whl", hash = "sha256:24f999400726a1c658beae55e15fdd2a6255ab1a418697864cd779874e6011ab", size = 167143, upload-time = "2025-10-19T15:06:28.975Z" }, + { url = "https://files.pythonhosted.org/packages/bd/0d/2d240e7098e0cafba4d25e9530e7596b1bb1bd4476e41b10346bcaaa36d6/jupytext-1.18.1-py3-none-any.whl", hash = "sha256:24f999400726a1c658beae55e15fdd2a6255ab1a418697864cd779874e6011ab", size = 167143 }, ] [[package]] name = "kiwisolver" version = "1.4.9" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/5c/3c/85844f1b0feb11ee581ac23fe5fce65cd049a200c1446708cc1b7f922875/kiwisolver-1.4.9.tar.gz", hash = "sha256:c3b22c26c6fd6811b0ae8363b95ca8ce4ea3c202d3d0975b2914310ceb1bcc4d", size = 97564, upload-time = "2025-08-10T21:27:49.279Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/6f/ab/c80b0d5a9d8a1a65f4f815f2afff9798b12c3b9f31f1d304dd233dd920e2/kiwisolver-1.4.9-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:eb14a5da6dc7642b0f3a18f13654847cd8b7a2550e2645a5bda677862b03ba16", size = 124167, upload-time = "2025-08-10T21:25:53.403Z" }, - { url = "https://files.pythonhosted.org/packages/a0/c0/27fe1a68a39cf62472a300e2879ffc13c0538546c359b86f149cc19f6ac3/kiwisolver-1.4.9-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:39a219e1c81ae3b103643d2aedb90f1ef22650deb266ff12a19e7773f3e5f089", size = 66579, upload-time = "2025-08-10T21:25:54.79Z" }, - { url = "https://files.pythonhosted.org/packages/31/a2/a12a503ac1fd4943c50f9822678e8015a790a13b5490354c68afb8489814/kiwisolver-1.4.9-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:2405a7d98604b87f3fc28b1716783534b1b4b8510d8142adca34ee0bc3c87543", size = 65309, upload-time = "2025-08-10T21:25:55.76Z" }, - { url = "https://files.pythonhosted.org/packages/66/e1/e533435c0be77c3f64040d68d7a657771194a63c279f55573188161e81ca/kiwisolver-1.4.9-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:dc1ae486f9abcef254b5618dfb4113dd49f94c68e3e027d03cf0143f3f772b61", size = 1435596, upload-time = "2025-08-10T21:25:56.861Z" }, - { url = "https://files.pythonhosted.org/packages/67/1e/51b73c7347f9aabdc7215aa79e8b15299097dc2f8e67dee2b095faca9cb0/kiwisolver-1.4.9-cp311-cp311-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8a1f570ce4d62d718dce3f179ee78dac3b545ac16c0c04bb363b7607a949c0d1", size = 1246548, upload-time = "2025-08-10T21:25:58.246Z" }, - { url = "https://files.pythonhosted.org/packages/21/aa/72a1c5d1e430294f2d32adb9542719cfb441b5da368d09d268c7757af46c/kiwisolver-1.4.9-cp311-cp311-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:cb27e7b78d716c591e88e0a09a2139c6577865d7f2e152488c2cc6257f460872", size = 1263618, upload-time = "2025-08-10T21:25:59.857Z" }, - { url = "https://files.pythonhosted.org/packages/a3/af/db1509a9e79dbf4c260ce0cfa3903ea8945f6240e9e59d1e4deb731b1a40/kiwisolver-1.4.9-cp311-cp311-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:15163165efc2f627eb9687ea5f3a28137217d217ac4024893d753f46bce9de26", size = 1317437, upload-time = "2025-08-10T21:26:01.105Z" }, - { url = "https://files.pythonhosted.org/packages/e0/f2/3ea5ee5d52abacdd12013a94130436e19969fa183faa1e7c7fbc89e9a42f/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:bdee92c56a71d2b24c33a7d4c2856bd6419d017e08caa7802d2963870e315028", size = 2195742, upload-time = "2025-08-10T21:26:02.675Z" }, - { url = "https://files.pythonhosted.org/packages/6f/9b/1efdd3013c2d9a2566aa6a337e9923a00590c516add9a1e89a768a3eb2fc/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:412f287c55a6f54b0650bd9b6dce5aceddb95864a1a90c87af16979d37c89771", size = 2290810, upload-time = "2025-08-10T21:26:04.009Z" }, - { url = "https://files.pythonhosted.org/packages/fb/e5/cfdc36109ae4e67361f9bc5b41323648cb24a01b9ade18784657e022e65f/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:2c93f00dcba2eea70af2be5f11a830a742fe6b579a1d4e00f47760ef13be247a", size = 2461579, upload-time = "2025-08-10T21:26:05.317Z" }, - { url = "https://files.pythonhosted.org/packages/62/86/b589e5e86c7610842213994cdea5add00960076bef4ae290c5fa68589cac/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:f117e1a089d9411663a3207ba874f31be9ac8eaa5b533787024dc07aeb74f464", size = 2268071, upload-time = "2025-08-10T21:26:06.686Z" }, - { url = "https://files.pythonhosted.org/packages/3b/c6/f8df8509fd1eee6c622febe54384a96cfaf4d43bf2ccec7a0cc17e4715c9/kiwisolver-1.4.9-cp311-cp311-win_amd64.whl", hash = "sha256:be6a04e6c79819c9a8c2373317d19a96048e5a3f90bec587787e86a1153883c2", size = 73840, upload-time = "2025-08-10T21:26:07.94Z" }, - { url = "https://files.pythonhosted.org/packages/e2/2d/16e0581daafd147bc11ac53f032a2b45eabac897f42a338d0a13c1e5c436/kiwisolver-1.4.9-cp311-cp311-win_arm64.whl", hash = "sha256:0ae37737256ba2de764ddc12aed4956460277f00c4996d51a197e72f62f5eec7", size = 65159, upload-time = "2025-08-10T21:26:09.048Z" }, - { url = "https://files.pythonhosted.org/packages/86/c9/13573a747838aeb1c76e3267620daa054f4152444d1f3d1a2324b78255b5/kiwisolver-1.4.9-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:ac5a486ac389dddcc5bef4f365b6ae3ffff2c433324fb38dd35e3fab7c957999", size = 123686, upload-time = "2025-08-10T21:26:10.034Z" }, - { url = "https://files.pythonhosted.org/packages/51/ea/2ecf727927f103ffd1739271ca19c424d0e65ea473fbaeea1c014aea93f6/kiwisolver-1.4.9-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:f2ba92255faa7309d06fe44c3a4a97efe1c8d640c2a79a5ef728b685762a6fd2", size = 66460, upload-time = "2025-08-10T21:26:11.083Z" }, - { url = "https://files.pythonhosted.org/packages/5b/5a/51f5464373ce2aeb5194508298a508b6f21d3867f499556263c64c621914/kiwisolver-1.4.9-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:4a2899935e724dd1074cb568ce7ac0dce28b2cd6ab539c8e001a8578eb106d14", size = 64952, upload-time = "2025-08-10T21:26:12.058Z" }, - { url = "https://files.pythonhosted.org/packages/70/90/6d240beb0f24b74371762873e9b7f499f1e02166a2d9c5801f4dbf8fa12e/kiwisolver-1.4.9-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f6008a4919fdbc0b0097089f67a1eb55d950ed7e90ce2cc3e640abadd2757a04", size = 1474756, upload-time = "2025-08-10T21:26:13.096Z" }, - { url = "https://files.pythonhosted.org/packages/12/42/f36816eaf465220f683fb711efdd1bbf7a7005a2473d0e4ed421389bd26c/kiwisolver-1.4.9-cp312-cp312-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:67bb8b474b4181770f926f7b7d2f8c0248cbcb78b660fdd41a47054b28d2a752", size = 1276404, upload-time = "2025-08-10T21:26:14.457Z" }, - { url = "https://files.pythonhosted.org/packages/2e/64/bc2de94800adc830c476dce44e9b40fd0809cddeef1fde9fcf0f73da301f/kiwisolver-1.4.9-cp312-cp312-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:2327a4a30d3ee07d2fbe2e7933e8a37c591663b96ce42a00bc67461a87d7df77", size = 1294410, upload-time = "2025-08-10T21:26:15.73Z" }, - { url = "https://files.pythonhosted.org/packages/5f/42/2dc82330a70aa8e55b6d395b11018045e58d0bb00834502bf11509f79091/kiwisolver-1.4.9-cp312-cp312-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:7a08b491ec91b1d5053ac177afe5290adacf1f0f6307d771ccac5de30592d198", size = 1343631, upload-time = "2025-08-10T21:26:17.045Z" }, - { url = "https://files.pythonhosted.org/packages/22/fd/f4c67a6ed1aab149ec5a8a401c323cee7a1cbe364381bb6c9c0d564e0e20/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:d8fc5c867c22b828001b6a38d2eaeb88160bf5783c6cb4a5e440efc981ce286d", size = 2224963, upload-time = "2025-08-10T21:26:18.737Z" }, - { url = "https://files.pythonhosted.org/packages/45/aa/76720bd4cb3713314677d9ec94dcc21ced3f1baf4830adde5bb9b2430a5f/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:3b3115b2581ea35bb6d1f24a4c90af37e5d9b49dcff267eeed14c3893c5b86ab", size = 2321295, upload-time = "2025-08-10T21:26:20.11Z" }, - { url = "https://files.pythonhosted.org/packages/80/19/d3ec0d9ab711242f56ae0dc2fc5d70e298bb4a1f9dfab44c027668c673a1/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:858e4c22fb075920b96a291928cb7dea5644e94c0ee4fcd5af7e865655e4ccf2", size = 2487987, upload-time = "2025-08-10T21:26:21.49Z" }, - { url = "https://files.pythonhosted.org/packages/39/e9/61e4813b2c97e86b6fdbd4dd824bf72d28bcd8d4849b8084a357bc0dd64d/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:ed0fecd28cc62c54b262e3736f8bb2512d8dcfdc2bcf08be5f47f96bf405b145", size = 2291817, upload-time = "2025-08-10T21:26:22.812Z" }, - { url = "https://files.pythonhosted.org/packages/a0/41/85d82b0291db7504da3c2defe35c9a8a5c9803a730f297bd823d11d5fb77/kiwisolver-1.4.9-cp312-cp312-win_amd64.whl", hash = "sha256:f68208a520c3d86ea51acf688a3e3002615a7f0238002cccc17affecc86a8a54", size = 73895, upload-time = "2025-08-10T21:26:24.37Z" }, - { url = "https://files.pythonhosted.org/packages/e2/92/5f3068cf15ee5cb624a0c7596e67e2a0bb2adee33f71c379054a491d07da/kiwisolver-1.4.9-cp312-cp312-win_arm64.whl", hash = "sha256:2c1a4f57df73965f3f14df20b80ee29e6a7930a57d2d9e8491a25f676e197c60", size = 64992, upload-time = "2025-08-10T21:26:25.732Z" }, - { url = "https://files.pythonhosted.org/packages/31/c1/c2686cda909742ab66c7388e9a1a8521a59eb89f8bcfbee28fc980d07e24/kiwisolver-1.4.9-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:a5d0432ccf1c7ab14f9949eec60c5d1f924f17c037e9f8b33352fa05799359b8", size = 123681, upload-time = "2025-08-10T21:26:26.725Z" }, - { url = "https://files.pythonhosted.org/packages/ca/f0/f44f50c9f5b1a1860261092e3bc91ecdc9acda848a8b8c6abfda4a24dd5c/kiwisolver-1.4.9-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:efb3a45b35622bb6c16dbfab491a8f5a391fe0e9d45ef32f4df85658232ca0e2", size = 66464, upload-time = "2025-08-10T21:26:27.733Z" }, - { url = "https://files.pythonhosted.org/packages/2d/7a/9d90a151f558e29c3936b8a47ac770235f436f2120aca41a6d5f3d62ae8d/kiwisolver-1.4.9-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:1a12cf6398e8a0a001a059747a1cbf24705e18fe413bc22de7b3d15c67cffe3f", size = 64961, upload-time = "2025-08-10T21:26:28.729Z" }, - { url = "https://files.pythonhosted.org/packages/e9/e9/f218a2cb3a9ffbe324ca29a9e399fa2d2866d7f348ec3a88df87fc248fc5/kiwisolver-1.4.9-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:b67e6efbf68e077dd71d1a6b37e43e1a99d0bff1a3d51867d45ee8908b931098", size = 1474607, upload-time = "2025-08-10T21:26:29.798Z" }, - { url = "https://files.pythonhosted.org/packages/d9/28/aac26d4c882f14de59041636292bc838db8961373825df23b8eeb807e198/kiwisolver-1.4.9-cp313-cp313-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5656aa670507437af0207645273ccdfee4f14bacd7f7c67a4306d0dcaeaf6eed", size = 1276546, upload-time = "2025-08-10T21:26:31.401Z" }, - { url = "https://files.pythonhosted.org/packages/8b/ad/8bfc1c93d4cc565e5069162f610ba2f48ff39b7de4b5b8d93f69f30c4bed/kiwisolver-1.4.9-cp313-cp313-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:bfc08add558155345129c7803b3671cf195e6a56e7a12f3dde7c57d9b417f525", size = 1294482, upload-time = "2025-08-10T21:26:32.721Z" }, - { url = "https://files.pythonhosted.org/packages/da/f1/6aca55ff798901d8ce403206d00e033191f63d82dd708a186e0ed2067e9c/kiwisolver-1.4.9-cp313-cp313-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:40092754720b174e6ccf9e845d0d8c7d8e12c3d71e7fc35f55f3813e96376f78", size = 1343720, upload-time = "2025-08-10T21:26:34.032Z" }, - { url = "https://files.pythonhosted.org/packages/d1/91/eed031876c595c81d90d0f6fc681ece250e14bf6998c3d7c419466b523b7/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:497d05f29a1300d14e02e6441cf0f5ee81c1ff5a304b0d9fb77423974684e08b", size = 2224907, upload-time = "2025-08-10T21:26:35.824Z" }, - { url = "https://files.pythonhosted.org/packages/e9/ec/4d1925f2e49617b9cca9c34bfa11adefad49d00db038e692a559454dfb2e/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:bdd1a81a1860476eb41ac4bc1e07b3f07259e6d55bbf739b79c8aaedcf512799", size = 2321334, upload-time = "2025-08-10T21:26:37.534Z" }, - { url = "https://files.pythonhosted.org/packages/43/cb/450cd4499356f68802750c6ddc18647b8ea01ffa28f50d20598e0befe6e9/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:e6b93f13371d341afee3be9f7c5964e3fe61d5fa30f6a30eb49856935dfe4fc3", size = 2488313, upload-time = "2025-08-10T21:26:39.191Z" }, - { url = "https://files.pythonhosted.org/packages/71/67/fc76242bd99f885651128a5d4fa6083e5524694b7c88b489b1b55fdc491d/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:d75aa530ccfaa593da12834b86a0724f58bff12706659baa9227c2ccaa06264c", size = 2291970, upload-time = "2025-08-10T21:26:40.828Z" }, - { url = "https://files.pythonhosted.org/packages/75/bd/f1a5d894000941739f2ae1b65a32892349423ad49c2e6d0771d0bad3fae4/kiwisolver-1.4.9-cp313-cp313-win_amd64.whl", hash = "sha256:dd0a578400839256df88c16abddf9ba14813ec5f21362e1fe65022e00c883d4d", size = 73894, upload-time = "2025-08-10T21:26:42.33Z" }, - { url = "https://files.pythonhosted.org/packages/95/38/dce480814d25b99a391abbddadc78f7c117c6da34be68ca8b02d5848b424/kiwisolver-1.4.9-cp313-cp313-win_arm64.whl", hash = "sha256:d4188e73af84ca82468f09cadc5ac4db578109e52acb4518d8154698d3a87ca2", size = 64995, upload-time = "2025-08-10T21:26:43.889Z" }, - { url = "https://files.pythonhosted.org/packages/e2/37/7d218ce5d92dadc5ebdd9070d903e0c7cf7edfe03f179433ac4d13ce659c/kiwisolver-1.4.9-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:5a0f2724dfd4e3b3ac5a82436a8e6fd16baa7d507117e4279b660fe8ca38a3a1", size = 126510, upload-time = "2025-08-10T21:26:44.915Z" }, - { url = "https://files.pythonhosted.org/packages/23/b0/e85a2b48233daef4b648fb657ebbb6f8367696a2d9548a00b4ee0eb67803/kiwisolver-1.4.9-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:1b11d6a633e4ed84fc0ddafd4ebfd8ea49b3f25082c04ad12b8315c11d504dc1", size = 67903, upload-time = "2025-08-10T21:26:45.934Z" }, - { url = "https://files.pythonhosted.org/packages/44/98/f2425bc0113ad7de24da6bb4dae1343476e95e1d738be7c04d31a5d037fd/kiwisolver-1.4.9-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:61874cdb0a36016354853593cffc38e56fc9ca5aa97d2c05d3dcf6922cd55a11", size = 66402, upload-time = "2025-08-10T21:26:47.101Z" }, - { url = "https://files.pythonhosted.org/packages/98/d8/594657886df9f34c4177cc353cc28ca7e6e5eb562d37ccc233bff43bbe2a/kiwisolver-1.4.9-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:60c439763a969a6af93b4881db0eed8fadf93ee98e18cbc35bc8da868d0c4f0c", size = 1582135, upload-time = "2025-08-10T21:26:48.665Z" }, - { url = "https://files.pythonhosted.org/packages/5c/c6/38a115b7170f8b306fc929e166340c24958347308ea3012c2b44e7e295db/kiwisolver-1.4.9-cp313-cp313t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:92a2f997387a1b79a75e7803aa7ded2cfbe2823852ccf1ba3bcf613b62ae3197", size = 1389409, upload-time = "2025-08-10T21:26:50.335Z" }, - { url = "https://files.pythonhosted.org/packages/bf/3b/e04883dace81f24a568bcee6eb3001da4ba05114afa622ec9b6fafdc1f5e/kiwisolver-1.4.9-cp313-cp313t-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a31d512c812daea6d8b3be3b2bfcbeb091dbb09177706569bcfc6240dcf8b41c", size = 1401763, upload-time = "2025-08-10T21:26:51.867Z" }, - { url = "https://files.pythonhosted.org/packages/9f/80/20ace48e33408947af49d7d15c341eaee69e4e0304aab4b7660e234d6288/kiwisolver-1.4.9-cp313-cp313t-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:52a15b0f35dad39862d376df10c5230155243a2c1a436e39eb55623ccbd68185", size = 1453643, upload-time = "2025-08-10T21:26:53.592Z" }, - { url = "https://files.pythonhosted.org/packages/64/31/6ce4380a4cd1f515bdda976a1e90e547ccd47b67a1546d63884463c92ca9/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:a30fd6fdef1430fd9e1ba7b3398b5ee4e2887783917a687d86ba69985fb08748", size = 2330818, upload-time = "2025-08-10T21:26:55.051Z" }, - { url = "https://files.pythonhosted.org/packages/fa/e9/3f3fcba3bcc7432c795b82646306e822f3fd74df0ee81f0fa067a1f95668/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:cc9617b46837c6468197b5945e196ee9ca43057bb7d9d1ae688101e4e1dddf64", size = 2419963, upload-time = "2025-08-10T21:26:56.421Z" }, - { url = "https://files.pythonhosted.org/packages/99/43/7320c50e4133575c66e9f7dadead35ab22d7c012a3b09bb35647792b2a6d/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:0ab74e19f6a2b027ea4f845a78827969af45ce790e6cb3e1ebab71bdf9f215ff", size = 2594639, upload-time = "2025-08-10T21:26:57.882Z" }, - { url = "https://files.pythonhosted.org/packages/65/d6/17ae4a270d4a987ef8a385b906d2bdfc9fce502d6dc0d3aea865b47f548c/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:dba5ee5d3981160c28d5490f0d1b7ed730c22470ff7f6cc26cfcfaacb9896a07", size = 2391741, upload-time = "2025-08-10T21:26:59.237Z" }, - { url = "https://files.pythonhosted.org/packages/2a/8f/8f6f491d595a9e5912971f3f863d81baddccc8a4d0c3749d6a0dd9ffc9df/kiwisolver-1.4.9-cp313-cp313t-win_arm64.whl", hash = "sha256:0749fd8f4218ad2e851e11cc4dc05c7cbc0cbc4267bdfdb31782e65aace4ee9c", size = 68646, upload-time = "2025-08-10T21:27:00.52Z" }, - { url = "https://files.pythonhosted.org/packages/6b/32/6cc0fbc9c54d06c2969faa9c1d29f5751a2e51809dd55c69055e62d9b426/kiwisolver-1.4.9-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:9928fe1eb816d11ae170885a74d074f57af3a0d65777ca47e9aeb854a1fba386", size = 123806, upload-time = "2025-08-10T21:27:01.537Z" }, - { url = "https://files.pythonhosted.org/packages/b2/dd/2bfb1d4a4823d92e8cbb420fe024b8d2167f72079b3bb941207c42570bdf/kiwisolver-1.4.9-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:d0005b053977e7b43388ddec89fa567f43d4f6d5c2c0affe57de5ebf290dc552", size = 66605, upload-time = "2025-08-10T21:27:03.335Z" }, - { url = "https://files.pythonhosted.org/packages/f7/69/00aafdb4e4509c2ca6064646cba9cd4b37933898f426756adb2cb92ebbed/kiwisolver-1.4.9-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:2635d352d67458b66fd0667c14cb1d4145e9560d503219034a18a87e971ce4f3", size = 64925, upload-time = "2025-08-10T21:27:04.339Z" }, - { url = "https://files.pythonhosted.org/packages/43/dc/51acc6791aa14e5cb6d8a2e28cefb0dc2886d8862795449d021334c0df20/kiwisolver-1.4.9-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:767c23ad1c58c9e827b649a9ab7809fd5fd9db266a9cf02b0e926ddc2c680d58", size = 1472414, upload-time = "2025-08-10T21:27:05.437Z" }, - { url = "https://files.pythonhosted.org/packages/3d/bb/93fa64a81db304ac8a246f834d5094fae4b13baf53c839d6bb6e81177129/kiwisolver-1.4.9-cp314-cp314-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:72d0eb9fba308b8311685c2268cf7d0a0639a6cd027d8128659f72bdd8a024b4", size = 1281272, upload-time = "2025-08-10T21:27:07.063Z" }, - { url = "https://files.pythonhosted.org/packages/70/e6/6df102916960fb8d05069d4bd92d6d9a8202d5a3e2444494e7cd50f65b7a/kiwisolver-1.4.9-cp314-cp314-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f68e4f3eeca8fb22cc3d731f9715a13b652795ef657a13df1ad0c7dc0e9731df", size = 1298578, upload-time = "2025-08-10T21:27:08.452Z" }, - { url = "https://files.pythonhosted.org/packages/7c/47/e142aaa612f5343736b087864dbaebc53ea8831453fb47e7521fa8658f30/kiwisolver-1.4.9-cp314-cp314-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d84cd4061ae292d8ac367b2c3fa3aad11cb8625a95d135fe93f286f914f3f5a6", size = 1345607, upload-time = "2025-08-10T21:27:10.125Z" }, - { url = "https://files.pythonhosted.org/packages/54/89/d641a746194a0f4d1a3670fb900d0dbaa786fb98341056814bc3f058fa52/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:a60ea74330b91bd22a29638940d115df9dc00af5035a9a2a6ad9399ffb4ceca5", size = 2230150, upload-time = "2025-08-10T21:27:11.484Z" }, - { url = "https://files.pythonhosted.org/packages/aa/6b/5ee1207198febdf16ac11f78c5ae40861b809cbe0e6d2a8d5b0b3044b199/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:ce6a3a4e106cf35c2d9c4fa17c05ce0b180db622736845d4315519397a77beaf", size = 2325979, upload-time = "2025-08-10T21:27:12.917Z" }, - { url = "https://files.pythonhosted.org/packages/fc/ff/b269eefd90f4ae14dcc74973d5a0f6d28d3b9bb1afd8c0340513afe6b39a/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:77937e5e2a38a7b48eef0585114fe7930346993a88060d0bf886086d2aa49ef5", size = 2491456, upload-time = "2025-08-10T21:27:14.353Z" }, - { url = "https://files.pythonhosted.org/packages/fc/d4/10303190bd4d30de547534601e259a4fbf014eed94aae3e5521129215086/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:24c175051354f4a28c5d6a31c93906dc653e2bf234e8a4bbfb964892078898ce", size = 2294621, upload-time = "2025-08-10T21:27:15.808Z" }, - { url = "https://files.pythonhosted.org/packages/28/e0/a9a90416fce5c0be25742729c2ea52105d62eda6c4be4d803c2a7be1fa50/kiwisolver-1.4.9-cp314-cp314-win_amd64.whl", hash = "sha256:0763515d4df10edf6d06a3c19734e2566368980d21ebec439f33f9eb936c07b7", size = 75417, upload-time = "2025-08-10T21:27:17.436Z" }, - { url = "https://files.pythonhosted.org/packages/1f/10/6949958215b7a9a264299a7db195564e87900f709db9245e4ebdd3c70779/kiwisolver-1.4.9-cp314-cp314-win_arm64.whl", hash = "sha256:0e4e2bf29574a6a7b7f6cb5fa69293b9f96c928949ac4a53ba3f525dffb87f9c", size = 66582, upload-time = "2025-08-10T21:27:18.436Z" }, - { url = "https://files.pythonhosted.org/packages/ec/79/60e53067903d3bc5469b369fe0dfc6b3482e2133e85dae9daa9527535991/kiwisolver-1.4.9-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:d976bbb382b202f71c67f77b0ac11244021cfa3f7dfd9e562eefcea2df711548", size = 126514, upload-time = "2025-08-10T21:27:19.465Z" }, - { url = "https://files.pythonhosted.org/packages/25/d1/4843d3e8d46b072c12a38c97c57fab4608d36e13fe47d47ee96b4d61ba6f/kiwisolver-1.4.9-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:2489e4e5d7ef9a1c300a5e0196e43d9c739f066ef23270607d45aba368b91f2d", size = 67905, upload-time = "2025-08-10T21:27:20.51Z" }, - { url = "https://files.pythonhosted.org/packages/8c/ae/29ffcbd239aea8b93108de1278271ae764dfc0d803a5693914975f200596/kiwisolver-1.4.9-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:e2ea9f7ab7fbf18fffb1b5434ce7c69a07582f7acc7717720f1d69f3e806f90c", size = 66399, upload-time = "2025-08-10T21:27:21.496Z" }, - { url = "https://files.pythonhosted.org/packages/a1/ae/d7ba902aa604152c2ceba5d352d7b62106bedbccc8e95c3934d94472bfa3/kiwisolver-1.4.9-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:b34e51affded8faee0dfdb705416153819d8ea9250bbbf7ea1b249bdeb5f1122", size = 1582197, upload-time = "2025-08-10T21:27:22.604Z" }, - { url = "https://files.pythonhosted.org/packages/f2/41/27c70d427eddb8bc7e4f16420a20fefc6f480312122a59a959fdfe0445ad/kiwisolver-1.4.9-cp314-cp314t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d8aacd3d4b33b772542b2e01beb50187536967b514b00003bdda7589722d2a64", size = 1390125, upload-time = "2025-08-10T21:27:24.036Z" }, - { url = "https://files.pythonhosted.org/packages/41/42/b3799a12bafc76d962ad69083f8b43b12bf4fe78b097b12e105d75c9b8f1/kiwisolver-1.4.9-cp314-cp314t-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:7cf974dd4e35fa315563ac99d6287a1024e4dc2077b8a7d7cd3d2fb65d283134", size = 1402612, upload-time = "2025-08-10T21:27:25.773Z" }, - { url = "https://files.pythonhosted.org/packages/d2/b5/a210ea073ea1cfaca1bb5c55a62307d8252f531beb364e18aa1e0888b5a0/kiwisolver-1.4.9-cp314-cp314t-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:85bd218b5ecfbee8c8a82e121802dcb519a86044c9c3b2e4aef02fa05c6da370", size = 1453990, upload-time = "2025-08-10T21:27:27.089Z" }, - { url = "https://files.pythonhosted.org/packages/5f/ce/a829eb8c033e977d7ea03ed32fb3c1781b4fa0433fbadfff29e39c676f32/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:0856e241c2d3df4efef7c04a1e46b1936b6120c9bcf36dd216e3acd84bc4fb21", size = 2331601, upload-time = "2025-08-10T21:27:29.343Z" }, - { url = "https://files.pythonhosted.org/packages/e0/4b/b5e97eb142eb9cd0072dacfcdcd31b1c66dc7352b0f7c7255d339c0edf00/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:9af39d6551f97d31a4deebeac6f45b156f9755ddc59c07b402c148f5dbb6482a", size = 2422041, upload-time = "2025-08-10T21:27:30.754Z" }, - { url = "https://files.pythonhosted.org/packages/40/be/8eb4cd53e1b85ba4edc3a9321666f12b83113a178845593307a3e7891f44/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:bb4ae2b57fc1d8cbd1cf7b1d9913803681ffa903e7488012be5b76dedf49297f", size = 2594897, upload-time = "2025-08-10T21:27:32.803Z" }, - { url = "https://files.pythonhosted.org/packages/99/dd/841e9a66c4715477ea0abc78da039832fbb09dac5c35c58dc4c41a407b8a/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:aedff62918805fb62d43a4aa2ecd4482c380dc76cd31bd7c8878588a61bd0369", size = 2391835, upload-time = "2025-08-10T21:27:34.23Z" }, - { url = "https://files.pythonhosted.org/packages/0c/28/4b2e5c47a0da96896fdfdb006340ade064afa1e63675d01ea5ac222b6d52/kiwisolver-1.4.9-cp314-cp314t-win_amd64.whl", hash = "sha256:1fa333e8b2ce4d9660f2cda9c0e1b6bafcfb2457a9d259faa82289e73ec24891", size = 79988, upload-time = "2025-08-10T21:27:35.587Z" }, - { url = "https://files.pythonhosted.org/packages/80/be/3578e8afd18c88cdf9cb4cffde75a96d2be38c5a903f1ed0ceec061bd09e/kiwisolver-1.4.9-cp314-cp314t-win_arm64.whl", hash = "sha256:4a48a2ce79d65d363597ef7b567ce3d14d68783d2b2263d98db3d9477805ba32", size = 70260, upload-time = "2025-08-10T21:27:36.606Z" }, - { url = "https://files.pythonhosted.org/packages/a3/0f/36d89194b5a32c054ce93e586d4049b6c2c22887b0eb229c61c68afd3078/kiwisolver-1.4.9-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:720e05574713db64c356e86732c0f3c5252818d05f9df320f0ad8380641acea5", size = 60104, upload-time = "2025-08-10T21:27:43.287Z" }, - { url = "https://files.pythonhosted.org/packages/52/ba/4ed75f59e4658fd21fe7dde1fee0ac397c678ec3befba3fe6482d987af87/kiwisolver-1.4.9-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:17680d737d5335b552994a2008fab4c851bcd7de33094a82067ef3a576ff02fa", size = 58592, upload-time = "2025-08-10T21:27:44.314Z" }, - { url = "https://files.pythonhosted.org/packages/33/01/a8ea7c5ea32a9b45ceeaee051a04c8ed4320f5add3c51bfa20879b765b70/kiwisolver-1.4.9-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:85b5352f94e490c028926ea567fc569c52ec79ce131dadb968d3853e809518c2", size = 80281, upload-time = "2025-08-10T21:27:45.369Z" }, - { url = "https://files.pythonhosted.org/packages/da/e3/dbd2ecdce306f1d07a1aaf324817ee993aab7aee9db47ceac757deabafbe/kiwisolver-1.4.9-pp311-pypy311_pp73-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:464415881e4801295659462c49461a24fb107c140de781d55518c4b80cb6790f", size = 78009, upload-time = "2025-08-10T21:27:46.376Z" }, - { url = "https://files.pythonhosted.org/packages/da/e9/0d4add7873a73e462aeb45c036a2dead2562b825aa46ba326727b3f31016/kiwisolver-1.4.9-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:fb940820c63a9590d31d88b815e7a3aa5915cad3ce735ab45f0c730b39547de1", size = 73929, upload-time = "2025-08-10T21:27:48.236Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/5c/3c/85844f1b0feb11ee581ac23fe5fce65cd049a200c1446708cc1b7f922875/kiwisolver-1.4.9.tar.gz", hash = "sha256:c3b22c26c6fd6811b0ae8363b95ca8ce4ea3c202d3d0975b2914310ceb1bcc4d", size = 97564 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/6f/ab/c80b0d5a9d8a1a65f4f815f2afff9798b12c3b9f31f1d304dd233dd920e2/kiwisolver-1.4.9-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:eb14a5da6dc7642b0f3a18f13654847cd8b7a2550e2645a5bda677862b03ba16", size = 124167 }, + { url = "https://files.pythonhosted.org/packages/a0/c0/27fe1a68a39cf62472a300e2879ffc13c0538546c359b86f149cc19f6ac3/kiwisolver-1.4.9-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:39a219e1c81ae3b103643d2aedb90f1ef22650deb266ff12a19e7773f3e5f089", size = 66579 }, + { url = "https://files.pythonhosted.org/packages/31/a2/a12a503ac1fd4943c50f9822678e8015a790a13b5490354c68afb8489814/kiwisolver-1.4.9-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:2405a7d98604b87f3fc28b1716783534b1b4b8510d8142adca34ee0bc3c87543", size = 65309 }, + { url = "https://files.pythonhosted.org/packages/66/e1/e533435c0be77c3f64040d68d7a657771194a63c279f55573188161e81ca/kiwisolver-1.4.9-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:dc1ae486f9abcef254b5618dfb4113dd49f94c68e3e027d03cf0143f3f772b61", size = 1435596 }, + { url = "https://files.pythonhosted.org/packages/67/1e/51b73c7347f9aabdc7215aa79e8b15299097dc2f8e67dee2b095faca9cb0/kiwisolver-1.4.9-cp311-cp311-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8a1f570ce4d62d718dce3f179ee78dac3b545ac16c0c04bb363b7607a949c0d1", size = 1246548 }, + { url = "https://files.pythonhosted.org/packages/21/aa/72a1c5d1e430294f2d32adb9542719cfb441b5da368d09d268c7757af46c/kiwisolver-1.4.9-cp311-cp311-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:cb27e7b78d716c591e88e0a09a2139c6577865d7f2e152488c2cc6257f460872", size = 1263618 }, + { url = "https://files.pythonhosted.org/packages/a3/af/db1509a9e79dbf4c260ce0cfa3903ea8945f6240e9e59d1e4deb731b1a40/kiwisolver-1.4.9-cp311-cp311-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:15163165efc2f627eb9687ea5f3a28137217d217ac4024893d753f46bce9de26", size = 1317437 }, + { url = "https://files.pythonhosted.org/packages/e0/f2/3ea5ee5d52abacdd12013a94130436e19969fa183faa1e7c7fbc89e9a42f/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:bdee92c56a71d2b24c33a7d4c2856bd6419d017e08caa7802d2963870e315028", size = 2195742 }, + { url = "https://files.pythonhosted.org/packages/6f/9b/1efdd3013c2d9a2566aa6a337e9923a00590c516add9a1e89a768a3eb2fc/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:412f287c55a6f54b0650bd9b6dce5aceddb95864a1a90c87af16979d37c89771", size = 2290810 }, + { url = "https://files.pythonhosted.org/packages/fb/e5/cfdc36109ae4e67361f9bc5b41323648cb24a01b9ade18784657e022e65f/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:2c93f00dcba2eea70af2be5f11a830a742fe6b579a1d4e00f47760ef13be247a", size = 2461579 }, + { url = "https://files.pythonhosted.org/packages/62/86/b589e5e86c7610842213994cdea5add00960076bef4ae290c5fa68589cac/kiwisolver-1.4.9-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:f117e1a089d9411663a3207ba874f31be9ac8eaa5b533787024dc07aeb74f464", size = 2268071 }, + { url = "https://files.pythonhosted.org/packages/3b/c6/f8df8509fd1eee6c622febe54384a96cfaf4d43bf2ccec7a0cc17e4715c9/kiwisolver-1.4.9-cp311-cp311-win_amd64.whl", hash = "sha256:be6a04e6c79819c9a8c2373317d19a96048e5a3f90bec587787e86a1153883c2", size = 73840 }, + { url = "https://files.pythonhosted.org/packages/e2/2d/16e0581daafd147bc11ac53f032a2b45eabac897f42a338d0a13c1e5c436/kiwisolver-1.4.9-cp311-cp311-win_arm64.whl", hash = "sha256:0ae37737256ba2de764ddc12aed4956460277f00c4996d51a197e72f62f5eec7", size = 65159 }, + { url = "https://files.pythonhosted.org/packages/86/c9/13573a747838aeb1c76e3267620daa054f4152444d1f3d1a2324b78255b5/kiwisolver-1.4.9-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:ac5a486ac389dddcc5bef4f365b6ae3ffff2c433324fb38dd35e3fab7c957999", size = 123686 }, + { url = "https://files.pythonhosted.org/packages/51/ea/2ecf727927f103ffd1739271ca19c424d0e65ea473fbaeea1c014aea93f6/kiwisolver-1.4.9-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:f2ba92255faa7309d06fe44c3a4a97efe1c8d640c2a79a5ef728b685762a6fd2", size = 66460 }, + { url = "https://files.pythonhosted.org/packages/5b/5a/51f5464373ce2aeb5194508298a508b6f21d3867f499556263c64c621914/kiwisolver-1.4.9-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:4a2899935e724dd1074cb568ce7ac0dce28b2cd6ab539c8e001a8578eb106d14", size = 64952 }, + { url = "https://files.pythonhosted.org/packages/70/90/6d240beb0f24b74371762873e9b7f499f1e02166a2d9c5801f4dbf8fa12e/kiwisolver-1.4.9-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f6008a4919fdbc0b0097089f67a1eb55d950ed7e90ce2cc3e640abadd2757a04", size = 1474756 }, + { url = "https://files.pythonhosted.org/packages/12/42/f36816eaf465220f683fb711efdd1bbf7a7005a2473d0e4ed421389bd26c/kiwisolver-1.4.9-cp312-cp312-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:67bb8b474b4181770f926f7b7d2f8c0248cbcb78b660fdd41a47054b28d2a752", size = 1276404 }, + { url = "https://files.pythonhosted.org/packages/2e/64/bc2de94800adc830c476dce44e9b40fd0809cddeef1fde9fcf0f73da301f/kiwisolver-1.4.9-cp312-cp312-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:2327a4a30d3ee07d2fbe2e7933e8a37c591663b96ce42a00bc67461a87d7df77", size = 1294410 }, + { url = "https://files.pythonhosted.org/packages/5f/42/2dc82330a70aa8e55b6d395b11018045e58d0bb00834502bf11509f79091/kiwisolver-1.4.9-cp312-cp312-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:7a08b491ec91b1d5053ac177afe5290adacf1f0f6307d771ccac5de30592d198", size = 1343631 }, + { url = "https://files.pythonhosted.org/packages/22/fd/f4c67a6ed1aab149ec5a8a401c323cee7a1cbe364381bb6c9c0d564e0e20/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:d8fc5c867c22b828001b6a38d2eaeb88160bf5783c6cb4a5e440efc981ce286d", size = 2224963 }, + { url = "https://files.pythonhosted.org/packages/45/aa/76720bd4cb3713314677d9ec94dcc21ced3f1baf4830adde5bb9b2430a5f/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:3b3115b2581ea35bb6d1f24a4c90af37e5d9b49dcff267eeed14c3893c5b86ab", size = 2321295 }, + { url = "https://files.pythonhosted.org/packages/80/19/d3ec0d9ab711242f56ae0dc2fc5d70e298bb4a1f9dfab44c027668c673a1/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:858e4c22fb075920b96a291928cb7dea5644e94c0ee4fcd5af7e865655e4ccf2", size = 2487987 }, + { url = "https://files.pythonhosted.org/packages/39/e9/61e4813b2c97e86b6fdbd4dd824bf72d28bcd8d4849b8084a357bc0dd64d/kiwisolver-1.4.9-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:ed0fecd28cc62c54b262e3736f8bb2512d8dcfdc2bcf08be5f47f96bf405b145", size = 2291817 }, + { url = "https://files.pythonhosted.org/packages/a0/41/85d82b0291db7504da3c2defe35c9a8a5c9803a730f297bd823d11d5fb77/kiwisolver-1.4.9-cp312-cp312-win_amd64.whl", hash = "sha256:f68208a520c3d86ea51acf688a3e3002615a7f0238002cccc17affecc86a8a54", size = 73895 }, + { url = "https://files.pythonhosted.org/packages/e2/92/5f3068cf15ee5cb624a0c7596e67e2a0bb2adee33f71c379054a491d07da/kiwisolver-1.4.9-cp312-cp312-win_arm64.whl", hash = "sha256:2c1a4f57df73965f3f14df20b80ee29e6a7930a57d2d9e8491a25f676e197c60", size = 64992 }, + { url = "https://files.pythonhosted.org/packages/31/c1/c2686cda909742ab66c7388e9a1a8521a59eb89f8bcfbee28fc980d07e24/kiwisolver-1.4.9-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:a5d0432ccf1c7ab14f9949eec60c5d1f924f17c037e9f8b33352fa05799359b8", size = 123681 }, + { url = "https://files.pythonhosted.org/packages/ca/f0/f44f50c9f5b1a1860261092e3bc91ecdc9acda848a8b8c6abfda4a24dd5c/kiwisolver-1.4.9-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:efb3a45b35622bb6c16dbfab491a8f5a391fe0e9d45ef32f4df85658232ca0e2", size = 66464 }, + { url = "https://files.pythonhosted.org/packages/2d/7a/9d90a151f558e29c3936b8a47ac770235f436f2120aca41a6d5f3d62ae8d/kiwisolver-1.4.9-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:1a12cf6398e8a0a001a059747a1cbf24705e18fe413bc22de7b3d15c67cffe3f", size = 64961 }, + { url = "https://files.pythonhosted.org/packages/e9/e9/f218a2cb3a9ffbe324ca29a9e399fa2d2866d7f348ec3a88df87fc248fc5/kiwisolver-1.4.9-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:b67e6efbf68e077dd71d1a6b37e43e1a99d0bff1a3d51867d45ee8908b931098", size = 1474607 }, + { url = "https://files.pythonhosted.org/packages/d9/28/aac26d4c882f14de59041636292bc838db8961373825df23b8eeb807e198/kiwisolver-1.4.9-cp313-cp313-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5656aa670507437af0207645273ccdfee4f14bacd7f7c67a4306d0dcaeaf6eed", size = 1276546 }, + { url = "https://files.pythonhosted.org/packages/8b/ad/8bfc1c93d4cc565e5069162f610ba2f48ff39b7de4b5b8d93f69f30c4bed/kiwisolver-1.4.9-cp313-cp313-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:bfc08add558155345129c7803b3671cf195e6a56e7a12f3dde7c57d9b417f525", size = 1294482 }, + { url = "https://files.pythonhosted.org/packages/da/f1/6aca55ff798901d8ce403206d00e033191f63d82dd708a186e0ed2067e9c/kiwisolver-1.4.9-cp313-cp313-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:40092754720b174e6ccf9e845d0d8c7d8e12c3d71e7fc35f55f3813e96376f78", size = 1343720 }, + { url = "https://files.pythonhosted.org/packages/d1/91/eed031876c595c81d90d0f6fc681ece250e14bf6998c3d7c419466b523b7/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:497d05f29a1300d14e02e6441cf0f5ee81c1ff5a304b0d9fb77423974684e08b", size = 2224907 }, + { url = "https://files.pythonhosted.org/packages/e9/ec/4d1925f2e49617b9cca9c34bfa11adefad49d00db038e692a559454dfb2e/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:bdd1a81a1860476eb41ac4bc1e07b3f07259e6d55bbf739b79c8aaedcf512799", size = 2321334 }, + { url = "https://files.pythonhosted.org/packages/43/cb/450cd4499356f68802750c6ddc18647b8ea01ffa28f50d20598e0befe6e9/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:e6b93f13371d341afee3be9f7c5964e3fe61d5fa30f6a30eb49856935dfe4fc3", size = 2488313 }, + { url = "https://files.pythonhosted.org/packages/71/67/fc76242bd99f885651128a5d4fa6083e5524694b7c88b489b1b55fdc491d/kiwisolver-1.4.9-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:d75aa530ccfaa593da12834b86a0724f58bff12706659baa9227c2ccaa06264c", size = 2291970 }, + { url = "https://files.pythonhosted.org/packages/75/bd/f1a5d894000941739f2ae1b65a32892349423ad49c2e6d0771d0bad3fae4/kiwisolver-1.4.9-cp313-cp313-win_amd64.whl", hash = "sha256:dd0a578400839256df88c16abddf9ba14813ec5f21362e1fe65022e00c883d4d", size = 73894 }, + { url = "https://files.pythonhosted.org/packages/95/38/dce480814d25b99a391abbddadc78f7c117c6da34be68ca8b02d5848b424/kiwisolver-1.4.9-cp313-cp313-win_arm64.whl", hash = "sha256:d4188e73af84ca82468f09cadc5ac4db578109e52acb4518d8154698d3a87ca2", size = 64995 }, + { url = "https://files.pythonhosted.org/packages/e2/37/7d218ce5d92dadc5ebdd9070d903e0c7cf7edfe03f179433ac4d13ce659c/kiwisolver-1.4.9-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:5a0f2724dfd4e3b3ac5a82436a8e6fd16baa7d507117e4279b660fe8ca38a3a1", size = 126510 }, + { url = "https://files.pythonhosted.org/packages/23/b0/e85a2b48233daef4b648fb657ebbb6f8367696a2d9548a00b4ee0eb67803/kiwisolver-1.4.9-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:1b11d6a633e4ed84fc0ddafd4ebfd8ea49b3f25082c04ad12b8315c11d504dc1", size = 67903 }, + { url = "https://files.pythonhosted.org/packages/44/98/f2425bc0113ad7de24da6bb4dae1343476e95e1d738be7c04d31a5d037fd/kiwisolver-1.4.9-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:61874cdb0a36016354853593cffc38e56fc9ca5aa97d2c05d3dcf6922cd55a11", size = 66402 }, + { url = "https://files.pythonhosted.org/packages/98/d8/594657886df9f34c4177cc353cc28ca7e6e5eb562d37ccc233bff43bbe2a/kiwisolver-1.4.9-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:60c439763a969a6af93b4881db0eed8fadf93ee98e18cbc35bc8da868d0c4f0c", size = 1582135 }, + { url = "https://files.pythonhosted.org/packages/5c/c6/38a115b7170f8b306fc929e166340c24958347308ea3012c2b44e7e295db/kiwisolver-1.4.9-cp313-cp313t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:92a2f997387a1b79a75e7803aa7ded2cfbe2823852ccf1ba3bcf613b62ae3197", size = 1389409 }, + { url = "https://files.pythonhosted.org/packages/bf/3b/e04883dace81f24a568bcee6eb3001da4ba05114afa622ec9b6fafdc1f5e/kiwisolver-1.4.9-cp313-cp313t-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a31d512c812daea6d8b3be3b2bfcbeb091dbb09177706569bcfc6240dcf8b41c", size = 1401763 }, + { url = "https://files.pythonhosted.org/packages/9f/80/20ace48e33408947af49d7d15c341eaee69e4e0304aab4b7660e234d6288/kiwisolver-1.4.9-cp313-cp313t-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:52a15b0f35dad39862d376df10c5230155243a2c1a436e39eb55623ccbd68185", size = 1453643 }, + { url = "https://files.pythonhosted.org/packages/64/31/6ce4380a4cd1f515bdda976a1e90e547ccd47b67a1546d63884463c92ca9/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:a30fd6fdef1430fd9e1ba7b3398b5ee4e2887783917a687d86ba69985fb08748", size = 2330818 }, + { url = "https://files.pythonhosted.org/packages/fa/e9/3f3fcba3bcc7432c795b82646306e822f3fd74df0ee81f0fa067a1f95668/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:cc9617b46837c6468197b5945e196ee9ca43057bb7d9d1ae688101e4e1dddf64", size = 2419963 }, + { url = "https://files.pythonhosted.org/packages/99/43/7320c50e4133575c66e9f7dadead35ab22d7c012a3b09bb35647792b2a6d/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:0ab74e19f6a2b027ea4f845a78827969af45ce790e6cb3e1ebab71bdf9f215ff", size = 2594639 }, + { url = "https://files.pythonhosted.org/packages/65/d6/17ae4a270d4a987ef8a385b906d2bdfc9fce502d6dc0d3aea865b47f548c/kiwisolver-1.4.9-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:dba5ee5d3981160c28d5490f0d1b7ed730c22470ff7f6cc26cfcfaacb9896a07", size = 2391741 }, + { url = "https://files.pythonhosted.org/packages/2a/8f/8f6f491d595a9e5912971f3f863d81baddccc8a4d0c3749d6a0dd9ffc9df/kiwisolver-1.4.9-cp313-cp313t-win_arm64.whl", hash = "sha256:0749fd8f4218ad2e851e11cc4dc05c7cbc0cbc4267bdfdb31782e65aace4ee9c", size = 68646 }, + { url = "https://files.pythonhosted.org/packages/6b/32/6cc0fbc9c54d06c2969faa9c1d29f5751a2e51809dd55c69055e62d9b426/kiwisolver-1.4.9-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:9928fe1eb816d11ae170885a74d074f57af3a0d65777ca47e9aeb854a1fba386", size = 123806 }, + { url = "https://files.pythonhosted.org/packages/b2/dd/2bfb1d4a4823d92e8cbb420fe024b8d2167f72079b3bb941207c42570bdf/kiwisolver-1.4.9-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:d0005b053977e7b43388ddec89fa567f43d4f6d5c2c0affe57de5ebf290dc552", size = 66605 }, + { url = "https://files.pythonhosted.org/packages/f7/69/00aafdb4e4509c2ca6064646cba9cd4b37933898f426756adb2cb92ebbed/kiwisolver-1.4.9-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:2635d352d67458b66fd0667c14cb1d4145e9560d503219034a18a87e971ce4f3", size = 64925 }, + { url = "https://files.pythonhosted.org/packages/43/dc/51acc6791aa14e5cb6d8a2e28cefb0dc2886d8862795449d021334c0df20/kiwisolver-1.4.9-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:767c23ad1c58c9e827b649a9ab7809fd5fd9db266a9cf02b0e926ddc2c680d58", size = 1472414 }, + { url = "https://files.pythonhosted.org/packages/3d/bb/93fa64a81db304ac8a246f834d5094fae4b13baf53c839d6bb6e81177129/kiwisolver-1.4.9-cp314-cp314-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:72d0eb9fba308b8311685c2268cf7d0a0639a6cd027d8128659f72bdd8a024b4", size = 1281272 }, + { url = "https://files.pythonhosted.org/packages/70/e6/6df102916960fb8d05069d4bd92d6d9a8202d5a3e2444494e7cd50f65b7a/kiwisolver-1.4.9-cp314-cp314-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f68e4f3eeca8fb22cc3d731f9715a13b652795ef657a13df1ad0c7dc0e9731df", size = 1298578 }, + { url = "https://files.pythonhosted.org/packages/7c/47/e142aaa612f5343736b087864dbaebc53ea8831453fb47e7521fa8658f30/kiwisolver-1.4.9-cp314-cp314-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d84cd4061ae292d8ac367b2c3fa3aad11cb8625a95d135fe93f286f914f3f5a6", size = 1345607 }, + { url = "https://files.pythonhosted.org/packages/54/89/d641a746194a0f4d1a3670fb900d0dbaa786fb98341056814bc3f058fa52/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:a60ea74330b91bd22a29638940d115df9dc00af5035a9a2a6ad9399ffb4ceca5", size = 2230150 }, + { url = "https://files.pythonhosted.org/packages/aa/6b/5ee1207198febdf16ac11f78c5ae40861b809cbe0e6d2a8d5b0b3044b199/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:ce6a3a4e106cf35c2d9c4fa17c05ce0b180db622736845d4315519397a77beaf", size = 2325979 }, + { url = "https://files.pythonhosted.org/packages/fc/ff/b269eefd90f4ae14dcc74973d5a0f6d28d3b9bb1afd8c0340513afe6b39a/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:77937e5e2a38a7b48eef0585114fe7930346993a88060d0bf886086d2aa49ef5", size = 2491456 }, + { url = "https://files.pythonhosted.org/packages/fc/d4/10303190bd4d30de547534601e259a4fbf014eed94aae3e5521129215086/kiwisolver-1.4.9-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:24c175051354f4a28c5d6a31c93906dc653e2bf234e8a4bbfb964892078898ce", size = 2294621 }, + { url = "https://files.pythonhosted.org/packages/28/e0/a9a90416fce5c0be25742729c2ea52105d62eda6c4be4d803c2a7be1fa50/kiwisolver-1.4.9-cp314-cp314-win_amd64.whl", hash = "sha256:0763515d4df10edf6d06a3c19734e2566368980d21ebec439f33f9eb936c07b7", size = 75417 }, + { url = "https://files.pythonhosted.org/packages/1f/10/6949958215b7a9a264299a7db195564e87900f709db9245e4ebdd3c70779/kiwisolver-1.4.9-cp314-cp314-win_arm64.whl", hash = "sha256:0e4e2bf29574a6a7b7f6cb5fa69293b9f96c928949ac4a53ba3f525dffb87f9c", size = 66582 }, + { url = "https://files.pythonhosted.org/packages/ec/79/60e53067903d3bc5469b369fe0dfc6b3482e2133e85dae9daa9527535991/kiwisolver-1.4.9-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:d976bbb382b202f71c67f77b0ac11244021cfa3f7dfd9e562eefcea2df711548", size = 126514 }, + { url = "https://files.pythonhosted.org/packages/25/d1/4843d3e8d46b072c12a38c97c57fab4608d36e13fe47d47ee96b4d61ba6f/kiwisolver-1.4.9-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:2489e4e5d7ef9a1c300a5e0196e43d9c739f066ef23270607d45aba368b91f2d", size = 67905 }, + { url = "https://files.pythonhosted.org/packages/8c/ae/29ffcbd239aea8b93108de1278271ae764dfc0d803a5693914975f200596/kiwisolver-1.4.9-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:e2ea9f7ab7fbf18fffb1b5434ce7c69a07582f7acc7717720f1d69f3e806f90c", size = 66399 }, + { url = "https://files.pythonhosted.org/packages/a1/ae/d7ba902aa604152c2ceba5d352d7b62106bedbccc8e95c3934d94472bfa3/kiwisolver-1.4.9-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:b34e51affded8faee0dfdb705416153819d8ea9250bbbf7ea1b249bdeb5f1122", size = 1582197 }, + { url = "https://files.pythonhosted.org/packages/f2/41/27c70d427eddb8bc7e4f16420a20fefc6f480312122a59a959fdfe0445ad/kiwisolver-1.4.9-cp314-cp314t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d8aacd3d4b33b772542b2e01beb50187536967b514b00003bdda7589722d2a64", size = 1390125 }, + { url = "https://files.pythonhosted.org/packages/41/42/b3799a12bafc76d962ad69083f8b43b12bf4fe78b097b12e105d75c9b8f1/kiwisolver-1.4.9-cp314-cp314t-manylinux_2_24_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:7cf974dd4e35fa315563ac99d6287a1024e4dc2077b8a7d7cd3d2fb65d283134", size = 1402612 }, + { url = "https://files.pythonhosted.org/packages/d2/b5/a210ea073ea1cfaca1bb5c55a62307d8252f531beb364e18aa1e0888b5a0/kiwisolver-1.4.9-cp314-cp314t-manylinux_2_24_s390x.manylinux_2_28_s390x.whl", hash = "sha256:85bd218b5ecfbee8c8a82e121802dcb519a86044c9c3b2e4aef02fa05c6da370", size = 1453990 }, + { url = "https://files.pythonhosted.org/packages/5f/ce/a829eb8c033e977d7ea03ed32fb3c1781b4fa0433fbadfff29e39c676f32/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:0856e241c2d3df4efef7c04a1e46b1936b6120c9bcf36dd216e3acd84bc4fb21", size = 2331601 }, + { url = "https://files.pythonhosted.org/packages/e0/4b/b5e97eb142eb9cd0072dacfcdcd31b1c66dc7352b0f7c7255d339c0edf00/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:9af39d6551f97d31a4deebeac6f45b156f9755ddc59c07b402c148f5dbb6482a", size = 2422041 }, + { url = "https://files.pythonhosted.org/packages/40/be/8eb4cd53e1b85ba4edc3a9321666f12b83113a178845593307a3e7891f44/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:bb4ae2b57fc1d8cbd1cf7b1d9913803681ffa903e7488012be5b76dedf49297f", size = 2594897 }, + { url = "https://files.pythonhosted.org/packages/99/dd/841e9a66c4715477ea0abc78da039832fbb09dac5c35c58dc4c41a407b8a/kiwisolver-1.4.9-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:aedff62918805fb62d43a4aa2ecd4482c380dc76cd31bd7c8878588a61bd0369", size = 2391835 }, + { url = "https://files.pythonhosted.org/packages/0c/28/4b2e5c47a0da96896fdfdb006340ade064afa1e63675d01ea5ac222b6d52/kiwisolver-1.4.9-cp314-cp314t-win_amd64.whl", hash = "sha256:1fa333e8b2ce4d9660f2cda9c0e1b6bafcfb2457a9d259faa82289e73ec24891", size = 79988 }, + { url = "https://files.pythonhosted.org/packages/80/be/3578e8afd18c88cdf9cb4cffde75a96d2be38c5a903f1ed0ceec061bd09e/kiwisolver-1.4.9-cp314-cp314t-win_arm64.whl", hash = "sha256:4a48a2ce79d65d363597ef7b567ce3d14d68783d2b2263d98db3d9477805ba32", size = 70260 }, + { url = "https://files.pythonhosted.org/packages/a3/0f/36d89194b5a32c054ce93e586d4049b6c2c22887b0eb229c61c68afd3078/kiwisolver-1.4.9-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:720e05574713db64c356e86732c0f3c5252818d05f9df320f0ad8380641acea5", size = 60104 }, + { url = "https://files.pythonhosted.org/packages/52/ba/4ed75f59e4658fd21fe7dde1fee0ac397c678ec3befba3fe6482d987af87/kiwisolver-1.4.9-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:17680d737d5335b552994a2008fab4c851bcd7de33094a82067ef3a576ff02fa", size = 58592 }, + { url = "https://files.pythonhosted.org/packages/33/01/a8ea7c5ea32a9b45ceeaee051a04c8ed4320f5add3c51bfa20879b765b70/kiwisolver-1.4.9-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:85b5352f94e490c028926ea567fc569c52ec79ce131dadb968d3853e809518c2", size = 80281 }, + { url = "https://files.pythonhosted.org/packages/da/e3/dbd2ecdce306f1d07a1aaf324817ee993aab7aee9db47ceac757deabafbe/kiwisolver-1.4.9-pp311-pypy311_pp73-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:464415881e4801295659462c49461a24fb107c140de781d55518c4b80cb6790f", size = 78009 }, + { url = "https://files.pythonhosted.org/packages/da/e9/0d4add7873a73e462aeb45c036a2dead2562b825aa46ba326727b3f31016/kiwisolver-1.4.9-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:fb940820c63a9590d31d88b815e7a3aa5915cad3ce735ab45f0c730b39547de1", size = 73929 }, ] [[package]] name = "lark" version = "1.3.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/da/34/28fff3ab31ccff1fd4f6c7c7b0ceb2b6968d8ea4950663eadcb5720591a0/lark-1.3.1.tar.gz", hash = "sha256:b426a7a6d6d53189d318f2b6236ab5d6429eaf09259f1ca33eb716eed10d2905", size = 382732, upload-time = "2025-10-27T18:25:56.653Z" } +sdist = { url = "https://files.pythonhosted.org/packages/da/34/28fff3ab31ccff1fd4f6c7c7b0ceb2b6968d8ea4950663eadcb5720591a0/lark-1.3.1.tar.gz", hash = "sha256:b426a7a6d6d53189d318f2b6236ab5d6429eaf09259f1ca33eb716eed10d2905", size = 382732 } wheels = [ - { url = "https://files.pythonhosted.org/packages/82/3d/14ce75ef66813643812f3093ab17e46d3a206942ce7376d31ec2d36229e7/lark-1.3.1-py3-none-any.whl", hash = "sha256:c629b661023a014c37da873b4ff58a817398d12635d3bbb2c5a03be7fe5d1e12", size = 113151, upload-time = "2025-10-27T18:25:54.882Z" }, + { url = "https://files.pythonhosted.org/packages/82/3d/14ce75ef66813643812f3093ab17e46d3a206942ce7376d31ec2d36229e7/lark-1.3.1-py3-none-any.whl", hash = "sha256:c629b661023a014c37da873b4ff58a817398d12635d3bbb2c5a03be7fe5d1e12", size = 113151 }, ] [[package]] name = "line-profiler" version = "5.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ea/5c/bbe9042ef5cf4c6cad4bf4d6f7975193430eba9191b7278ea114a3993fbb/line_profiler-5.0.0.tar.gz", hash = "sha256:a80f0afb05ba0d275d9dddc5ff97eab637471167ff3e66dcc7d135755059398c", size = 376919, upload-time = "2025-07-23T20:15:41.819Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/ef/f7/4e0fd2610749136d60f3e168812b5f6c697ffcfbb167b10d4aac24af1223/line_profiler-5.0.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:f32d536c056393b7ca703e459632edc327ff9e0fc320c7b0e0ed14b84d342b7f", size = 634587, upload-time = "2025-07-23T20:14:39.069Z" }, - { url = "https://files.pythonhosted.org/packages/d7/fe/b5458452c2dbf7a9590b5ad3cf4250710a2554a5a045bfa6395cdea1b2d5/line_profiler-5.0.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:a7da04ffc5a0a1f6653f43b13ad2e7ebf66f1d757174b7e660dfa0cbe74c4fc6", size = 492744, upload-time = "2025-07-23T20:14:40.632Z" }, - { url = "https://files.pythonhosted.org/packages/4c/e1/b69e20aeea8a11340f8c5d540c88ecf955a3559d8fbd5034cfe5677c69cf/line_profiler-5.0.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:d2746f6b13c19ca4847efd500402d53a5ebb2fe31644ce8af74fbeac5ea4c54c", size = 478101, upload-time = "2025-07-23T20:14:42.306Z" }, - { url = "https://files.pythonhosted.org/packages/0d/3b/b29e5539b2c98d2bd9f5651f10597dd70e07d5b09bb47cc0aa8d48927d72/line_profiler-5.0.0-cp311-cp311-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:7b4290319a59730c04cbd03755472d10524130065a20a695dc10dd66ffd92172", size = 1455927, upload-time = "2025-07-23T20:14:44.139Z" }, - { url = "https://files.pythonhosted.org/packages/82/1d/dcc75d2cf82bbe6ef65d0f39cc32410e099e7e1cd7f85b121a8d440ce8bc/line_profiler-5.0.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:7cd168a8af0032e8e3cb2fbb9ffc7694cdcecd47ec356ae863134df07becb3a2", size = 1508770, upload-time = "2025-07-23T20:14:45.868Z" }, - { url = "https://files.pythonhosted.org/packages/cc/9f/cbf9d011381c878f848f824190ad833fbfeb5426eb6c42811b5b759d5d54/line_profiler-5.0.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:cbe7b095865d00dda0f53d7d4556c2b1b5d13f723173a85edb206a78779ee07a", size = 2551269, upload-time = "2025-07-23T20:14:47.279Z" }, - { url = "https://files.pythonhosted.org/packages/7c/86/06999bff316e2522fc1d11fcd3720be81a7c47e94c785a9d93c290ae0415/line_profiler-5.0.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:ff176045ea8a9e33900856db31b0b979357c337862ae4837140c98bd3161c3c7", size = 2491091, upload-time = "2025-07-23T20:14:48.637Z" }, - { url = "https://files.pythonhosted.org/packages/61/d1/758f2f569b5d4fdc667b88e88e7424081ba3a1d17fb531042ed7f0f08d7f/line_profiler-5.0.0-cp311-cp311-win_amd64.whl", hash = "sha256:474e0962d02123f1190a804073b308a67ef5f9c3b8379184483d5016844a00df", size = 462954, upload-time = "2025-07-23T20:14:50.094Z" }, - { url = "https://files.pythonhosted.org/packages/73/d8/383c37c36f888c4ca82a28ffea27c589988463fc3f0edd6abae221c35275/line_profiler-5.0.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:729b18c0ac66b3368ade61203459219c202609f76b34190cbb2508b8e13998c8", size = 628109, upload-time = "2025-07-23T20:14:51.71Z" }, - { url = "https://files.pythonhosted.org/packages/54/a3/75a27b1f3e14ae63a2e99f3c7014dbc1e3a37f56c91b63a2fc171e72990d/line_profiler-5.0.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:438ed24278c428119473b61a473c8fe468ace7c97c94b005cb001137bc624547", size = 489142, upload-time = "2025-07-23T20:14:52.993Z" }, - { url = "https://files.pythonhosted.org/packages/8b/85/f65cdbfe8537da6fab97c42958109858df846563546b9c234a902a98c313/line_profiler-5.0.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:920b0076dca726caadbf29f0bfcce0cbcb4d9ff034cd9445a7308f9d556b4b3a", size = 475838, upload-time = "2025-07-23T20:14:54.637Z" }, - { url = "https://files.pythonhosted.org/packages/0c/ea/cfa53c8ede0ef539cfe767a390d7ccfc015f89c39cc2a8c34e77753fd023/line_profiler-5.0.0-cp312-cp312-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:53326eaad2d807487dcd45d2e385feaaed81aaf72b9ecd4f53c1a225d658006f", size = 1402290, upload-time = "2025-07-23T20:14:56.775Z" }, - { url = "https://files.pythonhosted.org/packages/e4/2c/3467cd5051afbc0eb277ee426e8dffdbd1fcdd82f1bc95a0cd8945b6c106/line_profiler-5.0.0-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0e3995a989cdea022f0ede5db19a6ab527f818c59ffcebf4e5f7a8be4eb8e880", size = 1457827, upload-time = "2025-07-23T20:14:58.158Z" }, - { url = "https://files.pythonhosted.org/packages/d9/87/d5039608979b37ce3dadfa3eed7bf8bfec53b645acd30ca12c8088cf738d/line_profiler-5.0.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:8bf57892a1d3a42273652506746ba9f620c505773ada804367c42e5b4146d6b6", size = 2497423, upload-time = "2025-07-23T20:15:01.015Z" }, - { url = "https://files.pythonhosted.org/packages/59/3e/e5e09699e2841b4f41c16d01ff2adfd20fde6cb73cfa512262f0421e15e0/line_profiler-5.0.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:43672085f149f5fbf3f08bba072ad7014dd485282e8665827b26941ea97d2d76", size = 2439733, upload-time = "2025-07-23T20:15:02.582Z" }, - { url = "https://files.pythonhosted.org/packages/d0/cf/18d8fefabd8a56fb963f944149cadb69be67a479ce6723275cae2c943af5/line_profiler-5.0.0-cp312-cp312-win_amd64.whl", hash = "sha256:446bd4f04e4bd9e979d68fdd916103df89a9d419e25bfb92b31af13c33808ee0", size = 460852, upload-time = "2025-07-23T20:15:03.827Z" }, - { url = "https://files.pythonhosted.org/packages/7d/eb/bc4420cf68661406c98d590656d72eed6f7d76e45accf568802dc83615ef/line_profiler-5.0.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:9873fabbae1587778a551176758a70a5f6c89d8d070a1aca7a689677d41a1348", size = 624828, upload-time = "2025-07-23T20:15:05.315Z" }, - { url = "https://files.pythonhosted.org/packages/f2/6e/6e0a4c1009975d27810027427d601acbad75b45947040d0fd80cec5b3e94/line_profiler-5.0.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:2cd6cdb5a4d3b4ced607104dbed73ec820a69018decd1a90904854380536ed32", size = 487651, upload-time = "2025-07-23T20:15:06.961Z" }, - { url = "https://files.pythonhosted.org/packages/3b/2c/e60e61f24faa0e6eca375bdac9c4b4b37c3267488d7cb1a8c5bd74cf5cdc/line_profiler-5.0.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:34d6172a3bd14167b3ea2e629d71b08683b17b3bc6eb6a4936d74e3669f875b6", size = 474071, upload-time = "2025-07-23T20:15:08.607Z" }, - { url = "https://files.pythonhosted.org/packages/e1/d5/6f178e74746f84cc17381f607d191c54772207770d585fda773b868bfe28/line_profiler-5.0.0-cp313-cp313-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e5edd859be322aa8252253e940ac1c60cca4c385760d90a402072f8f35e4b967", size = 1405434, upload-time = "2025-07-23T20:15:09.862Z" }, - { url = "https://files.pythonhosted.org/packages/9b/32/ce67bbf81e5c78cc8d606afe6a192fbef30395021b2aaffe15681e186e3f/line_profiler-5.0.0-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5d4f97b223105eed6e525994f5653061bd981e04838ee5d14e01d17c26185094", size = 1467553, upload-time = "2025-07-23T20:15:11.195Z" }, - { url = "https://files.pythonhosted.org/packages/c1/c1/431ffb89a351aaa63f8358442e0b9456a3bb745cebdf9c0d7aa4d47affca/line_profiler-5.0.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:4758007e491bee3be40ebcca460596e0e28e7f39b735264694a9cafec729dfa9", size = 2442489, upload-time = "2025-07-23T20:15:12.602Z" }, - { url = "https://files.pythonhosted.org/packages/ce/9d/e34cc99c8abca3a27911d3542a87361e9c292fa1258d182e4a0a5c442850/line_profiler-5.0.0-cp313-cp313-win_amd64.whl", hash = "sha256:213b19c4b65942db5d477e603c18c76126e3811a39d8bab251d930d8ce82ffba", size = 461377, upload-time = "2025-07-23T20:15:13.871Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/ea/5c/bbe9042ef5cf4c6cad4bf4d6f7975193430eba9191b7278ea114a3993fbb/line_profiler-5.0.0.tar.gz", hash = "sha256:a80f0afb05ba0d275d9dddc5ff97eab637471167ff3e66dcc7d135755059398c", size = 376919 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ef/f7/4e0fd2610749136d60f3e168812b5f6c697ffcfbb167b10d4aac24af1223/line_profiler-5.0.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:f32d536c056393b7ca703e459632edc327ff9e0fc320c7b0e0ed14b84d342b7f", size = 634587 }, + { url = "https://files.pythonhosted.org/packages/d7/fe/b5458452c2dbf7a9590b5ad3cf4250710a2554a5a045bfa6395cdea1b2d5/line_profiler-5.0.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:a7da04ffc5a0a1f6653f43b13ad2e7ebf66f1d757174b7e660dfa0cbe74c4fc6", size = 492744 }, + { url = "https://files.pythonhosted.org/packages/4c/e1/b69e20aeea8a11340f8c5d540c88ecf955a3559d8fbd5034cfe5677c69cf/line_profiler-5.0.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:d2746f6b13c19ca4847efd500402d53a5ebb2fe31644ce8af74fbeac5ea4c54c", size = 478101 }, + { url = "https://files.pythonhosted.org/packages/0d/3b/b29e5539b2c98d2bd9f5651f10597dd70e07d5b09bb47cc0aa8d48927d72/line_profiler-5.0.0-cp311-cp311-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:7b4290319a59730c04cbd03755472d10524130065a20a695dc10dd66ffd92172", size = 1455927 }, + { url = "https://files.pythonhosted.org/packages/82/1d/dcc75d2cf82bbe6ef65d0f39cc32410e099e7e1cd7f85b121a8d440ce8bc/line_profiler-5.0.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:7cd168a8af0032e8e3cb2fbb9ffc7694cdcecd47ec356ae863134df07becb3a2", size = 1508770 }, + { url = "https://files.pythonhosted.org/packages/cc/9f/cbf9d011381c878f848f824190ad833fbfeb5426eb6c42811b5b759d5d54/line_profiler-5.0.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:cbe7b095865d00dda0f53d7d4556c2b1b5d13f723173a85edb206a78779ee07a", size = 2551269 }, + { url = "https://files.pythonhosted.org/packages/7c/86/06999bff316e2522fc1d11fcd3720be81a7c47e94c785a9d93c290ae0415/line_profiler-5.0.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:ff176045ea8a9e33900856db31b0b979357c337862ae4837140c98bd3161c3c7", size = 2491091 }, + { url = "https://files.pythonhosted.org/packages/61/d1/758f2f569b5d4fdc667b88e88e7424081ba3a1d17fb531042ed7f0f08d7f/line_profiler-5.0.0-cp311-cp311-win_amd64.whl", hash = "sha256:474e0962d02123f1190a804073b308a67ef5f9c3b8379184483d5016844a00df", size = 462954 }, + { url = "https://files.pythonhosted.org/packages/73/d8/383c37c36f888c4ca82a28ffea27c589988463fc3f0edd6abae221c35275/line_profiler-5.0.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:729b18c0ac66b3368ade61203459219c202609f76b34190cbb2508b8e13998c8", size = 628109 }, + { url = "https://files.pythonhosted.org/packages/54/a3/75a27b1f3e14ae63a2e99f3c7014dbc1e3a37f56c91b63a2fc171e72990d/line_profiler-5.0.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:438ed24278c428119473b61a473c8fe468ace7c97c94b005cb001137bc624547", size = 489142 }, + { url = "https://files.pythonhosted.org/packages/8b/85/f65cdbfe8537da6fab97c42958109858df846563546b9c234a902a98c313/line_profiler-5.0.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:920b0076dca726caadbf29f0bfcce0cbcb4d9ff034cd9445a7308f9d556b4b3a", size = 475838 }, + { url = "https://files.pythonhosted.org/packages/0c/ea/cfa53c8ede0ef539cfe767a390d7ccfc015f89c39cc2a8c34e77753fd023/line_profiler-5.0.0-cp312-cp312-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:53326eaad2d807487dcd45d2e385feaaed81aaf72b9ecd4f53c1a225d658006f", size = 1402290 }, + { url = "https://files.pythonhosted.org/packages/e4/2c/3467cd5051afbc0eb277ee426e8dffdbd1fcdd82f1bc95a0cd8945b6c106/line_profiler-5.0.0-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0e3995a989cdea022f0ede5db19a6ab527f818c59ffcebf4e5f7a8be4eb8e880", size = 1457827 }, + { url = "https://files.pythonhosted.org/packages/d9/87/d5039608979b37ce3dadfa3eed7bf8bfec53b645acd30ca12c8088cf738d/line_profiler-5.0.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:8bf57892a1d3a42273652506746ba9f620c505773ada804367c42e5b4146d6b6", size = 2497423 }, + { url = "https://files.pythonhosted.org/packages/59/3e/e5e09699e2841b4f41c16d01ff2adfd20fde6cb73cfa512262f0421e15e0/line_profiler-5.0.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:43672085f149f5fbf3f08bba072ad7014dd485282e8665827b26941ea97d2d76", size = 2439733 }, + { url = "https://files.pythonhosted.org/packages/d0/cf/18d8fefabd8a56fb963f944149cadb69be67a479ce6723275cae2c943af5/line_profiler-5.0.0-cp312-cp312-win_amd64.whl", hash = "sha256:446bd4f04e4bd9e979d68fdd916103df89a9d419e25bfb92b31af13c33808ee0", size = 460852 }, + { url = "https://files.pythonhosted.org/packages/7d/eb/bc4420cf68661406c98d590656d72eed6f7d76e45accf568802dc83615ef/line_profiler-5.0.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:9873fabbae1587778a551176758a70a5f6c89d8d070a1aca7a689677d41a1348", size = 624828 }, + { url = "https://files.pythonhosted.org/packages/f2/6e/6e0a4c1009975d27810027427d601acbad75b45947040d0fd80cec5b3e94/line_profiler-5.0.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:2cd6cdb5a4d3b4ced607104dbed73ec820a69018decd1a90904854380536ed32", size = 487651 }, + { url = "https://files.pythonhosted.org/packages/3b/2c/e60e61f24faa0e6eca375bdac9c4b4b37c3267488d7cb1a8c5bd74cf5cdc/line_profiler-5.0.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:34d6172a3bd14167b3ea2e629d71b08683b17b3bc6eb6a4936d74e3669f875b6", size = 474071 }, + { url = "https://files.pythonhosted.org/packages/e1/d5/6f178e74746f84cc17381f607d191c54772207770d585fda773b868bfe28/line_profiler-5.0.0-cp313-cp313-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e5edd859be322aa8252253e940ac1c60cca4c385760d90a402072f8f35e4b967", size = 1405434 }, + { url = "https://files.pythonhosted.org/packages/9b/32/ce67bbf81e5c78cc8d606afe6a192fbef30395021b2aaffe15681e186e3f/line_profiler-5.0.0-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5d4f97b223105eed6e525994f5653061bd981e04838ee5d14e01d17c26185094", size = 1467553 }, + { url = "https://files.pythonhosted.org/packages/c1/c1/431ffb89a351aaa63f8358442e0b9456a3bb745cebdf9c0d7aa4d47affca/line_profiler-5.0.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:4758007e491bee3be40ebcca460596e0e28e7f39b735264694a9cafec729dfa9", size = 2442489 }, + { url = "https://files.pythonhosted.org/packages/ce/9d/e34cc99c8abca3a27911d3542a87361e9c292fa1258d182e4a0a5c442850/line_profiler-5.0.0-cp313-cp313-win_amd64.whl", hash = "sha256:213b19c4b65942db5d477e603c18c76126e3811a39d8bab251d930d8ce82ffba", size = 461377 }, ] [[package]] name = "llvmlite" version = "0.45.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/99/8d/5baf1cef7f9c084fb35a8afbde88074f0d6a727bc63ef764fe0e7543ba40/llvmlite-0.45.1.tar.gz", hash = "sha256:09430bb9d0bb58fc45a45a57c7eae912850bedc095cd0810a57de109c69e1c32", size = 185600, upload-time = "2025-10-01T17:59:52.046Z" } +sdist = { url = "https://files.pythonhosted.org/packages/99/8d/5baf1cef7f9c084fb35a8afbde88074f0d6a727bc63ef764fe0e7543ba40/llvmlite-0.45.1.tar.gz", hash = "sha256:09430bb9d0bb58fc45a45a57c7eae912850bedc095cd0810a57de109c69e1c32", size = 185600 } wheels = [ - { url = "https://files.pythonhosted.org/packages/04/ad/9bdc87b2eb34642c1cfe6bcb4f5db64c21f91f26b010f263e7467e7536a3/llvmlite-0.45.1-cp311-cp311-macosx_10_15_x86_64.whl", hash = "sha256:60f92868d5d3af30b4239b50e1717cb4e4e54f6ac1c361a27903b318d0f07f42", size = 43043526, upload-time = "2025-10-01T18:03:15.051Z" }, - { url = "https://files.pythonhosted.org/packages/a5/ea/c25c6382f452a943b4082da5e8c1665ce29a62884e2ec80608533e8e82d5/llvmlite-0.45.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:98baab513e19beb210f1ef39066288784839a44cd504e24fff5d17f1b3cf0860", size = 37253118, upload-time = "2025-10-01T18:04:06.783Z" }, - { url = "https://files.pythonhosted.org/packages/fe/af/85fc237de98b181dbbe8647324331238d6c52a3554327ccdc83ced28efba/llvmlite-0.45.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:3adc2355694d6a6fbcc024d59bb756677e7de506037c878022d7b877e7613a36", size = 56288209, upload-time = "2025-10-01T18:01:00.168Z" }, - { url = "https://files.pythonhosted.org/packages/0a/df/3daf95302ff49beff4230065e3178cd40e71294968e8d55baf4a9e560814/llvmlite-0.45.1-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2f3377a6db40f563058c9515dedcc8a3e562d8693a106a28f2ddccf2c8fcf6ca", size = 55140958, upload-time = "2025-10-01T18:02:11.199Z" }, - { url = "https://files.pythonhosted.org/packages/a4/56/4c0d503fe03bac820ecdeb14590cf9a248e120f483bcd5c009f2534f23f0/llvmlite-0.45.1-cp311-cp311-win_amd64.whl", hash = "sha256:f9c272682d91e0d57f2a76c6d9ebdfccc603a01828cdbe3d15273bdca0c3363a", size = 38132232, upload-time = "2025-10-01T18:04:52.181Z" }, - { url = "https://files.pythonhosted.org/packages/e2/7c/82cbd5c656e8991bcc110c69d05913be2229302a92acb96109e166ae31fb/llvmlite-0.45.1-cp312-cp312-macosx_10_15_x86_64.whl", hash = "sha256:28e763aba92fe9c72296911e040231d486447c01d4f90027c8e893d89d49b20e", size = 43043524, upload-time = "2025-10-01T18:03:30.666Z" }, - { url = "https://files.pythonhosted.org/packages/9d/bc/5314005bb2c7ee9f33102c6456c18cc81745d7055155d1218f1624463774/llvmlite-0.45.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:1a53f4b74ee9fd30cb3d27d904dadece67a7575198bd80e687ee76474620735f", size = 37253123, upload-time = "2025-10-01T18:04:18.177Z" }, - { url = "https://files.pythonhosted.org/packages/96/76/0f7154952f037cb320b83e1c952ec4a19d5d689cf7d27cb8a26887d7bbc1/llvmlite-0.45.1-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:5b3796b1b1e1c14dcae34285d2f4ea488402fbd2c400ccf7137603ca3800864f", size = 56288211, upload-time = "2025-10-01T18:01:24.079Z" }, - { url = "https://files.pythonhosted.org/packages/00/b1/0b581942be2683ceb6862d558979e87387e14ad65a1e4db0e7dd671fa315/llvmlite-0.45.1-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:779e2f2ceefef0f4368548685f0b4adde34e5f4b457e90391f570a10b348d433", size = 55140958, upload-time = "2025-10-01T18:02:30.482Z" }, - { url = "https://files.pythonhosted.org/packages/33/94/9ba4ebcf4d541a325fd8098ddc073b663af75cc8b065b6059848f7d4dce7/llvmlite-0.45.1-cp312-cp312-win_amd64.whl", hash = "sha256:9e6c9949baf25d9aa9cd7cf0f6d011b9ca660dd17f5ba2b23bdbdb77cc86b116", size = 38132231, upload-time = "2025-10-01T18:05:03.664Z" }, - { url = "https://files.pythonhosted.org/packages/1d/e2/c185bb7e88514d5025f93c6c4092f6120c6cea8fe938974ec9860fb03bbb/llvmlite-0.45.1-cp313-cp313-macosx_10_15_x86_64.whl", hash = "sha256:d9ea9e6f17569a4253515cc01dade70aba536476e3d750b2e18d81d7e670eb15", size = 43043524, upload-time = "2025-10-01T18:03:43.249Z" }, - { url = "https://files.pythonhosted.org/packages/09/b8/b5437b9ecb2064e89ccf67dccae0d02cd38911705112dd0dcbfa9cd9a9de/llvmlite-0.45.1-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:c9f3cadee1630ce4ac18ea38adebf2a4f57a89bd2740ce83746876797f6e0bfb", size = 37253121, upload-time = "2025-10-01T18:04:30.557Z" }, - { url = "https://files.pythonhosted.org/packages/f7/97/ad1a907c0173a90dd4df7228f24a3ec61058bc1a9ff8a0caec20a0cc622e/llvmlite-0.45.1-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:57c48bf2e1083eedbc9406fb83c4e6483017879714916fe8be8a72a9672c995a", size = 56288210, upload-time = "2025-10-01T18:01:40.26Z" }, - { url = "https://files.pythonhosted.org/packages/32/d8/c99c8ac7a326e9735401ead3116f7685a7ec652691aeb2615aa732b1fc4a/llvmlite-0.45.1-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3aa3dfceda4219ae39cf18806c60eeb518c1680ff834b8b311bd784160b9ce40", size = 55140957, upload-time = "2025-10-01T18:02:46.244Z" }, - { url = "https://files.pythonhosted.org/packages/09/56/ed35668130e32dbfad2eb37356793b0a95f23494ab5be7d9bf5cb75850ee/llvmlite-0.45.1-cp313-cp313-win_amd64.whl", hash = "sha256:080e6f8d0778a8239cd47686d402cb66eb165e421efa9391366a9b7e5810a38b", size = 38132232, upload-time = "2025-10-01T18:05:14.477Z" }, + { url = "https://files.pythonhosted.org/packages/04/ad/9bdc87b2eb34642c1cfe6bcb4f5db64c21f91f26b010f263e7467e7536a3/llvmlite-0.45.1-cp311-cp311-macosx_10_15_x86_64.whl", hash = "sha256:60f92868d5d3af30b4239b50e1717cb4e4e54f6ac1c361a27903b318d0f07f42", size = 43043526 }, + { url = "https://files.pythonhosted.org/packages/a5/ea/c25c6382f452a943b4082da5e8c1665ce29a62884e2ec80608533e8e82d5/llvmlite-0.45.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:98baab513e19beb210f1ef39066288784839a44cd504e24fff5d17f1b3cf0860", size = 37253118 }, + { url = "https://files.pythonhosted.org/packages/fe/af/85fc237de98b181dbbe8647324331238d6c52a3554327ccdc83ced28efba/llvmlite-0.45.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:3adc2355694d6a6fbcc024d59bb756677e7de506037c878022d7b877e7613a36", size = 56288209 }, + { url = "https://files.pythonhosted.org/packages/0a/df/3daf95302ff49beff4230065e3178cd40e71294968e8d55baf4a9e560814/llvmlite-0.45.1-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2f3377a6db40f563058c9515dedcc8a3e562d8693a106a28f2ddccf2c8fcf6ca", size = 55140958 }, + { url = "https://files.pythonhosted.org/packages/a4/56/4c0d503fe03bac820ecdeb14590cf9a248e120f483bcd5c009f2534f23f0/llvmlite-0.45.1-cp311-cp311-win_amd64.whl", hash = "sha256:f9c272682d91e0d57f2a76c6d9ebdfccc603a01828cdbe3d15273bdca0c3363a", size = 38132232 }, + { url = "https://files.pythonhosted.org/packages/e2/7c/82cbd5c656e8991bcc110c69d05913be2229302a92acb96109e166ae31fb/llvmlite-0.45.1-cp312-cp312-macosx_10_15_x86_64.whl", hash = "sha256:28e763aba92fe9c72296911e040231d486447c01d4f90027c8e893d89d49b20e", size = 43043524 }, + { url = "https://files.pythonhosted.org/packages/9d/bc/5314005bb2c7ee9f33102c6456c18cc81745d7055155d1218f1624463774/llvmlite-0.45.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:1a53f4b74ee9fd30cb3d27d904dadece67a7575198bd80e687ee76474620735f", size = 37253123 }, + { url = "https://files.pythonhosted.org/packages/96/76/0f7154952f037cb320b83e1c952ec4a19d5d689cf7d27cb8a26887d7bbc1/llvmlite-0.45.1-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:5b3796b1b1e1c14dcae34285d2f4ea488402fbd2c400ccf7137603ca3800864f", size = 56288211 }, + { url = "https://files.pythonhosted.org/packages/00/b1/0b581942be2683ceb6862d558979e87387e14ad65a1e4db0e7dd671fa315/llvmlite-0.45.1-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:779e2f2ceefef0f4368548685f0b4adde34e5f4b457e90391f570a10b348d433", size = 55140958 }, + { url = "https://files.pythonhosted.org/packages/33/94/9ba4ebcf4d541a325fd8098ddc073b663af75cc8b065b6059848f7d4dce7/llvmlite-0.45.1-cp312-cp312-win_amd64.whl", hash = "sha256:9e6c9949baf25d9aa9cd7cf0f6d011b9ca660dd17f5ba2b23bdbdb77cc86b116", size = 38132231 }, + { url = "https://files.pythonhosted.org/packages/1d/e2/c185bb7e88514d5025f93c6c4092f6120c6cea8fe938974ec9860fb03bbb/llvmlite-0.45.1-cp313-cp313-macosx_10_15_x86_64.whl", hash = "sha256:d9ea9e6f17569a4253515cc01dade70aba536476e3d750b2e18d81d7e670eb15", size = 43043524 }, + { url = "https://files.pythonhosted.org/packages/09/b8/b5437b9ecb2064e89ccf67dccae0d02cd38911705112dd0dcbfa9cd9a9de/llvmlite-0.45.1-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:c9f3cadee1630ce4ac18ea38adebf2a4f57a89bd2740ce83746876797f6e0bfb", size = 37253121 }, + { url = "https://files.pythonhosted.org/packages/f7/97/ad1a907c0173a90dd4df7228f24a3ec61058bc1a9ff8a0caec20a0cc622e/llvmlite-0.45.1-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:57c48bf2e1083eedbc9406fb83c4e6483017879714916fe8be8a72a9672c995a", size = 56288210 }, + { url = "https://files.pythonhosted.org/packages/32/d8/c99c8ac7a326e9735401ead3116f7685a7ec652691aeb2615aa732b1fc4a/llvmlite-0.45.1-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3aa3dfceda4219ae39cf18806c60eeb518c1680ff834b8b311bd784160b9ce40", size = 55140957 }, + { url = "https://files.pythonhosted.org/packages/09/56/ed35668130e32dbfad2eb37356793b0a95f23494ab5be7d9bf5cb75850ee/llvmlite-0.45.1-cp313-cp313-win_amd64.whl", hash = "sha256:080e6f8d0778a8239cd47686d402cb66eb165e421efa9391366a9b7e5810a38b", size = 38132232 }, ] [[package]] name = "lxml" version = "6.0.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/aa/88/262177de60548e5a2bfc46ad28232c9e9cbde697bd94132aeb80364675cb/lxml-6.0.2.tar.gz", hash = "sha256:cd79f3367bd74b317dda655dc8fcfa304d9eb6e4fb06b7168c5cf27f96e0cd62", size = 4073426, upload-time = "2025-09-22T04:04:59.287Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/77/d5/becbe1e2569b474a23f0c672ead8a29ac50b2dc1d5b9de184831bda8d14c/lxml-6.0.2-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:13e35cbc684aadf05d8711a5d1b5857c92e5e580efa9a0d2be197199c8def607", size = 8634365, upload-time = "2025-09-22T04:00:45.672Z" }, - { url = "https://files.pythonhosted.org/packages/28/66/1ced58f12e804644426b85d0bb8a4478ca77bc1761455da310505f1a3526/lxml-6.0.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:3b1675e096e17c6fe9c0e8c81434f5736c0739ff9ac6123c87c2d452f48fc938", size = 4650793, upload-time = "2025-09-22T04:00:47.783Z" }, - { url = "https://files.pythonhosted.org/packages/11/84/549098ffea39dfd167e3f174b4ce983d0eed61f9d8d25b7bf2a57c3247fc/lxml-6.0.2-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:8ac6e5811ae2870953390452e3476694196f98d447573234592d30488147404d", size = 4944362, upload-time = "2025-09-22T04:00:49.845Z" }, - { url = "https://files.pythonhosted.org/packages/ac/bd/f207f16abf9749d2037453d56b643a7471d8fde855a231a12d1e095c4f01/lxml-6.0.2-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:5aa0fc67ae19d7a64c3fe725dc9a1bb11f80e01f78289d05c6f62545affec438", size = 5083152, upload-time = "2025-09-22T04:00:51.709Z" }, - { url = "https://files.pythonhosted.org/packages/15/ae/bd813e87d8941d52ad5b65071b1affb48da01c4ed3c9c99e40abb266fbff/lxml-6.0.2-cp311-cp311-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:de496365750cc472b4e7902a485d3f152ecf57bd3ba03ddd5578ed8ceb4c5964", size = 5023539, upload-time = "2025-09-22T04:00:53.593Z" }, - { url = "https://files.pythonhosted.org/packages/02/cd/9bfef16bd1d874fbe0cb51afb00329540f30a3283beb9f0780adbb7eec03/lxml-6.0.2-cp311-cp311-manylinux_2_26_i686.manylinux_2_28_i686.whl", hash = "sha256:200069a593c5e40b8f6fc0d84d86d970ba43138c3e68619ffa234bc9bb806a4d", size = 5344853, upload-time = "2025-09-22T04:00:55.524Z" }, - { url = "https://files.pythonhosted.org/packages/b8/89/ea8f91594bc5dbb879734d35a6f2b0ad50605d7fb419de2b63d4211765cc/lxml-6.0.2-cp311-cp311-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:7d2de809c2ee3b888b59f995625385f74629707c9355e0ff856445cdcae682b7", size = 5225133, upload-time = "2025-09-22T04:00:57.269Z" }, - { url = "https://files.pythonhosted.org/packages/b9/37/9c735274f5dbec726b2db99b98a43950395ba3d4a1043083dba2ad814170/lxml-6.0.2-cp311-cp311-manylinux_2_31_armv7l.whl", hash = "sha256:b2c3da8d93cf5db60e8858c17684c47d01fee6405e554fb55018dd85fc23b178", size = 4677944, upload-time = "2025-09-22T04:00:59.052Z" }, - { url = "https://files.pythonhosted.org/packages/20/28/7dfe1ba3475d8bfca3878365075abe002e05d40dfaaeb7ec01b4c587d533/lxml-6.0.2-cp311-cp311-manylinux_2_38_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:442de7530296ef5e188373a1ea5789a46ce90c4847e597856570439621d9c553", size = 5284535, upload-time = "2025-09-22T04:01:01.335Z" }, - { url = "https://files.pythonhosted.org/packages/e7/cf/5f14bc0de763498fc29510e3532bf2b4b3a1c1d5d0dff2e900c16ba021ef/lxml-6.0.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:2593c77efde7bfea7f6389f1ab249b15ed4aa5bc5cb5131faa3b843c429fbedb", size = 5067343, upload-time = "2025-09-22T04:01:03.13Z" }, - { url = "https://files.pythonhosted.org/packages/1c/b0/bb8275ab5472f32b28cfbbcc6db7c9d092482d3439ca279d8d6fa02f7025/lxml-6.0.2-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:3e3cb08855967a20f553ff32d147e14329b3ae70ced6edc2f282b94afbc74b2a", size = 4725419, upload-time = "2025-09-22T04:01:05.013Z" }, - { url = "https://files.pythonhosted.org/packages/25/4c/7c222753bc72edca3b99dbadba1b064209bc8ed4ad448af990e60dcce462/lxml-6.0.2-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:2ed6c667fcbb8c19c6791bbf40b7268ef8ddf5a96940ba9404b9f9a304832f6c", size = 5275008, upload-time = "2025-09-22T04:01:07.327Z" }, - { url = "https://files.pythonhosted.org/packages/6c/8c/478a0dc6b6ed661451379447cdbec77c05741a75736d97e5b2b729687828/lxml-6.0.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:b8f18914faec94132e5b91e69d76a5c1d7b0c73e2489ea8929c4aaa10b76bbf7", size = 5248906, upload-time = "2025-09-22T04:01:09.452Z" }, - { url = "https://files.pythonhosted.org/packages/2d/d9/5be3a6ab2784cdf9accb0703b65e1b64fcdd9311c9f007630c7db0cfcce1/lxml-6.0.2-cp311-cp311-win32.whl", hash = "sha256:6605c604e6daa9e0d7f0a2137bdc47a2e93b59c60a65466353e37f8272f47c46", size = 3610357, upload-time = "2025-09-22T04:01:11.102Z" }, - { url = "https://files.pythonhosted.org/packages/e2/7d/ca6fb13349b473d5732fb0ee3eec8f6c80fc0688e76b7d79c1008481bf1f/lxml-6.0.2-cp311-cp311-win_amd64.whl", hash = "sha256:e5867f2651016a3afd8dd2c8238baa66f1e2802f44bc17e236f547ace6647078", size = 4036583, upload-time = "2025-09-22T04:01:12.766Z" }, - { url = "https://files.pythonhosted.org/packages/ab/a2/51363b5ecd3eab46563645f3a2c3836a2fc67d01a1b87c5017040f39f567/lxml-6.0.2-cp311-cp311-win_arm64.whl", hash = "sha256:4197fb2534ee05fd3e7afaab5d8bfd6c2e186f65ea7f9cd6a82809c887bd1285", size = 3680591, upload-time = "2025-09-22T04:01:14.874Z" }, - { url = "https://files.pythonhosted.org/packages/f3/c8/8ff2bc6b920c84355146cd1ab7d181bc543b89241cfb1ebee824a7c81457/lxml-6.0.2-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:a59f5448ba2ceccd06995c95ea59a7674a10de0810f2ce90c9006f3cbc044456", size = 8661887, upload-time = "2025-09-22T04:01:17.265Z" }, - { url = "https://files.pythonhosted.org/packages/37/6f/9aae1008083bb501ef63284220ce81638332f9ccbfa53765b2b7502203cf/lxml-6.0.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:e8113639f3296706fbac34a30813929e29247718e88173ad849f57ca59754924", size = 4667818, upload-time = "2025-09-22T04:01:19.688Z" }, - { url = "https://files.pythonhosted.org/packages/f1/ca/31fb37f99f37f1536c133476674c10b577e409c0a624384147653e38baf2/lxml-6.0.2-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:a8bef9b9825fa8bc816a6e641bb67219489229ebc648be422af695f6e7a4fa7f", size = 4950807, upload-time = "2025-09-22T04:01:21.487Z" }, - { url = "https://files.pythonhosted.org/packages/da/87/f6cb9442e4bada8aab5ae7e1046264f62fdbeaa6e3f6211b93f4c0dd97f1/lxml-6.0.2-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:65ea18d710fd14e0186c2f973dc60bb52039a275f82d3c44a0e42b43440ea534", size = 5109179, upload-time = "2025-09-22T04:01:23.32Z" }, - { url = "https://files.pythonhosted.org/packages/c8/20/a7760713e65888db79bbae4f6146a6ae5c04e4a204a3c48896c408cd6ed2/lxml-6.0.2-cp312-cp312-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c371aa98126a0d4c739ca93ceffa0fd7a5d732e3ac66a46e74339acd4d334564", size = 5023044, upload-time = "2025-09-22T04:01:25.118Z" }, - { url = "https://files.pythonhosted.org/packages/a2/b0/7e64e0460fcb36471899f75831509098f3fd7cd02a3833ac517433cb4f8f/lxml-6.0.2-cp312-cp312-manylinux_2_26_i686.manylinux_2_28_i686.whl", hash = "sha256:700efd30c0fa1a3581d80a748157397559396090a51d306ea59a70020223d16f", size = 5359685, upload-time = "2025-09-22T04:01:27.398Z" }, - { url = "https://files.pythonhosted.org/packages/b9/e1/e5df362e9ca4e2f48ed6411bd4b3a0ae737cc842e96877f5bf9428055ab4/lxml-6.0.2-cp312-cp312-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c33e66d44fe60e72397b487ee92e01da0d09ba2d66df8eae42d77b6d06e5eba0", size = 5654127, upload-time = "2025-09-22T04:01:29.629Z" }, - { url = "https://files.pythonhosted.org/packages/c6/d1/232b3309a02d60f11e71857778bfcd4acbdb86c07db8260caf7d008b08f8/lxml-6.0.2-cp312-cp312-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:90a345bbeaf9d0587a3aaffb7006aa39ccb6ff0e96a57286c0cb2fd1520ea192", size = 5253958, upload-time = "2025-09-22T04:01:31.535Z" }, - { url = "https://files.pythonhosted.org/packages/35/35/d955a070994725c4f7d80583a96cab9c107c57a125b20bb5f708fe941011/lxml-6.0.2-cp312-cp312-manylinux_2_31_armv7l.whl", hash = "sha256:064fdadaf7a21af3ed1dcaa106b854077fbeada827c18f72aec9346847cd65d0", size = 4711541, upload-time = "2025-09-22T04:01:33.801Z" }, - { url = "https://files.pythonhosted.org/packages/1e/be/667d17363b38a78c4bd63cfd4b4632029fd68d2c2dc81f25ce9eb5224dd5/lxml-6.0.2-cp312-cp312-manylinux_2_38_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:fbc74f42c3525ac4ffa4b89cbdd00057b6196bcefe8bce794abd42d33a018092", size = 5267426, upload-time = "2025-09-22T04:01:35.639Z" }, - { url = "https://files.pythonhosted.org/packages/ea/47/62c70aa4a1c26569bc958c9ca86af2bb4e1f614e8c04fb2989833874f7ae/lxml-6.0.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:6ddff43f702905a4e32bc24f3f2e2edfe0f8fde3277d481bffb709a4cced7a1f", size = 5064917, upload-time = "2025-09-22T04:01:37.448Z" }, - { url = "https://files.pythonhosted.org/packages/bd/55/6ceddaca353ebd0f1908ef712c597f8570cc9c58130dbb89903198e441fd/lxml-6.0.2-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:6da5185951d72e6f5352166e3da7b0dc27aa70bd1090b0eb3f7f7212b53f1bb8", size = 4788795, upload-time = "2025-09-22T04:01:39.165Z" }, - { url = "https://files.pythonhosted.org/packages/cf/e8/fd63e15da5e3fd4c2146f8bbb3c14e94ab850589beab88e547b2dbce22e1/lxml-6.0.2-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:57a86e1ebb4020a38d295c04fc79603c7899e0df71588043eb218722dabc087f", size = 5676759, upload-time = "2025-09-22T04:01:41.506Z" }, - { url = "https://files.pythonhosted.org/packages/76/47/b3ec58dc5c374697f5ba37412cd2728f427d056315d124dd4b61da381877/lxml-6.0.2-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:2047d8234fe735ab77802ce5f2297e410ff40f5238aec569ad7c8e163d7b19a6", size = 5255666, upload-time = "2025-09-22T04:01:43.363Z" }, - { url = "https://files.pythonhosted.org/packages/19/93/03ba725df4c3d72afd9596eef4a37a837ce8e4806010569bedfcd2cb68fd/lxml-6.0.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:6f91fd2b2ea15a6800c8e24418c0775a1694eefc011392da73bc6cef2623b322", size = 5277989, upload-time = "2025-09-22T04:01:45.215Z" }, - { url = "https://files.pythonhosted.org/packages/c6/80/c06de80bfce881d0ad738576f243911fccf992687ae09fd80b734712b39c/lxml-6.0.2-cp312-cp312-win32.whl", hash = "sha256:3ae2ce7d6fedfb3414a2b6c5e20b249c4c607f72cb8d2bb7cc9c6ec7c6f4e849", size = 3611456, upload-time = "2025-09-22T04:01:48.243Z" }, - { url = "https://files.pythonhosted.org/packages/f7/d7/0cdfb6c3e30893463fb3d1e52bc5f5f99684a03c29a0b6b605cfae879cd5/lxml-6.0.2-cp312-cp312-win_amd64.whl", hash = "sha256:72c87e5ee4e58a8354fb9c7c84cbf95a1c8236c127a5d1b7683f04bed8361e1f", size = 4011793, upload-time = "2025-09-22T04:01:50.042Z" }, - { url = "https://files.pythonhosted.org/packages/ea/7b/93c73c67db235931527301ed3785f849c78991e2e34f3fd9a6663ffda4c5/lxml-6.0.2-cp312-cp312-win_arm64.whl", hash = "sha256:61cb10eeb95570153e0c0e554f58df92ecf5109f75eacad4a95baa709e26c3d6", size = 3672836, upload-time = "2025-09-22T04:01:52.145Z" }, - { url = "https://files.pythonhosted.org/packages/53/fd/4e8f0540608977aea078bf6d79f128e0e2c2bba8af1acf775c30baa70460/lxml-6.0.2-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:9b33d21594afab46f37ae58dfadd06636f154923c4e8a4d754b0127554eb2e77", size = 8648494, upload-time = "2025-09-22T04:01:54.242Z" }, - { url = "https://files.pythonhosted.org/packages/5d/f4/2a94a3d3dfd6c6b433501b8d470a1960a20ecce93245cf2db1706adf6c19/lxml-6.0.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:6c8963287d7a4c5c9a432ff487c52e9c5618667179c18a204bdedb27310f022f", size = 4661146, upload-time = "2025-09-22T04:01:56.282Z" }, - { url = "https://files.pythonhosted.org/packages/25/2e/4efa677fa6b322013035d38016f6ae859d06cac67437ca7dc708a6af7028/lxml-6.0.2-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:1941354d92699fb5ffe6ed7b32f9649e43c2feb4b97205f75866f7d21aa91452", size = 4946932, upload-time = "2025-09-22T04:01:58.989Z" }, - { url = "https://files.pythonhosted.org/packages/ce/0f/526e78a6d38d109fdbaa5049c62e1d32fdd70c75fb61c4eadf3045d3d124/lxml-6.0.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:bb2f6ca0ae2d983ded09357b84af659c954722bbf04dea98030064996d156048", size = 5100060, upload-time = "2025-09-22T04:02:00.812Z" }, - { url = "https://files.pythonhosted.org/packages/81/76/99de58d81fa702cc0ea7edae4f4640416c2062813a00ff24bd70ac1d9c9b/lxml-6.0.2-cp313-cp313-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:eb2a12d704f180a902d7fa778c6d71f36ceb7b0d317f34cdc76a5d05aa1dd1df", size = 5019000, upload-time = "2025-09-22T04:02:02.671Z" }, - { url = "https://files.pythonhosted.org/packages/b5/35/9e57d25482bc9a9882cb0037fdb9cc18f4b79d85df94fa9d2a89562f1d25/lxml-6.0.2-cp313-cp313-manylinux_2_26_i686.manylinux_2_28_i686.whl", hash = "sha256:6ec0e3f745021bfed19c456647f0298d60a24c9ff86d9d051f52b509663feeb1", size = 5348496, upload-time = "2025-09-22T04:02:04.904Z" }, - { url = "https://files.pythonhosted.org/packages/a6/8e/cb99bd0b83ccc3e8f0f528e9aa1f7a9965dfec08c617070c5db8d63a87ce/lxml-6.0.2-cp313-cp313-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:846ae9a12d54e368933b9759052d6206a9e8b250291109c48e350c1f1f49d916", size = 5643779, upload-time = "2025-09-22T04:02:06.689Z" }, - { url = "https://files.pythonhosted.org/packages/d0/34/9e591954939276bb679b73773836c6684c22e56d05980e31d52a9a8deb18/lxml-6.0.2-cp313-cp313-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ef9266d2aa545d7374938fb5c484531ef5a2ec7f2d573e62f8ce722c735685fd", size = 5244072, upload-time = "2025-09-22T04:02:08.587Z" }, - { url = "https://files.pythonhosted.org/packages/8d/27/b29ff065f9aaca443ee377aff699714fcbffb371b4fce5ac4ca759e436d5/lxml-6.0.2-cp313-cp313-manylinux_2_31_armv7l.whl", hash = "sha256:4077b7c79f31755df33b795dc12119cb557a0106bfdab0d2c2d97bd3cf3dffa6", size = 4718675, upload-time = "2025-09-22T04:02:10.783Z" }, - { url = "https://files.pythonhosted.org/packages/2b/9f/f756f9c2cd27caa1a6ef8c32ae47aadea697f5c2c6d07b0dae133c244fbe/lxml-6.0.2-cp313-cp313-manylinux_2_38_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:a7c5d5e5f1081955358533be077166ee97ed2571d6a66bdba6ec2f609a715d1a", size = 5255171, upload-time = "2025-09-22T04:02:12.631Z" }, - { url = "https://files.pythonhosted.org/packages/61/46/bb85ea42d2cb1bd8395484fd72f38e3389611aa496ac7772da9205bbda0e/lxml-6.0.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:8f8d0cbd0674ee89863a523e6994ac25fd5be9c8486acfc3e5ccea679bad2679", size = 5057175, upload-time = "2025-09-22T04:02:14.718Z" }, - { url = "https://files.pythonhosted.org/packages/95/0c/443fc476dcc8e41577f0af70458c50fe299a97bb6b7505bb1ae09aa7f9ac/lxml-6.0.2-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:2cbcbf6d6e924c28f04a43f3b6f6e272312a090f269eff68a2982e13e5d57659", size = 4785688, upload-time = "2025-09-22T04:02:16.957Z" }, - { url = "https://files.pythonhosted.org/packages/48/78/6ef0b359d45bb9697bc5a626e1992fa5d27aa3f8004b137b2314793b50a0/lxml-6.0.2-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:dfb874cfa53340009af6bdd7e54ebc0d21012a60a4e65d927c2e477112e63484", size = 5660655, upload-time = "2025-09-22T04:02:18.815Z" }, - { url = "https://files.pythonhosted.org/packages/ff/ea/e1d33808f386bc1339d08c0dcada6e4712d4ed8e93fcad5f057070b7988a/lxml-6.0.2-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:fb8dae0b6b8b7f9e96c26fdd8121522ce5de9bb5538010870bd538683d30e9a2", size = 5247695, upload-time = "2025-09-22T04:02:20.593Z" }, - { url = "https://files.pythonhosted.org/packages/4f/47/eba75dfd8183673725255247a603b4ad606f4ae657b60c6c145b381697da/lxml-6.0.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:358d9adae670b63e95bc59747c72f4dc97c9ec58881d4627fe0120da0f90d314", size = 5269841, upload-time = "2025-09-22T04:02:22.489Z" }, - { url = "https://files.pythonhosted.org/packages/76/04/5c5e2b8577bc936e219becb2e98cdb1aca14a4921a12995b9d0c523502ae/lxml-6.0.2-cp313-cp313-win32.whl", hash = "sha256:e8cd2415f372e7e5a789d743d133ae474290a90b9023197fd78f32e2dc6873e2", size = 3610700, upload-time = "2025-09-22T04:02:24.465Z" }, - { url = "https://files.pythonhosted.org/packages/fe/0a/4643ccc6bb8b143e9f9640aa54e38255f9d3b45feb2cbe7ae2ca47e8782e/lxml-6.0.2-cp313-cp313-win_amd64.whl", hash = "sha256:b30d46379644fbfc3ab81f8f82ae4de55179414651f110a1514f0b1f8f6cb2d7", size = 4010347, upload-time = "2025-09-22T04:02:26.286Z" }, - { url = "https://files.pythonhosted.org/packages/31/ef/dcf1d29c3f530577f61e5fe2f1bd72929acf779953668a8a47a479ae6f26/lxml-6.0.2-cp313-cp313-win_arm64.whl", hash = "sha256:13dcecc9946dca97b11b7c40d29fba63b55ab4170d3c0cf8c0c164343b9bfdcf", size = 3671248, upload-time = "2025-09-22T04:02:27.918Z" }, - { url = "https://files.pythonhosted.org/packages/03/15/d4a377b385ab693ce97b472fe0c77c2b16ec79590e688b3ccc71fba19884/lxml-6.0.2-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:b0c732aa23de8f8aec23f4b580d1e52905ef468afb4abeafd3fec77042abb6fe", size = 8659801, upload-time = "2025-09-22T04:02:30.113Z" }, - { url = "https://files.pythonhosted.org/packages/c8/e8/c128e37589463668794d503afaeb003987373c5f94d667124ffd8078bbd9/lxml-6.0.2-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:4468e3b83e10e0317a89a33d28f7aeba1caa4d1a6fd457d115dd4ffe90c5931d", size = 4659403, upload-time = "2025-09-22T04:02:32.119Z" }, - { url = "https://files.pythonhosted.org/packages/00/ce/74903904339decdf7da7847bb5741fc98a5451b42fc419a86c0c13d26fe2/lxml-6.0.2-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:abd44571493973bad4598a3be7e1d807ed45aa2adaf7ab92ab7c62609569b17d", size = 4966974, upload-time = "2025-09-22T04:02:34.155Z" }, - { url = "https://files.pythonhosted.org/packages/1f/d3/131dec79ce61c5567fecf82515bd9bc36395df42501b50f7f7f3bd065df0/lxml-6.0.2-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:370cd78d5855cfbffd57c422851f7d3864e6ae72d0da615fca4dad8c45d375a5", size = 5102953, upload-time = "2025-09-22T04:02:36.054Z" }, - { url = "https://files.pythonhosted.org/packages/3a/ea/a43ba9bb750d4ffdd885f2cd333572f5bb900cd2408b67fdda07e85978a0/lxml-6.0.2-cp314-cp314-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:901e3b4219fa04ef766885fb40fa516a71662a4c61b80c94d25336b4934b71c0", size = 5055054, upload-time = "2025-09-22T04:02:38.154Z" }, - { url = "https://files.pythonhosted.org/packages/60/23/6885b451636ae286c34628f70a7ed1fcc759f8d9ad382d132e1c8d3d9bfd/lxml-6.0.2-cp314-cp314-manylinux_2_26_i686.manylinux_2_28_i686.whl", hash = "sha256:a4bf42d2e4cf52c28cc1812d62426b9503cdb0c87a6de81442626aa7d69707ba", size = 5352421, upload-time = "2025-09-22T04:02:40.413Z" }, - { url = "https://files.pythonhosted.org/packages/48/5b/fc2ddfc94ddbe3eebb8e9af6e3fd65e2feba4967f6a4e9683875c394c2d8/lxml-6.0.2-cp314-cp314-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:b2c7fdaa4d7c3d886a42534adec7cfac73860b89b4e5298752f60aa5984641a0", size = 5673684, upload-time = "2025-09-22T04:02:42.288Z" }, - { url = "https://files.pythonhosted.org/packages/29/9c/47293c58cc91769130fbf85531280e8cc7868f7fbb6d92f4670071b9cb3e/lxml-6.0.2-cp314-cp314-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:98a5e1660dc7de2200b00d53fa00bcd3c35a3608c305d45a7bbcaf29fa16e83d", size = 5252463, upload-time = "2025-09-22T04:02:44.165Z" }, - { url = "https://files.pythonhosted.org/packages/9b/da/ba6eceb830c762b48e711ded880d7e3e89fc6c7323e587c36540b6b23c6b/lxml-6.0.2-cp314-cp314-manylinux_2_31_armv7l.whl", hash = "sha256:dc051506c30b609238d79eda75ee9cab3e520570ec8219844a72a46020901e37", size = 4698437, upload-time = "2025-09-22T04:02:46.524Z" }, - { url = "https://files.pythonhosted.org/packages/a5/24/7be3f82cb7990b89118d944b619e53c656c97dc89c28cfb143fdb7cd6f4d/lxml-6.0.2-cp314-cp314-manylinux_2_38_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:8799481bbdd212470d17513a54d568f44416db01250f49449647b5ab5b5dccb9", size = 5269890, upload-time = "2025-09-22T04:02:48.812Z" }, - { url = "https://files.pythonhosted.org/packages/1b/bd/dcfb9ea1e16c665efd7538fc5d5c34071276ce9220e234217682e7d2c4a5/lxml-6.0.2-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:9261bb77c2dab42f3ecd9103951aeca2c40277701eb7e912c545c1b16e0e4917", size = 5097185, upload-time = "2025-09-22T04:02:50.746Z" }, - { url = "https://files.pythonhosted.org/packages/21/04/a60b0ff9314736316f28316b694bccbbabe100f8483ad83852d77fc7468e/lxml-6.0.2-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:65ac4a01aba353cfa6d5725b95d7aed6356ddc0a3cd734de00124d285b04b64f", size = 4745895, upload-time = "2025-09-22T04:02:52.968Z" }, - { url = "https://files.pythonhosted.org/packages/d6/bd/7d54bd1846e5a310d9c715921c5faa71cf5c0853372adf78aee70c8d7aa2/lxml-6.0.2-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:b22a07cbb82fea98f8a2fd814f3d1811ff9ed76d0fc6abc84eb21527596e7cc8", size = 5695246, upload-time = "2025-09-22T04:02:54.798Z" }, - { url = "https://files.pythonhosted.org/packages/fd/32/5643d6ab947bc371da21323acb2a6e603cedbe71cb4c99c8254289ab6f4e/lxml-6.0.2-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:d759cdd7f3e055d6bc8d9bec3ad905227b2e4c785dc16c372eb5b5e83123f48a", size = 5260797, upload-time = "2025-09-22T04:02:57.058Z" }, - { url = "https://files.pythonhosted.org/packages/33/da/34c1ec4cff1eea7d0b4cd44af8411806ed943141804ac9c5d565302afb78/lxml-6.0.2-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:945da35a48d193d27c188037a05fec5492937f66fb1958c24fc761fb9d40d43c", size = 5277404, upload-time = "2025-09-22T04:02:58.966Z" }, - { url = "https://files.pythonhosted.org/packages/82/57/4eca3e31e54dc89e2c3507e1cd411074a17565fa5ffc437c4ae0a00d439e/lxml-6.0.2-cp314-cp314-win32.whl", hash = "sha256:be3aaa60da67e6153eb15715cc2e19091af5dc75faef8b8a585aea372507384b", size = 3670072, upload-time = "2025-09-22T04:03:38.05Z" }, - { url = "https://files.pythonhosted.org/packages/e3/e0/c96cf13eccd20c9421ba910304dae0f619724dcf1702864fd59dd386404d/lxml-6.0.2-cp314-cp314-win_amd64.whl", hash = "sha256:fa25afbadead523f7001caf0c2382afd272c315a033a7b06336da2637d92d6ed", size = 4080617, upload-time = "2025-09-22T04:03:39.835Z" }, - { url = "https://files.pythonhosted.org/packages/d5/5d/b3f03e22b3d38d6f188ef044900a9b29b2fe0aebb94625ce9fe244011d34/lxml-6.0.2-cp314-cp314-win_arm64.whl", hash = "sha256:063eccf89df5b24e361b123e257e437f9e9878f425ee9aae3144c77faf6da6d8", size = 3754930, upload-time = "2025-09-22T04:03:41.565Z" }, - { url = "https://files.pythonhosted.org/packages/5e/5c/42c2c4c03554580708fc738d13414801f340c04c3eff90d8d2d227145275/lxml-6.0.2-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:6162a86d86893d63084faaf4ff937b3daea233e3682fb4474db07395794fa80d", size = 8910380, upload-time = "2025-09-22T04:03:01.645Z" }, - { url = "https://files.pythonhosted.org/packages/bf/4f/12df843e3e10d18d468a7557058f8d3733e8b6e12401f30b1ef29360740f/lxml-6.0.2-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:414aaa94e974e23a3e92e7ca5b97d10c0cf37b6481f50911032c69eeb3991bba", size = 4775632, upload-time = "2025-09-22T04:03:03.814Z" }, - { url = "https://files.pythonhosted.org/packages/e4/0c/9dc31e6c2d0d418483cbcb469d1f5a582a1cd00a1f4081953d44051f3c50/lxml-6.0.2-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:48461bd21625458dd01e14e2c38dd0aea69addc3c4f960c30d9f59d7f93be601", size = 4975171, upload-time = "2025-09-22T04:03:05.651Z" }, - { url = "https://files.pythonhosted.org/packages/e7/2b/9b870c6ca24c841bdd887504808f0417aa9d8d564114689266f19ddf29c8/lxml-6.0.2-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:25fcc59afc57d527cfc78a58f40ab4c9b8fd096a9a3f964d2781ffb6eb33f4ed", size = 5110109, upload-time = "2025-09-22T04:03:07.452Z" }, - { url = "https://files.pythonhosted.org/packages/bf/0c/4f5f2a4dd319a178912751564471355d9019e220c20d7db3fb8307ed8582/lxml-6.0.2-cp314-cp314t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5179c60288204e6ddde3f774a93350177e08876eaf3ab78aa3a3649d43eb7d37", size = 5041061, upload-time = "2025-09-22T04:03:09.297Z" }, - { url = "https://files.pythonhosted.org/packages/12/64/554eed290365267671fe001a20d72d14f468ae4e6acef1e179b039436967/lxml-6.0.2-cp314-cp314t-manylinux_2_26_i686.manylinux_2_28_i686.whl", hash = "sha256:967aab75434de148ec80597b75062d8123cadf2943fb4281f385141e18b21338", size = 5306233, upload-time = "2025-09-22T04:03:11.651Z" }, - { url = "https://files.pythonhosted.org/packages/7a/31/1d748aa275e71802ad9722df32a7a35034246b42c0ecdd8235412c3396ef/lxml-6.0.2-cp314-cp314t-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:d100fcc8930d697c6561156c6810ab4a508fb264c8b6779e6e61e2ed5e7558f9", size = 5604739, upload-time = "2025-09-22T04:03:13.592Z" }, - { url = "https://files.pythonhosted.org/packages/8f/41/2c11916bcac09ed561adccacceaedd2bf0e0b25b297ea92aab99fd03d0fa/lxml-6.0.2-cp314-cp314t-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2ca59e7e13e5981175b8b3e4ab84d7da57993eeff53c07764dcebda0d0e64ecd", size = 5225119, upload-time = "2025-09-22T04:03:15.408Z" }, - { url = "https://files.pythonhosted.org/packages/99/05/4e5c2873d8f17aa018e6afde417c80cc5d0c33be4854cce3ef5670c49367/lxml-6.0.2-cp314-cp314t-manylinux_2_31_armv7l.whl", hash = "sha256:957448ac63a42e2e49531b9d6c0fa449a1970dbc32467aaad46f11545be9af1d", size = 4633665, upload-time = "2025-09-22T04:03:17.262Z" }, - { url = "https://files.pythonhosted.org/packages/0f/c9/dcc2da1bebd6275cdc723b515f93edf548b82f36a5458cca3578bc899332/lxml-6.0.2-cp314-cp314t-manylinux_2_38_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:b7fc49c37f1786284b12af63152fe1d0990722497e2d5817acfe7a877522f9a9", size = 5234997, upload-time = "2025-09-22T04:03:19.14Z" }, - { url = "https://files.pythonhosted.org/packages/9c/e2/5172e4e7468afca64a37b81dba152fc5d90e30f9c83c7c3213d6a02a5ce4/lxml-6.0.2-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:e19e0643cc936a22e837f79d01a550678da8377d7d801a14487c10c34ee49c7e", size = 5090957, upload-time = "2025-09-22T04:03:21.436Z" }, - { url = "https://files.pythonhosted.org/packages/a5/b3/15461fd3e5cd4ddcb7938b87fc20b14ab113b92312fc97afe65cd7c85de1/lxml-6.0.2-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:1db01e5cf14345628e0cbe71067204db658e2fb8e51e7f33631f5f4735fefd8d", size = 4764372, upload-time = "2025-09-22T04:03:23.27Z" }, - { url = "https://files.pythonhosted.org/packages/05/33/f310b987c8bf9e61c4dd8e8035c416bd3230098f5e3cfa69fc4232de7059/lxml-6.0.2-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:875c6b5ab39ad5291588aed6925fac99d0097af0dd62f33c7b43736043d4a2ec", size = 5634653, upload-time = "2025-09-22T04:03:25.767Z" }, - { url = "https://files.pythonhosted.org/packages/70/ff/51c80e75e0bc9382158133bdcf4e339b5886c6ee2418b5199b3f1a61ed6d/lxml-6.0.2-cp314-cp314t-musllinux_1_2_riscv64.whl", hash = "sha256:cdcbed9ad19da81c480dfd6dd161886db6096083c9938ead313d94b30aadf272", size = 5233795, upload-time = "2025-09-22T04:03:27.62Z" }, - { url = "https://files.pythonhosted.org/packages/56/4d/4856e897df0d588789dd844dbed9d91782c4ef0b327f96ce53c807e13128/lxml-6.0.2-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:80dadc234ebc532e09be1975ff538d154a7fa61ea5031c03d25178855544728f", size = 5257023, upload-time = "2025-09-22T04:03:30.056Z" }, - { url = "https://files.pythonhosted.org/packages/0f/85/86766dfebfa87bea0ab78e9ff7a4b4b45225df4b4d3b8cc3c03c5cd68464/lxml-6.0.2-cp314-cp314t-win32.whl", hash = "sha256:da08e7bb297b04e893d91087df19638dc7a6bb858a954b0cc2b9f5053c922312", size = 3911420, upload-time = "2025-09-22T04:03:32.198Z" }, - { url = "https://files.pythonhosted.org/packages/fe/1a/b248b355834c8e32614650b8008c69ffeb0ceb149c793961dd8c0b991bb3/lxml-6.0.2-cp314-cp314t-win_amd64.whl", hash = "sha256:252a22982dca42f6155125ac76d3432e548a7625d56f5a273ee78a5057216eca", size = 4406837, upload-time = "2025-09-22T04:03:34.027Z" }, - { url = "https://files.pythonhosted.org/packages/92/aa/df863bcc39c5e0946263454aba394de8a9084dbaff8ad143846b0d844739/lxml-6.0.2-cp314-cp314t-win_arm64.whl", hash = "sha256:bb4c1847b303835d89d785a18801a883436cdfd5dc3d62947f9c49e24f0f5a2c", size = 3822205, upload-time = "2025-09-22T04:03:36.249Z" }, - { url = "https://files.pythonhosted.org/packages/0b/11/29d08bc103a62c0eba8016e7ed5aeebbf1e4312e83b0b1648dd203b0e87d/lxml-6.0.2-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:1c06035eafa8404b5cf475bb37a9f6088b0aca288d4ccc9d69389750d5543700", size = 3949829, upload-time = "2025-09-22T04:04:45.608Z" }, - { url = "https://files.pythonhosted.org/packages/12/b3/52ab9a3b31e5ab8238da241baa19eec44d2ab426532441ee607165aebb52/lxml-6.0.2-pp311-pypy311_pp73-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:c7d13103045de1bdd6fe5d61802565f1a3537d70cd3abf596aa0af62761921ee", size = 4226277, upload-time = "2025-09-22T04:04:47.754Z" }, - { url = "https://files.pythonhosted.org/packages/a0/33/1eaf780c1baad88224611df13b1c2a9dfa460b526cacfe769103ff50d845/lxml-6.0.2-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:0a3c150a95fbe5ac91de323aa756219ef9cf7fde5a3f00e2281e30f33fa5fa4f", size = 4330433, upload-time = "2025-09-22T04:04:49.907Z" }, - { url = "https://files.pythonhosted.org/packages/7a/c1/27428a2ff348e994ab4f8777d3a0ad510b6b92d37718e5887d2da99952a2/lxml-6.0.2-pp311-pypy311_pp73-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:60fa43be34f78bebb27812ed90f1925ec99560b0fa1decdb7d12b84d857d31e9", size = 4272119, upload-time = "2025-09-22T04:04:51.801Z" }, - { url = "https://files.pythonhosted.org/packages/f0/d0/3020fa12bcec4ab62f97aab026d57c2f0cfd480a558758d9ca233bb6a79d/lxml-6.0.2-pp311-pypy311_pp73-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:21c73b476d3cfe836be731225ec3421fa2f048d84f6df6a8e70433dff1376d5a", size = 4417314, upload-time = "2025-09-22T04:04:55.024Z" }, - { url = "https://files.pythonhosted.org/packages/6c/77/d7f491cbc05303ac6801651aabeb262d43f319288c1ea96c66b1d2692ff3/lxml-6.0.2-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:27220da5be049e936c3aca06f174e8827ca6445a4353a1995584311487fc4e3e", size = 3518768, upload-time = "2025-09-22T04:04:57.097Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/aa/88/262177de60548e5a2bfc46ad28232c9e9cbde697bd94132aeb80364675cb/lxml-6.0.2.tar.gz", hash = "sha256:cd79f3367bd74b317dda655dc8fcfa304d9eb6e4fb06b7168c5cf27f96e0cd62", size = 4073426 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/77/d5/becbe1e2569b474a23f0c672ead8a29ac50b2dc1d5b9de184831bda8d14c/lxml-6.0.2-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:13e35cbc684aadf05d8711a5d1b5857c92e5e580efa9a0d2be197199c8def607", size = 8634365 }, + { url = "https://files.pythonhosted.org/packages/28/66/1ced58f12e804644426b85d0bb8a4478ca77bc1761455da310505f1a3526/lxml-6.0.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:3b1675e096e17c6fe9c0e8c81434f5736c0739ff9ac6123c87c2d452f48fc938", size = 4650793 }, + { url = "https://files.pythonhosted.org/packages/11/84/549098ffea39dfd167e3f174b4ce983d0eed61f9d8d25b7bf2a57c3247fc/lxml-6.0.2-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:8ac6e5811ae2870953390452e3476694196f98d447573234592d30488147404d", size = 4944362 }, + { url = "https://files.pythonhosted.org/packages/ac/bd/f207f16abf9749d2037453d56b643a7471d8fde855a231a12d1e095c4f01/lxml-6.0.2-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:5aa0fc67ae19d7a64c3fe725dc9a1bb11f80e01f78289d05c6f62545affec438", size = 5083152 }, + { url = "https://files.pythonhosted.org/packages/15/ae/bd813e87d8941d52ad5b65071b1affb48da01c4ed3c9c99e40abb266fbff/lxml-6.0.2-cp311-cp311-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:de496365750cc472b4e7902a485d3f152ecf57bd3ba03ddd5578ed8ceb4c5964", size = 5023539 }, + { url = "https://files.pythonhosted.org/packages/02/cd/9bfef16bd1d874fbe0cb51afb00329540f30a3283beb9f0780adbb7eec03/lxml-6.0.2-cp311-cp311-manylinux_2_26_i686.manylinux_2_28_i686.whl", hash = "sha256:200069a593c5e40b8f6fc0d84d86d970ba43138c3e68619ffa234bc9bb806a4d", size = 5344853 }, + { url = "https://files.pythonhosted.org/packages/b8/89/ea8f91594bc5dbb879734d35a6f2b0ad50605d7fb419de2b63d4211765cc/lxml-6.0.2-cp311-cp311-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:7d2de809c2ee3b888b59f995625385f74629707c9355e0ff856445cdcae682b7", size = 5225133 }, + { url = "https://files.pythonhosted.org/packages/b9/37/9c735274f5dbec726b2db99b98a43950395ba3d4a1043083dba2ad814170/lxml-6.0.2-cp311-cp311-manylinux_2_31_armv7l.whl", hash = "sha256:b2c3da8d93cf5db60e8858c17684c47d01fee6405e554fb55018dd85fc23b178", size = 4677944 }, + { url = "https://files.pythonhosted.org/packages/20/28/7dfe1ba3475d8bfca3878365075abe002e05d40dfaaeb7ec01b4c587d533/lxml-6.0.2-cp311-cp311-manylinux_2_38_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:442de7530296ef5e188373a1ea5789a46ce90c4847e597856570439621d9c553", size = 5284535 }, + { url = "https://files.pythonhosted.org/packages/e7/cf/5f14bc0de763498fc29510e3532bf2b4b3a1c1d5d0dff2e900c16ba021ef/lxml-6.0.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:2593c77efde7bfea7f6389f1ab249b15ed4aa5bc5cb5131faa3b843c429fbedb", size = 5067343 }, + { url = "https://files.pythonhosted.org/packages/1c/b0/bb8275ab5472f32b28cfbbcc6db7c9d092482d3439ca279d8d6fa02f7025/lxml-6.0.2-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:3e3cb08855967a20f553ff32d147e14329b3ae70ced6edc2f282b94afbc74b2a", size = 4725419 }, + { url = "https://files.pythonhosted.org/packages/25/4c/7c222753bc72edca3b99dbadba1b064209bc8ed4ad448af990e60dcce462/lxml-6.0.2-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:2ed6c667fcbb8c19c6791bbf40b7268ef8ddf5a96940ba9404b9f9a304832f6c", size = 5275008 }, + { url = "https://files.pythonhosted.org/packages/6c/8c/478a0dc6b6ed661451379447cdbec77c05741a75736d97e5b2b729687828/lxml-6.0.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:b8f18914faec94132e5b91e69d76a5c1d7b0c73e2489ea8929c4aaa10b76bbf7", size = 5248906 }, + { url = "https://files.pythonhosted.org/packages/2d/d9/5be3a6ab2784cdf9accb0703b65e1b64fcdd9311c9f007630c7db0cfcce1/lxml-6.0.2-cp311-cp311-win32.whl", hash = "sha256:6605c604e6daa9e0d7f0a2137bdc47a2e93b59c60a65466353e37f8272f47c46", size = 3610357 }, + { url = "https://files.pythonhosted.org/packages/e2/7d/ca6fb13349b473d5732fb0ee3eec8f6c80fc0688e76b7d79c1008481bf1f/lxml-6.0.2-cp311-cp311-win_amd64.whl", hash = "sha256:e5867f2651016a3afd8dd2c8238baa66f1e2802f44bc17e236f547ace6647078", size = 4036583 }, + { url = "https://files.pythonhosted.org/packages/ab/a2/51363b5ecd3eab46563645f3a2c3836a2fc67d01a1b87c5017040f39f567/lxml-6.0.2-cp311-cp311-win_arm64.whl", hash = "sha256:4197fb2534ee05fd3e7afaab5d8bfd6c2e186f65ea7f9cd6a82809c887bd1285", size = 3680591 }, + { url = "https://files.pythonhosted.org/packages/f3/c8/8ff2bc6b920c84355146cd1ab7d181bc543b89241cfb1ebee824a7c81457/lxml-6.0.2-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:a59f5448ba2ceccd06995c95ea59a7674a10de0810f2ce90c9006f3cbc044456", size = 8661887 }, + { url = "https://files.pythonhosted.org/packages/37/6f/9aae1008083bb501ef63284220ce81638332f9ccbfa53765b2b7502203cf/lxml-6.0.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:e8113639f3296706fbac34a30813929e29247718e88173ad849f57ca59754924", size = 4667818 }, + { url = "https://files.pythonhosted.org/packages/f1/ca/31fb37f99f37f1536c133476674c10b577e409c0a624384147653e38baf2/lxml-6.0.2-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:a8bef9b9825fa8bc816a6e641bb67219489229ebc648be422af695f6e7a4fa7f", size = 4950807 }, + { url = "https://files.pythonhosted.org/packages/da/87/f6cb9442e4bada8aab5ae7e1046264f62fdbeaa6e3f6211b93f4c0dd97f1/lxml-6.0.2-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:65ea18d710fd14e0186c2f973dc60bb52039a275f82d3c44a0e42b43440ea534", size = 5109179 }, + { url = "https://files.pythonhosted.org/packages/c8/20/a7760713e65888db79bbae4f6146a6ae5c04e4a204a3c48896c408cd6ed2/lxml-6.0.2-cp312-cp312-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c371aa98126a0d4c739ca93ceffa0fd7a5d732e3ac66a46e74339acd4d334564", size = 5023044 }, + { url = "https://files.pythonhosted.org/packages/a2/b0/7e64e0460fcb36471899f75831509098f3fd7cd02a3833ac517433cb4f8f/lxml-6.0.2-cp312-cp312-manylinux_2_26_i686.manylinux_2_28_i686.whl", hash = "sha256:700efd30c0fa1a3581d80a748157397559396090a51d306ea59a70020223d16f", size = 5359685 }, + { url = "https://files.pythonhosted.org/packages/b9/e1/e5df362e9ca4e2f48ed6411bd4b3a0ae737cc842e96877f5bf9428055ab4/lxml-6.0.2-cp312-cp312-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c33e66d44fe60e72397b487ee92e01da0d09ba2d66df8eae42d77b6d06e5eba0", size = 5654127 }, + { url = "https://files.pythonhosted.org/packages/c6/d1/232b3309a02d60f11e71857778bfcd4acbdb86c07db8260caf7d008b08f8/lxml-6.0.2-cp312-cp312-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:90a345bbeaf9d0587a3aaffb7006aa39ccb6ff0e96a57286c0cb2fd1520ea192", size = 5253958 }, + { url = "https://files.pythonhosted.org/packages/35/35/d955a070994725c4f7d80583a96cab9c107c57a125b20bb5f708fe941011/lxml-6.0.2-cp312-cp312-manylinux_2_31_armv7l.whl", hash = "sha256:064fdadaf7a21af3ed1dcaa106b854077fbeada827c18f72aec9346847cd65d0", size = 4711541 }, + { url = "https://files.pythonhosted.org/packages/1e/be/667d17363b38a78c4bd63cfd4b4632029fd68d2c2dc81f25ce9eb5224dd5/lxml-6.0.2-cp312-cp312-manylinux_2_38_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:fbc74f42c3525ac4ffa4b89cbdd00057b6196bcefe8bce794abd42d33a018092", size = 5267426 }, + { url = "https://files.pythonhosted.org/packages/ea/47/62c70aa4a1c26569bc958c9ca86af2bb4e1f614e8c04fb2989833874f7ae/lxml-6.0.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:6ddff43f702905a4e32bc24f3f2e2edfe0f8fde3277d481bffb709a4cced7a1f", size = 5064917 }, + { url = "https://files.pythonhosted.org/packages/bd/55/6ceddaca353ebd0f1908ef712c597f8570cc9c58130dbb89903198e441fd/lxml-6.0.2-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:6da5185951d72e6f5352166e3da7b0dc27aa70bd1090b0eb3f7f7212b53f1bb8", size = 4788795 }, + { url = "https://files.pythonhosted.org/packages/cf/e8/fd63e15da5e3fd4c2146f8bbb3c14e94ab850589beab88e547b2dbce22e1/lxml-6.0.2-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:57a86e1ebb4020a38d295c04fc79603c7899e0df71588043eb218722dabc087f", size = 5676759 }, + { url = "https://files.pythonhosted.org/packages/76/47/b3ec58dc5c374697f5ba37412cd2728f427d056315d124dd4b61da381877/lxml-6.0.2-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:2047d8234fe735ab77802ce5f2297e410ff40f5238aec569ad7c8e163d7b19a6", size = 5255666 }, + { url = "https://files.pythonhosted.org/packages/19/93/03ba725df4c3d72afd9596eef4a37a837ce8e4806010569bedfcd2cb68fd/lxml-6.0.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:6f91fd2b2ea15a6800c8e24418c0775a1694eefc011392da73bc6cef2623b322", size = 5277989 }, + { url = "https://files.pythonhosted.org/packages/c6/80/c06de80bfce881d0ad738576f243911fccf992687ae09fd80b734712b39c/lxml-6.0.2-cp312-cp312-win32.whl", hash = "sha256:3ae2ce7d6fedfb3414a2b6c5e20b249c4c607f72cb8d2bb7cc9c6ec7c6f4e849", size = 3611456 }, + { url = "https://files.pythonhosted.org/packages/f7/d7/0cdfb6c3e30893463fb3d1e52bc5f5f99684a03c29a0b6b605cfae879cd5/lxml-6.0.2-cp312-cp312-win_amd64.whl", hash = "sha256:72c87e5ee4e58a8354fb9c7c84cbf95a1c8236c127a5d1b7683f04bed8361e1f", size = 4011793 }, + { url = "https://files.pythonhosted.org/packages/ea/7b/93c73c67db235931527301ed3785f849c78991e2e34f3fd9a6663ffda4c5/lxml-6.0.2-cp312-cp312-win_arm64.whl", hash = "sha256:61cb10eeb95570153e0c0e554f58df92ecf5109f75eacad4a95baa709e26c3d6", size = 3672836 }, + { url = "https://files.pythonhosted.org/packages/53/fd/4e8f0540608977aea078bf6d79f128e0e2c2bba8af1acf775c30baa70460/lxml-6.0.2-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:9b33d21594afab46f37ae58dfadd06636f154923c4e8a4d754b0127554eb2e77", size = 8648494 }, + { url = "https://files.pythonhosted.org/packages/5d/f4/2a94a3d3dfd6c6b433501b8d470a1960a20ecce93245cf2db1706adf6c19/lxml-6.0.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:6c8963287d7a4c5c9a432ff487c52e9c5618667179c18a204bdedb27310f022f", size = 4661146 }, + { url = "https://files.pythonhosted.org/packages/25/2e/4efa677fa6b322013035d38016f6ae859d06cac67437ca7dc708a6af7028/lxml-6.0.2-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:1941354d92699fb5ffe6ed7b32f9649e43c2feb4b97205f75866f7d21aa91452", size = 4946932 }, + { url = "https://files.pythonhosted.org/packages/ce/0f/526e78a6d38d109fdbaa5049c62e1d32fdd70c75fb61c4eadf3045d3d124/lxml-6.0.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:bb2f6ca0ae2d983ded09357b84af659c954722bbf04dea98030064996d156048", size = 5100060 }, + { url = "https://files.pythonhosted.org/packages/81/76/99de58d81fa702cc0ea7edae4f4640416c2062813a00ff24bd70ac1d9c9b/lxml-6.0.2-cp313-cp313-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:eb2a12d704f180a902d7fa778c6d71f36ceb7b0d317f34cdc76a5d05aa1dd1df", size = 5019000 }, + { url = "https://files.pythonhosted.org/packages/b5/35/9e57d25482bc9a9882cb0037fdb9cc18f4b79d85df94fa9d2a89562f1d25/lxml-6.0.2-cp313-cp313-manylinux_2_26_i686.manylinux_2_28_i686.whl", hash = "sha256:6ec0e3f745021bfed19c456647f0298d60a24c9ff86d9d051f52b509663feeb1", size = 5348496 }, + { url = "https://files.pythonhosted.org/packages/a6/8e/cb99bd0b83ccc3e8f0f528e9aa1f7a9965dfec08c617070c5db8d63a87ce/lxml-6.0.2-cp313-cp313-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:846ae9a12d54e368933b9759052d6206a9e8b250291109c48e350c1f1f49d916", size = 5643779 }, + { url = "https://files.pythonhosted.org/packages/d0/34/9e591954939276bb679b73773836c6684c22e56d05980e31d52a9a8deb18/lxml-6.0.2-cp313-cp313-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ef9266d2aa545d7374938fb5c484531ef5a2ec7f2d573e62f8ce722c735685fd", size = 5244072 }, + { url = "https://files.pythonhosted.org/packages/8d/27/b29ff065f9aaca443ee377aff699714fcbffb371b4fce5ac4ca759e436d5/lxml-6.0.2-cp313-cp313-manylinux_2_31_armv7l.whl", hash = "sha256:4077b7c79f31755df33b795dc12119cb557a0106bfdab0d2c2d97bd3cf3dffa6", size = 4718675 }, + { url = "https://files.pythonhosted.org/packages/2b/9f/f756f9c2cd27caa1a6ef8c32ae47aadea697f5c2c6d07b0dae133c244fbe/lxml-6.0.2-cp313-cp313-manylinux_2_38_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:a7c5d5e5f1081955358533be077166ee97ed2571d6a66bdba6ec2f609a715d1a", size = 5255171 }, + { url = "https://files.pythonhosted.org/packages/61/46/bb85ea42d2cb1bd8395484fd72f38e3389611aa496ac7772da9205bbda0e/lxml-6.0.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:8f8d0cbd0674ee89863a523e6994ac25fd5be9c8486acfc3e5ccea679bad2679", size = 5057175 }, + { url = "https://files.pythonhosted.org/packages/95/0c/443fc476dcc8e41577f0af70458c50fe299a97bb6b7505bb1ae09aa7f9ac/lxml-6.0.2-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:2cbcbf6d6e924c28f04a43f3b6f6e272312a090f269eff68a2982e13e5d57659", size = 4785688 }, + { url = "https://files.pythonhosted.org/packages/48/78/6ef0b359d45bb9697bc5a626e1992fa5d27aa3f8004b137b2314793b50a0/lxml-6.0.2-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:dfb874cfa53340009af6bdd7e54ebc0d21012a60a4e65d927c2e477112e63484", size = 5660655 }, + { url = "https://files.pythonhosted.org/packages/ff/ea/e1d33808f386bc1339d08c0dcada6e4712d4ed8e93fcad5f057070b7988a/lxml-6.0.2-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:fb8dae0b6b8b7f9e96c26fdd8121522ce5de9bb5538010870bd538683d30e9a2", size = 5247695 }, + { url = "https://files.pythonhosted.org/packages/4f/47/eba75dfd8183673725255247a603b4ad606f4ae657b60c6c145b381697da/lxml-6.0.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:358d9adae670b63e95bc59747c72f4dc97c9ec58881d4627fe0120da0f90d314", size = 5269841 }, + { url = "https://files.pythonhosted.org/packages/76/04/5c5e2b8577bc936e219becb2e98cdb1aca14a4921a12995b9d0c523502ae/lxml-6.0.2-cp313-cp313-win32.whl", hash = "sha256:e8cd2415f372e7e5a789d743d133ae474290a90b9023197fd78f32e2dc6873e2", size = 3610700 }, + { url = "https://files.pythonhosted.org/packages/fe/0a/4643ccc6bb8b143e9f9640aa54e38255f9d3b45feb2cbe7ae2ca47e8782e/lxml-6.0.2-cp313-cp313-win_amd64.whl", hash = "sha256:b30d46379644fbfc3ab81f8f82ae4de55179414651f110a1514f0b1f8f6cb2d7", size = 4010347 }, + { url = "https://files.pythonhosted.org/packages/31/ef/dcf1d29c3f530577f61e5fe2f1bd72929acf779953668a8a47a479ae6f26/lxml-6.0.2-cp313-cp313-win_arm64.whl", hash = "sha256:13dcecc9946dca97b11b7c40d29fba63b55ab4170d3c0cf8c0c164343b9bfdcf", size = 3671248 }, + { url = "https://files.pythonhosted.org/packages/03/15/d4a377b385ab693ce97b472fe0c77c2b16ec79590e688b3ccc71fba19884/lxml-6.0.2-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:b0c732aa23de8f8aec23f4b580d1e52905ef468afb4abeafd3fec77042abb6fe", size = 8659801 }, + { url = "https://files.pythonhosted.org/packages/c8/e8/c128e37589463668794d503afaeb003987373c5f94d667124ffd8078bbd9/lxml-6.0.2-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:4468e3b83e10e0317a89a33d28f7aeba1caa4d1a6fd457d115dd4ffe90c5931d", size = 4659403 }, + { url = "https://files.pythonhosted.org/packages/00/ce/74903904339decdf7da7847bb5741fc98a5451b42fc419a86c0c13d26fe2/lxml-6.0.2-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:abd44571493973bad4598a3be7e1d807ed45aa2adaf7ab92ab7c62609569b17d", size = 4966974 }, + { url = "https://files.pythonhosted.org/packages/1f/d3/131dec79ce61c5567fecf82515bd9bc36395df42501b50f7f7f3bd065df0/lxml-6.0.2-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:370cd78d5855cfbffd57c422851f7d3864e6ae72d0da615fca4dad8c45d375a5", size = 5102953 }, + { url = "https://files.pythonhosted.org/packages/3a/ea/a43ba9bb750d4ffdd885f2cd333572f5bb900cd2408b67fdda07e85978a0/lxml-6.0.2-cp314-cp314-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:901e3b4219fa04ef766885fb40fa516a71662a4c61b80c94d25336b4934b71c0", size = 5055054 }, + { url = "https://files.pythonhosted.org/packages/60/23/6885b451636ae286c34628f70a7ed1fcc759f8d9ad382d132e1c8d3d9bfd/lxml-6.0.2-cp314-cp314-manylinux_2_26_i686.manylinux_2_28_i686.whl", hash = "sha256:a4bf42d2e4cf52c28cc1812d62426b9503cdb0c87a6de81442626aa7d69707ba", size = 5352421 }, + { url = "https://files.pythonhosted.org/packages/48/5b/fc2ddfc94ddbe3eebb8e9af6e3fd65e2feba4967f6a4e9683875c394c2d8/lxml-6.0.2-cp314-cp314-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:b2c7fdaa4d7c3d886a42534adec7cfac73860b89b4e5298752f60aa5984641a0", size = 5673684 }, + { url = "https://files.pythonhosted.org/packages/29/9c/47293c58cc91769130fbf85531280e8cc7868f7fbb6d92f4670071b9cb3e/lxml-6.0.2-cp314-cp314-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:98a5e1660dc7de2200b00d53fa00bcd3c35a3608c305d45a7bbcaf29fa16e83d", size = 5252463 }, + { url = "https://files.pythonhosted.org/packages/9b/da/ba6eceb830c762b48e711ded880d7e3e89fc6c7323e587c36540b6b23c6b/lxml-6.0.2-cp314-cp314-manylinux_2_31_armv7l.whl", hash = "sha256:dc051506c30b609238d79eda75ee9cab3e520570ec8219844a72a46020901e37", size = 4698437 }, + { url = "https://files.pythonhosted.org/packages/a5/24/7be3f82cb7990b89118d944b619e53c656c97dc89c28cfb143fdb7cd6f4d/lxml-6.0.2-cp314-cp314-manylinux_2_38_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:8799481bbdd212470d17513a54d568f44416db01250f49449647b5ab5b5dccb9", size = 5269890 }, + { url = "https://files.pythonhosted.org/packages/1b/bd/dcfb9ea1e16c665efd7538fc5d5c34071276ce9220e234217682e7d2c4a5/lxml-6.0.2-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:9261bb77c2dab42f3ecd9103951aeca2c40277701eb7e912c545c1b16e0e4917", size = 5097185 }, + { url = "https://files.pythonhosted.org/packages/21/04/a60b0ff9314736316f28316b694bccbbabe100f8483ad83852d77fc7468e/lxml-6.0.2-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:65ac4a01aba353cfa6d5725b95d7aed6356ddc0a3cd734de00124d285b04b64f", size = 4745895 }, + { url = "https://files.pythonhosted.org/packages/d6/bd/7d54bd1846e5a310d9c715921c5faa71cf5c0853372adf78aee70c8d7aa2/lxml-6.0.2-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:b22a07cbb82fea98f8a2fd814f3d1811ff9ed76d0fc6abc84eb21527596e7cc8", size = 5695246 }, + { url = "https://files.pythonhosted.org/packages/fd/32/5643d6ab947bc371da21323acb2a6e603cedbe71cb4c99c8254289ab6f4e/lxml-6.0.2-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:d759cdd7f3e055d6bc8d9bec3ad905227b2e4c785dc16c372eb5b5e83123f48a", size = 5260797 }, + { url = "https://files.pythonhosted.org/packages/33/da/34c1ec4cff1eea7d0b4cd44af8411806ed943141804ac9c5d565302afb78/lxml-6.0.2-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:945da35a48d193d27c188037a05fec5492937f66fb1958c24fc761fb9d40d43c", size = 5277404 }, + { url = "https://files.pythonhosted.org/packages/82/57/4eca3e31e54dc89e2c3507e1cd411074a17565fa5ffc437c4ae0a00d439e/lxml-6.0.2-cp314-cp314-win32.whl", hash = "sha256:be3aaa60da67e6153eb15715cc2e19091af5dc75faef8b8a585aea372507384b", size = 3670072 }, + { url = "https://files.pythonhosted.org/packages/e3/e0/c96cf13eccd20c9421ba910304dae0f619724dcf1702864fd59dd386404d/lxml-6.0.2-cp314-cp314-win_amd64.whl", hash = "sha256:fa25afbadead523f7001caf0c2382afd272c315a033a7b06336da2637d92d6ed", size = 4080617 }, + { url = "https://files.pythonhosted.org/packages/d5/5d/b3f03e22b3d38d6f188ef044900a9b29b2fe0aebb94625ce9fe244011d34/lxml-6.0.2-cp314-cp314-win_arm64.whl", hash = "sha256:063eccf89df5b24e361b123e257e437f9e9878f425ee9aae3144c77faf6da6d8", size = 3754930 }, + { url = "https://files.pythonhosted.org/packages/5e/5c/42c2c4c03554580708fc738d13414801f340c04c3eff90d8d2d227145275/lxml-6.0.2-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:6162a86d86893d63084faaf4ff937b3daea233e3682fb4474db07395794fa80d", size = 8910380 }, + { url = "https://files.pythonhosted.org/packages/bf/4f/12df843e3e10d18d468a7557058f8d3733e8b6e12401f30b1ef29360740f/lxml-6.0.2-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:414aaa94e974e23a3e92e7ca5b97d10c0cf37b6481f50911032c69eeb3991bba", size = 4775632 }, + { url = "https://files.pythonhosted.org/packages/e4/0c/9dc31e6c2d0d418483cbcb469d1f5a582a1cd00a1f4081953d44051f3c50/lxml-6.0.2-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:48461bd21625458dd01e14e2c38dd0aea69addc3c4f960c30d9f59d7f93be601", size = 4975171 }, + { url = "https://files.pythonhosted.org/packages/e7/2b/9b870c6ca24c841bdd887504808f0417aa9d8d564114689266f19ddf29c8/lxml-6.0.2-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:25fcc59afc57d527cfc78a58f40ab4c9b8fd096a9a3f964d2781ffb6eb33f4ed", size = 5110109 }, + { url = "https://files.pythonhosted.org/packages/bf/0c/4f5f2a4dd319a178912751564471355d9019e220c20d7db3fb8307ed8582/lxml-6.0.2-cp314-cp314t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5179c60288204e6ddde3f774a93350177e08876eaf3ab78aa3a3649d43eb7d37", size = 5041061 }, + { url = "https://files.pythonhosted.org/packages/12/64/554eed290365267671fe001a20d72d14f468ae4e6acef1e179b039436967/lxml-6.0.2-cp314-cp314t-manylinux_2_26_i686.manylinux_2_28_i686.whl", hash = "sha256:967aab75434de148ec80597b75062d8123cadf2943fb4281f385141e18b21338", size = 5306233 }, + { url = "https://files.pythonhosted.org/packages/7a/31/1d748aa275e71802ad9722df32a7a35034246b42c0ecdd8235412c3396ef/lxml-6.0.2-cp314-cp314t-manylinux_2_26_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:d100fcc8930d697c6561156c6810ab4a508fb264c8b6779e6e61e2ed5e7558f9", size = 5604739 }, + { url = "https://files.pythonhosted.org/packages/8f/41/2c11916bcac09ed561adccacceaedd2bf0e0b25b297ea92aab99fd03d0fa/lxml-6.0.2-cp314-cp314t-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2ca59e7e13e5981175b8b3e4ab84d7da57993eeff53c07764dcebda0d0e64ecd", size = 5225119 }, + { url = "https://files.pythonhosted.org/packages/99/05/4e5c2873d8f17aa018e6afde417c80cc5d0c33be4854cce3ef5670c49367/lxml-6.0.2-cp314-cp314t-manylinux_2_31_armv7l.whl", hash = "sha256:957448ac63a42e2e49531b9d6c0fa449a1970dbc32467aaad46f11545be9af1d", size = 4633665 }, + { url = "https://files.pythonhosted.org/packages/0f/c9/dcc2da1bebd6275cdc723b515f93edf548b82f36a5458cca3578bc899332/lxml-6.0.2-cp314-cp314t-manylinux_2_38_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:b7fc49c37f1786284b12af63152fe1d0990722497e2d5817acfe7a877522f9a9", size = 5234997 }, + { url = "https://files.pythonhosted.org/packages/9c/e2/5172e4e7468afca64a37b81dba152fc5d90e30f9c83c7c3213d6a02a5ce4/lxml-6.0.2-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:e19e0643cc936a22e837f79d01a550678da8377d7d801a14487c10c34ee49c7e", size = 5090957 }, + { url = "https://files.pythonhosted.org/packages/a5/b3/15461fd3e5cd4ddcb7938b87fc20b14ab113b92312fc97afe65cd7c85de1/lxml-6.0.2-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:1db01e5cf14345628e0cbe71067204db658e2fb8e51e7f33631f5f4735fefd8d", size = 4764372 }, + { url = "https://files.pythonhosted.org/packages/05/33/f310b987c8bf9e61c4dd8e8035c416bd3230098f5e3cfa69fc4232de7059/lxml-6.0.2-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:875c6b5ab39ad5291588aed6925fac99d0097af0dd62f33c7b43736043d4a2ec", size = 5634653 }, + { url = "https://files.pythonhosted.org/packages/70/ff/51c80e75e0bc9382158133bdcf4e339b5886c6ee2418b5199b3f1a61ed6d/lxml-6.0.2-cp314-cp314t-musllinux_1_2_riscv64.whl", hash = "sha256:cdcbed9ad19da81c480dfd6dd161886db6096083c9938ead313d94b30aadf272", size = 5233795 }, + { url = "https://files.pythonhosted.org/packages/56/4d/4856e897df0d588789dd844dbed9d91782c4ef0b327f96ce53c807e13128/lxml-6.0.2-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:80dadc234ebc532e09be1975ff538d154a7fa61ea5031c03d25178855544728f", size = 5257023 }, + { url = "https://files.pythonhosted.org/packages/0f/85/86766dfebfa87bea0ab78e9ff7a4b4b45225df4b4d3b8cc3c03c5cd68464/lxml-6.0.2-cp314-cp314t-win32.whl", hash = "sha256:da08e7bb297b04e893d91087df19638dc7a6bb858a954b0cc2b9f5053c922312", size = 3911420 }, + { url = "https://files.pythonhosted.org/packages/fe/1a/b248b355834c8e32614650b8008c69ffeb0ceb149c793961dd8c0b991bb3/lxml-6.0.2-cp314-cp314t-win_amd64.whl", hash = "sha256:252a22982dca42f6155125ac76d3432e548a7625d56f5a273ee78a5057216eca", size = 4406837 }, + { url = "https://files.pythonhosted.org/packages/92/aa/df863bcc39c5e0946263454aba394de8a9084dbaff8ad143846b0d844739/lxml-6.0.2-cp314-cp314t-win_arm64.whl", hash = "sha256:bb4c1847b303835d89d785a18801a883436cdfd5dc3d62947f9c49e24f0f5a2c", size = 3822205 }, + { url = "https://files.pythonhosted.org/packages/0b/11/29d08bc103a62c0eba8016e7ed5aeebbf1e4312e83b0b1648dd203b0e87d/lxml-6.0.2-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:1c06035eafa8404b5cf475bb37a9f6088b0aca288d4ccc9d69389750d5543700", size = 3949829 }, + { url = "https://files.pythonhosted.org/packages/12/b3/52ab9a3b31e5ab8238da241baa19eec44d2ab426532441ee607165aebb52/lxml-6.0.2-pp311-pypy311_pp73-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:c7d13103045de1bdd6fe5d61802565f1a3537d70cd3abf596aa0af62761921ee", size = 4226277 }, + { url = "https://files.pythonhosted.org/packages/a0/33/1eaf780c1baad88224611df13b1c2a9dfa460b526cacfe769103ff50d845/lxml-6.0.2-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:0a3c150a95fbe5ac91de323aa756219ef9cf7fde5a3f00e2281e30f33fa5fa4f", size = 4330433 }, + { url = "https://files.pythonhosted.org/packages/7a/c1/27428a2ff348e994ab4f8777d3a0ad510b6b92d37718e5887d2da99952a2/lxml-6.0.2-pp311-pypy311_pp73-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:60fa43be34f78bebb27812ed90f1925ec99560b0fa1decdb7d12b84d857d31e9", size = 4272119 }, + { url = "https://files.pythonhosted.org/packages/f0/d0/3020fa12bcec4ab62f97aab026d57c2f0cfd480a558758d9ca233bb6a79d/lxml-6.0.2-pp311-pypy311_pp73-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:21c73b476d3cfe836be731225ec3421fa2f048d84f6df6a8e70433dff1376d5a", size = 4417314 }, + { url = "https://files.pythonhosted.org/packages/6c/77/d7f491cbc05303ac6801651aabeb262d43f319288c1ea96c66b1d2692ff3/lxml-6.0.2-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:27220da5be049e936c3aca06f174e8827ca6445a4353a1995584311487fc4e3e", size = 3518768 }, ] [[package]] @@ -1620,83 +1630,83 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "mdurl" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/38/71/3b932df36c1a044d397a1f92d1cf91ee0a503d91e470cbd670aa66b07ed0/markdown-it-py-3.0.0.tar.gz", hash = "sha256:e3f60a94fa066dc52ec76661e37c851cb232d92f9886b15cb560aaada2df8feb", size = 74596, upload-time = "2023-06-03T06:41:14.443Z" } +sdist = { url = "https://files.pythonhosted.org/packages/38/71/3b932df36c1a044d397a1f92d1cf91ee0a503d91e470cbd670aa66b07ed0/markdown-it-py-3.0.0.tar.gz", hash = "sha256:e3f60a94fa066dc52ec76661e37c851cb232d92f9886b15cb560aaada2df8feb", size = 74596 } wheels = [ - { url = "https://files.pythonhosted.org/packages/42/d7/1ec15b46af6af88f19b8e5ffea08fa375d433c998b8a7639e76935c14f1f/markdown_it_py-3.0.0-py3-none-any.whl", hash = "sha256:355216845c60bd96232cd8d8c40e8f9765cc86f46880e43a8fd22dc1a1a8cab1", size = 87528, upload-time = "2023-06-03T06:41:11.019Z" }, + { url = "https://files.pythonhosted.org/packages/42/d7/1ec15b46af6af88f19b8e5ffea08fa375d433c998b8a7639e76935c14f1f/markdown_it_py-3.0.0-py3-none-any.whl", hash = "sha256:355216845c60bd96232cd8d8c40e8f9765cc86f46880e43a8fd22dc1a1a8cab1", size = 87528 }, ] [[package]] name = "markupsafe" version = "3.0.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/7e/99/7690b6d4034fffd95959cbe0c02de8deb3098cc577c67bb6a24fe5d7caa7/markupsafe-3.0.3.tar.gz", hash = "sha256:722695808f4b6457b320fdc131280796bdceb04ab50fe1795cd540799ebe1698", size = 80313, upload-time = "2025-09-27T18:37:40.426Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/08/db/fefacb2136439fc8dd20e797950e749aa1f4997ed584c62cfb8ef7c2be0e/markupsafe-3.0.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:1cc7ea17a6824959616c525620e387f6dd30fec8cb44f649e31712db02123dad", size = 11631, upload-time = "2025-09-27T18:36:18.185Z" }, - { url = "https://files.pythonhosted.org/packages/e1/2e/5898933336b61975ce9dc04decbc0a7f2fee78c30353c5efba7f2d6ff27a/markupsafe-3.0.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:4bd4cd07944443f5a265608cc6aab442e4f74dff8088b0dfc8238647b8f6ae9a", size = 12058, upload-time = "2025-09-27T18:36:19.444Z" }, - { url = "https://files.pythonhosted.org/packages/1d/09/adf2df3699d87d1d8184038df46a9c80d78c0148492323f4693df54e17bb/markupsafe-3.0.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6b5420a1d9450023228968e7e6a9ce57f65d148ab56d2313fcd589eee96a7a50", size = 24287, upload-time = "2025-09-27T18:36:20.768Z" }, - { url = "https://files.pythonhosted.org/packages/30/ac/0273f6fcb5f42e314c6d8cd99effae6a5354604d461b8d392b5ec9530a54/markupsafe-3.0.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0bf2a864d67e76e5c9a34dc26ec616a66b9888e25e7b9460e1c76d3293bd9dbf", size = 22940, upload-time = "2025-09-27T18:36:22.249Z" }, - { url = "https://files.pythonhosted.org/packages/19/ae/31c1be199ef767124c042c6c3e904da327a2f7f0cd63a0337e1eca2967a8/markupsafe-3.0.3-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:bc51efed119bc9cfdf792cdeaa4d67e8f6fcccab66ed4bfdd6bde3e59bfcbb2f", size = 21887, upload-time = "2025-09-27T18:36:23.535Z" }, - { url = "https://files.pythonhosted.org/packages/b2/76/7edcab99d5349a4532a459e1fe64f0b0467a3365056ae550d3bcf3f79e1e/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:068f375c472b3e7acbe2d5318dea141359e6900156b5b2ba06a30b169086b91a", size = 23692, upload-time = "2025-09-27T18:36:24.823Z" }, - { url = "https://files.pythonhosted.org/packages/a4/28/6e74cdd26d7514849143d69f0bf2399f929c37dc2b31e6829fd2045b2765/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:7be7b61bb172e1ed687f1754f8e7484f1c8019780f6f6b0786e76bb01c2ae115", size = 21471, upload-time = "2025-09-27T18:36:25.95Z" }, - { url = "https://files.pythonhosted.org/packages/62/7e/a145f36a5c2945673e590850a6f8014318d5577ed7e5920a4b3448e0865d/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:f9e130248f4462aaa8e2552d547f36ddadbeaa573879158d721bbd33dfe4743a", size = 22923, upload-time = "2025-09-27T18:36:27.109Z" }, - { url = "https://files.pythonhosted.org/packages/0f/62/d9c46a7f5c9adbeeeda52f5b8d802e1094e9717705a645efc71b0913a0a8/markupsafe-3.0.3-cp311-cp311-win32.whl", hash = "sha256:0db14f5dafddbb6d9208827849fad01f1a2609380add406671a26386cdf15a19", size = 14572, upload-time = "2025-09-27T18:36:28.045Z" }, - { url = "https://files.pythonhosted.org/packages/83/8a/4414c03d3f891739326e1783338e48fb49781cc915b2e0ee052aa490d586/markupsafe-3.0.3-cp311-cp311-win_amd64.whl", hash = "sha256:de8a88e63464af587c950061a5e6a67d3632e36df62b986892331d4620a35c01", size = 15077, upload-time = "2025-09-27T18:36:29.025Z" }, - { url = "https://files.pythonhosted.org/packages/35/73/893072b42e6862f319b5207adc9ae06070f095b358655f077f69a35601f0/markupsafe-3.0.3-cp311-cp311-win_arm64.whl", hash = "sha256:3b562dd9e9ea93f13d53989d23a7e775fdfd1066c33494ff43f5418bc8c58a5c", size = 13876, upload-time = "2025-09-27T18:36:29.954Z" }, - { url = "https://files.pythonhosted.org/packages/5a/72/147da192e38635ada20e0a2e1a51cf8823d2119ce8883f7053879c2199b5/markupsafe-3.0.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:d53197da72cc091b024dd97249dfc7794d6a56530370992a5e1a08983ad9230e", size = 11615, upload-time = "2025-09-27T18:36:30.854Z" }, - { url = "https://files.pythonhosted.org/packages/9a/81/7e4e08678a1f98521201c3079f77db69fb552acd56067661f8c2f534a718/markupsafe-3.0.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:1872df69a4de6aead3491198eaf13810b565bdbeec3ae2dc8780f14458ec73ce", size = 12020, upload-time = "2025-09-27T18:36:31.971Z" }, - { url = "https://files.pythonhosted.org/packages/1e/2c/799f4742efc39633a1b54a92eec4082e4f815314869865d876824c257c1e/markupsafe-3.0.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3a7e8ae81ae39e62a41ec302f972ba6ae23a5c5396c8e60113e9066ef893da0d", size = 24332, upload-time = "2025-09-27T18:36:32.813Z" }, - { url = "https://files.pythonhosted.org/packages/3c/2e/8d0c2ab90a8c1d9a24f0399058ab8519a3279d1bd4289511d74e909f060e/markupsafe-3.0.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d6dd0be5b5b189d31db7cda48b91d7e0a9795f31430b7f271219ab30f1d3ac9d", size = 22947, upload-time = "2025-09-27T18:36:33.86Z" }, - { url = "https://files.pythonhosted.org/packages/2c/54/887f3092a85238093a0b2154bd629c89444f395618842e8b0c41783898ea/markupsafe-3.0.3-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:94c6f0bb423f739146aec64595853541634bde58b2135f27f61c1ffd1cd4d16a", size = 21962, upload-time = "2025-09-27T18:36:35.099Z" }, - { url = "https://files.pythonhosted.org/packages/c9/2f/336b8c7b6f4a4d95e91119dc8521402461b74a485558d8f238a68312f11c/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:be8813b57049a7dc738189df53d69395eba14fb99345e0a5994914a3864c8a4b", size = 23760, upload-time = "2025-09-27T18:36:36.001Z" }, - { url = "https://files.pythonhosted.org/packages/32/43/67935f2b7e4982ffb50a4d169b724d74b62a3964bc1a9a527f5ac4f1ee2b/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:83891d0e9fb81a825d9a6d61e3f07550ca70a076484292a70fde82c4b807286f", size = 21529, upload-time = "2025-09-27T18:36:36.906Z" }, - { url = "https://files.pythonhosted.org/packages/89/e0/4486f11e51bbba8b0c041098859e869e304d1c261e59244baa3d295d47b7/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:77f0643abe7495da77fb436f50f8dab76dbc6e5fd25d39589a0f1fe6548bfa2b", size = 23015, upload-time = "2025-09-27T18:36:37.868Z" }, - { url = "https://files.pythonhosted.org/packages/2f/e1/78ee7a023dac597a5825441ebd17170785a9dab23de95d2c7508ade94e0e/markupsafe-3.0.3-cp312-cp312-win32.whl", hash = "sha256:d88b440e37a16e651bda4c7c2b930eb586fd15ca7406cb39e211fcff3bf3017d", size = 14540, upload-time = "2025-09-27T18:36:38.761Z" }, - { url = "https://files.pythonhosted.org/packages/aa/5b/bec5aa9bbbb2c946ca2733ef9c4ca91c91b6a24580193e891b5f7dbe8e1e/markupsafe-3.0.3-cp312-cp312-win_amd64.whl", hash = "sha256:26a5784ded40c9e318cfc2bdb30fe164bdb8665ded9cd64d500a34fb42067b1c", size = 15105, upload-time = "2025-09-27T18:36:39.701Z" }, - { url = "https://files.pythonhosted.org/packages/e5/f1/216fc1bbfd74011693a4fd837e7026152e89c4bcf3e77b6692fba9923123/markupsafe-3.0.3-cp312-cp312-win_arm64.whl", hash = "sha256:35add3b638a5d900e807944a078b51922212fb3dedb01633a8defc4b01a3c85f", size = 13906, upload-time = "2025-09-27T18:36:40.689Z" }, - { url = "https://files.pythonhosted.org/packages/38/2f/907b9c7bbba283e68f20259574b13d005c121a0fa4c175f9bed27c4597ff/markupsafe-3.0.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:e1cf1972137e83c5d4c136c43ced9ac51d0e124706ee1c8aa8532c1287fa8795", size = 11622, upload-time = "2025-09-27T18:36:41.777Z" }, - { url = "https://files.pythonhosted.org/packages/9c/d9/5f7756922cdd676869eca1c4e3c0cd0df60ed30199ffd775e319089cb3ed/markupsafe-3.0.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:116bb52f642a37c115f517494ea5feb03889e04df47eeff5b130b1808ce7c219", size = 12029, upload-time = "2025-09-27T18:36:43.257Z" }, - { url = "https://files.pythonhosted.org/packages/00/07/575a68c754943058c78f30db02ee03a64b3c638586fba6a6dd56830b30a3/markupsafe-3.0.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:133a43e73a802c5562be9bbcd03d090aa5a1fe899db609c29e8c8d815c5f6de6", size = 24374, upload-time = "2025-09-27T18:36:44.508Z" }, - { url = "https://files.pythonhosted.org/packages/a9/21/9b05698b46f218fc0e118e1f8168395c65c8a2c750ae2bab54fc4bd4e0e8/markupsafe-3.0.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ccfcd093f13f0f0b7fdd0f198b90053bf7b2f02a3927a30e63f3ccc9df56b676", size = 22980, upload-time = "2025-09-27T18:36:45.385Z" }, - { url = "https://files.pythonhosted.org/packages/7f/71/544260864f893f18b6827315b988c146b559391e6e7e8f7252839b1b846a/markupsafe-3.0.3-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:509fa21c6deb7a7a273d629cf5ec029bc209d1a51178615ddf718f5918992ab9", size = 21990, upload-time = "2025-09-27T18:36:46.916Z" }, - { url = "https://files.pythonhosted.org/packages/c2/28/b50fc2f74d1ad761af2f5dcce7492648b983d00a65b8c0e0cb457c82ebbe/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:a4afe79fb3de0b7097d81da19090f4df4f8d3a2b3adaa8764138aac2e44f3af1", size = 23784, upload-time = "2025-09-27T18:36:47.884Z" }, - { url = "https://files.pythonhosted.org/packages/ed/76/104b2aa106a208da8b17a2fb72e033a5a9d7073c68f7e508b94916ed47a9/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:795e7751525cae078558e679d646ae45574b47ed6e7771863fcc079a6171a0fc", size = 21588, upload-time = "2025-09-27T18:36:48.82Z" }, - { url = "https://files.pythonhosted.org/packages/b5/99/16a5eb2d140087ebd97180d95249b00a03aa87e29cc224056274f2e45fd6/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:8485f406a96febb5140bfeca44a73e3ce5116b2501ac54fe953e488fb1d03b12", size = 23041, upload-time = "2025-09-27T18:36:49.797Z" }, - { url = "https://files.pythonhosted.org/packages/19/bc/e7140ed90c5d61d77cea142eed9f9c303f4c4806f60a1044c13e3f1471d0/markupsafe-3.0.3-cp313-cp313-win32.whl", hash = "sha256:bdd37121970bfd8be76c5fb069c7751683bdf373db1ed6c010162b2a130248ed", size = 14543, upload-time = "2025-09-27T18:36:51.584Z" }, - { url = "https://files.pythonhosted.org/packages/05/73/c4abe620b841b6b791f2edc248f556900667a5a1cf023a6646967ae98335/markupsafe-3.0.3-cp313-cp313-win_amd64.whl", hash = "sha256:9a1abfdc021a164803f4d485104931fb8f8c1efd55bc6b748d2f5774e78b62c5", size = 15113, upload-time = "2025-09-27T18:36:52.537Z" }, - { url = "https://files.pythonhosted.org/packages/f0/3a/fa34a0f7cfef23cf9500d68cb7c32dd64ffd58a12b09225fb03dd37d5b80/markupsafe-3.0.3-cp313-cp313-win_arm64.whl", hash = "sha256:7e68f88e5b8799aa49c85cd116c932a1ac15caaa3f5db09087854d218359e485", size = 13911, upload-time = "2025-09-27T18:36:53.513Z" }, - { url = "https://files.pythonhosted.org/packages/e4/d7/e05cd7efe43a88a17a37b3ae96e79a19e846f3f456fe79c57ca61356ef01/markupsafe-3.0.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:218551f6df4868a8d527e3062d0fb968682fe92054e89978594c28e642c43a73", size = 11658, upload-time = "2025-09-27T18:36:54.819Z" }, - { url = "https://files.pythonhosted.org/packages/99/9e/e412117548182ce2148bdeacdda3bb494260c0b0184360fe0d56389b523b/markupsafe-3.0.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:3524b778fe5cfb3452a09d31e7b5adefeea8c5be1d43c4f810ba09f2ceb29d37", size = 12066, upload-time = "2025-09-27T18:36:55.714Z" }, - { url = "https://files.pythonhosted.org/packages/bc/e6/fa0ffcda717ef64a5108eaa7b4f5ed28d56122c9a6d70ab8b72f9f715c80/markupsafe-3.0.3-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4e885a3d1efa2eadc93c894a21770e4bc67899e3543680313b09f139e149ab19", size = 25639, upload-time = "2025-09-27T18:36:56.908Z" }, - { url = "https://files.pythonhosted.org/packages/96/ec/2102e881fe9d25fc16cb4b25d5f5cde50970967ffa5dddafdb771237062d/markupsafe-3.0.3-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8709b08f4a89aa7586de0aadc8da56180242ee0ada3999749b183aa23df95025", size = 23569, upload-time = "2025-09-27T18:36:57.913Z" }, - { url = "https://files.pythonhosted.org/packages/4b/30/6f2fce1f1f205fc9323255b216ca8a235b15860c34b6798f810f05828e32/markupsafe-3.0.3-cp313-cp313t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:b8512a91625c9b3da6f127803b166b629725e68af71f8184ae7e7d54686a56d6", size = 23284, upload-time = "2025-09-27T18:36:58.833Z" }, - { url = "https://files.pythonhosted.org/packages/58/47/4a0ccea4ab9f5dcb6f79c0236d954acb382202721e704223a8aafa38b5c8/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:9b79b7a16f7fedff2495d684f2b59b0457c3b493778c9eed31111be64d58279f", size = 24801, upload-time = "2025-09-27T18:36:59.739Z" }, - { url = "https://files.pythonhosted.org/packages/6a/70/3780e9b72180b6fecb83a4814d84c3bf4b4ae4bf0b19c27196104149734c/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_riscv64.whl", hash = "sha256:12c63dfb4a98206f045aa9563db46507995f7ef6d83b2f68eda65c307c6829eb", size = 22769, upload-time = "2025-09-27T18:37:00.719Z" }, - { url = "https://files.pythonhosted.org/packages/98/c5/c03c7f4125180fc215220c035beac6b9cb684bc7a067c84fc69414d315f5/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:8f71bc33915be5186016f675cd83a1e08523649b0e33efdb898db577ef5bb009", size = 23642, upload-time = "2025-09-27T18:37:01.673Z" }, - { url = "https://files.pythonhosted.org/packages/80/d6/2d1b89f6ca4bff1036499b1e29a1d02d282259f3681540e16563f27ebc23/markupsafe-3.0.3-cp313-cp313t-win32.whl", hash = "sha256:69c0b73548bc525c8cb9a251cddf1931d1db4d2258e9599c28c07ef3580ef354", size = 14612, upload-time = "2025-09-27T18:37:02.639Z" }, - { url = "https://files.pythonhosted.org/packages/2b/98/e48a4bfba0a0ffcf9925fe2d69240bfaa19c6f7507b8cd09c70684a53c1e/markupsafe-3.0.3-cp313-cp313t-win_amd64.whl", hash = "sha256:1b4b79e8ebf6b55351f0d91fe80f893b4743f104bff22e90697db1590e47a218", size = 15200, upload-time = "2025-09-27T18:37:03.582Z" }, - { url = "https://files.pythonhosted.org/packages/0e/72/e3cc540f351f316e9ed0f092757459afbc595824ca724cbc5a5d4263713f/markupsafe-3.0.3-cp313-cp313t-win_arm64.whl", hash = "sha256:ad2cf8aa28b8c020ab2fc8287b0f823d0a7d8630784c31e9ee5edea20f406287", size = 13973, upload-time = "2025-09-27T18:37:04.929Z" }, - { url = "https://files.pythonhosted.org/packages/33/8a/8e42d4838cd89b7dde187011e97fe6c3af66d8c044997d2183fbd6d31352/markupsafe-3.0.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:eaa9599de571d72e2daf60164784109f19978b327a3910d3e9de8c97b5b70cfe", size = 11619, upload-time = "2025-09-27T18:37:06.342Z" }, - { url = "https://files.pythonhosted.org/packages/b5/64/7660f8a4a8e53c924d0fa05dc3a55c9cee10bbd82b11c5afb27d44b096ce/markupsafe-3.0.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:c47a551199eb8eb2121d4f0f15ae0f923d31350ab9280078d1e5f12b249e0026", size = 12029, upload-time = "2025-09-27T18:37:07.213Z" }, - { url = "https://files.pythonhosted.org/packages/da/ef/e648bfd021127bef5fa12e1720ffed0c6cbb8310c8d9bea7266337ff06de/markupsafe-3.0.3-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f34c41761022dd093b4b6896d4810782ffbabe30f2d443ff5f083e0cbbb8c737", size = 24408, upload-time = "2025-09-27T18:37:09.572Z" }, - { url = "https://files.pythonhosted.org/packages/41/3c/a36c2450754618e62008bf7435ccb0f88053e07592e6028a34776213d877/markupsafe-3.0.3-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:457a69a9577064c05a97c41f4e65148652db078a3a509039e64d3467b9e7ef97", size = 23005, upload-time = "2025-09-27T18:37:10.58Z" }, - { url = "https://files.pythonhosted.org/packages/bc/20/b7fdf89a8456b099837cd1dc21974632a02a999ec9bf7ca3e490aacd98e7/markupsafe-3.0.3-cp314-cp314-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:e8afc3f2ccfa24215f8cb28dcf43f0113ac3c37c2f0f0806d8c70e4228c5cf4d", size = 22048, upload-time = "2025-09-27T18:37:11.547Z" }, - { url = "https://files.pythonhosted.org/packages/9a/a7/591f592afdc734f47db08a75793a55d7fbcc6902a723ae4cfbab61010cc5/markupsafe-3.0.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:ec15a59cf5af7be74194f7ab02d0f59a62bdcf1a537677ce67a2537c9b87fcda", size = 23821, upload-time = "2025-09-27T18:37:12.48Z" }, - { url = "https://files.pythonhosted.org/packages/7d/33/45b24e4f44195b26521bc6f1a82197118f74df348556594bd2262bda1038/markupsafe-3.0.3-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:0eb9ff8191e8498cca014656ae6b8d61f39da5f95b488805da4bb029cccbfbaf", size = 21606, upload-time = "2025-09-27T18:37:13.485Z" }, - { url = "https://files.pythonhosted.org/packages/ff/0e/53dfaca23a69fbfbbf17a4b64072090e70717344c52eaaaa9c5ddff1e5f0/markupsafe-3.0.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:2713baf880df847f2bece4230d4d094280f4e67b1e813eec43b4c0e144a34ffe", size = 23043, upload-time = "2025-09-27T18:37:14.408Z" }, - { url = "https://files.pythonhosted.org/packages/46/11/f333a06fc16236d5238bfe74daccbca41459dcd8d1fa952e8fbd5dccfb70/markupsafe-3.0.3-cp314-cp314-win32.whl", hash = "sha256:729586769a26dbceff69f7a7dbbf59ab6572b99d94576a5592625d5b411576b9", size = 14747, upload-time = "2025-09-27T18:37:15.36Z" }, - { url = "https://files.pythonhosted.org/packages/28/52/182836104b33b444e400b14f797212f720cbc9ed6ba34c800639d154e821/markupsafe-3.0.3-cp314-cp314-win_amd64.whl", hash = "sha256:bdc919ead48f234740ad807933cdf545180bfbe9342c2bb451556db2ed958581", size = 15341, upload-time = "2025-09-27T18:37:16.496Z" }, - { url = "https://files.pythonhosted.org/packages/6f/18/acf23e91bd94fd7b3031558b1f013adfa21a8e407a3fdb32745538730382/markupsafe-3.0.3-cp314-cp314-win_arm64.whl", hash = "sha256:5a7d5dc5140555cf21a6fefbdbf8723f06fcd2f63ef108f2854de715e4422cb4", size = 14073, upload-time = "2025-09-27T18:37:17.476Z" }, - { url = "https://files.pythonhosted.org/packages/3c/f0/57689aa4076e1b43b15fdfa646b04653969d50cf30c32a102762be2485da/markupsafe-3.0.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:1353ef0c1b138e1907ae78e2f6c63ff67501122006b0f9abad68fda5f4ffc6ab", size = 11661, upload-time = "2025-09-27T18:37:18.453Z" }, - { url = "https://files.pythonhosted.org/packages/89/c3/2e67a7ca217c6912985ec766c6393b636fb0c2344443ff9d91404dc4c79f/markupsafe-3.0.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:1085e7fbddd3be5f89cc898938f42c0b3c711fdcb37d75221de2666af647c175", size = 12069, upload-time = "2025-09-27T18:37:19.332Z" }, - { url = "https://files.pythonhosted.org/packages/f0/00/be561dce4e6ca66b15276e184ce4b8aec61fe83662cce2f7d72bd3249d28/markupsafe-3.0.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1b52b4fb9df4eb9ae465f8d0c228a00624de2334f216f178a995ccdcf82c4634", size = 25670, upload-time = "2025-09-27T18:37:20.245Z" }, - { url = "https://files.pythonhosted.org/packages/50/09/c419f6f5a92e5fadde27efd190eca90f05e1261b10dbd8cbcb39cd8ea1dc/markupsafe-3.0.3-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fed51ac40f757d41b7c48425901843666a6677e3e8eb0abcff09e4ba6e664f50", size = 23598, upload-time = "2025-09-27T18:37:21.177Z" }, - { url = "https://files.pythonhosted.org/packages/22/44/a0681611106e0b2921b3033fc19bc53323e0b50bc70cffdd19f7d679bb66/markupsafe-3.0.3-cp314-cp314t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:f190daf01f13c72eac4efd5c430a8de82489d9cff23c364c3ea822545032993e", size = 23261, upload-time = "2025-09-27T18:37:22.167Z" }, - { url = "https://files.pythonhosted.org/packages/5f/57/1b0b3f100259dc9fffe780cfb60d4be71375510e435efec3d116b6436d43/markupsafe-3.0.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:e56b7d45a839a697b5eb268c82a71bd8c7f6c94d6fd50c3d577fa39a9f1409f5", size = 24835, upload-time = "2025-09-27T18:37:23.296Z" }, - { url = "https://files.pythonhosted.org/packages/26/6a/4bf6d0c97c4920f1597cc14dd720705eca0bf7c787aebc6bb4d1bead5388/markupsafe-3.0.3-cp314-cp314t-musllinux_1_2_riscv64.whl", hash = "sha256:f3e98bb3798ead92273dc0e5fd0f31ade220f59a266ffd8a4f6065e0a3ce0523", size = 22733, upload-time = "2025-09-27T18:37:24.237Z" }, - { url = "https://files.pythonhosted.org/packages/14/c7/ca723101509b518797fedc2fdf79ba57f886b4aca8a7d31857ba3ee8281f/markupsafe-3.0.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:5678211cb9333a6468fb8d8be0305520aa073f50d17f089b5b4b477ea6e67fdc", size = 23672, upload-time = "2025-09-27T18:37:25.271Z" }, - { url = "https://files.pythonhosted.org/packages/fb/df/5bd7a48c256faecd1d36edc13133e51397e41b73bb77e1a69deab746ebac/markupsafe-3.0.3-cp314-cp314t-win32.whl", hash = "sha256:915c04ba3851909ce68ccc2b8e2cd691618c4dc4c4232fb7982bca3f41fd8c3d", size = 14819, upload-time = "2025-09-27T18:37:26.285Z" }, - { url = "https://files.pythonhosted.org/packages/1a/8a/0402ba61a2f16038b48b39bccca271134be00c5c9f0f623208399333c448/markupsafe-3.0.3-cp314-cp314t-win_amd64.whl", hash = "sha256:4faffd047e07c38848ce017e8725090413cd80cbc23d86e55c587bf979e579c9", size = 15426, upload-time = "2025-09-27T18:37:27.316Z" }, - { url = "https://files.pythonhosted.org/packages/70/bc/6f1c2f612465f5fa89b95bead1f44dcb607670fd42891d8fdcd5d039f4f4/markupsafe-3.0.3-cp314-cp314t-win_arm64.whl", hash = "sha256:32001d6a8fc98c8cb5c947787c5d08b0a50663d139f1305bac5885d98d9b40fa", size = 14146, upload-time = "2025-09-27T18:37:28.327Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/7e/99/7690b6d4034fffd95959cbe0c02de8deb3098cc577c67bb6a24fe5d7caa7/markupsafe-3.0.3.tar.gz", hash = "sha256:722695808f4b6457b320fdc131280796bdceb04ab50fe1795cd540799ebe1698", size = 80313 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/08/db/fefacb2136439fc8dd20e797950e749aa1f4997ed584c62cfb8ef7c2be0e/markupsafe-3.0.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:1cc7ea17a6824959616c525620e387f6dd30fec8cb44f649e31712db02123dad", size = 11631 }, + { url = "https://files.pythonhosted.org/packages/e1/2e/5898933336b61975ce9dc04decbc0a7f2fee78c30353c5efba7f2d6ff27a/markupsafe-3.0.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:4bd4cd07944443f5a265608cc6aab442e4f74dff8088b0dfc8238647b8f6ae9a", size = 12058 }, + { url = "https://files.pythonhosted.org/packages/1d/09/adf2df3699d87d1d8184038df46a9c80d78c0148492323f4693df54e17bb/markupsafe-3.0.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6b5420a1d9450023228968e7e6a9ce57f65d148ab56d2313fcd589eee96a7a50", size = 24287 }, + { url = "https://files.pythonhosted.org/packages/30/ac/0273f6fcb5f42e314c6d8cd99effae6a5354604d461b8d392b5ec9530a54/markupsafe-3.0.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0bf2a864d67e76e5c9a34dc26ec616a66b9888e25e7b9460e1c76d3293bd9dbf", size = 22940 }, + { url = "https://files.pythonhosted.org/packages/19/ae/31c1be199ef767124c042c6c3e904da327a2f7f0cd63a0337e1eca2967a8/markupsafe-3.0.3-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:bc51efed119bc9cfdf792cdeaa4d67e8f6fcccab66ed4bfdd6bde3e59bfcbb2f", size = 21887 }, + { url = "https://files.pythonhosted.org/packages/b2/76/7edcab99d5349a4532a459e1fe64f0b0467a3365056ae550d3bcf3f79e1e/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:068f375c472b3e7acbe2d5318dea141359e6900156b5b2ba06a30b169086b91a", size = 23692 }, + { url = "https://files.pythonhosted.org/packages/a4/28/6e74cdd26d7514849143d69f0bf2399f929c37dc2b31e6829fd2045b2765/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:7be7b61bb172e1ed687f1754f8e7484f1c8019780f6f6b0786e76bb01c2ae115", size = 21471 }, + { url = "https://files.pythonhosted.org/packages/62/7e/a145f36a5c2945673e590850a6f8014318d5577ed7e5920a4b3448e0865d/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:f9e130248f4462aaa8e2552d547f36ddadbeaa573879158d721bbd33dfe4743a", size = 22923 }, + { url = "https://files.pythonhosted.org/packages/0f/62/d9c46a7f5c9adbeeeda52f5b8d802e1094e9717705a645efc71b0913a0a8/markupsafe-3.0.3-cp311-cp311-win32.whl", hash = "sha256:0db14f5dafddbb6d9208827849fad01f1a2609380add406671a26386cdf15a19", size = 14572 }, + { url = "https://files.pythonhosted.org/packages/83/8a/4414c03d3f891739326e1783338e48fb49781cc915b2e0ee052aa490d586/markupsafe-3.0.3-cp311-cp311-win_amd64.whl", hash = "sha256:de8a88e63464af587c950061a5e6a67d3632e36df62b986892331d4620a35c01", size = 15077 }, + { url = "https://files.pythonhosted.org/packages/35/73/893072b42e6862f319b5207adc9ae06070f095b358655f077f69a35601f0/markupsafe-3.0.3-cp311-cp311-win_arm64.whl", hash = "sha256:3b562dd9e9ea93f13d53989d23a7e775fdfd1066c33494ff43f5418bc8c58a5c", size = 13876 }, + { url = "https://files.pythonhosted.org/packages/5a/72/147da192e38635ada20e0a2e1a51cf8823d2119ce8883f7053879c2199b5/markupsafe-3.0.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:d53197da72cc091b024dd97249dfc7794d6a56530370992a5e1a08983ad9230e", size = 11615 }, + { url = "https://files.pythonhosted.org/packages/9a/81/7e4e08678a1f98521201c3079f77db69fb552acd56067661f8c2f534a718/markupsafe-3.0.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:1872df69a4de6aead3491198eaf13810b565bdbeec3ae2dc8780f14458ec73ce", size = 12020 }, + { url = "https://files.pythonhosted.org/packages/1e/2c/799f4742efc39633a1b54a92eec4082e4f815314869865d876824c257c1e/markupsafe-3.0.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3a7e8ae81ae39e62a41ec302f972ba6ae23a5c5396c8e60113e9066ef893da0d", size = 24332 }, + { url = "https://files.pythonhosted.org/packages/3c/2e/8d0c2ab90a8c1d9a24f0399058ab8519a3279d1bd4289511d74e909f060e/markupsafe-3.0.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d6dd0be5b5b189d31db7cda48b91d7e0a9795f31430b7f271219ab30f1d3ac9d", size = 22947 }, + { url = "https://files.pythonhosted.org/packages/2c/54/887f3092a85238093a0b2154bd629c89444f395618842e8b0c41783898ea/markupsafe-3.0.3-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:94c6f0bb423f739146aec64595853541634bde58b2135f27f61c1ffd1cd4d16a", size = 21962 }, + { url = "https://files.pythonhosted.org/packages/c9/2f/336b8c7b6f4a4d95e91119dc8521402461b74a485558d8f238a68312f11c/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:be8813b57049a7dc738189df53d69395eba14fb99345e0a5994914a3864c8a4b", size = 23760 }, + { url = "https://files.pythonhosted.org/packages/32/43/67935f2b7e4982ffb50a4d169b724d74b62a3964bc1a9a527f5ac4f1ee2b/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:83891d0e9fb81a825d9a6d61e3f07550ca70a076484292a70fde82c4b807286f", size = 21529 }, + { url = "https://files.pythonhosted.org/packages/89/e0/4486f11e51bbba8b0c041098859e869e304d1c261e59244baa3d295d47b7/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:77f0643abe7495da77fb436f50f8dab76dbc6e5fd25d39589a0f1fe6548bfa2b", size = 23015 }, + { url = "https://files.pythonhosted.org/packages/2f/e1/78ee7a023dac597a5825441ebd17170785a9dab23de95d2c7508ade94e0e/markupsafe-3.0.3-cp312-cp312-win32.whl", hash = "sha256:d88b440e37a16e651bda4c7c2b930eb586fd15ca7406cb39e211fcff3bf3017d", size = 14540 }, + { url = "https://files.pythonhosted.org/packages/aa/5b/bec5aa9bbbb2c946ca2733ef9c4ca91c91b6a24580193e891b5f7dbe8e1e/markupsafe-3.0.3-cp312-cp312-win_amd64.whl", hash = "sha256:26a5784ded40c9e318cfc2bdb30fe164bdb8665ded9cd64d500a34fb42067b1c", size = 15105 }, + { url = "https://files.pythonhosted.org/packages/e5/f1/216fc1bbfd74011693a4fd837e7026152e89c4bcf3e77b6692fba9923123/markupsafe-3.0.3-cp312-cp312-win_arm64.whl", hash = "sha256:35add3b638a5d900e807944a078b51922212fb3dedb01633a8defc4b01a3c85f", size = 13906 }, + { url = "https://files.pythonhosted.org/packages/38/2f/907b9c7bbba283e68f20259574b13d005c121a0fa4c175f9bed27c4597ff/markupsafe-3.0.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:e1cf1972137e83c5d4c136c43ced9ac51d0e124706ee1c8aa8532c1287fa8795", size = 11622 }, + { url = "https://files.pythonhosted.org/packages/9c/d9/5f7756922cdd676869eca1c4e3c0cd0df60ed30199ffd775e319089cb3ed/markupsafe-3.0.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:116bb52f642a37c115f517494ea5feb03889e04df47eeff5b130b1808ce7c219", size = 12029 }, + { url = "https://files.pythonhosted.org/packages/00/07/575a68c754943058c78f30db02ee03a64b3c638586fba6a6dd56830b30a3/markupsafe-3.0.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:133a43e73a802c5562be9bbcd03d090aa5a1fe899db609c29e8c8d815c5f6de6", size = 24374 }, + { url = "https://files.pythonhosted.org/packages/a9/21/9b05698b46f218fc0e118e1f8168395c65c8a2c750ae2bab54fc4bd4e0e8/markupsafe-3.0.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ccfcd093f13f0f0b7fdd0f198b90053bf7b2f02a3927a30e63f3ccc9df56b676", size = 22980 }, + { url = "https://files.pythonhosted.org/packages/7f/71/544260864f893f18b6827315b988c146b559391e6e7e8f7252839b1b846a/markupsafe-3.0.3-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:509fa21c6deb7a7a273d629cf5ec029bc209d1a51178615ddf718f5918992ab9", size = 21990 }, + { url = "https://files.pythonhosted.org/packages/c2/28/b50fc2f74d1ad761af2f5dcce7492648b983d00a65b8c0e0cb457c82ebbe/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:a4afe79fb3de0b7097d81da19090f4df4f8d3a2b3adaa8764138aac2e44f3af1", size = 23784 }, + { url = "https://files.pythonhosted.org/packages/ed/76/104b2aa106a208da8b17a2fb72e033a5a9d7073c68f7e508b94916ed47a9/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:795e7751525cae078558e679d646ae45574b47ed6e7771863fcc079a6171a0fc", size = 21588 }, + { url = "https://files.pythonhosted.org/packages/b5/99/16a5eb2d140087ebd97180d95249b00a03aa87e29cc224056274f2e45fd6/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:8485f406a96febb5140bfeca44a73e3ce5116b2501ac54fe953e488fb1d03b12", size = 23041 }, + { url = "https://files.pythonhosted.org/packages/19/bc/e7140ed90c5d61d77cea142eed9f9c303f4c4806f60a1044c13e3f1471d0/markupsafe-3.0.3-cp313-cp313-win32.whl", hash = "sha256:bdd37121970bfd8be76c5fb069c7751683bdf373db1ed6c010162b2a130248ed", size = 14543 }, + { url = "https://files.pythonhosted.org/packages/05/73/c4abe620b841b6b791f2edc248f556900667a5a1cf023a6646967ae98335/markupsafe-3.0.3-cp313-cp313-win_amd64.whl", hash = "sha256:9a1abfdc021a164803f4d485104931fb8f8c1efd55bc6b748d2f5774e78b62c5", size = 15113 }, + { url = "https://files.pythonhosted.org/packages/f0/3a/fa34a0f7cfef23cf9500d68cb7c32dd64ffd58a12b09225fb03dd37d5b80/markupsafe-3.0.3-cp313-cp313-win_arm64.whl", hash = "sha256:7e68f88e5b8799aa49c85cd116c932a1ac15caaa3f5db09087854d218359e485", size = 13911 }, + { url = "https://files.pythonhosted.org/packages/e4/d7/e05cd7efe43a88a17a37b3ae96e79a19e846f3f456fe79c57ca61356ef01/markupsafe-3.0.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:218551f6df4868a8d527e3062d0fb968682fe92054e89978594c28e642c43a73", size = 11658 }, + { url = "https://files.pythonhosted.org/packages/99/9e/e412117548182ce2148bdeacdda3bb494260c0b0184360fe0d56389b523b/markupsafe-3.0.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:3524b778fe5cfb3452a09d31e7b5adefeea8c5be1d43c4f810ba09f2ceb29d37", size = 12066 }, + { url = "https://files.pythonhosted.org/packages/bc/e6/fa0ffcda717ef64a5108eaa7b4f5ed28d56122c9a6d70ab8b72f9f715c80/markupsafe-3.0.3-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4e885a3d1efa2eadc93c894a21770e4bc67899e3543680313b09f139e149ab19", size = 25639 }, + { url = "https://files.pythonhosted.org/packages/96/ec/2102e881fe9d25fc16cb4b25d5f5cde50970967ffa5dddafdb771237062d/markupsafe-3.0.3-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8709b08f4a89aa7586de0aadc8da56180242ee0ada3999749b183aa23df95025", size = 23569 }, + { url = "https://files.pythonhosted.org/packages/4b/30/6f2fce1f1f205fc9323255b216ca8a235b15860c34b6798f810f05828e32/markupsafe-3.0.3-cp313-cp313t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:b8512a91625c9b3da6f127803b166b629725e68af71f8184ae7e7d54686a56d6", size = 23284 }, + { url = "https://files.pythonhosted.org/packages/58/47/4a0ccea4ab9f5dcb6f79c0236d954acb382202721e704223a8aafa38b5c8/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:9b79b7a16f7fedff2495d684f2b59b0457c3b493778c9eed31111be64d58279f", size = 24801 }, + { url = "https://files.pythonhosted.org/packages/6a/70/3780e9b72180b6fecb83a4814d84c3bf4b4ae4bf0b19c27196104149734c/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_riscv64.whl", hash = "sha256:12c63dfb4a98206f045aa9563db46507995f7ef6d83b2f68eda65c307c6829eb", size = 22769 }, + { url = "https://files.pythonhosted.org/packages/98/c5/c03c7f4125180fc215220c035beac6b9cb684bc7a067c84fc69414d315f5/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:8f71bc33915be5186016f675cd83a1e08523649b0e33efdb898db577ef5bb009", size = 23642 }, + { url = "https://files.pythonhosted.org/packages/80/d6/2d1b89f6ca4bff1036499b1e29a1d02d282259f3681540e16563f27ebc23/markupsafe-3.0.3-cp313-cp313t-win32.whl", hash = "sha256:69c0b73548bc525c8cb9a251cddf1931d1db4d2258e9599c28c07ef3580ef354", size = 14612 }, + { url = "https://files.pythonhosted.org/packages/2b/98/e48a4bfba0a0ffcf9925fe2d69240bfaa19c6f7507b8cd09c70684a53c1e/markupsafe-3.0.3-cp313-cp313t-win_amd64.whl", hash = "sha256:1b4b79e8ebf6b55351f0d91fe80f893b4743f104bff22e90697db1590e47a218", size = 15200 }, + { url = "https://files.pythonhosted.org/packages/0e/72/e3cc540f351f316e9ed0f092757459afbc595824ca724cbc5a5d4263713f/markupsafe-3.0.3-cp313-cp313t-win_arm64.whl", hash = "sha256:ad2cf8aa28b8c020ab2fc8287b0f823d0a7d8630784c31e9ee5edea20f406287", size = 13973 }, + { url = "https://files.pythonhosted.org/packages/33/8a/8e42d4838cd89b7dde187011e97fe6c3af66d8c044997d2183fbd6d31352/markupsafe-3.0.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:eaa9599de571d72e2daf60164784109f19978b327a3910d3e9de8c97b5b70cfe", size = 11619 }, + { url = "https://files.pythonhosted.org/packages/b5/64/7660f8a4a8e53c924d0fa05dc3a55c9cee10bbd82b11c5afb27d44b096ce/markupsafe-3.0.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:c47a551199eb8eb2121d4f0f15ae0f923d31350ab9280078d1e5f12b249e0026", size = 12029 }, + { url = "https://files.pythonhosted.org/packages/da/ef/e648bfd021127bef5fa12e1720ffed0c6cbb8310c8d9bea7266337ff06de/markupsafe-3.0.3-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f34c41761022dd093b4b6896d4810782ffbabe30f2d443ff5f083e0cbbb8c737", size = 24408 }, + { url = "https://files.pythonhosted.org/packages/41/3c/a36c2450754618e62008bf7435ccb0f88053e07592e6028a34776213d877/markupsafe-3.0.3-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:457a69a9577064c05a97c41f4e65148652db078a3a509039e64d3467b9e7ef97", size = 23005 }, + { url = "https://files.pythonhosted.org/packages/bc/20/b7fdf89a8456b099837cd1dc21974632a02a999ec9bf7ca3e490aacd98e7/markupsafe-3.0.3-cp314-cp314-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:e8afc3f2ccfa24215f8cb28dcf43f0113ac3c37c2f0f0806d8c70e4228c5cf4d", size = 22048 }, + { url = "https://files.pythonhosted.org/packages/9a/a7/591f592afdc734f47db08a75793a55d7fbcc6902a723ae4cfbab61010cc5/markupsafe-3.0.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:ec15a59cf5af7be74194f7ab02d0f59a62bdcf1a537677ce67a2537c9b87fcda", size = 23821 }, + { url = "https://files.pythonhosted.org/packages/7d/33/45b24e4f44195b26521bc6f1a82197118f74df348556594bd2262bda1038/markupsafe-3.0.3-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:0eb9ff8191e8498cca014656ae6b8d61f39da5f95b488805da4bb029cccbfbaf", size = 21606 }, + { url = "https://files.pythonhosted.org/packages/ff/0e/53dfaca23a69fbfbbf17a4b64072090e70717344c52eaaaa9c5ddff1e5f0/markupsafe-3.0.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:2713baf880df847f2bece4230d4d094280f4e67b1e813eec43b4c0e144a34ffe", size = 23043 }, + { url = "https://files.pythonhosted.org/packages/46/11/f333a06fc16236d5238bfe74daccbca41459dcd8d1fa952e8fbd5dccfb70/markupsafe-3.0.3-cp314-cp314-win32.whl", hash = "sha256:729586769a26dbceff69f7a7dbbf59ab6572b99d94576a5592625d5b411576b9", size = 14747 }, + { url = "https://files.pythonhosted.org/packages/28/52/182836104b33b444e400b14f797212f720cbc9ed6ba34c800639d154e821/markupsafe-3.0.3-cp314-cp314-win_amd64.whl", hash = "sha256:bdc919ead48f234740ad807933cdf545180bfbe9342c2bb451556db2ed958581", size = 15341 }, + { url = "https://files.pythonhosted.org/packages/6f/18/acf23e91bd94fd7b3031558b1f013adfa21a8e407a3fdb32745538730382/markupsafe-3.0.3-cp314-cp314-win_arm64.whl", hash = "sha256:5a7d5dc5140555cf21a6fefbdbf8723f06fcd2f63ef108f2854de715e4422cb4", size = 14073 }, + { url = "https://files.pythonhosted.org/packages/3c/f0/57689aa4076e1b43b15fdfa646b04653969d50cf30c32a102762be2485da/markupsafe-3.0.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:1353ef0c1b138e1907ae78e2f6c63ff67501122006b0f9abad68fda5f4ffc6ab", size = 11661 }, + { url = "https://files.pythonhosted.org/packages/89/c3/2e67a7ca217c6912985ec766c6393b636fb0c2344443ff9d91404dc4c79f/markupsafe-3.0.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:1085e7fbddd3be5f89cc898938f42c0b3c711fdcb37d75221de2666af647c175", size = 12069 }, + { url = "https://files.pythonhosted.org/packages/f0/00/be561dce4e6ca66b15276e184ce4b8aec61fe83662cce2f7d72bd3249d28/markupsafe-3.0.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1b52b4fb9df4eb9ae465f8d0c228a00624de2334f216f178a995ccdcf82c4634", size = 25670 }, + { url = "https://files.pythonhosted.org/packages/50/09/c419f6f5a92e5fadde27efd190eca90f05e1261b10dbd8cbcb39cd8ea1dc/markupsafe-3.0.3-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fed51ac40f757d41b7c48425901843666a6677e3e8eb0abcff09e4ba6e664f50", size = 23598 }, + { url = "https://files.pythonhosted.org/packages/22/44/a0681611106e0b2921b3033fc19bc53323e0b50bc70cffdd19f7d679bb66/markupsafe-3.0.3-cp314-cp314t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:f190daf01f13c72eac4efd5c430a8de82489d9cff23c364c3ea822545032993e", size = 23261 }, + { url = "https://files.pythonhosted.org/packages/5f/57/1b0b3f100259dc9fffe780cfb60d4be71375510e435efec3d116b6436d43/markupsafe-3.0.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:e56b7d45a839a697b5eb268c82a71bd8c7f6c94d6fd50c3d577fa39a9f1409f5", size = 24835 }, + { url = "https://files.pythonhosted.org/packages/26/6a/4bf6d0c97c4920f1597cc14dd720705eca0bf7c787aebc6bb4d1bead5388/markupsafe-3.0.3-cp314-cp314t-musllinux_1_2_riscv64.whl", hash = "sha256:f3e98bb3798ead92273dc0e5fd0f31ade220f59a266ffd8a4f6065e0a3ce0523", size = 22733 }, + { url = "https://files.pythonhosted.org/packages/14/c7/ca723101509b518797fedc2fdf79ba57f886b4aca8a7d31857ba3ee8281f/markupsafe-3.0.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:5678211cb9333a6468fb8d8be0305520aa073f50d17f089b5b4b477ea6e67fdc", size = 23672 }, + { url = "https://files.pythonhosted.org/packages/fb/df/5bd7a48c256faecd1d36edc13133e51397e41b73bb77e1a69deab746ebac/markupsafe-3.0.3-cp314-cp314t-win32.whl", hash = "sha256:915c04ba3851909ce68ccc2b8e2cd691618c4dc4c4232fb7982bca3f41fd8c3d", size = 14819 }, + { url = "https://files.pythonhosted.org/packages/1a/8a/0402ba61a2f16038b48b39bccca271134be00c5c9f0f623208399333c448/markupsafe-3.0.3-cp314-cp314t-win_amd64.whl", hash = "sha256:4faffd047e07c38848ce017e8725090413cd80cbc23d86e55c587bf979e579c9", size = 15426 }, + { url = "https://files.pythonhosted.org/packages/70/bc/6f1c2f612465f5fa89b95bead1f44dcb607670fd42891d8fdcd5d039f4f4/markupsafe-3.0.3-cp314-cp314t-win_arm64.whl", hash = "sha256:32001d6a8fc98c8cb5c947787c5d08b0a50663d139f1305bac5885d98d9b40fa", size = 14146 }, ] [[package]] @@ -1714,53 +1724,53 @@ dependencies = [ { name = "pyparsing" }, { name = "python-dateutil" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/ae/e2/d2d5295be2f44c678ebaf3544ba32d20c1f9ef08c49fe47f496180e1db15/matplotlib-3.10.7.tar.gz", hash = "sha256:a06ba7e2a2ef9131c79c49e63dad355d2d878413a0376c1727c8b9335ff731c7", size = 34804865, upload-time = "2025-10-09T00:28:00.669Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/fc/bc/0fb489005669127ec13f51be0c6adc074d7cf191075dab1da9fe3b7a3cfc/matplotlib-3.10.7-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:53b492410a6cd66c7a471de6c924f6ede976e963c0f3097a3b7abfadddc67d0a", size = 8257507, upload-time = "2025-10-09T00:26:19.073Z" }, - { url = "https://files.pythonhosted.org/packages/e2/6a/d42588ad895279ff6708924645b5d2ed54a7fb2dc045c8a804e955aeace1/matplotlib-3.10.7-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:d9749313deb729f08207718d29c86246beb2ea3fdba753595b55901dee5d2fd6", size = 8119565, upload-time = "2025-10-09T00:26:21.023Z" }, - { url = "https://files.pythonhosted.org/packages/10/b7/4aa196155b4d846bd749cf82aa5a4c300cf55a8b5e0dfa5b722a63c0f8a0/matplotlib-3.10.7-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:2222c7ba2cbde7fe63032769f6eb7e83ab3227f47d997a8453377709b7fe3a5a", size = 8692668, upload-time = "2025-10-09T00:26:22.967Z" }, - { url = "https://files.pythonhosted.org/packages/e6/e7/664d2b97016f46683a02d854d730cfcf54ff92c1dafa424beebef50f831d/matplotlib-3.10.7-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e91f61a064c92c307c5a9dc8c05dc9f8a68f0a3be199d9a002a0622e13f874a1", size = 9521051, upload-time = "2025-10-09T00:26:25.041Z" }, - { url = "https://files.pythonhosted.org/packages/a8/a3/37aef1404efa615f49b5758a5e0261c16dd88f389bc1861e722620e4a754/matplotlib-3.10.7-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:6f1851eab59ca082c95df5a500106bad73672645625e04538b3ad0f69471ffcc", size = 9576878, upload-time = "2025-10-09T00:26:27.478Z" }, - { url = "https://files.pythonhosted.org/packages/33/cd/b145f9797126f3f809d177ca378de57c45413c5099c5990de2658760594a/matplotlib-3.10.7-cp311-cp311-win_amd64.whl", hash = "sha256:6516ce375109c60ceec579e699524e9d504cd7578506f01150f7a6bc174a775e", size = 8115142, upload-time = "2025-10-09T00:26:29.774Z" }, - { url = "https://files.pythonhosted.org/packages/2e/39/63bca9d2b78455ed497fcf51a9c71df200a11048f48249038f06447fa947/matplotlib-3.10.7-cp311-cp311-win_arm64.whl", hash = "sha256:b172db79759f5f9bc13ef1c3ef8b9ee7b37b0247f987fbbbdaa15e4f87fd46a9", size = 7992439, upload-time = "2025-10-09T00:26:40.32Z" }, - { url = "https://files.pythonhosted.org/packages/be/b3/09eb0f7796932826ec20c25b517d568627754f6c6462fca19e12c02f2e12/matplotlib-3.10.7-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:7a0edb7209e21840e8361e91ea84ea676658aa93edd5f8762793dec77a4a6748", size = 8272389, upload-time = "2025-10-09T00:26:42.474Z" }, - { url = "https://files.pythonhosted.org/packages/11/0b/1ae80ddafb8652fd8046cb5c8460ecc8d4afccb89e2c6d6bec61e04e1eaf/matplotlib-3.10.7-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:c380371d3c23e0eadf8ebff114445b9f970aff2010198d498d4ab4c3b41eea4f", size = 8128247, upload-time = "2025-10-09T00:26:44.77Z" }, - { url = "https://files.pythonhosted.org/packages/7d/18/95ae2e242d4a5c98bd6e90e36e128d71cf1c7e39b0874feaed3ef782e789/matplotlib-3.10.7-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:d5f256d49fea31f40f166a5e3131235a5d2f4b7f44520b1cf0baf1ce568ccff0", size = 8696996, upload-time = "2025-10-09T00:26:46.792Z" }, - { url = "https://files.pythonhosted.org/packages/7e/3d/5b559efc800bd05cb2033aa85f7e13af51958136a48327f7c261801ff90a/matplotlib-3.10.7-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:11ae579ac83cdf3fb72573bb89f70e0534de05266728740d478f0f818983c695", size = 9530153, upload-time = "2025-10-09T00:26:49.07Z" }, - { url = "https://files.pythonhosted.org/packages/88/57/eab4a719fd110312d3c220595d63a3c85ec2a39723f0f4e7fa7e6e3f74ba/matplotlib-3.10.7-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:4c14b6acd16cddc3569a2d515cfdd81c7a68ac5639b76548cfc1a9e48b20eb65", size = 9593093, upload-time = "2025-10-09T00:26:51.067Z" }, - { url = "https://files.pythonhosted.org/packages/31/3c/80816f027b3a4a28cd2a0a6ef7f89a2db22310e945cd886ec25bfb399221/matplotlib-3.10.7-cp312-cp312-win_amd64.whl", hash = "sha256:0d8c32b7ea6fb80b1aeff5a2ceb3fb9778e2759e899d9beff75584714afcc5ee", size = 8122771, upload-time = "2025-10-09T00:26:53.296Z" }, - { url = "https://files.pythonhosted.org/packages/de/77/ef1fc78bfe99999b2675435cc52120887191c566b25017d78beaabef7f2d/matplotlib-3.10.7-cp312-cp312-win_arm64.whl", hash = "sha256:5f3f6d315dcc176ba7ca6e74c7768fb7e4cf566c49cb143f6bc257b62e634ed8", size = 7992812, upload-time = "2025-10-09T00:26:54.882Z" }, - { url = "https://files.pythonhosted.org/packages/02/9c/207547916a02c78f6bdd83448d9b21afbc42f6379ed887ecf610984f3b4e/matplotlib-3.10.7-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:1d9d3713a237970569156cfb4de7533b7c4eacdd61789726f444f96a0d28f57f", size = 8273212, upload-time = "2025-10-09T00:26:56.752Z" }, - { url = "https://files.pythonhosted.org/packages/bc/d0/b3d3338d467d3fc937f0bb7f256711395cae6f78e22cef0656159950adf0/matplotlib-3.10.7-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:37a1fea41153dd6ee061d21ab69c9cf2cf543160b1b85d89cd3d2e2a7902ca4c", size = 8128713, upload-time = "2025-10-09T00:26:59.001Z" }, - { url = "https://files.pythonhosted.org/packages/22/ff/6425bf5c20d79aa5b959d1ce9e65f599632345391381c9a104133fe0b171/matplotlib-3.10.7-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:b3c4ea4948d93c9c29dc01c0c23eef66f2101bf75158c291b88de6525c55c3d1", size = 8698527, upload-time = "2025-10-09T00:27:00.69Z" }, - { url = "https://files.pythonhosted.org/packages/d0/7f/ccdca06f4c2e6c7989270ed7829b8679466682f4cfc0f8c9986241c023b6/matplotlib-3.10.7-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:22df30ffaa89f6643206cf13877191c63a50e8f800b038bc39bee9d2d4957632", size = 9529690, upload-time = "2025-10-09T00:27:02.664Z" }, - { url = "https://files.pythonhosted.org/packages/b8/95/b80fc2c1f269f21ff3d193ca697358e24408c33ce2b106a7438a45407b63/matplotlib-3.10.7-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:b69676845a0a66f9da30e87f48be36734d6748024b525ec4710be40194282c84", size = 9593732, upload-time = "2025-10-09T00:27:04.653Z" }, - { url = "https://files.pythonhosted.org/packages/e1/b6/23064a96308b9aeceeffa65e96bcde459a2ea4934d311dee20afde7407a0/matplotlib-3.10.7-cp313-cp313-win_amd64.whl", hash = "sha256:744991e0cc863dd669c8dc9136ca4e6e0082be2070b9d793cbd64bec872a6815", size = 8122727, upload-time = "2025-10-09T00:27:06.814Z" }, - { url = "https://files.pythonhosted.org/packages/b3/a6/2faaf48133b82cf3607759027f82b5c702aa99cdfcefb7f93d6ccf26a424/matplotlib-3.10.7-cp313-cp313-win_arm64.whl", hash = "sha256:fba2974df0bf8ce3c995fa84b79cde38326e0f7b5409e7a3a481c1141340bcf7", size = 7992958, upload-time = "2025-10-09T00:27:08.567Z" }, - { url = "https://files.pythonhosted.org/packages/4a/f0/b018fed0b599bd48d84c08794cb242227fe3341952da102ee9d9682db574/matplotlib-3.10.7-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:932c55d1fa7af4423422cb6a492a31cbcbdbe68fd1a9a3f545aa5e7a143b5355", size = 8316849, upload-time = "2025-10-09T00:27:10.254Z" }, - { url = "https://files.pythonhosted.org/packages/b0/b7/bb4f23856197659f275e11a2a164e36e65e9b48ea3e93c4ec25b4f163198/matplotlib-3.10.7-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:5e38c2d581d62ee729a6e144c47a71b3f42fb4187508dbbf4fe71d5612c3433b", size = 8178225, upload-time = "2025-10-09T00:27:12.241Z" }, - { url = "https://files.pythonhosted.org/packages/62/56/0600609893ff277e6f3ab3c0cef4eafa6e61006c058e84286c467223d4d5/matplotlib-3.10.7-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:786656bb13c237bbcebcd402f65f44dd61ead60ee3deb045af429d889c8dbc67", size = 8711708, upload-time = "2025-10-09T00:27:13.879Z" }, - { url = "https://files.pythonhosted.org/packages/d8/1a/6bfecb0cafe94d6658f2f1af22c43b76cf7a1c2f0dc34ef84cbb6809617e/matplotlib-3.10.7-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:09d7945a70ea43bf9248f4b6582734c2fe726723204a76eca233f24cffc7ef67", size = 9541409, upload-time = "2025-10-09T00:27:15.684Z" }, - { url = "https://files.pythonhosted.org/packages/08/50/95122a407d7f2e446fd865e2388a232a23f2b81934960ea802f3171518e4/matplotlib-3.10.7-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:d0b181e9fa8daf1d9f2d4c547527b167cb8838fc587deabca7b5c01f97199e84", size = 9594054, upload-time = "2025-10-09T00:27:17.547Z" }, - { url = "https://files.pythonhosted.org/packages/13/76/75b194a43b81583478a81e78a07da8d9ca6ddf50dd0a2ccabf258059481d/matplotlib-3.10.7-cp313-cp313t-win_amd64.whl", hash = "sha256:31963603041634ce1a96053047b40961f7a29eb8f9a62e80cc2c0427aa1d22a2", size = 8200100, upload-time = "2025-10-09T00:27:20.039Z" }, - { url = "https://files.pythonhosted.org/packages/f5/9e/6aefebdc9f8235c12bdeeda44cc0383d89c1e41da2c400caf3ee2073a3ce/matplotlib-3.10.7-cp313-cp313t-win_arm64.whl", hash = "sha256:aebed7b50aa6ac698c90f60f854b47e48cd2252b30510e7a1feddaf5a3f72cbf", size = 8042131, upload-time = "2025-10-09T00:27:21.608Z" }, - { url = "https://files.pythonhosted.org/packages/0d/4b/e5bc2c321b6a7e3a75638d937d19ea267c34bd5a90e12bee76c4d7c7a0d9/matplotlib-3.10.7-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:d883460c43e8c6b173fef244a2341f7f7c0e9725c7fe68306e8e44ed9c8fb100", size = 8273787, upload-time = "2025-10-09T00:27:23.27Z" }, - { url = "https://files.pythonhosted.org/packages/86/ad/6efae459c56c2fbc404da154e13e3a6039129f3c942b0152624f1c621f05/matplotlib-3.10.7-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:07124afcf7a6504eafcb8ce94091c5898bbdd351519a1beb5c45f7a38c67e77f", size = 8131348, upload-time = "2025-10-09T00:27:24.926Z" }, - { url = "https://files.pythonhosted.org/packages/a6/5a/a4284d2958dee4116359cc05d7e19c057e64ece1b4ac986ab0f2f4d52d5a/matplotlib-3.10.7-cp314-cp314-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c17398b709a6cce3d9fdb1595c33e356d91c098cd9486cb2cc21ea2ea418e715", size = 9533949, upload-time = "2025-10-09T00:27:26.704Z" }, - { url = "https://files.pythonhosted.org/packages/de/ff/f3781b5057fa3786623ad8976fc9f7b0d02b2f28534751fd5a44240de4cf/matplotlib-3.10.7-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:7146d64f561498764561e9cd0ed64fcf582e570fc519e6f521e2d0cfd43365e1", size = 9804247, upload-time = "2025-10-09T00:27:28.514Z" }, - { url = "https://files.pythonhosted.org/packages/47/5a/993a59facb8444efb0e197bf55f545ee449902dcee86a4dfc580c3b61314/matplotlib-3.10.7-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:90ad854c0a435da3104c01e2c6f0028d7e719b690998a2333d7218db80950722", size = 9595497, upload-time = "2025-10-09T00:27:30.418Z" }, - { url = "https://files.pythonhosted.org/packages/0d/a5/77c95aaa9bb32c345cbb49626ad8eb15550cba2e6d4c88081a6c2ac7b08d/matplotlib-3.10.7-cp314-cp314-win_amd64.whl", hash = "sha256:4645fc5d9d20ffa3a39361fcdbcec731382763b623b72627806bf251b6388866", size = 8252732, upload-time = "2025-10-09T00:27:32.332Z" }, - { url = "https://files.pythonhosted.org/packages/74/04/45d269b4268d222390d7817dae77b159651909669a34ee9fdee336db5883/matplotlib-3.10.7-cp314-cp314-win_arm64.whl", hash = "sha256:9257be2f2a03415f9105c486d304a321168e61ad450f6153d77c69504ad764bb", size = 8124240, upload-time = "2025-10-09T00:27:33.94Z" }, - { url = "https://files.pythonhosted.org/packages/4b/c7/ca01c607bb827158b439208c153d6f14ddb9fb640768f06f7ca3488ae67b/matplotlib-3.10.7-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:1e4bbad66c177a8fdfa53972e5ef8be72a5f27e6a607cec0d8579abd0f3102b1", size = 8316938, upload-time = "2025-10-09T00:27:35.534Z" }, - { url = "https://files.pythonhosted.org/packages/84/d2/5539e66e9f56d2fdec94bb8436f5e449683b4e199bcc897c44fbe3c99e28/matplotlib-3.10.7-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:d8eb7194b084b12feb19142262165832fc6ee879b945491d1c3d4660748020c4", size = 8178245, upload-time = "2025-10-09T00:27:37.334Z" }, - { url = "https://files.pythonhosted.org/packages/77/b5/e6ca22901fd3e4fe433a82e583436dd872f6c966fca7e63cf806b40356f8/matplotlib-3.10.7-cp314-cp314t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b4d41379b05528091f00e1728004f9a8d7191260f3862178b88e8fd770206318", size = 9541411, upload-time = "2025-10-09T00:27:39.387Z" }, - { url = "https://files.pythonhosted.org/packages/9e/99/a4524db57cad8fee54b7237239a8f8360bfcfa3170d37c9e71c090c0f409/matplotlib-3.10.7-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4a74f79fafb2e177f240579bc83f0b60f82cc47d2f1d260f422a0627207008ca", size = 9803664, upload-time = "2025-10-09T00:27:41.492Z" }, - { url = "https://files.pythonhosted.org/packages/e6/a5/85e2edf76ea0ad4288d174926d9454ea85f3ce5390cc4e6fab196cbf250b/matplotlib-3.10.7-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:702590829c30aada1e8cef0568ddbffa77ca747b4d6e36c6d173f66e301f89cc", size = 9594066, upload-time = "2025-10-09T00:27:43.694Z" }, - { url = "https://files.pythonhosted.org/packages/39/69/9684368a314f6d83fe5c5ad2a4121a3a8e03723d2e5c8ea17b66c1bad0e7/matplotlib-3.10.7-cp314-cp314t-win_amd64.whl", hash = "sha256:f79d5de970fc90cd5591f60053aecfce1fcd736e0303d9f0bf86be649fa68fb8", size = 8342832, upload-time = "2025-10-09T00:27:45.543Z" }, - { url = "https://files.pythonhosted.org/packages/04/5f/e22e08da14bc1a0894184640d47819d2338b792732e20d292bf86e5ab785/matplotlib-3.10.7-cp314-cp314t-win_arm64.whl", hash = "sha256:cb783436e47fcf82064baca52ce748af71725d0352e1d31564cbe9c95df92b9c", size = 8172585, upload-time = "2025-10-09T00:27:47.185Z" }, - { url = "https://files.pythonhosted.org/packages/58/8f/76d5dc21ac64a49e5498d7f0472c0781dae442dd266a67458baec38288ec/matplotlib-3.10.7-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:15112bcbaef211bd663fa935ec33313b948e214454d949b723998a43357b17b0", size = 8252283, upload-time = "2025-10-09T00:27:54.739Z" }, - { url = "https://files.pythonhosted.org/packages/27/0d/9c5d4c2317feb31d819e38c9f947c942f42ebd4eb935fc6fd3518a11eaa7/matplotlib-3.10.7-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:d2a959c640cdeecdd2ec3136e8ea0441da59bcaf58d67e9c590740addba2cb68", size = 8116733, upload-time = "2025-10-09T00:27:56.406Z" }, - { url = "https://files.pythonhosted.org/packages/9a/cc/3fe688ff1355010937713164caacf9ed443675ac48a997bab6ed23b3f7c0/matplotlib-3.10.7-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:3886e47f64611046bc1db523a09dd0a0a6bed6081e6f90e13806dd1d1d1b5e91", size = 8693919, upload-time = "2025-10-09T00:27:58.41Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/ae/e2/d2d5295be2f44c678ebaf3544ba32d20c1f9ef08c49fe47f496180e1db15/matplotlib-3.10.7.tar.gz", hash = "sha256:a06ba7e2a2ef9131c79c49e63dad355d2d878413a0376c1727c8b9335ff731c7", size = 34804865 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/fc/bc/0fb489005669127ec13f51be0c6adc074d7cf191075dab1da9fe3b7a3cfc/matplotlib-3.10.7-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:53b492410a6cd66c7a471de6c924f6ede976e963c0f3097a3b7abfadddc67d0a", size = 8257507 }, + { url = "https://files.pythonhosted.org/packages/e2/6a/d42588ad895279ff6708924645b5d2ed54a7fb2dc045c8a804e955aeace1/matplotlib-3.10.7-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:d9749313deb729f08207718d29c86246beb2ea3fdba753595b55901dee5d2fd6", size = 8119565 }, + { url = "https://files.pythonhosted.org/packages/10/b7/4aa196155b4d846bd749cf82aa5a4c300cf55a8b5e0dfa5b722a63c0f8a0/matplotlib-3.10.7-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:2222c7ba2cbde7fe63032769f6eb7e83ab3227f47d997a8453377709b7fe3a5a", size = 8692668 }, + { url = "https://files.pythonhosted.org/packages/e6/e7/664d2b97016f46683a02d854d730cfcf54ff92c1dafa424beebef50f831d/matplotlib-3.10.7-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e91f61a064c92c307c5a9dc8c05dc9f8a68f0a3be199d9a002a0622e13f874a1", size = 9521051 }, + { url = "https://files.pythonhosted.org/packages/a8/a3/37aef1404efa615f49b5758a5e0261c16dd88f389bc1861e722620e4a754/matplotlib-3.10.7-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:6f1851eab59ca082c95df5a500106bad73672645625e04538b3ad0f69471ffcc", size = 9576878 }, + { url = "https://files.pythonhosted.org/packages/33/cd/b145f9797126f3f809d177ca378de57c45413c5099c5990de2658760594a/matplotlib-3.10.7-cp311-cp311-win_amd64.whl", hash = "sha256:6516ce375109c60ceec579e699524e9d504cd7578506f01150f7a6bc174a775e", size = 8115142 }, + { url = "https://files.pythonhosted.org/packages/2e/39/63bca9d2b78455ed497fcf51a9c71df200a11048f48249038f06447fa947/matplotlib-3.10.7-cp311-cp311-win_arm64.whl", hash = "sha256:b172db79759f5f9bc13ef1c3ef8b9ee7b37b0247f987fbbbdaa15e4f87fd46a9", size = 7992439 }, + { url = "https://files.pythonhosted.org/packages/be/b3/09eb0f7796932826ec20c25b517d568627754f6c6462fca19e12c02f2e12/matplotlib-3.10.7-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:7a0edb7209e21840e8361e91ea84ea676658aa93edd5f8762793dec77a4a6748", size = 8272389 }, + { url = "https://files.pythonhosted.org/packages/11/0b/1ae80ddafb8652fd8046cb5c8460ecc8d4afccb89e2c6d6bec61e04e1eaf/matplotlib-3.10.7-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:c380371d3c23e0eadf8ebff114445b9f970aff2010198d498d4ab4c3b41eea4f", size = 8128247 }, + { url = "https://files.pythonhosted.org/packages/7d/18/95ae2e242d4a5c98bd6e90e36e128d71cf1c7e39b0874feaed3ef782e789/matplotlib-3.10.7-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:d5f256d49fea31f40f166a5e3131235a5d2f4b7f44520b1cf0baf1ce568ccff0", size = 8696996 }, + { url = "https://files.pythonhosted.org/packages/7e/3d/5b559efc800bd05cb2033aa85f7e13af51958136a48327f7c261801ff90a/matplotlib-3.10.7-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:11ae579ac83cdf3fb72573bb89f70e0534de05266728740d478f0f818983c695", size = 9530153 }, + { url = "https://files.pythonhosted.org/packages/88/57/eab4a719fd110312d3c220595d63a3c85ec2a39723f0f4e7fa7e6e3f74ba/matplotlib-3.10.7-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:4c14b6acd16cddc3569a2d515cfdd81c7a68ac5639b76548cfc1a9e48b20eb65", size = 9593093 }, + { url = "https://files.pythonhosted.org/packages/31/3c/80816f027b3a4a28cd2a0a6ef7f89a2db22310e945cd886ec25bfb399221/matplotlib-3.10.7-cp312-cp312-win_amd64.whl", hash = "sha256:0d8c32b7ea6fb80b1aeff5a2ceb3fb9778e2759e899d9beff75584714afcc5ee", size = 8122771 }, + { url = "https://files.pythonhosted.org/packages/de/77/ef1fc78bfe99999b2675435cc52120887191c566b25017d78beaabef7f2d/matplotlib-3.10.7-cp312-cp312-win_arm64.whl", hash = "sha256:5f3f6d315dcc176ba7ca6e74c7768fb7e4cf566c49cb143f6bc257b62e634ed8", size = 7992812 }, + { url = "https://files.pythonhosted.org/packages/02/9c/207547916a02c78f6bdd83448d9b21afbc42f6379ed887ecf610984f3b4e/matplotlib-3.10.7-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:1d9d3713a237970569156cfb4de7533b7c4eacdd61789726f444f96a0d28f57f", size = 8273212 }, + { url = "https://files.pythonhosted.org/packages/bc/d0/b3d3338d467d3fc937f0bb7f256711395cae6f78e22cef0656159950adf0/matplotlib-3.10.7-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:37a1fea41153dd6ee061d21ab69c9cf2cf543160b1b85d89cd3d2e2a7902ca4c", size = 8128713 }, + { url = "https://files.pythonhosted.org/packages/22/ff/6425bf5c20d79aa5b959d1ce9e65f599632345391381c9a104133fe0b171/matplotlib-3.10.7-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:b3c4ea4948d93c9c29dc01c0c23eef66f2101bf75158c291b88de6525c55c3d1", size = 8698527 }, + { url = "https://files.pythonhosted.org/packages/d0/7f/ccdca06f4c2e6c7989270ed7829b8679466682f4cfc0f8c9986241c023b6/matplotlib-3.10.7-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:22df30ffaa89f6643206cf13877191c63a50e8f800b038bc39bee9d2d4957632", size = 9529690 }, + { url = "https://files.pythonhosted.org/packages/b8/95/b80fc2c1f269f21ff3d193ca697358e24408c33ce2b106a7438a45407b63/matplotlib-3.10.7-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:b69676845a0a66f9da30e87f48be36734d6748024b525ec4710be40194282c84", size = 9593732 }, + { url = "https://files.pythonhosted.org/packages/e1/b6/23064a96308b9aeceeffa65e96bcde459a2ea4934d311dee20afde7407a0/matplotlib-3.10.7-cp313-cp313-win_amd64.whl", hash = "sha256:744991e0cc863dd669c8dc9136ca4e6e0082be2070b9d793cbd64bec872a6815", size = 8122727 }, + { url = "https://files.pythonhosted.org/packages/b3/a6/2faaf48133b82cf3607759027f82b5c702aa99cdfcefb7f93d6ccf26a424/matplotlib-3.10.7-cp313-cp313-win_arm64.whl", hash = "sha256:fba2974df0bf8ce3c995fa84b79cde38326e0f7b5409e7a3a481c1141340bcf7", size = 7992958 }, + { url = "https://files.pythonhosted.org/packages/4a/f0/b018fed0b599bd48d84c08794cb242227fe3341952da102ee9d9682db574/matplotlib-3.10.7-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:932c55d1fa7af4423422cb6a492a31cbcbdbe68fd1a9a3f545aa5e7a143b5355", size = 8316849 }, + { url = "https://files.pythonhosted.org/packages/b0/b7/bb4f23856197659f275e11a2a164e36e65e9b48ea3e93c4ec25b4f163198/matplotlib-3.10.7-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:5e38c2d581d62ee729a6e144c47a71b3f42fb4187508dbbf4fe71d5612c3433b", size = 8178225 }, + { url = "https://files.pythonhosted.org/packages/62/56/0600609893ff277e6f3ab3c0cef4eafa6e61006c058e84286c467223d4d5/matplotlib-3.10.7-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:786656bb13c237bbcebcd402f65f44dd61ead60ee3deb045af429d889c8dbc67", size = 8711708 }, + { url = "https://files.pythonhosted.org/packages/d8/1a/6bfecb0cafe94d6658f2f1af22c43b76cf7a1c2f0dc34ef84cbb6809617e/matplotlib-3.10.7-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:09d7945a70ea43bf9248f4b6582734c2fe726723204a76eca233f24cffc7ef67", size = 9541409 }, + { url = "https://files.pythonhosted.org/packages/08/50/95122a407d7f2e446fd865e2388a232a23f2b81934960ea802f3171518e4/matplotlib-3.10.7-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:d0b181e9fa8daf1d9f2d4c547527b167cb8838fc587deabca7b5c01f97199e84", size = 9594054 }, + { url = "https://files.pythonhosted.org/packages/13/76/75b194a43b81583478a81e78a07da8d9ca6ddf50dd0a2ccabf258059481d/matplotlib-3.10.7-cp313-cp313t-win_amd64.whl", hash = "sha256:31963603041634ce1a96053047b40961f7a29eb8f9a62e80cc2c0427aa1d22a2", size = 8200100 }, + { url = "https://files.pythonhosted.org/packages/f5/9e/6aefebdc9f8235c12bdeeda44cc0383d89c1e41da2c400caf3ee2073a3ce/matplotlib-3.10.7-cp313-cp313t-win_arm64.whl", hash = "sha256:aebed7b50aa6ac698c90f60f854b47e48cd2252b30510e7a1feddaf5a3f72cbf", size = 8042131 }, + { url = "https://files.pythonhosted.org/packages/0d/4b/e5bc2c321b6a7e3a75638d937d19ea267c34bd5a90e12bee76c4d7c7a0d9/matplotlib-3.10.7-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:d883460c43e8c6b173fef244a2341f7f7c0e9725c7fe68306e8e44ed9c8fb100", size = 8273787 }, + { url = "https://files.pythonhosted.org/packages/86/ad/6efae459c56c2fbc404da154e13e3a6039129f3c942b0152624f1c621f05/matplotlib-3.10.7-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:07124afcf7a6504eafcb8ce94091c5898bbdd351519a1beb5c45f7a38c67e77f", size = 8131348 }, + { url = "https://files.pythonhosted.org/packages/a6/5a/a4284d2958dee4116359cc05d7e19c057e64ece1b4ac986ab0f2f4d52d5a/matplotlib-3.10.7-cp314-cp314-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c17398b709a6cce3d9fdb1595c33e356d91c098cd9486cb2cc21ea2ea418e715", size = 9533949 }, + { url = "https://files.pythonhosted.org/packages/de/ff/f3781b5057fa3786623ad8976fc9f7b0d02b2f28534751fd5a44240de4cf/matplotlib-3.10.7-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:7146d64f561498764561e9cd0ed64fcf582e570fc519e6f521e2d0cfd43365e1", size = 9804247 }, + { url = "https://files.pythonhosted.org/packages/47/5a/993a59facb8444efb0e197bf55f545ee449902dcee86a4dfc580c3b61314/matplotlib-3.10.7-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:90ad854c0a435da3104c01e2c6f0028d7e719b690998a2333d7218db80950722", size = 9595497 }, + { url = "https://files.pythonhosted.org/packages/0d/a5/77c95aaa9bb32c345cbb49626ad8eb15550cba2e6d4c88081a6c2ac7b08d/matplotlib-3.10.7-cp314-cp314-win_amd64.whl", hash = "sha256:4645fc5d9d20ffa3a39361fcdbcec731382763b623b72627806bf251b6388866", size = 8252732 }, + { url = "https://files.pythonhosted.org/packages/74/04/45d269b4268d222390d7817dae77b159651909669a34ee9fdee336db5883/matplotlib-3.10.7-cp314-cp314-win_arm64.whl", hash = "sha256:9257be2f2a03415f9105c486d304a321168e61ad450f6153d77c69504ad764bb", size = 8124240 }, + { url = "https://files.pythonhosted.org/packages/4b/c7/ca01c607bb827158b439208c153d6f14ddb9fb640768f06f7ca3488ae67b/matplotlib-3.10.7-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:1e4bbad66c177a8fdfa53972e5ef8be72a5f27e6a607cec0d8579abd0f3102b1", size = 8316938 }, + { url = "https://files.pythonhosted.org/packages/84/d2/5539e66e9f56d2fdec94bb8436f5e449683b4e199bcc897c44fbe3c99e28/matplotlib-3.10.7-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:d8eb7194b084b12feb19142262165832fc6ee879b945491d1c3d4660748020c4", size = 8178245 }, + { url = "https://files.pythonhosted.org/packages/77/b5/e6ca22901fd3e4fe433a82e583436dd872f6c966fca7e63cf806b40356f8/matplotlib-3.10.7-cp314-cp314t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b4d41379b05528091f00e1728004f9a8d7191260f3862178b88e8fd770206318", size = 9541411 }, + { url = "https://files.pythonhosted.org/packages/9e/99/a4524db57cad8fee54b7237239a8f8360bfcfa3170d37c9e71c090c0f409/matplotlib-3.10.7-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4a74f79fafb2e177f240579bc83f0b60f82cc47d2f1d260f422a0627207008ca", size = 9803664 }, + { url = "https://files.pythonhosted.org/packages/e6/a5/85e2edf76ea0ad4288d174926d9454ea85f3ce5390cc4e6fab196cbf250b/matplotlib-3.10.7-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:702590829c30aada1e8cef0568ddbffa77ca747b4d6e36c6d173f66e301f89cc", size = 9594066 }, + { url = "https://files.pythonhosted.org/packages/39/69/9684368a314f6d83fe5c5ad2a4121a3a8e03723d2e5c8ea17b66c1bad0e7/matplotlib-3.10.7-cp314-cp314t-win_amd64.whl", hash = "sha256:f79d5de970fc90cd5591f60053aecfce1fcd736e0303d9f0bf86be649fa68fb8", size = 8342832 }, + { url = "https://files.pythonhosted.org/packages/04/5f/e22e08da14bc1a0894184640d47819d2338b792732e20d292bf86e5ab785/matplotlib-3.10.7-cp314-cp314t-win_arm64.whl", hash = "sha256:cb783436e47fcf82064baca52ce748af71725d0352e1d31564cbe9c95df92b9c", size = 8172585 }, + { url = "https://files.pythonhosted.org/packages/58/8f/76d5dc21ac64a49e5498d7f0472c0781dae442dd266a67458baec38288ec/matplotlib-3.10.7-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:15112bcbaef211bd663fa935ec33313b948e214454d949b723998a43357b17b0", size = 8252283 }, + { url = "https://files.pythonhosted.org/packages/27/0d/9c5d4c2317feb31d819e38c9f947c942f42ebd4eb935fc6fd3518a11eaa7/matplotlib-3.10.7-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:d2a959c640cdeecdd2ec3136e8ea0441da59bcaf58d67e9c590740addba2cb68", size = 8116733 }, + { url = "https://files.pythonhosted.org/packages/9a/cc/3fe688ff1355010937713164caacf9ed443675ac48a997bab6ed23b3f7c0/matplotlib-3.10.7-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:3886e47f64611046bc1db523a09dd0a0a6bed6081e6f90e13806dd1d1d1b5e91", size = 8693919 }, ] [[package]] @@ -1770,9 +1780,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/c7/74/97e72a36efd4ae2bccb3463284300f8953f199b5ffbc04cbbb0ec78f74b1/matplotlib_inline-0.2.1.tar.gz", hash = "sha256:e1ee949c340d771fc39e241ea75683deb94762c8fa5f2927ec57c83c4dffa9fe", size = 8110, upload-time = "2025-10-23T09:00:22.126Z" } +sdist = { url = "https://files.pythonhosted.org/packages/c7/74/97e72a36efd4ae2bccb3463284300f8953f199b5ffbc04cbbb0ec78f74b1/matplotlib_inline-0.2.1.tar.gz", hash = "sha256:e1ee949c340d771fc39e241ea75683deb94762c8fa5f2927ec57c83c4dffa9fe", size = 8110 } wheels = [ - { url = "https://files.pythonhosted.org/packages/af/33/ee4519fa02ed11a94aef9559552f3b17bb863f2ecfe1a35dc7f548cde231/matplotlib_inline-0.2.1-py3-none-any.whl", hash = "sha256:d56ce5156ba6085e00a9d54fead6ed29a9c47e215cd1bba2e976ef39f5710a76", size = 9516, upload-time = "2025-10-23T09:00:20.675Z" }, + { url = "https://files.pythonhosted.org/packages/af/33/ee4519fa02ed11a94aef9559552f3b17bb863f2ecfe1a35dc7f548cde231/matplotlib_inline-0.2.1-py3-none-any.whl", hash = "sha256:d56ce5156ba6085e00a9d54fead6ed29a9c47e215cd1bba2e976ef39f5710a76", size = 9516 }, ] [[package]] @@ -1782,27 +1792,36 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "markdown-it-py" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/b2/fd/a756d36c0bfba5f6e39a1cdbdbfdd448dc02692467d83816dff4592a1ebc/mdit_py_plugins-0.5.0.tar.gz", hash = "sha256:f4918cb50119f50446560513a8e311d574ff6aaed72606ddae6d35716fe809c6", size = 44655, upload-time = "2025-08-11T07:25:49.083Z" } +sdist = { url = "https://files.pythonhosted.org/packages/b2/fd/a756d36c0bfba5f6e39a1cdbdbfdd448dc02692467d83816dff4592a1ebc/mdit_py_plugins-0.5.0.tar.gz", hash = "sha256:f4918cb50119f50446560513a8e311d574ff6aaed72606ddae6d35716fe809c6", size = 44655 } wheels = [ - { url = "https://files.pythonhosted.org/packages/fb/86/dd6e5db36df29e76c7a7699123569a4a18c1623ce68d826ed96c62643cae/mdit_py_plugins-0.5.0-py3-none-any.whl", hash = "sha256:07a08422fc1936a5d26d146759e9155ea466e842f5ab2f7d2266dd084c8dab1f", size = 57205, upload-time = "2025-08-11T07:25:47.597Z" }, + { url = "https://files.pythonhosted.org/packages/fb/86/dd6e5db36df29e76c7a7699123569a4a18c1623ce68d826ed96c62643cae/mdit_py_plugins-0.5.0-py3-none-any.whl", hash = "sha256:07a08422fc1936a5d26d146759e9155ea466e842f5ab2f7d2266dd084c8dab1f", size = 57205 }, ] [[package]] name = "mdurl" version = "0.1.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/d6/54/cfe61301667036ec958cb99bd3efefba235e65cdeb9c84d24a8293ba1d90/mdurl-0.1.2.tar.gz", hash = "sha256:bb413d29f5eea38f31dd4754dd7377d4465116fb207585f97bf925588687c1ba", size = 8729, upload-time = "2022-08-14T12:40:10.846Z" } +sdist = { url = "https://files.pythonhosted.org/packages/d6/54/cfe61301667036ec958cb99bd3efefba235e65cdeb9c84d24a8293ba1d90/mdurl-0.1.2.tar.gz", hash = "sha256:bb413d29f5eea38f31dd4754dd7377d4465116fb207585f97bf925588687c1ba", size = 8729 } wheels = [ - { url = "https://files.pythonhosted.org/packages/b3/38/89ba8ad64ae25be8de66a6d463314cf1eb366222074cfda9ee839c56a4b4/mdurl-0.1.2-py3-none-any.whl", hash = "sha256:84008a41e51615a49fc9966191ff91509e3c40b939176e643fd50a5c2196b8f8", size = 9979, upload-time = "2022-08-14T12:40:09.779Z" }, + { url = "https://files.pythonhosted.org/packages/b3/38/89ba8ad64ae25be8de66a6d463314cf1eb366222074cfda9ee839c56a4b4/mdurl-0.1.2-py3-none-any.whl", hash = "sha256:84008a41e51615a49fc9966191ff91509e3c40b939176e643fd50a5c2196b8f8", size = 9979 }, ] [[package]] name = "mistune" version = "3.1.4" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/d7/02/a7fb8b21d4d55ac93cdcde9d3638da5dd0ebdd3a4fed76c7725e10b81cbe/mistune-3.1.4.tar.gz", hash = "sha256:b5a7f801d389f724ec702840c11d8fc48f2b33519102fc7ee739e8177b672164", size = 94588, upload-time = "2025-08-29T07:20:43.594Z" } +sdist = { url = "https://files.pythonhosted.org/packages/d7/02/a7fb8b21d4d55ac93cdcde9d3638da5dd0ebdd3a4fed76c7725e10b81cbe/mistune-3.1.4.tar.gz", hash = "sha256:b5a7f801d389f724ec702840c11d8fc48f2b33519102fc7ee739e8177b672164", size = 94588 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/7a/f0/8282d9641415e9e33df173516226b404d367a0fc55e1a60424a152913abc/mistune-3.1.4-py3-none-any.whl", hash = "sha256:93691da911e5d9d2e23bc54472892aff676df27a75274962ff9edc210364266d", size = 53481 }, +] + +[[package]] +name = "mpmath" +version = "1.3.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/e0/47/dd32fa426cc72114383ac549964eecb20ecfd886d1e5ccf5340b55b02f57/mpmath-1.3.0.tar.gz", hash = "sha256:7a28eb2a9774d00c7bc92411c19a89209d5da7c4c9a9e227be8330a23a25b91f", size = 508106 } wheels = [ - { url = "https://files.pythonhosted.org/packages/7a/f0/8282d9641415e9e33df173516226b404d367a0fc55e1a60424a152913abc/mistune-3.1.4-py3-none-any.whl", hash = "sha256:93691da911e5d9d2e23bc54472892aff676df27a75274962ff9edc210364266d", size = 53481, upload-time = "2025-08-29T07:20:42.218Z" }, + { url = "https://files.pythonhosted.org/packages/43/e3/7d92a15f894aa0c9c4b49b8ee9ac9850d6e63b03c9c32c0367a13ae62209/mpmath-1.3.0-py3-none-any.whl", hash = "sha256:a0b2b9fe80bbcd81a6647ff13108738cfb482d481d826cc0e02f5b35e5c88d2c", size = 536198 }, ] [[package]] @@ -1814,42 +1833,42 @@ dependencies = [ { name = "pathspec" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/c0/77/8f0d0001ffad290cef2f7f216f96c814866248a0b92a722365ed54648e7e/mypy-1.18.2.tar.gz", hash = "sha256:06a398102a5f203d7477b2923dda3634c36727fa5c237d8f859ef90c42a9924b", size = 3448846, upload-time = "2025-09-19T00:11:10.519Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/88/87/cafd3ae563f88f94eec33f35ff722d043e09832ea8530ef149ec1efbaf08/mypy-1.18.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:807d9315ab9d464125aa9fcf6d84fde6e1dc67da0b6f80e7405506b8ac72bc7f", size = 12731198, upload-time = "2025-09-19T00:09:44.857Z" }, - { url = "https://files.pythonhosted.org/packages/0f/e0/1e96c3d4266a06d4b0197ace5356d67d937d8358e2ee3ffac71faa843724/mypy-1.18.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:776bb00de1778caf4db739c6e83919c1d85a448f71979b6a0edd774ea8399341", size = 11817879, upload-time = "2025-09-19T00:09:47.131Z" }, - { url = "https://files.pythonhosted.org/packages/72/ef/0c9ba89eb03453e76bdac5a78b08260a848c7bfc5d6603634774d9cd9525/mypy-1.18.2-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1379451880512ffce14505493bd9fe469e0697543717298242574882cf8cdb8d", size = 12427292, upload-time = "2025-09-19T00:10:22.472Z" }, - { url = "https://files.pythonhosted.org/packages/1a/52/ec4a061dd599eb8179d5411d99775bec2a20542505988f40fc2fee781068/mypy-1.18.2-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1331eb7fd110d60c24999893320967594ff84c38ac6d19e0a76c5fd809a84c86", size = 13163750, upload-time = "2025-09-19T00:09:51.472Z" }, - { url = "https://files.pythonhosted.org/packages/c4/5f/2cf2ceb3b36372d51568f2208c021870fe7834cf3186b653ac6446511839/mypy-1.18.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:3ca30b50a51e7ba93b00422e486cbb124f1c56a535e20eff7b2d6ab72b3b2e37", size = 13351827, upload-time = "2025-09-19T00:09:58.311Z" }, - { url = "https://files.pythonhosted.org/packages/c8/7d/2697b930179e7277529eaaec1513f8de622818696857f689e4a5432e5e27/mypy-1.18.2-cp311-cp311-win_amd64.whl", hash = "sha256:664dc726e67fa54e14536f6e1224bcfce1d9e5ac02426d2326e2bb4e081d1ce8", size = 9757983, upload-time = "2025-09-19T00:10:09.071Z" }, - { url = "https://files.pythonhosted.org/packages/07/06/dfdd2bc60c66611dd8335f463818514733bc763e4760dee289dcc33df709/mypy-1.18.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:33eca32dd124b29400c31d7cf784e795b050ace0e1f91b8dc035672725617e34", size = 12908273, upload-time = "2025-09-19T00:10:58.321Z" }, - { url = "https://files.pythonhosted.org/packages/81/14/6a9de6d13a122d5608e1a04130724caf9170333ac5a924e10f670687d3eb/mypy-1.18.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:a3c47adf30d65e89b2dcd2fa32f3aeb5e94ca970d2c15fcb25e297871c8e4764", size = 11920910, upload-time = "2025-09-19T00:10:20.043Z" }, - { url = "https://files.pythonhosted.org/packages/5f/a9/b29de53e42f18e8cc547e38daa9dfa132ffdc64f7250e353f5c8cdd44bee/mypy-1.18.2-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5d6c838e831a062f5f29d11c9057c6009f60cb294fea33a98422688181fe2893", size = 12465585, upload-time = "2025-09-19T00:10:33.005Z" }, - { url = "https://files.pythonhosted.org/packages/77/ae/6c3d2c7c61ff21f2bee938c917616c92ebf852f015fb55917fd6e2811db2/mypy-1.18.2-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:01199871b6110a2ce984bde85acd481232d17413868c9807e95c1b0739a58914", size = 13348562, upload-time = "2025-09-19T00:10:11.51Z" }, - { url = "https://files.pythonhosted.org/packages/4d/31/aec68ab3b4aebdf8f36d191b0685d99faa899ab990753ca0fee60fb99511/mypy-1.18.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:a2afc0fa0b0e91b4599ddfe0f91e2c26c2b5a5ab263737e998d6817874c5f7c8", size = 13533296, upload-time = "2025-09-19T00:10:06.568Z" }, - { url = "https://files.pythonhosted.org/packages/9f/83/abcb3ad9478fca3ebeb6a5358bb0b22c95ea42b43b7789c7fb1297ca44f4/mypy-1.18.2-cp312-cp312-win_amd64.whl", hash = "sha256:d8068d0afe682c7c4897c0f7ce84ea77f6de953262b12d07038f4d296d547074", size = 9828828, upload-time = "2025-09-19T00:10:28.203Z" }, - { url = "https://files.pythonhosted.org/packages/5f/04/7f462e6fbba87a72bc8097b93f6842499c428a6ff0c81dd46948d175afe8/mypy-1.18.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:07b8b0f580ca6d289e69209ec9d3911b4a26e5abfde32228a288eb79df129fcc", size = 12898728, upload-time = "2025-09-19T00:10:01.33Z" }, - { url = "https://files.pythonhosted.org/packages/99/5b/61ed4efb64f1871b41fd0b82d29a64640f3516078f6c7905b68ab1ad8b13/mypy-1.18.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:ed4482847168439651d3feee5833ccedbf6657e964572706a2adb1f7fa4dfe2e", size = 11910758, upload-time = "2025-09-19T00:10:42.607Z" }, - { url = "https://files.pythonhosted.org/packages/3c/46/d297d4b683cc89a6e4108c4250a6a6b717f5fa96e1a30a7944a6da44da35/mypy-1.18.2-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c3ad2afadd1e9fea5cf99a45a822346971ede8685cc581ed9cd4d42eaf940986", size = 12475342, upload-time = "2025-09-19T00:11:00.371Z" }, - { url = "https://files.pythonhosted.org/packages/83/45/4798f4d00df13eae3bfdf726c9244bcb495ab5bd588c0eed93a2f2dd67f3/mypy-1.18.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a431a6f1ef14cf8c144c6b14793a23ec4eae3db28277c358136e79d7d062f62d", size = 13338709, upload-time = "2025-09-19T00:11:03.358Z" }, - { url = "https://files.pythonhosted.org/packages/d7/09/479f7358d9625172521a87a9271ddd2441e1dab16a09708f056e97007207/mypy-1.18.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:7ab28cc197f1dd77a67e1c6f35cd1f8e8b73ed2217e4fc005f9e6a504e46e7ba", size = 13529806, upload-time = "2025-09-19T00:10:26.073Z" }, - { url = "https://files.pythonhosted.org/packages/71/cf/ac0f2c7e9d0ea3c75cd99dff7aec1c9df4a1376537cb90e4c882267ee7e9/mypy-1.18.2-cp313-cp313-win_amd64.whl", hash = "sha256:0e2785a84b34a72ba55fb5daf079a1003a34c05b22238da94fcae2bbe46f3544", size = 9833262, upload-time = "2025-09-19T00:10:40.035Z" }, - { url = "https://files.pythonhosted.org/packages/5a/0c/7d5300883da16f0063ae53996358758b2a2df2a09c72a5061fa79a1f5006/mypy-1.18.2-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:62f0e1e988ad41c2a110edde6c398383a889d95b36b3e60bcf155f5164c4fdce", size = 12893775, upload-time = "2025-09-19T00:10:03.814Z" }, - { url = "https://files.pythonhosted.org/packages/50/df/2cffbf25737bdb236f60c973edf62e3e7b4ee1c25b6878629e88e2cde967/mypy-1.18.2-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:8795a039bab805ff0c1dfdb8cd3344642c2b99b8e439d057aba30850b8d3423d", size = 11936852, upload-time = "2025-09-19T00:10:51.631Z" }, - { url = "https://files.pythonhosted.org/packages/be/50/34059de13dd269227fb4a03be1faee6e2a4b04a2051c82ac0a0b5a773c9a/mypy-1.18.2-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6ca1e64b24a700ab5ce10133f7ccd956a04715463d30498e64ea8715236f9c9c", size = 12480242, upload-time = "2025-09-19T00:11:07.955Z" }, - { url = "https://files.pythonhosted.org/packages/5b/11/040983fad5132d85914c874a2836252bbc57832065548885b5bb5b0d4359/mypy-1.18.2-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d924eef3795cc89fecf6bedc6ed32b33ac13e8321344f6ddbf8ee89f706c05cb", size = 13326683, upload-time = "2025-09-19T00:09:55.572Z" }, - { url = "https://files.pythonhosted.org/packages/e9/ba/89b2901dd77414dd7a8c8729985832a5735053be15b744c18e4586e506ef/mypy-1.18.2-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:20c02215a080e3a2be3aa50506c67242df1c151eaba0dcbc1e4e557922a26075", size = 13514749, upload-time = "2025-09-19T00:10:44.827Z" }, - { url = "https://files.pythonhosted.org/packages/25/bc/cc98767cffd6b2928ba680f3e5bc969c4152bf7c2d83f92f5a504b92b0eb/mypy-1.18.2-cp314-cp314-win_amd64.whl", hash = "sha256:749b5f83198f1ca64345603118a6f01a4e99ad4bf9d103ddc5a3200cc4614adf", size = 9982959, upload-time = "2025-09-19T00:10:37.344Z" }, - { url = "https://files.pythonhosted.org/packages/87/e3/be76d87158ebafa0309946c4a73831974d4d6ab4f4ef40c3b53a385a66fd/mypy-1.18.2-py3-none-any.whl", hash = "sha256:22a1748707dd62b58d2ae53562ffc4d7f8bcc727e8ac7cbc69c053ddc874d47e", size = 2352367, upload-time = "2025-09-19T00:10:15.489Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/c0/77/8f0d0001ffad290cef2f7f216f96c814866248a0b92a722365ed54648e7e/mypy-1.18.2.tar.gz", hash = "sha256:06a398102a5f203d7477b2923dda3634c36727fa5c237d8f859ef90c42a9924b", size = 3448846 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/88/87/cafd3ae563f88f94eec33f35ff722d043e09832ea8530ef149ec1efbaf08/mypy-1.18.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:807d9315ab9d464125aa9fcf6d84fde6e1dc67da0b6f80e7405506b8ac72bc7f", size = 12731198 }, + { url = "https://files.pythonhosted.org/packages/0f/e0/1e96c3d4266a06d4b0197ace5356d67d937d8358e2ee3ffac71faa843724/mypy-1.18.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:776bb00de1778caf4db739c6e83919c1d85a448f71979b6a0edd774ea8399341", size = 11817879 }, + { url = "https://files.pythonhosted.org/packages/72/ef/0c9ba89eb03453e76bdac5a78b08260a848c7bfc5d6603634774d9cd9525/mypy-1.18.2-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1379451880512ffce14505493bd9fe469e0697543717298242574882cf8cdb8d", size = 12427292 }, + { url = "https://files.pythonhosted.org/packages/1a/52/ec4a061dd599eb8179d5411d99775bec2a20542505988f40fc2fee781068/mypy-1.18.2-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1331eb7fd110d60c24999893320967594ff84c38ac6d19e0a76c5fd809a84c86", size = 13163750 }, + { url = "https://files.pythonhosted.org/packages/c4/5f/2cf2ceb3b36372d51568f2208c021870fe7834cf3186b653ac6446511839/mypy-1.18.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:3ca30b50a51e7ba93b00422e486cbb124f1c56a535e20eff7b2d6ab72b3b2e37", size = 13351827 }, + { url = "https://files.pythonhosted.org/packages/c8/7d/2697b930179e7277529eaaec1513f8de622818696857f689e4a5432e5e27/mypy-1.18.2-cp311-cp311-win_amd64.whl", hash = "sha256:664dc726e67fa54e14536f6e1224bcfce1d9e5ac02426d2326e2bb4e081d1ce8", size = 9757983 }, + { url = "https://files.pythonhosted.org/packages/07/06/dfdd2bc60c66611dd8335f463818514733bc763e4760dee289dcc33df709/mypy-1.18.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:33eca32dd124b29400c31d7cf784e795b050ace0e1f91b8dc035672725617e34", size = 12908273 }, + { url = "https://files.pythonhosted.org/packages/81/14/6a9de6d13a122d5608e1a04130724caf9170333ac5a924e10f670687d3eb/mypy-1.18.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:a3c47adf30d65e89b2dcd2fa32f3aeb5e94ca970d2c15fcb25e297871c8e4764", size = 11920910 }, + { url = "https://files.pythonhosted.org/packages/5f/a9/b29de53e42f18e8cc547e38daa9dfa132ffdc64f7250e353f5c8cdd44bee/mypy-1.18.2-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5d6c838e831a062f5f29d11c9057c6009f60cb294fea33a98422688181fe2893", size = 12465585 }, + { url = "https://files.pythonhosted.org/packages/77/ae/6c3d2c7c61ff21f2bee938c917616c92ebf852f015fb55917fd6e2811db2/mypy-1.18.2-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:01199871b6110a2ce984bde85acd481232d17413868c9807e95c1b0739a58914", size = 13348562 }, + { url = "https://files.pythonhosted.org/packages/4d/31/aec68ab3b4aebdf8f36d191b0685d99faa899ab990753ca0fee60fb99511/mypy-1.18.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:a2afc0fa0b0e91b4599ddfe0f91e2c26c2b5a5ab263737e998d6817874c5f7c8", size = 13533296 }, + { url = "https://files.pythonhosted.org/packages/9f/83/abcb3ad9478fca3ebeb6a5358bb0b22c95ea42b43b7789c7fb1297ca44f4/mypy-1.18.2-cp312-cp312-win_amd64.whl", hash = "sha256:d8068d0afe682c7c4897c0f7ce84ea77f6de953262b12d07038f4d296d547074", size = 9828828 }, + { url = "https://files.pythonhosted.org/packages/5f/04/7f462e6fbba87a72bc8097b93f6842499c428a6ff0c81dd46948d175afe8/mypy-1.18.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:07b8b0f580ca6d289e69209ec9d3911b4a26e5abfde32228a288eb79df129fcc", size = 12898728 }, + { url = "https://files.pythonhosted.org/packages/99/5b/61ed4efb64f1871b41fd0b82d29a64640f3516078f6c7905b68ab1ad8b13/mypy-1.18.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:ed4482847168439651d3feee5833ccedbf6657e964572706a2adb1f7fa4dfe2e", size = 11910758 }, + { url = "https://files.pythonhosted.org/packages/3c/46/d297d4b683cc89a6e4108c4250a6a6b717f5fa96e1a30a7944a6da44da35/mypy-1.18.2-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c3ad2afadd1e9fea5cf99a45a822346971ede8685cc581ed9cd4d42eaf940986", size = 12475342 }, + { url = "https://files.pythonhosted.org/packages/83/45/4798f4d00df13eae3bfdf726c9244bcb495ab5bd588c0eed93a2f2dd67f3/mypy-1.18.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a431a6f1ef14cf8c144c6b14793a23ec4eae3db28277c358136e79d7d062f62d", size = 13338709 }, + { url = "https://files.pythonhosted.org/packages/d7/09/479f7358d9625172521a87a9271ddd2441e1dab16a09708f056e97007207/mypy-1.18.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:7ab28cc197f1dd77a67e1c6f35cd1f8e8b73ed2217e4fc005f9e6a504e46e7ba", size = 13529806 }, + { url = "https://files.pythonhosted.org/packages/71/cf/ac0f2c7e9d0ea3c75cd99dff7aec1c9df4a1376537cb90e4c882267ee7e9/mypy-1.18.2-cp313-cp313-win_amd64.whl", hash = "sha256:0e2785a84b34a72ba55fb5daf079a1003a34c05b22238da94fcae2bbe46f3544", size = 9833262 }, + { url = "https://files.pythonhosted.org/packages/5a/0c/7d5300883da16f0063ae53996358758b2a2df2a09c72a5061fa79a1f5006/mypy-1.18.2-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:62f0e1e988ad41c2a110edde6c398383a889d95b36b3e60bcf155f5164c4fdce", size = 12893775 }, + { url = "https://files.pythonhosted.org/packages/50/df/2cffbf25737bdb236f60c973edf62e3e7b4ee1c25b6878629e88e2cde967/mypy-1.18.2-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:8795a039bab805ff0c1dfdb8cd3344642c2b99b8e439d057aba30850b8d3423d", size = 11936852 }, + { url = "https://files.pythonhosted.org/packages/be/50/34059de13dd269227fb4a03be1faee6e2a4b04a2051c82ac0a0b5a773c9a/mypy-1.18.2-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6ca1e64b24a700ab5ce10133f7ccd956a04715463d30498e64ea8715236f9c9c", size = 12480242 }, + { url = "https://files.pythonhosted.org/packages/5b/11/040983fad5132d85914c874a2836252bbc57832065548885b5bb5b0d4359/mypy-1.18.2-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d924eef3795cc89fecf6bedc6ed32b33ac13e8321344f6ddbf8ee89f706c05cb", size = 13326683 }, + { url = "https://files.pythonhosted.org/packages/e9/ba/89b2901dd77414dd7a8c8729985832a5735053be15b744c18e4586e506ef/mypy-1.18.2-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:20c02215a080e3a2be3aa50506c67242df1c151eaba0dcbc1e4e557922a26075", size = 13514749 }, + { url = "https://files.pythonhosted.org/packages/25/bc/cc98767cffd6b2928ba680f3e5bc969c4152bf7c2d83f92f5a504b92b0eb/mypy-1.18.2-cp314-cp314-win_amd64.whl", hash = "sha256:749b5f83198f1ca64345603118a6f01a4e99ad4bf9d103ddc5a3200cc4614adf", size = 9982959 }, + { url = "https://files.pythonhosted.org/packages/87/e3/be76d87158ebafa0309946c4a73831974d4d6ab4f4ef40c3b53a385a66fd/mypy-1.18.2-py3-none-any.whl", hash = "sha256:22a1748707dd62b58d2ae53562ffc4d7f8bcc727e8ac7cbc69c053ddc874d47e", size = 2352367 }, ] [[package]] name = "mypy-extensions" version = "1.1.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a2/6e/371856a3fb9d31ca8dac321cda606860fa4548858c0cc45d9d1d4ca2628b/mypy_extensions-1.1.0.tar.gz", hash = "sha256:52e68efc3284861e772bbcd66823fde5ae21fd2fdb51c62a211403730b916558", size = 6343, upload-time = "2025-04-22T14:54:24.164Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a2/6e/371856a3fb9d31ca8dac321cda606860fa4548858c0cc45d9d1d4ca2628b/mypy_extensions-1.1.0.tar.gz", hash = "sha256:52e68efc3284861e772bbcd66823fde5ae21fd2fdb51c62a211403730b916558", size = 6343 } wheels = [ - { url = "https://files.pythonhosted.org/packages/79/7b/2c79738432f5c924bef5071f933bcc9efd0473bac3b4aa584a6f7c1c8df8/mypy_extensions-1.1.0-py3-none-any.whl", hash = "sha256:1be4cccdb0f2482337c4743e60421de3a356cd97508abadd57d47403e94f5505", size = 4963, upload-time = "2025-04-22T14:54:22.983Z" }, + { url = "https://files.pythonhosted.org/packages/79/7b/2c79738432f5c924bef5071f933bcc9efd0473bac3b4aa584a6f7c1c8df8/mypy_extensions-1.1.0-py3-none-any.whl", hash = "sha256:1be4cccdb0f2482337c4743e60421de3a356cd97508abadd57d47403e94f5505", size = 4963 }, ] [[package]] @@ -1868,9 +1887,9 @@ dependencies = [ { name = "sphinx" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/21/83/a894bd8dea7a6e9f053502ee8413484dcbf75a219013d6a72e971c0fecfd/myst_nb-1.3.0.tar.gz", hash = "sha256:df3cd4680f51a5af673fd46b38b562be3559aef1475e906ed0f2e66e4587ce4b", size = 81963, upload-time = "2025-07-13T22:49:38.493Z" } +sdist = { url = "https://files.pythonhosted.org/packages/21/83/a894bd8dea7a6e9f053502ee8413484dcbf75a219013d6a72e971c0fecfd/myst_nb-1.3.0.tar.gz", hash = "sha256:df3cd4680f51a5af673fd46b38b562be3559aef1475e906ed0f2e66e4587ce4b", size = 81963 } wheels = [ - { url = "https://files.pythonhosted.org/packages/69/a6/03d410c114b8c4856579b3d294dafc27626a7690a552625eec42b16dfa41/myst_nb-1.3.0-py3-none-any.whl", hash = "sha256:1f36af3c19964960ec4e51ac30949b6ed6df220356ffa8d60dd410885e132d7d", size = 82396, upload-time = "2025-07-13T22:49:37.019Z" }, + { url = "https://files.pythonhosted.org/packages/69/a6/03d410c114b8c4856579b3d294dafc27626a7690a552625eec42b16dfa41/myst_nb-1.3.0-py3-none-any.whl", hash = "sha256:1f36af3c19964960ec4e51ac30949b6ed6df220356ffa8d60dd410885e132d7d", size = 82396 }, ] [[package]] @@ -1885,9 +1904,9 @@ dependencies = [ { name = "pyyaml" }, { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/66/a5/9626ba4f73555b3735ad86247a8077d4603aa8628537687c839ab08bfe44/myst_parser-4.0.1.tar.gz", hash = "sha256:5cfea715e4f3574138aecbf7d54132296bfd72bb614d31168f48c477a830a7c4", size = 93985, upload-time = "2025-02-12T10:53:03.833Z" } +sdist = { url = "https://files.pythonhosted.org/packages/66/a5/9626ba4f73555b3735ad86247a8077d4603aa8628537687c839ab08bfe44/myst_parser-4.0.1.tar.gz", hash = "sha256:5cfea715e4f3574138aecbf7d54132296bfd72bb614d31168f48c477a830a7c4", size = 93985 } wheels = [ - { url = "https://files.pythonhosted.org/packages/5f/df/76d0321c3797b54b60fef9ec3bd6f4cfd124b9e422182156a1dd418722cf/myst_parser-4.0.1-py3-none-any.whl", hash = "sha256:9134e88959ec3b5780aedf8a99680ea242869d012e8821db3126d427edc9c95d", size = 84579, upload-time = "2025-02-12T10:53:02.078Z" }, + { url = "https://files.pythonhosted.org/packages/5f/df/76d0321c3797b54b60fef9ec3bd6f4cfd124b9e422182156a1dd418722cf/myst_parser-4.0.1-py3-none-any.whl", hash = "sha256:9134e88959ec3b5780aedf8a99680ea242869d012e8821db3126d427edc9c95d", size = 84579 }, ] [[package]] @@ -1900,9 +1919,9 @@ dependencies = [ { name = "nbformat" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/87/66/7ffd18d58eae90d5721f9f39212327695b749e23ad44b3881744eaf4d9e8/nbclient-0.10.2.tar.gz", hash = "sha256:90b7fc6b810630db87a6d0c2250b1f0ab4cf4d3c27a299b0cde78a4ed3fd9193", size = 62424, upload-time = "2024-12-19T10:32:27.164Z" } +sdist = { url = "https://files.pythonhosted.org/packages/87/66/7ffd18d58eae90d5721f9f39212327695b749e23ad44b3881744eaf4d9e8/nbclient-0.10.2.tar.gz", hash = "sha256:90b7fc6b810630db87a6d0c2250b1f0ab4cf4d3c27a299b0cde78a4ed3fd9193", size = 62424 } wheels = [ - { url = "https://files.pythonhosted.org/packages/34/6d/e7fa07f03a4a7b221d94b4d586edb754a9b0dc3c9e2c93353e9fa4e0d117/nbclient-0.10.2-py3-none-any.whl", hash = "sha256:4ffee11e788b4a27fabeb7955547e4318a5298f34342a4bfd01f2e1faaeadc3d", size = 25434, upload-time = "2024-12-19T10:32:24.139Z" }, + { url = "https://files.pythonhosted.org/packages/34/6d/e7fa07f03a4a7b221d94b4d586edb754a9b0dc3c9e2c93353e9fa4e0d117/nbclient-0.10.2-py3-none-any.whl", hash = "sha256:4ffee11e788b4a27fabeb7955547e4318a5298f34342a4bfd01f2e1faaeadc3d", size = 25434 }, ] [[package]] @@ -1925,9 +1944,9 @@ dependencies = [ { name = "pygments" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/a3/59/f28e15fc47ffb73af68a8d9b47367a8630d76e97ae85ad18271b9db96fdf/nbconvert-7.16.6.tar.gz", hash = "sha256:576a7e37c6480da7b8465eefa66c17844243816ce1ccc372633c6b71c3c0f582", size = 857715, upload-time = "2025-01-28T09:29:14.724Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a3/59/f28e15fc47ffb73af68a8d9b47367a8630d76e97ae85ad18271b9db96fdf/nbconvert-7.16.6.tar.gz", hash = "sha256:576a7e37c6480da7b8465eefa66c17844243816ce1ccc372633c6b71c3c0f582", size = 857715 } wheels = [ - { url = "https://files.pythonhosted.org/packages/cc/9a/cd673b2f773a12c992f41309ef81b99da1690426bd2f96957a7ade0d3ed7/nbconvert-7.16.6-py3-none-any.whl", hash = "sha256:1375a7b67e0c2883678c48e506dc320febb57685e5ee67faa51b18a90f3a712b", size = 258525, upload-time = "2025-01-28T09:29:12.551Z" }, + { url = "https://files.pythonhosted.org/packages/cc/9a/cd673b2f773a12c992f41309ef81b99da1690426bd2f96957a7ade0d3ed7/nbconvert-7.16.6-py3-none-any.whl", hash = "sha256:1375a7b67e0c2883678c48e506dc320febb57685e5ee67faa51b18a90f3a712b", size = 258525 }, ] [[package]] @@ -1940,27 +1959,27 @@ dependencies = [ { name = "jupyter-core" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/6d/fd/91545e604bc3dad7dca9ed03284086039b294c6b3d75c0d2fa45f9e9caf3/nbformat-5.10.4.tar.gz", hash = "sha256:322168b14f937a5d11362988ecac2a4952d3d8e3a2cbeb2319584631226d5b3a", size = 142749, upload-time = "2024-04-04T11:20:37.371Z" } +sdist = { url = "https://files.pythonhosted.org/packages/6d/fd/91545e604bc3dad7dca9ed03284086039b294c6b3d75c0d2fa45f9e9caf3/nbformat-5.10.4.tar.gz", hash = "sha256:322168b14f937a5d11362988ecac2a4952d3d8e3a2cbeb2319584631226d5b3a", size = 142749 } wheels = [ - { url = "https://files.pythonhosted.org/packages/a9/82/0340caa499416c78e5d8f5f05947ae4bc3cba53c9f038ab6e9ed964e22f1/nbformat-5.10.4-py3-none-any.whl", hash = "sha256:3b48d6c8fbca4b299bf3982ea7db1af21580e4fec269ad087b9e81588891200b", size = 78454, upload-time = "2024-04-04T11:20:34.895Z" }, + { url = "https://files.pythonhosted.org/packages/a9/82/0340caa499416c78e5d8f5f05947ae4bc3cba53c9f038ab6e9ed964e22f1/nbformat-5.10.4-py3-none-any.whl", hash = "sha256:3b48d6c8fbca4b299bf3982ea7db1af21580e4fec269ad087b9e81588891200b", size = 78454 }, ] [[package]] name = "nest-asyncio" version = "1.6.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/83/f8/51569ac65d696c8ecbee95938f89d4abf00f47d58d48f6fbabfe8f0baefe/nest_asyncio-1.6.0.tar.gz", hash = "sha256:6f172d5449aca15afd6c646851f4e31e02c598d553a667e38cafa997cfec55fe", size = 7418, upload-time = "2024-01-21T14:25:19.227Z" } +sdist = { url = "https://files.pythonhosted.org/packages/83/f8/51569ac65d696c8ecbee95938f89d4abf00f47d58d48f6fbabfe8f0baefe/nest_asyncio-1.6.0.tar.gz", hash = "sha256:6f172d5449aca15afd6c646851f4e31e02c598d553a667e38cafa997cfec55fe", size = 7418 } wheels = [ - { url = "https://files.pythonhosted.org/packages/a0/c4/c2971a3ba4c6103a3d10c4b0f24f461ddc027f0f09763220cf35ca1401b3/nest_asyncio-1.6.0-py3-none-any.whl", hash = "sha256:87af6efd6b5e897c81050477ef65c62e2b2f35d51703cae01aff2905b1852e1c", size = 5195, upload-time = "2024-01-21T14:25:17.223Z" }, + { url = "https://files.pythonhosted.org/packages/a0/c4/c2971a3ba4c6103a3d10c4b0f24f461ddc027f0f09763220cf35ca1401b3/nest_asyncio-1.6.0-py3-none-any.whl", hash = "sha256:87af6efd6b5e897c81050477ef65c62e2b2f35d51703cae01aff2905b1852e1c", size = 5195 }, ] [[package]] name = "nodeenv" version = "1.9.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/43/16/fc88b08840de0e0a72a2f9d8c6bae36be573e475a6326ae854bcc549fc45/nodeenv-1.9.1.tar.gz", hash = "sha256:6ec12890a2dab7946721edbfbcd91f3319c6ccc9aec47be7c7e6b7011ee6645f", size = 47437, upload-time = "2024-06-04T18:44:11.171Z" } +sdist = { url = "https://files.pythonhosted.org/packages/43/16/fc88b08840de0e0a72a2f9d8c6bae36be573e475a6326ae854bcc549fc45/nodeenv-1.9.1.tar.gz", hash = "sha256:6ec12890a2dab7946721edbfbcd91f3319c6ccc9aec47be7c7e6b7011ee6645f", size = 47437 } wheels = [ - { url = "https://files.pythonhosted.org/packages/d2/1d/1b658dbd2b9fa9c4c9f32accbfc0205d532c8c6194dc0f2a4c0428e7128a/nodeenv-1.9.1-py2.py3-none-any.whl", hash = "sha256:ba11c9782d29c27c70ffbdda2d7415098754709be8a7056d79a737cd901155c9", size = 22314, upload-time = "2024-06-04T18:44:08.352Z" }, + { url = "https://files.pythonhosted.org/packages/d2/1d/1b658dbd2b9fa9c4c9f32accbfc0205d532c8c6194dc0f2a4c0428e7128a/nodeenv-1.9.1-py2.py3-none-any.whl", hash = "sha256:ba11c9782d29c27c70ffbdda2d7415098754709be8a7056d79a737cd901155c9", size = 22314 }, ] [[package]] @@ -1970,9 +1989,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "jupyter-server" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/54/d2/92fa3243712b9a3e8bafaf60aac366da1cada3639ca767ff4b5b3654ec28/notebook_shim-0.2.4.tar.gz", hash = "sha256:b4b2cfa1b65d98307ca24361f5b30fe785b53c3fd07b7a47e89acb5e6ac638cb", size = 13167, upload-time = "2024-02-14T23:35:18.353Z" } +sdist = { url = "https://files.pythonhosted.org/packages/54/d2/92fa3243712b9a3e8bafaf60aac366da1cada3639ca767ff4b5b3654ec28/notebook_shim-0.2.4.tar.gz", hash = "sha256:b4b2cfa1b65d98307ca24361f5b30fe785b53c3fd07b7a47e89acb5e6ac638cb", size = 13167 } wheels = [ - { url = "https://files.pythonhosted.org/packages/f9/33/bd5b9137445ea4b680023eb0469b2bb969d61303dedb2aac6560ff3d14a1/notebook_shim-0.2.4-py3-none-any.whl", hash = "sha256:411a5be4e9dc882a074ccbcae671eda64cceb068767e9a3419096986560e1cef", size = 13307, upload-time = "2024-02-14T23:35:16.286Z" }, + { url = "https://files.pythonhosted.org/packages/f9/33/bd5b9137445ea4b680023eb0469b2bb969d61303dedb2aac6560ff3d14a1/notebook_shim-0.2.4-py3-none-any.whl", hash = "sha256:411a5be4e9dc882a074ccbcae671eda64cceb068767e9a3419096986560e1cef", size = 13307 }, ] [[package]] @@ -1983,122 +2002,122 @@ dependencies = [ { name = "llvmlite" }, { name = "numpy" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/a3/20/33dbdbfe60e5fd8e3dbfde299d106279a33d9f8308346022316781368591/numba-0.62.1.tar.gz", hash = "sha256:7b774242aa890e34c21200a1fc62e5b5757d5286267e71103257f4e2af0d5161", size = 2749817, upload-time = "2025-09-29T10:46:31.551Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a3/20/33dbdbfe60e5fd8e3dbfde299d106279a33d9f8308346022316781368591/numba-0.62.1.tar.gz", hash = "sha256:7b774242aa890e34c21200a1fc62e5b5757d5286267e71103257f4e2af0d5161", size = 2749817 } wheels = [ - { url = "https://files.pythonhosted.org/packages/dd/5f/8b3491dd849474f55e33c16ef55678ace1455c490555337899c35826836c/numba-0.62.1-cp311-cp311-macosx_10_15_x86_64.whl", hash = "sha256:f43e24b057714e480fe44bc6031de499e7cf8150c63eb461192caa6cc8530bc8", size = 2684279, upload-time = "2025-09-29T10:43:37.213Z" }, - { url = "https://files.pythonhosted.org/packages/bf/18/71969149bfeb65a629e652b752b80167fe8a6a6f6e084f1f2060801f7f31/numba-0.62.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:57cbddc53b9ee02830b828a8428757f5c218831ccc96490a314ef569d8342b7b", size = 2687330, upload-time = "2025-09-29T10:43:59.601Z" }, - { url = "https://files.pythonhosted.org/packages/0e/7d/403be3fecae33088027bc8a95dc80a2fda1e3beff3e0e5fc4374ada3afbe/numba-0.62.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:604059730c637c7885386521bb1b0ddcbc91fd56131a6dcc54163d6f1804c872", size = 3739727, upload-time = "2025-09-29T10:42:45.922Z" }, - { url = "https://files.pythonhosted.org/packages/e0/c3/3d910d08b659a6d4c62ab3cd8cd93c4d8b7709f55afa0d79a87413027ff6/numba-0.62.1-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d6c540880170bee817011757dc9049dba5a29db0c09b4d2349295991fe3ee55f", size = 3445490, upload-time = "2025-09-29T10:43:12.692Z" }, - { url = "https://files.pythonhosted.org/packages/5b/82/9d425c2f20d9f0a37f7cb955945a553a00fa06a2b025856c3550227c5543/numba-0.62.1-cp311-cp311-win_amd64.whl", hash = "sha256:03de6d691d6b6e2b76660ba0f38f37b81ece8b2cc524a62f2a0cfae2bfb6f9da", size = 2745550, upload-time = "2025-09-29T10:44:20.571Z" }, - { url = "https://files.pythonhosted.org/packages/5e/fa/30fa6873e9f821c0ae755915a3ca444e6ff8d6a7b6860b669a3d33377ac7/numba-0.62.1-cp312-cp312-macosx_10_15_x86_64.whl", hash = "sha256:1b743b32f8fa5fff22e19c2e906db2f0a340782caf024477b97801b918cf0494", size = 2685346, upload-time = "2025-09-29T10:43:43.677Z" }, - { url = "https://files.pythonhosted.org/packages/a9/d5/504ce8dc46e0dba2790c77e6b878ee65b60fe3e7d6d0006483ef6fde5a97/numba-0.62.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:90fa21b0142bcf08ad8e32a97d25d0b84b1e921bc9423f8dda07d3652860eef6", size = 2688139, upload-time = "2025-09-29T10:44:04.894Z" }, - { url = "https://files.pythonhosted.org/packages/50/5f/6a802741176c93f2ebe97ad90751894c7b0c922b52ba99a4395e79492205/numba-0.62.1-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:6ef84d0ac19f1bf80431347b6f4ce3c39b7ec13f48f233a48c01e2ec06ecbc59", size = 3796453, upload-time = "2025-09-29T10:42:52.771Z" }, - { url = "https://files.pythonhosted.org/packages/7e/df/efd21527d25150c4544eccc9d0b7260a5dec4b7e98b5a581990e05a133c0/numba-0.62.1-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9315cc5e441300e0ca07c828a627d92a6802bcbf27c5487f31ae73783c58da53", size = 3496451, upload-time = "2025-09-29T10:43:19.279Z" }, - { url = "https://files.pythonhosted.org/packages/80/44/79bfdab12a02796bf4f1841630355c82b5a69933b1d50eb15c7fa37dabe8/numba-0.62.1-cp312-cp312-win_amd64.whl", hash = "sha256:44e3aa6228039992f058f5ebfcfd372c83798e9464297bdad8cc79febcf7891e", size = 2745552, upload-time = "2025-09-29T10:44:26.399Z" }, - { url = "https://files.pythonhosted.org/packages/22/76/501ea2c07c089ef1386868f33dff2978f43f51b854e34397b20fc55e0a58/numba-0.62.1-cp313-cp313-macosx_10_15_x86_64.whl", hash = "sha256:b72489ba8411cc9fdcaa2458d8f7677751e94f0109eeb53e5becfdc818c64afb", size = 2685766, upload-time = "2025-09-29T10:43:49.161Z" }, - { url = "https://files.pythonhosted.org/packages/80/68/444986ed95350c0611d5c7b46828411c222ce41a0c76707c36425d27ce29/numba-0.62.1-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:44a1412095534a26fb5da2717bc755b57da5f3053965128fe3dc286652cc6a92", size = 2688741, upload-time = "2025-09-29T10:44:10.07Z" }, - { url = "https://files.pythonhosted.org/packages/78/7e/bf2e3634993d57f95305c7cee4c9c6cb3c9c78404ee7b49569a0dfecfe33/numba-0.62.1-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:8c9460b9e936c5bd2f0570e20a0a5909ee6e8b694fd958b210e3bde3a6dba2d7", size = 3804576, upload-time = "2025-09-29T10:42:59.53Z" }, - { url = "https://files.pythonhosted.org/packages/e8/b6/8a1723fff71f63bbb1354bdc60a1513a068acc0f5322f58da6f022d20247/numba-0.62.1-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:728f91a874192df22d74e3fd42c12900b7ce7190b1aad3574c6c61b08313e4c5", size = 3503367, upload-time = "2025-09-29T10:43:26.326Z" }, - { url = "https://files.pythonhosted.org/packages/9c/ec/9d414e7a80d6d1dc4af0e07c6bfe293ce0b04ea4d0ed6c45dad9bd6e72eb/numba-0.62.1-cp313-cp313-win_amd64.whl", hash = "sha256:bbf3f88b461514287df66bc8d0307e949b09f2b6f67da92265094e8fa1282dd8", size = 2745529, upload-time = "2025-09-29T10:44:31.738Z" }, + { url = "https://files.pythonhosted.org/packages/dd/5f/8b3491dd849474f55e33c16ef55678ace1455c490555337899c35826836c/numba-0.62.1-cp311-cp311-macosx_10_15_x86_64.whl", hash = "sha256:f43e24b057714e480fe44bc6031de499e7cf8150c63eb461192caa6cc8530bc8", size = 2684279 }, + { url = "https://files.pythonhosted.org/packages/bf/18/71969149bfeb65a629e652b752b80167fe8a6a6f6e084f1f2060801f7f31/numba-0.62.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:57cbddc53b9ee02830b828a8428757f5c218831ccc96490a314ef569d8342b7b", size = 2687330 }, + { url = "https://files.pythonhosted.org/packages/0e/7d/403be3fecae33088027bc8a95dc80a2fda1e3beff3e0e5fc4374ada3afbe/numba-0.62.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:604059730c637c7885386521bb1b0ddcbc91fd56131a6dcc54163d6f1804c872", size = 3739727 }, + { url = "https://files.pythonhosted.org/packages/e0/c3/3d910d08b659a6d4c62ab3cd8cd93c4d8b7709f55afa0d79a87413027ff6/numba-0.62.1-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d6c540880170bee817011757dc9049dba5a29db0c09b4d2349295991fe3ee55f", size = 3445490 }, + { url = "https://files.pythonhosted.org/packages/5b/82/9d425c2f20d9f0a37f7cb955945a553a00fa06a2b025856c3550227c5543/numba-0.62.1-cp311-cp311-win_amd64.whl", hash = "sha256:03de6d691d6b6e2b76660ba0f38f37b81ece8b2cc524a62f2a0cfae2bfb6f9da", size = 2745550 }, + { url = "https://files.pythonhosted.org/packages/5e/fa/30fa6873e9f821c0ae755915a3ca444e6ff8d6a7b6860b669a3d33377ac7/numba-0.62.1-cp312-cp312-macosx_10_15_x86_64.whl", hash = "sha256:1b743b32f8fa5fff22e19c2e906db2f0a340782caf024477b97801b918cf0494", size = 2685346 }, + { url = "https://files.pythonhosted.org/packages/a9/d5/504ce8dc46e0dba2790c77e6b878ee65b60fe3e7d6d0006483ef6fde5a97/numba-0.62.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:90fa21b0142bcf08ad8e32a97d25d0b84b1e921bc9423f8dda07d3652860eef6", size = 2688139 }, + { url = "https://files.pythonhosted.org/packages/50/5f/6a802741176c93f2ebe97ad90751894c7b0c922b52ba99a4395e79492205/numba-0.62.1-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:6ef84d0ac19f1bf80431347b6f4ce3c39b7ec13f48f233a48c01e2ec06ecbc59", size = 3796453 }, + { url = "https://files.pythonhosted.org/packages/7e/df/efd21527d25150c4544eccc9d0b7260a5dec4b7e98b5a581990e05a133c0/numba-0.62.1-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9315cc5e441300e0ca07c828a627d92a6802bcbf27c5487f31ae73783c58da53", size = 3496451 }, + { url = "https://files.pythonhosted.org/packages/80/44/79bfdab12a02796bf4f1841630355c82b5a69933b1d50eb15c7fa37dabe8/numba-0.62.1-cp312-cp312-win_amd64.whl", hash = "sha256:44e3aa6228039992f058f5ebfcfd372c83798e9464297bdad8cc79febcf7891e", size = 2745552 }, + { url = "https://files.pythonhosted.org/packages/22/76/501ea2c07c089ef1386868f33dff2978f43f51b854e34397b20fc55e0a58/numba-0.62.1-cp313-cp313-macosx_10_15_x86_64.whl", hash = "sha256:b72489ba8411cc9fdcaa2458d8f7677751e94f0109eeb53e5becfdc818c64afb", size = 2685766 }, + { url = "https://files.pythonhosted.org/packages/80/68/444986ed95350c0611d5c7b46828411c222ce41a0c76707c36425d27ce29/numba-0.62.1-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:44a1412095534a26fb5da2717bc755b57da5f3053965128fe3dc286652cc6a92", size = 2688741 }, + { url = "https://files.pythonhosted.org/packages/78/7e/bf2e3634993d57f95305c7cee4c9c6cb3c9c78404ee7b49569a0dfecfe33/numba-0.62.1-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:8c9460b9e936c5bd2f0570e20a0a5909ee6e8b694fd958b210e3bde3a6dba2d7", size = 3804576 }, + { url = "https://files.pythonhosted.org/packages/e8/b6/8a1723fff71f63bbb1354bdc60a1513a068acc0f5322f58da6f022d20247/numba-0.62.1-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:728f91a874192df22d74e3fd42c12900b7ce7190b1aad3574c6c61b08313e4c5", size = 3503367 }, + { url = "https://files.pythonhosted.org/packages/9c/ec/9d414e7a80d6d1dc4af0e07c6bfe293ce0b04ea4d0ed6c45dad9bd6e72eb/numba-0.62.1-cp313-cp313-win_amd64.whl", hash = "sha256:bbf3f88b461514287df66bc8d0307e949b09f2b6f67da92265094e8fa1282dd8", size = 2745529 }, ] [[package]] name = "numpy" version = "2.3.4" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/b5/f4/098d2270d52b41f1bd7db9fc288aaa0400cb48c2a3e2af6fa365d9720947/numpy-2.3.4.tar.gz", hash = "sha256:a7d018bfedb375a8d979ac758b120ba846a7fe764911a64465fd87b8729f4a6a", size = 20582187, upload-time = "2025-10-15T16:18:11.77Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/60/e7/0e07379944aa8afb49a556a2b54587b828eb41dc9adc56fb7615b678ca53/numpy-2.3.4-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:e78aecd2800b32e8347ce49316d3eaf04aed849cd5b38e0af39f829a4e59f5eb", size = 21259519, upload-time = "2025-10-15T16:15:19.012Z" }, - { url = "https://files.pythonhosted.org/packages/d0/cb/5a69293561e8819b09e34ed9e873b9a82b5f2ade23dce4c51dc507f6cfe1/numpy-2.3.4-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:7fd09cc5d65bda1e79432859c40978010622112e9194e581e3415a3eccc7f43f", size = 14452796, upload-time = "2025-10-15T16:15:23.094Z" }, - { url = "https://files.pythonhosted.org/packages/e4/04/ff11611200acd602a1e5129e36cfd25bf01ad8e5cf927baf2e90236eb02e/numpy-2.3.4-cp311-cp311-macosx_14_0_arm64.whl", hash = "sha256:1b219560ae2c1de48ead517d085bc2d05b9433f8e49d0955c82e8cd37bd7bf36", size = 5381639, upload-time = "2025-10-15T16:15:25.572Z" }, - { url = "https://files.pythonhosted.org/packages/ea/77/e95c757a6fe7a48d28a009267408e8aa382630cc1ad1db7451b3bc21dbb4/numpy-2.3.4-cp311-cp311-macosx_14_0_x86_64.whl", hash = "sha256:bafa7d87d4c99752d07815ed7a2c0964f8ab311eb8168f41b910bd01d15b6032", size = 6914296, upload-time = "2025-10-15T16:15:27.079Z" }, - { url = "https://files.pythonhosted.org/packages/a3/d2/137c7b6841c942124eae921279e5c41b1c34bab0e6fc60c7348e69afd165/numpy-2.3.4-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:36dc13af226aeab72b7abad501d370d606326a0029b9f435eacb3b8c94b8a8b7", size = 14591904, upload-time = "2025-10-15T16:15:29.044Z" }, - { url = "https://files.pythonhosted.org/packages/bb/32/67e3b0f07b0aba57a078c4ab777a9e8e6bc62f24fb53a2337f75f9691699/numpy-2.3.4-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a7b2f9a18b5ff9824a6af80de4f37f4ec3c2aab05ef08f51c77a093f5b89adda", size = 16939602, upload-time = "2025-10-15T16:15:31.106Z" }, - { url = "https://files.pythonhosted.org/packages/95/22/9639c30e32c93c4cee3ccdb4b09c2d0fbff4dcd06d36b357da06146530fb/numpy-2.3.4-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:9984bd645a8db6ca15d850ff996856d8762c51a2239225288f08f9050ca240a0", size = 16372661, upload-time = "2025-10-15T16:15:33.546Z" }, - { url = "https://files.pythonhosted.org/packages/12/e9/a685079529be2b0156ae0c11b13d6be647743095bb51d46589e95be88086/numpy-2.3.4-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:64c5825affc76942973a70acf438a8ab618dbd692b84cd5ec40a0a0509edc09a", size = 18884682, upload-time = "2025-10-15T16:15:36.105Z" }, - { url = "https://files.pythonhosted.org/packages/cf/85/f6f00d019b0cc741e64b4e00ce865a57b6bed945d1bbeb1ccadbc647959b/numpy-2.3.4-cp311-cp311-win32.whl", hash = "sha256:ed759bf7a70342f7817d88376eb7142fab9fef8320d6019ef87fae05a99874e1", size = 6570076, upload-time = "2025-10-15T16:15:38.225Z" }, - { url = "https://files.pythonhosted.org/packages/7d/10/f8850982021cb90e2ec31990291f9e830ce7d94eef432b15066e7cbe0bec/numpy-2.3.4-cp311-cp311-win_amd64.whl", hash = "sha256:faba246fb30ea2a526c2e9645f61612341de1a83fb1e0c5edf4ddda5a9c10996", size = 13089358, upload-time = "2025-10-15T16:15:40.404Z" }, - { url = "https://files.pythonhosted.org/packages/d1/ad/afdd8351385edf0b3445f9e24210a9c3971ef4de8fd85155462fc4321d79/numpy-2.3.4-cp311-cp311-win_arm64.whl", hash = "sha256:4c01835e718bcebe80394fd0ac66c07cbb90147ebbdad3dcecd3f25de2ae7e2c", size = 10462292, upload-time = "2025-10-15T16:15:42.896Z" }, - { url = "https://files.pythonhosted.org/packages/96/7a/02420400b736f84317e759291b8edaeee9dc921f72b045475a9cbdb26b17/numpy-2.3.4-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:ef1b5a3e808bc40827b5fa2c8196151a4c5abe110e1726949d7abddfe5c7ae11", size = 20957727, upload-time = "2025-10-15T16:15:44.9Z" }, - { url = "https://files.pythonhosted.org/packages/18/90/a014805d627aa5750f6f0e878172afb6454552da929144b3c07fcae1bb13/numpy-2.3.4-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:c2f91f496a87235c6aaf6d3f3d89b17dba64996abadccb289f48456cff931ca9", size = 14187262, upload-time = "2025-10-15T16:15:47.761Z" }, - { url = "https://files.pythonhosted.org/packages/c7/e4/0a94b09abe89e500dc748e7515f21a13e30c5c3fe3396e6d4ac108c25fca/numpy-2.3.4-cp312-cp312-macosx_14_0_arm64.whl", hash = "sha256:f77e5b3d3da652b474cc80a14084927a5e86a5eccf54ca8ca5cbd697bf7f2667", size = 5115992, upload-time = "2025-10-15T16:15:50.144Z" }, - { url = "https://files.pythonhosted.org/packages/88/dd/db77c75b055c6157cbd4f9c92c4458daef0dd9cbe6d8d2fe7f803cb64c37/numpy-2.3.4-cp312-cp312-macosx_14_0_x86_64.whl", hash = "sha256:8ab1c5f5ee40d6e01cbe96de5863e39b215a4d24e7d007cad56c7184fdf4aeef", size = 6648672, upload-time = "2025-10-15T16:15:52.442Z" }, - { url = "https://files.pythonhosted.org/packages/e1/e6/e31b0d713719610e406c0ea3ae0d90760465b086da8783e2fd835ad59027/numpy-2.3.4-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:77b84453f3adcb994ddbd0d1c5d11db2d6bda1a2b7fd5ac5bd4649d6f5dc682e", size = 14284156, upload-time = "2025-10-15T16:15:54.351Z" }, - { url = "https://files.pythonhosted.org/packages/f9/58/30a85127bfee6f108282107caf8e06a1f0cc997cb6b52cdee699276fcce4/numpy-2.3.4-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4121c5beb58a7f9e6dfdee612cb24f4df5cd4db6e8261d7f4d7450a997a65d6a", size = 16641271, upload-time = "2025-10-15T16:15:56.67Z" }, - { url = "https://files.pythonhosted.org/packages/06/f2/2e06a0f2adf23e3ae29283ad96959267938d0efd20a2e25353b70065bfec/numpy-2.3.4-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:65611ecbb00ac9846efe04db15cbe6186f562f6bb7e5e05f077e53a599225d16", size = 16059531, upload-time = "2025-10-15T16:15:59.412Z" }, - { url = "https://files.pythonhosted.org/packages/b0/e7/b106253c7c0d5dc352b9c8fab91afd76a93950998167fa3e5afe4ef3a18f/numpy-2.3.4-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:dabc42f9c6577bcc13001b8810d300fe814b4cfbe8a92c873f269484594f9786", size = 18578983, upload-time = "2025-10-15T16:16:01.804Z" }, - { url = "https://files.pythonhosted.org/packages/73/e3/04ecc41e71462276ee867ccbef26a4448638eadecf1bc56772c9ed6d0255/numpy-2.3.4-cp312-cp312-win32.whl", hash = "sha256:a49d797192a8d950ca59ee2d0337a4d804f713bb5c3c50e8db26d49666e351dc", size = 6291380, upload-time = "2025-10-15T16:16:03.938Z" }, - { url = "https://files.pythonhosted.org/packages/3d/a8/566578b10d8d0e9955b1b6cd5db4e9d4592dd0026a941ff7994cedda030a/numpy-2.3.4-cp312-cp312-win_amd64.whl", hash = "sha256:985f1e46358f06c2a09921e8921e2c98168ed4ae12ccd6e5e87a4f1857923f32", size = 12787999, upload-time = "2025-10-15T16:16:05.801Z" }, - { url = "https://files.pythonhosted.org/packages/58/22/9c903a957d0a8071b607f5b1bff0761d6e608b9a965945411f867d515db1/numpy-2.3.4-cp312-cp312-win_arm64.whl", hash = "sha256:4635239814149e06e2cb9db3dd584b2fa64316c96f10656983b8026a82e6e4db", size = 10197412, upload-time = "2025-10-15T16:16:07.854Z" }, - { url = "https://files.pythonhosted.org/packages/57/7e/b72610cc91edf138bc588df5150957a4937221ca6058b825b4725c27be62/numpy-2.3.4-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:c090d4860032b857d94144d1a9976b8e36709e40386db289aaf6672de2a81966", size = 20950335, upload-time = "2025-10-15T16:16:10.304Z" }, - { url = "https://files.pythonhosted.org/packages/3e/46/bdd3370dcea2f95ef14af79dbf81e6927102ddf1cc54adc0024d61252fd9/numpy-2.3.4-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:a13fc473b6db0be619e45f11f9e81260f7302f8d180c49a22b6e6120022596b3", size = 14179878, upload-time = "2025-10-15T16:16:12.595Z" }, - { url = "https://files.pythonhosted.org/packages/ac/01/5a67cb785bda60f45415d09c2bc245433f1c68dd82eef9c9002c508b5a65/numpy-2.3.4-cp313-cp313-macosx_14_0_arm64.whl", hash = "sha256:3634093d0b428e6c32c3a69b78e554f0cd20ee420dcad5a9f3b2a63762ce4197", size = 5108673, upload-time = "2025-10-15T16:16:14.877Z" }, - { url = "https://files.pythonhosted.org/packages/c2/cd/8428e23a9fcebd33988f4cb61208fda832800ca03781f471f3727a820704/numpy-2.3.4-cp313-cp313-macosx_14_0_x86_64.whl", hash = "sha256:043885b4f7e6e232d7df4f51ffdef8c36320ee9d5f227b380ea636722c7ed12e", size = 6641438, upload-time = "2025-10-15T16:16:16.805Z" }, - { url = "https://files.pythonhosted.org/packages/3e/d1/913fe563820f3c6b079f992458f7331278dcd7ba8427e8e745af37ddb44f/numpy-2.3.4-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4ee6a571d1e4f0ea6d5f22d6e5fbd6ed1dc2b18542848e1e7301bd190500c9d7", size = 14281290, upload-time = "2025-10-15T16:16:18.764Z" }, - { url = "https://files.pythonhosted.org/packages/9e/7e/7d306ff7cb143e6d975cfa7eb98a93e73495c4deabb7d1b5ecf09ea0fd69/numpy-2.3.4-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fc8a63918b04b8571789688b2780ab2b4a33ab44bfe8ccea36d3eba51228c953", size = 16636543, upload-time = "2025-10-15T16:16:21.072Z" }, - { url = "https://files.pythonhosted.org/packages/47/6a/8cfc486237e56ccfb0db234945552a557ca266f022d281a2f577b98e955c/numpy-2.3.4-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:40cc556d5abbc54aabe2b1ae287042d7bdb80c08edede19f0c0afb36ae586f37", size = 16056117, upload-time = "2025-10-15T16:16:23.369Z" }, - { url = "https://files.pythonhosted.org/packages/b1/0e/42cb5e69ea901e06ce24bfcc4b5664a56f950a70efdcf221f30d9615f3f3/numpy-2.3.4-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:ecb63014bb7f4ce653f8be7f1df8cbc6093a5a2811211770f6606cc92b5a78fd", size = 18577788, upload-time = "2025-10-15T16:16:27.496Z" }, - { url = "https://files.pythonhosted.org/packages/86/92/41c3d5157d3177559ef0a35da50f0cda7fa071f4ba2306dd36818591a5bc/numpy-2.3.4-cp313-cp313-win32.whl", hash = "sha256:e8370eb6925bb8c1c4264fec52b0384b44f675f191df91cbe0140ec9f0955646", size = 6282620, upload-time = "2025-10-15T16:16:29.811Z" }, - { url = "https://files.pythonhosted.org/packages/09/97/fd421e8bc50766665ad35536c2bb4ef916533ba1fdd053a62d96cc7c8b95/numpy-2.3.4-cp313-cp313-win_amd64.whl", hash = "sha256:56209416e81a7893036eea03abcb91c130643eb14233b2515c90dcac963fe99d", size = 12784672, upload-time = "2025-10-15T16:16:31.589Z" }, - { url = "https://files.pythonhosted.org/packages/ad/df/5474fb2f74970ca8eb978093969b125a84cc3d30e47f82191f981f13a8a0/numpy-2.3.4-cp313-cp313-win_arm64.whl", hash = "sha256:a700a4031bc0fd6936e78a752eefb79092cecad2599ea9c8039c548bc097f9bc", size = 10196702, upload-time = "2025-10-15T16:16:33.902Z" }, - { url = "https://files.pythonhosted.org/packages/11/83/66ac031464ec1767ea3ed48ce40f615eb441072945e98693bec0bcd056cc/numpy-2.3.4-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:86966db35c4040fdca64f0816a1c1dd8dbd027d90fca5a57e00e1ca4cd41b879", size = 21049003, upload-time = "2025-10-15T16:16:36.101Z" }, - { url = "https://files.pythonhosted.org/packages/5f/99/5b14e0e686e61371659a1d5bebd04596b1d72227ce36eed121bb0aeab798/numpy-2.3.4-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:838f045478638b26c375ee96ea89464d38428c69170360b23a1a50fa4baa3562", size = 14302980, upload-time = "2025-10-15T16:16:39.124Z" }, - { url = "https://files.pythonhosted.org/packages/2c/44/e9486649cd087d9fc6920e3fc3ac2aba10838d10804b1e179fb7cbc4e634/numpy-2.3.4-cp313-cp313t-macosx_14_0_arm64.whl", hash = "sha256:d7315ed1dab0286adca467377c8381cd748f3dc92235f22a7dfc42745644a96a", size = 5231472, upload-time = "2025-10-15T16:16:41.168Z" }, - { url = "https://files.pythonhosted.org/packages/3e/51/902b24fa8887e5fe2063fd61b1895a476d0bbf46811ab0c7fdf4bd127345/numpy-2.3.4-cp313-cp313t-macosx_14_0_x86_64.whl", hash = "sha256:84f01a4d18b2cc4ade1814a08e5f3c907b079c847051d720fad15ce37aa930b6", size = 6739342, upload-time = "2025-10-15T16:16:43.777Z" }, - { url = "https://files.pythonhosted.org/packages/34/f1/4de9586d05b1962acdcdb1dc4af6646361a643f8c864cef7c852bf509740/numpy-2.3.4-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:817e719a868f0dacde4abdfc5c1910b301877970195db9ab6a5e2c4bd5b121f7", size = 14354338, upload-time = "2025-10-15T16:16:46.081Z" }, - { url = "https://files.pythonhosted.org/packages/1f/06/1c16103b425de7969d5a76bdf5ada0804b476fed05d5f9e17b777f1cbefd/numpy-2.3.4-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:85e071da78d92a214212cacea81c6da557cab307f2c34b5f85b628e94803f9c0", size = 16702392, upload-time = "2025-10-15T16:16:48.455Z" }, - { url = "https://files.pythonhosted.org/packages/34/b2/65f4dc1b89b5322093572b6e55161bb42e3e0487067af73627f795cc9d47/numpy-2.3.4-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:2ec646892819370cf3558f518797f16597b4e4669894a2ba712caccc9da53f1f", size = 16134998, upload-time = "2025-10-15T16:16:51.114Z" }, - { url = "https://files.pythonhosted.org/packages/d4/11/94ec578896cdb973aaf56425d6c7f2aff4186a5c00fac15ff2ec46998b46/numpy-2.3.4-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:035796aaaddfe2f9664b9a9372f089cfc88bd795a67bd1bfe15e6e770934cf64", size = 18651574, upload-time = "2025-10-15T16:16:53.429Z" }, - { url = "https://files.pythonhosted.org/packages/62/b7/7efa763ab33dbccf56dade36938a77345ce8e8192d6b39e470ca25ff3cd0/numpy-2.3.4-cp313-cp313t-win32.whl", hash = "sha256:fea80f4f4cf83b54c3a051f2f727870ee51e22f0248d3114b8e755d160b38cfb", size = 6413135, upload-time = "2025-10-15T16:16:55.992Z" }, - { url = "https://files.pythonhosted.org/packages/43/70/aba4c38e8400abcc2f345e13d972fb36c26409b3e644366db7649015f291/numpy-2.3.4-cp313-cp313t-win_amd64.whl", hash = "sha256:15eea9f306b98e0be91eb344a94c0e630689ef302e10c2ce5f7e11905c704f9c", size = 12928582, upload-time = "2025-10-15T16:16:57.943Z" }, - { url = "https://files.pythonhosted.org/packages/67/63/871fad5f0073fc00fbbdd7232962ea1ac40eeaae2bba66c76214f7954236/numpy-2.3.4-cp313-cp313t-win_arm64.whl", hash = "sha256:b6c231c9c2fadbae4011ca5e7e83e12dc4a5072f1a1d85a0a7b3ed754d145a40", size = 10266691, upload-time = "2025-10-15T16:17:00.048Z" }, - { url = "https://files.pythonhosted.org/packages/72/71/ae6170143c115732470ae3a2d01512870dd16e0953f8a6dc89525696069b/numpy-2.3.4-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:81c3e6d8c97295a7360d367f9f8553973651b76907988bb6066376bc2252f24e", size = 20955580, upload-time = "2025-10-15T16:17:02.509Z" }, - { url = "https://files.pythonhosted.org/packages/af/39/4be9222ffd6ca8a30eda033d5f753276a9c3426c397bb137d8e19dedd200/numpy-2.3.4-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:7c26b0b2bf58009ed1f38a641f3db4be8d960a417ca96d14e5b06df1506d41ff", size = 14188056, upload-time = "2025-10-15T16:17:04.873Z" }, - { url = "https://files.pythonhosted.org/packages/6c/3d/d85f6700d0a4aa4f9491030e1021c2b2b7421b2b38d01acd16734a2bfdc7/numpy-2.3.4-cp314-cp314-macosx_14_0_arm64.whl", hash = "sha256:62b2198c438058a20b6704351b35a1d7db881812d8512d67a69c9de1f18ca05f", size = 5116555, upload-time = "2025-10-15T16:17:07.499Z" }, - { url = "https://files.pythonhosted.org/packages/bf/04/82c1467d86f47eee8a19a464c92f90a9bb68ccf14a54c5224d7031241ffb/numpy-2.3.4-cp314-cp314-macosx_14_0_x86_64.whl", hash = "sha256:9d729d60f8d53a7361707f4b68a9663c968882dd4f09e0d58c044c8bf5faee7b", size = 6643581, upload-time = "2025-10-15T16:17:09.774Z" }, - { url = "https://files.pythonhosted.org/packages/0c/d3/c79841741b837e293f48bd7db89d0ac7a4f2503b382b78a790ef1dc778a5/numpy-2.3.4-cp314-cp314-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:bd0c630cf256b0a7fd9d0a11c9413b42fef5101219ce6ed5a09624f5a65392c7", size = 14299186, upload-time = "2025-10-15T16:17:11.937Z" }, - { url = "https://files.pythonhosted.org/packages/e8/7e/4a14a769741fbf237eec5a12a2cbc7a4c4e061852b6533bcb9e9a796c908/numpy-2.3.4-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d5e081bc082825f8b139f9e9fe42942cb4054524598aaeb177ff476cc76d09d2", size = 16638601, upload-time = "2025-10-15T16:17:14.391Z" }, - { url = "https://files.pythonhosted.org/packages/93/87/1c1de269f002ff0a41173fe01dcc925f4ecff59264cd8f96cf3b60d12c9b/numpy-2.3.4-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:15fb27364ed84114438fff8aaf998c9e19adbeba08c0b75409f8c452a8692c52", size = 16074219, upload-time = "2025-10-15T16:17:17.058Z" }, - { url = "https://files.pythonhosted.org/packages/cd/28/18f72ee77408e40a76d691001ae599e712ca2a47ddd2c4f695b16c65f077/numpy-2.3.4-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:85d9fb2d8cd998c84d13a79a09cc0c1091648e848e4e6249b0ccd7f6b487fa26", size = 18576702, upload-time = "2025-10-15T16:17:19.379Z" }, - { url = "https://files.pythonhosted.org/packages/c3/76/95650169b465ececa8cf4b2e8f6df255d4bf662775e797ade2025cc51ae6/numpy-2.3.4-cp314-cp314-win32.whl", hash = "sha256:e73d63fd04e3a9d6bc187f5455d81abfad05660b212c8804bf3b407e984cd2bc", size = 6337136, upload-time = "2025-10-15T16:17:22.886Z" }, - { url = "https://files.pythonhosted.org/packages/dc/89/a231a5c43ede5d6f77ba4a91e915a87dea4aeea76560ba4d2bf185c683f0/numpy-2.3.4-cp314-cp314-win_amd64.whl", hash = "sha256:3da3491cee49cf16157e70f607c03a217ea6647b1cea4819c4f48e53d49139b9", size = 12920542, upload-time = "2025-10-15T16:17:24.783Z" }, - { url = "https://files.pythonhosted.org/packages/0d/0c/ae9434a888f717c5ed2ff2393b3f344f0ff6f1c793519fa0c540461dc530/numpy-2.3.4-cp314-cp314-win_arm64.whl", hash = "sha256:6d9cd732068e8288dbe2717177320723ccec4fb064123f0caf9bbd90ab5be868", size = 10480213, upload-time = "2025-10-15T16:17:26.935Z" }, - { url = "https://files.pythonhosted.org/packages/83/4b/c4a5f0841f92536f6b9592694a5b5f68c9ab37b775ff342649eadf9055d3/numpy-2.3.4-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:22758999b256b595cf0b1d102b133bb61866ba5ceecf15f759623b64c020c9ec", size = 21052280, upload-time = "2025-10-15T16:17:29.638Z" }, - { url = "https://files.pythonhosted.org/packages/3e/80/90308845fc93b984d2cc96d83e2324ce8ad1fd6efea81b324cba4b673854/numpy-2.3.4-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:9cb177bc55b010b19798dc5497d540dea67fd13a8d9e882b2dae71de0cf09eb3", size = 14302930, upload-time = "2025-10-15T16:17:32.384Z" }, - { url = "https://files.pythonhosted.org/packages/3d/4e/07439f22f2a3b247cec4d63a713faae55e1141a36e77fb212881f7cda3fb/numpy-2.3.4-cp314-cp314t-macosx_14_0_arm64.whl", hash = "sha256:0f2bcc76f1e05e5ab58893407c63d90b2029908fa41f9f1cc51eecce936c3365", size = 5231504, upload-time = "2025-10-15T16:17:34.515Z" }, - { url = "https://files.pythonhosted.org/packages/ab/de/1e11f2547e2fe3d00482b19721855348b94ada8359aef5d40dd57bfae9df/numpy-2.3.4-cp314-cp314t-macosx_14_0_x86_64.whl", hash = "sha256:8dc20bde86802df2ed8397a08d793da0ad7a5fd4ea3ac85d757bf5dd4ad7c252", size = 6739405, upload-time = "2025-10-15T16:17:36.128Z" }, - { url = "https://files.pythonhosted.org/packages/3b/40/8cd57393a26cebe2e923005db5134a946c62fa56a1087dc7c478f3e30837/numpy-2.3.4-cp314-cp314t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5e199c087e2aa71c8f9ce1cb7a8e10677dc12457e7cc1be4798632da37c3e86e", size = 14354866, upload-time = "2025-10-15T16:17:38.884Z" }, - { url = "https://files.pythonhosted.org/packages/93/39/5b3510f023f96874ee6fea2e40dfa99313a00bf3ab779f3c92978f34aace/numpy-2.3.4-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:85597b2d25ddf655495e2363fe044b0ae999b75bc4d630dc0d886484b03a5eb0", size = 16703296, upload-time = "2025-10-15T16:17:41.564Z" }, - { url = "https://files.pythonhosted.org/packages/41/0d/19bb163617c8045209c1996c4e427bccbc4bbff1e2c711f39203c8ddbb4a/numpy-2.3.4-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:04a69abe45b49c5955923cf2c407843d1c85013b424ae8a560bba16c92fe44a0", size = 16136046, upload-time = "2025-10-15T16:17:43.901Z" }, - { url = "https://files.pythonhosted.org/packages/e2/c1/6dba12fdf68b02a21ac411c9df19afa66bed2540f467150ca64d246b463d/numpy-2.3.4-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:e1708fac43ef8b419c975926ce1eaf793b0c13b7356cfab6ab0dc34c0a02ac0f", size = 18652691, upload-time = "2025-10-15T16:17:46.247Z" }, - { url = "https://files.pythonhosted.org/packages/f8/73/f85056701dbbbb910c51d846c58d29fd46b30eecd2b6ba760fc8b8a1641b/numpy-2.3.4-cp314-cp314t-win32.whl", hash = "sha256:863e3b5f4d9915aaf1b8ec79ae560ad21f0b8d5e3adc31e73126491bb86dee1d", size = 6485782, upload-time = "2025-10-15T16:17:48.872Z" }, - { url = "https://files.pythonhosted.org/packages/17/90/28fa6f9865181cb817c2471ee65678afa8a7e2a1fb16141473d5fa6bacc3/numpy-2.3.4-cp314-cp314t-win_amd64.whl", hash = "sha256:962064de37b9aef801d33bc579690f8bfe6c5e70e29b61783f60bcba838a14d6", size = 13113301, upload-time = "2025-10-15T16:17:50.938Z" }, - { url = "https://files.pythonhosted.org/packages/54/23/08c002201a8e7e1f9afba93b97deceb813252d9cfd0d3351caed123dcf97/numpy-2.3.4-cp314-cp314t-win_arm64.whl", hash = "sha256:8b5a9a39c45d852b62693d9b3f3e0fe052541f804296ff401a72a1b60edafb29", size = 10547532, upload-time = "2025-10-15T16:17:53.48Z" }, - { url = "https://files.pythonhosted.org/packages/b1/b6/64898f51a86ec88ca1257a59c1d7fd077b60082a119affefcdf1dd0df8ca/numpy-2.3.4-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:6e274603039f924c0fe5cb73438fa9246699c78a6df1bd3decef9ae592ae1c05", size = 21131552, upload-time = "2025-10-15T16:17:55.845Z" }, - { url = "https://files.pythonhosted.org/packages/ce/4c/f135dc6ebe2b6a3c77f4e4838fa63d350f85c99462012306ada1bd4bc460/numpy-2.3.4-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:d149aee5c72176d9ddbc6803aef9c0f6d2ceeea7626574fc68518da5476fa346", size = 14377796, upload-time = "2025-10-15T16:17:58.308Z" }, - { url = "https://files.pythonhosted.org/packages/d0/a4/f33f9c23fcc13dd8412fc8614559b5b797e0aba9d8e01dfa8bae10c84004/numpy-2.3.4-pp311-pypy311_pp73-macosx_14_0_arm64.whl", hash = "sha256:6d34ed9db9e6395bb6cd33286035f73a59b058169733a9db9f85e650b88df37e", size = 5306904, upload-time = "2025-10-15T16:18:00.596Z" }, - { url = "https://files.pythonhosted.org/packages/28/af/c44097f25f834360f9fb960fa082863e0bad14a42f36527b2a121abdec56/numpy-2.3.4-pp311-pypy311_pp73-macosx_14_0_x86_64.whl", hash = "sha256:fdebe771ca06bb8d6abce84e51dca9f7921fe6ad34a0c914541b063e9a68928b", size = 6819682, upload-time = "2025-10-15T16:18:02.32Z" }, - { url = "https://files.pythonhosted.org/packages/c5/8c/cd283b54c3c2b77e188f63e23039844f56b23bba1712318288c13fe86baf/numpy-2.3.4-pp311-pypy311_pp73-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:957e92defe6c08211eb77902253b14fe5b480ebc5112bc741fd5e9cd0608f847", size = 14422300, upload-time = "2025-10-15T16:18:04.271Z" }, - { url = "https://files.pythonhosted.org/packages/b0/f0/8404db5098d92446b3e3695cf41c6f0ecb703d701cb0b7566ee2177f2eee/numpy-2.3.4-pp311-pypy311_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:13b9062e4f5c7ee5c7e5be96f29ba71bc5a37fed3d1d77c37390ae00724d296d", size = 16760806, upload-time = "2025-10-15T16:18:06.668Z" }, - { url = "https://files.pythonhosted.org/packages/95/8e/2844c3959ce9a63acc7c8e50881133d86666f0420bcde695e115ced0920f/numpy-2.3.4-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:81b3a59793523e552c4a96109dde028aa4448ae06ccac5a76ff6532a85558a7f", size = 12973130, upload-time = "2025-10-15T16:18:09.397Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/b5/f4/098d2270d52b41f1bd7db9fc288aaa0400cb48c2a3e2af6fa365d9720947/numpy-2.3.4.tar.gz", hash = "sha256:a7d018bfedb375a8d979ac758b120ba846a7fe764911a64465fd87b8729f4a6a", size = 20582187 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/60/e7/0e07379944aa8afb49a556a2b54587b828eb41dc9adc56fb7615b678ca53/numpy-2.3.4-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:e78aecd2800b32e8347ce49316d3eaf04aed849cd5b38e0af39f829a4e59f5eb", size = 21259519 }, + { url = "https://files.pythonhosted.org/packages/d0/cb/5a69293561e8819b09e34ed9e873b9a82b5f2ade23dce4c51dc507f6cfe1/numpy-2.3.4-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:7fd09cc5d65bda1e79432859c40978010622112e9194e581e3415a3eccc7f43f", size = 14452796 }, + { url = "https://files.pythonhosted.org/packages/e4/04/ff11611200acd602a1e5129e36cfd25bf01ad8e5cf927baf2e90236eb02e/numpy-2.3.4-cp311-cp311-macosx_14_0_arm64.whl", hash = "sha256:1b219560ae2c1de48ead517d085bc2d05b9433f8e49d0955c82e8cd37bd7bf36", size = 5381639 }, + { url = "https://files.pythonhosted.org/packages/ea/77/e95c757a6fe7a48d28a009267408e8aa382630cc1ad1db7451b3bc21dbb4/numpy-2.3.4-cp311-cp311-macosx_14_0_x86_64.whl", hash = "sha256:bafa7d87d4c99752d07815ed7a2c0964f8ab311eb8168f41b910bd01d15b6032", size = 6914296 }, + { url = "https://files.pythonhosted.org/packages/a3/d2/137c7b6841c942124eae921279e5c41b1c34bab0e6fc60c7348e69afd165/numpy-2.3.4-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:36dc13af226aeab72b7abad501d370d606326a0029b9f435eacb3b8c94b8a8b7", size = 14591904 }, + { url = "https://files.pythonhosted.org/packages/bb/32/67e3b0f07b0aba57a078c4ab777a9e8e6bc62f24fb53a2337f75f9691699/numpy-2.3.4-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a7b2f9a18b5ff9824a6af80de4f37f4ec3c2aab05ef08f51c77a093f5b89adda", size = 16939602 }, + { url = "https://files.pythonhosted.org/packages/95/22/9639c30e32c93c4cee3ccdb4b09c2d0fbff4dcd06d36b357da06146530fb/numpy-2.3.4-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:9984bd645a8db6ca15d850ff996856d8762c51a2239225288f08f9050ca240a0", size = 16372661 }, + { url = "https://files.pythonhosted.org/packages/12/e9/a685079529be2b0156ae0c11b13d6be647743095bb51d46589e95be88086/numpy-2.3.4-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:64c5825affc76942973a70acf438a8ab618dbd692b84cd5ec40a0a0509edc09a", size = 18884682 }, + { url = "https://files.pythonhosted.org/packages/cf/85/f6f00d019b0cc741e64b4e00ce865a57b6bed945d1bbeb1ccadbc647959b/numpy-2.3.4-cp311-cp311-win32.whl", hash = "sha256:ed759bf7a70342f7817d88376eb7142fab9fef8320d6019ef87fae05a99874e1", size = 6570076 }, + { url = "https://files.pythonhosted.org/packages/7d/10/f8850982021cb90e2ec31990291f9e830ce7d94eef432b15066e7cbe0bec/numpy-2.3.4-cp311-cp311-win_amd64.whl", hash = "sha256:faba246fb30ea2a526c2e9645f61612341de1a83fb1e0c5edf4ddda5a9c10996", size = 13089358 }, + { url = "https://files.pythonhosted.org/packages/d1/ad/afdd8351385edf0b3445f9e24210a9c3971ef4de8fd85155462fc4321d79/numpy-2.3.4-cp311-cp311-win_arm64.whl", hash = "sha256:4c01835e718bcebe80394fd0ac66c07cbb90147ebbdad3dcecd3f25de2ae7e2c", size = 10462292 }, + { url = "https://files.pythonhosted.org/packages/96/7a/02420400b736f84317e759291b8edaeee9dc921f72b045475a9cbdb26b17/numpy-2.3.4-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:ef1b5a3e808bc40827b5fa2c8196151a4c5abe110e1726949d7abddfe5c7ae11", size = 20957727 }, + { url = "https://files.pythonhosted.org/packages/18/90/a014805d627aa5750f6f0e878172afb6454552da929144b3c07fcae1bb13/numpy-2.3.4-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:c2f91f496a87235c6aaf6d3f3d89b17dba64996abadccb289f48456cff931ca9", size = 14187262 }, + { url = "https://files.pythonhosted.org/packages/c7/e4/0a94b09abe89e500dc748e7515f21a13e30c5c3fe3396e6d4ac108c25fca/numpy-2.3.4-cp312-cp312-macosx_14_0_arm64.whl", hash = "sha256:f77e5b3d3da652b474cc80a14084927a5e86a5eccf54ca8ca5cbd697bf7f2667", size = 5115992 }, + { url = "https://files.pythonhosted.org/packages/88/dd/db77c75b055c6157cbd4f9c92c4458daef0dd9cbe6d8d2fe7f803cb64c37/numpy-2.3.4-cp312-cp312-macosx_14_0_x86_64.whl", hash = "sha256:8ab1c5f5ee40d6e01cbe96de5863e39b215a4d24e7d007cad56c7184fdf4aeef", size = 6648672 }, + { url = "https://files.pythonhosted.org/packages/e1/e6/e31b0d713719610e406c0ea3ae0d90760465b086da8783e2fd835ad59027/numpy-2.3.4-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:77b84453f3adcb994ddbd0d1c5d11db2d6bda1a2b7fd5ac5bd4649d6f5dc682e", size = 14284156 }, + { url = "https://files.pythonhosted.org/packages/f9/58/30a85127bfee6f108282107caf8e06a1f0cc997cb6b52cdee699276fcce4/numpy-2.3.4-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4121c5beb58a7f9e6dfdee612cb24f4df5cd4db6e8261d7f4d7450a997a65d6a", size = 16641271 }, + { url = "https://files.pythonhosted.org/packages/06/f2/2e06a0f2adf23e3ae29283ad96959267938d0efd20a2e25353b70065bfec/numpy-2.3.4-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:65611ecbb00ac9846efe04db15cbe6186f562f6bb7e5e05f077e53a599225d16", size = 16059531 }, + { url = "https://files.pythonhosted.org/packages/b0/e7/b106253c7c0d5dc352b9c8fab91afd76a93950998167fa3e5afe4ef3a18f/numpy-2.3.4-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:dabc42f9c6577bcc13001b8810d300fe814b4cfbe8a92c873f269484594f9786", size = 18578983 }, + { url = "https://files.pythonhosted.org/packages/73/e3/04ecc41e71462276ee867ccbef26a4448638eadecf1bc56772c9ed6d0255/numpy-2.3.4-cp312-cp312-win32.whl", hash = "sha256:a49d797192a8d950ca59ee2d0337a4d804f713bb5c3c50e8db26d49666e351dc", size = 6291380 }, + { url = "https://files.pythonhosted.org/packages/3d/a8/566578b10d8d0e9955b1b6cd5db4e9d4592dd0026a941ff7994cedda030a/numpy-2.3.4-cp312-cp312-win_amd64.whl", hash = "sha256:985f1e46358f06c2a09921e8921e2c98168ed4ae12ccd6e5e87a4f1857923f32", size = 12787999 }, + { url = "https://files.pythonhosted.org/packages/58/22/9c903a957d0a8071b607f5b1bff0761d6e608b9a965945411f867d515db1/numpy-2.3.4-cp312-cp312-win_arm64.whl", hash = "sha256:4635239814149e06e2cb9db3dd584b2fa64316c96f10656983b8026a82e6e4db", size = 10197412 }, + { url = "https://files.pythonhosted.org/packages/57/7e/b72610cc91edf138bc588df5150957a4937221ca6058b825b4725c27be62/numpy-2.3.4-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:c090d4860032b857d94144d1a9976b8e36709e40386db289aaf6672de2a81966", size = 20950335 }, + { url = "https://files.pythonhosted.org/packages/3e/46/bdd3370dcea2f95ef14af79dbf81e6927102ddf1cc54adc0024d61252fd9/numpy-2.3.4-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:a13fc473b6db0be619e45f11f9e81260f7302f8d180c49a22b6e6120022596b3", size = 14179878 }, + { url = "https://files.pythonhosted.org/packages/ac/01/5a67cb785bda60f45415d09c2bc245433f1c68dd82eef9c9002c508b5a65/numpy-2.3.4-cp313-cp313-macosx_14_0_arm64.whl", hash = "sha256:3634093d0b428e6c32c3a69b78e554f0cd20ee420dcad5a9f3b2a63762ce4197", size = 5108673 }, + { url = "https://files.pythonhosted.org/packages/c2/cd/8428e23a9fcebd33988f4cb61208fda832800ca03781f471f3727a820704/numpy-2.3.4-cp313-cp313-macosx_14_0_x86_64.whl", hash = "sha256:043885b4f7e6e232d7df4f51ffdef8c36320ee9d5f227b380ea636722c7ed12e", size = 6641438 }, + { url = "https://files.pythonhosted.org/packages/3e/d1/913fe563820f3c6b079f992458f7331278dcd7ba8427e8e745af37ddb44f/numpy-2.3.4-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4ee6a571d1e4f0ea6d5f22d6e5fbd6ed1dc2b18542848e1e7301bd190500c9d7", size = 14281290 }, + { url = "https://files.pythonhosted.org/packages/9e/7e/7d306ff7cb143e6d975cfa7eb98a93e73495c4deabb7d1b5ecf09ea0fd69/numpy-2.3.4-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fc8a63918b04b8571789688b2780ab2b4a33ab44bfe8ccea36d3eba51228c953", size = 16636543 }, + { url = "https://files.pythonhosted.org/packages/47/6a/8cfc486237e56ccfb0db234945552a557ca266f022d281a2f577b98e955c/numpy-2.3.4-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:40cc556d5abbc54aabe2b1ae287042d7bdb80c08edede19f0c0afb36ae586f37", size = 16056117 }, + { url = "https://files.pythonhosted.org/packages/b1/0e/42cb5e69ea901e06ce24bfcc4b5664a56f950a70efdcf221f30d9615f3f3/numpy-2.3.4-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:ecb63014bb7f4ce653f8be7f1df8cbc6093a5a2811211770f6606cc92b5a78fd", size = 18577788 }, + { url = "https://files.pythonhosted.org/packages/86/92/41c3d5157d3177559ef0a35da50f0cda7fa071f4ba2306dd36818591a5bc/numpy-2.3.4-cp313-cp313-win32.whl", hash = "sha256:e8370eb6925bb8c1c4264fec52b0384b44f675f191df91cbe0140ec9f0955646", size = 6282620 }, + { url = "https://files.pythonhosted.org/packages/09/97/fd421e8bc50766665ad35536c2bb4ef916533ba1fdd053a62d96cc7c8b95/numpy-2.3.4-cp313-cp313-win_amd64.whl", hash = "sha256:56209416e81a7893036eea03abcb91c130643eb14233b2515c90dcac963fe99d", size = 12784672 }, + { url = "https://files.pythonhosted.org/packages/ad/df/5474fb2f74970ca8eb978093969b125a84cc3d30e47f82191f981f13a8a0/numpy-2.3.4-cp313-cp313-win_arm64.whl", hash = "sha256:a700a4031bc0fd6936e78a752eefb79092cecad2599ea9c8039c548bc097f9bc", size = 10196702 }, + { url = "https://files.pythonhosted.org/packages/11/83/66ac031464ec1767ea3ed48ce40f615eb441072945e98693bec0bcd056cc/numpy-2.3.4-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:86966db35c4040fdca64f0816a1c1dd8dbd027d90fca5a57e00e1ca4cd41b879", size = 21049003 }, + { url = "https://files.pythonhosted.org/packages/5f/99/5b14e0e686e61371659a1d5bebd04596b1d72227ce36eed121bb0aeab798/numpy-2.3.4-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:838f045478638b26c375ee96ea89464d38428c69170360b23a1a50fa4baa3562", size = 14302980 }, + { url = "https://files.pythonhosted.org/packages/2c/44/e9486649cd087d9fc6920e3fc3ac2aba10838d10804b1e179fb7cbc4e634/numpy-2.3.4-cp313-cp313t-macosx_14_0_arm64.whl", hash = "sha256:d7315ed1dab0286adca467377c8381cd748f3dc92235f22a7dfc42745644a96a", size = 5231472 }, + { url = "https://files.pythonhosted.org/packages/3e/51/902b24fa8887e5fe2063fd61b1895a476d0bbf46811ab0c7fdf4bd127345/numpy-2.3.4-cp313-cp313t-macosx_14_0_x86_64.whl", hash = "sha256:84f01a4d18b2cc4ade1814a08e5f3c907b079c847051d720fad15ce37aa930b6", size = 6739342 }, + { url = "https://files.pythonhosted.org/packages/34/f1/4de9586d05b1962acdcdb1dc4af6646361a643f8c864cef7c852bf509740/numpy-2.3.4-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:817e719a868f0dacde4abdfc5c1910b301877970195db9ab6a5e2c4bd5b121f7", size = 14354338 }, + { url = "https://files.pythonhosted.org/packages/1f/06/1c16103b425de7969d5a76bdf5ada0804b476fed05d5f9e17b777f1cbefd/numpy-2.3.4-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:85e071da78d92a214212cacea81c6da557cab307f2c34b5f85b628e94803f9c0", size = 16702392 }, + { url = "https://files.pythonhosted.org/packages/34/b2/65f4dc1b89b5322093572b6e55161bb42e3e0487067af73627f795cc9d47/numpy-2.3.4-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:2ec646892819370cf3558f518797f16597b4e4669894a2ba712caccc9da53f1f", size = 16134998 }, + { url = "https://files.pythonhosted.org/packages/d4/11/94ec578896cdb973aaf56425d6c7f2aff4186a5c00fac15ff2ec46998b46/numpy-2.3.4-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:035796aaaddfe2f9664b9a9372f089cfc88bd795a67bd1bfe15e6e770934cf64", size = 18651574 }, + { url = "https://files.pythonhosted.org/packages/62/b7/7efa763ab33dbccf56dade36938a77345ce8e8192d6b39e470ca25ff3cd0/numpy-2.3.4-cp313-cp313t-win32.whl", hash = "sha256:fea80f4f4cf83b54c3a051f2f727870ee51e22f0248d3114b8e755d160b38cfb", size = 6413135 }, + { url = "https://files.pythonhosted.org/packages/43/70/aba4c38e8400abcc2f345e13d972fb36c26409b3e644366db7649015f291/numpy-2.3.4-cp313-cp313t-win_amd64.whl", hash = "sha256:15eea9f306b98e0be91eb344a94c0e630689ef302e10c2ce5f7e11905c704f9c", size = 12928582 }, + { url = "https://files.pythonhosted.org/packages/67/63/871fad5f0073fc00fbbdd7232962ea1ac40eeaae2bba66c76214f7954236/numpy-2.3.4-cp313-cp313t-win_arm64.whl", hash = "sha256:b6c231c9c2fadbae4011ca5e7e83e12dc4a5072f1a1d85a0a7b3ed754d145a40", size = 10266691 }, + { url = "https://files.pythonhosted.org/packages/72/71/ae6170143c115732470ae3a2d01512870dd16e0953f8a6dc89525696069b/numpy-2.3.4-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:81c3e6d8c97295a7360d367f9f8553973651b76907988bb6066376bc2252f24e", size = 20955580 }, + { url = "https://files.pythonhosted.org/packages/af/39/4be9222ffd6ca8a30eda033d5f753276a9c3426c397bb137d8e19dedd200/numpy-2.3.4-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:7c26b0b2bf58009ed1f38a641f3db4be8d960a417ca96d14e5b06df1506d41ff", size = 14188056 }, + { url = "https://files.pythonhosted.org/packages/6c/3d/d85f6700d0a4aa4f9491030e1021c2b2b7421b2b38d01acd16734a2bfdc7/numpy-2.3.4-cp314-cp314-macosx_14_0_arm64.whl", hash = "sha256:62b2198c438058a20b6704351b35a1d7db881812d8512d67a69c9de1f18ca05f", size = 5116555 }, + { url = "https://files.pythonhosted.org/packages/bf/04/82c1467d86f47eee8a19a464c92f90a9bb68ccf14a54c5224d7031241ffb/numpy-2.3.4-cp314-cp314-macosx_14_0_x86_64.whl", hash = "sha256:9d729d60f8d53a7361707f4b68a9663c968882dd4f09e0d58c044c8bf5faee7b", size = 6643581 }, + { url = "https://files.pythonhosted.org/packages/0c/d3/c79841741b837e293f48bd7db89d0ac7a4f2503b382b78a790ef1dc778a5/numpy-2.3.4-cp314-cp314-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:bd0c630cf256b0a7fd9d0a11c9413b42fef5101219ce6ed5a09624f5a65392c7", size = 14299186 }, + { url = "https://files.pythonhosted.org/packages/e8/7e/4a14a769741fbf237eec5a12a2cbc7a4c4e061852b6533bcb9e9a796c908/numpy-2.3.4-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d5e081bc082825f8b139f9e9fe42942cb4054524598aaeb177ff476cc76d09d2", size = 16638601 }, + { url = "https://files.pythonhosted.org/packages/93/87/1c1de269f002ff0a41173fe01dcc925f4ecff59264cd8f96cf3b60d12c9b/numpy-2.3.4-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:15fb27364ed84114438fff8aaf998c9e19adbeba08c0b75409f8c452a8692c52", size = 16074219 }, + { url = "https://files.pythonhosted.org/packages/cd/28/18f72ee77408e40a76d691001ae599e712ca2a47ddd2c4f695b16c65f077/numpy-2.3.4-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:85d9fb2d8cd998c84d13a79a09cc0c1091648e848e4e6249b0ccd7f6b487fa26", size = 18576702 }, + { url = "https://files.pythonhosted.org/packages/c3/76/95650169b465ececa8cf4b2e8f6df255d4bf662775e797ade2025cc51ae6/numpy-2.3.4-cp314-cp314-win32.whl", hash = "sha256:e73d63fd04e3a9d6bc187f5455d81abfad05660b212c8804bf3b407e984cd2bc", size = 6337136 }, + { url = "https://files.pythonhosted.org/packages/dc/89/a231a5c43ede5d6f77ba4a91e915a87dea4aeea76560ba4d2bf185c683f0/numpy-2.3.4-cp314-cp314-win_amd64.whl", hash = "sha256:3da3491cee49cf16157e70f607c03a217ea6647b1cea4819c4f48e53d49139b9", size = 12920542 }, + { url = "https://files.pythonhosted.org/packages/0d/0c/ae9434a888f717c5ed2ff2393b3f344f0ff6f1c793519fa0c540461dc530/numpy-2.3.4-cp314-cp314-win_arm64.whl", hash = "sha256:6d9cd732068e8288dbe2717177320723ccec4fb064123f0caf9bbd90ab5be868", size = 10480213 }, + { url = "https://files.pythonhosted.org/packages/83/4b/c4a5f0841f92536f6b9592694a5b5f68c9ab37b775ff342649eadf9055d3/numpy-2.3.4-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:22758999b256b595cf0b1d102b133bb61866ba5ceecf15f759623b64c020c9ec", size = 21052280 }, + { url = "https://files.pythonhosted.org/packages/3e/80/90308845fc93b984d2cc96d83e2324ce8ad1fd6efea81b324cba4b673854/numpy-2.3.4-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:9cb177bc55b010b19798dc5497d540dea67fd13a8d9e882b2dae71de0cf09eb3", size = 14302930 }, + { url = "https://files.pythonhosted.org/packages/3d/4e/07439f22f2a3b247cec4d63a713faae55e1141a36e77fb212881f7cda3fb/numpy-2.3.4-cp314-cp314t-macosx_14_0_arm64.whl", hash = "sha256:0f2bcc76f1e05e5ab58893407c63d90b2029908fa41f9f1cc51eecce936c3365", size = 5231504 }, + { url = "https://files.pythonhosted.org/packages/ab/de/1e11f2547e2fe3d00482b19721855348b94ada8359aef5d40dd57bfae9df/numpy-2.3.4-cp314-cp314t-macosx_14_0_x86_64.whl", hash = "sha256:8dc20bde86802df2ed8397a08d793da0ad7a5fd4ea3ac85d757bf5dd4ad7c252", size = 6739405 }, + { url = "https://files.pythonhosted.org/packages/3b/40/8cd57393a26cebe2e923005db5134a946c62fa56a1087dc7c478f3e30837/numpy-2.3.4-cp314-cp314t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5e199c087e2aa71c8f9ce1cb7a8e10677dc12457e7cc1be4798632da37c3e86e", size = 14354866 }, + { url = "https://files.pythonhosted.org/packages/93/39/5b3510f023f96874ee6fea2e40dfa99313a00bf3ab779f3c92978f34aace/numpy-2.3.4-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:85597b2d25ddf655495e2363fe044b0ae999b75bc4d630dc0d886484b03a5eb0", size = 16703296 }, + { url = "https://files.pythonhosted.org/packages/41/0d/19bb163617c8045209c1996c4e427bccbc4bbff1e2c711f39203c8ddbb4a/numpy-2.3.4-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:04a69abe45b49c5955923cf2c407843d1c85013b424ae8a560bba16c92fe44a0", size = 16136046 }, + { url = "https://files.pythonhosted.org/packages/e2/c1/6dba12fdf68b02a21ac411c9df19afa66bed2540f467150ca64d246b463d/numpy-2.3.4-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:e1708fac43ef8b419c975926ce1eaf793b0c13b7356cfab6ab0dc34c0a02ac0f", size = 18652691 }, + { url = "https://files.pythonhosted.org/packages/f8/73/f85056701dbbbb910c51d846c58d29fd46b30eecd2b6ba760fc8b8a1641b/numpy-2.3.4-cp314-cp314t-win32.whl", hash = "sha256:863e3b5f4d9915aaf1b8ec79ae560ad21f0b8d5e3adc31e73126491bb86dee1d", size = 6485782 }, + { url = "https://files.pythonhosted.org/packages/17/90/28fa6f9865181cb817c2471ee65678afa8a7e2a1fb16141473d5fa6bacc3/numpy-2.3.4-cp314-cp314t-win_amd64.whl", hash = "sha256:962064de37b9aef801d33bc579690f8bfe6c5e70e29b61783f60bcba838a14d6", size = 13113301 }, + { url = "https://files.pythonhosted.org/packages/54/23/08c002201a8e7e1f9afba93b97deceb813252d9cfd0d3351caed123dcf97/numpy-2.3.4-cp314-cp314t-win_arm64.whl", hash = "sha256:8b5a9a39c45d852b62693d9b3f3e0fe052541f804296ff401a72a1b60edafb29", size = 10547532 }, + { url = "https://files.pythonhosted.org/packages/b1/b6/64898f51a86ec88ca1257a59c1d7fd077b60082a119affefcdf1dd0df8ca/numpy-2.3.4-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:6e274603039f924c0fe5cb73438fa9246699c78a6df1bd3decef9ae592ae1c05", size = 21131552 }, + { url = "https://files.pythonhosted.org/packages/ce/4c/f135dc6ebe2b6a3c77f4e4838fa63d350f85c99462012306ada1bd4bc460/numpy-2.3.4-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:d149aee5c72176d9ddbc6803aef9c0f6d2ceeea7626574fc68518da5476fa346", size = 14377796 }, + { url = "https://files.pythonhosted.org/packages/d0/a4/f33f9c23fcc13dd8412fc8614559b5b797e0aba9d8e01dfa8bae10c84004/numpy-2.3.4-pp311-pypy311_pp73-macosx_14_0_arm64.whl", hash = "sha256:6d34ed9db9e6395bb6cd33286035f73a59b058169733a9db9f85e650b88df37e", size = 5306904 }, + { url = "https://files.pythonhosted.org/packages/28/af/c44097f25f834360f9fb960fa082863e0bad14a42f36527b2a121abdec56/numpy-2.3.4-pp311-pypy311_pp73-macosx_14_0_x86_64.whl", hash = "sha256:fdebe771ca06bb8d6abce84e51dca9f7921fe6ad34a0c914541b063e9a68928b", size = 6819682 }, + { url = "https://files.pythonhosted.org/packages/c5/8c/cd283b54c3c2b77e188f63e23039844f56b23bba1712318288c13fe86baf/numpy-2.3.4-pp311-pypy311_pp73-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:957e92defe6c08211eb77902253b14fe5b480ebc5112bc741fd5e9cd0608f847", size = 14422300 }, + { url = "https://files.pythonhosted.org/packages/b0/f0/8404db5098d92446b3e3695cf41c6f0ecb703d701cb0b7566ee2177f2eee/numpy-2.3.4-pp311-pypy311_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:13b9062e4f5c7ee5c7e5be96f29ba71bc5a37fed3d1d77c37390ae00724d296d", size = 16760806 }, + { url = "https://files.pythonhosted.org/packages/95/8e/2844c3959ce9a63acc7c8e50881133d86666f0420bcde695e115ced0920f/numpy-2.3.4-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:81b3a59793523e552c4a96109dde028aa4448ae06ccac5a76ff6532a85558a7f", size = 12973130 }, ] [[package]] name = "overrides" version = "7.7.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/36/86/b585f53236dec60aba864e050778b25045f857e17f6e5ea0ae95fe80edd2/overrides-7.7.0.tar.gz", hash = "sha256:55158fa3d93b98cc75299b1e67078ad9003ca27945c76162c1c0766d6f91820a", size = 22812, upload-time = "2024-01-27T21:01:33.423Z" } +sdist = { url = "https://files.pythonhosted.org/packages/36/86/b585f53236dec60aba864e050778b25045f857e17f6e5ea0ae95fe80edd2/overrides-7.7.0.tar.gz", hash = "sha256:55158fa3d93b98cc75299b1e67078ad9003ca27945c76162c1c0766d6f91820a", size = 22812 } wheels = [ - { url = "https://files.pythonhosted.org/packages/2c/ab/fc8290c6a4c722e5514d80f62b2dc4c4df1a68a41d1364e625c35990fcf3/overrides-7.7.0-py3-none-any.whl", hash = "sha256:c7ed9d062f78b8e4c1a7b70bd8796b35ead4d9f510227ef9c5dc7626c60d7e49", size = 17832, upload-time = "2024-01-27T21:01:31.393Z" }, + { url = "https://files.pythonhosted.org/packages/2c/ab/fc8290c6a4c722e5514d80f62b2dc4c4df1a68a41d1364e625c35990fcf3/overrides-7.7.0-py3-none-any.whl", hash = "sha256:c7ed9d062f78b8e4c1a7b70bd8796b35ead4d9f510227ef9c5dc7626c60d7e49", size = 17832 }, ] [[package]] name = "packaging" version = "25.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a1/d4/1fc4078c65507b51b96ca8f8c3ba19e6a61c8253c72794544580a7b6c24d/packaging-25.0.tar.gz", hash = "sha256:d443872c98d677bf60f6a1f2f8c1cb748e8fe762d2bf9d3148b5599295b0fc4f", size = 165727, upload-time = "2025-04-19T11:48:59.673Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a1/d4/1fc4078c65507b51b96ca8f8c3ba19e6a61c8253c72794544580a7b6c24d/packaging-25.0.tar.gz", hash = "sha256:d443872c98d677bf60f6a1f2f8c1cb748e8fe762d2bf9d3148b5599295b0fc4f", size = 165727 } wheels = [ - { url = "https://files.pythonhosted.org/packages/20/12/38679034af332785aac8774540895e234f4d07f7545804097de4b666afd8/packaging-25.0-py3-none-any.whl", hash = "sha256:29572ef2b1f17581046b3a2227d5c611fb25ec70ca1ba8554b24b0e69331a484", size = 66469, upload-time = "2025-04-19T11:48:57.875Z" }, + { url = "https://files.pythonhosted.org/packages/20/12/38679034af332785aac8774540895e234f4d07f7545804097de4b666afd8/packaging-25.0-py3-none-any.whl", hash = "sha256:29572ef2b1f17581046b3a2227d5c611fb25ec70ca1ba8554b24b0e69331a484", size = 66469 }, ] [[package]] @@ -2111,75 +2130,75 @@ dependencies = [ { name = "pytz" }, { name = "tzdata" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/33/01/d40b85317f86cf08d853a4f495195c73815fdf205eef3993821720274518/pandas-2.3.3.tar.gz", hash = "sha256:e05e1af93b977f7eafa636d043f9f94c7ee3ac81af99c13508215942e64c993b", size = 4495223, upload-time = "2025-09-29T23:34:51.853Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/c1/fa/7ac648108144a095b4fb6aa3de1954689f7af60a14cf25583f4960ecb878/pandas-2.3.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:602b8615ebcc4a0c1751e71840428ddebeb142ec02c786e8ad6b1ce3c8dec523", size = 11578790, upload-time = "2025-09-29T23:18:30.065Z" }, - { url = "https://files.pythonhosted.org/packages/9b/35/74442388c6cf008882d4d4bdfc4109be87e9b8b7ccd097ad1e7f006e2e95/pandas-2.3.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:8fe25fc7b623b0ef6b5009149627e34d2a4657e880948ec3c840e9402e5c1b45", size = 10833831, upload-time = "2025-09-29T23:38:56.071Z" }, - { url = "https://files.pythonhosted.org/packages/fe/e4/de154cbfeee13383ad58d23017da99390b91d73f8c11856f2095e813201b/pandas-2.3.3-cp311-cp311-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b468d3dad6ff947df92dcb32ede5b7bd41a9b3cceef0a30ed925f6d01fb8fa66", size = 12199267, upload-time = "2025-09-29T23:18:41.627Z" }, - { url = "https://files.pythonhosted.org/packages/bf/c9/63f8d545568d9ab91476b1818b4741f521646cbdd151c6efebf40d6de6f7/pandas-2.3.3-cp311-cp311-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b98560e98cb334799c0b07ca7967ac361a47326e9b4e5a7dfb5ab2b1c9d35a1b", size = 12789281, upload-time = "2025-09-29T23:18:56.834Z" }, - { url = "https://files.pythonhosted.org/packages/f2/00/a5ac8c7a0e67fd1a6059e40aa08fa1c52cc00709077d2300e210c3ce0322/pandas-2.3.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:1d37b5848ba49824e5c30bedb9c830ab9b7751fd049bc7914533e01c65f79791", size = 13240453, upload-time = "2025-09-29T23:19:09.247Z" }, - { url = "https://files.pythonhosted.org/packages/27/4d/5c23a5bc7bd209231618dd9e606ce076272c9bc4f12023a70e03a86b4067/pandas-2.3.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:db4301b2d1f926ae677a751eb2bd0e8c5f5319c9cb3f88b0becbbb0b07b34151", size = 13890361, upload-time = "2025-09-29T23:19:25.342Z" }, - { url = "https://files.pythonhosted.org/packages/8e/59/712db1d7040520de7a4965df15b774348980e6df45c129b8c64d0dbe74ef/pandas-2.3.3-cp311-cp311-win_amd64.whl", hash = "sha256:f086f6fe114e19d92014a1966f43a3e62285109afe874f067f5abbdcbb10e59c", size = 11348702, upload-time = "2025-09-29T23:19:38.296Z" }, - { url = "https://files.pythonhosted.org/packages/9c/fb/231d89e8637c808b997d172b18e9d4a4bc7bf31296196c260526055d1ea0/pandas-2.3.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:6d21f6d74eb1725c2efaa71a2bfc661a0689579b58e9c0ca58a739ff0b002b53", size = 11597846, upload-time = "2025-09-29T23:19:48.856Z" }, - { url = "https://files.pythonhosted.org/packages/5c/bd/bf8064d9cfa214294356c2d6702b716d3cf3bb24be59287a6a21e24cae6b/pandas-2.3.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:3fd2f887589c7aa868e02632612ba39acb0b8948faf5cc58f0850e165bd46f35", size = 10729618, upload-time = "2025-09-29T23:39:08.659Z" }, - { url = "https://files.pythonhosted.org/packages/57/56/cf2dbe1a3f5271370669475ead12ce77c61726ffd19a35546e31aa8edf4e/pandas-2.3.3-cp312-cp312-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ecaf1e12bdc03c86ad4a7ea848d66c685cb6851d807a26aa245ca3d2017a1908", size = 11737212, upload-time = "2025-09-29T23:19:59.765Z" }, - { url = "https://files.pythonhosted.org/packages/e5/63/cd7d615331b328e287d8233ba9fdf191a9c2d11b6af0c7a59cfcec23de68/pandas-2.3.3-cp312-cp312-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b3d11d2fda7eb164ef27ffc14b4fcab16a80e1ce67e9f57e19ec0afaf715ba89", size = 12362693, upload-time = "2025-09-29T23:20:14.098Z" }, - { url = "https://files.pythonhosted.org/packages/a6/de/8b1895b107277d52f2b42d3a6806e69cfef0d5cf1d0ba343470b9d8e0a04/pandas-2.3.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:a68e15f780eddf2b07d242e17a04aa187a7ee12b40b930bfdd78070556550e98", size = 12771002, upload-time = "2025-09-29T23:20:26.76Z" }, - { url = "https://files.pythonhosted.org/packages/87/21/84072af3187a677c5893b170ba2c8fbe450a6ff911234916da889b698220/pandas-2.3.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:371a4ab48e950033bcf52b6527eccb564f52dc826c02afd9a1bc0ab731bba084", size = 13450971, upload-time = "2025-09-29T23:20:41.344Z" }, - { url = "https://files.pythonhosted.org/packages/86/41/585a168330ff063014880a80d744219dbf1dd7a1c706e75ab3425a987384/pandas-2.3.3-cp312-cp312-win_amd64.whl", hash = "sha256:a16dcec078a01eeef8ee61bf64074b4e524a2a3f4b3be9326420cabe59c4778b", size = 10992722, upload-time = "2025-09-29T23:20:54.139Z" }, - { url = "https://files.pythonhosted.org/packages/cd/4b/18b035ee18f97c1040d94debd8f2e737000ad70ccc8f5513f4eefad75f4b/pandas-2.3.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:56851a737e3470de7fa88e6131f41281ed440d29a9268dcbf0002da5ac366713", size = 11544671, upload-time = "2025-09-29T23:21:05.024Z" }, - { url = "https://files.pythonhosted.org/packages/31/94/72fac03573102779920099bcac1c3b05975c2cb5f01eac609faf34bed1ca/pandas-2.3.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:bdcd9d1167f4885211e401b3036c0c8d9e274eee67ea8d0758a256d60704cfe8", size = 10680807, upload-time = "2025-09-29T23:21:15.979Z" }, - { url = "https://files.pythonhosted.org/packages/16/87/9472cf4a487d848476865321de18cc8c920b8cab98453ab79dbbc98db63a/pandas-2.3.3-cp313-cp313-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e32e7cc9af0f1cc15548288a51a3b681cc2a219faa838e995f7dc53dbab1062d", size = 11709872, upload-time = "2025-09-29T23:21:27.165Z" }, - { url = "https://files.pythonhosted.org/packages/15/07/284f757f63f8a8d69ed4472bfd85122bd086e637bf4ed09de572d575a693/pandas-2.3.3-cp313-cp313-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:318d77e0e42a628c04dc56bcef4b40de67918f7041c2b061af1da41dcff670ac", size = 12306371, upload-time = "2025-09-29T23:21:40.532Z" }, - { url = "https://files.pythonhosted.org/packages/33/81/a3afc88fca4aa925804a27d2676d22dcd2031c2ebe08aabd0ae55b9ff282/pandas-2.3.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:4e0a175408804d566144e170d0476b15d78458795bb18f1304fb94160cabf40c", size = 12765333, upload-time = "2025-09-29T23:21:55.77Z" }, - { url = "https://files.pythonhosted.org/packages/8d/0f/b4d4ae743a83742f1153464cf1a8ecfafc3ac59722a0b5c8602310cb7158/pandas-2.3.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:93c2d9ab0fc11822b5eece72ec9587e172f63cff87c00b062f6e37448ced4493", size = 13418120, upload-time = "2025-09-29T23:22:10.109Z" }, - { url = "https://files.pythonhosted.org/packages/4f/c7/e54682c96a895d0c808453269e0b5928a07a127a15704fedb643e9b0a4c8/pandas-2.3.3-cp313-cp313-win_amd64.whl", hash = "sha256:f8bfc0e12dc78f777f323f55c58649591b2cd0c43534e8355c51d3fede5f4dee", size = 10993991, upload-time = "2025-09-29T23:25:04.889Z" }, - { url = "https://files.pythonhosted.org/packages/f9/ca/3f8d4f49740799189e1395812f3bf23b5e8fc7c190827d55a610da72ce55/pandas-2.3.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:75ea25f9529fdec2d2e93a42c523962261e567d250b0013b16210e1d40d7c2e5", size = 12048227, upload-time = "2025-09-29T23:22:24.343Z" }, - { url = "https://files.pythonhosted.org/packages/0e/5a/f43efec3e8c0cc92c4663ccad372dbdff72b60bdb56b2749f04aa1d07d7e/pandas-2.3.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:74ecdf1d301e812db96a465a525952f4dde225fdb6d8e5a521d47e1f42041e21", size = 11411056, upload-time = "2025-09-29T23:22:37.762Z" }, - { url = "https://files.pythonhosted.org/packages/46/b1/85331edfc591208c9d1a63a06baa67b21d332e63b7a591a5ba42a10bb507/pandas-2.3.3-cp313-cp313t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6435cb949cb34ec11cc9860246ccb2fdc9ecd742c12d3304989017d53f039a78", size = 11645189, upload-time = "2025-09-29T23:22:51.688Z" }, - { url = "https://files.pythonhosted.org/packages/44/23/78d645adc35d94d1ac4f2a3c4112ab6f5b8999f4898b8cdf01252f8df4a9/pandas-2.3.3-cp313-cp313t-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:900f47d8f20860de523a1ac881c4c36d65efcb2eb850e6948140fa781736e110", size = 12121912, upload-time = "2025-09-29T23:23:05.042Z" }, - { url = "https://files.pythonhosted.org/packages/53/da/d10013df5e6aaef6b425aa0c32e1fc1f3e431e4bcabd420517dceadce354/pandas-2.3.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:a45c765238e2ed7d7c608fc5bc4a6f88b642f2f01e70c0c23d2224dd21829d86", size = 12712160, upload-time = "2025-09-29T23:23:28.57Z" }, - { url = "https://files.pythonhosted.org/packages/bd/17/e756653095a083d8a37cbd816cb87148debcfcd920129b25f99dd8d04271/pandas-2.3.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:c4fc4c21971a1a9f4bdb4c73978c7f7256caa3e62b323f70d6cb80db583350bc", size = 13199233, upload-time = "2025-09-29T23:24:24.876Z" }, - { url = "https://files.pythonhosted.org/packages/04/fd/74903979833db8390b73b3a8a7d30d146d710bd32703724dd9083950386f/pandas-2.3.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:ee15f284898e7b246df8087fc82b87b01686f98ee67d85a17b7ab44143a3a9a0", size = 11540635, upload-time = "2025-09-29T23:25:52.486Z" }, - { url = "https://files.pythonhosted.org/packages/21/00/266d6b357ad5e6d3ad55093a7e8efc7dd245f5a842b584db9f30b0f0a287/pandas-2.3.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:1611aedd912e1ff81ff41c745822980c49ce4a7907537be8692c8dbc31924593", size = 10759079, upload-time = "2025-09-29T23:26:33.204Z" }, - { url = "https://files.pythonhosted.org/packages/ca/05/d01ef80a7a3a12b2f8bbf16daba1e17c98a2f039cbc8e2f77a2c5a63d382/pandas-2.3.3-cp314-cp314-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6d2cefc361461662ac48810cb14365a365ce864afe85ef1f447ff5a1e99ea81c", size = 11814049, upload-time = "2025-09-29T23:27:15.384Z" }, - { url = "https://files.pythonhosted.org/packages/15/b2/0e62f78c0c5ba7e3d2c5945a82456f4fac76c480940f805e0b97fcbc2f65/pandas-2.3.3-cp314-cp314-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ee67acbbf05014ea6c763beb097e03cd629961c8a632075eeb34247120abcb4b", size = 12332638, upload-time = "2025-09-29T23:27:51.625Z" }, - { url = "https://files.pythonhosted.org/packages/c5/33/dd70400631b62b9b29c3c93d2feee1d0964dc2bae2e5ad7a6c73a7f25325/pandas-2.3.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:c46467899aaa4da076d5abc11084634e2d197e9460643dd455ac3db5856b24d6", size = 12886834, upload-time = "2025-09-29T23:28:21.289Z" }, - { url = "https://files.pythonhosted.org/packages/d3/18/b5d48f55821228d0d2692b34fd5034bb185e854bdb592e9c640f6290e012/pandas-2.3.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:6253c72c6a1d990a410bc7de641d34053364ef8bcd3126f7e7450125887dffe3", size = 13409925, upload-time = "2025-09-29T23:28:58.261Z" }, - { url = "https://files.pythonhosted.org/packages/a6/3d/124ac75fcd0ecc09b8fdccb0246ef65e35b012030defb0e0eba2cbbbe948/pandas-2.3.3-cp314-cp314-win_amd64.whl", hash = "sha256:1b07204a219b3b7350abaae088f451860223a52cfb8a6c53358e7948735158e5", size = 11109071, upload-time = "2025-09-29T23:32:27.484Z" }, - { url = "https://files.pythonhosted.org/packages/89/9c/0e21c895c38a157e0faa1fb64587a9226d6dd46452cac4532d80c3c4a244/pandas-2.3.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:2462b1a365b6109d275250baaae7b760fd25c726aaca0054649286bcfbb3e8ec", size = 12048504, upload-time = "2025-09-29T23:29:31.47Z" }, - { url = "https://files.pythonhosted.org/packages/d7/82/b69a1c95df796858777b68fbe6a81d37443a33319761d7c652ce77797475/pandas-2.3.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:0242fe9a49aa8b4d78a4fa03acb397a58833ef6199e9aa40a95f027bb3a1b6e7", size = 11410702, upload-time = "2025-09-29T23:29:54.591Z" }, - { url = "https://files.pythonhosted.org/packages/f9/88/702bde3ba0a94b8c73a0181e05144b10f13f29ebfc2150c3a79062a8195d/pandas-2.3.3-cp314-cp314t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a21d830e78df0a515db2b3d2f5570610f5e6bd2e27749770e8bb7b524b89b450", size = 11634535, upload-time = "2025-09-29T23:30:21.003Z" }, - { url = "https://files.pythonhosted.org/packages/a4/1e/1bac1a839d12e6a82ec6cb40cda2edde64a2013a66963293696bbf31fbbb/pandas-2.3.3-cp314-cp314t-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2e3ebdb170b5ef78f19bfb71b0dc5dc58775032361fa188e814959b74d726dd5", size = 12121582, upload-time = "2025-09-29T23:30:43.391Z" }, - { url = "https://files.pythonhosted.org/packages/44/91/483de934193e12a3b1d6ae7c8645d083ff88dec75f46e827562f1e4b4da6/pandas-2.3.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:d051c0e065b94b7a3cea50eb1ec32e912cd96dba41647eb24104b6c6c14c5788", size = 12699963, upload-time = "2025-09-29T23:31:10.009Z" }, - { url = "https://files.pythonhosted.org/packages/70/44/5191d2e4026f86a2a109053e194d3ba7a31a2d10a9c2348368c63ed4e85a/pandas-2.3.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:3869faf4bd07b3b66a9f462417d0ca3a9df29a9f6abd5d0d0dbab15dac7abe87", size = 13202175, upload-time = "2025-09-29T23:31:59.173Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/33/01/d40b85317f86cf08d853a4f495195c73815fdf205eef3993821720274518/pandas-2.3.3.tar.gz", hash = "sha256:e05e1af93b977f7eafa636d043f9f94c7ee3ac81af99c13508215942e64c993b", size = 4495223 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c1/fa/7ac648108144a095b4fb6aa3de1954689f7af60a14cf25583f4960ecb878/pandas-2.3.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:602b8615ebcc4a0c1751e71840428ddebeb142ec02c786e8ad6b1ce3c8dec523", size = 11578790 }, + { url = "https://files.pythonhosted.org/packages/9b/35/74442388c6cf008882d4d4bdfc4109be87e9b8b7ccd097ad1e7f006e2e95/pandas-2.3.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:8fe25fc7b623b0ef6b5009149627e34d2a4657e880948ec3c840e9402e5c1b45", size = 10833831 }, + { url = "https://files.pythonhosted.org/packages/fe/e4/de154cbfeee13383ad58d23017da99390b91d73f8c11856f2095e813201b/pandas-2.3.3-cp311-cp311-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b468d3dad6ff947df92dcb32ede5b7bd41a9b3cceef0a30ed925f6d01fb8fa66", size = 12199267 }, + { url = "https://files.pythonhosted.org/packages/bf/c9/63f8d545568d9ab91476b1818b4741f521646cbdd151c6efebf40d6de6f7/pandas-2.3.3-cp311-cp311-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b98560e98cb334799c0b07ca7967ac361a47326e9b4e5a7dfb5ab2b1c9d35a1b", size = 12789281 }, + { url = "https://files.pythonhosted.org/packages/f2/00/a5ac8c7a0e67fd1a6059e40aa08fa1c52cc00709077d2300e210c3ce0322/pandas-2.3.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:1d37b5848ba49824e5c30bedb9c830ab9b7751fd049bc7914533e01c65f79791", size = 13240453 }, + { url = "https://files.pythonhosted.org/packages/27/4d/5c23a5bc7bd209231618dd9e606ce076272c9bc4f12023a70e03a86b4067/pandas-2.3.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:db4301b2d1f926ae677a751eb2bd0e8c5f5319c9cb3f88b0becbbb0b07b34151", size = 13890361 }, + { url = "https://files.pythonhosted.org/packages/8e/59/712db1d7040520de7a4965df15b774348980e6df45c129b8c64d0dbe74ef/pandas-2.3.3-cp311-cp311-win_amd64.whl", hash = "sha256:f086f6fe114e19d92014a1966f43a3e62285109afe874f067f5abbdcbb10e59c", size = 11348702 }, + { url = "https://files.pythonhosted.org/packages/9c/fb/231d89e8637c808b997d172b18e9d4a4bc7bf31296196c260526055d1ea0/pandas-2.3.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:6d21f6d74eb1725c2efaa71a2bfc661a0689579b58e9c0ca58a739ff0b002b53", size = 11597846 }, + { url = "https://files.pythonhosted.org/packages/5c/bd/bf8064d9cfa214294356c2d6702b716d3cf3bb24be59287a6a21e24cae6b/pandas-2.3.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:3fd2f887589c7aa868e02632612ba39acb0b8948faf5cc58f0850e165bd46f35", size = 10729618 }, + { url = "https://files.pythonhosted.org/packages/57/56/cf2dbe1a3f5271370669475ead12ce77c61726ffd19a35546e31aa8edf4e/pandas-2.3.3-cp312-cp312-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ecaf1e12bdc03c86ad4a7ea848d66c685cb6851d807a26aa245ca3d2017a1908", size = 11737212 }, + { url = "https://files.pythonhosted.org/packages/e5/63/cd7d615331b328e287d8233ba9fdf191a9c2d11b6af0c7a59cfcec23de68/pandas-2.3.3-cp312-cp312-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b3d11d2fda7eb164ef27ffc14b4fcab16a80e1ce67e9f57e19ec0afaf715ba89", size = 12362693 }, + { url = "https://files.pythonhosted.org/packages/a6/de/8b1895b107277d52f2b42d3a6806e69cfef0d5cf1d0ba343470b9d8e0a04/pandas-2.3.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:a68e15f780eddf2b07d242e17a04aa187a7ee12b40b930bfdd78070556550e98", size = 12771002 }, + { url = "https://files.pythonhosted.org/packages/87/21/84072af3187a677c5893b170ba2c8fbe450a6ff911234916da889b698220/pandas-2.3.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:371a4ab48e950033bcf52b6527eccb564f52dc826c02afd9a1bc0ab731bba084", size = 13450971 }, + { url = "https://files.pythonhosted.org/packages/86/41/585a168330ff063014880a80d744219dbf1dd7a1c706e75ab3425a987384/pandas-2.3.3-cp312-cp312-win_amd64.whl", hash = "sha256:a16dcec078a01eeef8ee61bf64074b4e524a2a3f4b3be9326420cabe59c4778b", size = 10992722 }, + { url = "https://files.pythonhosted.org/packages/cd/4b/18b035ee18f97c1040d94debd8f2e737000ad70ccc8f5513f4eefad75f4b/pandas-2.3.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:56851a737e3470de7fa88e6131f41281ed440d29a9268dcbf0002da5ac366713", size = 11544671 }, + { url = "https://files.pythonhosted.org/packages/31/94/72fac03573102779920099bcac1c3b05975c2cb5f01eac609faf34bed1ca/pandas-2.3.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:bdcd9d1167f4885211e401b3036c0c8d9e274eee67ea8d0758a256d60704cfe8", size = 10680807 }, + { url = "https://files.pythonhosted.org/packages/16/87/9472cf4a487d848476865321de18cc8c920b8cab98453ab79dbbc98db63a/pandas-2.3.3-cp313-cp313-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e32e7cc9af0f1cc15548288a51a3b681cc2a219faa838e995f7dc53dbab1062d", size = 11709872 }, + { url = "https://files.pythonhosted.org/packages/15/07/284f757f63f8a8d69ed4472bfd85122bd086e637bf4ed09de572d575a693/pandas-2.3.3-cp313-cp313-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:318d77e0e42a628c04dc56bcef4b40de67918f7041c2b061af1da41dcff670ac", size = 12306371 }, + { url = "https://files.pythonhosted.org/packages/33/81/a3afc88fca4aa925804a27d2676d22dcd2031c2ebe08aabd0ae55b9ff282/pandas-2.3.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:4e0a175408804d566144e170d0476b15d78458795bb18f1304fb94160cabf40c", size = 12765333 }, + { url = "https://files.pythonhosted.org/packages/8d/0f/b4d4ae743a83742f1153464cf1a8ecfafc3ac59722a0b5c8602310cb7158/pandas-2.3.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:93c2d9ab0fc11822b5eece72ec9587e172f63cff87c00b062f6e37448ced4493", size = 13418120 }, + { url = "https://files.pythonhosted.org/packages/4f/c7/e54682c96a895d0c808453269e0b5928a07a127a15704fedb643e9b0a4c8/pandas-2.3.3-cp313-cp313-win_amd64.whl", hash = "sha256:f8bfc0e12dc78f777f323f55c58649591b2cd0c43534e8355c51d3fede5f4dee", size = 10993991 }, + { url = "https://files.pythonhosted.org/packages/f9/ca/3f8d4f49740799189e1395812f3bf23b5e8fc7c190827d55a610da72ce55/pandas-2.3.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:75ea25f9529fdec2d2e93a42c523962261e567d250b0013b16210e1d40d7c2e5", size = 12048227 }, + { url = "https://files.pythonhosted.org/packages/0e/5a/f43efec3e8c0cc92c4663ccad372dbdff72b60bdb56b2749f04aa1d07d7e/pandas-2.3.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:74ecdf1d301e812db96a465a525952f4dde225fdb6d8e5a521d47e1f42041e21", size = 11411056 }, + { url = "https://files.pythonhosted.org/packages/46/b1/85331edfc591208c9d1a63a06baa67b21d332e63b7a591a5ba42a10bb507/pandas-2.3.3-cp313-cp313t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6435cb949cb34ec11cc9860246ccb2fdc9ecd742c12d3304989017d53f039a78", size = 11645189 }, + { url = "https://files.pythonhosted.org/packages/44/23/78d645adc35d94d1ac4f2a3c4112ab6f5b8999f4898b8cdf01252f8df4a9/pandas-2.3.3-cp313-cp313t-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:900f47d8f20860de523a1ac881c4c36d65efcb2eb850e6948140fa781736e110", size = 12121912 }, + { url = "https://files.pythonhosted.org/packages/53/da/d10013df5e6aaef6b425aa0c32e1fc1f3e431e4bcabd420517dceadce354/pandas-2.3.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:a45c765238e2ed7d7c608fc5bc4a6f88b642f2f01e70c0c23d2224dd21829d86", size = 12712160 }, + { url = "https://files.pythonhosted.org/packages/bd/17/e756653095a083d8a37cbd816cb87148debcfcd920129b25f99dd8d04271/pandas-2.3.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:c4fc4c21971a1a9f4bdb4c73978c7f7256caa3e62b323f70d6cb80db583350bc", size = 13199233 }, + { url = "https://files.pythonhosted.org/packages/04/fd/74903979833db8390b73b3a8a7d30d146d710bd32703724dd9083950386f/pandas-2.3.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:ee15f284898e7b246df8087fc82b87b01686f98ee67d85a17b7ab44143a3a9a0", size = 11540635 }, + { url = "https://files.pythonhosted.org/packages/21/00/266d6b357ad5e6d3ad55093a7e8efc7dd245f5a842b584db9f30b0f0a287/pandas-2.3.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:1611aedd912e1ff81ff41c745822980c49ce4a7907537be8692c8dbc31924593", size = 10759079 }, + { url = "https://files.pythonhosted.org/packages/ca/05/d01ef80a7a3a12b2f8bbf16daba1e17c98a2f039cbc8e2f77a2c5a63d382/pandas-2.3.3-cp314-cp314-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6d2cefc361461662ac48810cb14365a365ce864afe85ef1f447ff5a1e99ea81c", size = 11814049 }, + { url = "https://files.pythonhosted.org/packages/15/b2/0e62f78c0c5ba7e3d2c5945a82456f4fac76c480940f805e0b97fcbc2f65/pandas-2.3.3-cp314-cp314-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ee67acbbf05014ea6c763beb097e03cd629961c8a632075eeb34247120abcb4b", size = 12332638 }, + { url = "https://files.pythonhosted.org/packages/c5/33/dd70400631b62b9b29c3c93d2feee1d0964dc2bae2e5ad7a6c73a7f25325/pandas-2.3.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:c46467899aaa4da076d5abc11084634e2d197e9460643dd455ac3db5856b24d6", size = 12886834 }, + { url = "https://files.pythonhosted.org/packages/d3/18/b5d48f55821228d0d2692b34fd5034bb185e854bdb592e9c640f6290e012/pandas-2.3.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:6253c72c6a1d990a410bc7de641d34053364ef8bcd3126f7e7450125887dffe3", size = 13409925 }, + { url = "https://files.pythonhosted.org/packages/a6/3d/124ac75fcd0ecc09b8fdccb0246ef65e35b012030defb0e0eba2cbbbe948/pandas-2.3.3-cp314-cp314-win_amd64.whl", hash = "sha256:1b07204a219b3b7350abaae088f451860223a52cfb8a6c53358e7948735158e5", size = 11109071 }, + { url = "https://files.pythonhosted.org/packages/89/9c/0e21c895c38a157e0faa1fb64587a9226d6dd46452cac4532d80c3c4a244/pandas-2.3.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:2462b1a365b6109d275250baaae7b760fd25c726aaca0054649286bcfbb3e8ec", size = 12048504 }, + { url = "https://files.pythonhosted.org/packages/d7/82/b69a1c95df796858777b68fbe6a81d37443a33319761d7c652ce77797475/pandas-2.3.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:0242fe9a49aa8b4d78a4fa03acb397a58833ef6199e9aa40a95f027bb3a1b6e7", size = 11410702 }, + { url = "https://files.pythonhosted.org/packages/f9/88/702bde3ba0a94b8c73a0181e05144b10f13f29ebfc2150c3a79062a8195d/pandas-2.3.3-cp314-cp314t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a21d830e78df0a515db2b3d2f5570610f5e6bd2e27749770e8bb7b524b89b450", size = 11634535 }, + { url = "https://files.pythonhosted.org/packages/a4/1e/1bac1a839d12e6a82ec6cb40cda2edde64a2013a66963293696bbf31fbbb/pandas-2.3.3-cp314-cp314t-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2e3ebdb170b5ef78f19bfb71b0dc5dc58775032361fa188e814959b74d726dd5", size = 12121582 }, + { url = "https://files.pythonhosted.org/packages/44/91/483de934193e12a3b1d6ae7c8645d083ff88dec75f46e827562f1e4b4da6/pandas-2.3.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:d051c0e065b94b7a3cea50eb1ec32e912cd96dba41647eb24104b6c6c14c5788", size = 12699963 }, + { url = "https://files.pythonhosted.org/packages/70/44/5191d2e4026f86a2a109053e194d3ba7a31a2d10a9c2348368c63ed4e85a/pandas-2.3.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:3869faf4bd07b3b66a9f462417d0ca3a9df29a9f6abd5d0d0dbab15dac7abe87", size = 13202175 }, ] [[package]] name = "pandocfilters" version = "1.5.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/70/6f/3dd4940bbe001c06a65f88e36bad298bc7a0de5036115639926b0c5c0458/pandocfilters-1.5.1.tar.gz", hash = "sha256:002b4a555ee4ebc03f8b66307e287fa492e4a77b4ea14d3f934328297bb4939e", size = 8454, upload-time = "2024-01-18T20:08:13.726Z" } +sdist = { url = "https://files.pythonhosted.org/packages/70/6f/3dd4940bbe001c06a65f88e36bad298bc7a0de5036115639926b0c5c0458/pandocfilters-1.5.1.tar.gz", hash = "sha256:002b4a555ee4ebc03f8b66307e287fa492e4a77b4ea14d3f934328297bb4939e", size = 8454 } wheels = [ - { url = "https://files.pythonhosted.org/packages/ef/af/4fbc8cab944db5d21b7e2a5b8e9211a03a79852b1157e2c102fcc61ac440/pandocfilters-1.5.1-py2.py3-none-any.whl", hash = "sha256:93be382804a9cdb0a7267585f157e5d1731bbe5545a85b268d6f5fe6232de2bc", size = 8663, upload-time = "2024-01-18T20:08:11.28Z" }, + { url = "https://files.pythonhosted.org/packages/ef/af/4fbc8cab944db5d21b7e2a5b8e9211a03a79852b1157e2c102fcc61ac440/pandocfilters-1.5.1-py2.py3-none-any.whl", hash = "sha256:93be382804a9cdb0a7267585f157e5d1731bbe5545a85b268d6f5fe6232de2bc", size = 8663 }, ] [[package]] name = "parso" version = "0.8.5" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/d4/de/53e0bcf53d13e005bd8c92e7855142494f41171b34c2536b86187474184d/parso-0.8.5.tar.gz", hash = "sha256:034d7354a9a018bdce352f48b2a8a450f05e9d6ee85db84764e9b6bd96dafe5a", size = 401205, upload-time = "2025-08-23T15:15:28.028Z" } +sdist = { url = "https://files.pythonhosted.org/packages/d4/de/53e0bcf53d13e005bd8c92e7855142494f41171b34c2536b86187474184d/parso-0.8.5.tar.gz", hash = "sha256:034d7354a9a018bdce352f48b2a8a450f05e9d6ee85db84764e9b6bd96dafe5a", size = 401205 } wheels = [ - { url = "https://files.pythonhosted.org/packages/16/32/f8e3c85d1d5250232a5d3477a2a28cc291968ff175caeadaf3cc19ce0e4a/parso-0.8.5-py2.py3-none-any.whl", hash = "sha256:646204b5ee239c396d040b90f9e272e9a8017c630092bf59980beb62fd033887", size = 106668, upload-time = "2025-08-23T15:15:25.663Z" }, + { url = "https://files.pythonhosted.org/packages/16/32/f8e3c85d1d5250232a5d3477a2a28cc291968ff175caeadaf3cc19ce0e4a/parso-0.8.5-py2.py3-none-any.whl", hash = "sha256:646204b5ee239c396d040b90f9e272e9a8017c630092bf59980beb62fd033887", size = 106668 }, ] [[package]] name = "pathspec" version = "0.12.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ca/bc/f35b8446f4531a7cb215605d100cd88b7ac6f44ab3fc94870c120ab3adbf/pathspec-0.12.1.tar.gz", hash = "sha256:a482d51503a1ab33b1c67a6c3813a26953dbdc71c31dacaef9a838c4e29f5712", size = 51043, upload-time = "2023-12-10T22:30:45Z" } +sdist = { url = "https://files.pythonhosted.org/packages/ca/bc/f35b8446f4531a7cb215605d100cd88b7ac6f44ab3fc94870c120ab3adbf/pathspec-0.12.1.tar.gz", hash = "sha256:a482d51503a1ab33b1c67a6c3813a26953dbdc71c31dacaef9a838c4e29f5712", size = 51043 } wheels = [ - { url = "https://files.pythonhosted.org/packages/cc/20/ff623b09d963f88bfde16306a54e12ee5ea43e9b597108672ff3a408aad6/pathspec-0.12.1-py3-none-any.whl", hash = "sha256:a0d503e138a4c123b27490a4f7beda6a01c6f288df0e4a8b79c7eb0dc7b4cc08", size = 31191, upload-time = "2023-12-10T22:30:43.14Z" }, + { url = "https://files.pythonhosted.org/packages/cc/20/ff623b09d963f88bfde16306a54e12ee5ea43e9b597108672ff3a408aad6/pathspec-0.12.1-py3-none-any.whl", hash = "sha256:a0d503e138a4c123b27490a4f7beda6a01c6f288df0e4a8b79c7eb0dc7b4cc08", size = 31191 }, ] [[package]] @@ -2189,114 +2208,114 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "ptyprocess" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/42/92/cc564bf6381ff43ce1f4d06852fc19a2f11d180f23dc32d9588bee2f149d/pexpect-4.9.0.tar.gz", hash = "sha256:ee7d41123f3c9911050ea2c2dac107568dc43b2d3b0c7557a33212c398ead30f", size = 166450, upload-time = "2023-11-25T09:07:26.339Z" } +sdist = { url = "https://files.pythonhosted.org/packages/42/92/cc564bf6381ff43ce1f4d06852fc19a2f11d180f23dc32d9588bee2f149d/pexpect-4.9.0.tar.gz", hash = "sha256:ee7d41123f3c9911050ea2c2dac107568dc43b2d3b0c7557a33212c398ead30f", size = 166450 } wheels = [ - { url = "https://files.pythonhosted.org/packages/9e/c3/059298687310d527a58bb01f3b1965787ee3b40dce76752eda8b44e9a2c5/pexpect-4.9.0-py2.py3-none-any.whl", hash = "sha256:7236d1e080e4936be2dc3e326cec0af72acf9212a7e1d060210e70a47e253523", size = 63772, upload-time = "2023-11-25T06:56:14.81Z" }, + { url = "https://files.pythonhosted.org/packages/9e/c3/059298687310d527a58bb01f3b1965787ee3b40dce76752eda8b44e9a2c5/pexpect-4.9.0-py2.py3-none-any.whl", hash = "sha256:7236d1e080e4936be2dc3e326cec0af72acf9212a7e1d060210e70a47e253523", size = 63772 }, ] [[package]] name = "pillow" version = "12.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/5a/b0/cace85a1b0c9775a9f8f5d5423c8261c858760e2466c79b2dd184638b056/pillow-12.0.0.tar.gz", hash = "sha256:87d4f8125c9988bfbed67af47dd7a953e2fc7b0cc1e7800ec6d2080d490bb353", size = 47008828, upload-time = "2025-10-15T18:24:14.008Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/0e/5a/a2f6773b64edb921a756eb0729068acad9fc5208a53f4a349396e9436721/pillow-12.0.0-cp311-cp311-macosx_10_10_x86_64.whl", hash = "sha256:0fd00cac9c03256c8b2ff58f162ebcd2587ad3e1f2e397eab718c47e24d231cc", size = 5289798, upload-time = "2025-10-15T18:21:47.763Z" }, - { url = "https://files.pythonhosted.org/packages/2e/05/069b1f8a2e4b5a37493da6c5868531c3f77b85e716ad7a590ef87d58730d/pillow-12.0.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:a3475b96f5908b3b16c47533daaa87380c491357d197564e0ba34ae75c0f3257", size = 4650589, upload-time = "2025-10-15T18:21:49.515Z" }, - { url = "https://files.pythonhosted.org/packages/61/e3/2c820d6e9a36432503ead175ae294f96861b07600a7156154a086ba7111a/pillow-12.0.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:110486b79f2d112cf6add83b28b627e369219388f64ef2f960fef9ebaf54c642", size = 6230472, upload-time = "2025-10-15T18:21:51.052Z" }, - { url = "https://files.pythonhosted.org/packages/4f/89/63427f51c64209c5e23d4d52071c8d0f21024d3a8a487737caaf614a5795/pillow-12.0.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:5269cc1caeedb67e6f7269a42014f381f45e2e7cd42d834ede3c703a1d915fe3", size = 8033887, upload-time = "2025-10-15T18:21:52.604Z" }, - { url = "https://files.pythonhosted.org/packages/f6/1b/c9711318d4901093c15840f268ad649459cd81984c9ec9887756cca049a5/pillow-12.0.0-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:aa5129de4e174daccbc59d0a3b6d20eaf24417d59851c07ebb37aeb02947987c", size = 6343964, upload-time = "2025-10-15T18:21:54.619Z" }, - { url = "https://files.pythonhosted.org/packages/41/1e/db9470f2d030b4995083044cd8738cdd1bf773106819f6d8ba12597d5352/pillow-12.0.0-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bee2a6db3a7242ea309aa7ee8e2780726fed67ff4e5b40169f2c940e7eb09227", size = 7034756, upload-time = "2025-10-15T18:21:56.151Z" }, - { url = "https://files.pythonhosted.org/packages/cc/b0/6177a8bdd5ee4ed87cba2de5a3cc1db55ffbbec6176784ce5bb75aa96798/pillow-12.0.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:90387104ee8400a7b4598253b4c406f8958f59fcf983a6cea2b50d59f7d63d0b", size = 6458075, upload-time = "2025-10-15T18:21:57.759Z" }, - { url = "https://files.pythonhosted.org/packages/bc/5e/61537aa6fa977922c6a03253a0e727e6e4a72381a80d63ad8eec350684f2/pillow-12.0.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:bc91a56697869546d1b8f0a3ff35224557ae7f881050e99f615e0119bf934b4e", size = 7125955, upload-time = "2025-10-15T18:21:59.372Z" }, - { url = "https://files.pythonhosted.org/packages/1f/3d/d5033539344ee3cbd9a4d69e12e63ca3a44a739eb2d4c8da350a3d38edd7/pillow-12.0.0-cp311-cp311-win32.whl", hash = "sha256:27f95b12453d165099c84f8a8bfdfd46b9e4bda9e0e4b65f0635430027f55739", size = 6298440, upload-time = "2025-10-15T18:22:00.982Z" }, - { url = "https://files.pythonhosted.org/packages/4d/42/aaca386de5cc8bd8a0254516957c1f265e3521c91515b16e286c662854c4/pillow-12.0.0-cp311-cp311-win_amd64.whl", hash = "sha256:b583dc9070312190192631373c6c8ed277254aa6e6084b74bdd0a6d3b221608e", size = 6999256, upload-time = "2025-10-15T18:22:02.617Z" }, - { url = "https://files.pythonhosted.org/packages/ba/f1/9197c9c2d5708b785f631a6dfbfa8eb3fb9672837cb92ae9af812c13b4ed/pillow-12.0.0-cp311-cp311-win_arm64.whl", hash = "sha256:759de84a33be3b178a64c8ba28ad5c135900359e85fb662bc6e403ad4407791d", size = 2436025, upload-time = "2025-10-15T18:22:04.598Z" }, - { url = "https://files.pythonhosted.org/packages/2c/90/4fcce2c22caf044e660a198d740e7fbc14395619e3cb1abad12192c0826c/pillow-12.0.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:53561a4ddc36facb432fae7a9d8afbfaf94795414f5cdc5fc52f28c1dca90371", size = 5249377, upload-time = "2025-10-15T18:22:05.993Z" }, - { url = "https://files.pythonhosted.org/packages/fd/e0/ed960067543d080691d47d6938ebccbf3976a931c9567ab2fbfab983a5dd/pillow-12.0.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:71db6b4c1653045dacc1585c1b0d184004f0d7e694c7b34ac165ca70c0838082", size = 4650343, upload-time = "2025-10-15T18:22:07.718Z" }, - { url = "https://files.pythonhosted.org/packages/e7/a1/f81fdeddcb99c044bf7d6faa47e12850f13cee0849537a7d27eeab5534d4/pillow-12.0.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:2fa5f0b6716fc88f11380b88b31fe591a06c6315e955c096c35715788b339e3f", size = 6232981, upload-time = "2025-10-15T18:22:09.287Z" }, - { url = "https://files.pythonhosted.org/packages/88/e1/9098d3ce341a8750b55b0e00c03f1630d6178f38ac191c81c97a3b047b44/pillow-12.0.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:82240051c6ca513c616f7f9da06e871f61bfd7805f566275841af15015b8f98d", size = 8041399, upload-time = "2025-10-15T18:22:10.872Z" }, - { url = "https://files.pythonhosted.org/packages/a7/62/a22e8d3b602ae8cc01446d0c57a54e982737f44b6f2e1e019a925143771d/pillow-12.0.0-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:55f818bd74fe2f11d4d7cbc65880a843c4075e0ac7226bc1a23261dbea531953", size = 6347740, upload-time = "2025-10-15T18:22:12.769Z" }, - { url = "https://files.pythonhosted.org/packages/4f/87/424511bdcd02c8d7acf9f65caa09f291a519b16bd83c3fb3374b3d4ae951/pillow-12.0.0-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b87843e225e74576437fd5b6a4c2205d422754f84a06942cfaf1dc32243e45a8", size = 7040201, upload-time = "2025-10-15T18:22:14.813Z" }, - { url = "https://files.pythonhosted.org/packages/dc/4d/435c8ac688c54d11755aedfdd9f29c9eeddf68d150fe42d1d3dbd2365149/pillow-12.0.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:c607c90ba67533e1b2355b821fef6764d1dd2cbe26b8c1005ae84f7aea25ff79", size = 6462334, upload-time = "2025-10-15T18:22:16.375Z" }, - { url = "https://files.pythonhosted.org/packages/2b/f2/ad34167a8059a59b8ad10bc5c72d4d9b35acc6b7c0877af8ac885b5f2044/pillow-12.0.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:21f241bdd5080a15bc86d3466a9f6074a9c2c2b314100dd896ac81ee6db2f1ba", size = 7134162, upload-time = "2025-10-15T18:22:17.996Z" }, - { url = "https://files.pythonhosted.org/packages/0c/b1/a7391df6adacf0a5c2cf6ac1cf1fcc1369e7d439d28f637a847f8803beb3/pillow-12.0.0-cp312-cp312-win32.whl", hash = "sha256:dd333073e0cacdc3089525c7df7d39b211bcdf31fc2824e49d01c6b6187b07d0", size = 6298769, upload-time = "2025-10-15T18:22:19.923Z" }, - { url = "https://files.pythonhosted.org/packages/a2/0b/d87733741526541c909bbf159e338dcace4f982daac6e5a8d6be225ca32d/pillow-12.0.0-cp312-cp312-win_amd64.whl", hash = "sha256:9fe611163f6303d1619bbcb653540a4d60f9e55e622d60a3108be0d5b441017a", size = 7001107, upload-time = "2025-10-15T18:22:21.644Z" }, - { url = "https://files.pythonhosted.org/packages/bc/96/aaa61ce33cc98421fb6088af2a03be4157b1e7e0e87087c888e2370a7f45/pillow-12.0.0-cp312-cp312-win_arm64.whl", hash = "sha256:7dfb439562f234f7d57b1ac6bc8fe7f838a4bd49c79230e0f6a1da93e82f1fad", size = 2436012, upload-time = "2025-10-15T18:22:23.621Z" }, - { url = "https://files.pythonhosted.org/packages/62/f2/de993bb2d21b33a98d031ecf6a978e4b61da207bef02f7b43093774c480d/pillow-12.0.0-cp313-cp313-ios_13_0_arm64_iphoneos.whl", hash = "sha256:0869154a2d0546545cde61d1789a6524319fc1897d9ee31218eae7a60ccc5643", size = 4045493, upload-time = "2025-10-15T18:22:25.758Z" }, - { url = "https://files.pythonhosted.org/packages/0e/b6/bc8d0c4c9f6f111a783d045310945deb769b806d7574764234ffd50bc5ea/pillow-12.0.0-cp313-cp313-ios_13_0_arm64_iphonesimulator.whl", hash = "sha256:a7921c5a6d31b3d756ec980f2f47c0cfdbce0fc48c22a39347a895f41f4a6ea4", size = 4120461, upload-time = "2025-10-15T18:22:27.286Z" }, - { url = "https://files.pythonhosted.org/packages/5d/57/d60d343709366a353dc56adb4ee1e7d8a2cc34e3fbc22905f4167cfec119/pillow-12.0.0-cp313-cp313-ios_13_0_x86_64_iphonesimulator.whl", hash = "sha256:1ee80a59f6ce048ae13cda1abf7fbd2a34ab9ee7d401c46be3ca685d1999a399", size = 3576912, upload-time = "2025-10-15T18:22:28.751Z" }, - { url = "https://files.pythonhosted.org/packages/a4/a4/a0a31467e3f83b94d37568294b01d22b43ae3c5d85f2811769b9c66389dd/pillow-12.0.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:c50f36a62a22d350c96e49ad02d0da41dbd17ddc2e29750dbdba4323f85eb4a5", size = 5249132, upload-time = "2025-10-15T18:22:30.641Z" }, - { url = "https://files.pythonhosted.org/packages/83/06/48eab21dd561de2914242711434c0c0eb992ed08ff3f6107a5f44527f5e9/pillow-12.0.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:5193fde9a5f23c331ea26d0cf171fbf67e3f247585f50c08b3e205c7aeb4589b", size = 4650099, upload-time = "2025-10-15T18:22:32.73Z" }, - { url = "https://files.pythonhosted.org/packages/fc/bd/69ed99fd46a8dba7c1887156d3572fe4484e3f031405fcc5a92e31c04035/pillow-12.0.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:bde737cff1a975b70652b62d626f7785e0480918dece11e8fef3c0cf057351c3", size = 6230808, upload-time = "2025-10-15T18:22:34.337Z" }, - { url = "https://files.pythonhosted.org/packages/ea/94/8fad659bcdbf86ed70099cb60ae40be6acca434bbc8c4c0d4ef356d7e0de/pillow-12.0.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:a6597ff2b61d121172f5844b53f21467f7082f5fb385a9a29c01414463f93b07", size = 8037804, upload-time = "2025-10-15T18:22:36.402Z" }, - { url = "https://files.pythonhosted.org/packages/20/39/c685d05c06deecfd4e2d1950e9a908aa2ca8bc4e6c3b12d93b9cafbd7837/pillow-12.0.0-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:0b817e7035ea7f6b942c13aa03bb554fc44fea70838ea21f8eb31c638326584e", size = 6345553, upload-time = "2025-10-15T18:22:38.066Z" }, - { url = "https://files.pythonhosted.org/packages/38/57/755dbd06530a27a5ed74f8cb0a7a44a21722ebf318edbe67ddbd7fb28f88/pillow-12.0.0-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f4f1231b7dec408e8670264ce63e9c71409d9583dd21d32c163e25213ee2a344", size = 7037729, upload-time = "2025-10-15T18:22:39.769Z" }, - { url = "https://files.pythonhosted.org/packages/ca/b6/7e94f4c41d238615674d06ed677c14883103dce1c52e4af16f000338cfd7/pillow-12.0.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:6e51b71417049ad6ab14c49608b4a24d8fb3fe605e5dfabfe523b58064dc3d27", size = 6459789, upload-time = "2025-10-15T18:22:41.437Z" }, - { url = "https://files.pythonhosted.org/packages/9c/14/4448bb0b5e0f22dd865290536d20ec8a23b64e2d04280b89139f09a36bb6/pillow-12.0.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:d120c38a42c234dc9a8c5de7ceaaf899cf33561956acb4941653f8bdc657aa79", size = 7130917, upload-time = "2025-10-15T18:22:43.152Z" }, - { url = "https://files.pythonhosted.org/packages/dd/ca/16c6926cc1c015845745d5c16c9358e24282f1e588237a4c36d2b30f182f/pillow-12.0.0-cp313-cp313-win32.whl", hash = "sha256:4cc6b3b2efff105c6a1656cfe59da4fdde2cda9af1c5e0b58529b24525d0a098", size = 6302391, upload-time = "2025-10-15T18:22:44.753Z" }, - { url = "https://files.pythonhosted.org/packages/6d/2a/dd43dcfd6dae9b6a49ee28a8eedb98c7d5ff2de94a5d834565164667b97b/pillow-12.0.0-cp313-cp313-win_amd64.whl", hash = "sha256:4cf7fed4b4580601c4345ceb5d4cbf5a980d030fd5ad07c4d2ec589f95f09905", size = 7007477, upload-time = "2025-10-15T18:22:46.838Z" }, - { url = "https://files.pythonhosted.org/packages/77/f0/72ea067f4b5ae5ead653053212af05ce3705807906ba3f3e8f58ddf617e6/pillow-12.0.0-cp313-cp313-win_arm64.whl", hash = "sha256:9f0b04c6b8584c2c193babcccc908b38ed29524b29dd464bc8801bf10d746a3a", size = 2435918, upload-time = "2025-10-15T18:22:48.399Z" }, - { url = "https://files.pythonhosted.org/packages/f5/5e/9046b423735c21f0487ea6cb5b10f89ea8f8dfbe32576fe052b5ba9d4e5b/pillow-12.0.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:7fa22993bac7b77b78cae22bad1e2a987ddf0d9015c63358032f84a53f23cdc3", size = 5251406, upload-time = "2025-10-15T18:22:49.905Z" }, - { url = "https://files.pythonhosted.org/packages/12/66/982ceebcdb13c97270ef7a56c3969635b4ee7cd45227fa707c94719229c5/pillow-12.0.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:f135c702ac42262573fe9714dfe99c944b4ba307af5eb507abef1667e2cbbced", size = 4653218, upload-time = "2025-10-15T18:22:51.587Z" }, - { url = "https://files.pythonhosted.org/packages/16/b3/81e625524688c31859450119bf12674619429cab3119eec0e30a7a1029cb/pillow-12.0.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:c85de1136429c524e55cfa4e033b4a7940ac5c8ee4d9401cc2d1bf48154bbc7b", size = 6266564, upload-time = "2025-10-15T18:22:53.215Z" }, - { url = "https://files.pythonhosted.org/packages/98/59/dfb38f2a41240d2408096e1a76c671d0a105a4a8471b1871c6902719450c/pillow-12.0.0-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:38df9b4bfd3db902c9c2bd369bcacaf9d935b2fff73709429d95cc41554f7b3d", size = 8069260, upload-time = "2025-10-15T18:22:54.933Z" }, - { url = "https://files.pythonhosted.org/packages/dc/3d/378dbea5cd1874b94c312425ca77b0f47776c78e0df2df751b820c8c1d6c/pillow-12.0.0-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7d87ef5795da03d742bf49439f9ca4d027cde49c82c5371ba52464aee266699a", size = 6379248, upload-time = "2025-10-15T18:22:56.605Z" }, - { url = "https://files.pythonhosted.org/packages/84/b0/d525ef47d71590f1621510327acec75ae58c721dc071b17d8d652ca494d8/pillow-12.0.0-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:aff9e4d82d082ff9513bdd6acd4f5bd359f5b2c870907d2b0a9c5e10d40c88fe", size = 7066043, upload-time = "2025-10-15T18:22:58.53Z" }, - { url = "https://files.pythonhosted.org/packages/61/2c/aced60e9cf9d0cde341d54bf7932c9ffc33ddb4a1595798b3a5150c7ec4e/pillow-12.0.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:8d8ca2b210ada074d57fcee40c30446c9562e542fc46aedc19baf758a93532ee", size = 6490915, upload-time = "2025-10-15T18:23:00.582Z" }, - { url = "https://files.pythonhosted.org/packages/ef/26/69dcb9b91f4e59f8f34b2332a4a0a951b44f547c4ed39d3e4dcfcff48f89/pillow-12.0.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:99a7f72fb6249302aa62245680754862a44179b545ded638cf1fef59befb57ef", size = 7157998, upload-time = "2025-10-15T18:23:02.627Z" }, - { url = "https://files.pythonhosted.org/packages/61/2b/726235842220ca95fa441ddf55dd2382b52ab5b8d9c0596fe6b3f23dafe8/pillow-12.0.0-cp313-cp313t-win32.whl", hash = "sha256:4078242472387600b2ce8d93ade8899c12bf33fa89e55ec89fe126e9d6d5d9e9", size = 6306201, upload-time = "2025-10-15T18:23:04.709Z" }, - { url = "https://files.pythonhosted.org/packages/c0/3d/2afaf4e840b2df71344ababf2f8edd75a705ce500e5dc1e7227808312ae1/pillow-12.0.0-cp313-cp313t-win_amd64.whl", hash = "sha256:2c54c1a783d6d60595d3514f0efe9b37c8808746a66920315bfd34a938d7994b", size = 7013165, upload-time = "2025-10-15T18:23:06.46Z" }, - { url = "https://files.pythonhosted.org/packages/6f/75/3fa09aa5cf6ed04bee3fa575798ddf1ce0bace8edb47249c798077a81f7f/pillow-12.0.0-cp313-cp313t-win_arm64.whl", hash = "sha256:26d9f7d2b604cd23aba3e9faf795787456ac25634d82cd060556998e39c6fa47", size = 2437834, upload-time = "2025-10-15T18:23:08.194Z" }, - { url = "https://files.pythonhosted.org/packages/54/2a/9a8c6ba2c2c07b71bec92cf63e03370ca5e5f5c5b119b742bcc0cde3f9c5/pillow-12.0.0-cp314-cp314-ios_13_0_arm64_iphoneos.whl", hash = "sha256:beeae3f27f62308f1ddbcfb0690bf44b10732f2ef43758f169d5e9303165d3f9", size = 4045531, upload-time = "2025-10-15T18:23:10.121Z" }, - { url = "https://files.pythonhosted.org/packages/84/54/836fdbf1bfb3d66a59f0189ff0b9f5f666cee09c6188309300df04ad71fa/pillow-12.0.0-cp314-cp314-ios_13_0_arm64_iphonesimulator.whl", hash = "sha256:d4827615da15cd59784ce39d3388275ec093ae3ee8d7f0c089b76fa87af756c2", size = 4120554, upload-time = "2025-10-15T18:23:12.14Z" }, - { url = "https://files.pythonhosted.org/packages/0d/cd/16aec9f0da4793e98e6b54778a5fbce4f375c6646fe662e80600b8797379/pillow-12.0.0-cp314-cp314-ios_13_0_x86_64_iphonesimulator.whl", hash = "sha256:3e42edad50b6909089750e65c91aa09aaf1e0a71310d383f11321b27c224ed8a", size = 3576812, upload-time = "2025-10-15T18:23:13.962Z" }, - { url = "https://files.pythonhosted.org/packages/f6/b7/13957fda356dc46339298b351cae0d327704986337c3c69bb54628c88155/pillow-12.0.0-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:e5d8efac84c9afcb40914ab49ba063d94f5dbdf5066db4482c66a992f47a3a3b", size = 5252689, upload-time = "2025-10-15T18:23:15.562Z" }, - { url = "https://files.pythonhosted.org/packages/fc/f5/eae31a306341d8f331f43edb2e9122c7661b975433de5e447939ae61c5da/pillow-12.0.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:266cd5f2b63ff316d5a1bba46268e603c9caf5606d44f38c2873c380950576ad", size = 4650186, upload-time = "2025-10-15T18:23:17.379Z" }, - { url = "https://files.pythonhosted.org/packages/86/62/2a88339aa40c4c77e79108facbd307d6091e2c0eb5b8d3cf4977cfca2fe6/pillow-12.0.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:58eea5ebe51504057dd95c5b77d21700b77615ab0243d8152793dc00eb4faf01", size = 6230308, upload-time = "2025-10-15T18:23:18.971Z" }, - { url = "https://files.pythonhosted.org/packages/c7/33/5425a8992bcb32d1cb9fa3dd39a89e613d09a22f2c8083b7bf43c455f760/pillow-12.0.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f13711b1a5ba512d647a0e4ba79280d3a9a045aaf7e0cc6fbe96b91d4cdf6b0c", size = 8039222, upload-time = "2025-10-15T18:23:20.909Z" }, - { url = "https://files.pythonhosted.org/packages/d8/61/3f5d3b35c5728f37953d3eec5b5f3e77111949523bd2dd7f31a851e50690/pillow-12.0.0-cp314-cp314-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6846bd2d116ff42cba6b646edf5bf61d37e5cbd256425fa089fee4ff5c07a99e", size = 6346657, upload-time = "2025-10-15T18:23:23.077Z" }, - { url = "https://files.pythonhosted.org/packages/3a/be/ee90a3d79271227e0f0a33c453531efd6ed14b2e708596ba5dd9be948da3/pillow-12.0.0-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c98fa880d695de164b4135a52fd2e9cd7b7c90a9d8ac5e9e443a24a95ef9248e", size = 7038482, upload-time = "2025-10-15T18:23:25.005Z" }, - { url = "https://files.pythonhosted.org/packages/44/34/a16b6a4d1ad727de390e9bd9f19f5f669e079e5826ec0f329010ddea492f/pillow-12.0.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:fa3ed2a29a9e9d2d488b4da81dcb54720ac3104a20bf0bd273f1e4648aff5af9", size = 6461416, upload-time = "2025-10-15T18:23:27.009Z" }, - { url = "https://files.pythonhosted.org/packages/b6/39/1aa5850d2ade7d7ba9f54e4e4c17077244ff7a2d9e25998c38a29749eb3f/pillow-12.0.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:d034140032870024e6b9892c692fe2968493790dd57208b2c37e3fb35f6df3ab", size = 7131584, upload-time = "2025-10-15T18:23:29.752Z" }, - { url = "https://files.pythonhosted.org/packages/bf/db/4fae862f8fad0167073a7733973bfa955f47e2cac3dc3e3e6257d10fab4a/pillow-12.0.0-cp314-cp314-win32.whl", hash = "sha256:1b1b133e6e16105f524a8dec491e0586d072948ce15c9b914e41cdadd209052b", size = 6400621, upload-time = "2025-10-15T18:23:32.06Z" }, - { url = "https://files.pythonhosted.org/packages/2b/24/b350c31543fb0107ab2599464d7e28e6f856027aadda995022e695313d94/pillow-12.0.0-cp314-cp314-win_amd64.whl", hash = "sha256:8dc232e39d409036af549c86f24aed8273a40ffa459981146829a324e0848b4b", size = 7142916, upload-time = "2025-10-15T18:23:34.71Z" }, - { url = "https://files.pythonhosted.org/packages/0f/9b/0ba5a6fd9351793996ef7487c4fdbde8d3f5f75dbedc093bb598648fddf0/pillow-12.0.0-cp314-cp314-win_arm64.whl", hash = "sha256:d52610d51e265a51518692045e372a4c363056130d922a7351429ac9f27e70b0", size = 2523836, upload-time = "2025-10-15T18:23:36.967Z" }, - { url = "https://files.pythonhosted.org/packages/f5/7a/ceee0840aebc579af529b523d530840338ecf63992395842e54edc805987/pillow-12.0.0-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:1979f4566bb96c1e50a62d9831e2ea2d1211761e5662afc545fa766f996632f6", size = 5255092, upload-time = "2025-10-15T18:23:38.573Z" }, - { url = "https://files.pythonhosted.org/packages/44/76/20776057b4bfd1aef4eeca992ebde0f53a4dce874f3ae693d0ec90a4f79b/pillow-12.0.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:b2e4b27a6e15b04832fe9bf292b94b5ca156016bbc1ea9c2c20098a0320d6cf6", size = 4653158, upload-time = "2025-10-15T18:23:40.238Z" }, - { url = "https://files.pythonhosted.org/packages/82/3f/d9ff92ace07be8836b4e7e87e6a4c7a8318d47c2f1463ffcf121fc57d9cb/pillow-12.0.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:fb3096c30df99fd01c7bf8e544f392103d0795b9f98ba71a8054bcbf56b255f1", size = 6267882, upload-time = "2025-10-15T18:23:42.434Z" }, - { url = "https://files.pythonhosted.org/packages/9f/7a/4f7ff87f00d3ad33ba21af78bfcd2f032107710baf8280e3722ceec28cda/pillow-12.0.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:7438839e9e053ef79f7112c881cef684013855016f928b168b81ed5835f3e75e", size = 8071001, upload-time = "2025-10-15T18:23:44.29Z" }, - { url = "https://files.pythonhosted.org/packages/75/87/fcea108944a52dad8cca0715ae6247e271eb80459364a98518f1e4f480c1/pillow-12.0.0-cp314-cp314t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5d5c411a8eaa2299322b647cd932586b1427367fd3184ffbb8f7a219ea2041ca", size = 6380146, upload-time = "2025-10-15T18:23:46.065Z" }, - { url = "https://files.pythonhosted.org/packages/91/52/0d31b5e571ef5fd111d2978b84603fce26aba1b6092f28e941cb46570745/pillow-12.0.0-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d7e091d464ac59d2c7ad8e7e08105eaf9dafbc3883fd7265ffccc2baad6ac925", size = 7067344, upload-time = "2025-10-15T18:23:47.898Z" }, - { url = "https://files.pythonhosted.org/packages/7b/f4/2dd3d721f875f928d48e83bb30a434dee75a2531bca839bb996bb0aa5a91/pillow-12.0.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:792a2c0be4dcc18af9d4a2dfd8a11a17d5e25274a1062b0ec1c2d79c76f3e7f8", size = 6491864, upload-time = "2025-10-15T18:23:49.607Z" }, - { url = "https://files.pythonhosted.org/packages/30/4b/667dfcf3d61fc309ba5a15b141845cece5915e39b99c1ceab0f34bf1d124/pillow-12.0.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:afbefa430092f71a9593a99ab6a4e7538bc9eabbf7bf94f91510d3503943edc4", size = 7158911, upload-time = "2025-10-15T18:23:51.351Z" }, - { url = "https://files.pythonhosted.org/packages/a2/2f/16cabcc6426c32218ace36bf0d55955e813f2958afddbf1d391849fee9d1/pillow-12.0.0-cp314-cp314t-win32.whl", hash = "sha256:3830c769decf88f1289680a59d4f4c46c72573446352e2befec9a8512104fa52", size = 6408045, upload-time = "2025-10-15T18:23:53.177Z" }, - { url = "https://files.pythonhosted.org/packages/35/73/e29aa0c9c666cf787628d3f0dcf379f4791fba79f4936d02f8b37165bdf8/pillow-12.0.0-cp314-cp314t-win_amd64.whl", hash = "sha256:905b0365b210c73afb0ebe9101a32572152dfd1c144c7e28968a331b9217b94a", size = 7148282, upload-time = "2025-10-15T18:23:55.316Z" }, - { url = "https://files.pythonhosted.org/packages/c1/70/6b41bdcddf541b437bbb9f47f94d2db5d9ddef6c37ccab8c9107743748a4/pillow-12.0.0-cp314-cp314t-win_arm64.whl", hash = "sha256:99353a06902c2e43b43e8ff74ee65a7d90307d82370604746738a1e0661ccca7", size = 2525630, upload-time = "2025-10-15T18:23:57.149Z" }, - { url = "https://files.pythonhosted.org/packages/1d/b3/582327e6c9f86d037b63beebe981425d6811104cb443e8193824ef1a2f27/pillow-12.0.0-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:b22bd8c974942477156be55a768f7aa37c46904c175be4e158b6a86e3a6b7ca8", size = 5215068, upload-time = "2025-10-15T18:23:59.594Z" }, - { url = "https://files.pythonhosted.org/packages/fd/d6/67748211d119f3b6540baf90f92fae73ae51d5217b171b0e8b5f7e5d558f/pillow-12.0.0-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:805ebf596939e48dbb2e4922a1d3852cfc25c38160751ce02da93058b48d252a", size = 4614994, upload-time = "2025-10-15T18:24:01.669Z" }, - { url = "https://files.pythonhosted.org/packages/2d/e1/f8281e5d844c41872b273b9f2c34a4bf64ca08905668c8ae730eedc7c9fa/pillow-12.0.0-pp311-pypy311_pp73-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:cae81479f77420d217def5f54b5b9d279804d17e982e0f2fa19b1d1e14ab5197", size = 5246639, upload-time = "2025-10-15T18:24:03.403Z" }, - { url = "https://files.pythonhosted.org/packages/94/5a/0d8ab8ffe8a102ff5df60d0de5af309015163bf710c7bb3e8311dd3b3ad0/pillow-12.0.0-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:aeaefa96c768fc66818730b952a862235d68825c178f1b3ffd4efd7ad2edcb7c", size = 6986839, upload-time = "2025-10-15T18:24:05.344Z" }, - { url = "https://files.pythonhosted.org/packages/20/2e/3434380e8110b76cd9eb00a363c484b050f949b4bbe84ba770bb8508a02c/pillow-12.0.0-pp311-pypy311_pp73-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:09f2d0abef9e4e2f349305a4f8cc784a8a6c2f58a8c4892eea13b10a943bd26e", size = 5313505, upload-time = "2025-10-15T18:24:07.137Z" }, - { url = "https://files.pythonhosted.org/packages/57/ca/5a9d38900d9d74785141d6580950fe705de68af735ff6e727cb911b64740/pillow-12.0.0-pp311-pypy311_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bdee52571a343d721fb2eb3b090a82d959ff37fc631e3f70422e0c2e029f3e76", size = 5963654, upload-time = "2025-10-15T18:24:09.579Z" }, - { url = "https://files.pythonhosted.org/packages/95/7e/f896623c3c635a90537ac093c6a618ebe1a90d87206e42309cb5d98a1b9e/pillow-12.0.0-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:b290fd8aa38422444d4b50d579de197557f182ef1068b75f5aa8558638b8d0a5", size = 6997850, upload-time = "2025-10-15T18:24:11.495Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/5a/b0/cace85a1b0c9775a9f8f5d5423c8261c858760e2466c79b2dd184638b056/pillow-12.0.0.tar.gz", hash = "sha256:87d4f8125c9988bfbed67af47dd7a953e2fc7b0cc1e7800ec6d2080d490bb353", size = 47008828 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/0e/5a/a2f6773b64edb921a756eb0729068acad9fc5208a53f4a349396e9436721/pillow-12.0.0-cp311-cp311-macosx_10_10_x86_64.whl", hash = "sha256:0fd00cac9c03256c8b2ff58f162ebcd2587ad3e1f2e397eab718c47e24d231cc", size = 5289798 }, + { url = "https://files.pythonhosted.org/packages/2e/05/069b1f8a2e4b5a37493da6c5868531c3f77b85e716ad7a590ef87d58730d/pillow-12.0.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:a3475b96f5908b3b16c47533daaa87380c491357d197564e0ba34ae75c0f3257", size = 4650589 }, + { url = "https://files.pythonhosted.org/packages/61/e3/2c820d6e9a36432503ead175ae294f96861b07600a7156154a086ba7111a/pillow-12.0.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:110486b79f2d112cf6add83b28b627e369219388f64ef2f960fef9ebaf54c642", size = 6230472 }, + { url = "https://files.pythonhosted.org/packages/4f/89/63427f51c64209c5e23d4d52071c8d0f21024d3a8a487737caaf614a5795/pillow-12.0.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:5269cc1caeedb67e6f7269a42014f381f45e2e7cd42d834ede3c703a1d915fe3", size = 8033887 }, + { url = "https://files.pythonhosted.org/packages/f6/1b/c9711318d4901093c15840f268ad649459cd81984c9ec9887756cca049a5/pillow-12.0.0-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:aa5129de4e174daccbc59d0a3b6d20eaf24417d59851c07ebb37aeb02947987c", size = 6343964 }, + { url = "https://files.pythonhosted.org/packages/41/1e/db9470f2d030b4995083044cd8738cdd1bf773106819f6d8ba12597d5352/pillow-12.0.0-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bee2a6db3a7242ea309aa7ee8e2780726fed67ff4e5b40169f2c940e7eb09227", size = 7034756 }, + { url = "https://files.pythonhosted.org/packages/cc/b0/6177a8bdd5ee4ed87cba2de5a3cc1db55ffbbec6176784ce5bb75aa96798/pillow-12.0.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:90387104ee8400a7b4598253b4c406f8958f59fcf983a6cea2b50d59f7d63d0b", size = 6458075 }, + { url = "https://files.pythonhosted.org/packages/bc/5e/61537aa6fa977922c6a03253a0e727e6e4a72381a80d63ad8eec350684f2/pillow-12.0.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:bc91a56697869546d1b8f0a3ff35224557ae7f881050e99f615e0119bf934b4e", size = 7125955 }, + { url = "https://files.pythonhosted.org/packages/1f/3d/d5033539344ee3cbd9a4d69e12e63ca3a44a739eb2d4c8da350a3d38edd7/pillow-12.0.0-cp311-cp311-win32.whl", hash = "sha256:27f95b12453d165099c84f8a8bfdfd46b9e4bda9e0e4b65f0635430027f55739", size = 6298440 }, + { url = "https://files.pythonhosted.org/packages/4d/42/aaca386de5cc8bd8a0254516957c1f265e3521c91515b16e286c662854c4/pillow-12.0.0-cp311-cp311-win_amd64.whl", hash = "sha256:b583dc9070312190192631373c6c8ed277254aa6e6084b74bdd0a6d3b221608e", size = 6999256 }, + { url = "https://files.pythonhosted.org/packages/ba/f1/9197c9c2d5708b785f631a6dfbfa8eb3fb9672837cb92ae9af812c13b4ed/pillow-12.0.0-cp311-cp311-win_arm64.whl", hash = "sha256:759de84a33be3b178a64c8ba28ad5c135900359e85fb662bc6e403ad4407791d", size = 2436025 }, + { url = "https://files.pythonhosted.org/packages/2c/90/4fcce2c22caf044e660a198d740e7fbc14395619e3cb1abad12192c0826c/pillow-12.0.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:53561a4ddc36facb432fae7a9d8afbfaf94795414f5cdc5fc52f28c1dca90371", size = 5249377 }, + { url = "https://files.pythonhosted.org/packages/fd/e0/ed960067543d080691d47d6938ebccbf3976a931c9567ab2fbfab983a5dd/pillow-12.0.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:71db6b4c1653045dacc1585c1b0d184004f0d7e694c7b34ac165ca70c0838082", size = 4650343 }, + { url = "https://files.pythonhosted.org/packages/e7/a1/f81fdeddcb99c044bf7d6faa47e12850f13cee0849537a7d27eeab5534d4/pillow-12.0.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:2fa5f0b6716fc88f11380b88b31fe591a06c6315e955c096c35715788b339e3f", size = 6232981 }, + { url = "https://files.pythonhosted.org/packages/88/e1/9098d3ce341a8750b55b0e00c03f1630d6178f38ac191c81c97a3b047b44/pillow-12.0.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:82240051c6ca513c616f7f9da06e871f61bfd7805f566275841af15015b8f98d", size = 8041399 }, + { url = "https://files.pythonhosted.org/packages/a7/62/a22e8d3b602ae8cc01446d0c57a54e982737f44b6f2e1e019a925143771d/pillow-12.0.0-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:55f818bd74fe2f11d4d7cbc65880a843c4075e0ac7226bc1a23261dbea531953", size = 6347740 }, + { url = "https://files.pythonhosted.org/packages/4f/87/424511bdcd02c8d7acf9f65caa09f291a519b16bd83c3fb3374b3d4ae951/pillow-12.0.0-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b87843e225e74576437fd5b6a4c2205d422754f84a06942cfaf1dc32243e45a8", size = 7040201 }, + { url = "https://files.pythonhosted.org/packages/dc/4d/435c8ac688c54d11755aedfdd9f29c9eeddf68d150fe42d1d3dbd2365149/pillow-12.0.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:c607c90ba67533e1b2355b821fef6764d1dd2cbe26b8c1005ae84f7aea25ff79", size = 6462334 }, + { url = "https://files.pythonhosted.org/packages/2b/f2/ad34167a8059a59b8ad10bc5c72d4d9b35acc6b7c0877af8ac885b5f2044/pillow-12.0.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:21f241bdd5080a15bc86d3466a9f6074a9c2c2b314100dd896ac81ee6db2f1ba", size = 7134162 }, + { url = "https://files.pythonhosted.org/packages/0c/b1/a7391df6adacf0a5c2cf6ac1cf1fcc1369e7d439d28f637a847f8803beb3/pillow-12.0.0-cp312-cp312-win32.whl", hash = "sha256:dd333073e0cacdc3089525c7df7d39b211bcdf31fc2824e49d01c6b6187b07d0", size = 6298769 }, + { url = "https://files.pythonhosted.org/packages/a2/0b/d87733741526541c909bbf159e338dcace4f982daac6e5a8d6be225ca32d/pillow-12.0.0-cp312-cp312-win_amd64.whl", hash = "sha256:9fe611163f6303d1619bbcb653540a4d60f9e55e622d60a3108be0d5b441017a", size = 7001107 }, + { url = "https://files.pythonhosted.org/packages/bc/96/aaa61ce33cc98421fb6088af2a03be4157b1e7e0e87087c888e2370a7f45/pillow-12.0.0-cp312-cp312-win_arm64.whl", hash = "sha256:7dfb439562f234f7d57b1ac6bc8fe7f838a4bd49c79230e0f6a1da93e82f1fad", size = 2436012 }, + { url = "https://files.pythonhosted.org/packages/62/f2/de993bb2d21b33a98d031ecf6a978e4b61da207bef02f7b43093774c480d/pillow-12.0.0-cp313-cp313-ios_13_0_arm64_iphoneos.whl", hash = "sha256:0869154a2d0546545cde61d1789a6524319fc1897d9ee31218eae7a60ccc5643", size = 4045493 }, + { url = "https://files.pythonhosted.org/packages/0e/b6/bc8d0c4c9f6f111a783d045310945deb769b806d7574764234ffd50bc5ea/pillow-12.0.0-cp313-cp313-ios_13_0_arm64_iphonesimulator.whl", hash = "sha256:a7921c5a6d31b3d756ec980f2f47c0cfdbce0fc48c22a39347a895f41f4a6ea4", size = 4120461 }, + { url = "https://files.pythonhosted.org/packages/5d/57/d60d343709366a353dc56adb4ee1e7d8a2cc34e3fbc22905f4167cfec119/pillow-12.0.0-cp313-cp313-ios_13_0_x86_64_iphonesimulator.whl", hash = "sha256:1ee80a59f6ce048ae13cda1abf7fbd2a34ab9ee7d401c46be3ca685d1999a399", size = 3576912 }, + { url = "https://files.pythonhosted.org/packages/a4/a4/a0a31467e3f83b94d37568294b01d22b43ae3c5d85f2811769b9c66389dd/pillow-12.0.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:c50f36a62a22d350c96e49ad02d0da41dbd17ddc2e29750dbdba4323f85eb4a5", size = 5249132 }, + { url = "https://files.pythonhosted.org/packages/83/06/48eab21dd561de2914242711434c0c0eb992ed08ff3f6107a5f44527f5e9/pillow-12.0.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:5193fde9a5f23c331ea26d0cf171fbf67e3f247585f50c08b3e205c7aeb4589b", size = 4650099 }, + { url = "https://files.pythonhosted.org/packages/fc/bd/69ed99fd46a8dba7c1887156d3572fe4484e3f031405fcc5a92e31c04035/pillow-12.0.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:bde737cff1a975b70652b62d626f7785e0480918dece11e8fef3c0cf057351c3", size = 6230808 }, + { url = "https://files.pythonhosted.org/packages/ea/94/8fad659bcdbf86ed70099cb60ae40be6acca434bbc8c4c0d4ef356d7e0de/pillow-12.0.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:a6597ff2b61d121172f5844b53f21467f7082f5fb385a9a29c01414463f93b07", size = 8037804 }, + { url = "https://files.pythonhosted.org/packages/20/39/c685d05c06deecfd4e2d1950e9a908aa2ca8bc4e6c3b12d93b9cafbd7837/pillow-12.0.0-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:0b817e7035ea7f6b942c13aa03bb554fc44fea70838ea21f8eb31c638326584e", size = 6345553 }, + { url = "https://files.pythonhosted.org/packages/38/57/755dbd06530a27a5ed74f8cb0a7a44a21722ebf318edbe67ddbd7fb28f88/pillow-12.0.0-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f4f1231b7dec408e8670264ce63e9c71409d9583dd21d32c163e25213ee2a344", size = 7037729 }, + { url = "https://files.pythonhosted.org/packages/ca/b6/7e94f4c41d238615674d06ed677c14883103dce1c52e4af16f000338cfd7/pillow-12.0.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:6e51b71417049ad6ab14c49608b4a24d8fb3fe605e5dfabfe523b58064dc3d27", size = 6459789 }, + { url = "https://files.pythonhosted.org/packages/9c/14/4448bb0b5e0f22dd865290536d20ec8a23b64e2d04280b89139f09a36bb6/pillow-12.0.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:d120c38a42c234dc9a8c5de7ceaaf899cf33561956acb4941653f8bdc657aa79", size = 7130917 }, + { url = "https://files.pythonhosted.org/packages/dd/ca/16c6926cc1c015845745d5c16c9358e24282f1e588237a4c36d2b30f182f/pillow-12.0.0-cp313-cp313-win32.whl", hash = "sha256:4cc6b3b2efff105c6a1656cfe59da4fdde2cda9af1c5e0b58529b24525d0a098", size = 6302391 }, + { url = "https://files.pythonhosted.org/packages/6d/2a/dd43dcfd6dae9b6a49ee28a8eedb98c7d5ff2de94a5d834565164667b97b/pillow-12.0.0-cp313-cp313-win_amd64.whl", hash = "sha256:4cf7fed4b4580601c4345ceb5d4cbf5a980d030fd5ad07c4d2ec589f95f09905", size = 7007477 }, + { url = "https://files.pythonhosted.org/packages/77/f0/72ea067f4b5ae5ead653053212af05ce3705807906ba3f3e8f58ddf617e6/pillow-12.0.0-cp313-cp313-win_arm64.whl", hash = "sha256:9f0b04c6b8584c2c193babcccc908b38ed29524b29dd464bc8801bf10d746a3a", size = 2435918 }, + { url = "https://files.pythonhosted.org/packages/f5/5e/9046b423735c21f0487ea6cb5b10f89ea8f8dfbe32576fe052b5ba9d4e5b/pillow-12.0.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:7fa22993bac7b77b78cae22bad1e2a987ddf0d9015c63358032f84a53f23cdc3", size = 5251406 }, + { url = "https://files.pythonhosted.org/packages/12/66/982ceebcdb13c97270ef7a56c3969635b4ee7cd45227fa707c94719229c5/pillow-12.0.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:f135c702ac42262573fe9714dfe99c944b4ba307af5eb507abef1667e2cbbced", size = 4653218 }, + { url = "https://files.pythonhosted.org/packages/16/b3/81e625524688c31859450119bf12674619429cab3119eec0e30a7a1029cb/pillow-12.0.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:c85de1136429c524e55cfa4e033b4a7940ac5c8ee4d9401cc2d1bf48154bbc7b", size = 6266564 }, + { url = "https://files.pythonhosted.org/packages/98/59/dfb38f2a41240d2408096e1a76c671d0a105a4a8471b1871c6902719450c/pillow-12.0.0-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:38df9b4bfd3db902c9c2bd369bcacaf9d935b2fff73709429d95cc41554f7b3d", size = 8069260 }, + { url = "https://files.pythonhosted.org/packages/dc/3d/378dbea5cd1874b94c312425ca77b0f47776c78e0df2df751b820c8c1d6c/pillow-12.0.0-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7d87ef5795da03d742bf49439f9ca4d027cde49c82c5371ba52464aee266699a", size = 6379248 }, + { url = "https://files.pythonhosted.org/packages/84/b0/d525ef47d71590f1621510327acec75ae58c721dc071b17d8d652ca494d8/pillow-12.0.0-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:aff9e4d82d082ff9513bdd6acd4f5bd359f5b2c870907d2b0a9c5e10d40c88fe", size = 7066043 }, + { url = "https://files.pythonhosted.org/packages/61/2c/aced60e9cf9d0cde341d54bf7932c9ffc33ddb4a1595798b3a5150c7ec4e/pillow-12.0.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:8d8ca2b210ada074d57fcee40c30446c9562e542fc46aedc19baf758a93532ee", size = 6490915 }, + { url = "https://files.pythonhosted.org/packages/ef/26/69dcb9b91f4e59f8f34b2332a4a0a951b44f547c4ed39d3e4dcfcff48f89/pillow-12.0.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:99a7f72fb6249302aa62245680754862a44179b545ded638cf1fef59befb57ef", size = 7157998 }, + { url = "https://files.pythonhosted.org/packages/61/2b/726235842220ca95fa441ddf55dd2382b52ab5b8d9c0596fe6b3f23dafe8/pillow-12.0.0-cp313-cp313t-win32.whl", hash = "sha256:4078242472387600b2ce8d93ade8899c12bf33fa89e55ec89fe126e9d6d5d9e9", size = 6306201 }, + { url = "https://files.pythonhosted.org/packages/c0/3d/2afaf4e840b2df71344ababf2f8edd75a705ce500e5dc1e7227808312ae1/pillow-12.0.0-cp313-cp313t-win_amd64.whl", hash = "sha256:2c54c1a783d6d60595d3514f0efe9b37c8808746a66920315bfd34a938d7994b", size = 7013165 }, + { url = "https://files.pythonhosted.org/packages/6f/75/3fa09aa5cf6ed04bee3fa575798ddf1ce0bace8edb47249c798077a81f7f/pillow-12.0.0-cp313-cp313t-win_arm64.whl", hash = "sha256:26d9f7d2b604cd23aba3e9faf795787456ac25634d82cd060556998e39c6fa47", size = 2437834 }, + { url = "https://files.pythonhosted.org/packages/54/2a/9a8c6ba2c2c07b71bec92cf63e03370ca5e5f5c5b119b742bcc0cde3f9c5/pillow-12.0.0-cp314-cp314-ios_13_0_arm64_iphoneos.whl", hash = "sha256:beeae3f27f62308f1ddbcfb0690bf44b10732f2ef43758f169d5e9303165d3f9", size = 4045531 }, + { url = "https://files.pythonhosted.org/packages/84/54/836fdbf1bfb3d66a59f0189ff0b9f5f666cee09c6188309300df04ad71fa/pillow-12.0.0-cp314-cp314-ios_13_0_arm64_iphonesimulator.whl", hash = "sha256:d4827615da15cd59784ce39d3388275ec093ae3ee8d7f0c089b76fa87af756c2", size = 4120554 }, + { url = "https://files.pythonhosted.org/packages/0d/cd/16aec9f0da4793e98e6b54778a5fbce4f375c6646fe662e80600b8797379/pillow-12.0.0-cp314-cp314-ios_13_0_x86_64_iphonesimulator.whl", hash = "sha256:3e42edad50b6909089750e65c91aa09aaf1e0a71310d383f11321b27c224ed8a", size = 3576812 }, + { url = "https://files.pythonhosted.org/packages/f6/b7/13957fda356dc46339298b351cae0d327704986337c3c69bb54628c88155/pillow-12.0.0-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:e5d8efac84c9afcb40914ab49ba063d94f5dbdf5066db4482c66a992f47a3a3b", size = 5252689 }, + { url = "https://files.pythonhosted.org/packages/fc/f5/eae31a306341d8f331f43edb2e9122c7661b975433de5e447939ae61c5da/pillow-12.0.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:266cd5f2b63ff316d5a1bba46268e603c9caf5606d44f38c2873c380950576ad", size = 4650186 }, + { url = "https://files.pythonhosted.org/packages/86/62/2a88339aa40c4c77e79108facbd307d6091e2c0eb5b8d3cf4977cfca2fe6/pillow-12.0.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:58eea5ebe51504057dd95c5b77d21700b77615ab0243d8152793dc00eb4faf01", size = 6230308 }, + { url = "https://files.pythonhosted.org/packages/c7/33/5425a8992bcb32d1cb9fa3dd39a89e613d09a22f2c8083b7bf43c455f760/pillow-12.0.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f13711b1a5ba512d647a0e4ba79280d3a9a045aaf7e0cc6fbe96b91d4cdf6b0c", size = 8039222 }, + { url = "https://files.pythonhosted.org/packages/d8/61/3f5d3b35c5728f37953d3eec5b5f3e77111949523bd2dd7f31a851e50690/pillow-12.0.0-cp314-cp314-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6846bd2d116ff42cba6b646edf5bf61d37e5cbd256425fa089fee4ff5c07a99e", size = 6346657 }, + { url = "https://files.pythonhosted.org/packages/3a/be/ee90a3d79271227e0f0a33c453531efd6ed14b2e708596ba5dd9be948da3/pillow-12.0.0-cp314-cp314-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c98fa880d695de164b4135a52fd2e9cd7b7c90a9d8ac5e9e443a24a95ef9248e", size = 7038482 }, + { url = "https://files.pythonhosted.org/packages/44/34/a16b6a4d1ad727de390e9bd9f19f5f669e079e5826ec0f329010ddea492f/pillow-12.0.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:fa3ed2a29a9e9d2d488b4da81dcb54720ac3104a20bf0bd273f1e4648aff5af9", size = 6461416 }, + { url = "https://files.pythonhosted.org/packages/b6/39/1aa5850d2ade7d7ba9f54e4e4c17077244ff7a2d9e25998c38a29749eb3f/pillow-12.0.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:d034140032870024e6b9892c692fe2968493790dd57208b2c37e3fb35f6df3ab", size = 7131584 }, + { url = "https://files.pythonhosted.org/packages/bf/db/4fae862f8fad0167073a7733973bfa955f47e2cac3dc3e3e6257d10fab4a/pillow-12.0.0-cp314-cp314-win32.whl", hash = "sha256:1b1b133e6e16105f524a8dec491e0586d072948ce15c9b914e41cdadd209052b", size = 6400621 }, + { url = "https://files.pythonhosted.org/packages/2b/24/b350c31543fb0107ab2599464d7e28e6f856027aadda995022e695313d94/pillow-12.0.0-cp314-cp314-win_amd64.whl", hash = "sha256:8dc232e39d409036af549c86f24aed8273a40ffa459981146829a324e0848b4b", size = 7142916 }, + { url = "https://files.pythonhosted.org/packages/0f/9b/0ba5a6fd9351793996ef7487c4fdbde8d3f5f75dbedc093bb598648fddf0/pillow-12.0.0-cp314-cp314-win_arm64.whl", hash = "sha256:d52610d51e265a51518692045e372a4c363056130d922a7351429ac9f27e70b0", size = 2523836 }, + { url = "https://files.pythonhosted.org/packages/f5/7a/ceee0840aebc579af529b523d530840338ecf63992395842e54edc805987/pillow-12.0.0-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:1979f4566bb96c1e50a62d9831e2ea2d1211761e5662afc545fa766f996632f6", size = 5255092 }, + { url = "https://files.pythonhosted.org/packages/44/76/20776057b4bfd1aef4eeca992ebde0f53a4dce874f3ae693d0ec90a4f79b/pillow-12.0.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:b2e4b27a6e15b04832fe9bf292b94b5ca156016bbc1ea9c2c20098a0320d6cf6", size = 4653158 }, + { url = "https://files.pythonhosted.org/packages/82/3f/d9ff92ace07be8836b4e7e87e6a4c7a8318d47c2f1463ffcf121fc57d9cb/pillow-12.0.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:fb3096c30df99fd01c7bf8e544f392103d0795b9f98ba71a8054bcbf56b255f1", size = 6267882 }, + { url = "https://files.pythonhosted.org/packages/9f/7a/4f7ff87f00d3ad33ba21af78bfcd2f032107710baf8280e3722ceec28cda/pillow-12.0.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:7438839e9e053ef79f7112c881cef684013855016f928b168b81ed5835f3e75e", size = 8071001 }, + { url = "https://files.pythonhosted.org/packages/75/87/fcea108944a52dad8cca0715ae6247e271eb80459364a98518f1e4f480c1/pillow-12.0.0-cp314-cp314t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5d5c411a8eaa2299322b647cd932586b1427367fd3184ffbb8f7a219ea2041ca", size = 6380146 }, + { url = "https://files.pythonhosted.org/packages/91/52/0d31b5e571ef5fd111d2978b84603fce26aba1b6092f28e941cb46570745/pillow-12.0.0-cp314-cp314t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d7e091d464ac59d2c7ad8e7e08105eaf9dafbc3883fd7265ffccc2baad6ac925", size = 7067344 }, + { url = "https://files.pythonhosted.org/packages/7b/f4/2dd3d721f875f928d48e83bb30a434dee75a2531bca839bb996bb0aa5a91/pillow-12.0.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:792a2c0be4dcc18af9d4a2dfd8a11a17d5e25274a1062b0ec1c2d79c76f3e7f8", size = 6491864 }, + { url = "https://files.pythonhosted.org/packages/30/4b/667dfcf3d61fc309ba5a15b141845cece5915e39b99c1ceab0f34bf1d124/pillow-12.0.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:afbefa430092f71a9593a99ab6a4e7538bc9eabbf7bf94f91510d3503943edc4", size = 7158911 }, + { url = "https://files.pythonhosted.org/packages/a2/2f/16cabcc6426c32218ace36bf0d55955e813f2958afddbf1d391849fee9d1/pillow-12.0.0-cp314-cp314t-win32.whl", hash = "sha256:3830c769decf88f1289680a59d4f4c46c72573446352e2befec9a8512104fa52", size = 6408045 }, + { url = "https://files.pythonhosted.org/packages/35/73/e29aa0c9c666cf787628d3f0dcf379f4791fba79f4936d02f8b37165bdf8/pillow-12.0.0-cp314-cp314t-win_amd64.whl", hash = "sha256:905b0365b210c73afb0ebe9101a32572152dfd1c144c7e28968a331b9217b94a", size = 7148282 }, + { url = "https://files.pythonhosted.org/packages/c1/70/6b41bdcddf541b437bbb9f47f94d2db5d9ddef6c37ccab8c9107743748a4/pillow-12.0.0-cp314-cp314t-win_arm64.whl", hash = "sha256:99353a06902c2e43b43e8ff74ee65a7d90307d82370604746738a1e0661ccca7", size = 2525630 }, + { url = "https://files.pythonhosted.org/packages/1d/b3/582327e6c9f86d037b63beebe981425d6811104cb443e8193824ef1a2f27/pillow-12.0.0-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:b22bd8c974942477156be55a768f7aa37c46904c175be4e158b6a86e3a6b7ca8", size = 5215068 }, + { url = "https://files.pythonhosted.org/packages/fd/d6/67748211d119f3b6540baf90f92fae73ae51d5217b171b0e8b5f7e5d558f/pillow-12.0.0-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:805ebf596939e48dbb2e4922a1d3852cfc25c38160751ce02da93058b48d252a", size = 4614994 }, + { url = "https://files.pythonhosted.org/packages/2d/e1/f8281e5d844c41872b273b9f2c34a4bf64ca08905668c8ae730eedc7c9fa/pillow-12.0.0-pp311-pypy311_pp73-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:cae81479f77420d217def5f54b5b9d279804d17e982e0f2fa19b1d1e14ab5197", size = 5246639 }, + { url = "https://files.pythonhosted.org/packages/94/5a/0d8ab8ffe8a102ff5df60d0de5af309015163bf710c7bb3e8311dd3b3ad0/pillow-12.0.0-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:aeaefa96c768fc66818730b952a862235d68825c178f1b3ffd4efd7ad2edcb7c", size = 6986839 }, + { url = "https://files.pythonhosted.org/packages/20/2e/3434380e8110b76cd9eb00a363c484b050f949b4bbe84ba770bb8508a02c/pillow-12.0.0-pp311-pypy311_pp73-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:09f2d0abef9e4e2f349305a4f8cc784a8a6c2f58a8c4892eea13b10a943bd26e", size = 5313505 }, + { url = "https://files.pythonhosted.org/packages/57/ca/5a9d38900d9d74785141d6580950fe705de68af735ff6e727cb911b64740/pillow-12.0.0-pp311-pypy311_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bdee52571a343d721fb2eb3b090a82d959ff37fc631e3f70422e0c2e029f3e76", size = 5963654 }, + { url = "https://files.pythonhosted.org/packages/95/7e/f896623c3c635a90537ac093c6a618ebe1a90d87206e42309cb5d98a1b9e/pillow-12.0.0-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:b290fd8aa38422444d4b50d579de197557f182ef1068b75f5aa8558638b8d0a5", size = 6997850 }, ] [[package]] name = "platformdirs" version = "4.5.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/61/33/9611380c2bdb1225fdef633e2a9610622310fed35ab11dac9620972ee088/platformdirs-4.5.0.tar.gz", hash = "sha256:70ddccdd7c99fc5942e9fc25636a8b34d04c24b335100223152c2803e4063312", size = 21632, upload-time = "2025-10-08T17:44:48.791Z" } +sdist = { url = "https://files.pythonhosted.org/packages/61/33/9611380c2bdb1225fdef633e2a9610622310fed35ab11dac9620972ee088/platformdirs-4.5.0.tar.gz", hash = "sha256:70ddccdd7c99fc5942e9fc25636a8b34d04c24b335100223152c2803e4063312", size = 21632 } wheels = [ - { url = "https://files.pythonhosted.org/packages/73/cb/ac7874b3e5d58441674fb70742e6c374b28b0c7cb988d37d991cde47166c/platformdirs-4.5.0-py3-none-any.whl", hash = "sha256:e578a81bb873cbb89a41fcc904c7ef523cc18284b7e3b3ccf06aca1403b7ebd3", size = 18651, upload-time = "2025-10-08T17:44:47.223Z" }, + { url = "https://files.pythonhosted.org/packages/73/cb/ac7874b3e5d58441674fb70742e6c374b28b0c7cb988d37d991cde47166c/platformdirs-4.5.0-py3-none-any.whl", hash = "sha256:e578a81bb873cbb89a41fcc904c7ef523cc18284b7e3b3ccf06aca1403b7ebd3", size = 18651 }, ] [[package]] name = "pluggy" version = "1.6.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f9/e2/3e91f31a7d2b083fe6ef3fa267035b518369d9511ffab804f839851d2779/pluggy-1.6.0.tar.gz", hash = "sha256:7dcc130b76258d33b90f61b658791dede3486c3e6bfb003ee5c9bfb396dd22f3", size = 69412, upload-time = "2025-05-15T12:30:07.975Z" } +sdist = { url = "https://files.pythonhosted.org/packages/f9/e2/3e91f31a7d2b083fe6ef3fa267035b518369d9511ffab804f839851d2779/pluggy-1.6.0.tar.gz", hash = "sha256:7dcc130b76258d33b90f61b658791dede3486c3e6bfb003ee5c9bfb396dd22f3", size = 69412 } wheels = [ - { url = "https://files.pythonhosted.org/packages/54/20/4d324d65cc6d9205fabedc306948156824eb9f0ee1633355a8f7ec5c66bf/pluggy-1.6.0-py3-none-any.whl", hash = "sha256:e920276dd6813095e9377c0bc5566d94c932c33b27a3e3945d8389c374dd4746", size = 20538, upload-time = "2025-05-15T12:30:06.134Z" }, + { url = "https://files.pythonhosted.org/packages/54/20/4d324d65cc6d9205fabedc306948156824eb9f0ee1633355a8f7ec5c66bf/pluggy-1.6.0-py3-none-any.whl", hash = "sha256:e920276dd6813095e9377c0bc5566d94c932c33b27a3e3945d8389c374dd4746", size = 20538 }, ] [[package]] @@ -2310,18 +2329,18 @@ dependencies = [ { name = "pyyaml" }, { name = "virtualenv" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/ff/29/7cf5bbc236333876e4b41f56e06857a87937ce4bf91e117a6991a2dbb02a/pre_commit-4.3.0.tar.gz", hash = "sha256:499fe450cc9d42e9d58e606262795ecb64dd05438943c62b66f6a8673da30b16", size = 193792, upload-time = "2025-08-09T18:56:14.651Z" } +sdist = { url = "https://files.pythonhosted.org/packages/ff/29/7cf5bbc236333876e4b41f56e06857a87937ce4bf91e117a6991a2dbb02a/pre_commit-4.3.0.tar.gz", hash = "sha256:499fe450cc9d42e9d58e606262795ecb64dd05438943c62b66f6a8673da30b16", size = 193792 } wheels = [ - { url = "https://files.pythonhosted.org/packages/5b/a5/987a405322d78a73b66e39e4a90e4ef156fd7141bf71df987e50717c321b/pre_commit-4.3.0-py2.py3-none-any.whl", hash = "sha256:2b0747ad7e6e967169136edffee14c16e148a778a54e4f967921aa1ebf2308d8", size = 220965, upload-time = "2025-08-09T18:56:13.192Z" }, + { url = "https://files.pythonhosted.org/packages/5b/a5/987a405322d78a73b66e39e4a90e4ef156fd7141bf71df987e50717c321b/pre_commit-4.3.0-py2.py3-none-any.whl", hash = "sha256:2b0747ad7e6e967169136edffee14c16e148a778a54e4f967921aa1ebf2308d8", size = 220965 }, ] [[package]] name = "prometheus-client" version = "0.23.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/23/53/3edb5d68ecf6b38fcbcc1ad28391117d2a322d9a1a3eff04bfdb184d8c3b/prometheus_client-0.23.1.tar.gz", hash = "sha256:6ae8f9081eaaaf153a2e959d2e6c4f4fb57b12ef76c8c7980202f1e57b48b2ce", size = 80481, upload-time = "2025-09-18T20:47:25.043Z" } +sdist = { url = "https://files.pythonhosted.org/packages/23/53/3edb5d68ecf6b38fcbcc1ad28391117d2a322d9a1a3eff04bfdb184d8c3b/prometheus_client-0.23.1.tar.gz", hash = "sha256:6ae8f9081eaaaf153a2e959d2e6c4f4fb57b12ef76c8c7980202f1e57b48b2ce", size = 80481 } wheels = [ - { url = "https://files.pythonhosted.org/packages/b8/db/14bafcb4af2139e046d03fd00dea7873e48eafe18b7d2797e73d6681f210/prometheus_client-0.23.1-py3-none-any.whl", hash = "sha256:dd1913e6e76b59cfe44e7a4b83e01afc9873c1bdfd2ed8739f1e76aeca115f99", size = 61145, upload-time = "2025-09-18T20:47:23.875Z" }, + { url = "https://files.pythonhosted.org/packages/b8/db/14bafcb4af2139e046d03fd00dea7873e48eafe18b7d2797e73d6681f210/prometheus_client-0.23.1-py3-none-any.whl", hash = "sha256:dd1913e6e76b59cfe44e7a4b83e01afc9873c1bdfd2ed8739f1e76aeca115f99", size = 61145 }, ] [[package]] @@ -2331,115 +2350,115 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "wcwidth" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/a1/96/06e01a7b38dce6fe1db213e061a4602dd6032a8a97ef6c1a862537732421/prompt_toolkit-3.0.52.tar.gz", hash = "sha256:28cde192929c8e7321de85de1ddbe736f1375148b02f2e17edd840042b1be855", size = 434198, upload-time = "2025-08-27T15:24:02.057Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a1/96/06e01a7b38dce6fe1db213e061a4602dd6032a8a97ef6c1a862537732421/prompt_toolkit-3.0.52.tar.gz", hash = "sha256:28cde192929c8e7321de85de1ddbe736f1375148b02f2e17edd840042b1be855", size = 434198 } wheels = [ - { url = "https://files.pythonhosted.org/packages/84/03/0d3ce49e2505ae70cf43bc5bb3033955d2fc9f932163e84dc0779cc47f48/prompt_toolkit-3.0.52-py3-none-any.whl", hash = "sha256:9aac639a3bbd33284347de5ad8d68ecc044b91a762dc39b7c21095fcd6a19955", size = 391431, upload-time = "2025-08-27T15:23:59.498Z" }, + { url = "https://files.pythonhosted.org/packages/84/03/0d3ce49e2505ae70cf43bc5bb3033955d2fc9f932163e84dc0779cc47f48/prompt_toolkit-3.0.52-py3-none-any.whl", hash = "sha256:9aac639a3bbd33284347de5ad8d68ecc044b91a762dc39b7c21095fcd6a19955", size = 391431 }, ] [[package]] name = "psutil" version = "7.1.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e1/88/bdd0a41e5857d5d703287598cbf08dad90aed56774ea52ae071bae9071b6/psutil-7.1.3.tar.gz", hash = "sha256:6c86281738d77335af7aec228328e944b30930899ea760ecf33a4dba66be5e74", size = 489059, upload-time = "2025-11-02T12:25:54.619Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/bd/93/0c49e776b8734fef56ec9c5c57f923922f2cf0497d62e0f419465f28f3d0/psutil-7.1.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:0005da714eee687b4b8decd3d6cc7c6db36215c9e74e5ad2264b90c3df7d92dc", size = 239751, upload-time = "2025-11-02T12:25:58.161Z" }, - { url = "https://files.pythonhosted.org/packages/6f/8d/b31e39c769e70780f007969815195a55c81a63efebdd4dbe9e7a113adb2f/psutil-7.1.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:19644c85dcb987e35eeeaefdc3915d059dac7bd1167cdcdbf27e0ce2df0c08c0", size = 240368, upload-time = "2025-11-02T12:26:00.491Z" }, - { url = "https://files.pythonhosted.org/packages/62/61/23fd4acc3c9eebbf6b6c78bcd89e5d020cfde4acf0a9233e9d4e3fa698b4/psutil-7.1.3-cp313-cp313t-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:95ef04cf2e5ba0ab9eaafc4a11eaae91b44f4ef5541acd2ee91d9108d00d59a7", size = 287134, upload-time = "2025-11-02T12:26:02.613Z" }, - { url = "https://files.pythonhosted.org/packages/30/1c/f921a009ea9ceb51aa355cb0cc118f68d354db36eae18174bab63affb3e6/psutil-7.1.3-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1068c303be3a72f8e18e412c5b2a8f6d31750fb152f9cb106b54090296c9d251", size = 289904, upload-time = "2025-11-02T12:26:05.207Z" }, - { url = "https://files.pythonhosted.org/packages/a6/82/62d68066e13e46a5116df187d319d1724b3f437ddd0f958756fc052677f4/psutil-7.1.3-cp313-cp313t-win_amd64.whl", hash = "sha256:18349c5c24b06ac5612c0428ec2a0331c26443d259e2a0144a9b24b4395b58fa", size = 249642, upload-time = "2025-11-02T12:26:07.447Z" }, - { url = "https://files.pythonhosted.org/packages/df/ad/c1cd5fe965c14a0392112f68362cfceb5230819dbb5b1888950d18a11d9f/psutil-7.1.3-cp313-cp313t-win_arm64.whl", hash = "sha256:c525ffa774fe4496282fb0b1187725793de3e7c6b29e41562733cae9ada151ee", size = 245518, upload-time = "2025-11-02T12:26:09.719Z" }, - { url = "https://files.pythonhosted.org/packages/2e/bb/6670bded3e3236eb4287c7bcdc167e9fae6e1e9286e437f7111caed2f909/psutil-7.1.3-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:b403da1df4d6d43973dc004d19cee3b848e998ae3154cc8097d139b77156c353", size = 239843, upload-time = "2025-11-02T12:26:11.968Z" }, - { url = "https://files.pythonhosted.org/packages/b8/66/853d50e75a38c9a7370ddbeefabdd3d3116b9c31ef94dc92c6729bc36bec/psutil-7.1.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:ad81425efc5e75da3f39b3e636293360ad8d0b49bed7df824c79764fb4ba9b8b", size = 240369, upload-time = "2025-11-02T12:26:14.358Z" }, - { url = "https://files.pythonhosted.org/packages/41/bd/313aba97cb5bfb26916dc29cf0646cbe4dd6a89ca69e8c6edce654876d39/psutil-7.1.3-cp314-cp314t-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8f33a3702e167783a9213db10ad29650ebf383946e91bc77f28a5eb083496bc9", size = 288210, upload-time = "2025-11-02T12:26:16.699Z" }, - { url = "https://files.pythonhosted.org/packages/c2/fa/76e3c06e760927a0cfb5705eb38164254de34e9bd86db656d4dbaa228b04/psutil-7.1.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:fac9cd332c67f4422504297889da5ab7e05fd11e3c4392140f7370f4208ded1f", size = 291182, upload-time = "2025-11-02T12:26:18.848Z" }, - { url = "https://files.pythonhosted.org/packages/0f/1d/5774a91607035ee5078b8fd747686ebec28a962f178712de100d00b78a32/psutil-7.1.3-cp314-cp314t-win_amd64.whl", hash = "sha256:3792983e23b69843aea49c8f5b8f115572c5ab64c153bada5270086a2123c7e7", size = 250466, upload-time = "2025-11-02T12:26:21.183Z" }, - { url = "https://files.pythonhosted.org/packages/00/ca/e426584bacb43a5cb1ac91fae1937f478cd8fbe5e4ff96574e698a2c77cd/psutil-7.1.3-cp314-cp314t-win_arm64.whl", hash = "sha256:31d77fcedb7529f27bb3a0472bea9334349f9a04160e8e6e5020f22c59893264", size = 245756, upload-time = "2025-11-02T12:26:23.148Z" }, - { url = "https://files.pythonhosted.org/packages/ef/94/46b9154a800253e7ecff5aaacdf8ebf43db99de4a2dfa18575b02548654e/psutil-7.1.3-cp36-abi3-macosx_10_9_x86_64.whl", hash = "sha256:2bdbcd0e58ca14996a42adf3621a6244f1bb2e2e528886959c72cf1e326677ab", size = 238359, upload-time = "2025-11-02T12:26:25.284Z" }, - { url = "https://files.pythonhosted.org/packages/68/3a/9f93cff5c025029a36d9a92fef47220ab4692ee7f2be0fba9f92813d0cb8/psutil-7.1.3-cp36-abi3-macosx_11_0_arm64.whl", hash = "sha256:bc31fa00f1fbc3c3802141eede66f3a2d51d89716a194bf2cd6fc68310a19880", size = 239171, upload-time = "2025-11-02T12:26:27.23Z" }, - { url = "https://files.pythonhosted.org/packages/ce/b1/5f49af514f76431ba4eea935b8ad3725cdeb397e9245ab919dbc1d1dc20f/psutil-7.1.3-cp36-abi3-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:3bb428f9f05c1225a558f53e30ccbad9930b11c3fc206836242de1091d3e7dd3", size = 263261, upload-time = "2025-11-02T12:26:29.48Z" }, - { url = "https://files.pythonhosted.org/packages/e0/95/992c8816a74016eb095e73585d747e0a8ea21a061ed3689474fabb29a395/psutil-7.1.3-cp36-abi3-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:56d974e02ca2c8eb4812c3f76c30e28836fffc311d55d979f1465c1feeb2b68b", size = 264635, upload-time = "2025-11-02T12:26:31.74Z" }, - { url = "https://files.pythonhosted.org/packages/55/4c/c3ed1a622b6ae2fd3c945a366e64eb35247a31e4db16cf5095e269e8eb3c/psutil-7.1.3-cp37-abi3-win_amd64.whl", hash = "sha256:f39c2c19fe824b47484b96f9692932248a54c43799a84282cfe58d05a6449efd", size = 247633, upload-time = "2025-11-02T12:26:33.887Z" }, - { url = "https://files.pythonhosted.org/packages/c9/ad/33b2ccec09bf96c2b2ef3f9a6f66baac8253d7565d8839e024a6b905d45d/psutil-7.1.3-cp37-abi3-win_arm64.whl", hash = "sha256:bd0d69cee829226a761e92f28140bec9a5ee9d5b4fb4b0cc589068dbfff559b1", size = 244608, upload-time = "2025-11-02T12:26:36.136Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/e1/88/bdd0a41e5857d5d703287598cbf08dad90aed56774ea52ae071bae9071b6/psutil-7.1.3.tar.gz", hash = "sha256:6c86281738d77335af7aec228328e944b30930899ea760ecf33a4dba66be5e74", size = 489059 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/bd/93/0c49e776b8734fef56ec9c5c57f923922f2cf0497d62e0f419465f28f3d0/psutil-7.1.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:0005da714eee687b4b8decd3d6cc7c6db36215c9e74e5ad2264b90c3df7d92dc", size = 239751 }, + { url = "https://files.pythonhosted.org/packages/6f/8d/b31e39c769e70780f007969815195a55c81a63efebdd4dbe9e7a113adb2f/psutil-7.1.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:19644c85dcb987e35eeeaefdc3915d059dac7bd1167cdcdbf27e0ce2df0c08c0", size = 240368 }, + { url = "https://files.pythonhosted.org/packages/62/61/23fd4acc3c9eebbf6b6c78bcd89e5d020cfde4acf0a9233e9d4e3fa698b4/psutil-7.1.3-cp313-cp313t-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:95ef04cf2e5ba0ab9eaafc4a11eaae91b44f4ef5541acd2ee91d9108d00d59a7", size = 287134 }, + { url = "https://files.pythonhosted.org/packages/30/1c/f921a009ea9ceb51aa355cb0cc118f68d354db36eae18174bab63affb3e6/psutil-7.1.3-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1068c303be3a72f8e18e412c5b2a8f6d31750fb152f9cb106b54090296c9d251", size = 289904 }, + { url = "https://files.pythonhosted.org/packages/a6/82/62d68066e13e46a5116df187d319d1724b3f437ddd0f958756fc052677f4/psutil-7.1.3-cp313-cp313t-win_amd64.whl", hash = "sha256:18349c5c24b06ac5612c0428ec2a0331c26443d259e2a0144a9b24b4395b58fa", size = 249642 }, + { url = "https://files.pythonhosted.org/packages/df/ad/c1cd5fe965c14a0392112f68362cfceb5230819dbb5b1888950d18a11d9f/psutil-7.1.3-cp313-cp313t-win_arm64.whl", hash = "sha256:c525ffa774fe4496282fb0b1187725793de3e7c6b29e41562733cae9ada151ee", size = 245518 }, + { url = "https://files.pythonhosted.org/packages/2e/bb/6670bded3e3236eb4287c7bcdc167e9fae6e1e9286e437f7111caed2f909/psutil-7.1.3-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:b403da1df4d6d43973dc004d19cee3b848e998ae3154cc8097d139b77156c353", size = 239843 }, + { url = "https://files.pythonhosted.org/packages/b8/66/853d50e75a38c9a7370ddbeefabdd3d3116b9c31ef94dc92c6729bc36bec/psutil-7.1.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:ad81425efc5e75da3f39b3e636293360ad8d0b49bed7df824c79764fb4ba9b8b", size = 240369 }, + { url = "https://files.pythonhosted.org/packages/41/bd/313aba97cb5bfb26916dc29cf0646cbe4dd6a89ca69e8c6edce654876d39/psutil-7.1.3-cp314-cp314t-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8f33a3702e167783a9213db10ad29650ebf383946e91bc77f28a5eb083496bc9", size = 288210 }, + { url = "https://files.pythonhosted.org/packages/c2/fa/76e3c06e760927a0cfb5705eb38164254de34e9bd86db656d4dbaa228b04/psutil-7.1.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:fac9cd332c67f4422504297889da5ab7e05fd11e3c4392140f7370f4208ded1f", size = 291182 }, + { url = "https://files.pythonhosted.org/packages/0f/1d/5774a91607035ee5078b8fd747686ebec28a962f178712de100d00b78a32/psutil-7.1.3-cp314-cp314t-win_amd64.whl", hash = "sha256:3792983e23b69843aea49c8f5b8f115572c5ab64c153bada5270086a2123c7e7", size = 250466 }, + { url = "https://files.pythonhosted.org/packages/00/ca/e426584bacb43a5cb1ac91fae1937f478cd8fbe5e4ff96574e698a2c77cd/psutil-7.1.3-cp314-cp314t-win_arm64.whl", hash = "sha256:31d77fcedb7529f27bb3a0472bea9334349f9a04160e8e6e5020f22c59893264", size = 245756 }, + { url = "https://files.pythonhosted.org/packages/ef/94/46b9154a800253e7ecff5aaacdf8ebf43db99de4a2dfa18575b02548654e/psutil-7.1.3-cp36-abi3-macosx_10_9_x86_64.whl", hash = "sha256:2bdbcd0e58ca14996a42adf3621a6244f1bb2e2e528886959c72cf1e326677ab", size = 238359 }, + { url = "https://files.pythonhosted.org/packages/68/3a/9f93cff5c025029a36d9a92fef47220ab4692ee7f2be0fba9f92813d0cb8/psutil-7.1.3-cp36-abi3-macosx_11_0_arm64.whl", hash = "sha256:bc31fa00f1fbc3c3802141eede66f3a2d51d89716a194bf2cd6fc68310a19880", size = 239171 }, + { url = "https://files.pythonhosted.org/packages/ce/b1/5f49af514f76431ba4eea935b8ad3725cdeb397e9245ab919dbc1d1dc20f/psutil-7.1.3-cp36-abi3-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:3bb428f9f05c1225a558f53e30ccbad9930b11c3fc206836242de1091d3e7dd3", size = 263261 }, + { url = "https://files.pythonhosted.org/packages/e0/95/992c8816a74016eb095e73585d747e0a8ea21a061ed3689474fabb29a395/psutil-7.1.3-cp36-abi3-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:56d974e02ca2c8eb4812c3f76c30e28836fffc311d55d979f1465c1feeb2b68b", size = 264635 }, + { url = "https://files.pythonhosted.org/packages/55/4c/c3ed1a622b6ae2fd3c945a366e64eb35247a31e4db16cf5095e269e8eb3c/psutil-7.1.3-cp37-abi3-win_amd64.whl", hash = "sha256:f39c2c19fe824b47484b96f9692932248a54c43799a84282cfe58d05a6449efd", size = 247633 }, + { url = "https://files.pythonhosted.org/packages/c9/ad/33b2ccec09bf96c2b2ef3f9a6f66baac8253d7565d8839e024a6b905d45d/psutil-7.1.3-cp37-abi3-win_arm64.whl", hash = "sha256:bd0d69cee829226a761e92f28140bec9a5ee9d5b4fb4b0cc589068dbfff559b1", size = 244608 }, ] [[package]] name = "psygnal" version = "0.15.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/5a/20/70430999aa609adb0601ec0f72bd23790a6e51a80ae6e7dc6621e6c5ee2a/psygnal-0.15.0.tar.gz", hash = "sha256:5534f18e2d1536675e181c6f81cf04f4177b25a9e60fdcf724a25ce5cc195765", size = 124470, upload-time = "2025-10-15T12:05:50.522Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/1f/b7/1979a82f27c32e70b165b3f1282bbfbaf81a3e44ea85a4599487511533a7/psygnal-0.15.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:4d83239961c66f0763c26df121d8028eeb1cdebc3ce2d511836b3424dda591f3", size = 512136, upload-time = "2025-10-15T12:05:19.963Z" }, - { url = "https://files.pythonhosted.org/packages/f1/85/64e1b2cf86e563aca9498842b7a5fb3bbba38ed50d7306278417f687939e/psygnal-0.15.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:219550f78512cd274ee11966033843426a85ee333fbfed73d0f7ce1b153c547c", size = 568105, upload-time = "2025-10-15T12:05:22.015Z" }, - { url = "https://files.pythonhosted.org/packages/17/44/744374443b6e30f2ede11eb182d698d97c0bd021d59e472a0f0a4ddccf8e/psygnal-0.15.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0c29149a5042d79cb9dfb4d7b6b8c624296681b1533d58b7820c0817ffdd81c4", size = 854314, upload-time = "2025-10-15T12:05:23.489Z" }, - { url = "https://files.pythonhosted.org/packages/94/56/782a5da7a3e0fa5019b617c47a963202de37dabb73f2e43b67b8d76bac0a/psygnal-0.15.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:d4c9762102df30530044c5a44cc591240ff3b89bd67292e10c0b73cd694c84e9", size = 862143, upload-time = "2025-10-15T12:05:25.316Z" }, - { url = "https://files.pythonhosted.org/packages/4a/93/ee50e54c5a8693a6954647da7e2c6a3150c4a37f0760c6e87ac6de3037dc/psygnal-0.15.0-cp311-cp311-win_amd64.whl", hash = "sha256:0f50938b3caf07e34ab044c19d4e9280a53ff65492c285ff211285f0a08934c1", size = 414136, upload-time = "2025-10-15T12:05:26.551Z" }, - { url = "https://files.pythonhosted.org/packages/e9/6d/f3adf8f66bf12651f35aff13dd4a6c88afffa815ef8b2b7fa60a602a6cd7/psygnal-0.15.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:82eb5767f6cba67fa2d034dab9ec94e8eaf465067666dea3e2f832f2c32debc3", size = 522774, upload-time = "2025-10-15T12:05:27.72Z" }, - { url = "https://files.pythonhosted.org/packages/e6/40/adc69bd677a2683f931614fdd716034ba5bc238752973bad3a1415b2f015/psygnal-0.15.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:5dbcc67b2282eebe2e4e55ff9b50dad6b811d4ab698c573a61a725a6296919ba", size = 576015, upload-time = "2025-10-15T12:05:29.423Z" }, - { url = "https://files.pythonhosted.org/packages/0c/ce/ad35c19f489c563e6655a6ee9509e1af7ee864ae8fe95f04f851a47e141a/psygnal-0.15.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c0d65e2686c19997eb4495974abc972ca1661504e73b8b58b1fb8466baf0c7ae", size = 888755, upload-time = "2025-10-15T12:05:30.971Z" }, - { url = "https://files.pythonhosted.org/packages/b6/be/0f680df48bf819025ce4f486443471f541c1559e3ad474311f92fb9a8549/psygnal-0.15.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:ed3ff192cdd14956c2f7a0be4635fa72b2eb2773dfc58a6aa8c14926647041f2", size = 880071, upload-time = "2025-10-15T12:05:32.487Z" }, - { url = "https://files.pythonhosted.org/packages/f5/2d/c16b2e2a657a908d363ba4b1680cb827f152cb680c24a1add720c8bfde36/psygnal-0.15.0-cp312-cp312-win_amd64.whl", hash = "sha256:0ed1fd5797df111c9f9b43a1dc01ffb7c76e19ddc9b0de969e0b816034345246", size = 417554, upload-time = "2025-10-15T12:05:33.758Z" }, - { url = "https://files.pythonhosted.org/packages/f9/b0/d4ef27d30e0336e5dd49a145bc5f55ad7e8c2d4403a8cc89827e3dc4e17d/psygnal-0.15.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:eb11ecb42b4ff9e45d661396399029c41fbd1cfdd5dbd5c31a3f6f52c8fc2b90", size = 521990, upload-time = "2025-10-15T12:05:35.904Z" }, - { url = "https://files.pythonhosted.org/packages/5a/1a/d78fcfa19c06d5ef610054e159ce2d08a0787af8e2ebdf425ba81284ce71/psygnal-0.15.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:eace624bb6aa7ad42d1c047a2e3a531f68b3bfc63d8b4c3de9dec4cc122bb534", size = 574962, upload-time = "2025-10-15T12:05:37.175Z" }, - { url = "https://files.pythonhosted.org/packages/ff/7b/e9a6fa461ef266c5a23485004934b8f08a2a8ddc447802161ea56d9837dd/psygnal-0.15.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a0172efeb861280bca05673989a4df21624f44344eff20b873d8c9d0edc01350", size = 884958, upload-time = "2025-10-15T12:05:38.789Z" }, - { url = "https://files.pythonhosted.org/packages/cb/a3/1c14461602090ae84120ebd4e47f46990c853e61a71716e69a1ce18c3909/psygnal-0.15.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:c284edb17542dad0114ad2a942799d6526fa72be7d76d078a388469d584d034c", size = 876350, upload-time = "2025-10-15T12:05:40.013Z" }, - { url = "https://files.pythonhosted.org/packages/e3/71/d143b294259a9067cde1a1a5c4025e0a98dff876576a84495e50da7e1316/psygnal-0.15.0-cp313-cp313-win_amd64.whl", hash = "sha256:c60d36d46c992835608030ff3fa918c06c7f22133391d90500585fef726f5d07", size = 417938, upload-time = "2025-10-15T12:05:41.302Z" }, - { url = "https://files.pythonhosted.org/packages/e9/0f/8f6e5339cdfe9c67b8a4250501b9b4ac488c836e56c9a15f65b4a3c7a1a8/psygnal-0.15.0-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:f0125639597d42b8d78fcd61cc306d7ae71a198d8fac83ab64a07742e8bb1ca8", size = 521077, upload-time = "2025-10-15T12:05:42.491Z" }, - { url = "https://files.pythonhosted.org/packages/b6/46/7b93bad30b1df8ca4d5940b8b6ab60913ab26820f53066f37504f328b76b/psygnal-0.15.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:d3e759e84c9396f4b1f30bf4b5efd83c5fd359745a72df44b639aa0e5e94c51d", size = 574562, upload-time = "2025-10-15T12:05:43.717Z" }, - { url = "https://files.pythonhosted.org/packages/67/14/1c3b8bf8e341029856b9c09f3c115eb84dad1bf03e0fb849bee575cff8ed/psygnal-0.15.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:876e2f8b22236c0327e3da75a17e40a550d89efed904c1e9db23acdd4a66504d", size = 888609, upload-time = "2025-10-15T12:05:44.895Z" }, - { url = "https://files.pythonhosted.org/packages/82/48/ff492974866f041debf57148f582c68247bec66cf0e354adef7db808cae3/psygnal-0.15.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:5108268d08ac176ac6f8a0cad2c76883282d75a14663f806fdf207eb53e38014", size = 880256, upload-time = "2025-10-15T12:05:46.377Z" }, - { url = "https://files.pythonhosted.org/packages/1a/88/aafeeaf8543189e77dac5f833fe6fac1d3f37a62932da445ccd9533e6770/psygnal-0.15.0-cp314-cp314-win_amd64.whl", hash = "sha256:6034cacebd252776743450be62f25df323f8cb4ed7b01a46fc4dcf540baa64a6", size = 422151, upload-time = "2025-10-15T12:05:47.972Z" }, - { url = "https://files.pythonhosted.org/packages/4c/68/ad28d0c0a089bcd813fc6355a448acf18c897b4ea02d33276b5f740c2a07/psygnal-0.15.0-py3-none-any.whl", hash = "sha256:023c361c38e8ada87d0704704e1f2b7e799e9771e00b8e174fb409ff9ddeb502", size = 91027, upload-time = "2025-10-15T12:05:49.179Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/5a/20/70430999aa609adb0601ec0f72bd23790a6e51a80ae6e7dc6621e6c5ee2a/psygnal-0.15.0.tar.gz", hash = "sha256:5534f18e2d1536675e181c6f81cf04f4177b25a9e60fdcf724a25ce5cc195765", size = 124470 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/1f/b7/1979a82f27c32e70b165b3f1282bbfbaf81a3e44ea85a4599487511533a7/psygnal-0.15.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:4d83239961c66f0763c26df121d8028eeb1cdebc3ce2d511836b3424dda591f3", size = 512136 }, + { url = "https://files.pythonhosted.org/packages/f1/85/64e1b2cf86e563aca9498842b7a5fb3bbba38ed50d7306278417f687939e/psygnal-0.15.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:219550f78512cd274ee11966033843426a85ee333fbfed73d0f7ce1b153c547c", size = 568105 }, + { url = "https://files.pythonhosted.org/packages/17/44/744374443b6e30f2ede11eb182d698d97c0bd021d59e472a0f0a4ddccf8e/psygnal-0.15.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0c29149a5042d79cb9dfb4d7b6b8c624296681b1533d58b7820c0817ffdd81c4", size = 854314 }, + { url = "https://files.pythonhosted.org/packages/94/56/782a5da7a3e0fa5019b617c47a963202de37dabb73f2e43b67b8d76bac0a/psygnal-0.15.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:d4c9762102df30530044c5a44cc591240ff3b89bd67292e10c0b73cd694c84e9", size = 862143 }, + { url = "https://files.pythonhosted.org/packages/4a/93/ee50e54c5a8693a6954647da7e2c6a3150c4a37f0760c6e87ac6de3037dc/psygnal-0.15.0-cp311-cp311-win_amd64.whl", hash = "sha256:0f50938b3caf07e34ab044c19d4e9280a53ff65492c285ff211285f0a08934c1", size = 414136 }, + { url = "https://files.pythonhosted.org/packages/e9/6d/f3adf8f66bf12651f35aff13dd4a6c88afffa815ef8b2b7fa60a602a6cd7/psygnal-0.15.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:82eb5767f6cba67fa2d034dab9ec94e8eaf465067666dea3e2f832f2c32debc3", size = 522774 }, + { url = "https://files.pythonhosted.org/packages/e6/40/adc69bd677a2683f931614fdd716034ba5bc238752973bad3a1415b2f015/psygnal-0.15.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:5dbcc67b2282eebe2e4e55ff9b50dad6b811d4ab698c573a61a725a6296919ba", size = 576015 }, + { url = "https://files.pythonhosted.org/packages/0c/ce/ad35c19f489c563e6655a6ee9509e1af7ee864ae8fe95f04f851a47e141a/psygnal-0.15.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c0d65e2686c19997eb4495974abc972ca1661504e73b8b58b1fb8466baf0c7ae", size = 888755 }, + { url = "https://files.pythonhosted.org/packages/b6/be/0f680df48bf819025ce4f486443471f541c1559e3ad474311f92fb9a8549/psygnal-0.15.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:ed3ff192cdd14956c2f7a0be4635fa72b2eb2773dfc58a6aa8c14926647041f2", size = 880071 }, + { url = "https://files.pythonhosted.org/packages/f5/2d/c16b2e2a657a908d363ba4b1680cb827f152cb680c24a1add720c8bfde36/psygnal-0.15.0-cp312-cp312-win_amd64.whl", hash = "sha256:0ed1fd5797df111c9f9b43a1dc01ffb7c76e19ddc9b0de969e0b816034345246", size = 417554 }, + { url = "https://files.pythonhosted.org/packages/f9/b0/d4ef27d30e0336e5dd49a145bc5f55ad7e8c2d4403a8cc89827e3dc4e17d/psygnal-0.15.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:eb11ecb42b4ff9e45d661396399029c41fbd1cfdd5dbd5c31a3f6f52c8fc2b90", size = 521990 }, + { url = "https://files.pythonhosted.org/packages/5a/1a/d78fcfa19c06d5ef610054e159ce2d08a0787af8e2ebdf425ba81284ce71/psygnal-0.15.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:eace624bb6aa7ad42d1c047a2e3a531f68b3bfc63d8b4c3de9dec4cc122bb534", size = 574962 }, + { url = "https://files.pythonhosted.org/packages/ff/7b/e9a6fa461ef266c5a23485004934b8f08a2a8ddc447802161ea56d9837dd/psygnal-0.15.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a0172efeb861280bca05673989a4df21624f44344eff20b873d8c9d0edc01350", size = 884958 }, + { url = "https://files.pythonhosted.org/packages/cb/a3/1c14461602090ae84120ebd4e47f46990c853e61a71716e69a1ce18c3909/psygnal-0.15.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:c284edb17542dad0114ad2a942799d6526fa72be7d76d078a388469d584d034c", size = 876350 }, + { url = "https://files.pythonhosted.org/packages/e3/71/d143b294259a9067cde1a1a5c4025e0a98dff876576a84495e50da7e1316/psygnal-0.15.0-cp313-cp313-win_amd64.whl", hash = "sha256:c60d36d46c992835608030ff3fa918c06c7f22133391d90500585fef726f5d07", size = 417938 }, + { url = "https://files.pythonhosted.org/packages/e9/0f/8f6e5339cdfe9c67b8a4250501b9b4ac488c836e56c9a15f65b4a3c7a1a8/psygnal-0.15.0-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:f0125639597d42b8d78fcd61cc306d7ae71a198d8fac83ab64a07742e8bb1ca8", size = 521077 }, + { url = "https://files.pythonhosted.org/packages/b6/46/7b93bad30b1df8ca4d5940b8b6ab60913ab26820f53066f37504f328b76b/psygnal-0.15.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:d3e759e84c9396f4b1f30bf4b5efd83c5fd359745a72df44b639aa0e5e94c51d", size = 574562 }, + { url = "https://files.pythonhosted.org/packages/67/14/1c3b8bf8e341029856b9c09f3c115eb84dad1bf03e0fb849bee575cff8ed/psygnal-0.15.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:876e2f8b22236c0327e3da75a17e40a550d89efed904c1e9db23acdd4a66504d", size = 888609 }, + { url = "https://files.pythonhosted.org/packages/82/48/ff492974866f041debf57148f582c68247bec66cf0e354adef7db808cae3/psygnal-0.15.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:5108268d08ac176ac6f8a0cad2c76883282d75a14663f806fdf207eb53e38014", size = 880256 }, + { url = "https://files.pythonhosted.org/packages/1a/88/aafeeaf8543189e77dac5f833fe6fac1d3f37a62932da445ccd9533e6770/psygnal-0.15.0-cp314-cp314-win_amd64.whl", hash = "sha256:6034cacebd252776743450be62f25df323f8cb4ed7b01a46fc4dcf540baa64a6", size = 422151 }, + { url = "https://files.pythonhosted.org/packages/4c/68/ad28d0c0a089bcd813fc6355a448acf18c897b4ea02d33276b5f740c2a07/psygnal-0.15.0-py3-none-any.whl", hash = "sha256:023c361c38e8ada87d0704704e1f2b7e799e9771e00b8e174fb409ff9ddeb502", size = 91027 }, ] [[package]] name = "ptyprocess" version = "0.7.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/20/e5/16ff212c1e452235a90aeb09066144d0c5a6a8c0834397e03f5224495c4e/ptyprocess-0.7.0.tar.gz", hash = "sha256:5c5d0a3b48ceee0b48485e0c26037c0acd7d29765ca3fbb5cb3831d347423220", size = 70762, upload-time = "2020-12-28T15:15:30.155Z" } +sdist = { url = "https://files.pythonhosted.org/packages/20/e5/16ff212c1e452235a90aeb09066144d0c5a6a8c0834397e03f5224495c4e/ptyprocess-0.7.0.tar.gz", hash = "sha256:5c5d0a3b48ceee0b48485e0c26037c0acd7d29765ca3fbb5cb3831d347423220", size = 70762 } wheels = [ - { url = "https://files.pythonhosted.org/packages/22/a6/858897256d0deac81a172289110f31629fc4cee19b6f01283303e18c8db3/ptyprocess-0.7.0-py2.py3-none-any.whl", hash = "sha256:4b41f3967fce3af57cc7e94b888626c18bf37a083e3651ca8feeb66d492fef35", size = 13993, upload-time = "2020-12-28T15:15:28.35Z" }, + { url = "https://files.pythonhosted.org/packages/22/a6/858897256d0deac81a172289110f31629fc4cee19b6f01283303e18c8db3/ptyprocess-0.7.0-py2.py3-none-any.whl", hash = "sha256:4b41f3967fce3af57cc7e94b888626c18bf37a083e3651ca8feeb66d492fef35", size = 13993 }, ] [[package]] name = "pure-eval" version = "0.2.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/cd/05/0a34433a064256a578f1783a10da6df098ceaa4a57bbeaa96a6c0352786b/pure_eval-0.2.3.tar.gz", hash = "sha256:5f4e983f40564c576c7c8635ae88db5956bb2229d7e9237d03b3c0b0190eaf42", size = 19752, upload-time = "2024-07-21T12:58:21.801Z" } +sdist = { url = "https://files.pythonhosted.org/packages/cd/05/0a34433a064256a578f1783a10da6df098ceaa4a57bbeaa96a6c0352786b/pure_eval-0.2.3.tar.gz", hash = "sha256:5f4e983f40564c576c7c8635ae88db5956bb2229d7e9237d03b3c0b0190eaf42", size = 19752 } wheels = [ - { url = "https://files.pythonhosted.org/packages/8e/37/efad0257dc6e593a18957422533ff0f87ede7c9c6ea010a2177d738fb82f/pure_eval-0.2.3-py3-none-any.whl", hash = "sha256:1db8e35b67b3d218d818ae653e27f06c3aa420901fa7b081ca98cbedc874e0d0", size = 11842, upload-time = "2024-07-21T12:58:20.04Z" }, + { url = "https://files.pythonhosted.org/packages/8e/37/efad0257dc6e593a18957422533ff0f87ede7c9c6ea010a2177d738fb82f/pure_eval-0.2.3-py3-none-any.whl", hash = "sha256:1db8e35b67b3d218d818ae653e27f06c3aa420901fa7b081ca98cbedc874e0d0", size = 11842 }, ] [[package]] name = "py-cpuinfo" version = "9.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/37/a8/d832f7293ebb21690860d2e01d8115e5ff6f2ae8bbdc953f0eb0fa4bd2c7/py-cpuinfo-9.0.0.tar.gz", hash = "sha256:3cdbbf3fac90dc6f118bfd64384f309edeadd902d7c8fb17f02ffa1fc3f49690", size = 104716, upload-time = "2022-10-25T20:38:06.303Z" } +sdist = { url = "https://files.pythonhosted.org/packages/37/a8/d832f7293ebb21690860d2e01d8115e5ff6f2ae8bbdc953f0eb0fa4bd2c7/py-cpuinfo-9.0.0.tar.gz", hash = "sha256:3cdbbf3fac90dc6f118bfd64384f309edeadd902d7c8fb17f02ffa1fc3f49690", size = 104716 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e0/a9/023730ba63db1e494a271cb018dcd361bd2c917ba7004c3e49d5daf795a2/py_cpuinfo-9.0.0-py3-none-any.whl", hash = "sha256:859625bc251f64e21f077d099d4162689c762b5d6a4c3c97553d56241c9674d5", size = 22335, upload-time = "2022-10-25T20:38:27.636Z" }, + { url = "https://files.pythonhosted.org/packages/e0/a9/023730ba63db1e494a271cb018dcd361bd2c917ba7004c3e49d5daf795a2/py_cpuinfo-9.0.0-py3-none-any.whl", hash = "sha256:859625bc251f64e21f077d099d4162689c762b5d6a4c3c97553d56241c9674d5", size = 22335 }, ] [[package]] name = "py-spy" version = "0.4.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/19/e2/ff811a367028b87e86714945bb9ecb5c1cc69114a8039a67b3a862cef921/py_spy-0.4.1.tar.gz", hash = "sha256:e53aa53daa2e47c2eef97dd2455b47bb3a7e7f962796a86cc3e7dbde8e6f4db4", size = 244726, upload-time = "2025-07-31T19:33:25.172Z" } +sdist = { url = "https://files.pythonhosted.org/packages/19/e2/ff811a367028b87e86714945bb9ecb5c1cc69114a8039a67b3a862cef921/py_spy-0.4.1.tar.gz", hash = "sha256:e53aa53daa2e47c2eef97dd2455b47bb3a7e7f962796a86cc3e7dbde8e6f4db4", size = 244726 } wheels = [ - { url = "https://files.pythonhosted.org/packages/14/e3/3a32500d845bdd94f6a2b4ed6244982f42ec2bc64602ea8fcfe900678ae7/py_spy-0.4.1-py2.py3-none-macosx_10_12_x86_64.macosx_11_0_arm64.macosx_10_12_universal2.whl", hash = "sha256:809094208c6256c8f4ccadd31e9a513fe2429253f48e20066879239ba12cd8cc", size = 3682508, upload-time = "2025-07-31T19:33:13.753Z" }, - { url = "https://files.pythonhosted.org/packages/4f/bf/e4d280e9e0bec71d39fc646654097027d4bbe8e04af18fb68e49afcff404/py_spy-0.4.1-py2.py3-none-macosx_11_0_arm64.whl", hash = "sha256:1fb8bf71ab8df95a95cc387deed6552934c50feef2cf6456bc06692a5508fd0c", size = 1796395, upload-time = "2025-07-31T19:33:15.325Z" }, - { url = "https://files.pythonhosted.org/packages/df/79/9ed50bb0a9de63ed023aa2db8b6265b04a7760d98c61eb54def6a5fddb68/py_spy-0.4.1-py2.py3-none-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ee776b9d512a011d1ad3907ed53ae32ce2f3d9ff3e1782236554e22103b5c084", size = 2034938, upload-time = "2025-07-31T19:33:17.194Z" }, - { url = "https://files.pythonhosted.org/packages/53/a5/36862e3eea59f729dfb70ee6f9e14b051d8ddce1aa7e70e0b81d9fe18536/py_spy-0.4.1-py2.py3-none-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:532d3525538254d1859b49de1fbe9744df6b8865657c9f0e444bf36ce3f19226", size = 2658968, upload-time = "2025-07-31T19:33:18.916Z" }, - { url = "https://files.pythonhosted.org/packages/08/f8/9ea0b586b065a623f591e5e7961282ec944b5fbbdca33186c7c0296645b3/py_spy-0.4.1-py2.py3-none-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:4972c21890b6814017e39ac233c22572c4a61fd874524ebc5ccab0f2237aee0a", size = 2147541, upload-time = "2025-07-31T19:33:20.565Z" }, - { url = "https://files.pythonhosted.org/packages/68/fb/bc7f639aed026bca6e7beb1e33f6951e16b7d315594e7635a4f7d21d63f4/py_spy-0.4.1-py2.py3-none-manylinux_2_5_x86_64.manylinux1_x86_64.whl", hash = "sha256:6a80ec05eb8a6883863a367c6a4d4f2d57de68466f7956b6367d4edd5c61bb29", size = 2763338, upload-time = "2025-07-31T19:33:22.202Z" }, - { url = "https://files.pythonhosted.org/packages/e1/da/fcc9a9fcd4ca946ff402cff20348e838b051d69f50f5d1f5dca4cd3c5eb8/py_spy-0.4.1-py2.py3-none-win_amd64.whl", hash = "sha256:d92e522bd40e9bf7d87c204033ce5bb5c828fca45fa28d970f58d71128069fdc", size = 1818784, upload-time = "2025-07-31T19:33:23.802Z" }, + { url = "https://files.pythonhosted.org/packages/14/e3/3a32500d845bdd94f6a2b4ed6244982f42ec2bc64602ea8fcfe900678ae7/py_spy-0.4.1-py2.py3-none-macosx_10_12_x86_64.macosx_11_0_arm64.macosx_10_12_universal2.whl", hash = "sha256:809094208c6256c8f4ccadd31e9a513fe2429253f48e20066879239ba12cd8cc", size = 3682508 }, + { url = "https://files.pythonhosted.org/packages/4f/bf/e4d280e9e0bec71d39fc646654097027d4bbe8e04af18fb68e49afcff404/py_spy-0.4.1-py2.py3-none-macosx_11_0_arm64.whl", hash = "sha256:1fb8bf71ab8df95a95cc387deed6552934c50feef2cf6456bc06692a5508fd0c", size = 1796395 }, + { url = "https://files.pythonhosted.org/packages/df/79/9ed50bb0a9de63ed023aa2db8b6265b04a7760d98c61eb54def6a5fddb68/py_spy-0.4.1-py2.py3-none-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ee776b9d512a011d1ad3907ed53ae32ce2f3d9ff3e1782236554e22103b5c084", size = 2034938 }, + { url = "https://files.pythonhosted.org/packages/53/a5/36862e3eea59f729dfb70ee6f9e14b051d8ddce1aa7e70e0b81d9fe18536/py_spy-0.4.1-py2.py3-none-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:532d3525538254d1859b49de1fbe9744df6b8865657c9f0e444bf36ce3f19226", size = 2658968 }, + { url = "https://files.pythonhosted.org/packages/08/f8/9ea0b586b065a623f591e5e7961282ec944b5fbbdca33186c7c0296645b3/py_spy-0.4.1-py2.py3-none-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:4972c21890b6814017e39ac233c22572c4a61fd874524ebc5ccab0f2237aee0a", size = 2147541 }, + { url = "https://files.pythonhosted.org/packages/68/fb/bc7f639aed026bca6e7beb1e33f6951e16b7d315594e7635a4f7d21d63f4/py_spy-0.4.1-py2.py3-none-manylinux_2_5_x86_64.manylinux1_x86_64.whl", hash = "sha256:6a80ec05eb8a6883863a367c6a4d4f2d57de68466f7956b6367d4edd5c61bb29", size = 2763338 }, + { url = "https://files.pythonhosted.org/packages/e1/da/fcc9a9fcd4ca946ff402cff20348e838b051d69f50f5d1f5dca4cd3c5eb8/py_spy-0.4.1-py2.py3-none-win_amd64.whl", hash = "sha256:d92e522bd40e9bf7d87c204033ce5bb5c828fca45fa28d970f58d71128069fdc", size = 1818784 }, ] [[package]] name = "pycparser" version = "2.23" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/fe/cf/d2d3b9f5699fb1e4615c8e32ff220203e43b248e1dfcc6736ad9057731ca/pycparser-2.23.tar.gz", hash = "sha256:78816d4f24add8f10a06d6f05b4d424ad9e96cfebf68a4ddc99c65c0720d00c2", size = 173734, upload-time = "2025-09-09T13:23:47.91Z" } +sdist = { url = "https://files.pythonhosted.org/packages/fe/cf/d2d3b9f5699fb1e4615c8e32ff220203e43b248e1dfcc6736ad9057731ca/pycparser-2.23.tar.gz", hash = "sha256:78816d4f24add8f10a06d6f05b4d424ad9e96cfebf68a4ddc99c65c0720d00c2", size = 173734 } wheels = [ - { url = "https://files.pythonhosted.org/packages/a0/e3/59cd50310fc9b59512193629e1984c1f95e5c8ae6e5d8c69532ccc65a7fe/pycparser-2.23-py3-none-any.whl", hash = "sha256:e5c6e8d3fbad53479cab09ac03729e0a9faf2bee3db8208a550daf5af81a5934", size = 118140, upload-time = "2025-09-09T13:23:46.651Z" }, + { url = "https://files.pythonhosted.org/packages/a0/e3/59cd50310fc9b59512193629e1984c1f95e5c8ae6e5d8c69532ccc65a7fe/pycparser-2.23-py3-none-any.whl", hash = "sha256:e5c6e8d3fbad53479cab09ac03729e0a9faf2bee3db8208a550daf5af81a5934", size = 118140 }, ] [[package]] @@ -2455,27 +2474,27 @@ dependencies = [ { name = "sphinx" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/00/20/bb50f9de3a6de69e6abd6b087b52fa2418a0418b19597601605f855ad044/pydata_sphinx_theme-0.16.1.tar.gz", hash = "sha256:a08b7f0b7f70387219dc659bff0893a7554d5eb39b59d3b8ef37b8401b7642d7", size = 2412693, upload-time = "2024-12-17T10:53:39.537Z" } +sdist = { url = "https://files.pythonhosted.org/packages/00/20/bb50f9de3a6de69e6abd6b087b52fa2418a0418b19597601605f855ad044/pydata_sphinx_theme-0.16.1.tar.gz", hash = "sha256:a08b7f0b7f70387219dc659bff0893a7554d5eb39b59d3b8ef37b8401b7642d7", size = 2412693 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e2/0d/8ba33fa83a7dcde13eb3c1c2a0c1cc29950a048bfed6d9b0d8b6bd710b4c/pydata_sphinx_theme-0.16.1-py3-none-any.whl", hash = "sha256:225331e8ac4b32682c18fcac5a57a6f717c4e632cea5dd0e247b55155faeccde", size = 6723264, upload-time = "2024-12-17T10:53:35.645Z" }, + { url = "https://files.pythonhosted.org/packages/e2/0d/8ba33fa83a7dcde13eb3c1c2a0c1cc29950a048bfed6d9b0d8b6bd710b4c/pydata_sphinx_theme-0.16.1-py3-none-any.whl", hash = "sha256:225331e8ac4b32682c18fcac5a57a6f717c4e632cea5dd0e247b55155faeccde", size = 6723264 }, ] [[package]] name = "pygments" version = "2.19.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/b0/77/a5b8c569bf593b0140bde72ea885a803b82086995367bf2037de0159d924/pygments-2.19.2.tar.gz", hash = "sha256:636cb2477cec7f8952536970bc533bc43743542f70392ae026374600add5b887", size = 4968631, upload-time = "2025-06-21T13:39:12.283Z" } +sdist = { url = "https://files.pythonhosted.org/packages/b0/77/a5b8c569bf593b0140bde72ea885a803b82086995367bf2037de0159d924/pygments-2.19.2.tar.gz", hash = "sha256:636cb2477cec7f8952536970bc533bc43743542f70392ae026374600add5b887", size = 4968631 } wheels = [ - { url = "https://files.pythonhosted.org/packages/c7/21/705964c7812476f378728bdf590ca4b771ec72385c533964653c68e86bdc/pygments-2.19.2-py3-none-any.whl", hash = "sha256:86540386c03d588bb81d44bc3928634ff26449851e99741617ecb9037ee5ec0b", size = 1225217, upload-time = "2025-06-21T13:39:07.939Z" }, + { url = "https://files.pythonhosted.org/packages/c7/21/705964c7812476f378728bdf590ca4b771ec72385c533964653c68e86bdc/pygments-2.19.2-py3-none-any.whl", hash = "sha256:86540386c03d588bb81d44bc3928634ff26449851e99741617ecb9037ee5ec0b", size = 1225217 }, ] [[package]] name = "pyparsing" version = "3.2.5" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f2/a5/181488fc2b9d093e3972d2a472855aae8a03f000592dbfce716a512b3359/pyparsing-3.2.5.tar.gz", hash = "sha256:2df8d5b7b2802ef88e8d016a2eb9c7aeaa923529cd251ed0fe4608275d4105b6", size = 1099274, upload-time = "2025-09-21T04:11:06.277Z" } +sdist = { url = "https://files.pythonhosted.org/packages/f2/a5/181488fc2b9d093e3972d2a472855aae8a03f000592dbfce716a512b3359/pyparsing-3.2.5.tar.gz", hash = "sha256:2df8d5b7b2802ef88e8d016a2eb9c7aeaa923529cd251ed0fe4608275d4105b6", size = 1099274 } wheels = [ - { url = "https://files.pythonhosted.org/packages/10/5e/1aa9a93198c6b64513c9d7752de7422c06402de6600a8767da1524f9570b/pyparsing-3.2.5-py3-none-any.whl", hash = "sha256:e38a4f02064cf41fe6593d328d0512495ad1f3d8a91c4f73fc401b3079a59a5e", size = 113890, upload-time = "2025-09-21T04:11:04.117Z" }, + { url = "https://files.pythonhosted.org/packages/10/5e/1aa9a93198c6b64513c9d7752de7422c06402de6600a8767da1524f9570b/pyparsing-3.2.5-py3-none-any.whl", hash = "sha256:e38a4f02064cf41fe6593d328d0512495ad1f3d8a91c4f73fc401b3079a59a5e", size = 113890 }, ] [[package]] @@ -2489,9 +2508,9 @@ dependencies = [ { name = "pluggy" }, { name = "pygments" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/a3/5c/00a0e072241553e1a7496d638deababa67c5058571567b92a7eaa258397c/pytest-8.4.2.tar.gz", hash = "sha256:86c0d0b93306b961d58d62a4db4879f27fe25513d4b969df351abdddb3c30e01", size = 1519618, upload-time = "2025-09-04T14:34:22.711Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a3/5c/00a0e072241553e1a7496d638deababa67c5058571567b92a7eaa258397c/pytest-8.4.2.tar.gz", hash = "sha256:86c0d0b93306b961d58d62a4db4879f27fe25513d4b969df351abdddb3c30e01", size = 1519618 } wheels = [ - { url = "https://files.pythonhosted.org/packages/a8/a4/20da314d277121d6534b3a980b29035dcd51e6744bd79075a6ce8fa4eb8d/pytest-8.4.2-py3-none-any.whl", hash = "sha256:872f880de3fc3a5bdc88a11b39c9710c3497a547cfa9320bc3c5e62fbf272e79", size = 365750, upload-time = "2025-09-04T14:34:20.226Z" }, + { url = "https://files.pythonhosted.org/packages/a8/a4/20da314d277121d6534b3a980b29035dcd51e6744bd79075a6ce8fa4eb8d/pytest-8.4.2-py3-none-any.whl", hash = "sha256:872f880de3fc3a5bdc88a11b39c9710c3497a547cfa9320bc3c5e62fbf272e79", size = 365750 }, ] [[package]] @@ -2502,9 +2521,9 @@ dependencies = [ { name = "py-cpuinfo" }, { name = "pytest" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/91/84/84ba011c4b2a44c8fce772be6124821a27cecd0f69b324f24ef4c1172863/pytest_benchmark-5.2.0.tar.gz", hash = "sha256:75731991edf6c807d0699130afbb4ba77d8ce8e3b8314662c340ee8e1db19f43", size = 339143, upload-time = "2025-10-30T18:11:02.264Z" } +sdist = { url = "https://files.pythonhosted.org/packages/91/84/84ba011c4b2a44c8fce772be6124821a27cecd0f69b324f24ef4c1172863/pytest_benchmark-5.2.0.tar.gz", hash = "sha256:75731991edf6c807d0699130afbb4ba77d8ce8e3b8314662c340ee8e1db19f43", size = 339143 } wheels = [ - { url = "https://files.pythonhosted.org/packages/b7/c2/57de9aa286a2f6d00c52a7bb4b16dbbfa2a6c80b4a4f0e415c874269a4a6/pytest_benchmark-5.2.0-py3-none-any.whl", hash = "sha256:0631cdf19f6032fc46d6bf9e8d15931d78473228b579a3fd84ca5e2f0e8ee06c", size = 44194, upload-time = "2025-10-30T18:11:00.311Z" }, + { url = "https://files.pythonhosted.org/packages/b7/c2/57de9aa286a2f6d00c52a7bb4b16dbbfa2a6c80b4a4f0e415c874269a4a6/pytest_benchmark-5.2.0-py3-none-any.whl", hash = "sha256:0631cdf19f6032fc46d6bf9e8d15931d78473228b579a3fd84ca5e2f0e8ee06c", size = 44194 }, ] [[package]] @@ -2516,19 +2535,19 @@ dependencies = [ { name = "pytest" }, { name = "rich" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/e2/e8/27fcbe6516a1c956614a4b61a7fccbf3791ea0b992e07416e8948184327d/pytest_codspeed-4.2.0.tar.gz", hash = "sha256:04b5d0bc5a1851ba1504d46bf9d7dbb355222a69f2cd440d54295db721b331f7", size = 113263, upload-time = "2025-10-24T09:02:55.704Z" } +sdist = { url = "https://files.pythonhosted.org/packages/e2/e8/27fcbe6516a1c956614a4b61a7fccbf3791ea0b992e07416e8948184327d/pytest_codspeed-4.2.0.tar.gz", hash = "sha256:04b5d0bc5a1851ba1504d46bf9d7dbb355222a69f2cd440d54295db721b331f7", size = 113263 } wheels = [ - { url = "https://files.pythonhosted.org/packages/b9/2d/f0083a2f14ecf008d961d40439a71da0ae0d568e5f8dc2fccd3e8a2ab3e4/pytest_codspeed-4.2.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2de87bde9fbc6fd53f0fd21dcf2599c89e0b8948d49f9bad224edce51c47e26b", size = 261960, upload-time = "2025-10-24T09:02:40.665Z" }, - { url = "https://files.pythonhosted.org/packages/5f/0c/1f514c553db4ea5a69dfbe2706734129acd0eca8d5101ec16f1dd00dbc0f/pytest_codspeed-4.2.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:95aeb2479ca383f6b18e2cc9ebcd3b03ab184980a59a232aea6f370bbf59a1e3", size = 250808, upload-time = "2025-10-24T09:02:42.07Z" }, - { url = "https://files.pythonhosted.org/packages/81/04/479905bd6653bc981c0554fcce6df52d7ae1594e1eefd53e6cf31810ec7f/pytest_codspeed-4.2.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7d4fefbd4ae401e2c60f6be920a0be50eef0c3e4a1f0a1c83962efd45be38b39", size = 262084, upload-time = "2025-10-24T09:02:43.155Z" }, - { url = "https://files.pythonhosted.org/packages/d2/46/d6f345d7907bac6cbb6224bd697ecbc11cf7427acc9e843c3618f19e3476/pytest_codspeed-4.2.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:309b4227f57fcbb9df21e889ea1ae191d0d1cd8b903b698fdb9ea0461dbf1dfe", size = 251100, upload-time = "2025-10-24T09:02:44.168Z" }, - { url = "https://files.pythonhosted.org/packages/de/dc/e864f45e994a50390ff49792256f1bdcbf42f170e3bc0470ee1a7d2403f3/pytest_codspeed-4.2.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:72aab8278452a6d020798b9e4f82780966adb00f80d27a25d1274272c54630d5", size = 262057, upload-time = "2025-10-24T09:02:45.791Z" }, - { url = "https://files.pythonhosted.org/packages/1d/1c/f1d2599784486879cf6579d8d94a3e22108f0e1f130033dab8feefd29249/pytest_codspeed-4.2.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:684fcd9491d810ded653a8d38de4835daa2d001645f4a23942862950664273f8", size = 251013, upload-time = "2025-10-24T09:02:46.937Z" }, - { url = "https://files.pythonhosted.org/packages/0c/fd/eafd24db5652a94b4d00fe9b309b607de81add0f55f073afb68a378a24b6/pytest_codspeed-4.2.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:50794dabea6ec90d4288904452051e2febace93e7edf4ca9f2bce8019dd8cd37", size = 262065, upload-time = "2025-10-24T09:02:48.018Z" }, - { url = "https://files.pythonhosted.org/packages/f9/14/8d9340d7dc0ae647991b28a396e16b3403e10def883cde90d6b663d3f7ec/pytest_codspeed-4.2.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a0ebd87f2a99467a1cfd8e83492c4712976e43d353ee0b5f71cbb057f1393aca", size = 251057, upload-time = "2025-10-24T09:02:49.102Z" }, - { url = "https://files.pythonhosted.org/packages/4b/39/48cf6afbca55bc7c8c93c3d4ae926a1068bcce3f0241709db19b078d5418/pytest_codspeed-4.2.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:dbbb2d61b85bef8fc7e2193f723f9ac2db388a48259d981bbce96319043e9830", size = 267983, upload-time = "2025-10-24T09:02:50.558Z" }, - { url = "https://files.pythonhosted.org/packages/33/86/4407341efb5dceb3e389635749ce1d670542d6ca148bd34f9d5334295faf/pytest_codspeed-4.2.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:748411c832147bfc85f805af78a1ab1684f52d08e14aabe22932bbe46c079a5f", size = 256732, upload-time = "2025-10-24T09:02:51.603Z" }, - { url = "https://files.pythonhosted.org/packages/25/0e/8cb71fd3ed4ed08c07aec1245aea7bc1b661ba55fd9c392db76f1978d453/pytest_codspeed-4.2.0-py3-none-any.whl", hash = "sha256:e81bbb45c130874ef99aca97929d72682733527a49f84239ba575b5cb843bab0", size = 113726, upload-time = "2025-10-24T09:02:54.785Z" }, + { url = "https://files.pythonhosted.org/packages/b9/2d/f0083a2f14ecf008d961d40439a71da0ae0d568e5f8dc2fccd3e8a2ab3e4/pytest_codspeed-4.2.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2de87bde9fbc6fd53f0fd21dcf2599c89e0b8948d49f9bad224edce51c47e26b", size = 261960 }, + { url = "https://files.pythonhosted.org/packages/5f/0c/1f514c553db4ea5a69dfbe2706734129acd0eca8d5101ec16f1dd00dbc0f/pytest_codspeed-4.2.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:95aeb2479ca383f6b18e2cc9ebcd3b03ab184980a59a232aea6f370bbf59a1e3", size = 250808 }, + { url = "https://files.pythonhosted.org/packages/81/04/479905bd6653bc981c0554fcce6df52d7ae1594e1eefd53e6cf31810ec7f/pytest_codspeed-4.2.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7d4fefbd4ae401e2c60f6be920a0be50eef0c3e4a1f0a1c83962efd45be38b39", size = 262084 }, + { url = "https://files.pythonhosted.org/packages/d2/46/d6f345d7907bac6cbb6224bd697ecbc11cf7427acc9e843c3618f19e3476/pytest_codspeed-4.2.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:309b4227f57fcbb9df21e889ea1ae191d0d1cd8b903b698fdb9ea0461dbf1dfe", size = 251100 }, + { url = "https://files.pythonhosted.org/packages/de/dc/e864f45e994a50390ff49792256f1bdcbf42f170e3bc0470ee1a7d2403f3/pytest_codspeed-4.2.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:72aab8278452a6d020798b9e4f82780966adb00f80d27a25d1274272c54630d5", size = 262057 }, + { url = "https://files.pythonhosted.org/packages/1d/1c/f1d2599784486879cf6579d8d94a3e22108f0e1f130033dab8feefd29249/pytest_codspeed-4.2.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:684fcd9491d810ded653a8d38de4835daa2d001645f4a23942862950664273f8", size = 251013 }, + { url = "https://files.pythonhosted.org/packages/0c/fd/eafd24db5652a94b4d00fe9b309b607de81add0f55f073afb68a378a24b6/pytest_codspeed-4.2.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:50794dabea6ec90d4288904452051e2febace93e7edf4ca9f2bce8019dd8cd37", size = 262065 }, + { url = "https://files.pythonhosted.org/packages/f9/14/8d9340d7dc0ae647991b28a396e16b3403e10def883cde90d6b663d3f7ec/pytest_codspeed-4.2.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a0ebd87f2a99467a1cfd8e83492c4712976e43d353ee0b5f71cbb057f1393aca", size = 251057 }, + { url = "https://files.pythonhosted.org/packages/4b/39/48cf6afbca55bc7c8c93c3d4ae926a1068bcce3f0241709db19b078d5418/pytest_codspeed-4.2.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:dbbb2d61b85bef8fc7e2193f723f9ac2db388a48259d981bbce96319043e9830", size = 267983 }, + { url = "https://files.pythonhosted.org/packages/33/86/4407341efb5dceb3e389635749ce1d670542d6ca148bd34f9d5334295faf/pytest_codspeed-4.2.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:748411c832147bfc85f805af78a1ab1684f52d08e14aabe22932bbe46c079a5f", size = 256732 }, + { url = "https://files.pythonhosted.org/packages/25/0e/8cb71fd3ed4ed08c07aec1245aea7bc1b661ba55fd9c392db76f1978d453/pytest_codspeed-4.2.0-py3-none-any.whl", hash = "sha256:e81bbb45c130874ef99aca97929d72682733527a49f84239ba575b5cb843bab0", size = 113726 }, ] [[package]] @@ -2539,9 +2558,9 @@ dependencies = [ { name = "execnet" }, { name = "pytest" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/78/b4/439b179d1ff526791eb921115fca8e44e596a13efeda518b9d845a619450/pytest_xdist-3.8.0.tar.gz", hash = "sha256:7e578125ec9bc6050861aa93f2d59f1d8d085595d6551c2c90b6f4fad8d3a9f1", size = 88069, upload-time = "2025-07-01T13:30:59.346Z" } +sdist = { url = "https://files.pythonhosted.org/packages/78/b4/439b179d1ff526791eb921115fca8e44e596a13efeda518b9d845a619450/pytest_xdist-3.8.0.tar.gz", hash = "sha256:7e578125ec9bc6050861aa93f2d59f1d8d085595d6551c2c90b6f4fad8d3a9f1", size = 88069 } wheels = [ - { url = "https://files.pythonhosted.org/packages/ca/31/d4e37e9e550c2b92a9cbc2e4d0b7420a27224968580b5a447f420847c975/pytest_xdist-3.8.0-py3-none-any.whl", hash = "sha256:202ca578cfeb7370784a8c33d6d05bc6e13b4f25b5053c30a152269fd10f0b88", size = 46396, upload-time = "2025-07-01T13:30:56.632Z" }, + { url = "https://files.pythonhosted.org/packages/ca/31/d4e37e9e550c2b92a9cbc2e4d0b7420a27224968580b5a447f420847c975/pytest_xdist-3.8.0-py3-none-any.whl", hash = "sha256:202ca578cfeb7370784a8c33d6d05bc6e13b4f25b5053c30a152269fd10f0b88", size = 46396 }, ] [[package]] @@ -2551,105 +2570,105 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "six" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/66/c0/0c8b6ad9f17a802ee498c46e004a0eb49bc148f2fd230864601a86dcf6db/python-dateutil-2.9.0.post0.tar.gz", hash = "sha256:37dd54208da7e1cd875388217d5e00ebd4179249f90fb72437e91a35459a0ad3", size = 342432, upload-time = "2024-03-01T18:36:20.211Z" } +sdist = { url = "https://files.pythonhosted.org/packages/66/c0/0c8b6ad9f17a802ee498c46e004a0eb49bc148f2fd230864601a86dcf6db/python-dateutil-2.9.0.post0.tar.gz", hash = "sha256:37dd54208da7e1cd875388217d5e00ebd4179249f90fb72437e91a35459a0ad3", size = 342432 } wheels = [ - { url = "https://files.pythonhosted.org/packages/ec/57/56b9bcc3c9c6a792fcbaf139543cee77261f3651ca9da0c93f5c1221264b/python_dateutil-2.9.0.post0-py2.py3-none-any.whl", hash = "sha256:a8b2bc7bffae282281c8140a97d3aa9c14da0b136dfe83f850eea9a5f7470427", size = 229892, upload-time = "2024-03-01T18:36:18.57Z" }, + { url = "https://files.pythonhosted.org/packages/ec/57/56b9bcc3c9c6a792fcbaf139543cee77261f3651ca9da0c93f5c1221264b/python_dateutil-2.9.0.post0-py2.py3-none-any.whl", hash = "sha256:a8b2bc7bffae282281c8140a97d3aa9c14da0b136dfe83f850eea9a5f7470427", size = 229892 }, ] [[package]] name = "python-json-logger" version = "4.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/29/bf/eca6a3d43db1dae7070f70e160ab20b807627ba953663ba07928cdd3dc58/python_json_logger-4.0.0.tar.gz", hash = "sha256:f58e68eb46e1faed27e0f574a55a0455eecd7b8a5b88b85a784519ba3cff047f", size = 17683, upload-time = "2025-10-06T04:15:18.984Z" } +sdist = { url = "https://files.pythonhosted.org/packages/29/bf/eca6a3d43db1dae7070f70e160ab20b807627ba953663ba07928cdd3dc58/python_json_logger-4.0.0.tar.gz", hash = "sha256:f58e68eb46e1faed27e0f574a55a0455eecd7b8a5b88b85a784519ba3cff047f", size = 17683 } wheels = [ - { url = "https://files.pythonhosted.org/packages/51/e5/fecf13f06e5e5f67e8837d777d1bc43fac0ed2b77a676804df5c34744727/python_json_logger-4.0.0-py3-none-any.whl", hash = "sha256:af09c9daf6a813aa4cc7180395f50f2a9e5fa056034c9953aec92e381c5ba1e2", size = 15548, upload-time = "2025-10-06T04:15:17.553Z" }, + { url = "https://files.pythonhosted.org/packages/51/e5/fecf13f06e5e5f67e8837d777d1bc43fac0ed2b77a676804df5c34744727/python_json_logger-4.0.0-py3-none-any.whl", hash = "sha256:af09c9daf6a813aa4cc7180395f50f2a9e5fa056034c9953aec92e381c5ba1e2", size = 15548 }, ] [[package]] name = "pytokens" version = "0.2.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/d4/c2/dbadcdddb412a267585459142bfd7cc241e6276db69339353ae6e241ab2b/pytokens-0.2.0.tar.gz", hash = "sha256:532d6421364e5869ea57a9523bf385f02586d4662acbcc0342afd69511b4dd43", size = 15368, upload-time = "2025-10-15T08:02:42.738Z" } +sdist = { url = "https://files.pythonhosted.org/packages/d4/c2/dbadcdddb412a267585459142bfd7cc241e6276db69339353ae6e241ab2b/pytokens-0.2.0.tar.gz", hash = "sha256:532d6421364e5869ea57a9523bf385f02586d4662acbcc0342afd69511b4dd43", size = 15368 } wheels = [ - { url = "https://files.pythonhosted.org/packages/89/5a/c269ea6b348b6f2c32686635df89f32dbe05df1088dd4579302a6f8f99af/pytokens-0.2.0-py3-none-any.whl", hash = "sha256:74d4b318c67f4295c13782ddd9abcb7e297ec5630ad060eb90abf7ebbefe59f8", size = 12038, upload-time = "2025-10-15T08:02:41.694Z" }, + { url = "https://files.pythonhosted.org/packages/89/5a/c269ea6b348b6f2c32686635df89f32dbe05df1088dd4579302a6f8f99af/pytokens-0.2.0-py3-none-any.whl", hash = "sha256:74d4b318c67f4295c13782ddd9abcb7e297ec5630ad060eb90abf7ebbefe59f8", size = 12038 }, ] [[package]] name = "pytz" version = "2025.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f8/bf/abbd3cdfb8fbc7fb3d4d38d320f2441b1e7cbe29be4f23797b4a2b5d8aac/pytz-2025.2.tar.gz", hash = "sha256:360b9e3dbb49a209c21ad61809c7fb453643e048b38924c765813546746e81c3", size = 320884, upload-time = "2025-03-25T02:25:00.538Z" } +sdist = { url = "https://files.pythonhosted.org/packages/f8/bf/abbd3cdfb8fbc7fb3d4d38d320f2441b1e7cbe29be4f23797b4a2b5d8aac/pytz-2025.2.tar.gz", hash = "sha256:360b9e3dbb49a209c21ad61809c7fb453643e048b38924c765813546746e81c3", size = 320884 } wheels = [ - { url = "https://files.pythonhosted.org/packages/81/c4/34e93fe5f5429d7570ec1fa436f1986fb1f00c3e0f43a589fe2bbcd22c3f/pytz-2025.2-py2.py3-none-any.whl", hash = "sha256:5ddf76296dd8c44c26eb8f4b6f35488f3ccbf6fbbd7adee0b7262d43f0ec2f00", size = 509225, upload-time = "2025-03-25T02:24:58.468Z" }, + { url = "https://files.pythonhosted.org/packages/81/c4/34e93fe5f5429d7570ec1fa436f1986fb1f00c3e0f43a589fe2bbcd22c3f/pytz-2025.2-py2.py3-none-any.whl", hash = "sha256:5ddf76296dd8c44c26eb8f4b6f35488f3ccbf6fbbd7adee0b7262d43f0ec2f00", size = 509225 }, ] [[package]] name = "pywinpty" version = "3.0.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f3/bb/a7cc2967c5c4eceb6cc49cfe39447d4bfc56e6c865e7c2249b6eb978935f/pywinpty-3.0.2.tar.gz", hash = "sha256:1505cc4cb248af42cb6285a65c9c2086ee9e7e574078ee60933d5d7fa86fb004", size = 30669, upload-time = "2025-10-03T21:16:29.205Z" } +sdist = { url = "https://files.pythonhosted.org/packages/f3/bb/a7cc2967c5c4eceb6cc49cfe39447d4bfc56e6c865e7c2249b6eb978935f/pywinpty-3.0.2.tar.gz", hash = "sha256:1505cc4cb248af42cb6285a65c9c2086ee9e7e574078ee60933d5d7fa86fb004", size = 30669 } wheels = [ - { url = "https://files.pythonhosted.org/packages/a6/a1/409c1651c9f874d598c10f51ff586c416625601df4bca315d08baec4c3e3/pywinpty-3.0.2-cp311-cp311-win_amd64.whl", hash = "sha256:327790d70e4c841ebd9d0f295a780177149aeb405bca44c7115a3de5c2054b23", size = 2050304, upload-time = "2025-10-03T21:19:29.466Z" }, - { url = "https://files.pythonhosted.org/packages/02/4e/1098484e042c9485f56f16eb2b69b43b874bd526044ee401512234cf9e04/pywinpty-3.0.2-cp312-cp312-win_amd64.whl", hash = "sha256:99fdd9b455f0ad6419aba6731a7a0d2f88ced83c3c94a80ff9533d95fa8d8a9e", size = 2050391, upload-time = "2025-10-03T21:19:01.642Z" }, - { url = "https://files.pythonhosted.org/packages/fc/19/b757fe28008236a4a713e813283721b8a40aa60cd7d3f83549f2e25a3155/pywinpty-3.0.2-cp313-cp313-win_amd64.whl", hash = "sha256:18f78b81e4cfee6aabe7ea8688441d30247b73e52cd9657138015c5f4ee13a51", size = 2050057, upload-time = "2025-10-03T21:19:26.732Z" }, - { url = "https://files.pythonhosted.org/packages/cb/44/cbae12ecf6f4fa4129c36871fd09c6bef4f98d5f625ecefb5e2449765508/pywinpty-3.0.2-cp313-cp313t-win_amd64.whl", hash = "sha256:663383ecfab7fc382cc97ea5c4f7f0bb32c2f889259855df6ea34e5df42d305b", size = 2049874, upload-time = "2025-10-03T21:18:53.923Z" }, - { url = "https://files.pythonhosted.org/packages/ca/15/f12c6055e2d7a617d4d5820e8ac4ceaff849da4cb124640ef5116a230771/pywinpty-3.0.2-cp314-cp314-win_amd64.whl", hash = "sha256:28297cecc37bee9f24d8889e47231972d6e9e84f7b668909de54f36ca785029a", size = 2050386, upload-time = "2025-10-03T21:18:50.477Z" }, - { url = "https://files.pythonhosted.org/packages/de/24/c6907c5bb06043df98ad6a0a0ff5db2e0affcecbc3b15c42404393a3f72a/pywinpty-3.0.2-cp314-cp314t-win_amd64.whl", hash = "sha256:34b55ae9a1b671fe3eae071d86618110538e8eaad18fcb1531c0830b91a82767", size = 2049834, upload-time = "2025-10-03T21:19:25.688Z" }, + { url = "https://files.pythonhosted.org/packages/a6/a1/409c1651c9f874d598c10f51ff586c416625601df4bca315d08baec4c3e3/pywinpty-3.0.2-cp311-cp311-win_amd64.whl", hash = "sha256:327790d70e4c841ebd9d0f295a780177149aeb405bca44c7115a3de5c2054b23", size = 2050304 }, + { url = "https://files.pythonhosted.org/packages/02/4e/1098484e042c9485f56f16eb2b69b43b874bd526044ee401512234cf9e04/pywinpty-3.0.2-cp312-cp312-win_amd64.whl", hash = "sha256:99fdd9b455f0ad6419aba6731a7a0d2f88ced83c3c94a80ff9533d95fa8d8a9e", size = 2050391 }, + { url = "https://files.pythonhosted.org/packages/fc/19/b757fe28008236a4a713e813283721b8a40aa60cd7d3f83549f2e25a3155/pywinpty-3.0.2-cp313-cp313-win_amd64.whl", hash = "sha256:18f78b81e4cfee6aabe7ea8688441d30247b73e52cd9657138015c5f4ee13a51", size = 2050057 }, + { url = "https://files.pythonhosted.org/packages/cb/44/cbae12ecf6f4fa4129c36871fd09c6bef4f98d5f625ecefb5e2449765508/pywinpty-3.0.2-cp313-cp313t-win_amd64.whl", hash = "sha256:663383ecfab7fc382cc97ea5c4f7f0bb32c2f889259855df6ea34e5df42d305b", size = 2049874 }, + { url = "https://files.pythonhosted.org/packages/ca/15/f12c6055e2d7a617d4d5820e8ac4ceaff849da4cb124640ef5116a230771/pywinpty-3.0.2-cp314-cp314-win_amd64.whl", hash = "sha256:28297cecc37bee9f24d8889e47231972d6e9e84f7b668909de54f36ca785029a", size = 2050386 }, + { url = "https://files.pythonhosted.org/packages/de/24/c6907c5bb06043df98ad6a0a0ff5db2e0affcecbc3b15c42404393a3f72a/pywinpty-3.0.2-cp314-cp314t-win_amd64.whl", hash = "sha256:34b55ae9a1b671fe3eae071d86618110538e8eaad18fcb1531c0830b91a82767", size = 2049834 }, ] [[package]] name = "pyyaml" version = "6.0.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/05/8e/961c0007c59b8dd7729d542c61a4d537767a59645b82a0b521206e1e25c2/pyyaml-6.0.3.tar.gz", hash = "sha256:d76623373421df22fb4cf8817020cbb7ef15c725b9d5e45f17e189bfc384190f", size = 130960, upload-time = "2025-09-25T21:33:16.546Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/6d/16/a95b6757765b7b031c9374925bb718d55e0a9ba8a1b6a12d25962ea44347/pyyaml-6.0.3-cp311-cp311-macosx_10_13_x86_64.whl", hash = "sha256:44edc647873928551a01e7a563d7452ccdebee747728c1080d881d68af7b997e", size = 185826, upload-time = "2025-09-25T21:31:58.655Z" }, - { url = "https://files.pythonhosted.org/packages/16/19/13de8e4377ed53079ee996e1ab0a9c33ec2faf808a4647b7b4c0d46dd239/pyyaml-6.0.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:652cb6edd41e718550aad172851962662ff2681490a8a711af6a4d288dd96824", size = 175577, upload-time = "2025-09-25T21:32:00.088Z" }, - { url = "https://files.pythonhosted.org/packages/0c/62/d2eb46264d4b157dae1275b573017abec435397aa59cbcdab6fc978a8af4/pyyaml-6.0.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:10892704fc220243f5305762e276552a0395f7beb4dbf9b14ec8fd43b57f126c", size = 775556, upload-time = "2025-09-25T21:32:01.31Z" }, - { url = "https://files.pythonhosted.org/packages/10/cb/16c3f2cf3266edd25aaa00d6c4350381c8b012ed6f5276675b9eba8d9ff4/pyyaml-6.0.3-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:850774a7879607d3a6f50d36d04f00ee69e7fc816450e5f7e58d7f17f1ae5c00", size = 882114, upload-time = "2025-09-25T21:32:03.376Z" }, - { url = "https://files.pythonhosted.org/packages/71/60/917329f640924b18ff085ab889a11c763e0b573da888e8404ff486657602/pyyaml-6.0.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b8bb0864c5a28024fac8a632c443c87c5aa6f215c0b126c449ae1a150412f31d", size = 806638, upload-time = "2025-09-25T21:32:04.553Z" }, - { url = "https://files.pythonhosted.org/packages/dd/6f/529b0f316a9fd167281a6c3826b5583e6192dba792dd55e3203d3f8e655a/pyyaml-6.0.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:1d37d57ad971609cf3c53ba6a7e365e40660e3be0e5175fa9f2365a379d6095a", size = 767463, upload-time = "2025-09-25T21:32:06.152Z" }, - { url = "https://files.pythonhosted.org/packages/f2/6a/b627b4e0c1dd03718543519ffb2f1deea4a1e6d42fbab8021936a4d22589/pyyaml-6.0.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:37503bfbfc9d2c40b344d06b2199cf0e96e97957ab1c1b546fd4f87e53e5d3e4", size = 794986, upload-time = "2025-09-25T21:32:07.367Z" }, - { url = "https://files.pythonhosted.org/packages/45/91/47a6e1c42d9ee337c4839208f30d9f09caa9f720ec7582917b264defc875/pyyaml-6.0.3-cp311-cp311-win32.whl", hash = "sha256:8098f252adfa6c80ab48096053f512f2321f0b998f98150cea9bd23d83e1467b", size = 142543, upload-time = "2025-09-25T21:32:08.95Z" }, - { url = "https://files.pythonhosted.org/packages/da/e3/ea007450a105ae919a72393cb06f122f288ef60bba2dc64b26e2646fa315/pyyaml-6.0.3-cp311-cp311-win_amd64.whl", hash = "sha256:9f3bfb4965eb874431221a3ff3fdcddc7e74e3b07799e0e84ca4a0f867d449bf", size = 158763, upload-time = "2025-09-25T21:32:09.96Z" }, - { url = "https://files.pythonhosted.org/packages/d1/33/422b98d2195232ca1826284a76852ad5a86fe23e31b009c9886b2d0fb8b2/pyyaml-6.0.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:7f047e29dcae44602496db43be01ad42fc6f1cc0d8cd6c83d342306c32270196", size = 182063, upload-time = "2025-09-25T21:32:11.445Z" }, - { url = "https://files.pythonhosted.org/packages/89/a0/6cf41a19a1f2f3feab0e9c0b74134aa2ce6849093d5517a0c550fe37a648/pyyaml-6.0.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:fc09d0aa354569bc501d4e787133afc08552722d3ab34836a80547331bb5d4a0", size = 173973, upload-time = "2025-09-25T21:32:12.492Z" }, - { url = "https://files.pythonhosted.org/packages/ed/23/7a778b6bd0b9a8039df8b1b1d80e2e2ad78aa04171592c8a5c43a56a6af4/pyyaml-6.0.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9149cad251584d5fb4981be1ecde53a1ca46c891a79788c0df828d2f166bda28", size = 775116, upload-time = "2025-09-25T21:32:13.652Z" }, - { url = "https://files.pythonhosted.org/packages/65/30/d7353c338e12baef4ecc1b09e877c1970bd3382789c159b4f89d6a70dc09/pyyaml-6.0.3-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5fdec68f91a0c6739b380c83b951e2c72ac0197ace422360e6d5a959d8d97b2c", size = 844011, upload-time = "2025-09-25T21:32:15.21Z" }, - { url = "https://files.pythonhosted.org/packages/8b/9d/b3589d3877982d4f2329302ef98a8026e7f4443c765c46cfecc8858c6b4b/pyyaml-6.0.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ba1cc08a7ccde2d2ec775841541641e4548226580ab850948cbfda66a1befcdc", size = 807870, upload-time = "2025-09-25T21:32:16.431Z" }, - { url = "https://files.pythonhosted.org/packages/05/c0/b3be26a015601b822b97d9149ff8cb5ead58c66f981e04fedf4e762f4bd4/pyyaml-6.0.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:8dc52c23056b9ddd46818a57b78404882310fb473d63f17b07d5c40421e47f8e", size = 761089, upload-time = "2025-09-25T21:32:17.56Z" }, - { url = "https://files.pythonhosted.org/packages/be/8e/98435a21d1d4b46590d5459a22d88128103f8da4c2d4cb8f14f2a96504e1/pyyaml-6.0.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:41715c910c881bc081f1e8872880d3c650acf13dfa8214bad49ed4cede7c34ea", size = 790181, upload-time = "2025-09-25T21:32:18.834Z" }, - { url = "https://files.pythonhosted.org/packages/74/93/7baea19427dcfbe1e5a372d81473250b379f04b1bd3c4c5ff825e2327202/pyyaml-6.0.3-cp312-cp312-win32.whl", hash = "sha256:96b533f0e99f6579b3d4d4995707cf36df9100d67e0c8303a0c55b27b5f99bc5", size = 137658, upload-time = "2025-09-25T21:32:20.209Z" }, - { url = "https://files.pythonhosted.org/packages/86/bf/899e81e4cce32febab4fb42bb97dcdf66bc135272882d1987881a4b519e9/pyyaml-6.0.3-cp312-cp312-win_amd64.whl", hash = "sha256:5fcd34e47f6e0b794d17de1b4ff496c00986e1c83f7ab2fb8fcfe9616ff7477b", size = 154003, upload-time = "2025-09-25T21:32:21.167Z" }, - { url = "https://files.pythonhosted.org/packages/1a/08/67bd04656199bbb51dbed1439b7f27601dfb576fb864099c7ef0c3e55531/pyyaml-6.0.3-cp312-cp312-win_arm64.whl", hash = "sha256:64386e5e707d03a7e172c0701abfb7e10f0fb753ee1d773128192742712a98fd", size = 140344, upload-time = "2025-09-25T21:32:22.617Z" }, - { url = "https://files.pythonhosted.org/packages/d1/11/0fd08f8192109f7169db964b5707a2f1e8b745d4e239b784a5a1dd80d1db/pyyaml-6.0.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:8da9669d359f02c0b91ccc01cac4a67f16afec0dac22c2ad09f46bee0697eba8", size = 181669, upload-time = "2025-09-25T21:32:23.673Z" }, - { url = "https://files.pythonhosted.org/packages/b1/16/95309993f1d3748cd644e02e38b75d50cbc0d9561d21f390a76242ce073f/pyyaml-6.0.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:2283a07e2c21a2aa78d9c4442724ec1eb15f5e42a723b99cb3d822d48f5f7ad1", size = 173252, upload-time = "2025-09-25T21:32:25.149Z" }, - { url = "https://files.pythonhosted.org/packages/50/31/b20f376d3f810b9b2371e72ef5adb33879b25edb7a6d072cb7ca0c486398/pyyaml-6.0.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ee2922902c45ae8ccada2c5b501ab86c36525b883eff4255313a253a3160861c", size = 767081, upload-time = "2025-09-25T21:32:26.575Z" }, - { url = "https://files.pythonhosted.org/packages/49/1e/a55ca81e949270d5d4432fbbd19dfea5321eda7c41a849d443dc92fd1ff7/pyyaml-6.0.3-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:a33284e20b78bd4a18c8c2282d549d10bc8408a2a7ff57653c0cf0b9be0afce5", size = 841159, upload-time = "2025-09-25T21:32:27.727Z" }, - { url = "https://files.pythonhosted.org/packages/74/27/e5b8f34d02d9995b80abcef563ea1f8b56d20134d8f4e5e81733b1feceb2/pyyaml-6.0.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0f29edc409a6392443abf94b9cf89ce99889a1dd5376d94316ae5145dfedd5d6", size = 801626, upload-time = "2025-09-25T21:32:28.878Z" }, - { url = "https://files.pythonhosted.org/packages/f9/11/ba845c23988798f40e52ba45f34849aa8a1f2d4af4b798588010792ebad6/pyyaml-6.0.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:f7057c9a337546edc7973c0d3ba84ddcdf0daa14533c2065749c9075001090e6", size = 753613, upload-time = "2025-09-25T21:32:30.178Z" }, - { url = "https://files.pythonhosted.org/packages/3d/e0/7966e1a7bfc0a45bf0a7fb6b98ea03fc9b8d84fa7f2229e9659680b69ee3/pyyaml-6.0.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:eda16858a3cab07b80edaf74336ece1f986ba330fdb8ee0d6c0d68fe82bc96be", size = 794115, upload-time = "2025-09-25T21:32:31.353Z" }, - { url = "https://files.pythonhosted.org/packages/de/94/980b50a6531b3019e45ddeada0626d45fa85cbe22300844a7983285bed3b/pyyaml-6.0.3-cp313-cp313-win32.whl", hash = "sha256:d0eae10f8159e8fdad514efdc92d74fd8d682c933a6dd088030f3834bc8e6b26", size = 137427, upload-time = "2025-09-25T21:32:32.58Z" }, - { url = "https://files.pythonhosted.org/packages/97/c9/39d5b874e8b28845e4ec2202b5da735d0199dbe5b8fb85f91398814a9a46/pyyaml-6.0.3-cp313-cp313-win_amd64.whl", hash = "sha256:79005a0d97d5ddabfeeea4cf676af11e647e41d81c9a7722a193022accdb6b7c", size = 154090, upload-time = "2025-09-25T21:32:33.659Z" }, - { url = "https://files.pythonhosted.org/packages/73/e8/2bdf3ca2090f68bb3d75b44da7bbc71843b19c9f2b9cb9b0f4ab7a5a4329/pyyaml-6.0.3-cp313-cp313-win_arm64.whl", hash = "sha256:5498cd1645aa724a7c71c8f378eb29ebe23da2fc0d7a08071d89469bf1d2defb", size = 140246, upload-time = "2025-09-25T21:32:34.663Z" }, - { url = "https://files.pythonhosted.org/packages/9d/8c/f4bd7f6465179953d3ac9bc44ac1a8a3e6122cf8ada906b4f96c60172d43/pyyaml-6.0.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:8d1fab6bb153a416f9aeb4b8763bc0f22a5586065f86f7664fc23339fc1c1fac", size = 181814, upload-time = "2025-09-25T21:32:35.712Z" }, - { url = "https://files.pythonhosted.org/packages/bd/9c/4d95bb87eb2063d20db7b60faa3840c1b18025517ae857371c4dd55a6b3a/pyyaml-6.0.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:34d5fcd24b8445fadc33f9cf348c1047101756fd760b4dacb5c3e99755703310", size = 173809, upload-time = "2025-09-25T21:32:36.789Z" }, - { url = "https://files.pythonhosted.org/packages/92/b5/47e807c2623074914e29dabd16cbbdd4bf5e9b2db9f8090fa64411fc5382/pyyaml-6.0.3-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:501a031947e3a9025ed4405a168e6ef5ae3126c59f90ce0cd6f2bfc477be31b7", size = 766454, upload-time = "2025-09-25T21:32:37.966Z" }, - { url = "https://files.pythonhosted.org/packages/02/9e/e5e9b168be58564121efb3de6859c452fccde0ab093d8438905899a3a483/pyyaml-6.0.3-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:b3bc83488de33889877a0f2543ade9f70c67d66d9ebb4ac959502e12de895788", size = 836355, upload-time = "2025-09-25T21:32:39.178Z" }, - { url = "https://files.pythonhosted.org/packages/88/f9/16491d7ed2a919954993e48aa941b200f38040928474c9e85ea9e64222c3/pyyaml-6.0.3-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c458b6d084f9b935061bc36216e8a69a7e293a2f1e68bf956dcd9e6cbcd143f5", size = 794175, upload-time = "2025-09-25T21:32:40.865Z" }, - { url = "https://files.pythonhosted.org/packages/dd/3f/5989debef34dc6397317802b527dbbafb2b4760878a53d4166579111411e/pyyaml-6.0.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:7c6610def4f163542a622a73fb39f534f8c101d690126992300bf3207eab9764", size = 755228, upload-time = "2025-09-25T21:32:42.084Z" }, - { url = "https://files.pythonhosted.org/packages/d7/ce/af88a49043cd2e265be63d083fc75b27b6ed062f5f9fd6cdc223ad62f03e/pyyaml-6.0.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:5190d403f121660ce8d1d2c1bb2ef1bd05b5f68533fc5c2ea899bd15f4399b35", size = 789194, upload-time = "2025-09-25T21:32:43.362Z" }, - { url = "https://files.pythonhosted.org/packages/23/20/bb6982b26a40bb43951265ba29d4c246ef0ff59c9fdcdf0ed04e0687de4d/pyyaml-6.0.3-cp314-cp314-win_amd64.whl", hash = "sha256:4a2e8cebe2ff6ab7d1050ecd59c25d4c8bd7e6f400f5f82b96557ac0abafd0ac", size = 156429, upload-time = "2025-09-25T21:32:57.844Z" }, - { url = "https://files.pythonhosted.org/packages/f4/f4/a4541072bb9422c8a883ab55255f918fa378ecf083f5b85e87fc2b4eda1b/pyyaml-6.0.3-cp314-cp314-win_arm64.whl", hash = "sha256:93dda82c9c22deb0a405ea4dc5f2d0cda384168e466364dec6255b293923b2f3", size = 143912, upload-time = "2025-09-25T21:32:59.247Z" }, - { url = "https://files.pythonhosted.org/packages/7c/f9/07dd09ae774e4616edf6cda684ee78f97777bdd15847253637a6f052a62f/pyyaml-6.0.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:02893d100e99e03eda1c8fd5c441d8c60103fd175728e23e431db1b589cf5ab3", size = 189108, upload-time = "2025-09-25T21:32:44.377Z" }, - { url = "https://files.pythonhosted.org/packages/4e/78/8d08c9fb7ce09ad8c38ad533c1191cf27f7ae1effe5bb9400a46d9437fcf/pyyaml-6.0.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:c1ff362665ae507275af2853520967820d9124984e0f7466736aea23d8611fba", size = 183641, upload-time = "2025-09-25T21:32:45.407Z" }, - { url = "https://files.pythonhosted.org/packages/7b/5b/3babb19104a46945cf816d047db2788bcaf8c94527a805610b0289a01c6b/pyyaml-6.0.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6adc77889b628398debc7b65c073bcb99c4a0237b248cacaf3fe8a557563ef6c", size = 831901, upload-time = "2025-09-25T21:32:48.83Z" }, - { url = "https://files.pythonhosted.org/packages/8b/cc/dff0684d8dc44da4d22a13f35f073d558c268780ce3c6ba1b87055bb0b87/pyyaml-6.0.3-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:a80cb027f6b349846a3bf6d73b5e95e782175e52f22108cfa17876aaeff93702", size = 861132, upload-time = "2025-09-25T21:32:50.149Z" }, - { url = "https://files.pythonhosted.org/packages/b1/5e/f77dc6b9036943e285ba76b49e118d9ea929885becb0a29ba8a7c75e29fe/pyyaml-6.0.3-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:00c4bdeba853cc34e7dd471f16b4114f4162dc03e6b7afcc2128711f0eca823c", size = 839261, upload-time = "2025-09-25T21:32:51.808Z" }, - { url = "https://files.pythonhosted.org/packages/ce/88/a9db1376aa2a228197c58b37302f284b5617f56a5d959fd1763fb1675ce6/pyyaml-6.0.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:66e1674c3ef6f541c35191caae2d429b967b99e02040f5ba928632d9a7f0f065", size = 805272, upload-time = "2025-09-25T21:32:52.941Z" }, - { url = "https://files.pythonhosted.org/packages/da/92/1446574745d74df0c92e6aa4a7b0b3130706a4142b2d1a5869f2eaa423c6/pyyaml-6.0.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:16249ee61e95f858e83976573de0f5b2893b3677ba71c9dd36b9cf8be9ac6d65", size = 829923, upload-time = "2025-09-25T21:32:54.537Z" }, - { url = "https://files.pythonhosted.org/packages/f0/7a/1c7270340330e575b92f397352af856a8c06f230aa3e76f86b39d01b416a/pyyaml-6.0.3-cp314-cp314t-win_amd64.whl", hash = "sha256:4ad1906908f2f5ae4e5a8ddfce73c320c2a1429ec52eafd27138b7f1cbe341c9", size = 174062, upload-time = "2025-09-25T21:32:55.767Z" }, - { url = "https://files.pythonhosted.org/packages/f1/12/de94a39c2ef588c7e6455cfbe7343d3b2dc9d6b6b2f40c4c6565744c873d/pyyaml-6.0.3-cp314-cp314t-win_arm64.whl", hash = "sha256:ebc55a14a21cb14062aa4162f906cd962b28e2e9ea38f9b4391244cd8de4ae0b", size = 149341, upload-time = "2025-09-25T21:32:56.828Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/05/8e/961c0007c59b8dd7729d542c61a4d537767a59645b82a0b521206e1e25c2/pyyaml-6.0.3.tar.gz", hash = "sha256:d76623373421df22fb4cf8817020cbb7ef15c725b9d5e45f17e189bfc384190f", size = 130960 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/6d/16/a95b6757765b7b031c9374925bb718d55e0a9ba8a1b6a12d25962ea44347/pyyaml-6.0.3-cp311-cp311-macosx_10_13_x86_64.whl", hash = "sha256:44edc647873928551a01e7a563d7452ccdebee747728c1080d881d68af7b997e", size = 185826 }, + { url = "https://files.pythonhosted.org/packages/16/19/13de8e4377ed53079ee996e1ab0a9c33ec2faf808a4647b7b4c0d46dd239/pyyaml-6.0.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:652cb6edd41e718550aad172851962662ff2681490a8a711af6a4d288dd96824", size = 175577 }, + { url = "https://files.pythonhosted.org/packages/0c/62/d2eb46264d4b157dae1275b573017abec435397aa59cbcdab6fc978a8af4/pyyaml-6.0.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:10892704fc220243f5305762e276552a0395f7beb4dbf9b14ec8fd43b57f126c", size = 775556 }, + { url = "https://files.pythonhosted.org/packages/10/cb/16c3f2cf3266edd25aaa00d6c4350381c8b012ed6f5276675b9eba8d9ff4/pyyaml-6.0.3-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:850774a7879607d3a6f50d36d04f00ee69e7fc816450e5f7e58d7f17f1ae5c00", size = 882114 }, + { url = "https://files.pythonhosted.org/packages/71/60/917329f640924b18ff085ab889a11c763e0b573da888e8404ff486657602/pyyaml-6.0.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b8bb0864c5a28024fac8a632c443c87c5aa6f215c0b126c449ae1a150412f31d", size = 806638 }, + { url = "https://files.pythonhosted.org/packages/dd/6f/529b0f316a9fd167281a6c3826b5583e6192dba792dd55e3203d3f8e655a/pyyaml-6.0.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:1d37d57ad971609cf3c53ba6a7e365e40660e3be0e5175fa9f2365a379d6095a", size = 767463 }, + { url = "https://files.pythonhosted.org/packages/f2/6a/b627b4e0c1dd03718543519ffb2f1deea4a1e6d42fbab8021936a4d22589/pyyaml-6.0.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:37503bfbfc9d2c40b344d06b2199cf0e96e97957ab1c1b546fd4f87e53e5d3e4", size = 794986 }, + { url = "https://files.pythonhosted.org/packages/45/91/47a6e1c42d9ee337c4839208f30d9f09caa9f720ec7582917b264defc875/pyyaml-6.0.3-cp311-cp311-win32.whl", hash = "sha256:8098f252adfa6c80ab48096053f512f2321f0b998f98150cea9bd23d83e1467b", size = 142543 }, + { url = "https://files.pythonhosted.org/packages/da/e3/ea007450a105ae919a72393cb06f122f288ef60bba2dc64b26e2646fa315/pyyaml-6.0.3-cp311-cp311-win_amd64.whl", hash = "sha256:9f3bfb4965eb874431221a3ff3fdcddc7e74e3b07799e0e84ca4a0f867d449bf", size = 158763 }, + { url = "https://files.pythonhosted.org/packages/d1/33/422b98d2195232ca1826284a76852ad5a86fe23e31b009c9886b2d0fb8b2/pyyaml-6.0.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:7f047e29dcae44602496db43be01ad42fc6f1cc0d8cd6c83d342306c32270196", size = 182063 }, + { url = "https://files.pythonhosted.org/packages/89/a0/6cf41a19a1f2f3feab0e9c0b74134aa2ce6849093d5517a0c550fe37a648/pyyaml-6.0.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:fc09d0aa354569bc501d4e787133afc08552722d3ab34836a80547331bb5d4a0", size = 173973 }, + { url = "https://files.pythonhosted.org/packages/ed/23/7a778b6bd0b9a8039df8b1b1d80e2e2ad78aa04171592c8a5c43a56a6af4/pyyaml-6.0.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9149cad251584d5fb4981be1ecde53a1ca46c891a79788c0df828d2f166bda28", size = 775116 }, + { url = "https://files.pythonhosted.org/packages/65/30/d7353c338e12baef4ecc1b09e877c1970bd3382789c159b4f89d6a70dc09/pyyaml-6.0.3-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5fdec68f91a0c6739b380c83b951e2c72ac0197ace422360e6d5a959d8d97b2c", size = 844011 }, + { url = "https://files.pythonhosted.org/packages/8b/9d/b3589d3877982d4f2329302ef98a8026e7f4443c765c46cfecc8858c6b4b/pyyaml-6.0.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ba1cc08a7ccde2d2ec775841541641e4548226580ab850948cbfda66a1befcdc", size = 807870 }, + { url = "https://files.pythonhosted.org/packages/05/c0/b3be26a015601b822b97d9149ff8cb5ead58c66f981e04fedf4e762f4bd4/pyyaml-6.0.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:8dc52c23056b9ddd46818a57b78404882310fb473d63f17b07d5c40421e47f8e", size = 761089 }, + { url = "https://files.pythonhosted.org/packages/be/8e/98435a21d1d4b46590d5459a22d88128103f8da4c2d4cb8f14f2a96504e1/pyyaml-6.0.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:41715c910c881bc081f1e8872880d3c650acf13dfa8214bad49ed4cede7c34ea", size = 790181 }, + { url = "https://files.pythonhosted.org/packages/74/93/7baea19427dcfbe1e5a372d81473250b379f04b1bd3c4c5ff825e2327202/pyyaml-6.0.3-cp312-cp312-win32.whl", hash = "sha256:96b533f0e99f6579b3d4d4995707cf36df9100d67e0c8303a0c55b27b5f99bc5", size = 137658 }, + { url = "https://files.pythonhosted.org/packages/86/bf/899e81e4cce32febab4fb42bb97dcdf66bc135272882d1987881a4b519e9/pyyaml-6.0.3-cp312-cp312-win_amd64.whl", hash = "sha256:5fcd34e47f6e0b794d17de1b4ff496c00986e1c83f7ab2fb8fcfe9616ff7477b", size = 154003 }, + { url = "https://files.pythonhosted.org/packages/1a/08/67bd04656199bbb51dbed1439b7f27601dfb576fb864099c7ef0c3e55531/pyyaml-6.0.3-cp312-cp312-win_arm64.whl", hash = "sha256:64386e5e707d03a7e172c0701abfb7e10f0fb753ee1d773128192742712a98fd", size = 140344 }, + { url = "https://files.pythonhosted.org/packages/d1/11/0fd08f8192109f7169db964b5707a2f1e8b745d4e239b784a5a1dd80d1db/pyyaml-6.0.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:8da9669d359f02c0b91ccc01cac4a67f16afec0dac22c2ad09f46bee0697eba8", size = 181669 }, + { url = "https://files.pythonhosted.org/packages/b1/16/95309993f1d3748cd644e02e38b75d50cbc0d9561d21f390a76242ce073f/pyyaml-6.0.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:2283a07e2c21a2aa78d9c4442724ec1eb15f5e42a723b99cb3d822d48f5f7ad1", size = 173252 }, + { url = "https://files.pythonhosted.org/packages/50/31/b20f376d3f810b9b2371e72ef5adb33879b25edb7a6d072cb7ca0c486398/pyyaml-6.0.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ee2922902c45ae8ccada2c5b501ab86c36525b883eff4255313a253a3160861c", size = 767081 }, + { url = "https://files.pythonhosted.org/packages/49/1e/a55ca81e949270d5d4432fbbd19dfea5321eda7c41a849d443dc92fd1ff7/pyyaml-6.0.3-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:a33284e20b78bd4a18c8c2282d549d10bc8408a2a7ff57653c0cf0b9be0afce5", size = 841159 }, + { url = "https://files.pythonhosted.org/packages/74/27/e5b8f34d02d9995b80abcef563ea1f8b56d20134d8f4e5e81733b1feceb2/pyyaml-6.0.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0f29edc409a6392443abf94b9cf89ce99889a1dd5376d94316ae5145dfedd5d6", size = 801626 }, + { url = "https://files.pythonhosted.org/packages/f9/11/ba845c23988798f40e52ba45f34849aa8a1f2d4af4b798588010792ebad6/pyyaml-6.0.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:f7057c9a337546edc7973c0d3ba84ddcdf0daa14533c2065749c9075001090e6", size = 753613 }, + { url = "https://files.pythonhosted.org/packages/3d/e0/7966e1a7bfc0a45bf0a7fb6b98ea03fc9b8d84fa7f2229e9659680b69ee3/pyyaml-6.0.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:eda16858a3cab07b80edaf74336ece1f986ba330fdb8ee0d6c0d68fe82bc96be", size = 794115 }, + { url = "https://files.pythonhosted.org/packages/de/94/980b50a6531b3019e45ddeada0626d45fa85cbe22300844a7983285bed3b/pyyaml-6.0.3-cp313-cp313-win32.whl", hash = "sha256:d0eae10f8159e8fdad514efdc92d74fd8d682c933a6dd088030f3834bc8e6b26", size = 137427 }, + { url = "https://files.pythonhosted.org/packages/97/c9/39d5b874e8b28845e4ec2202b5da735d0199dbe5b8fb85f91398814a9a46/pyyaml-6.0.3-cp313-cp313-win_amd64.whl", hash = "sha256:79005a0d97d5ddabfeeea4cf676af11e647e41d81c9a7722a193022accdb6b7c", size = 154090 }, + { url = "https://files.pythonhosted.org/packages/73/e8/2bdf3ca2090f68bb3d75b44da7bbc71843b19c9f2b9cb9b0f4ab7a5a4329/pyyaml-6.0.3-cp313-cp313-win_arm64.whl", hash = "sha256:5498cd1645aa724a7c71c8f378eb29ebe23da2fc0d7a08071d89469bf1d2defb", size = 140246 }, + { url = "https://files.pythonhosted.org/packages/9d/8c/f4bd7f6465179953d3ac9bc44ac1a8a3e6122cf8ada906b4f96c60172d43/pyyaml-6.0.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:8d1fab6bb153a416f9aeb4b8763bc0f22a5586065f86f7664fc23339fc1c1fac", size = 181814 }, + { url = "https://files.pythonhosted.org/packages/bd/9c/4d95bb87eb2063d20db7b60faa3840c1b18025517ae857371c4dd55a6b3a/pyyaml-6.0.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:34d5fcd24b8445fadc33f9cf348c1047101756fd760b4dacb5c3e99755703310", size = 173809 }, + { url = "https://files.pythonhosted.org/packages/92/b5/47e807c2623074914e29dabd16cbbdd4bf5e9b2db9f8090fa64411fc5382/pyyaml-6.0.3-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:501a031947e3a9025ed4405a168e6ef5ae3126c59f90ce0cd6f2bfc477be31b7", size = 766454 }, + { url = "https://files.pythonhosted.org/packages/02/9e/e5e9b168be58564121efb3de6859c452fccde0ab093d8438905899a3a483/pyyaml-6.0.3-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:b3bc83488de33889877a0f2543ade9f70c67d66d9ebb4ac959502e12de895788", size = 836355 }, + { url = "https://files.pythonhosted.org/packages/88/f9/16491d7ed2a919954993e48aa941b200f38040928474c9e85ea9e64222c3/pyyaml-6.0.3-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c458b6d084f9b935061bc36216e8a69a7e293a2f1e68bf956dcd9e6cbcd143f5", size = 794175 }, + { url = "https://files.pythonhosted.org/packages/dd/3f/5989debef34dc6397317802b527dbbafb2b4760878a53d4166579111411e/pyyaml-6.0.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:7c6610def4f163542a622a73fb39f534f8c101d690126992300bf3207eab9764", size = 755228 }, + { url = "https://files.pythonhosted.org/packages/d7/ce/af88a49043cd2e265be63d083fc75b27b6ed062f5f9fd6cdc223ad62f03e/pyyaml-6.0.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:5190d403f121660ce8d1d2c1bb2ef1bd05b5f68533fc5c2ea899bd15f4399b35", size = 789194 }, + { url = "https://files.pythonhosted.org/packages/23/20/bb6982b26a40bb43951265ba29d4c246ef0ff59c9fdcdf0ed04e0687de4d/pyyaml-6.0.3-cp314-cp314-win_amd64.whl", hash = "sha256:4a2e8cebe2ff6ab7d1050ecd59c25d4c8bd7e6f400f5f82b96557ac0abafd0ac", size = 156429 }, + { url = "https://files.pythonhosted.org/packages/f4/f4/a4541072bb9422c8a883ab55255f918fa378ecf083f5b85e87fc2b4eda1b/pyyaml-6.0.3-cp314-cp314-win_arm64.whl", hash = "sha256:93dda82c9c22deb0a405ea4dc5f2d0cda384168e466364dec6255b293923b2f3", size = 143912 }, + { url = "https://files.pythonhosted.org/packages/7c/f9/07dd09ae774e4616edf6cda684ee78f97777bdd15847253637a6f052a62f/pyyaml-6.0.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:02893d100e99e03eda1c8fd5c441d8c60103fd175728e23e431db1b589cf5ab3", size = 189108 }, + { url = "https://files.pythonhosted.org/packages/4e/78/8d08c9fb7ce09ad8c38ad533c1191cf27f7ae1effe5bb9400a46d9437fcf/pyyaml-6.0.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:c1ff362665ae507275af2853520967820d9124984e0f7466736aea23d8611fba", size = 183641 }, + { url = "https://files.pythonhosted.org/packages/7b/5b/3babb19104a46945cf816d047db2788bcaf8c94527a805610b0289a01c6b/pyyaml-6.0.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6adc77889b628398debc7b65c073bcb99c4a0237b248cacaf3fe8a557563ef6c", size = 831901 }, + { url = "https://files.pythonhosted.org/packages/8b/cc/dff0684d8dc44da4d22a13f35f073d558c268780ce3c6ba1b87055bb0b87/pyyaml-6.0.3-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:a80cb027f6b349846a3bf6d73b5e95e782175e52f22108cfa17876aaeff93702", size = 861132 }, + { url = "https://files.pythonhosted.org/packages/b1/5e/f77dc6b9036943e285ba76b49e118d9ea929885becb0a29ba8a7c75e29fe/pyyaml-6.0.3-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:00c4bdeba853cc34e7dd471f16b4114f4162dc03e6b7afcc2128711f0eca823c", size = 839261 }, + { url = "https://files.pythonhosted.org/packages/ce/88/a9db1376aa2a228197c58b37302f284b5617f56a5d959fd1763fb1675ce6/pyyaml-6.0.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:66e1674c3ef6f541c35191caae2d429b967b99e02040f5ba928632d9a7f0f065", size = 805272 }, + { url = "https://files.pythonhosted.org/packages/da/92/1446574745d74df0c92e6aa4a7b0b3130706a4142b2d1a5869f2eaa423c6/pyyaml-6.0.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:16249ee61e95f858e83976573de0f5b2893b3677ba71c9dd36b9cf8be9ac6d65", size = 829923 }, + { url = "https://files.pythonhosted.org/packages/f0/7a/1c7270340330e575b92f397352af856a8c06f230aa3e76f86b39d01b416a/pyyaml-6.0.3-cp314-cp314t-win_amd64.whl", hash = "sha256:4ad1906908f2f5ae4e5a8ddfce73c320c2a1429ec52eafd27138b7f1cbe341c9", size = 174062 }, + { url = "https://files.pythonhosted.org/packages/f1/12/de94a39c2ef588c7e6455cfbe7343d3b2dc9d6b6b2f40c4c6565744c873d/pyyaml-6.0.3-cp314-cp314t-win_arm64.whl", hash = "sha256:ebc55a14a21cb14062aa4162f906cd962b28e2e9ea38f9b4391244cd8de4ae0b", size = 149341 }, ] [[package]] @@ -2659,55 +2678,55 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "cffi", marker = "implementation_name == 'pypy'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/04/0b/3c9baedbdf613ecaa7aa07027780b8867f57b6293b6ee50de316c9f3222b/pyzmq-27.1.0.tar.gz", hash = "sha256:ac0765e3d44455adb6ddbf4417dcce460fc40a05978c08efdf2948072f6db540", size = 281750, upload-time = "2025-09-08T23:10:18.157Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/06/5d/305323ba86b284e6fcb0d842d6adaa2999035f70f8c38a9b6d21ad28c3d4/pyzmq-27.1.0-cp311-cp311-macosx_10_15_universal2.whl", hash = "sha256:226b091818d461a3bef763805e75685e478ac17e9008f49fce2d3e52b3d58b86", size = 1333328, upload-time = "2025-09-08T23:07:45.946Z" }, - { url = "https://files.pythonhosted.org/packages/bd/a0/fc7e78a23748ad5443ac3275943457e8452da67fda347e05260261108cbc/pyzmq-27.1.0-cp311-cp311-manylinux2014_i686.manylinux_2_17_i686.whl", hash = "sha256:0790a0161c281ca9723f804871b4027f2e8b5a528d357c8952d08cd1a9c15581", size = 908803, upload-time = "2025-09-08T23:07:47.551Z" }, - { url = "https://files.pythonhosted.org/packages/7e/22/37d15eb05f3bdfa4abea6f6d96eb3bb58585fbd3e4e0ded4e743bc650c97/pyzmq-27.1.0-cp311-cp311-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c895a6f35476b0c3a54e3eb6ccf41bf3018de937016e6e18748317f25d4e925f", size = 668836, upload-time = "2025-09-08T23:07:49.436Z" }, - { url = "https://files.pythonhosted.org/packages/b1/c4/2a6fe5111a01005fc7af3878259ce17684fabb8852815eda6225620f3c59/pyzmq-27.1.0-cp311-cp311-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:5bbf8d3630bf96550b3be8e1fc0fea5cbdc8d5466c1192887bd94869da17a63e", size = 857038, upload-time = "2025-09-08T23:07:51.234Z" }, - { url = "https://files.pythonhosted.org/packages/cb/eb/bfdcb41d0db9cd233d6fb22dc131583774135505ada800ebf14dfb0a7c40/pyzmq-27.1.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:15c8bd0fe0dabf808e2d7a681398c4e5ded70a551ab47482067a572c054c8e2e", size = 1657531, upload-time = "2025-09-08T23:07:52.795Z" }, - { url = "https://files.pythonhosted.org/packages/ab/21/e3180ca269ed4a0de5c34417dfe71a8ae80421198be83ee619a8a485b0c7/pyzmq-27.1.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:bafcb3dd171b4ae9f19ee6380dfc71ce0390fefaf26b504c0e5f628d7c8c54f2", size = 2034786, upload-time = "2025-09-08T23:07:55.047Z" }, - { url = "https://files.pythonhosted.org/packages/3b/b1/5e21d0b517434b7f33588ff76c177c5a167858cc38ef740608898cd329f2/pyzmq-27.1.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:e829529fcaa09937189178115c49c504e69289abd39967cd8a4c215761373394", size = 1894220, upload-time = "2025-09-08T23:07:57.172Z" }, - { url = "https://files.pythonhosted.org/packages/03/f2/44913a6ff6941905efc24a1acf3d3cb6146b636c546c7406c38c49c403d4/pyzmq-27.1.0-cp311-cp311-win32.whl", hash = "sha256:6df079c47d5902af6db298ec92151db82ecb557af663098b92f2508c398bb54f", size = 567155, upload-time = "2025-09-08T23:07:59.05Z" }, - { url = "https://files.pythonhosted.org/packages/23/6d/d8d92a0eb270a925c9b4dd039c0b4dc10abc2fcbc48331788824ef113935/pyzmq-27.1.0-cp311-cp311-win_amd64.whl", hash = "sha256:190cbf120fbc0fc4957b56866830def56628934a9d112aec0e2507aa6a032b97", size = 633428, upload-time = "2025-09-08T23:08:00.663Z" }, - { url = "https://files.pythonhosted.org/packages/ae/14/01afebc96c5abbbd713ecfc7469cfb1bc801c819a74ed5c9fad9a48801cb/pyzmq-27.1.0-cp311-cp311-win_arm64.whl", hash = "sha256:eca6b47df11a132d1745eb3b5b5e557a7dae2c303277aa0e69c6ba91b8736e07", size = 559497, upload-time = "2025-09-08T23:08:02.15Z" }, - { url = "https://files.pythonhosted.org/packages/92/e7/038aab64a946d535901103da16b953c8c9cc9c961dadcbf3609ed6428d23/pyzmq-27.1.0-cp312-abi3-macosx_10_15_universal2.whl", hash = "sha256:452631b640340c928fa343801b0d07eb0c3789a5ffa843f6e1a9cee0ba4eb4fc", size = 1306279, upload-time = "2025-09-08T23:08:03.807Z" }, - { url = "https://files.pythonhosted.org/packages/e8/5e/c3c49fdd0f535ef45eefcc16934648e9e59dace4a37ee88fc53f6cd8e641/pyzmq-27.1.0-cp312-abi3-manylinux2014_i686.manylinux_2_17_i686.whl", hash = "sha256:1c179799b118e554b66da67d88ed66cd37a169f1f23b5d9f0a231b4e8d44a113", size = 895645, upload-time = "2025-09-08T23:08:05.301Z" }, - { url = "https://files.pythonhosted.org/packages/f8/e5/b0b2504cb4e903a74dcf1ebae157f9e20ebb6ea76095f6cfffea28c42ecd/pyzmq-27.1.0-cp312-abi3-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3837439b7f99e60312f0c926a6ad437b067356dc2bc2ec96eb395fd0fe804233", size = 652574, upload-time = "2025-09-08T23:08:06.828Z" }, - { url = "https://files.pythonhosted.org/packages/f8/9b/c108cdb55560eaf253f0cbdb61b29971e9fb34d9c3499b0e96e4e60ed8a5/pyzmq-27.1.0-cp312-abi3-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:43ad9a73e3da1fab5b0e7e13402f0b2fb934ae1c876c51d0afff0e7c052eca31", size = 840995, upload-time = "2025-09-08T23:08:08.396Z" }, - { url = "https://files.pythonhosted.org/packages/c2/bb/b79798ca177b9eb0825b4c9998c6af8cd2a7f15a6a1a4272c1d1a21d382f/pyzmq-27.1.0-cp312-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:0de3028d69d4cdc475bfe47a6128eb38d8bc0e8f4d69646adfbcd840facbac28", size = 1642070, upload-time = "2025-09-08T23:08:09.989Z" }, - { url = "https://files.pythonhosted.org/packages/9c/80/2df2e7977c4ede24c79ae39dcef3899bfc5f34d1ca7a5b24f182c9b7a9ca/pyzmq-27.1.0-cp312-abi3-musllinux_1_2_i686.whl", hash = "sha256:cf44a7763aea9298c0aa7dbf859f87ed7012de8bda0f3977b6fb1d96745df856", size = 2021121, upload-time = "2025-09-08T23:08:11.907Z" }, - { url = "https://files.pythonhosted.org/packages/46/bd/2d45ad24f5f5ae7e8d01525eb76786fa7557136555cac7d929880519e33a/pyzmq-27.1.0-cp312-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:f30f395a9e6fbca195400ce833c731e7b64c3919aa481af4d88c3759e0cb7496", size = 1878550, upload-time = "2025-09-08T23:08:13.513Z" }, - { url = "https://files.pythonhosted.org/packages/e6/2f/104c0a3c778d7c2ab8190e9db4f62f0b6957b53c9d87db77c284b69f33ea/pyzmq-27.1.0-cp312-abi3-win32.whl", hash = "sha256:250e5436a4ba13885494412b3da5d518cd0d3a278a1ae640e113c073a5f88edd", size = 559184, upload-time = "2025-09-08T23:08:15.163Z" }, - { url = "https://files.pythonhosted.org/packages/fc/7f/a21b20d577e4100c6a41795842028235998a643b1ad406a6d4163ea8f53e/pyzmq-27.1.0-cp312-abi3-win_amd64.whl", hash = "sha256:9ce490cf1d2ca2ad84733aa1d69ce6855372cb5ce9223802450c9b2a7cba0ccf", size = 619480, upload-time = "2025-09-08T23:08:17.192Z" }, - { url = "https://files.pythonhosted.org/packages/78/c2/c012beae5f76b72f007a9e91ee9401cb88c51d0f83c6257a03e785c81cc2/pyzmq-27.1.0-cp312-abi3-win_arm64.whl", hash = "sha256:75a2f36223f0d535a0c919e23615fc85a1e23b71f40c7eb43d7b1dedb4d8f15f", size = 552993, upload-time = "2025-09-08T23:08:18.926Z" }, - { url = "https://files.pythonhosted.org/packages/60/cb/84a13459c51da6cec1b7b1dc1a47e6db6da50b77ad7fd9c145842750a011/pyzmq-27.1.0-cp313-cp313-android_24_arm64_v8a.whl", hash = "sha256:93ad4b0855a664229559e45c8d23797ceac03183c7b6f5b4428152a6b06684a5", size = 1122436, upload-time = "2025-09-08T23:08:20.801Z" }, - { url = "https://files.pythonhosted.org/packages/dc/b6/94414759a69a26c3dd674570a81813c46a078767d931a6c70ad29fc585cb/pyzmq-27.1.0-cp313-cp313-android_24_x86_64.whl", hash = "sha256:fbb4f2400bfda24f12f009cba62ad5734148569ff4949b1b6ec3b519444342e6", size = 1156301, upload-time = "2025-09-08T23:08:22.47Z" }, - { url = "https://files.pythonhosted.org/packages/a5/ad/15906493fd40c316377fd8a8f6b1f93104f97a752667763c9b9c1b71d42d/pyzmq-27.1.0-cp313-cp313t-macosx_10_15_universal2.whl", hash = "sha256:e343d067f7b151cfe4eb3bb796a7752c9d369eed007b91231e817071d2c2fec7", size = 1341197, upload-time = "2025-09-08T23:08:24.286Z" }, - { url = "https://files.pythonhosted.org/packages/14/1d/d343f3ce13db53a54cb8946594e567410b2125394dafcc0268d8dda027e0/pyzmq-27.1.0-cp313-cp313t-manylinux2014_i686.manylinux_2_17_i686.whl", hash = "sha256:08363b2011dec81c354d694bdecaef4770e0ae96b9afea70b3f47b973655cc05", size = 897275, upload-time = "2025-09-08T23:08:26.063Z" }, - { url = "https://files.pythonhosted.org/packages/69/2d/d83dd6d7ca929a2fc67d2c3005415cdf322af7751d773524809f9e585129/pyzmq-27.1.0-cp313-cp313t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d54530c8c8b5b8ddb3318f481297441af102517602b569146185fa10b63f4fa9", size = 660469, upload-time = "2025-09-08T23:08:27.623Z" }, - { url = "https://files.pythonhosted.org/packages/3e/cd/9822a7af117f4bc0f1952dbe9ef8358eb50a24928efd5edf54210b850259/pyzmq-27.1.0-cp313-cp313t-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:6f3afa12c392f0a44a2414056d730eebc33ec0926aae92b5ad5cf26ebb6cc128", size = 847961, upload-time = "2025-09-08T23:08:29.672Z" }, - { url = "https://files.pythonhosted.org/packages/9a/12/f003e824a19ed73be15542f172fd0ec4ad0b60cf37436652c93b9df7c585/pyzmq-27.1.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:c65047adafe573ff023b3187bb93faa583151627bc9c51fc4fb2c561ed689d39", size = 1650282, upload-time = "2025-09-08T23:08:31.349Z" }, - { url = "https://files.pythonhosted.org/packages/d5/4a/e82d788ed58e9a23995cee70dbc20c9aded3d13a92d30d57ec2291f1e8a3/pyzmq-27.1.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:90e6e9441c946a8b0a667356f7078d96411391a3b8f80980315455574177ec97", size = 2024468, upload-time = "2025-09-08T23:08:33.543Z" }, - { url = "https://files.pythonhosted.org/packages/d9/94/2da0a60841f757481e402b34bf4c8bf57fa54a5466b965de791b1e6f747d/pyzmq-27.1.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:add071b2d25f84e8189aaf0882d39a285b42fa3853016ebab234a5e78c7a43db", size = 1885394, upload-time = "2025-09-08T23:08:35.51Z" }, - { url = "https://files.pythonhosted.org/packages/4f/6f/55c10e2e49ad52d080dc24e37adb215e5b0d64990b57598abc2e3f01725b/pyzmq-27.1.0-cp313-cp313t-win32.whl", hash = "sha256:7ccc0700cfdf7bd487bea8d850ec38f204478681ea02a582a8da8171b7f90a1c", size = 574964, upload-time = "2025-09-08T23:08:37.178Z" }, - { url = "https://files.pythonhosted.org/packages/87/4d/2534970ba63dd7c522d8ca80fb92777f362c0f321900667c615e2067cb29/pyzmq-27.1.0-cp313-cp313t-win_amd64.whl", hash = "sha256:8085a9fba668216b9b4323be338ee5437a235fe275b9d1610e422ccc279733e2", size = 641029, upload-time = "2025-09-08T23:08:40.595Z" }, - { url = "https://files.pythonhosted.org/packages/f6/fa/f8aea7a28b0641f31d40dea42d7ef003fded31e184ef47db696bc74cd610/pyzmq-27.1.0-cp313-cp313t-win_arm64.whl", hash = "sha256:6bb54ca21bcfe361e445256c15eedf083f153811c37be87e0514934d6913061e", size = 561541, upload-time = "2025-09-08T23:08:42.668Z" }, - { url = "https://files.pythonhosted.org/packages/87/45/19efbb3000956e82d0331bafca5d9ac19ea2857722fa2caacefb6042f39d/pyzmq-27.1.0-cp314-cp314t-macosx_10_15_universal2.whl", hash = "sha256:ce980af330231615756acd5154f29813d553ea555485ae712c491cd483df6b7a", size = 1341197, upload-time = "2025-09-08T23:08:44.973Z" }, - { url = "https://files.pythonhosted.org/packages/48/43/d72ccdbf0d73d1343936296665826350cb1e825f92f2db9db3e61c2162a2/pyzmq-27.1.0-cp314-cp314t-manylinux2014_i686.manylinux_2_17_i686.whl", hash = "sha256:1779be8c549e54a1c38f805e56d2a2e5c009d26de10921d7d51cfd1c8d4632ea", size = 897175, upload-time = "2025-09-08T23:08:46.601Z" }, - { url = "https://files.pythonhosted.org/packages/2f/2e/a483f73a10b65a9ef0161e817321d39a770b2acf8bcf3004a28d90d14a94/pyzmq-27.1.0-cp314-cp314t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7200bb0f03345515df50d99d3db206a0a6bee1955fbb8c453c76f5bf0e08fb96", size = 660427, upload-time = "2025-09-08T23:08:48.187Z" }, - { url = "https://files.pythonhosted.org/packages/f5/d2/5f36552c2d3e5685abe60dfa56f91169f7a2d99bbaf67c5271022ab40863/pyzmq-27.1.0-cp314-cp314t-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:01c0e07d558b06a60773744ea6251f769cd79a41a97d11b8bf4ab8f034b0424d", size = 847929, upload-time = "2025-09-08T23:08:49.76Z" }, - { url = "https://files.pythonhosted.org/packages/c4/2a/404b331f2b7bf3198e9945f75c4c521f0c6a3a23b51f7a4a401b94a13833/pyzmq-27.1.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:80d834abee71f65253c91540445d37c4c561e293ba6e741b992f20a105d69146", size = 1650193, upload-time = "2025-09-08T23:08:51.7Z" }, - { url = "https://files.pythonhosted.org/packages/1c/0b/f4107e33f62a5acf60e3ded67ed33d79b4ce18de432625ce2fc5093d6388/pyzmq-27.1.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:544b4e3b7198dde4a62b8ff6685e9802a9a1ebf47e77478a5eb88eca2a82f2fd", size = 2024388, upload-time = "2025-09-08T23:08:53.393Z" }, - { url = "https://files.pythonhosted.org/packages/0d/01/add31fe76512642fd6e40e3a3bd21f4b47e242c8ba33efb6809e37076d9b/pyzmq-27.1.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:cedc4c68178e59a4046f97eca31b148ddcf51e88677de1ef4e78cf06c5376c9a", size = 1885316, upload-time = "2025-09-08T23:08:55.702Z" }, - { url = "https://files.pythonhosted.org/packages/c4/59/a5f38970f9bf07cee96128de79590bb354917914a9be11272cfc7ff26af0/pyzmq-27.1.0-cp314-cp314t-win32.whl", hash = "sha256:1f0b2a577fd770aa6f053211a55d1c47901f4d537389a034c690291485e5fe92", size = 587472, upload-time = "2025-09-08T23:08:58.18Z" }, - { url = "https://files.pythonhosted.org/packages/70/d8/78b1bad170f93fcf5e3536e70e8fadac55030002275c9a29e8f5719185de/pyzmq-27.1.0-cp314-cp314t-win_amd64.whl", hash = "sha256:19c9468ae0437f8074af379e986c5d3d7d7bfe033506af442e8c879732bedbe0", size = 661401, upload-time = "2025-09-08T23:08:59.802Z" }, - { url = "https://files.pythonhosted.org/packages/81/d6/4bfbb40c9a0b42fc53c7cf442f6385db70b40f74a783130c5d0a5aa62228/pyzmq-27.1.0-cp314-cp314t-win_arm64.whl", hash = "sha256:dc5dbf68a7857b59473f7df42650c621d7e8923fb03fa74a526890f4d33cc4d7", size = 575170, upload-time = "2025-09-08T23:09:01.418Z" }, - { url = "https://files.pythonhosted.org/packages/4c/c6/c4dcdecdbaa70969ee1fdced6d7b8f60cfabe64d25361f27ac4665a70620/pyzmq-27.1.0-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:18770c8d3563715387139060d37859c02ce40718d1faf299abddcdcc6a649066", size = 836265, upload-time = "2025-09-08T23:09:49.376Z" }, - { url = "https://files.pythonhosted.org/packages/3e/79/f38c92eeaeb03a2ccc2ba9866f0439593bb08c5e3b714ac1d553e5c96e25/pyzmq-27.1.0-pp311-pypy311_pp73-manylinux2014_i686.manylinux_2_17_i686.whl", hash = "sha256:ac25465d42f92e990f8d8b0546b01c391ad431c3bf447683fdc40565941d0604", size = 800208, upload-time = "2025-09-08T23:09:51.073Z" }, - { url = "https://files.pythonhosted.org/packages/49/0e/3f0d0d335c6b3abb9b7b723776d0b21fa7f3a6c819a0db6097059aada160/pyzmq-27.1.0-pp311-pypy311_pp73-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:53b40f8ae006f2734ee7608d59ed661419f087521edbfc2149c3932e9c14808c", size = 567747, upload-time = "2025-09-08T23:09:52.698Z" }, - { url = "https://files.pythonhosted.org/packages/a1/cf/f2b3784d536250ffd4be70e049f3b60981235d70c6e8ce7e3ef21e1adb25/pyzmq-27.1.0-pp311-pypy311_pp73-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f605d884e7c8be8fe1aa94e0a783bf3f591b84c24e4bc4f3e7564c82ac25e271", size = 747371, upload-time = "2025-09-08T23:09:54.563Z" }, - { url = "https://files.pythonhosted.org/packages/01/1b/5dbe84eefc86f48473947e2f41711aded97eecef1231f4558f1f02713c12/pyzmq-27.1.0-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:c9f7f6e13dff2e44a6afeaf2cf54cee5929ad64afaf4d40b50f93c58fc687355", size = 544862, upload-time = "2025-09-08T23:09:56.509Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/04/0b/3c9baedbdf613ecaa7aa07027780b8867f57b6293b6ee50de316c9f3222b/pyzmq-27.1.0.tar.gz", hash = "sha256:ac0765e3d44455adb6ddbf4417dcce460fc40a05978c08efdf2948072f6db540", size = 281750 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/06/5d/305323ba86b284e6fcb0d842d6adaa2999035f70f8c38a9b6d21ad28c3d4/pyzmq-27.1.0-cp311-cp311-macosx_10_15_universal2.whl", hash = "sha256:226b091818d461a3bef763805e75685e478ac17e9008f49fce2d3e52b3d58b86", size = 1333328 }, + { url = "https://files.pythonhosted.org/packages/bd/a0/fc7e78a23748ad5443ac3275943457e8452da67fda347e05260261108cbc/pyzmq-27.1.0-cp311-cp311-manylinux2014_i686.manylinux_2_17_i686.whl", hash = "sha256:0790a0161c281ca9723f804871b4027f2e8b5a528d357c8952d08cd1a9c15581", size = 908803 }, + { url = "https://files.pythonhosted.org/packages/7e/22/37d15eb05f3bdfa4abea6f6d96eb3bb58585fbd3e4e0ded4e743bc650c97/pyzmq-27.1.0-cp311-cp311-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c895a6f35476b0c3a54e3eb6ccf41bf3018de937016e6e18748317f25d4e925f", size = 668836 }, + { url = "https://files.pythonhosted.org/packages/b1/c4/2a6fe5111a01005fc7af3878259ce17684fabb8852815eda6225620f3c59/pyzmq-27.1.0-cp311-cp311-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:5bbf8d3630bf96550b3be8e1fc0fea5cbdc8d5466c1192887bd94869da17a63e", size = 857038 }, + { url = "https://files.pythonhosted.org/packages/cb/eb/bfdcb41d0db9cd233d6fb22dc131583774135505ada800ebf14dfb0a7c40/pyzmq-27.1.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:15c8bd0fe0dabf808e2d7a681398c4e5ded70a551ab47482067a572c054c8e2e", size = 1657531 }, + { url = "https://files.pythonhosted.org/packages/ab/21/e3180ca269ed4a0de5c34417dfe71a8ae80421198be83ee619a8a485b0c7/pyzmq-27.1.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:bafcb3dd171b4ae9f19ee6380dfc71ce0390fefaf26b504c0e5f628d7c8c54f2", size = 2034786 }, + { url = "https://files.pythonhosted.org/packages/3b/b1/5e21d0b517434b7f33588ff76c177c5a167858cc38ef740608898cd329f2/pyzmq-27.1.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:e829529fcaa09937189178115c49c504e69289abd39967cd8a4c215761373394", size = 1894220 }, + { url = "https://files.pythonhosted.org/packages/03/f2/44913a6ff6941905efc24a1acf3d3cb6146b636c546c7406c38c49c403d4/pyzmq-27.1.0-cp311-cp311-win32.whl", hash = "sha256:6df079c47d5902af6db298ec92151db82ecb557af663098b92f2508c398bb54f", size = 567155 }, + { url = "https://files.pythonhosted.org/packages/23/6d/d8d92a0eb270a925c9b4dd039c0b4dc10abc2fcbc48331788824ef113935/pyzmq-27.1.0-cp311-cp311-win_amd64.whl", hash = "sha256:190cbf120fbc0fc4957b56866830def56628934a9d112aec0e2507aa6a032b97", size = 633428 }, + { url = "https://files.pythonhosted.org/packages/ae/14/01afebc96c5abbbd713ecfc7469cfb1bc801c819a74ed5c9fad9a48801cb/pyzmq-27.1.0-cp311-cp311-win_arm64.whl", hash = "sha256:eca6b47df11a132d1745eb3b5b5e557a7dae2c303277aa0e69c6ba91b8736e07", size = 559497 }, + { url = "https://files.pythonhosted.org/packages/92/e7/038aab64a946d535901103da16b953c8c9cc9c961dadcbf3609ed6428d23/pyzmq-27.1.0-cp312-abi3-macosx_10_15_universal2.whl", hash = "sha256:452631b640340c928fa343801b0d07eb0c3789a5ffa843f6e1a9cee0ba4eb4fc", size = 1306279 }, + { url = "https://files.pythonhosted.org/packages/e8/5e/c3c49fdd0f535ef45eefcc16934648e9e59dace4a37ee88fc53f6cd8e641/pyzmq-27.1.0-cp312-abi3-manylinux2014_i686.manylinux_2_17_i686.whl", hash = "sha256:1c179799b118e554b66da67d88ed66cd37a169f1f23b5d9f0a231b4e8d44a113", size = 895645 }, + { url = "https://files.pythonhosted.org/packages/f8/e5/b0b2504cb4e903a74dcf1ebae157f9e20ebb6ea76095f6cfffea28c42ecd/pyzmq-27.1.0-cp312-abi3-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3837439b7f99e60312f0c926a6ad437b067356dc2bc2ec96eb395fd0fe804233", size = 652574 }, + { url = "https://files.pythonhosted.org/packages/f8/9b/c108cdb55560eaf253f0cbdb61b29971e9fb34d9c3499b0e96e4e60ed8a5/pyzmq-27.1.0-cp312-abi3-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:43ad9a73e3da1fab5b0e7e13402f0b2fb934ae1c876c51d0afff0e7c052eca31", size = 840995 }, + { url = "https://files.pythonhosted.org/packages/c2/bb/b79798ca177b9eb0825b4c9998c6af8cd2a7f15a6a1a4272c1d1a21d382f/pyzmq-27.1.0-cp312-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:0de3028d69d4cdc475bfe47a6128eb38d8bc0e8f4d69646adfbcd840facbac28", size = 1642070 }, + { url = "https://files.pythonhosted.org/packages/9c/80/2df2e7977c4ede24c79ae39dcef3899bfc5f34d1ca7a5b24f182c9b7a9ca/pyzmq-27.1.0-cp312-abi3-musllinux_1_2_i686.whl", hash = "sha256:cf44a7763aea9298c0aa7dbf859f87ed7012de8bda0f3977b6fb1d96745df856", size = 2021121 }, + { url = "https://files.pythonhosted.org/packages/46/bd/2d45ad24f5f5ae7e8d01525eb76786fa7557136555cac7d929880519e33a/pyzmq-27.1.0-cp312-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:f30f395a9e6fbca195400ce833c731e7b64c3919aa481af4d88c3759e0cb7496", size = 1878550 }, + { url = "https://files.pythonhosted.org/packages/e6/2f/104c0a3c778d7c2ab8190e9db4f62f0b6957b53c9d87db77c284b69f33ea/pyzmq-27.1.0-cp312-abi3-win32.whl", hash = "sha256:250e5436a4ba13885494412b3da5d518cd0d3a278a1ae640e113c073a5f88edd", size = 559184 }, + { url = "https://files.pythonhosted.org/packages/fc/7f/a21b20d577e4100c6a41795842028235998a643b1ad406a6d4163ea8f53e/pyzmq-27.1.0-cp312-abi3-win_amd64.whl", hash = "sha256:9ce490cf1d2ca2ad84733aa1d69ce6855372cb5ce9223802450c9b2a7cba0ccf", size = 619480 }, + { url = "https://files.pythonhosted.org/packages/78/c2/c012beae5f76b72f007a9e91ee9401cb88c51d0f83c6257a03e785c81cc2/pyzmq-27.1.0-cp312-abi3-win_arm64.whl", hash = "sha256:75a2f36223f0d535a0c919e23615fc85a1e23b71f40c7eb43d7b1dedb4d8f15f", size = 552993 }, + { url = "https://files.pythonhosted.org/packages/60/cb/84a13459c51da6cec1b7b1dc1a47e6db6da50b77ad7fd9c145842750a011/pyzmq-27.1.0-cp313-cp313-android_24_arm64_v8a.whl", hash = "sha256:93ad4b0855a664229559e45c8d23797ceac03183c7b6f5b4428152a6b06684a5", size = 1122436 }, + { url = "https://files.pythonhosted.org/packages/dc/b6/94414759a69a26c3dd674570a81813c46a078767d931a6c70ad29fc585cb/pyzmq-27.1.0-cp313-cp313-android_24_x86_64.whl", hash = "sha256:fbb4f2400bfda24f12f009cba62ad5734148569ff4949b1b6ec3b519444342e6", size = 1156301 }, + { url = "https://files.pythonhosted.org/packages/a5/ad/15906493fd40c316377fd8a8f6b1f93104f97a752667763c9b9c1b71d42d/pyzmq-27.1.0-cp313-cp313t-macosx_10_15_universal2.whl", hash = "sha256:e343d067f7b151cfe4eb3bb796a7752c9d369eed007b91231e817071d2c2fec7", size = 1341197 }, + { url = "https://files.pythonhosted.org/packages/14/1d/d343f3ce13db53a54cb8946594e567410b2125394dafcc0268d8dda027e0/pyzmq-27.1.0-cp313-cp313t-manylinux2014_i686.manylinux_2_17_i686.whl", hash = "sha256:08363b2011dec81c354d694bdecaef4770e0ae96b9afea70b3f47b973655cc05", size = 897275 }, + { url = "https://files.pythonhosted.org/packages/69/2d/d83dd6d7ca929a2fc67d2c3005415cdf322af7751d773524809f9e585129/pyzmq-27.1.0-cp313-cp313t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d54530c8c8b5b8ddb3318f481297441af102517602b569146185fa10b63f4fa9", size = 660469 }, + { url = "https://files.pythonhosted.org/packages/3e/cd/9822a7af117f4bc0f1952dbe9ef8358eb50a24928efd5edf54210b850259/pyzmq-27.1.0-cp313-cp313t-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:6f3afa12c392f0a44a2414056d730eebc33ec0926aae92b5ad5cf26ebb6cc128", size = 847961 }, + { url = "https://files.pythonhosted.org/packages/9a/12/f003e824a19ed73be15542f172fd0ec4ad0b60cf37436652c93b9df7c585/pyzmq-27.1.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:c65047adafe573ff023b3187bb93faa583151627bc9c51fc4fb2c561ed689d39", size = 1650282 }, + { url = "https://files.pythonhosted.org/packages/d5/4a/e82d788ed58e9a23995cee70dbc20c9aded3d13a92d30d57ec2291f1e8a3/pyzmq-27.1.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:90e6e9441c946a8b0a667356f7078d96411391a3b8f80980315455574177ec97", size = 2024468 }, + { url = "https://files.pythonhosted.org/packages/d9/94/2da0a60841f757481e402b34bf4c8bf57fa54a5466b965de791b1e6f747d/pyzmq-27.1.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:add071b2d25f84e8189aaf0882d39a285b42fa3853016ebab234a5e78c7a43db", size = 1885394 }, + { url = "https://files.pythonhosted.org/packages/4f/6f/55c10e2e49ad52d080dc24e37adb215e5b0d64990b57598abc2e3f01725b/pyzmq-27.1.0-cp313-cp313t-win32.whl", hash = "sha256:7ccc0700cfdf7bd487bea8d850ec38f204478681ea02a582a8da8171b7f90a1c", size = 574964 }, + { url = "https://files.pythonhosted.org/packages/87/4d/2534970ba63dd7c522d8ca80fb92777f362c0f321900667c615e2067cb29/pyzmq-27.1.0-cp313-cp313t-win_amd64.whl", hash = "sha256:8085a9fba668216b9b4323be338ee5437a235fe275b9d1610e422ccc279733e2", size = 641029 }, + { url = "https://files.pythonhosted.org/packages/f6/fa/f8aea7a28b0641f31d40dea42d7ef003fded31e184ef47db696bc74cd610/pyzmq-27.1.0-cp313-cp313t-win_arm64.whl", hash = "sha256:6bb54ca21bcfe361e445256c15eedf083f153811c37be87e0514934d6913061e", size = 561541 }, + { url = "https://files.pythonhosted.org/packages/87/45/19efbb3000956e82d0331bafca5d9ac19ea2857722fa2caacefb6042f39d/pyzmq-27.1.0-cp314-cp314t-macosx_10_15_universal2.whl", hash = "sha256:ce980af330231615756acd5154f29813d553ea555485ae712c491cd483df6b7a", size = 1341197 }, + { url = "https://files.pythonhosted.org/packages/48/43/d72ccdbf0d73d1343936296665826350cb1e825f92f2db9db3e61c2162a2/pyzmq-27.1.0-cp314-cp314t-manylinux2014_i686.manylinux_2_17_i686.whl", hash = "sha256:1779be8c549e54a1c38f805e56d2a2e5c009d26de10921d7d51cfd1c8d4632ea", size = 897175 }, + { url = "https://files.pythonhosted.org/packages/2f/2e/a483f73a10b65a9ef0161e817321d39a770b2acf8bcf3004a28d90d14a94/pyzmq-27.1.0-cp314-cp314t-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7200bb0f03345515df50d99d3db206a0a6bee1955fbb8c453c76f5bf0e08fb96", size = 660427 }, + { url = "https://files.pythonhosted.org/packages/f5/d2/5f36552c2d3e5685abe60dfa56f91169f7a2d99bbaf67c5271022ab40863/pyzmq-27.1.0-cp314-cp314t-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:01c0e07d558b06a60773744ea6251f769cd79a41a97d11b8bf4ab8f034b0424d", size = 847929 }, + { url = "https://files.pythonhosted.org/packages/c4/2a/404b331f2b7bf3198e9945f75c4c521f0c6a3a23b51f7a4a401b94a13833/pyzmq-27.1.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:80d834abee71f65253c91540445d37c4c561e293ba6e741b992f20a105d69146", size = 1650193 }, + { url = "https://files.pythonhosted.org/packages/1c/0b/f4107e33f62a5acf60e3ded67ed33d79b4ce18de432625ce2fc5093d6388/pyzmq-27.1.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:544b4e3b7198dde4a62b8ff6685e9802a9a1ebf47e77478a5eb88eca2a82f2fd", size = 2024388 }, + { url = "https://files.pythonhosted.org/packages/0d/01/add31fe76512642fd6e40e3a3bd21f4b47e242c8ba33efb6809e37076d9b/pyzmq-27.1.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:cedc4c68178e59a4046f97eca31b148ddcf51e88677de1ef4e78cf06c5376c9a", size = 1885316 }, + { url = "https://files.pythonhosted.org/packages/c4/59/a5f38970f9bf07cee96128de79590bb354917914a9be11272cfc7ff26af0/pyzmq-27.1.0-cp314-cp314t-win32.whl", hash = "sha256:1f0b2a577fd770aa6f053211a55d1c47901f4d537389a034c690291485e5fe92", size = 587472 }, + { url = "https://files.pythonhosted.org/packages/70/d8/78b1bad170f93fcf5e3536e70e8fadac55030002275c9a29e8f5719185de/pyzmq-27.1.0-cp314-cp314t-win_amd64.whl", hash = "sha256:19c9468ae0437f8074af379e986c5d3d7d7bfe033506af442e8c879732bedbe0", size = 661401 }, + { url = "https://files.pythonhosted.org/packages/81/d6/4bfbb40c9a0b42fc53c7cf442f6385db70b40f74a783130c5d0a5aa62228/pyzmq-27.1.0-cp314-cp314t-win_arm64.whl", hash = "sha256:dc5dbf68a7857b59473f7df42650c621d7e8923fb03fa74a526890f4d33cc4d7", size = 575170 }, + { url = "https://files.pythonhosted.org/packages/4c/c6/c4dcdecdbaa70969ee1fdced6d7b8f60cfabe64d25361f27ac4665a70620/pyzmq-27.1.0-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:18770c8d3563715387139060d37859c02ce40718d1faf299abddcdcc6a649066", size = 836265 }, + { url = "https://files.pythonhosted.org/packages/3e/79/f38c92eeaeb03a2ccc2ba9866f0439593bb08c5e3b714ac1d553e5c96e25/pyzmq-27.1.0-pp311-pypy311_pp73-manylinux2014_i686.manylinux_2_17_i686.whl", hash = "sha256:ac25465d42f92e990f8d8b0546b01c391ad431c3bf447683fdc40565941d0604", size = 800208 }, + { url = "https://files.pythonhosted.org/packages/49/0e/3f0d0d335c6b3abb9b7b723776d0b21fa7f3a6c819a0db6097059aada160/pyzmq-27.1.0-pp311-pypy311_pp73-manylinux_2_26_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:53b40f8ae006f2734ee7608d59ed661419f087521edbfc2149c3932e9c14808c", size = 567747 }, + { url = "https://files.pythonhosted.org/packages/a1/cf/f2b3784d536250ffd4be70e049f3b60981235d70c6e8ce7e3ef21e1adb25/pyzmq-27.1.0-pp311-pypy311_pp73-manylinux_2_26_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f605d884e7c8be8fe1aa94e0a783bf3f591b84c24e4bc4f3e7564c82ac25e271", size = 747371 }, + { url = "https://files.pythonhosted.org/packages/01/1b/5dbe84eefc86f48473947e2f41711aded97eecef1231f4558f1f02713c12/pyzmq-27.1.0-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:c9f7f6e13dff2e44a6afeaf2cf54cee5929ad64afaf4d40b50f93c58fc687355", size = 544862 }, ] [[package]] @@ -2719,9 +2738,9 @@ dependencies = [ { name = "rpds-py" }, { name = "typing-extensions", marker = "python_full_version < '3.13'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/22/f5/df4e9027acead3ecc63e50fe1e36aca1523e1719559c499951bb4b53188f/referencing-0.37.0.tar.gz", hash = "sha256:44aefc3142c5b842538163acb373e24cce6632bd54bdb01b21ad5863489f50d8", size = 78036, upload-time = "2025-10-13T15:30:48.871Z" } +sdist = { url = "https://files.pythonhosted.org/packages/22/f5/df4e9027acead3ecc63e50fe1e36aca1523e1719559c499951bb4b53188f/referencing-0.37.0.tar.gz", hash = "sha256:44aefc3142c5b842538163acb373e24cce6632bd54bdb01b21ad5863489f50d8", size = 78036 } wheels = [ - { url = "https://files.pythonhosted.org/packages/2c/58/ca301544e1fa93ed4f80d724bf5b194f6e4b945841c5bfd555878eea9fcb/referencing-0.37.0-py3-none-any.whl", hash = "sha256:381329a9f99628c9069361716891d34ad94af76e461dcb0335825aecc7692231", size = 26766, upload-time = "2025-10-13T15:30:47.625Z" }, + { url = "https://files.pythonhosted.org/packages/2c/58/ca301544e1fa93ed4f80d724bf5b194f6e4b945841c5bfd555878eea9fcb/referencing-0.37.0-py3-none-any.whl", hash = "sha256:381329a9f99628c9069361716891d34ad94af76e461dcb0335825aecc7692231", size = 26766 }, ] [[package]] @@ -2734,9 +2753,9 @@ dependencies = [ { name = "idna" }, { name = "urllib3" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/c9/74/b3ff8e6c8446842c3f5c837e9c3dfcfe2018ea6ecef224c710c85ef728f4/requests-2.32.5.tar.gz", hash = "sha256:dbba0bac56e100853db0ea71b82b4dfd5fe2bf6d3754a8893c3af500cec7d7cf", size = 134517, upload-time = "2025-08-18T20:46:02.573Z" } +sdist = { url = "https://files.pythonhosted.org/packages/c9/74/b3ff8e6c8446842c3f5c837e9c3dfcfe2018ea6ecef224c710c85ef728f4/requests-2.32.5.tar.gz", hash = "sha256:dbba0bac56e100853db0ea71b82b4dfd5fe2bf6d3754a8893c3af500cec7d7cf", size = 134517 } wheels = [ - { url = "https://files.pythonhosted.org/packages/1e/db/4254e3eabe8020b458f1a747140d32277ec7a271daf1d235b70dc0b4e6e3/requests-2.32.5-py3-none-any.whl", hash = "sha256:2462f94637a34fd532264295e186976db0f5d453d1cdd31473c85a6a161affb6", size = 64738, upload-time = "2025-08-18T20:46:00.542Z" }, + { url = "https://files.pythonhosted.org/packages/1e/db/4254e3eabe8020b458f1a747140d32277ec7a271daf1d235b70dc0b4e6e3/requests-2.32.5-py3-none-any.whl", hash = "sha256:2462f94637a34fd532264295e186976db0f5d453d1cdd31473c85a6a161affb6", size = 64738 }, ] [[package]] @@ -2746,18 +2765,18 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "six" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/28/ea/a9387748e2d111c3c2b275ba970b735e04e15cdb1eb30693b6b5708c4dbd/rfc3339_validator-0.1.4.tar.gz", hash = "sha256:138a2abdf93304ad60530167e51d2dfb9549521a836871b88d7f4695d0022f6b", size = 5513, upload-time = "2021-05-12T16:37:54.178Z" } +sdist = { url = "https://files.pythonhosted.org/packages/28/ea/a9387748e2d111c3c2b275ba970b735e04e15cdb1eb30693b6b5708c4dbd/rfc3339_validator-0.1.4.tar.gz", hash = "sha256:138a2abdf93304ad60530167e51d2dfb9549521a836871b88d7f4695d0022f6b", size = 5513 } wheels = [ - { url = "https://files.pythonhosted.org/packages/7b/44/4e421b96b67b2daff264473f7465db72fbdf36a07e05494f50300cc7b0c6/rfc3339_validator-0.1.4-py2.py3-none-any.whl", hash = "sha256:24f6ec1eda14ef823da9e36ec7113124b39c04d50a4d3d3a3c2859577e7791fa", size = 3490, upload-time = "2021-05-12T16:37:52.536Z" }, + { url = "https://files.pythonhosted.org/packages/7b/44/4e421b96b67b2daff264473f7465db72fbdf36a07e05494f50300cc7b0c6/rfc3339_validator-0.1.4-py2.py3-none-any.whl", hash = "sha256:24f6ec1eda14ef823da9e36ec7113124b39c04d50a4d3d3a3c2859577e7791fa", size = 3490 }, ] [[package]] name = "rfc3986-validator" version = "0.1.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/da/88/f270de456dd7d11dcc808abfa291ecdd3f45ff44e3b549ffa01b126464d0/rfc3986_validator-0.1.1.tar.gz", hash = "sha256:3d44bde7921b3b9ec3ae4e3adca370438eccebc676456449b145d533b240d055", size = 6760, upload-time = "2019-10-28T16:00:19.144Z" } +sdist = { url = "https://files.pythonhosted.org/packages/da/88/f270de456dd7d11dcc808abfa291ecdd3f45ff44e3b549ffa01b126464d0/rfc3986_validator-0.1.1.tar.gz", hash = "sha256:3d44bde7921b3b9ec3ae4e3adca370438eccebc676456449b145d533b240d055", size = 6760 } wheels = [ - { url = "https://files.pythonhosted.org/packages/9e/51/17023c0f8f1869d8806b979a2bffa3f861f26a3f1a66b094288323fba52f/rfc3986_validator-0.1.1-py2.py3-none-any.whl", hash = "sha256:2f235c432ef459970b4306369336b9d5dbdda31b510ca1e327636e01f528bfa9", size = 4242, upload-time = "2019-10-28T16:00:13.976Z" }, + { url = "https://files.pythonhosted.org/packages/9e/51/17023c0f8f1869d8806b979a2bffa3f861f26a3f1a66b094288323fba52f/rfc3986_validator-0.1.1-py2.py3-none-any.whl", hash = "sha256:2f235c432ef459970b4306369336b9d5dbdda31b510ca1e327636e01f528bfa9", size = 4242 }, ] [[package]] @@ -2767,9 +2786,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "lark" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/2c/06/37c1a5557acf449e8e406a830a05bf885ac47d33270aec454ef78675008d/rfc3987_syntax-1.1.0.tar.gz", hash = "sha256:717a62cbf33cffdd16dfa3a497d81ce48a660ea691b1ddd7be710c22f00b4a0d", size = 14239, upload-time = "2025-07-18T01:05:05.015Z" } +sdist = { url = "https://files.pythonhosted.org/packages/2c/06/37c1a5557acf449e8e406a830a05bf885ac47d33270aec454ef78675008d/rfc3987_syntax-1.1.0.tar.gz", hash = "sha256:717a62cbf33cffdd16dfa3a497d81ce48a660ea691b1ddd7be710c22f00b4a0d", size = 14239 } wheels = [ - { url = "https://files.pythonhosted.org/packages/7e/71/44ce230e1b7fadd372515a97e32a83011f906ddded8d03e3c6aafbdedbb7/rfc3987_syntax-1.1.0-py3-none-any.whl", hash = "sha256:6c3d97604e4c5ce9f714898e05401a0445a641cfa276432b0a648c80856f6a3f", size = 8046, upload-time = "2025-07-18T01:05:03.843Z" }, + { url = "https://files.pythonhosted.org/packages/7e/71/44ce230e1b7fadd372515a97e32a83011f906ddded8d03e3c6aafbdedbb7/rfc3987_syntax-1.1.0-py3-none-any.whl", hash = "sha256:6c3d97604e4c5ce9f714898e05401a0445a641cfa276432b0a648c80856f6a3f", size = 8046 }, ] [[package]] @@ -2780,152 +2799,152 @@ dependencies = [ { name = "markdown-it-py" }, { name = "pygments" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/fb/d2/8920e102050a0de7bfabeb4c4614a49248cf8d5d7a8d01885fbb24dc767a/rich-14.2.0.tar.gz", hash = "sha256:73ff50c7c0c1c77c8243079283f4edb376f0f6442433aecb8ce7e6d0b92d1fe4", size = 219990, upload-time = "2025-10-09T14:16:53.064Z" } +sdist = { url = "https://files.pythonhosted.org/packages/fb/d2/8920e102050a0de7bfabeb4c4614a49248cf8d5d7a8d01885fbb24dc767a/rich-14.2.0.tar.gz", hash = "sha256:73ff50c7c0c1c77c8243079283f4edb376f0f6442433aecb8ce7e6d0b92d1fe4", size = 219990 } wheels = [ - { url = "https://files.pythonhosted.org/packages/25/7a/b0178788f8dc6cafce37a212c99565fa1fe7872c70c6c9c1e1a372d9d88f/rich-14.2.0-py3-none-any.whl", hash = "sha256:76bc51fe2e57d2b1be1f96c524b890b816e334ab4c1e45888799bfaab0021edd", size = 243393, upload-time = "2025-10-09T14:16:51.245Z" }, + { url = "https://files.pythonhosted.org/packages/25/7a/b0178788f8dc6cafce37a212c99565fa1fe7872c70c6c9c1e1a372d9d88f/rich-14.2.0-py3-none-any.whl", hash = "sha256:76bc51fe2e57d2b1be1f96c524b890b816e334ab4c1e45888799bfaab0021edd", size = 243393 }, ] [[package]] name = "roman-numerals-py" version = "3.1.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/30/76/48fd56d17c5bdbdf65609abbc67288728a98ed4c02919428d4f52d23b24b/roman_numerals_py-3.1.0.tar.gz", hash = "sha256:be4bf804f083a4ce001b5eb7e3c0862479d10f94c936f6c4e5f250aa5ff5bd2d", size = 9017, upload-time = "2025-02-22T07:34:54.333Z" } +sdist = { url = "https://files.pythonhosted.org/packages/30/76/48fd56d17c5bdbdf65609abbc67288728a98ed4c02919428d4f52d23b24b/roman_numerals_py-3.1.0.tar.gz", hash = "sha256:be4bf804f083a4ce001b5eb7e3c0862479d10f94c936f6c4e5f250aa5ff5bd2d", size = 9017 } wheels = [ - { url = "https://files.pythonhosted.org/packages/53/97/d2cbbaa10c9b826af0e10fdf836e1bf344d9f0abb873ebc34d1f49642d3f/roman_numerals_py-3.1.0-py3-none-any.whl", hash = "sha256:9da2ad2fb670bcf24e81070ceb3be72f6c11c440d73bd579fbeca1e9f330954c", size = 7742, upload-time = "2025-02-22T07:34:52.422Z" }, + { url = "https://files.pythonhosted.org/packages/53/97/d2cbbaa10c9b826af0e10fdf836e1bf344d9f0abb873ebc34d1f49642d3f/roman_numerals_py-3.1.0-py3-none-any.whl", hash = "sha256:9da2ad2fb670bcf24e81070ceb3be72f6c11c440d73bd579fbeca1e9f330954c", size = 7742 }, ] [[package]] name = "rpds-py" version = "0.28.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/48/dc/95f074d43452b3ef5d06276696ece4b3b5d696e7c9ad7173c54b1390cd70/rpds_py-0.28.0.tar.gz", hash = "sha256:abd4df20485a0983e2ca334a216249b6186d6e3c1627e106651943dbdb791aea", size = 27419, upload-time = "2025-10-22T22:24:29.327Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/a6/34/058d0db5471c6be7bef82487ad5021ff8d1d1d27794be8730aad938649cf/rpds_py-0.28.0-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:03065002fd2e287725d95fbc69688e0c6daf6c6314ba38bdbaa3895418e09296", size = 362344, upload-time = "2025-10-22T22:21:39.713Z" }, - { url = "https://files.pythonhosted.org/packages/5d/67/9503f0ec8c055a0782880f300c50a2b8e5e72eb1f94dfc2053da527444dd/rpds_py-0.28.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:28ea02215f262b6d078daec0b45344c89e161eab9526b0d898221d96fdda5f27", size = 348440, upload-time = "2025-10-22T22:21:41.056Z" }, - { url = "https://files.pythonhosted.org/packages/68/2e/94223ee9b32332a41d75b6f94b37b4ce3e93878a556fc5f152cbd856a81f/rpds_py-0.28.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:25dbade8fbf30bcc551cb352376c0ad64b067e4fc56f90e22ba70c3ce205988c", size = 379068, upload-time = "2025-10-22T22:21:42.593Z" }, - { url = "https://files.pythonhosted.org/packages/b4/25/54fd48f9f680cfc44e6a7f39a5fadf1d4a4a1fd0848076af4a43e79f998c/rpds_py-0.28.0-cp311-cp311-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:3c03002f54cc855860bfdc3442928ffdca9081e73b5b382ed0b9e8efe6e5e205", size = 390518, upload-time = "2025-10-22T22:21:43.998Z" }, - { url = "https://files.pythonhosted.org/packages/1b/85/ac258c9c27f2ccb1bd5d0697e53a82ebcf8088e3186d5d2bf8498ee7ed44/rpds_py-0.28.0-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:b9699fa7990368b22032baf2b2dce1f634388e4ffc03dfefaaac79f4695edc95", size = 525319, upload-time = "2025-10-22T22:21:45.645Z" }, - { url = "https://files.pythonhosted.org/packages/40/cb/c6734774789566d46775f193964b76627cd5f42ecf246d257ce84d1912ed/rpds_py-0.28.0-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:b9b06fe1a75e05e0713f06ea0c89ecb6452210fd60e2f1b6ddc1067b990e08d9", size = 404896, upload-time = "2025-10-22T22:21:47.544Z" }, - { url = "https://files.pythonhosted.org/packages/1f/53/14e37ce83202c632c89b0691185dca9532288ff9d390eacae3d2ff771bae/rpds_py-0.28.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ac9f83e7b326a3f9ec3ef84cda98fb0a74c7159f33e692032233046e7fd15da2", size = 382862, upload-time = "2025-10-22T22:21:49.176Z" }, - { url = "https://files.pythonhosted.org/packages/6a/83/f3642483ca971a54d60caa4449f9d6d4dbb56a53e0072d0deff51b38af74/rpds_py-0.28.0-cp311-cp311-manylinux_2_31_riscv64.whl", hash = "sha256:0d3259ea9ad8743a75a43eb7819324cdab393263c91be86e2d1901ee65c314e0", size = 398848, upload-time = "2025-10-22T22:21:51.024Z" }, - { url = "https://files.pythonhosted.org/packages/44/09/2d9c8b2f88e399b4cfe86efdf2935feaf0394e4f14ab30c6c5945d60af7d/rpds_py-0.28.0-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:9a7548b345f66f6695943b4ef6afe33ccd3f1b638bd9afd0f730dd255c249c9e", size = 412030, upload-time = "2025-10-22T22:21:52.665Z" }, - { url = "https://files.pythonhosted.org/packages/dd/f5/e1cec473d4bde6df1fd3738be8e82d64dd0600868e76e92dfeaebbc2d18f/rpds_py-0.28.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:c9a40040aa388b037eb39416710fbcce9443498d2eaab0b9b45ae988b53f5c67", size = 559700, upload-time = "2025-10-22T22:21:54.123Z" }, - { url = "https://files.pythonhosted.org/packages/8d/be/73bb241c1649edbf14e98e9e78899c2c5e52bbe47cb64811f44d2cc11808/rpds_py-0.28.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:8f60c7ea34e78c199acd0d3cda37a99be2c861dd2b8cf67399784f70c9f8e57d", size = 584581, upload-time = "2025-10-22T22:21:56.102Z" }, - { url = "https://files.pythonhosted.org/packages/9c/9c/ffc6e9218cd1eb5c2c7dbd276c87cd10e8c2232c456b554169eb363381df/rpds_py-0.28.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:1571ae4292649100d743b26d5f9c63503bb1fedf538a8f29a98dce2d5ba6b4e6", size = 549981, upload-time = "2025-10-22T22:21:58.253Z" }, - { url = "https://files.pythonhosted.org/packages/5f/50/da8b6d33803a94df0149345ee33e5d91ed4d25fc6517de6a25587eae4133/rpds_py-0.28.0-cp311-cp311-win32.whl", hash = "sha256:5cfa9af45e7c1140af7321fa0bef25b386ee9faa8928c80dc3a5360971a29e8c", size = 214729, upload-time = "2025-10-22T22:21:59.625Z" }, - { url = "https://files.pythonhosted.org/packages/12/fd/b0f48c4c320ee24c8c20df8b44acffb7353991ddf688af01eef5f93d7018/rpds_py-0.28.0-cp311-cp311-win_amd64.whl", hash = "sha256:dd8d86b5d29d1b74100982424ba53e56033dc47720a6de9ba0259cf81d7cecaa", size = 223977, upload-time = "2025-10-22T22:22:01.092Z" }, - { url = "https://files.pythonhosted.org/packages/b4/21/c8e77a2ac66e2ec4e21f18a04b4e9a0417ecf8e61b5eaeaa9360a91713b4/rpds_py-0.28.0-cp311-cp311-win_arm64.whl", hash = "sha256:4e27d3a5709cc2b3e013bf93679a849213c79ae0573f9b894b284b55e729e120", size = 217326, upload-time = "2025-10-22T22:22:02.944Z" }, - { url = "https://files.pythonhosted.org/packages/b8/5c/6c3936495003875fe7b14f90ea812841a08fca50ab26bd840e924097d9c8/rpds_py-0.28.0-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:6b4f28583a4f247ff60cd7bdda83db8c3f5b05a7a82ff20dd4b078571747708f", size = 366439, upload-time = "2025-10-22T22:22:04.525Z" }, - { url = "https://files.pythonhosted.org/packages/56/f9/a0f1ca194c50aa29895b442771f036a25b6c41a35e4f35b1a0ea713bedae/rpds_py-0.28.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:d678e91b610c29c4b3d52a2c148b641df2b4676ffe47c59f6388d58b99cdc424", size = 348170, upload-time = "2025-10-22T22:22:06.397Z" }, - { url = "https://files.pythonhosted.org/packages/18/ea/42d243d3a586beb72c77fa5def0487daf827210069a95f36328e869599ea/rpds_py-0.28.0-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e819e0e37a44a78e1383bf1970076e2ccc4dc8c2bbaa2f9bd1dc987e9afff628", size = 378838, upload-time = "2025-10-22T22:22:07.932Z" }, - { url = "https://files.pythonhosted.org/packages/e7/78/3de32e18a94791af8f33601402d9d4f39613136398658412a4e0b3047327/rpds_py-0.28.0-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:5ee514e0f0523db5d3fb171f397c54875dbbd69760a414dccf9d4d7ad628b5bd", size = 393299, upload-time = "2025-10-22T22:22:09.435Z" }, - { url = "https://files.pythonhosted.org/packages/13/7e/4bdb435afb18acea2eb8a25ad56b956f28de7c59f8a1d32827effa0d4514/rpds_py-0.28.0-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:5f3fa06d27fdcee47f07a39e02862da0100cb4982508f5ead53ec533cd5fe55e", size = 518000, upload-time = "2025-10-22T22:22:11.326Z" }, - { url = "https://files.pythonhosted.org/packages/31/d0/5f52a656875cdc60498ab035a7a0ac8f399890cc1ee73ebd567bac4e39ae/rpds_py-0.28.0-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:46959ef2e64f9e4a41fc89aa20dbca2b85531f9a72c21099a3360f35d10b0d5a", size = 408746, upload-time = "2025-10-22T22:22:13.143Z" }, - { url = "https://files.pythonhosted.org/packages/3e/cd/49ce51767b879cde77e7ad9fae164ea15dce3616fe591d9ea1df51152706/rpds_py-0.28.0-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8455933b4bcd6e83fde3fefc987a023389c4b13f9a58c8d23e4b3f6d13f78c84", size = 386379, upload-time = "2025-10-22T22:22:14.602Z" }, - { url = "https://files.pythonhosted.org/packages/6a/99/e4e1e1ee93a98f72fc450e36c0e4d99c35370220e815288e3ecd2ec36a2a/rpds_py-0.28.0-cp312-cp312-manylinux_2_31_riscv64.whl", hash = "sha256:ad50614a02c8c2962feebe6012b52f9802deec4263946cddea37aaf28dd25a66", size = 401280, upload-time = "2025-10-22T22:22:16.063Z" }, - { url = "https://files.pythonhosted.org/packages/61/35/e0c6a57488392a8b319d2200d03dad2b29c0db9996f5662c3b02d0b86c02/rpds_py-0.28.0-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:e5deca01b271492553fdb6c7fd974659dce736a15bae5dad7ab8b93555bceb28", size = 412365, upload-time = "2025-10-22T22:22:17.504Z" }, - { url = "https://files.pythonhosted.org/packages/ff/6a/841337980ea253ec797eb084665436007a1aad0faac1ba097fb906c5f69c/rpds_py-0.28.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:735f8495a13159ce6a0d533f01e8674cec0c57038c920495f87dcb20b3ddb48a", size = 559573, upload-time = "2025-10-22T22:22:19.108Z" }, - { url = "https://files.pythonhosted.org/packages/e7/5e/64826ec58afd4c489731f8b00729c5f6afdb86f1df1df60bfede55d650bb/rpds_py-0.28.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:961ca621ff10d198bbe6ba4957decca61aa2a0c56695384c1d6b79bf61436df5", size = 583973, upload-time = "2025-10-22T22:22:20.768Z" }, - { url = "https://files.pythonhosted.org/packages/b6/ee/44d024b4843f8386a4eeaa4c171b3d31d55f7177c415545fd1a24c249b5d/rpds_py-0.28.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:2374e16cc9131022e7d9a8f8d65d261d9ba55048c78f3b6e017971a4f5e6353c", size = 553800, upload-time = "2025-10-22T22:22:22.25Z" }, - { url = "https://files.pythonhosted.org/packages/7d/89/33e675dccff11a06d4d85dbb4d1865f878d5020cbb69b2c1e7b2d3f82562/rpds_py-0.28.0-cp312-cp312-win32.whl", hash = "sha256:d15431e334fba488b081d47f30f091e5d03c18527c325386091f31718952fe08", size = 216954, upload-time = "2025-10-22T22:22:24.105Z" }, - { url = "https://files.pythonhosted.org/packages/af/36/45f6ebb3210887e8ee6dbf1bc710ae8400bb417ce165aaf3024b8360d999/rpds_py-0.28.0-cp312-cp312-win_amd64.whl", hash = "sha256:a410542d61fc54710f750d3764380b53bf09e8c4edbf2f9141a82aa774a04f7c", size = 227844, upload-time = "2025-10-22T22:22:25.551Z" }, - { url = "https://files.pythonhosted.org/packages/57/91/f3fb250d7e73de71080f9a221d19bd6a1c1eb0d12a1ea26513f6c1052ad6/rpds_py-0.28.0-cp312-cp312-win_arm64.whl", hash = "sha256:1f0cfd1c69e2d14f8c892b893997fa9a60d890a0c8a603e88dca4955f26d1edd", size = 217624, upload-time = "2025-10-22T22:22:26.914Z" }, - { url = "https://files.pythonhosted.org/packages/d3/03/ce566d92611dfac0085c2f4b048cd53ed7c274a5c05974b882a908d540a2/rpds_py-0.28.0-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:e9e184408a0297086f880556b6168fa927d677716f83d3472ea333b42171ee3b", size = 366235, upload-time = "2025-10-22T22:22:28.397Z" }, - { url = "https://files.pythonhosted.org/packages/00/34/1c61da1b25592b86fd285bd7bd8422f4c9d748a7373b46126f9ae792a004/rpds_py-0.28.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:edd267266a9b0448f33dc465a97cfc5d467594b600fe28e7fa2f36450e03053a", size = 348241, upload-time = "2025-10-22T22:22:30.171Z" }, - { url = "https://files.pythonhosted.org/packages/fc/00/ed1e28616848c61c493a067779633ebf4b569eccaacf9ccbdc0e7cba2b9d/rpds_py-0.28.0-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:85beb8b3f45e4e32f6802fb6cd6b17f615ef6c6a52f265371fb916fae02814aa", size = 378079, upload-time = "2025-10-22T22:22:31.644Z" }, - { url = "https://files.pythonhosted.org/packages/11/b2/ccb30333a16a470091b6e50289adb4d3ec656fd9951ba8c5e3aaa0746a67/rpds_py-0.28.0-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:d2412be8d00a1b895f8ad827cc2116455196e20ed994bb704bf138fe91a42724", size = 393151, upload-time = "2025-10-22T22:22:33.453Z" }, - { url = "https://files.pythonhosted.org/packages/8c/d0/73e2217c3ee486d555cb84920597480627d8c0240ff3062005c6cc47773e/rpds_py-0.28.0-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:cf128350d384b777da0e68796afdcebc2e9f63f0e9f242217754e647f6d32491", size = 517520, upload-time = "2025-10-22T22:22:34.949Z" }, - { url = "https://files.pythonhosted.org/packages/c4/91/23efe81c700427d0841a4ae7ea23e305654381831e6029499fe80be8a071/rpds_py-0.28.0-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a2036d09b363aa36695d1cc1a97b36865597f4478470b0697b5ee9403f4fe399", size = 408699, upload-time = "2025-10-22T22:22:36.584Z" }, - { url = "https://files.pythonhosted.org/packages/ca/ee/a324d3198da151820a326c1f988caaa4f37fc27955148a76fff7a2d787a9/rpds_py-0.28.0-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b8e1e9be4fa6305a16be628959188e4fd5cd6f1b0e724d63c6d8b2a8adf74ea6", size = 385720, upload-time = "2025-10-22T22:22:38.014Z" }, - { url = "https://files.pythonhosted.org/packages/19/ad/e68120dc05af8b7cab4a789fccd8cdcf0fe7e6581461038cc5c164cd97d2/rpds_py-0.28.0-cp313-cp313-manylinux_2_31_riscv64.whl", hash = "sha256:0a403460c9dd91a7f23fc3188de6d8977f1d9603a351d5db6cf20aaea95b538d", size = 401096, upload-time = "2025-10-22T22:22:39.869Z" }, - { url = "https://files.pythonhosted.org/packages/99/90/c1e070620042459d60df6356b666bb1f62198a89d68881816a7ed121595a/rpds_py-0.28.0-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:d7366b6553cdc805abcc512b849a519167db8f5e5c3472010cd1228b224265cb", size = 411465, upload-time = "2025-10-22T22:22:41.395Z" }, - { url = "https://files.pythonhosted.org/packages/68/61/7c195b30d57f1b8d5970f600efee72a4fad79ec829057972e13a0370fd24/rpds_py-0.28.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:5b43c6a3726efd50f18d8120ec0551241c38785b68952d240c45ea553912ac41", size = 558832, upload-time = "2025-10-22T22:22:42.871Z" }, - { url = "https://files.pythonhosted.org/packages/b0/3d/06f3a718864773f69941d4deccdf18e5e47dd298b4628062f004c10f3b34/rpds_py-0.28.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:0cb7203c7bc69d7c1585ebb33a2e6074492d2fc21ad28a7b9d40457ac2a51ab7", size = 583230, upload-time = "2025-10-22T22:22:44.877Z" }, - { url = "https://files.pythonhosted.org/packages/66/df/62fc783781a121e77fee9a21ead0a926f1b652280a33f5956a5e7833ed30/rpds_py-0.28.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:7a52a5169c664dfb495882adc75c304ae1d50df552fbd68e100fdc719dee4ff9", size = 553268, upload-time = "2025-10-22T22:22:46.441Z" }, - { url = "https://files.pythonhosted.org/packages/84/85/d34366e335140a4837902d3dea89b51f087bd6a63c993ebdff59e93ee61d/rpds_py-0.28.0-cp313-cp313-win32.whl", hash = "sha256:2e42456917b6687215b3e606ab46aa6bca040c77af7df9a08a6dcfe8a4d10ca5", size = 217100, upload-time = "2025-10-22T22:22:48.342Z" }, - { url = "https://files.pythonhosted.org/packages/3c/1c/f25a3f3752ad7601476e3eff395fe075e0f7813fbb9862bd67c82440e880/rpds_py-0.28.0-cp313-cp313-win_amd64.whl", hash = "sha256:e0a0311caedc8069d68fc2bf4c9019b58a2d5ce3cd7cb656c845f1615b577e1e", size = 227759, upload-time = "2025-10-22T22:22:50.219Z" }, - { url = "https://files.pythonhosted.org/packages/e0/d6/5f39b42b99615b5bc2f36ab90423ea404830bdfee1c706820943e9a645eb/rpds_py-0.28.0-cp313-cp313-win_arm64.whl", hash = "sha256:04c1b207ab8b581108801528d59ad80aa83bb170b35b0ddffb29c20e411acdc1", size = 217326, upload-time = "2025-10-22T22:22:51.647Z" }, - { url = "https://files.pythonhosted.org/packages/5c/8b/0c69b72d1cee20a63db534be0df271effe715ef6c744fdf1ff23bb2b0b1c/rpds_py-0.28.0-cp313-cp313t-macosx_10_12_x86_64.whl", hash = "sha256:f296ea3054e11fc58ad42e850e8b75c62d9a93a9f981ad04b2e5ae7d2186ff9c", size = 355736, upload-time = "2025-10-22T22:22:53.211Z" }, - { url = "https://files.pythonhosted.org/packages/f7/6d/0c2ee773cfb55c31a8514d2cece856dd299170a49babd50dcffb15ddc749/rpds_py-0.28.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:5a7306c19b19005ad98468fcefeb7100b19c79fc23a5f24a12e06d91181193fa", size = 342677, upload-time = "2025-10-22T22:22:54.723Z" }, - { url = "https://files.pythonhosted.org/packages/e2/1c/22513ab25a27ea205144414724743e305e8153e6abe81833b5e678650f5a/rpds_py-0.28.0-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e5d9b86aa501fed9862a443c5c3116f6ead8bc9296185f369277c42542bd646b", size = 371847, upload-time = "2025-10-22T22:22:56.295Z" }, - { url = "https://files.pythonhosted.org/packages/60/07/68e6ccdb4b05115ffe61d31afc94adef1833d3a72f76c9632d4d90d67954/rpds_py-0.28.0-cp313-cp313t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:e5bbc701eff140ba0e872691d573b3d5d30059ea26e5785acba9132d10c8c31d", size = 381800, upload-time = "2025-10-22T22:22:57.808Z" }, - { url = "https://files.pythonhosted.org/packages/73/bf/6d6d15df80781d7f9f368e7c1a00caf764436518c4877fb28b029c4624af/rpds_py-0.28.0-cp313-cp313t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:9a5690671cd672a45aa8616d7374fdf334a1b9c04a0cac3c854b1136e92374fe", size = 518827, upload-time = "2025-10-22T22:22:59.826Z" }, - { url = "https://files.pythonhosted.org/packages/7b/d3/2decbb2976cc452cbf12a2b0aaac5f1b9dc5dd9d1f7e2509a3ee00421249/rpds_py-0.28.0-cp313-cp313t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:9f1d92ecea4fa12f978a367c32a5375a1982834649cdb96539dcdc12e609ab1a", size = 399471, upload-time = "2025-10-22T22:23:01.968Z" }, - { url = "https://files.pythonhosted.org/packages/b1/2c/f30892f9e54bd02e5faca3f6a26d6933c51055e67d54818af90abed9748e/rpds_py-0.28.0-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8d252db6b1a78d0a3928b6190156042d54c93660ce4d98290d7b16b5296fb7cc", size = 377578, upload-time = "2025-10-22T22:23:03.52Z" }, - { url = "https://files.pythonhosted.org/packages/f0/5d/3bce97e5534157318f29ac06bf2d279dae2674ec12f7cb9c12739cee64d8/rpds_py-0.28.0-cp313-cp313t-manylinux_2_31_riscv64.whl", hash = "sha256:d61b355c3275acb825f8777d6c4505f42b5007e357af500939d4a35b19177259", size = 390482, upload-time = "2025-10-22T22:23:05.391Z" }, - { url = "https://files.pythonhosted.org/packages/e3/f0/886bd515ed457b5bd93b166175edb80a0b21a210c10e993392127f1e3931/rpds_py-0.28.0-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:acbe5e8b1026c0c580d0321c8aae4b0a1e1676861d48d6e8c6586625055b606a", size = 402447, upload-time = "2025-10-22T22:23:06.93Z" }, - { url = "https://files.pythonhosted.org/packages/42/b5/71e8777ac55e6af1f4f1c05b47542a1eaa6c33c1cf0d300dca6a1c6e159a/rpds_py-0.28.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:8aa23b6f0fc59b85b4c7d89ba2965af274346f738e8d9fc2455763602e62fd5f", size = 552385, upload-time = "2025-10-22T22:23:08.557Z" }, - { url = "https://files.pythonhosted.org/packages/5d/cb/6ca2d70cbda5a8e36605e7788c4aa3bea7c17d71d213465a5a675079b98d/rpds_py-0.28.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:7b14b0c680286958817c22d76fcbca4800ddacef6f678f3a7c79a1fe7067fe37", size = 575642, upload-time = "2025-10-22T22:23:10.348Z" }, - { url = "https://files.pythonhosted.org/packages/4a/d4/407ad9960ca7856d7b25c96dcbe019270b5ffdd83a561787bc682c797086/rpds_py-0.28.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:bcf1d210dfee61a6c86551d67ee1031899c0fdbae88b2d44a569995d43797712", size = 544507, upload-time = "2025-10-22T22:23:12.434Z" }, - { url = "https://files.pythonhosted.org/packages/51/31/2f46fe0efcac23fbf5797c6b6b7e1c76f7d60773e525cb65fcbc582ee0f2/rpds_py-0.28.0-cp313-cp313t-win32.whl", hash = "sha256:3aa4dc0fdab4a7029ac63959a3ccf4ed605fee048ba67ce89ca3168da34a1342", size = 205376, upload-time = "2025-10-22T22:23:13.979Z" }, - { url = "https://files.pythonhosted.org/packages/92/e4/15947bda33cbedfc134490a41841ab8870a72a867a03d4969d886f6594a2/rpds_py-0.28.0-cp313-cp313t-win_amd64.whl", hash = "sha256:7b7d9d83c942855e4fdcfa75d4f96f6b9e272d42fffcb72cd4bb2577db2e2907", size = 215907, upload-time = "2025-10-22T22:23:15.5Z" }, - { url = "https://files.pythonhosted.org/packages/08/47/ffe8cd7a6a02833b10623bf765fbb57ce977e9a4318ca0e8cf97e9c3d2b3/rpds_py-0.28.0-cp314-cp314-macosx_10_12_x86_64.whl", hash = "sha256:dcdcb890b3ada98a03f9f2bb108489cdc7580176cb73b4f2d789e9a1dac1d472", size = 353830, upload-time = "2025-10-22T22:23:17.03Z" }, - { url = "https://files.pythonhosted.org/packages/f9/9f/890f36cbd83a58491d0d91ae0db1702639edb33fb48eeb356f80ecc6b000/rpds_py-0.28.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:f274f56a926ba2dc02976ca5b11c32855cbd5925534e57cfe1fda64e04d1add2", size = 341819, upload-time = "2025-10-22T22:23:18.57Z" }, - { url = "https://files.pythonhosted.org/packages/09/e3/921eb109f682aa24fb76207698fbbcf9418738f35a40c21652c29053f23d/rpds_py-0.28.0-cp314-cp314-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4fe0438ac4a29a520ea94c8c7f1754cdd8feb1bc490dfda1bfd990072363d527", size = 373127, upload-time = "2025-10-22T22:23:20.216Z" }, - { url = "https://files.pythonhosted.org/packages/23/13/bce4384d9f8f4989f1a9599c71b7a2d877462e5fd7175e1f69b398f729f4/rpds_py-0.28.0-cp314-cp314-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:8a358a32dd3ae50e933347889b6af9a1bdf207ba5d1a3f34e1a38cd3540e6733", size = 382767, upload-time = "2025-10-22T22:23:21.787Z" }, - { url = "https://files.pythonhosted.org/packages/23/e1/579512b2d89a77c64ccef5a0bc46a6ef7f72ae0cf03d4b26dcd52e57ee0a/rpds_py-0.28.0-cp314-cp314-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:e80848a71c78aa328fefaba9c244d588a342c8e03bda518447b624ea64d1ff56", size = 517585, upload-time = "2025-10-22T22:23:23.699Z" }, - { url = "https://files.pythonhosted.org/packages/62/3c/ca704b8d324a2591b0b0adcfcaadf9c862375b11f2f667ac03c61b4fd0a6/rpds_py-0.28.0-cp314-cp314-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f586db2e209d54fe177e58e0bc4946bea5fb0102f150b1b2f13de03e1f0976f8", size = 399828, upload-time = "2025-10-22T22:23:25.713Z" }, - { url = "https://files.pythonhosted.org/packages/da/37/e84283b9e897e3adc46b4c88bb3f6ec92a43bd4d2f7ef5b13459963b2e9c/rpds_py-0.28.0-cp314-cp314-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5ae8ee156d6b586e4292491e885d41483136ab994e719a13458055bec14cf370", size = 375509, upload-time = "2025-10-22T22:23:27.32Z" }, - { url = "https://files.pythonhosted.org/packages/1a/c2/a980beab869d86258bf76ec42dec778ba98151f253a952b02fe36d72b29c/rpds_py-0.28.0-cp314-cp314-manylinux_2_31_riscv64.whl", hash = "sha256:a805e9b3973f7e27f7cab63a6b4f61d90f2e5557cff73b6e97cd5b8540276d3d", size = 392014, upload-time = "2025-10-22T22:23:29.332Z" }, - { url = "https://files.pythonhosted.org/packages/da/b5/b1d3c5f9d3fa5aeef74265f9c64de3c34a0d6d5cd3c81c8b17d5c8f10ed4/rpds_py-0.28.0-cp314-cp314-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:5d3fd16b6dc89c73a4da0b4ac8b12a7ecc75b2864b95c9e5afed8003cb50a728", size = 402410, upload-time = "2025-10-22T22:23:31.14Z" }, - { url = "https://files.pythonhosted.org/packages/74/ae/cab05ff08dfcc052afc73dcb38cbc765ffc86f94e966f3924cd17492293c/rpds_py-0.28.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:6796079e5d24fdaba6d49bda28e2c47347e89834678f2bc2c1b4fc1489c0fb01", size = 553593, upload-time = "2025-10-22T22:23:32.834Z" }, - { url = "https://files.pythonhosted.org/packages/70/80/50d5706ea2a9bfc9e9c5f401d91879e7c790c619969369800cde202da214/rpds_py-0.28.0-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:76500820c2af232435cbe215e3324c75b950a027134e044423f59f5b9a1ba515", size = 576925, upload-time = "2025-10-22T22:23:34.47Z" }, - { url = "https://files.pythonhosted.org/packages/ab/12/85a57d7a5855a3b188d024b099fd09c90db55d32a03626d0ed16352413ff/rpds_py-0.28.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:bbdc5640900a7dbf9dd707fe6388972f5bbd883633eb68b76591044cfe346f7e", size = 542444, upload-time = "2025-10-22T22:23:36.093Z" }, - { url = "https://files.pythonhosted.org/packages/6c/65/10643fb50179509150eb94d558e8837c57ca8b9adc04bd07b98e57b48f8c/rpds_py-0.28.0-cp314-cp314-win32.whl", hash = "sha256:adc8aa88486857d2b35d75f0640b949759f79dc105f50aa2c27816b2e0dd749f", size = 207968, upload-time = "2025-10-22T22:23:37.638Z" }, - { url = "https://files.pythonhosted.org/packages/b4/84/0c11fe4d9aaea784ff4652499e365963222481ac647bcd0251c88af646eb/rpds_py-0.28.0-cp314-cp314-win_amd64.whl", hash = "sha256:66e6fa8e075b58946e76a78e69e1a124a21d9a48a5b4766d15ba5b06869d1fa1", size = 218876, upload-time = "2025-10-22T22:23:39.179Z" }, - { url = "https://files.pythonhosted.org/packages/0f/e0/3ab3b86ded7bb18478392dc3e835f7b754cd446f62f3fc96f4fe2aca78f6/rpds_py-0.28.0-cp314-cp314-win_arm64.whl", hash = "sha256:a6fe887c2c5c59413353b7c0caff25d0e566623501ccfff88957fa438a69377d", size = 212506, upload-time = "2025-10-22T22:23:40.755Z" }, - { url = "https://files.pythonhosted.org/packages/51/ec/d5681bb425226c3501eab50fc30e9d275de20c131869322c8a1729c7b61c/rpds_py-0.28.0-cp314-cp314t-macosx_10_12_x86_64.whl", hash = "sha256:7a69df082db13c7070f7b8b1f155fa9e687f1d6aefb7b0e3f7231653b79a067b", size = 355433, upload-time = "2025-10-22T22:23:42.259Z" }, - { url = "https://files.pythonhosted.org/packages/be/ec/568c5e689e1cfb1ea8b875cffea3649260955f677fdd7ddc6176902d04cd/rpds_py-0.28.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:b1cde22f2c30ebb049a9e74c5374994157b9b70a16147d332f89c99c5960737a", size = 342601, upload-time = "2025-10-22T22:23:44.372Z" }, - { url = "https://files.pythonhosted.org/packages/32/fe/51ada84d1d2a1d9d8f2c902cfddd0133b4a5eb543196ab5161d1c07ed2ad/rpds_py-0.28.0-cp314-cp314t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:5338742f6ba7a51012ea470bd4dc600a8c713c0c72adaa0977a1b1f4327d6592", size = 372039, upload-time = "2025-10-22T22:23:46.025Z" }, - { url = "https://files.pythonhosted.org/packages/07/c1/60144a2f2620abade1a78e0d91b298ac2d9b91bc08864493fa00451ef06e/rpds_py-0.28.0-cp314-cp314t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:e1460ebde1bcf6d496d80b191d854adedcc619f84ff17dc1c6d550f58c9efbba", size = 382407, upload-time = "2025-10-22T22:23:48.098Z" }, - { url = "https://files.pythonhosted.org/packages/45/ed/091a7bbdcf4038a60a461df50bc4c82a7ed6d5d5e27649aab61771c17585/rpds_py-0.28.0-cp314-cp314t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:e3eb248f2feba84c692579257a043a7699e28a77d86c77b032c1d9fbb3f0219c", size = 518172, upload-time = "2025-10-22T22:23:50.16Z" }, - { url = "https://files.pythonhosted.org/packages/54/dd/02cc90c2fd9c2ef8016fd7813bfacd1c3a1325633ec8f244c47b449fc868/rpds_py-0.28.0-cp314-cp314t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:bd3bbba5def70b16cd1c1d7255666aad3b290fbf8d0fe7f9f91abafb73611a91", size = 399020, upload-time = "2025-10-22T22:23:51.81Z" }, - { url = "https://files.pythonhosted.org/packages/ab/81/5d98cc0329bbb911ccecd0b9e19fbf7f3a5de8094b4cda5e71013b2dd77e/rpds_py-0.28.0-cp314-cp314t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3114f4db69ac5a1f32e7e4d1cbbe7c8f9cf8217f78e6e002cedf2d54c2a548ed", size = 377451, upload-time = "2025-10-22T22:23:53.711Z" }, - { url = "https://files.pythonhosted.org/packages/b4/07/4d5bcd49e3dfed2d38e2dcb49ab6615f2ceb9f89f5a372c46dbdebb4e028/rpds_py-0.28.0-cp314-cp314t-manylinux_2_31_riscv64.whl", hash = "sha256:4b0cb8a906b1a0196b863d460c0222fb8ad0f34041568da5620f9799b83ccf0b", size = 390355, upload-time = "2025-10-22T22:23:55.299Z" }, - { url = "https://files.pythonhosted.org/packages/3f/79/9f14ba9010fee74e4f40bf578735cfcbb91d2e642ffd1abe429bb0b96364/rpds_py-0.28.0-cp314-cp314t-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:cf681ac76a60b667106141e11a92a3330890257e6f559ca995fbb5265160b56e", size = 403146, upload-time = "2025-10-22T22:23:56.929Z" }, - { url = "https://files.pythonhosted.org/packages/39/4c/f08283a82ac141331a83a40652830edd3a4a92c34e07e2bbe00baaea2f5f/rpds_py-0.28.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:1e8ee6413cfc677ce8898d9cde18cc3a60fc2ba756b0dec5b71eb6eb21c49fa1", size = 552656, upload-time = "2025-10-22T22:23:58.62Z" }, - { url = "https://files.pythonhosted.org/packages/61/47/d922fc0666f0dd8e40c33990d055f4cc6ecff6f502c2d01569dbed830f9b/rpds_py-0.28.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:b3072b16904d0b5572a15eb9d31c1954e0d3227a585fc1351aa9878729099d6c", size = 576782, upload-time = "2025-10-22T22:24:00.312Z" }, - { url = "https://files.pythonhosted.org/packages/d3/0c/5bafdd8ccf6aa9d3bfc630cfece457ff5b581af24f46a9f3590f790e3df2/rpds_py-0.28.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:b670c30fd87a6aec281c3c9896d3bae4b205fd75d79d06dc87c2503717e46092", size = 544671, upload-time = "2025-10-22T22:24:02.297Z" }, - { url = "https://files.pythonhosted.org/packages/2c/37/dcc5d8397caa924988693519069d0beea077a866128719351a4ad95e82fc/rpds_py-0.28.0-cp314-cp314t-win32.whl", hash = "sha256:8014045a15b4d2b3476f0a287fcc93d4f823472d7d1308d47884ecac9e612be3", size = 205749, upload-time = "2025-10-22T22:24:03.848Z" }, - { url = "https://files.pythonhosted.org/packages/d7/69/64d43b21a10d72b45939a28961216baeb721cc2a430f5f7c3bfa21659a53/rpds_py-0.28.0-cp314-cp314t-win_amd64.whl", hash = "sha256:7a4e59c90d9c27c561eb3160323634a9ff50b04e4f7820600a2beb0ac90db578", size = 216233, upload-time = "2025-10-22T22:24:05.471Z" }, - { url = "https://files.pythonhosted.org/packages/ae/bc/b43f2ea505f28119bd551ae75f70be0c803d2dbcd37c1b3734909e40620b/rpds_py-0.28.0-pp311-pypy311_pp73-macosx_10_12_x86_64.whl", hash = "sha256:f5e7101145427087e493b9c9b959da68d357c28c562792300dd21a095118ed16", size = 363913, upload-time = "2025-10-22T22:24:07.129Z" }, - { url = "https://files.pythonhosted.org/packages/28/f2/db318195d324c89a2c57dc5195058cbadd71b20d220685c5bd1da79ee7fe/rpds_py-0.28.0-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:31eb671150b9c62409a888850aaa8e6533635704fe2b78335f9aaf7ff81eec4d", size = 350452, upload-time = "2025-10-22T22:24:08.754Z" }, - { url = "https://files.pythonhosted.org/packages/ae/f2/1391c819b8573a4898cedd6b6c5ec5bc370ce59e5d6bdcebe3c9c1db4588/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:48b55c1f64482f7d8bd39942f376bfdf2f6aec637ee8c805b5041e14eeb771db", size = 380957, upload-time = "2025-10-22T22:24:10.826Z" }, - { url = "https://files.pythonhosted.org/packages/5a/5c/e5de68ee7eb7248fce93269833d1b329a196d736aefb1a7481d1e99d1222/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:24743a7b372e9a76171f6b69c01aedf927e8ac3e16c474d9fe20d552a8cb45c7", size = 391919, upload-time = "2025-10-22T22:24:12.559Z" }, - { url = "https://files.pythonhosted.org/packages/fb/4f/2376336112cbfeb122fd435d608ad8d5041b3aed176f85a3cb32c262eb80/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:389c29045ee8bbb1627ea190b4976a310a295559eaf9f1464a1a6f2bf84dde78", size = 528541, upload-time = "2025-10-22T22:24:14.197Z" }, - { url = "https://files.pythonhosted.org/packages/68/53/5ae232e795853dd20da7225c5dd13a09c0a905b1a655e92bdf8d78a99fd9/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:23690b5827e643150cf7b49569679ec13fe9a610a15949ed48b85eb7f98f34ec", size = 405629, upload-time = "2025-10-22T22:24:16.001Z" }, - { url = "https://files.pythonhosted.org/packages/b9/2d/351a3b852b683ca9b6b8b38ed9efb2347596973849ba6c3a0e99877c10aa/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6f0c9266c26580e7243ad0d72fc3e01d6b33866cfab5084a6da7576bcf1c4f72", size = 384123, upload-time = "2025-10-22T22:24:17.585Z" }, - { url = "https://files.pythonhosted.org/packages/e0/15/870804daa00202728cc91cb8e2385fa9f1f4eb49857c49cfce89e304eae6/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_31_riscv64.whl", hash = "sha256:4c6c4db5d73d179746951486df97fd25e92396be07fc29ee8ff9a8f5afbdfb27", size = 400923, upload-time = "2025-10-22T22:24:19.512Z" }, - { url = "https://files.pythonhosted.org/packages/53/25/3706b83c125fa2a0bccceac951de3f76631f6bd0ee4d02a0ed780712ef1b/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:a3b695a8fa799dd2cfdb4804b37096c5f6dba1ac7f48a7fbf6d0485bcd060316", size = 413767, upload-time = "2025-10-22T22:24:21.316Z" }, - { url = "https://files.pythonhosted.org/packages/ef/f9/ce43dbe62767432273ed2584cef71fef8411bddfb64125d4c19128015018/rpds_py-0.28.0-pp311-pypy311_pp73-musllinux_1_2_aarch64.whl", hash = "sha256:6aa1bfce3f83baf00d9c5fcdbba93a3ab79958b4c7d7d1f55e7fe68c20e63912", size = 561530, upload-time = "2025-10-22T22:24:22.958Z" }, - { url = "https://files.pythonhosted.org/packages/46/c9/ffe77999ed8f81e30713dd38fd9ecaa161f28ec48bb80fa1cd9118399c27/rpds_py-0.28.0-pp311-pypy311_pp73-musllinux_1_2_i686.whl", hash = "sha256:7b0f9dceb221792b3ee6acb5438eb1f02b0cb2c247796a72b016dcc92c6de829", size = 585453, upload-time = "2025-10-22T22:24:24.779Z" }, - { url = "https://files.pythonhosted.org/packages/ed/d2/4a73b18821fd4669762c855fd1f4e80ceb66fb72d71162d14da58444a763/rpds_py-0.28.0-pp311-pypy311_pp73-musllinux_1_2_x86_64.whl", hash = "sha256:5d0145edba8abd3db0ab22b5300c99dc152f5c9021fab861be0f0544dc3cbc5f", size = 552199, upload-time = "2025-10-22T22:24:26.54Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/48/dc/95f074d43452b3ef5d06276696ece4b3b5d696e7c9ad7173c54b1390cd70/rpds_py-0.28.0.tar.gz", hash = "sha256:abd4df20485a0983e2ca334a216249b6186d6e3c1627e106651943dbdb791aea", size = 27419 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/a6/34/058d0db5471c6be7bef82487ad5021ff8d1d1d27794be8730aad938649cf/rpds_py-0.28.0-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:03065002fd2e287725d95fbc69688e0c6daf6c6314ba38bdbaa3895418e09296", size = 362344 }, + { url = "https://files.pythonhosted.org/packages/5d/67/9503f0ec8c055a0782880f300c50a2b8e5e72eb1f94dfc2053da527444dd/rpds_py-0.28.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:28ea02215f262b6d078daec0b45344c89e161eab9526b0d898221d96fdda5f27", size = 348440 }, + { url = "https://files.pythonhosted.org/packages/68/2e/94223ee9b32332a41d75b6f94b37b4ce3e93878a556fc5f152cbd856a81f/rpds_py-0.28.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:25dbade8fbf30bcc551cb352376c0ad64b067e4fc56f90e22ba70c3ce205988c", size = 379068 }, + { url = "https://files.pythonhosted.org/packages/b4/25/54fd48f9f680cfc44e6a7f39a5fadf1d4a4a1fd0848076af4a43e79f998c/rpds_py-0.28.0-cp311-cp311-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:3c03002f54cc855860bfdc3442928ffdca9081e73b5b382ed0b9e8efe6e5e205", size = 390518 }, + { url = "https://files.pythonhosted.org/packages/1b/85/ac258c9c27f2ccb1bd5d0697e53a82ebcf8088e3186d5d2bf8498ee7ed44/rpds_py-0.28.0-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:b9699fa7990368b22032baf2b2dce1f634388e4ffc03dfefaaac79f4695edc95", size = 525319 }, + { url = "https://files.pythonhosted.org/packages/40/cb/c6734774789566d46775f193964b76627cd5f42ecf246d257ce84d1912ed/rpds_py-0.28.0-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:b9b06fe1a75e05e0713f06ea0c89ecb6452210fd60e2f1b6ddc1067b990e08d9", size = 404896 }, + { url = "https://files.pythonhosted.org/packages/1f/53/14e37ce83202c632c89b0691185dca9532288ff9d390eacae3d2ff771bae/rpds_py-0.28.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ac9f83e7b326a3f9ec3ef84cda98fb0a74c7159f33e692032233046e7fd15da2", size = 382862 }, + { url = "https://files.pythonhosted.org/packages/6a/83/f3642483ca971a54d60caa4449f9d6d4dbb56a53e0072d0deff51b38af74/rpds_py-0.28.0-cp311-cp311-manylinux_2_31_riscv64.whl", hash = "sha256:0d3259ea9ad8743a75a43eb7819324cdab393263c91be86e2d1901ee65c314e0", size = 398848 }, + { url = "https://files.pythonhosted.org/packages/44/09/2d9c8b2f88e399b4cfe86efdf2935feaf0394e4f14ab30c6c5945d60af7d/rpds_py-0.28.0-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:9a7548b345f66f6695943b4ef6afe33ccd3f1b638bd9afd0f730dd255c249c9e", size = 412030 }, + { url = "https://files.pythonhosted.org/packages/dd/f5/e1cec473d4bde6df1fd3738be8e82d64dd0600868e76e92dfeaebbc2d18f/rpds_py-0.28.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:c9a40040aa388b037eb39416710fbcce9443498d2eaab0b9b45ae988b53f5c67", size = 559700 }, + { url = "https://files.pythonhosted.org/packages/8d/be/73bb241c1649edbf14e98e9e78899c2c5e52bbe47cb64811f44d2cc11808/rpds_py-0.28.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:8f60c7ea34e78c199acd0d3cda37a99be2c861dd2b8cf67399784f70c9f8e57d", size = 584581 }, + { url = "https://files.pythonhosted.org/packages/9c/9c/ffc6e9218cd1eb5c2c7dbd276c87cd10e8c2232c456b554169eb363381df/rpds_py-0.28.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:1571ae4292649100d743b26d5f9c63503bb1fedf538a8f29a98dce2d5ba6b4e6", size = 549981 }, + { url = "https://files.pythonhosted.org/packages/5f/50/da8b6d33803a94df0149345ee33e5d91ed4d25fc6517de6a25587eae4133/rpds_py-0.28.0-cp311-cp311-win32.whl", hash = "sha256:5cfa9af45e7c1140af7321fa0bef25b386ee9faa8928c80dc3a5360971a29e8c", size = 214729 }, + { url = "https://files.pythonhosted.org/packages/12/fd/b0f48c4c320ee24c8c20df8b44acffb7353991ddf688af01eef5f93d7018/rpds_py-0.28.0-cp311-cp311-win_amd64.whl", hash = "sha256:dd8d86b5d29d1b74100982424ba53e56033dc47720a6de9ba0259cf81d7cecaa", size = 223977 }, + { url = "https://files.pythonhosted.org/packages/b4/21/c8e77a2ac66e2ec4e21f18a04b4e9a0417ecf8e61b5eaeaa9360a91713b4/rpds_py-0.28.0-cp311-cp311-win_arm64.whl", hash = "sha256:4e27d3a5709cc2b3e013bf93679a849213c79ae0573f9b894b284b55e729e120", size = 217326 }, + { url = "https://files.pythonhosted.org/packages/b8/5c/6c3936495003875fe7b14f90ea812841a08fca50ab26bd840e924097d9c8/rpds_py-0.28.0-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:6b4f28583a4f247ff60cd7bdda83db8c3f5b05a7a82ff20dd4b078571747708f", size = 366439 }, + { url = "https://files.pythonhosted.org/packages/56/f9/a0f1ca194c50aa29895b442771f036a25b6c41a35e4f35b1a0ea713bedae/rpds_py-0.28.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:d678e91b610c29c4b3d52a2c148b641df2b4676ffe47c59f6388d58b99cdc424", size = 348170 }, + { url = "https://files.pythonhosted.org/packages/18/ea/42d243d3a586beb72c77fa5def0487daf827210069a95f36328e869599ea/rpds_py-0.28.0-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e819e0e37a44a78e1383bf1970076e2ccc4dc8c2bbaa2f9bd1dc987e9afff628", size = 378838 }, + { url = "https://files.pythonhosted.org/packages/e7/78/3de32e18a94791af8f33601402d9d4f39613136398658412a4e0b3047327/rpds_py-0.28.0-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:5ee514e0f0523db5d3fb171f397c54875dbbd69760a414dccf9d4d7ad628b5bd", size = 393299 }, + { url = "https://files.pythonhosted.org/packages/13/7e/4bdb435afb18acea2eb8a25ad56b956f28de7c59f8a1d32827effa0d4514/rpds_py-0.28.0-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:5f3fa06d27fdcee47f07a39e02862da0100cb4982508f5ead53ec533cd5fe55e", size = 518000 }, + { url = "https://files.pythonhosted.org/packages/31/d0/5f52a656875cdc60498ab035a7a0ac8f399890cc1ee73ebd567bac4e39ae/rpds_py-0.28.0-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:46959ef2e64f9e4a41fc89aa20dbca2b85531f9a72c21099a3360f35d10b0d5a", size = 408746 }, + { url = "https://files.pythonhosted.org/packages/3e/cd/49ce51767b879cde77e7ad9fae164ea15dce3616fe591d9ea1df51152706/rpds_py-0.28.0-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8455933b4bcd6e83fde3fefc987a023389c4b13f9a58c8d23e4b3f6d13f78c84", size = 386379 }, + { url = "https://files.pythonhosted.org/packages/6a/99/e4e1e1ee93a98f72fc450e36c0e4d99c35370220e815288e3ecd2ec36a2a/rpds_py-0.28.0-cp312-cp312-manylinux_2_31_riscv64.whl", hash = "sha256:ad50614a02c8c2962feebe6012b52f9802deec4263946cddea37aaf28dd25a66", size = 401280 }, + { url = "https://files.pythonhosted.org/packages/61/35/e0c6a57488392a8b319d2200d03dad2b29c0db9996f5662c3b02d0b86c02/rpds_py-0.28.0-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:e5deca01b271492553fdb6c7fd974659dce736a15bae5dad7ab8b93555bceb28", size = 412365 }, + { url = "https://files.pythonhosted.org/packages/ff/6a/841337980ea253ec797eb084665436007a1aad0faac1ba097fb906c5f69c/rpds_py-0.28.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:735f8495a13159ce6a0d533f01e8674cec0c57038c920495f87dcb20b3ddb48a", size = 559573 }, + { url = "https://files.pythonhosted.org/packages/e7/5e/64826ec58afd4c489731f8b00729c5f6afdb86f1df1df60bfede55d650bb/rpds_py-0.28.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:961ca621ff10d198bbe6ba4957decca61aa2a0c56695384c1d6b79bf61436df5", size = 583973 }, + { url = "https://files.pythonhosted.org/packages/b6/ee/44d024b4843f8386a4eeaa4c171b3d31d55f7177c415545fd1a24c249b5d/rpds_py-0.28.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:2374e16cc9131022e7d9a8f8d65d261d9ba55048c78f3b6e017971a4f5e6353c", size = 553800 }, + { url = "https://files.pythonhosted.org/packages/7d/89/33e675dccff11a06d4d85dbb4d1865f878d5020cbb69b2c1e7b2d3f82562/rpds_py-0.28.0-cp312-cp312-win32.whl", hash = "sha256:d15431e334fba488b081d47f30f091e5d03c18527c325386091f31718952fe08", size = 216954 }, + { url = "https://files.pythonhosted.org/packages/af/36/45f6ebb3210887e8ee6dbf1bc710ae8400bb417ce165aaf3024b8360d999/rpds_py-0.28.0-cp312-cp312-win_amd64.whl", hash = "sha256:a410542d61fc54710f750d3764380b53bf09e8c4edbf2f9141a82aa774a04f7c", size = 227844 }, + { url = "https://files.pythonhosted.org/packages/57/91/f3fb250d7e73de71080f9a221d19bd6a1c1eb0d12a1ea26513f6c1052ad6/rpds_py-0.28.0-cp312-cp312-win_arm64.whl", hash = "sha256:1f0cfd1c69e2d14f8c892b893997fa9a60d890a0c8a603e88dca4955f26d1edd", size = 217624 }, + { url = "https://files.pythonhosted.org/packages/d3/03/ce566d92611dfac0085c2f4b048cd53ed7c274a5c05974b882a908d540a2/rpds_py-0.28.0-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:e9e184408a0297086f880556b6168fa927d677716f83d3472ea333b42171ee3b", size = 366235 }, + { url = "https://files.pythonhosted.org/packages/00/34/1c61da1b25592b86fd285bd7bd8422f4c9d748a7373b46126f9ae792a004/rpds_py-0.28.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:edd267266a9b0448f33dc465a97cfc5d467594b600fe28e7fa2f36450e03053a", size = 348241 }, + { url = "https://files.pythonhosted.org/packages/fc/00/ed1e28616848c61c493a067779633ebf4b569eccaacf9ccbdc0e7cba2b9d/rpds_py-0.28.0-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:85beb8b3f45e4e32f6802fb6cd6b17f615ef6c6a52f265371fb916fae02814aa", size = 378079 }, + { url = "https://files.pythonhosted.org/packages/11/b2/ccb30333a16a470091b6e50289adb4d3ec656fd9951ba8c5e3aaa0746a67/rpds_py-0.28.0-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:d2412be8d00a1b895f8ad827cc2116455196e20ed994bb704bf138fe91a42724", size = 393151 }, + { url = "https://files.pythonhosted.org/packages/8c/d0/73e2217c3ee486d555cb84920597480627d8c0240ff3062005c6cc47773e/rpds_py-0.28.0-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:cf128350d384b777da0e68796afdcebc2e9f63f0e9f242217754e647f6d32491", size = 517520 }, + { url = "https://files.pythonhosted.org/packages/c4/91/23efe81c700427d0841a4ae7ea23e305654381831e6029499fe80be8a071/rpds_py-0.28.0-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a2036d09b363aa36695d1cc1a97b36865597f4478470b0697b5ee9403f4fe399", size = 408699 }, + { url = "https://files.pythonhosted.org/packages/ca/ee/a324d3198da151820a326c1f988caaa4f37fc27955148a76fff7a2d787a9/rpds_py-0.28.0-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b8e1e9be4fa6305a16be628959188e4fd5cd6f1b0e724d63c6d8b2a8adf74ea6", size = 385720 }, + { url = "https://files.pythonhosted.org/packages/19/ad/e68120dc05af8b7cab4a789fccd8cdcf0fe7e6581461038cc5c164cd97d2/rpds_py-0.28.0-cp313-cp313-manylinux_2_31_riscv64.whl", hash = "sha256:0a403460c9dd91a7f23fc3188de6d8977f1d9603a351d5db6cf20aaea95b538d", size = 401096 }, + { url = "https://files.pythonhosted.org/packages/99/90/c1e070620042459d60df6356b666bb1f62198a89d68881816a7ed121595a/rpds_py-0.28.0-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:d7366b6553cdc805abcc512b849a519167db8f5e5c3472010cd1228b224265cb", size = 411465 }, + { url = "https://files.pythonhosted.org/packages/68/61/7c195b30d57f1b8d5970f600efee72a4fad79ec829057972e13a0370fd24/rpds_py-0.28.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:5b43c6a3726efd50f18d8120ec0551241c38785b68952d240c45ea553912ac41", size = 558832 }, + { url = "https://files.pythonhosted.org/packages/b0/3d/06f3a718864773f69941d4deccdf18e5e47dd298b4628062f004c10f3b34/rpds_py-0.28.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:0cb7203c7bc69d7c1585ebb33a2e6074492d2fc21ad28a7b9d40457ac2a51ab7", size = 583230 }, + { url = "https://files.pythonhosted.org/packages/66/df/62fc783781a121e77fee9a21ead0a926f1b652280a33f5956a5e7833ed30/rpds_py-0.28.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:7a52a5169c664dfb495882adc75c304ae1d50df552fbd68e100fdc719dee4ff9", size = 553268 }, + { url = "https://files.pythonhosted.org/packages/84/85/d34366e335140a4837902d3dea89b51f087bd6a63c993ebdff59e93ee61d/rpds_py-0.28.0-cp313-cp313-win32.whl", hash = "sha256:2e42456917b6687215b3e606ab46aa6bca040c77af7df9a08a6dcfe8a4d10ca5", size = 217100 }, + { url = "https://files.pythonhosted.org/packages/3c/1c/f25a3f3752ad7601476e3eff395fe075e0f7813fbb9862bd67c82440e880/rpds_py-0.28.0-cp313-cp313-win_amd64.whl", hash = "sha256:e0a0311caedc8069d68fc2bf4c9019b58a2d5ce3cd7cb656c845f1615b577e1e", size = 227759 }, + { url = "https://files.pythonhosted.org/packages/e0/d6/5f39b42b99615b5bc2f36ab90423ea404830bdfee1c706820943e9a645eb/rpds_py-0.28.0-cp313-cp313-win_arm64.whl", hash = "sha256:04c1b207ab8b581108801528d59ad80aa83bb170b35b0ddffb29c20e411acdc1", size = 217326 }, + { url = "https://files.pythonhosted.org/packages/5c/8b/0c69b72d1cee20a63db534be0df271effe715ef6c744fdf1ff23bb2b0b1c/rpds_py-0.28.0-cp313-cp313t-macosx_10_12_x86_64.whl", hash = "sha256:f296ea3054e11fc58ad42e850e8b75c62d9a93a9f981ad04b2e5ae7d2186ff9c", size = 355736 }, + { url = "https://files.pythonhosted.org/packages/f7/6d/0c2ee773cfb55c31a8514d2cece856dd299170a49babd50dcffb15ddc749/rpds_py-0.28.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:5a7306c19b19005ad98468fcefeb7100b19c79fc23a5f24a12e06d91181193fa", size = 342677 }, + { url = "https://files.pythonhosted.org/packages/e2/1c/22513ab25a27ea205144414724743e305e8153e6abe81833b5e678650f5a/rpds_py-0.28.0-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e5d9b86aa501fed9862a443c5c3116f6ead8bc9296185f369277c42542bd646b", size = 371847 }, + { url = "https://files.pythonhosted.org/packages/60/07/68e6ccdb4b05115ffe61d31afc94adef1833d3a72f76c9632d4d90d67954/rpds_py-0.28.0-cp313-cp313t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:e5bbc701eff140ba0e872691d573b3d5d30059ea26e5785acba9132d10c8c31d", size = 381800 }, + { url = "https://files.pythonhosted.org/packages/73/bf/6d6d15df80781d7f9f368e7c1a00caf764436518c4877fb28b029c4624af/rpds_py-0.28.0-cp313-cp313t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:9a5690671cd672a45aa8616d7374fdf334a1b9c04a0cac3c854b1136e92374fe", size = 518827 }, + { url = "https://files.pythonhosted.org/packages/7b/d3/2decbb2976cc452cbf12a2b0aaac5f1b9dc5dd9d1f7e2509a3ee00421249/rpds_py-0.28.0-cp313-cp313t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:9f1d92ecea4fa12f978a367c32a5375a1982834649cdb96539dcdc12e609ab1a", size = 399471 }, + { url = "https://files.pythonhosted.org/packages/b1/2c/f30892f9e54bd02e5faca3f6a26d6933c51055e67d54818af90abed9748e/rpds_py-0.28.0-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8d252db6b1a78d0a3928b6190156042d54c93660ce4d98290d7b16b5296fb7cc", size = 377578 }, + { url = "https://files.pythonhosted.org/packages/f0/5d/3bce97e5534157318f29ac06bf2d279dae2674ec12f7cb9c12739cee64d8/rpds_py-0.28.0-cp313-cp313t-manylinux_2_31_riscv64.whl", hash = "sha256:d61b355c3275acb825f8777d6c4505f42b5007e357af500939d4a35b19177259", size = 390482 }, + { url = "https://files.pythonhosted.org/packages/e3/f0/886bd515ed457b5bd93b166175edb80a0b21a210c10e993392127f1e3931/rpds_py-0.28.0-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:acbe5e8b1026c0c580d0321c8aae4b0a1e1676861d48d6e8c6586625055b606a", size = 402447 }, + { url = "https://files.pythonhosted.org/packages/42/b5/71e8777ac55e6af1f4f1c05b47542a1eaa6c33c1cf0d300dca6a1c6e159a/rpds_py-0.28.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:8aa23b6f0fc59b85b4c7d89ba2965af274346f738e8d9fc2455763602e62fd5f", size = 552385 }, + { url = "https://files.pythonhosted.org/packages/5d/cb/6ca2d70cbda5a8e36605e7788c4aa3bea7c17d71d213465a5a675079b98d/rpds_py-0.28.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:7b14b0c680286958817c22d76fcbca4800ddacef6f678f3a7c79a1fe7067fe37", size = 575642 }, + { url = "https://files.pythonhosted.org/packages/4a/d4/407ad9960ca7856d7b25c96dcbe019270b5ffdd83a561787bc682c797086/rpds_py-0.28.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:bcf1d210dfee61a6c86551d67ee1031899c0fdbae88b2d44a569995d43797712", size = 544507 }, + { url = "https://files.pythonhosted.org/packages/51/31/2f46fe0efcac23fbf5797c6b6b7e1c76f7d60773e525cb65fcbc582ee0f2/rpds_py-0.28.0-cp313-cp313t-win32.whl", hash = "sha256:3aa4dc0fdab4a7029ac63959a3ccf4ed605fee048ba67ce89ca3168da34a1342", size = 205376 }, + { url = "https://files.pythonhosted.org/packages/92/e4/15947bda33cbedfc134490a41841ab8870a72a867a03d4969d886f6594a2/rpds_py-0.28.0-cp313-cp313t-win_amd64.whl", hash = "sha256:7b7d9d83c942855e4fdcfa75d4f96f6b9e272d42fffcb72cd4bb2577db2e2907", size = 215907 }, + { url = "https://files.pythonhosted.org/packages/08/47/ffe8cd7a6a02833b10623bf765fbb57ce977e9a4318ca0e8cf97e9c3d2b3/rpds_py-0.28.0-cp314-cp314-macosx_10_12_x86_64.whl", hash = "sha256:dcdcb890b3ada98a03f9f2bb108489cdc7580176cb73b4f2d789e9a1dac1d472", size = 353830 }, + { url = "https://files.pythonhosted.org/packages/f9/9f/890f36cbd83a58491d0d91ae0db1702639edb33fb48eeb356f80ecc6b000/rpds_py-0.28.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:f274f56a926ba2dc02976ca5b11c32855cbd5925534e57cfe1fda64e04d1add2", size = 341819 }, + { url = "https://files.pythonhosted.org/packages/09/e3/921eb109f682aa24fb76207698fbbcf9418738f35a40c21652c29053f23d/rpds_py-0.28.0-cp314-cp314-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4fe0438ac4a29a520ea94c8c7f1754cdd8feb1bc490dfda1bfd990072363d527", size = 373127 }, + { url = "https://files.pythonhosted.org/packages/23/13/bce4384d9f8f4989f1a9599c71b7a2d877462e5fd7175e1f69b398f729f4/rpds_py-0.28.0-cp314-cp314-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:8a358a32dd3ae50e933347889b6af9a1bdf207ba5d1a3f34e1a38cd3540e6733", size = 382767 }, + { url = "https://files.pythonhosted.org/packages/23/e1/579512b2d89a77c64ccef5a0bc46a6ef7f72ae0cf03d4b26dcd52e57ee0a/rpds_py-0.28.0-cp314-cp314-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:e80848a71c78aa328fefaba9c244d588a342c8e03bda518447b624ea64d1ff56", size = 517585 }, + { url = "https://files.pythonhosted.org/packages/62/3c/ca704b8d324a2591b0b0adcfcaadf9c862375b11f2f667ac03c61b4fd0a6/rpds_py-0.28.0-cp314-cp314-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f586db2e209d54fe177e58e0bc4946bea5fb0102f150b1b2f13de03e1f0976f8", size = 399828 }, + { url = "https://files.pythonhosted.org/packages/da/37/e84283b9e897e3adc46b4c88bb3f6ec92a43bd4d2f7ef5b13459963b2e9c/rpds_py-0.28.0-cp314-cp314-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5ae8ee156d6b586e4292491e885d41483136ab994e719a13458055bec14cf370", size = 375509 }, + { url = "https://files.pythonhosted.org/packages/1a/c2/a980beab869d86258bf76ec42dec778ba98151f253a952b02fe36d72b29c/rpds_py-0.28.0-cp314-cp314-manylinux_2_31_riscv64.whl", hash = "sha256:a805e9b3973f7e27f7cab63a6b4f61d90f2e5557cff73b6e97cd5b8540276d3d", size = 392014 }, + { url = "https://files.pythonhosted.org/packages/da/b5/b1d3c5f9d3fa5aeef74265f9c64de3c34a0d6d5cd3c81c8b17d5c8f10ed4/rpds_py-0.28.0-cp314-cp314-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:5d3fd16b6dc89c73a4da0b4ac8b12a7ecc75b2864b95c9e5afed8003cb50a728", size = 402410 }, + { url = "https://files.pythonhosted.org/packages/74/ae/cab05ff08dfcc052afc73dcb38cbc765ffc86f94e966f3924cd17492293c/rpds_py-0.28.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:6796079e5d24fdaba6d49bda28e2c47347e89834678f2bc2c1b4fc1489c0fb01", size = 553593 }, + { url = "https://files.pythonhosted.org/packages/70/80/50d5706ea2a9bfc9e9c5f401d91879e7c790c619969369800cde202da214/rpds_py-0.28.0-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:76500820c2af232435cbe215e3324c75b950a027134e044423f59f5b9a1ba515", size = 576925 }, + { url = "https://files.pythonhosted.org/packages/ab/12/85a57d7a5855a3b188d024b099fd09c90db55d32a03626d0ed16352413ff/rpds_py-0.28.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:bbdc5640900a7dbf9dd707fe6388972f5bbd883633eb68b76591044cfe346f7e", size = 542444 }, + { url = "https://files.pythonhosted.org/packages/6c/65/10643fb50179509150eb94d558e8837c57ca8b9adc04bd07b98e57b48f8c/rpds_py-0.28.0-cp314-cp314-win32.whl", hash = "sha256:adc8aa88486857d2b35d75f0640b949759f79dc105f50aa2c27816b2e0dd749f", size = 207968 }, + { url = "https://files.pythonhosted.org/packages/b4/84/0c11fe4d9aaea784ff4652499e365963222481ac647bcd0251c88af646eb/rpds_py-0.28.0-cp314-cp314-win_amd64.whl", hash = "sha256:66e6fa8e075b58946e76a78e69e1a124a21d9a48a5b4766d15ba5b06869d1fa1", size = 218876 }, + { url = "https://files.pythonhosted.org/packages/0f/e0/3ab3b86ded7bb18478392dc3e835f7b754cd446f62f3fc96f4fe2aca78f6/rpds_py-0.28.0-cp314-cp314-win_arm64.whl", hash = "sha256:a6fe887c2c5c59413353b7c0caff25d0e566623501ccfff88957fa438a69377d", size = 212506 }, + { url = "https://files.pythonhosted.org/packages/51/ec/d5681bb425226c3501eab50fc30e9d275de20c131869322c8a1729c7b61c/rpds_py-0.28.0-cp314-cp314t-macosx_10_12_x86_64.whl", hash = "sha256:7a69df082db13c7070f7b8b1f155fa9e687f1d6aefb7b0e3f7231653b79a067b", size = 355433 }, + { url = "https://files.pythonhosted.org/packages/be/ec/568c5e689e1cfb1ea8b875cffea3649260955f677fdd7ddc6176902d04cd/rpds_py-0.28.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:b1cde22f2c30ebb049a9e74c5374994157b9b70a16147d332f89c99c5960737a", size = 342601 }, + { url = "https://files.pythonhosted.org/packages/32/fe/51ada84d1d2a1d9d8f2c902cfddd0133b4a5eb543196ab5161d1c07ed2ad/rpds_py-0.28.0-cp314-cp314t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:5338742f6ba7a51012ea470bd4dc600a8c713c0c72adaa0977a1b1f4327d6592", size = 372039 }, + { url = "https://files.pythonhosted.org/packages/07/c1/60144a2f2620abade1a78e0d91b298ac2d9b91bc08864493fa00451ef06e/rpds_py-0.28.0-cp314-cp314t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:e1460ebde1bcf6d496d80b191d854adedcc619f84ff17dc1c6d550f58c9efbba", size = 382407 }, + { url = "https://files.pythonhosted.org/packages/45/ed/091a7bbdcf4038a60a461df50bc4c82a7ed6d5d5e27649aab61771c17585/rpds_py-0.28.0-cp314-cp314t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:e3eb248f2feba84c692579257a043a7699e28a77d86c77b032c1d9fbb3f0219c", size = 518172 }, + { url = "https://files.pythonhosted.org/packages/54/dd/02cc90c2fd9c2ef8016fd7813bfacd1c3a1325633ec8f244c47b449fc868/rpds_py-0.28.0-cp314-cp314t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:bd3bbba5def70b16cd1c1d7255666aad3b290fbf8d0fe7f9f91abafb73611a91", size = 399020 }, + { url = "https://files.pythonhosted.org/packages/ab/81/5d98cc0329bbb911ccecd0b9e19fbf7f3a5de8094b4cda5e71013b2dd77e/rpds_py-0.28.0-cp314-cp314t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3114f4db69ac5a1f32e7e4d1cbbe7c8f9cf8217f78e6e002cedf2d54c2a548ed", size = 377451 }, + { url = "https://files.pythonhosted.org/packages/b4/07/4d5bcd49e3dfed2d38e2dcb49ab6615f2ceb9f89f5a372c46dbdebb4e028/rpds_py-0.28.0-cp314-cp314t-manylinux_2_31_riscv64.whl", hash = "sha256:4b0cb8a906b1a0196b863d460c0222fb8ad0f34041568da5620f9799b83ccf0b", size = 390355 }, + { url = "https://files.pythonhosted.org/packages/3f/79/9f14ba9010fee74e4f40bf578735cfcbb91d2e642ffd1abe429bb0b96364/rpds_py-0.28.0-cp314-cp314t-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:cf681ac76a60b667106141e11a92a3330890257e6f559ca995fbb5265160b56e", size = 403146 }, + { url = "https://files.pythonhosted.org/packages/39/4c/f08283a82ac141331a83a40652830edd3a4a92c34e07e2bbe00baaea2f5f/rpds_py-0.28.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:1e8ee6413cfc677ce8898d9cde18cc3a60fc2ba756b0dec5b71eb6eb21c49fa1", size = 552656 }, + { url = "https://files.pythonhosted.org/packages/61/47/d922fc0666f0dd8e40c33990d055f4cc6ecff6f502c2d01569dbed830f9b/rpds_py-0.28.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:b3072b16904d0b5572a15eb9d31c1954e0d3227a585fc1351aa9878729099d6c", size = 576782 }, + { url = "https://files.pythonhosted.org/packages/d3/0c/5bafdd8ccf6aa9d3bfc630cfece457ff5b581af24f46a9f3590f790e3df2/rpds_py-0.28.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:b670c30fd87a6aec281c3c9896d3bae4b205fd75d79d06dc87c2503717e46092", size = 544671 }, + { url = "https://files.pythonhosted.org/packages/2c/37/dcc5d8397caa924988693519069d0beea077a866128719351a4ad95e82fc/rpds_py-0.28.0-cp314-cp314t-win32.whl", hash = "sha256:8014045a15b4d2b3476f0a287fcc93d4f823472d7d1308d47884ecac9e612be3", size = 205749 }, + { url = "https://files.pythonhosted.org/packages/d7/69/64d43b21a10d72b45939a28961216baeb721cc2a430f5f7c3bfa21659a53/rpds_py-0.28.0-cp314-cp314t-win_amd64.whl", hash = "sha256:7a4e59c90d9c27c561eb3160323634a9ff50b04e4f7820600a2beb0ac90db578", size = 216233 }, + { url = "https://files.pythonhosted.org/packages/ae/bc/b43f2ea505f28119bd551ae75f70be0c803d2dbcd37c1b3734909e40620b/rpds_py-0.28.0-pp311-pypy311_pp73-macosx_10_12_x86_64.whl", hash = "sha256:f5e7101145427087e493b9c9b959da68d357c28c562792300dd21a095118ed16", size = 363913 }, + { url = "https://files.pythonhosted.org/packages/28/f2/db318195d324c89a2c57dc5195058cbadd71b20d220685c5bd1da79ee7fe/rpds_py-0.28.0-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:31eb671150b9c62409a888850aaa8e6533635704fe2b78335f9aaf7ff81eec4d", size = 350452 }, + { url = "https://files.pythonhosted.org/packages/ae/f2/1391c819b8573a4898cedd6b6c5ec5bc370ce59e5d6bdcebe3c9c1db4588/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:48b55c1f64482f7d8bd39942f376bfdf2f6aec637ee8c805b5041e14eeb771db", size = 380957 }, + { url = "https://files.pythonhosted.org/packages/5a/5c/e5de68ee7eb7248fce93269833d1b329a196d736aefb1a7481d1e99d1222/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:24743a7b372e9a76171f6b69c01aedf927e8ac3e16c474d9fe20d552a8cb45c7", size = 391919 }, + { url = "https://files.pythonhosted.org/packages/fb/4f/2376336112cbfeb122fd435d608ad8d5041b3aed176f85a3cb32c262eb80/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:389c29045ee8bbb1627ea190b4976a310a295559eaf9f1464a1a6f2bf84dde78", size = 528541 }, + { url = "https://files.pythonhosted.org/packages/68/53/5ae232e795853dd20da7225c5dd13a09c0a905b1a655e92bdf8d78a99fd9/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:23690b5827e643150cf7b49569679ec13fe9a610a15949ed48b85eb7f98f34ec", size = 405629 }, + { url = "https://files.pythonhosted.org/packages/b9/2d/351a3b852b683ca9b6b8b38ed9efb2347596973849ba6c3a0e99877c10aa/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6f0c9266c26580e7243ad0d72fc3e01d6b33866cfab5084a6da7576bcf1c4f72", size = 384123 }, + { url = "https://files.pythonhosted.org/packages/e0/15/870804daa00202728cc91cb8e2385fa9f1f4eb49857c49cfce89e304eae6/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_31_riscv64.whl", hash = "sha256:4c6c4db5d73d179746951486df97fd25e92396be07fc29ee8ff9a8f5afbdfb27", size = 400923 }, + { url = "https://files.pythonhosted.org/packages/53/25/3706b83c125fa2a0bccceac951de3f76631f6bd0ee4d02a0ed780712ef1b/rpds_py-0.28.0-pp311-pypy311_pp73-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:a3b695a8fa799dd2cfdb4804b37096c5f6dba1ac7f48a7fbf6d0485bcd060316", size = 413767 }, + { url = "https://files.pythonhosted.org/packages/ef/f9/ce43dbe62767432273ed2584cef71fef8411bddfb64125d4c19128015018/rpds_py-0.28.0-pp311-pypy311_pp73-musllinux_1_2_aarch64.whl", hash = "sha256:6aa1bfce3f83baf00d9c5fcdbba93a3ab79958b4c7d7d1f55e7fe68c20e63912", size = 561530 }, + { url = "https://files.pythonhosted.org/packages/46/c9/ffe77999ed8f81e30713dd38fd9ecaa161f28ec48bb80fa1cd9118399c27/rpds_py-0.28.0-pp311-pypy311_pp73-musllinux_1_2_i686.whl", hash = "sha256:7b0f9dceb221792b3ee6acb5438eb1f02b0cb2c247796a72b016dcc92c6de829", size = 585453 }, + { url = "https://files.pythonhosted.org/packages/ed/d2/4a73b18821fd4669762c855fd1f4e80ceb66fb72d71162d14da58444a763/rpds_py-0.28.0-pp311-pypy311_pp73-musllinux_1_2_x86_64.whl", hash = "sha256:5d0145edba8abd3db0ab22b5300c99dc152f5c9021fab861be0f0544dc3cbc5f", size = 552199 }, ] [[package]] name = "ruff" version = "0.14.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/75/62/50b7727004dfe361104dfbf898c45a9a2fdfad8c72c04ae62900224d6ecf/ruff-0.14.3.tar.gz", hash = "sha256:4ff876d2ab2b161b6de0aa1f5bd714e8e9b4033dc122ee006925fbacc4f62153", size = 5558687, upload-time = "2025-10-31T00:26:26.878Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/ce/8e/0c10ff1ea5d4360ab8bfca4cb2c9d979101a391f3e79d2616c9bf348cd26/ruff-0.14.3-py3-none-linux_armv6l.whl", hash = "sha256:876b21e6c824f519446715c1342b8e60f97f93264012de9d8d10314f8a79c371", size = 12535613, upload-time = "2025-10-31T00:25:44.302Z" }, - { url = "https://files.pythonhosted.org/packages/d3/c8/6724f4634c1daf52409fbf13fefda64aa9c8f81e44727a378b7b73dc590b/ruff-0.14.3-py3-none-macosx_10_12_x86_64.whl", hash = "sha256:b6fd8c79b457bedd2abf2702b9b472147cd860ed7855c73a5247fa55c9117654", size = 12855812, upload-time = "2025-10-31T00:25:47.793Z" }, - { url = "https://files.pythonhosted.org/packages/de/03/db1bce591d55fd5f8a08bb02517fa0b5097b2ccabd4ea1ee29aa72b67d96/ruff-0.14.3-py3-none-macosx_11_0_arm64.whl", hash = "sha256:71ff6edca490c308f083156938c0c1a66907151263c4abdcb588602c6e696a14", size = 11944026, upload-time = "2025-10-31T00:25:49.657Z" }, - { url = "https://files.pythonhosted.org/packages/0b/75/4f8dbd48e03272715d12c87dc4fcaaf21b913f0affa5f12a4e9c6f8a0582/ruff-0.14.3-py3-none-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:786ee3ce6139772ff9272aaf43296d975c0217ee1b97538a98171bf0d21f87ed", size = 12356818, upload-time = "2025-10-31T00:25:51.949Z" }, - { url = "https://files.pythonhosted.org/packages/ec/9b/506ec5b140c11d44a9a4f284ea7c14ebf6f8b01e6e8917734a3325bff787/ruff-0.14.3-py3-none-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:cd6291d0061811c52b8e392f946889916757610d45d004e41140d81fb6cd5ddc", size = 12336745, upload-time = "2025-10-31T00:25:54.248Z" }, - { url = "https://files.pythonhosted.org/packages/c7/e1/c560d254048c147f35e7f8131d30bc1f63a008ac61595cf3078a3e93533d/ruff-0.14.3-py3-none-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:a497ec0c3d2c88561b6d90f9c29f5ae68221ac00d471f306fa21fa4264ce5fcd", size = 13101684, upload-time = "2025-10-31T00:25:56.253Z" }, - { url = "https://files.pythonhosted.org/packages/a5/32/e310133f8af5cd11f8cc30f52522a3ebccc5ea5bff4b492f94faceaca7a8/ruff-0.14.3-py3-none-manylinux_2_17_ppc64.manylinux2014_ppc64.whl", hash = "sha256:e231e1be58fc568950a04fbe6887c8e4b85310e7889727e2b81db205c45059eb", size = 14535000, upload-time = "2025-10-31T00:25:58.397Z" }, - { url = "https://files.pythonhosted.org/packages/a2/a1/7b0470a22158c6d8501eabc5e9b6043c99bede40fa1994cadf6b5c2a61c7/ruff-0.14.3-py3-none-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:469e35872a09c0e45fecf48dd960bfbce056b5db2d5e6b50eca329b4f853ae20", size = 14156450, upload-time = "2025-10-31T00:26:00.889Z" }, - { url = "https://files.pythonhosted.org/packages/0a/96/24bfd9d1a7f532b560dcee1a87096332e461354d3882124219bcaff65c09/ruff-0.14.3-py3-none-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:3d6bc90307c469cb9d28b7cfad90aaa600b10d67c6e22026869f585e1e8a2db0", size = 13568414, upload-time = "2025-10-31T00:26:03.291Z" }, - { url = "https://files.pythonhosted.org/packages/a7/e7/138b883f0dfe4ad5b76b58bf4ae675f4d2176ac2b24bdd81b4d966b28c61/ruff-0.14.3-py3-none-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0e2f8a0bbcffcfd895df39c9a4ecd59bb80dca03dc43f7fb63e647ed176b741e", size = 13315293, upload-time = "2025-10-31T00:26:05.708Z" }, - { url = "https://files.pythonhosted.org/packages/33/f4/c09bb898be97b2eb18476b7c950df8815ef14cf956074177e9fbd40b7719/ruff-0.14.3-py3-none-manylinux_2_31_riscv64.whl", hash = "sha256:678fdd7c7d2d94851597c23ee6336d25f9930b460b55f8598e011b57c74fd8c5", size = 13539444, upload-time = "2025-10-31T00:26:08.09Z" }, - { url = "https://files.pythonhosted.org/packages/9c/aa/b30a1db25fc6128b1dd6ff0741fa4abf969ded161599d07ca7edd0739cc0/ruff-0.14.3-py3-none-musllinux_1_2_aarch64.whl", hash = "sha256:1ec1ac071e7e37e0221d2f2dbaf90897a988c531a8592a6a5959f0603a1ecf5e", size = 12252581, upload-time = "2025-10-31T00:26:10.297Z" }, - { url = "https://files.pythonhosted.org/packages/da/13/21096308f384d796ffe3f2960b17054110a9c3828d223ca540c2b7cc670b/ruff-0.14.3-py3-none-musllinux_1_2_armv7l.whl", hash = "sha256:afcdc4b5335ef440d19e7df9e8ae2ad9f749352190e96d481dc501b753f0733e", size = 12307503, upload-time = "2025-10-31T00:26:12.646Z" }, - { url = "https://files.pythonhosted.org/packages/cb/cc/a350bac23f03b7dbcde3c81b154706e80c6f16b06ff1ce28ed07dc7b07b0/ruff-0.14.3-py3-none-musllinux_1_2_i686.whl", hash = "sha256:7bfc42f81862749a7136267a343990f865e71fe2f99cf8d2958f684d23ce3dfa", size = 12675457, upload-time = "2025-10-31T00:26:15.044Z" }, - { url = "https://files.pythonhosted.org/packages/cb/76/46346029fa2f2078826bc88ef7167e8c198e58fe3126636e52f77488cbba/ruff-0.14.3-py3-none-musllinux_1_2_x86_64.whl", hash = "sha256:a65e448cfd7e9c59fae8cf37f9221585d3354febaad9a07f29158af1528e165f", size = 13403980, upload-time = "2025-10-31T00:26:17.81Z" }, - { url = "https://files.pythonhosted.org/packages/9f/a4/35f1ef68c4e7b236d4a5204e3669efdeefaef21f0ff6a456792b3d8be438/ruff-0.14.3-py3-none-win32.whl", hash = "sha256:f3d91857d023ba93e14ed2d462ab62c3428f9bbf2b4fbac50a03ca66d31991f7", size = 12500045, upload-time = "2025-10-31T00:26:20.503Z" }, - { url = "https://files.pythonhosted.org/packages/03/15/51960ae340823c9859fb60c63301d977308735403e2134e17d1d2858c7fb/ruff-0.14.3-py3-none-win_amd64.whl", hash = "sha256:d7b7006ac0756306db212fd37116cce2bd307e1e109375e1c6c106002df0ae5f", size = 13594005, upload-time = "2025-10-31T00:26:22.533Z" }, - { url = "https://files.pythonhosted.org/packages/b7/73/4de6579bac8e979fca0a77e54dec1f1e011a0d268165eb8a9bc0982a6564/ruff-0.14.3-py3-none-win_arm64.whl", hash = "sha256:26eb477ede6d399d898791d01961e16b86f02bc2486d0d1a7a9bb2379d055dc1", size = 12590017, upload-time = "2025-10-31T00:26:24.52Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/75/62/50b7727004dfe361104dfbf898c45a9a2fdfad8c72c04ae62900224d6ecf/ruff-0.14.3.tar.gz", hash = "sha256:4ff876d2ab2b161b6de0aa1f5bd714e8e9b4033dc122ee006925fbacc4f62153", size = 5558687 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ce/8e/0c10ff1ea5d4360ab8bfca4cb2c9d979101a391f3e79d2616c9bf348cd26/ruff-0.14.3-py3-none-linux_armv6l.whl", hash = "sha256:876b21e6c824f519446715c1342b8e60f97f93264012de9d8d10314f8a79c371", size = 12535613 }, + { url = "https://files.pythonhosted.org/packages/d3/c8/6724f4634c1daf52409fbf13fefda64aa9c8f81e44727a378b7b73dc590b/ruff-0.14.3-py3-none-macosx_10_12_x86_64.whl", hash = "sha256:b6fd8c79b457bedd2abf2702b9b472147cd860ed7855c73a5247fa55c9117654", size = 12855812 }, + { url = "https://files.pythonhosted.org/packages/de/03/db1bce591d55fd5f8a08bb02517fa0b5097b2ccabd4ea1ee29aa72b67d96/ruff-0.14.3-py3-none-macosx_11_0_arm64.whl", hash = "sha256:71ff6edca490c308f083156938c0c1a66907151263c4abdcb588602c6e696a14", size = 11944026 }, + { url = "https://files.pythonhosted.org/packages/0b/75/4f8dbd48e03272715d12c87dc4fcaaf21b913f0affa5f12a4e9c6f8a0582/ruff-0.14.3-py3-none-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:786ee3ce6139772ff9272aaf43296d975c0217ee1b97538a98171bf0d21f87ed", size = 12356818 }, + { url = "https://files.pythonhosted.org/packages/ec/9b/506ec5b140c11d44a9a4f284ea7c14ebf6f8b01e6e8917734a3325bff787/ruff-0.14.3-py3-none-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:cd6291d0061811c52b8e392f946889916757610d45d004e41140d81fb6cd5ddc", size = 12336745 }, + { url = "https://files.pythonhosted.org/packages/c7/e1/c560d254048c147f35e7f8131d30bc1f63a008ac61595cf3078a3e93533d/ruff-0.14.3-py3-none-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:a497ec0c3d2c88561b6d90f9c29f5ae68221ac00d471f306fa21fa4264ce5fcd", size = 13101684 }, + { url = "https://files.pythonhosted.org/packages/a5/32/e310133f8af5cd11f8cc30f52522a3ebccc5ea5bff4b492f94faceaca7a8/ruff-0.14.3-py3-none-manylinux_2_17_ppc64.manylinux2014_ppc64.whl", hash = "sha256:e231e1be58fc568950a04fbe6887c8e4b85310e7889727e2b81db205c45059eb", size = 14535000 }, + { url = "https://files.pythonhosted.org/packages/a2/a1/7b0470a22158c6d8501eabc5e9b6043c99bede40fa1994cadf6b5c2a61c7/ruff-0.14.3-py3-none-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:469e35872a09c0e45fecf48dd960bfbce056b5db2d5e6b50eca329b4f853ae20", size = 14156450 }, + { url = "https://files.pythonhosted.org/packages/0a/96/24bfd9d1a7f532b560dcee1a87096332e461354d3882124219bcaff65c09/ruff-0.14.3-py3-none-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:3d6bc90307c469cb9d28b7cfad90aaa600b10d67c6e22026869f585e1e8a2db0", size = 13568414 }, + { url = "https://files.pythonhosted.org/packages/a7/e7/138b883f0dfe4ad5b76b58bf4ae675f4d2176ac2b24bdd81b4d966b28c61/ruff-0.14.3-py3-none-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0e2f8a0bbcffcfd895df39c9a4ecd59bb80dca03dc43f7fb63e647ed176b741e", size = 13315293 }, + { url = "https://files.pythonhosted.org/packages/33/f4/c09bb898be97b2eb18476b7c950df8815ef14cf956074177e9fbd40b7719/ruff-0.14.3-py3-none-manylinux_2_31_riscv64.whl", hash = "sha256:678fdd7c7d2d94851597c23ee6336d25f9930b460b55f8598e011b57c74fd8c5", size = 13539444 }, + { url = "https://files.pythonhosted.org/packages/9c/aa/b30a1db25fc6128b1dd6ff0741fa4abf969ded161599d07ca7edd0739cc0/ruff-0.14.3-py3-none-musllinux_1_2_aarch64.whl", hash = "sha256:1ec1ac071e7e37e0221d2f2dbaf90897a988c531a8592a6a5959f0603a1ecf5e", size = 12252581 }, + { url = "https://files.pythonhosted.org/packages/da/13/21096308f384d796ffe3f2960b17054110a9c3828d223ca540c2b7cc670b/ruff-0.14.3-py3-none-musllinux_1_2_armv7l.whl", hash = "sha256:afcdc4b5335ef440d19e7df9e8ae2ad9f749352190e96d481dc501b753f0733e", size = 12307503 }, + { url = "https://files.pythonhosted.org/packages/cb/cc/a350bac23f03b7dbcde3c81b154706e80c6f16b06ff1ce28ed07dc7b07b0/ruff-0.14.3-py3-none-musllinux_1_2_i686.whl", hash = "sha256:7bfc42f81862749a7136267a343990f865e71fe2f99cf8d2958f684d23ce3dfa", size = 12675457 }, + { url = "https://files.pythonhosted.org/packages/cb/76/46346029fa2f2078826bc88ef7167e8c198e58fe3126636e52f77488cbba/ruff-0.14.3-py3-none-musllinux_1_2_x86_64.whl", hash = "sha256:a65e448cfd7e9c59fae8cf37f9221585d3354febaad9a07f29158af1528e165f", size = 13403980 }, + { url = "https://files.pythonhosted.org/packages/9f/a4/35f1ef68c4e7b236d4a5204e3669efdeefaef21f0ff6a456792b3d8be438/ruff-0.14.3-py3-none-win32.whl", hash = "sha256:f3d91857d023ba93e14ed2d462ab62c3428f9bbf2b4fbac50a03ca66d31991f7", size = 12500045 }, + { url = "https://files.pythonhosted.org/packages/03/15/51960ae340823c9859fb60c63301d977308735403e2134e17d1d2858c7fb/ruff-0.14.3-py3-none-win_amd64.whl", hash = "sha256:d7b7006ac0756306db212fd37116cce2bd307e1e109375e1c6c106002df0ae5f", size = 13594005 }, + { url = "https://files.pythonhosted.org/packages/b7/73/4de6579bac8e979fca0a77e54dec1f1e011a0d268165eb8a9bc0982a6564/ruff-0.14.3-py3-none-win_arm64.whl", hash = "sha256:26eb477ede6d399d898791d01961e16b86f02bc2486d0d1a7a9bb2379d055dc1", size = 12590017 }, ] [[package]] @@ -2938,33 +2957,33 @@ dependencies = [ { name = "scipy" }, { name = "threadpoolctl" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/98/c2/a7855e41c9d285dfe86dc50b250978105dce513d6e459ea66a6aeb0e1e0c/scikit_learn-1.7.2.tar.gz", hash = "sha256:20e9e49ecd130598f1ca38a1d85090e1a600147b9c02fa6f15d69cb53d968fda", size = 7193136, upload-time = "2025-09-09T08:21:29.075Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/43/83/564e141eef908a5863a54da8ca342a137f45a0bfb71d1d79704c9894c9d1/scikit_learn-1.7.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:c7509693451651cd7361d30ce4e86a1347493554f172b1c72a39300fa2aea79e", size = 9331967, upload-time = "2025-09-09T08:20:32.421Z" }, - { url = "https://files.pythonhosted.org/packages/18/d6/ba863a4171ac9d7314c4d3fc251f015704a2caeee41ced89f321c049ed83/scikit_learn-1.7.2-cp311-cp311-macosx_12_0_arm64.whl", hash = "sha256:0486c8f827c2e7b64837c731c8feff72c0bd2b998067a8a9cbc10643c31f0fe1", size = 8648645, upload-time = "2025-09-09T08:20:34.436Z" }, - { url = "https://files.pythonhosted.org/packages/ef/0e/97dbca66347b8cf0ea8b529e6bb9367e337ba2e8be0ef5c1a545232abfde/scikit_learn-1.7.2-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:89877e19a80c7b11a2891a27c21c4894fb18e2c2e077815bcade10d34287b20d", size = 9715424, upload-time = "2025-09-09T08:20:36.776Z" }, - { url = "https://files.pythonhosted.org/packages/f7/32/1f3b22e3207e1d2c883a7e09abb956362e7d1bd2f14458c7de258a26ac15/scikit_learn-1.7.2-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8da8bf89d4d79aaec192d2bda62f9b56ae4e5b4ef93b6a56b5de4977e375c1f1", size = 9509234, upload-time = "2025-09-09T08:20:38.957Z" }, - { url = "https://files.pythonhosted.org/packages/9f/71/34ddbd21f1da67c7a768146968b4d0220ee6831e4bcbad3e03dd3eae88b6/scikit_learn-1.7.2-cp311-cp311-win_amd64.whl", hash = "sha256:9b7ed8d58725030568523e937c43e56bc01cadb478fc43c042a9aca1dacb3ba1", size = 8894244, upload-time = "2025-09-09T08:20:41.166Z" }, - { url = "https://files.pythonhosted.org/packages/a7/aa/3996e2196075689afb9fce0410ebdb4a09099d7964d061d7213700204409/scikit_learn-1.7.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:8d91a97fa2b706943822398ab943cde71858a50245e31bc71dba62aab1d60a96", size = 9259818, upload-time = "2025-09-09T08:20:43.19Z" }, - { url = "https://files.pythonhosted.org/packages/43/5d/779320063e88af9c4a7c2cf463ff11c21ac9c8bd730c4a294b0000b666c9/scikit_learn-1.7.2-cp312-cp312-macosx_12_0_arm64.whl", hash = "sha256:acbc0f5fd2edd3432a22c69bed78e837c70cf896cd7993d71d51ba6708507476", size = 8636997, upload-time = "2025-09-09T08:20:45.468Z" }, - { url = "https://files.pythonhosted.org/packages/5c/d0/0c577d9325b05594fdd33aa970bf53fb673f051a45496842caee13cfd7fe/scikit_learn-1.7.2-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:e5bf3d930aee75a65478df91ac1225ff89cd28e9ac7bd1196853a9229b6adb0b", size = 9478381, upload-time = "2025-09-09T08:20:47.982Z" }, - { url = "https://files.pythonhosted.org/packages/82/70/8bf44b933837ba8494ca0fc9a9ab60f1c13b062ad0197f60a56e2fc4c43e/scikit_learn-1.7.2-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b4d6e9deed1a47aca9fe2f267ab8e8fe82ee20b4526b2c0cd9e135cea10feb44", size = 9300296, upload-time = "2025-09-09T08:20:50.366Z" }, - { url = "https://files.pythonhosted.org/packages/c6/99/ed35197a158f1fdc2fe7c3680e9c70d0128f662e1fee4ed495f4b5e13db0/scikit_learn-1.7.2-cp312-cp312-win_amd64.whl", hash = "sha256:6088aa475f0785e01bcf8529f55280a3d7d298679f50c0bb70a2364a82d0b290", size = 8731256, upload-time = "2025-09-09T08:20:52.627Z" }, - { url = "https://files.pythonhosted.org/packages/ae/93/a3038cb0293037fd335f77f31fe053b89c72f17b1c8908c576c29d953e84/scikit_learn-1.7.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:0b7dacaa05e5d76759fb071558a8b5130f4845166d88654a0f9bdf3eb57851b7", size = 9212382, upload-time = "2025-09-09T08:20:54.731Z" }, - { url = "https://files.pythonhosted.org/packages/40/dd/9a88879b0c1104259136146e4742026b52df8540c39fec21a6383f8292c7/scikit_learn-1.7.2-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:abebbd61ad9e1deed54cca45caea8ad5f79e1b93173dece40bb8e0c658dbe6fe", size = 8592042, upload-time = "2025-09-09T08:20:57.313Z" }, - { url = "https://files.pythonhosted.org/packages/46/af/c5e286471b7d10871b811b72ae794ac5fe2989c0a2df07f0ec723030f5f5/scikit_learn-1.7.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:502c18e39849c0ea1a5d681af1dbcf15f6cce601aebb657aabbfe84133c1907f", size = 9434180, upload-time = "2025-09-09T08:20:59.671Z" }, - { url = "https://files.pythonhosted.org/packages/f1/fd/df59faa53312d585023b2da27e866524ffb8faf87a68516c23896c718320/scikit_learn-1.7.2-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7a4c328a71785382fe3fe676a9ecf2c86189249beff90bf85e22bdb7efaf9ae0", size = 9283660, upload-time = "2025-09-09T08:21:01.71Z" }, - { url = "https://files.pythonhosted.org/packages/a7/c7/03000262759d7b6f38c836ff9d512f438a70d8a8ddae68ee80de72dcfb63/scikit_learn-1.7.2-cp313-cp313-win_amd64.whl", hash = "sha256:63a9afd6f7b229aad94618c01c252ce9e6fa97918c5ca19c9a17a087d819440c", size = 8702057, upload-time = "2025-09-09T08:21:04.234Z" }, - { url = "https://files.pythonhosted.org/packages/55/87/ef5eb1f267084532c8e4aef98a28b6ffe7425acbfd64b5e2f2e066bc29b3/scikit_learn-1.7.2-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:9acb6c5e867447b4e1390930e3944a005e2cb115922e693c08a323421a6966e8", size = 9558731, upload-time = "2025-09-09T08:21:06.381Z" }, - { url = "https://files.pythonhosted.org/packages/93/f8/6c1e3fc14b10118068d7938878a9f3f4e6d7b74a8ddb1e5bed65159ccda8/scikit_learn-1.7.2-cp313-cp313t-macosx_12_0_arm64.whl", hash = "sha256:2a41e2a0ef45063e654152ec9d8bcfc39f7afce35b08902bfe290c2498a67a6a", size = 9038852, upload-time = "2025-09-09T08:21:08.628Z" }, - { url = "https://files.pythonhosted.org/packages/83/87/066cafc896ee540c34becf95d30375fe5cbe93c3b75a0ee9aa852cd60021/scikit_learn-1.7.2-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:98335fb98509b73385b3ab2bd0639b1f610541d3988ee675c670371d6a87aa7c", size = 9527094, upload-time = "2025-09-09T08:21:11.486Z" }, - { url = "https://files.pythonhosted.org/packages/9c/2b/4903e1ccafa1f6453b1ab78413938c8800633988c838aa0be386cbb33072/scikit_learn-1.7.2-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:191e5550980d45449126e23ed1d5e9e24b2c68329ee1f691a3987476e115e09c", size = 9367436, upload-time = "2025-09-09T08:21:13.602Z" }, - { url = "https://files.pythonhosted.org/packages/b5/aa/8444be3cfb10451617ff9d177b3c190288f4563e6c50ff02728be67ad094/scikit_learn-1.7.2-cp313-cp313t-win_amd64.whl", hash = "sha256:57dc4deb1d3762c75d685507fbd0bc17160144b2f2ba4ccea5dc285ab0d0e973", size = 9275749, upload-time = "2025-09-09T08:21:15.96Z" }, - { url = "https://files.pythonhosted.org/packages/d9/82/dee5acf66837852e8e68df6d8d3a6cb22d3df997b733b032f513d95205b7/scikit_learn-1.7.2-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:fa8f63940e29c82d1e67a45d5297bdebbcb585f5a5a50c4914cc2e852ab77f33", size = 9208906, upload-time = "2025-09-09T08:21:18.557Z" }, - { url = "https://files.pythonhosted.org/packages/3c/30/9029e54e17b87cb7d50d51a5926429c683d5b4c1732f0507a6c3bed9bf65/scikit_learn-1.7.2-cp314-cp314-macosx_12_0_arm64.whl", hash = "sha256:f95dc55b7902b91331fa4e5845dd5bde0580c9cd9612b1b2791b7e80c3d32615", size = 8627836, upload-time = "2025-09-09T08:21:20.695Z" }, - { url = "https://files.pythonhosted.org/packages/60/18/4a52c635c71b536879f4b971c2cedf32c35ee78f48367885ed8025d1f7ee/scikit_learn-1.7.2-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:9656e4a53e54578ad10a434dc1f993330568cfee176dff07112b8785fb413106", size = 9426236, upload-time = "2025-09-09T08:21:22.645Z" }, - { url = "https://files.pythonhosted.org/packages/99/7e/290362f6ab582128c53445458a5befd471ed1ea37953d5bcf80604619250/scikit_learn-1.7.2-cp314-cp314-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:96dc05a854add0e50d3f47a1ef21a10a595016da5b007c7d9cd9d0bffd1fcc61", size = 9312593, upload-time = "2025-09-09T08:21:24.65Z" }, - { url = "https://files.pythonhosted.org/packages/8e/87/24f541b6d62b1794939ae6422f8023703bbf6900378b2b34e0b4384dfefd/scikit_learn-1.7.2-cp314-cp314-win_amd64.whl", hash = "sha256:bb24510ed3f9f61476181e4db51ce801e2ba37541def12dc9333b946fc7a9cf8", size = 8820007, upload-time = "2025-09-09T08:21:26.713Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/98/c2/a7855e41c9d285dfe86dc50b250978105dce513d6e459ea66a6aeb0e1e0c/scikit_learn-1.7.2.tar.gz", hash = "sha256:20e9e49ecd130598f1ca38a1d85090e1a600147b9c02fa6f15d69cb53d968fda", size = 7193136 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/43/83/564e141eef908a5863a54da8ca342a137f45a0bfb71d1d79704c9894c9d1/scikit_learn-1.7.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:c7509693451651cd7361d30ce4e86a1347493554f172b1c72a39300fa2aea79e", size = 9331967 }, + { url = "https://files.pythonhosted.org/packages/18/d6/ba863a4171ac9d7314c4d3fc251f015704a2caeee41ced89f321c049ed83/scikit_learn-1.7.2-cp311-cp311-macosx_12_0_arm64.whl", hash = "sha256:0486c8f827c2e7b64837c731c8feff72c0bd2b998067a8a9cbc10643c31f0fe1", size = 8648645 }, + { url = "https://files.pythonhosted.org/packages/ef/0e/97dbca66347b8cf0ea8b529e6bb9367e337ba2e8be0ef5c1a545232abfde/scikit_learn-1.7.2-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:89877e19a80c7b11a2891a27c21c4894fb18e2c2e077815bcade10d34287b20d", size = 9715424 }, + { url = "https://files.pythonhosted.org/packages/f7/32/1f3b22e3207e1d2c883a7e09abb956362e7d1bd2f14458c7de258a26ac15/scikit_learn-1.7.2-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8da8bf89d4d79aaec192d2bda62f9b56ae4e5b4ef93b6a56b5de4977e375c1f1", size = 9509234 }, + { url = "https://files.pythonhosted.org/packages/9f/71/34ddbd21f1da67c7a768146968b4d0220ee6831e4bcbad3e03dd3eae88b6/scikit_learn-1.7.2-cp311-cp311-win_amd64.whl", hash = "sha256:9b7ed8d58725030568523e937c43e56bc01cadb478fc43c042a9aca1dacb3ba1", size = 8894244 }, + { url = "https://files.pythonhosted.org/packages/a7/aa/3996e2196075689afb9fce0410ebdb4a09099d7964d061d7213700204409/scikit_learn-1.7.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:8d91a97fa2b706943822398ab943cde71858a50245e31bc71dba62aab1d60a96", size = 9259818 }, + { url = "https://files.pythonhosted.org/packages/43/5d/779320063e88af9c4a7c2cf463ff11c21ac9c8bd730c4a294b0000b666c9/scikit_learn-1.7.2-cp312-cp312-macosx_12_0_arm64.whl", hash = "sha256:acbc0f5fd2edd3432a22c69bed78e837c70cf896cd7993d71d51ba6708507476", size = 8636997 }, + { url = "https://files.pythonhosted.org/packages/5c/d0/0c577d9325b05594fdd33aa970bf53fb673f051a45496842caee13cfd7fe/scikit_learn-1.7.2-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:e5bf3d930aee75a65478df91ac1225ff89cd28e9ac7bd1196853a9229b6adb0b", size = 9478381 }, + { url = "https://files.pythonhosted.org/packages/82/70/8bf44b933837ba8494ca0fc9a9ab60f1c13b062ad0197f60a56e2fc4c43e/scikit_learn-1.7.2-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b4d6e9deed1a47aca9fe2f267ab8e8fe82ee20b4526b2c0cd9e135cea10feb44", size = 9300296 }, + { url = "https://files.pythonhosted.org/packages/c6/99/ed35197a158f1fdc2fe7c3680e9c70d0128f662e1fee4ed495f4b5e13db0/scikit_learn-1.7.2-cp312-cp312-win_amd64.whl", hash = "sha256:6088aa475f0785e01bcf8529f55280a3d7d298679f50c0bb70a2364a82d0b290", size = 8731256 }, + { url = "https://files.pythonhosted.org/packages/ae/93/a3038cb0293037fd335f77f31fe053b89c72f17b1c8908c576c29d953e84/scikit_learn-1.7.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:0b7dacaa05e5d76759fb071558a8b5130f4845166d88654a0f9bdf3eb57851b7", size = 9212382 }, + { url = "https://files.pythonhosted.org/packages/40/dd/9a88879b0c1104259136146e4742026b52df8540c39fec21a6383f8292c7/scikit_learn-1.7.2-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:abebbd61ad9e1deed54cca45caea8ad5f79e1b93173dece40bb8e0c658dbe6fe", size = 8592042 }, + { url = "https://files.pythonhosted.org/packages/46/af/c5e286471b7d10871b811b72ae794ac5fe2989c0a2df07f0ec723030f5f5/scikit_learn-1.7.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:502c18e39849c0ea1a5d681af1dbcf15f6cce601aebb657aabbfe84133c1907f", size = 9434180 }, + { url = "https://files.pythonhosted.org/packages/f1/fd/df59faa53312d585023b2da27e866524ffb8faf87a68516c23896c718320/scikit_learn-1.7.2-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7a4c328a71785382fe3fe676a9ecf2c86189249beff90bf85e22bdb7efaf9ae0", size = 9283660 }, + { url = "https://files.pythonhosted.org/packages/a7/c7/03000262759d7b6f38c836ff9d512f438a70d8a8ddae68ee80de72dcfb63/scikit_learn-1.7.2-cp313-cp313-win_amd64.whl", hash = "sha256:63a9afd6f7b229aad94618c01c252ce9e6fa97918c5ca19c9a17a087d819440c", size = 8702057 }, + { url = "https://files.pythonhosted.org/packages/55/87/ef5eb1f267084532c8e4aef98a28b6ffe7425acbfd64b5e2f2e066bc29b3/scikit_learn-1.7.2-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:9acb6c5e867447b4e1390930e3944a005e2cb115922e693c08a323421a6966e8", size = 9558731 }, + { url = "https://files.pythonhosted.org/packages/93/f8/6c1e3fc14b10118068d7938878a9f3f4e6d7b74a8ddb1e5bed65159ccda8/scikit_learn-1.7.2-cp313-cp313t-macosx_12_0_arm64.whl", hash = "sha256:2a41e2a0ef45063e654152ec9d8bcfc39f7afce35b08902bfe290c2498a67a6a", size = 9038852 }, + { url = "https://files.pythonhosted.org/packages/83/87/066cafc896ee540c34becf95d30375fe5cbe93c3b75a0ee9aa852cd60021/scikit_learn-1.7.2-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:98335fb98509b73385b3ab2bd0639b1f610541d3988ee675c670371d6a87aa7c", size = 9527094 }, + { url = "https://files.pythonhosted.org/packages/9c/2b/4903e1ccafa1f6453b1ab78413938c8800633988c838aa0be386cbb33072/scikit_learn-1.7.2-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:191e5550980d45449126e23ed1d5e9e24b2c68329ee1f691a3987476e115e09c", size = 9367436 }, + { url = "https://files.pythonhosted.org/packages/b5/aa/8444be3cfb10451617ff9d177b3c190288f4563e6c50ff02728be67ad094/scikit_learn-1.7.2-cp313-cp313t-win_amd64.whl", hash = "sha256:57dc4deb1d3762c75d685507fbd0bc17160144b2f2ba4ccea5dc285ab0d0e973", size = 9275749 }, + { url = "https://files.pythonhosted.org/packages/d9/82/dee5acf66837852e8e68df6d8d3a6cb22d3df997b733b032f513d95205b7/scikit_learn-1.7.2-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:fa8f63940e29c82d1e67a45d5297bdebbcb585f5a5a50c4914cc2e852ab77f33", size = 9208906 }, + { url = "https://files.pythonhosted.org/packages/3c/30/9029e54e17b87cb7d50d51a5926429c683d5b4c1732f0507a6c3bed9bf65/scikit_learn-1.7.2-cp314-cp314-macosx_12_0_arm64.whl", hash = "sha256:f95dc55b7902b91331fa4e5845dd5bde0580c9cd9612b1b2791b7e80c3d32615", size = 8627836 }, + { url = "https://files.pythonhosted.org/packages/60/18/4a52c635c71b536879f4b971c2cedf32c35ee78f48367885ed8025d1f7ee/scikit_learn-1.7.2-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:9656e4a53e54578ad10a434dc1f993330568cfee176dff07112b8785fb413106", size = 9426236 }, + { url = "https://files.pythonhosted.org/packages/99/7e/290362f6ab582128c53445458a5befd471ed1ea37953d5bcf80604619250/scikit_learn-1.7.2-cp314-cp314-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:96dc05a854add0e50d3f47a1ef21a10a595016da5b007c7d9cd9d0bffd1fcc61", size = 9312593 }, + { url = "https://files.pythonhosted.org/packages/8e/87/24f541b6d62b1794939ae6422f8023703bbf6900378b2b34e0b4384dfefd/scikit_learn-1.7.2-cp314-cp314-win_amd64.whl", hash = "sha256:bb24510ed3f9f61476181e4db51ce801e2ba37541def12dc9333b946fc7a9cf8", size = 8820007 }, ] [[package]] @@ -2974,68 +2993,68 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "numpy" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/0a/ca/d8ace4f98322d01abcd52d381134344bf7b431eba7ed8b42bdea5a3c2ac9/scipy-1.16.3.tar.gz", hash = "sha256:01e87659402762f43bd2fee13370553a17ada367d42e7487800bf2916535aecb", size = 30597883, upload-time = "2025-10-28T17:38:54.068Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/9b/5f/6f37d7439de1455ce9c5a556b8d1db0979f03a796c030bafdf08d35b7bf9/scipy-1.16.3-cp311-cp311-macosx_10_14_x86_64.whl", hash = "sha256:40be6cf99e68b6c4321e9f8782e7d5ff8265af28ef2cd56e9c9b2638fa08ad97", size = 36630881, upload-time = "2025-10-28T17:31:47.104Z" }, - { url = "https://files.pythonhosted.org/packages/7c/89/d70e9f628749b7e4db2aa4cd89735502ff3f08f7b9b27d2e799485987cd9/scipy-1.16.3-cp311-cp311-macosx_12_0_arm64.whl", hash = "sha256:8be1ca9170fcb6223cc7c27f4305d680ded114a1567c0bd2bfcbf947d1b17511", size = 28941012, upload-time = "2025-10-28T17:31:53.411Z" }, - { url = "https://files.pythonhosted.org/packages/a8/a8/0e7a9a6872a923505dbdf6bb93451edcac120363131c19013044a1e7cb0c/scipy-1.16.3-cp311-cp311-macosx_14_0_arm64.whl", hash = "sha256:bea0a62734d20d67608660f69dcda23e7f90fb4ca20974ab80b6ed40df87a005", size = 20931935, upload-time = "2025-10-28T17:31:57.361Z" }, - { url = "https://files.pythonhosted.org/packages/bd/c7/020fb72bd79ad798e4dbe53938543ecb96b3a9ac3fe274b7189e23e27353/scipy-1.16.3-cp311-cp311-macosx_14_0_x86_64.whl", hash = "sha256:2a207a6ce9c24f1951241f4693ede2d393f59c07abc159b2cb2be980820e01fb", size = 23534466, upload-time = "2025-10-28T17:32:01.875Z" }, - { url = "https://files.pythonhosted.org/packages/be/a0/668c4609ce6dbf2f948e167836ccaf897f95fb63fa231c87da7558a374cd/scipy-1.16.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:532fb5ad6a87e9e9cd9c959b106b73145a03f04c7d57ea3e6f6bb60b86ab0876", size = 33593618, upload-time = "2025-10-28T17:32:06.902Z" }, - { url = "https://files.pythonhosted.org/packages/ca/6e/8942461cf2636cdae083e3eb72622a7fbbfa5cf559c7d13ab250a5dbdc01/scipy-1.16.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:0151a0749efeaaab78711c78422d413c583b8cdd2011a3c1d6c794938ee9fdb2", size = 35899798, upload-time = "2025-10-28T17:32:12.665Z" }, - { url = "https://files.pythonhosted.org/packages/79/e8/d0f33590364cdbd67f28ce79368b373889faa4ee959588beddf6daef9abe/scipy-1.16.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:b7180967113560cca57418a7bc719e30366b47959dd845a93206fbed693c867e", size = 36226154, upload-time = "2025-10-28T17:32:17.961Z" }, - { url = "https://files.pythonhosted.org/packages/39/c1/1903de608c0c924a1749c590064e65810f8046e437aba6be365abc4f7557/scipy-1.16.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:deb3841c925eeddb6afc1e4e4a45e418d19ec7b87c5df177695224078e8ec733", size = 38878540, upload-time = "2025-10-28T17:32:23.907Z" }, - { url = "https://files.pythonhosted.org/packages/f1/d0/22ec7036ba0b0a35bccb7f25ab407382ed34af0b111475eb301c16f8a2e5/scipy-1.16.3-cp311-cp311-win_amd64.whl", hash = "sha256:53c3844d527213631e886621df5695d35e4f6a75f620dca412bcd292f6b87d78", size = 38722107, upload-time = "2025-10-28T17:32:29.921Z" }, - { url = "https://files.pythonhosted.org/packages/7b/60/8a00e5a524bb3bf8898db1650d350f50e6cffb9d7a491c561dc9826c7515/scipy-1.16.3-cp311-cp311-win_arm64.whl", hash = "sha256:9452781bd879b14b6f055b26643703551320aa8d79ae064a71df55c00286a184", size = 25506272, upload-time = "2025-10-28T17:32:34.577Z" }, - { url = "https://files.pythonhosted.org/packages/40/41/5bf55c3f386b1643812f3a5674edf74b26184378ef0f3e7c7a09a7e2ca7f/scipy-1.16.3-cp312-cp312-macosx_10_14_x86_64.whl", hash = "sha256:81fc5827606858cf71446a5e98715ba0e11f0dbc83d71c7409d05486592a45d6", size = 36659043, upload-time = "2025-10-28T17:32:40.285Z" }, - { url = "https://files.pythonhosted.org/packages/1e/0f/65582071948cfc45d43e9870bf7ca5f0e0684e165d7c9ef4e50d783073eb/scipy-1.16.3-cp312-cp312-macosx_12_0_arm64.whl", hash = "sha256:c97176013d404c7346bf57874eaac5187d969293bf40497140b0a2b2b7482e07", size = 28898986, upload-time = "2025-10-28T17:32:45.325Z" }, - { url = "https://files.pythonhosted.org/packages/96/5e/36bf3f0ac298187d1ceadde9051177d6a4fe4d507e8f59067dc9dd39e650/scipy-1.16.3-cp312-cp312-macosx_14_0_arm64.whl", hash = "sha256:2b71d93c8a9936046866acebc915e2af2e292b883ed6e2cbe5c34beb094b82d9", size = 20889814, upload-time = "2025-10-28T17:32:49.277Z" }, - { url = "https://files.pythonhosted.org/packages/80/35/178d9d0c35394d5d5211bbff7ac4f2986c5488b59506fef9e1de13ea28d3/scipy-1.16.3-cp312-cp312-macosx_14_0_x86_64.whl", hash = "sha256:3d4a07a8e785d80289dfe66b7c27d8634a773020742ec7187b85ccc4b0e7b686", size = 23565795, upload-time = "2025-10-28T17:32:53.337Z" }, - { url = "https://files.pythonhosted.org/packages/fa/46/d1146ff536d034d02f83c8afc3c4bab2eddb634624d6529a8512f3afc9da/scipy-1.16.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:0553371015692a898e1aa858fed67a3576c34edefa6b7ebdb4e9dde49ce5c203", size = 33349476, upload-time = "2025-10-28T17:32:58.353Z" }, - { url = "https://files.pythonhosted.org/packages/79/2e/415119c9ab3e62249e18c2b082c07aff907a273741b3f8160414b0e9193c/scipy-1.16.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:72d1717fd3b5e6ec747327ce9bda32d5463f472c9dce9f54499e81fbd50245a1", size = 35676692, upload-time = "2025-10-28T17:33:03.88Z" }, - { url = "https://files.pythonhosted.org/packages/27/82/df26e44da78bf8d2aeaf7566082260cfa15955a5a6e96e6a29935b64132f/scipy-1.16.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:1fb2472e72e24d1530debe6ae078db70fb1605350c88a3d14bc401d6306dbffe", size = 36019345, upload-time = "2025-10-28T17:33:09.773Z" }, - { url = "https://files.pythonhosted.org/packages/82/31/006cbb4b648ba379a95c87262c2855cd0d09453e500937f78b30f02fa1cd/scipy-1.16.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:c5192722cffe15f9329a3948c4b1db789fbb1f05c97899187dcf009b283aea70", size = 38678975, upload-time = "2025-10-28T17:33:15.809Z" }, - { url = "https://files.pythonhosted.org/packages/c2/7f/acbd28c97e990b421af7d6d6cd416358c9c293fc958b8529e0bd5d2a2a19/scipy-1.16.3-cp312-cp312-win_amd64.whl", hash = "sha256:56edc65510d1331dae01ef9b658d428e33ed48b4f77b1d51caf479a0253f96dc", size = 38555926, upload-time = "2025-10-28T17:33:21.388Z" }, - { url = "https://files.pythonhosted.org/packages/ce/69/c5c7807fd007dad4f48e0a5f2153038dc96e8725d3345b9ee31b2b7bed46/scipy-1.16.3-cp312-cp312-win_arm64.whl", hash = "sha256:a8a26c78ef223d3e30920ef759e25625a0ecdd0d60e5a8818b7513c3e5384cf2", size = 25463014, upload-time = "2025-10-28T17:33:25.975Z" }, - { url = "https://files.pythonhosted.org/packages/72/f1/57e8327ab1508272029e27eeef34f2302ffc156b69e7e233e906c2a5c379/scipy-1.16.3-cp313-cp313-macosx_10_14_x86_64.whl", hash = "sha256:d2ec56337675e61b312179a1ad124f5f570c00f920cc75e1000025451b88241c", size = 36617856, upload-time = "2025-10-28T17:33:31.375Z" }, - { url = "https://files.pythonhosted.org/packages/44/13/7e63cfba8a7452eb756306aa2fd9b37a29a323b672b964b4fdeded9a3f21/scipy-1.16.3-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:16b8bc35a4cc24db80a0ec836a9286d0e31b2503cb2fd7ff7fb0e0374a97081d", size = 28874306, upload-time = "2025-10-28T17:33:36.516Z" }, - { url = "https://files.pythonhosted.org/packages/15/65/3a9400efd0228a176e6ec3454b1fa998fbbb5a8defa1672c3f65706987db/scipy-1.16.3-cp313-cp313-macosx_14_0_arm64.whl", hash = "sha256:5803c5fadd29de0cf27fa08ccbfe7a9e5d741bf63e4ab1085437266f12460ff9", size = 20865371, upload-time = "2025-10-28T17:33:42.094Z" }, - { url = "https://files.pythonhosted.org/packages/33/d7/eda09adf009a9fb81827194d4dd02d2e4bc752cef16737cc4ef065234031/scipy-1.16.3-cp313-cp313-macosx_14_0_x86_64.whl", hash = "sha256:b81c27fc41954319a943d43b20e07c40bdcd3ff7cf013f4fb86286faefe546c4", size = 23524877, upload-time = "2025-10-28T17:33:48.483Z" }, - { url = "https://files.pythonhosted.org/packages/7d/6b/3f911e1ebc364cb81320223a3422aab7d26c9c7973109a9cd0f27c64c6c0/scipy-1.16.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:0c3b4dd3d9b08dbce0f3440032c52e9e2ab9f96ade2d3943313dfe51a7056959", size = 33342103, upload-time = "2025-10-28T17:33:56.495Z" }, - { url = "https://files.pythonhosted.org/packages/21/f6/4bfb5695d8941e5c570a04d9fcd0d36bce7511b7d78e6e75c8f9791f82d0/scipy-1.16.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:7dc1360c06535ea6116a2220f760ae572db9f661aba2d88074fe30ec2aa1ff88", size = 35697297, upload-time = "2025-10-28T17:34:04.722Z" }, - { url = "https://files.pythonhosted.org/packages/04/e1/6496dadbc80d8d896ff72511ecfe2316b50313bfc3ebf07a3f580f08bd8c/scipy-1.16.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:663b8d66a8748051c3ee9c96465fb417509315b99c71550fda2591d7dd634234", size = 36021756, upload-time = "2025-10-28T17:34:13.482Z" }, - { url = "https://files.pythonhosted.org/packages/fe/bd/a8c7799e0136b987bda3e1b23d155bcb31aec68a4a472554df5f0937eef7/scipy-1.16.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:eab43fae33a0c39006a88096cd7b4f4ef545ea0447d250d5ac18202d40b6611d", size = 38696566, upload-time = "2025-10-28T17:34:22.384Z" }, - { url = "https://files.pythonhosted.org/packages/cd/01/1204382461fcbfeb05b6161b594f4007e78b6eba9b375382f79153172b4d/scipy-1.16.3-cp313-cp313-win_amd64.whl", hash = "sha256:062246acacbe9f8210de8e751b16fc37458213f124bef161a5a02c7a39284304", size = 38529877, upload-time = "2025-10-28T17:35:51.076Z" }, - { url = "https://files.pythonhosted.org/packages/7f/14/9d9fbcaa1260a94f4bb5b64ba9213ceb5d03cd88841fe9fd1ffd47a45b73/scipy-1.16.3-cp313-cp313-win_arm64.whl", hash = "sha256:50a3dbf286dbc7d84f176f9a1574c705f277cb6565069f88f60db9eafdbe3ee2", size = 25455366, upload-time = "2025-10-28T17:35:59.014Z" }, - { url = "https://files.pythonhosted.org/packages/e2/a3/9ec205bd49f42d45d77f1730dbad9ccf146244c1647605cf834b3a8c4f36/scipy-1.16.3-cp313-cp313t-macosx_10_14_x86_64.whl", hash = "sha256:fb4b29f4cf8cc5a8d628bc8d8e26d12d7278cd1f219f22698a378c3d67db5e4b", size = 37027931, upload-time = "2025-10-28T17:34:31.451Z" }, - { url = "https://files.pythonhosted.org/packages/25/06/ca9fd1f3a4589cbd825b1447e5db3a8ebb969c1eaf22c8579bd286f51b6d/scipy-1.16.3-cp313-cp313t-macosx_12_0_arm64.whl", hash = "sha256:8d09d72dc92742988b0e7750bddb8060b0c7079606c0d24a8cc8e9c9c11f9079", size = 29400081, upload-time = "2025-10-28T17:34:39.087Z" }, - { url = "https://files.pythonhosted.org/packages/6a/56/933e68210d92657d93fb0e381683bc0e53a965048d7358ff5fbf9e6a1b17/scipy-1.16.3-cp313-cp313t-macosx_14_0_arm64.whl", hash = "sha256:03192a35e661470197556de24e7cb1330d84b35b94ead65c46ad6f16f6b28f2a", size = 21391244, upload-time = "2025-10-28T17:34:45.234Z" }, - { url = "https://files.pythonhosted.org/packages/a8/7e/779845db03dc1418e215726329674b40576879b91814568757ff0014ad65/scipy-1.16.3-cp313-cp313t-macosx_14_0_x86_64.whl", hash = "sha256:57d01cb6f85e34f0946b33caa66e892aae072b64b034183f3d87c4025802a119", size = 23929753, upload-time = "2025-10-28T17:34:51.793Z" }, - { url = "https://files.pythonhosted.org/packages/4c/4b/f756cf8161d5365dcdef9e5f460ab226c068211030a175d2fc7f3f41ca64/scipy-1.16.3-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:96491a6a54e995f00a28a3c3badfff58fd093bf26cd5fb34a2188c8c756a3a2c", size = 33496912, upload-time = "2025-10-28T17:34:59.8Z" }, - { url = "https://files.pythonhosted.org/packages/09/b5/222b1e49a58668f23839ca1542a6322bb095ab8d6590d4f71723869a6c2c/scipy-1.16.3-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:cd13e354df9938598af2be05822c323e97132d5e6306b83a3b4ee6724c6e522e", size = 35802371, upload-time = "2025-10-28T17:35:08.173Z" }, - { url = "https://files.pythonhosted.org/packages/c1/8d/5964ef68bb31829bde27611f8c9deeac13764589fe74a75390242b64ca44/scipy-1.16.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:63d3cdacb8a824a295191a723ee5e4ea7768ca5ca5f2838532d9f2e2b3ce2135", size = 36190477, upload-time = "2025-10-28T17:35:16.7Z" }, - { url = "https://files.pythonhosted.org/packages/ab/f2/b31d75cb9b5fa4dd39a0a931ee9b33e7f6f36f23be5ef560bf72e0f92f32/scipy-1.16.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:e7efa2681ea410b10dde31a52b18b0154d66f2485328830e45fdf183af5aefc6", size = 38796678, upload-time = "2025-10-28T17:35:26.354Z" }, - { url = "https://files.pythonhosted.org/packages/b4/1e/b3723d8ff64ab548c38d87055483714fefe6ee20e0189b62352b5e015bb1/scipy-1.16.3-cp313-cp313t-win_amd64.whl", hash = "sha256:2d1ae2cf0c350e7705168ff2429962a89ad90c2d49d1dd300686d8b2a5af22fc", size = 38640178, upload-time = "2025-10-28T17:35:35.304Z" }, - { url = "https://files.pythonhosted.org/packages/8e/f3/d854ff38789aca9b0cc23008d607ced9de4f7ab14fa1ca4329f86b3758ca/scipy-1.16.3-cp313-cp313t-win_arm64.whl", hash = "sha256:0c623a54f7b79dd88ef56da19bc2873afec9673a48f3b85b18e4d402bdd29a5a", size = 25803246, upload-time = "2025-10-28T17:35:42.155Z" }, - { url = "https://files.pythonhosted.org/packages/99/f6/99b10fd70f2d864c1e29a28bbcaa0c6340f9d8518396542d9ea3b4aaae15/scipy-1.16.3-cp314-cp314-macosx_10_14_x86_64.whl", hash = "sha256:875555ce62743e1d54f06cdf22c1e0bc47b91130ac40fe5d783b6dfa114beeb6", size = 36606469, upload-time = "2025-10-28T17:36:08.741Z" }, - { url = "https://files.pythonhosted.org/packages/4d/74/043b54f2319f48ea940dd025779fa28ee360e6b95acb7cd188fad4391c6b/scipy-1.16.3-cp314-cp314-macosx_12_0_arm64.whl", hash = "sha256:bb61878c18a470021fb515a843dc7a76961a8daceaaaa8bad1332f1bf4b54657", size = 28872043, upload-time = "2025-10-28T17:36:16.599Z" }, - { url = "https://files.pythonhosted.org/packages/4d/e1/24b7e50cc1c4ee6ffbcb1f27fe9f4c8b40e7911675f6d2d20955f41c6348/scipy-1.16.3-cp314-cp314-macosx_14_0_arm64.whl", hash = "sha256:f2622206f5559784fa5c4b53a950c3c7c1cf3e84ca1b9c4b6c03f062f289ca26", size = 20862952, upload-time = "2025-10-28T17:36:22.966Z" }, - { url = "https://files.pythonhosted.org/packages/dd/3a/3e8c01a4d742b730df368e063787c6808597ccb38636ed821d10b39ca51b/scipy-1.16.3-cp314-cp314-macosx_14_0_x86_64.whl", hash = "sha256:7f68154688c515cdb541a31ef8eb66d8cd1050605be9dcd74199cbd22ac739bc", size = 23508512, upload-time = "2025-10-28T17:36:29.731Z" }, - { url = "https://files.pythonhosted.org/packages/1f/60/c45a12b98ad591536bfe5330cb3cfe1850d7570259303563b1721564d458/scipy-1.16.3-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:8b3c820ddb80029fe9f43d61b81d8b488d3ef8ca010d15122b152db77dc94c22", size = 33413639, upload-time = "2025-10-28T17:36:37.982Z" }, - { url = "https://files.pythonhosted.org/packages/71/bc/35957d88645476307e4839712642896689df442f3e53b0fa016ecf8a3357/scipy-1.16.3-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:d3837938ae715fc0fe3c39c0202de3a8853aff22ca66781ddc2ade7554b7e2cc", size = 35704729, upload-time = "2025-10-28T17:36:46.547Z" }, - { url = "https://files.pythonhosted.org/packages/3b/15/89105e659041b1ca11c386e9995aefacd513a78493656e57789f9d9eab61/scipy-1.16.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:aadd23f98f9cb069b3bd64ddc900c4d277778242e961751f77a8cb5c4b946fb0", size = 36086251, upload-time = "2025-10-28T17:36:55.161Z" }, - { url = "https://files.pythonhosted.org/packages/1a/87/c0ea673ac9c6cc50b3da2196d860273bc7389aa69b64efa8493bdd25b093/scipy-1.16.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:b7c5f1bda1354d6a19bc6af73a649f8285ca63ac6b52e64e658a5a11d4d69800", size = 38716681, upload-time = "2025-10-28T17:37:04.1Z" }, - { url = "https://files.pythonhosted.org/packages/91/06/837893227b043fb9b0d13e4bd7586982d8136cb249ffb3492930dab905b8/scipy-1.16.3-cp314-cp314-win_amd64.whl", hash = "sha256:e5d42a9472e7579e473879a1990327830493a7047506d58d73fc429b84c1d49d", size = 39358423, upload-time = "2025-10-28T17:38:20.005Z" }, - { url = "https://files.pythonhosted.org/packages/95/03/28bce0355e4d34a7c034727505a02d19548549e190bedd13a721e35380b7/scipy-1.16.3-cp314-cp314-win_arm64.whl", hash = "sha256:6020470b9d00245926f2d5bb93b119ca0340f0d564eb6fbaad843eaebf9d690f", size = 26135027, upload-time = "2025-10-28T17:38:24.966Z" }, - { url = "https://files.pythonhosted.org/packages/b2/6f/69f1e2b682efe9de8fe9f91040f0cd32f13cfccba690512ba4c582b0bc29/scipy-1.16.3-cp314-cp314t-macosx_10_14_x86_64.whl", hash = "sha256:e1d27cbcb4602680a49d787d90664fa4974063ac9d4134813332a8c53dbe667c", size = 37028379, upload-time = "2025-10-28T17:37:14.061Z" }, - { url = "https://files.pythonhosted.org/packages/7c/2d/e826f31624a5ebbab1cd93d30fd74349914753076ed0593e1d56a98c4fb4/scipy-1.16.3-cp314-cp314t-macosx_12_0_arm64.whl", hash = "sha256:9b9c9c07b6d56a35777a1b4cc8966118fb16cfd8daf6743867d17d36cfad2d40", size = 29400052, upload-time = "2025-10-28T17:37:21.709Z" }, - { url = "https://files.pythonhosted.org/packages/69/27/d24feb80155f41fd1f156bf144e7e049b4e2b9dd06261a242905e3bc7a03/scipy-1.16.3-cp314-cp314t-macosx_14_0_arm64.whl", hash = "sha256:3a4c460301fb2cffb7f88528f30b3127742cff583603aa7dc964a52c463b385d", size = 21391183, upload-time = "2025-10-28T17:37:29.559Z" }, - { url = "https://files.pythonhosted.org/packages/f8/d3/1b229e433074c5738a24277eca520a2319aac7465eea7310ea6ae0e98ae2/scipy-1.16.3-cp314-cp314t-macosx_14_0_x86_64.whl", hash = "sha256:f667a4542cc8917af1db06366d3f78a5c8e83badd56409f94d1eac8d8d9133fa", size = 23930174, upload-time = "2025-10-28T17:37:36.306Z" }, - { url = "https://files.pythonhosted.org/packages/16/9d/d9e148b0ec680c0f042581a2be79a28a7ab66c0c4946697f9e7553ead337/scipy-1.16.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:f379b54b77a597aa7ee5e697df0d66903e41b9c85a6dd7946159e356319158e8", size = 33497852, upload-time = "2025-10-28T17:37:42.228Z" }, - { url = "https://files.pythonhosted.org/packages/2f/22/4e5f7561e4f98b7bea63cf3fd7934bff1e3182e9f1626b089a679914d5c8/scipy-1.16.3-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:4aff59800a3b7f786b70bfd6ab551001cb553244988d7d6b8299cb1ea653b353", size = 35798595, upload-time = "2025-10-28T17:37:48.102Z" }, - { url = "https://files.pythonhosted.org/packages/83/42/6644d714c179429fc7196857866f219fef25238319b650bb32dde7bf7a48/scipy-1.16.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:da7763f55885045036fabcebd80144b757d3db06ab0861415d1c3b7c69042146", size = 36186269, upload-time = "2025-10-28T17:37:53.72Z" }, - { url = "https://files.pythonhosted.org/packages/ac/70/64b4d7ca92f9cf2e6fc6aaa2eecf80bb9b6b985043a9583f32f8177ea122/scipy-1.16.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:ffa6eea95283b2b8079b821dc11f50a17d0571c92b43e2b5b12764dc5f9b285d", size = 38802779, upload-time = "2025-10-28T17:37:59.393Z" }, - { url = "https://files.pythonhosted.org/packages/61/82/8d0e39f62764cce5ffd5284131e109f07cf8955aef9ab8ed4e3aa5e30539/scipy-1.16.3-cp314-cp314t-win_amd64.whl", hash = "sha256:d9f48cafc7ce94cf9b15c6bffdc443a81a27bf7075cf2dcd5c8b40f85d10c4e7", size = 39471128, upload-time = "2025-10-28T17:38:05.259Z" }, - { url = "https://files.pythonhosted.org/packages/64/47/a494741db7280eae6dc033510c319e34d42dd41b7ac0c7ead39354d1a2b5/scipy-1.16.3-cp314-cp314t-win_arm64.whl", hash = "sha256:21d9d6b197227a12dcbf9633320a4e34c6b0e51c57268df255a0942983bac562", size = 26464127, upload-time = "2025-10-28T17:38:11.34Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/0a/ca/d8ace4f98322d01abcd52d381134344bf7b431eba7ed8b42bdea5a3c2ac9/scipy-1.16.3.tar.gz", hash = "sha256:01e87659402762f43bd2fee13370553a17ada367d42e7487800bf2916535aecb", size = 30597883 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/9b/5f/6f37d7439de1455ce9c5a556b8d1db0979f03a796c030bafdf08d35b7bf9/scipy-1.16.3-cp311-cp311-macosx_10_14_x86_64.whl", hash = "sha256:40be6cf99e68b6c4321e9f8782e7d5ff8265af28ef2cd56e9c9b2638fa08ad97", size = 36630881 }, + { url = "https://files.pythonhosted.org/packages/7c/89/d70e9f628749b7e4db2aa4cd89735502ff3f08f7b9b27d2e799485987cd9/scipy-1.16.3-cp311-cp311-macosx_12_0_arm64.whl", hash = "sha256:8be1ca9170fcb6223cc7c27f4305d680ded114a1567c0bd2bfcbf947d1b17511", size = 28941012 }, + { url = "https://files.pythonhosted.org/packages/a8/a8/0e7a9a6872a923505dbdf6bb93451edcac120363131c19013044a1e7cb0c/scipy-1.16.3-cp311-cp311-macosx_14_0_arm64.whl", hash = "sha256:bea0a62734d20d67608660f69dcda23e7f90fb4ca20974ab80b6ed40df87a005", size = 20931935 }, + { url = "https://files.pythonhosted.org/packages/bd/c7/020fb72bd79ad798e4dbe53938543ecb96b3a9ac3fe274b7189e23e27353/scipy-1.16.3-cp311-cp311-macosx_14_0_x86_64.whl", hash = "sha256:2a207a6ce9c24f1951241f4693ede2d393f59c07abc159b2cb2be980820e01fb", size = 23534466 }, + { url = "https://files.pythonhosted.org/packages/be/a0/668c4609ce6dbf2f948e167836ccaf897f95fb63fa231c87da7558a374cd/scipy-1.16.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:532fb5ad6a87e9e9cd9c959b106b73145a03f04c7d57ea3e6f6bb60b86ab0876", size = 33593618 }, + { url = "https://files.pythonhosted.org/packages/ca/6e/8942461cf2636cdae083e3eb72622a7fbbfa5cf559c7d13ab250a5dbdc01/scipy-1.16.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:0151a0749efeaaab78711c78422d413c583b8cdd2011a3c1d6c794938ee9fdb2", size = 35899798 }, + { url = "https://files.pythonhosted.org/packages/79/e8/d0f33590364cdbd67f28ce79368b373889faa4ee959588beddf6daef9abe/scipy-1.16.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:b7180967113560cca57418a7bc719e30366b47959dd845a93206fbed693c867e", size = 36226154 }, + { url = "https://files.pythonhosted.org/packages/39/c1/1903de608c0c924a1749c590064e65810f8046e437aba6be365abc4f7557/scipy-1.16.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:deb3841c925eeddb6afc1e4e4a45e418d19ec7b87c5df177695224078e8ec733", size = 38878540 }, + { url = "https://files.pythonhosted.org/packages/f1/d0/22ec7036ba0b0a35bccb7f25ab407382ed34af0b111475eb301c16f8a2e5/scipy-1.16.3-cp311-cp311-win_amd64.whl", hash = "sha256:53c3844d527213631e886621df5695d35e4f6a75f620dca412bcd292f6b87d78", size = 38722107 }, + { url = "https://files.pythonhosted.org/packages/7b/60/8a00e5a524bb3bf8898db1650d350f50e6cffb9d7a491c561dc9826c7515/scipy-1.16.3-cp311-cp311-win_arm64.whl", hash = "sha256:9452781bd879b14b6f055b26643703551320aa8d79ae064a71df55c00286a184", size = 25506272 }, + { url = "https://files.pythonhosted.org/packages/40/41/5bf55c3f386b1643812f3a5674edf74b26184378ef0f3e7c7a09a7e2ca7f/scipy-1.16.3-cp312-cp312-macosx_10_14_x86_64.whl", hash = "sha256:81fc5827606858cf71446a5e98715ba0e11f0dbc83d71c7409d05486592a45d6", size = 36659043 }, + { url = "https://files.pythonhosted.org/packages/1e/0f/65582071948cfc45d43e9870bf7ca5f0e0684e165d7c9ef4e50d783073eb/scipy-1.16.3-cp312-cp312-macosx_12_0_arm64.whl", hash = "sha256:c97176013d404c7346bf57874eaac5187d969293bf40497140b0a2b2b7482e07", size = 28898986 }, + { url = "https://files.pythonhosted.org/packages/96/5e/36bf3f0ac298187d1ceadde9051177d6a4fe4d507e8f59067dc9dd39e650/scipy-1.16.3-cp312-cp312-macosx_14_0_arm64.whl", hash = "sha256:2b71d93c8a9936046866acebc915e2af2e292b883ed6e2cbe5c34beb094b82d9", size = 20889814 }, + { url = "https://files.pythonhosted.org/packages/80/35/178d9d0c35394d5d5211bbff7ac4f2986c5488b59506fef9e1de13ea28d3/scipy-1.16.3-cp312-cp312-macosx_14_0_x86_64.whl", hash = "sha256:3d4a07a8e785d80289dfe66b7c27d8634a773020742ec7187b85ccc4b0e7b686", size = 23565795 }, + { url = "https://files.pythonhosted.org/packages/fa/46/d1146ff536d034d02f83c8afc3c4bab2eddb634624d6529a8512f3afc9da/scipy-1.16.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:0553371015692a898e1aa858fed67a3576c34edefa6b7ebdb4e9dde49ce5c203", size = 33349476 }, + { url = "https://files.pythonhosted.org/packages/79/2e/415119c9ab3e62249e18c2b082c07aff907a273741b3f8160414b0e9193c/scipy-1.16.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:72d1717fd3b5e6ec747327ce9bda32d5463f472c9dce9f54499e81fbd50245a1", size = 35676692 }, + { url = "https://files.pythonhosted.org/packages/27/82/df26e44da78bf8d2aeaf7566082260cfa15955a5a6e96e6a29935b64132f/scipy-1.16.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:1fb2472e72e24d1530debe6ae078db70fb1605350c88a3d14bc401d6306dbffe", size = 36019345 }, + { url = "https://files.pythonhosted.org/packages/82/31/006cbb4b648ba379a95c87262c2855cd0d09453e500937f78b30f02fa1cd/scipy-1.16.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:c5192722cffe15f9329a3948c4b1db789fbb1f05c97899187dcf009b283aea70", size = 38678975 }, + { url = "https://files.pythonhosted.org/packages/c2/7f/acbd28c97e990b421af7d6d6cd416358c9c293fc958b8529e0bd5d2a2a19/scipy-1.16.3-cp312-cp312-win_amd64.whl", hash = "sha256:56edc65510d1331dae01ef9b658d428e33ed48b4f77b1d51caf479a0253f96dc", size = 38555926 }, + { url = "https://files.pythonhosted.org/packages/ce/69/c5c7807fd007dad4f48e0a5f2153038dc96e8725d3345b9ee31b2b7bed46/scipy-1.16.3-cp312-cp312-win_arm64.whl", hash = "sha256:a8a26c78ef223d3e30920ef759e25625a0ecdd0d60e5a8818b7513c3e5384cf2", size = 25463014 }, + { url = "https://files.pythonhosted.org/packages/72/f1/57e8327ab1508272029e27eeef34f2302ffc156b69e7e233e906c2a5c379/scipy-1.16.3-cp313-cp313-macosx_10_14_x86_64.whl", hash = "sha256:d2ec56337675e61b312179a1ad124f5f570c00f920cc75e1000025451b88241c", size = 36617856 }, + { url = "https://files.pythonhosted.org/packages/44/13/7e63cfba8a7452eb756306aa2fd9b37a29a323b672b964b4fdeded9a3f21/scipy-1.16.3-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:16b8bc35a4cc24db80a0ec836a9286d0e31b2503cb2fd7ff7fb0e0374a97081d", size = 28874306 }, + { url = "https://files.pythonhosted.org/packages/15/65/3a9400efd0228a176e6ec3454b1fa998fbbb5a8defa1672c3f65706987db/scipy-1.16.3-cp313-cp313-macosx_14_0_arm64.whl", hash = "sha256:5803c5fadd29de0cf27fa08ccbfe7a9e5d741bf63e4ab1085437266f12460ff9", size = 20865371 }, + { url = "https://files.pythonhosted.org/packages/33/d7/eda09adf009a9fb81827194d4dd02d2e4bc752cef16737cc4ef065234031/scipy-1.16.3-cp313-cp313-macosx_14_0_x86_64.whl", hash = "sha256:b81c27fc41954319a943d43b20e07c40bdcd3ff7cf013f4fb86286faefe546c4", size = 23524877 }, + { url = "https://files.pythonhosted.org/packages/7d/6b/3f911e1ebc364cb81320223a3422aab7d26c9c7973109a9cd0f27c64c6c0/scipy-1.16.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:0c3b4dd3d9b08dbce0f3440032c52e9e2ab9f96ade2d3943313dfe51a7056959", size = 33342103 }, + { url = "https://files.pythonhosted.org/packages/21/f6/4bfb5695d8941e5c570a04d9fcd0d36bce7511b7d78e6e75c8f9791f82d0/scipy-1.16.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:7dc1360c06535ea6116a2220f760ae572db9f661aba2d88074fe30ec2aa1ff88", size = 35697297 }, + { url = "https://files.pythonhosted.org/packages/04/e1/6496dadbc80d8d896ff72511ecfe2316b50313bfc3ebf07a3f580f08bd8c/scipy-1.16.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:663b8d66a8748051c3ee9c96465fb417509315b99c71550fda2591d7dd634234", size = 36021756 }, + { url = "https://files.pythonhosted.org/packages/fe/bd/a8c7799e0136b987bda3e1b23d155bcb31aec68a4a472554df5f0937eef7/scipy-1.16.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:eab43fae33a0c39006a88096cd7b4f4ef545ea0447d250d5ac18202d40b6611d", size = 38696566 }, + { url = "https://files.pythonhosted.org/packages/cd/01/1204382461fcbfeb05b6161b594f4007e78b6eba9b375382f79153172b4d/scipy-1.16.3-cp313-cp313-win_amd64.whl", hash = "sha256:062246acacbe9f8210de8e751b16fc37458213f124bef161a5a02c7a39284304", size = 38529877 }, + { url = "https://files.pythonhosted.org/packages/7f/14/9d9fbcaa1260a94f4bb5b64ba9213ceb5d03cd88841fe9fd1ffd47a45b73/scipy-1.16.3-cp313-cp313-win_arm64.whl", hash = "sha256:50a3dbf286dbc7d84f176f9a1574c705f277cb6565069f88f60db9eafdbe3ee2", size = 25455366 }, + { url = "https://files.pythonhosted.org/packages/e2/a3/9ec205bd49f42d45d77f1730dbad9ccf146244c1647605cf834b3a8c4f36/scipy-1.16.3-cp313-cp313t-macosx_10_14_x86_64.whl", hash = "sha256:fb4b29f4cf8cc5a8d628bc8d8e26d12d7278cd1f219f22698a378c3d67db5e4b", size = 37027931 }, + { url = "https://files.pythonhosted.org/packages/25/06/ca9fd1f3a4589cbd825b1447e5db3a8ebb969c1eaf22c8579bd286f51b6d/scipy-1.16.3-cp313-cp313t-macosx_12_0_arm64.whl", hash = "sha256:8d09d72dc92742988b0e7750bddb8060b0c7079606c0d24a8cc8e9c9c11f9079", size = 29400081 }, + { url = "https://files.pythonhosted.org/packages/6a/56/933e68210d92657d93fb0e381683bc0e53a965048d7358ff5fbf9e6a1b17/scipy-1.16.3-cp313-cp313t-macosx_14_0_arm64.whl", hash = "sha256:03192a35e661470197556de24e7cb1330d84b35b94ead65c46ad6f16f6b28f2a", size = 21391244 }, + { url = "https://files.pythonhosted.org/packages/a8/7e/779845db03dc1418e215726329674b40576879b91814568757ff0014ad65/scipy-1.16.3-cp313-cp313t-macosx_14_0_x86_64.whl", hash = "sha256:57d01cb6f85e34f0946b33caa66e892aae072b64b034183f3d87c4025802a119", size = 23929753 }, + { url = "https://files.pythonhosted.org/packages/4c/4b/f756cf8161d5365dcdef9e5f460ab226c068211030a175d2fc7f3f41ca64/scipy-1.16.3-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:96491a6a54e995f00a28a3c3badfff58fd093bf26cd5fb34a2188c8c756a3a2c", size = 33496912 }, + { url = "https://files.pythonhosted.org/packages/09/b5/222b1e49a58668f23839ca1542a6322bb095ab8d6590d4f71723869a6c2c/scipy-1.16.3-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:cd13e354df9938598af2be05822c323e97132d5e6306b83a3b4ee6724c6e522e", size = 35802371 }, + { url = "https://files.pythonhosted.org/packages/c1/8d/5964ef68bb31829bde27611f8c9deeac13764589fe74a75390242b64ca44/scipy-1.16.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:63d3cdacb8a824a295191a723ee5e4ea7768ca5ca5f2838532d9f2e2b3ce2135", size = 36190477 }, + { url = "https://files.pythonhosted.org/packages/ab/f2/b31d75cb9b5fa4dd39a0a931ee9b33e7f6f36f23be5ef560bf72e0f92f32/scipy-1.16.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:e7efa2681ea410b10dde31a52b18b0154d66f2485328830e45fdf183af5aefc6", size = 38796678 }, + { url = "https://files.pythonhosted.org/packages/b4/1e/b3723d8ff64ab548c38d87055483714fefe6ee20e0189b62352b5e015bb1/scipy-1.16.3-cp313-cp313t-win_amd64.whl", hash = "sha256:2d1ae2cf0c350e7705168ff2429962a89ad90c2d49d1dd300686d8b2a5af22fc", size = 38640178 }, + { url = "https://files.pythonhosted.org/packages/8e/f3/d854ff38789aca9b0cc23008d607ced9de4f7ab14fa1ca4329f86b3758ca/scipy-1.16.3-cp313-cp313t-win_arm64.whl", hash = "sha256:0c623a54f7b79dd88ef56da19bc2873afec9673a48f3b85b18e4d402bdd29a5a", size = 25803246 }, + { url = "https://files.pythonhosted.org/packages/99/f6/99b10fd70f2d864c1e29a28bbcaa0c6340f9d8518396542d9ea3b4aaae15/scipy-1.16.3-cp314-cp314-macosx_10_14_x86_64.whl", hash = "sha256:875555ce62743e1d54f06cdf22c1e0bc47b91130ac40fe5d783b6dfa114beeb6", size = 36606469 }, + { url = "https://files.pythonhosted.org/packages/4d/74/043b54f2319f48ea940dd025779fa28ee360e6b95acb7cd188fad4391c6b/scipy-1.16.3-cp314-cp314-macosx_12_0_arm64.whl", hash = "sha256:bb61878c18a470021fb515a843dc7a76961a8daceaaaa8bad1332f1bf4b54657", size = 28872043 }, + { url = "https://files.pythonhosted.org/packages/4d/e1/24b7e50cc1c4ee6ffbcb1f27fe9f4c8b40e7911675f6d2d20955f41c6348/scipy-1.16.3-cp314-cp314-macosx_14_0_arm64.whl", hash = "sha256:f2622206f5559784fa5c4b53a950c3c7c1cf3e84ca1b9c4b6c03f062f289ca26", size = 20862952 }, + { url = "https://files.pythonhosted.org/packages/dd/3a/3e8c01a4d742b730df368e063787c6808597ccb38636ed821d10b39ca51b/scipy-1.16.3-cp314-cp314-macosx_14_0_x86_64.whl", hash = "sha256:7f68154688c515cdb541a31ef8eb66d8cd1050605be9dcd74199cbd22ac739bc", size = 23508512 }, + { url = "https://files.pythonhosted.org/packages/1f/60/c45a12b98ad591536bfe5330cb3cfe1850d7570259303563b1721564d458/scipy-1.16.3-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:8b3c820ddb80029fe9f43d61b81d8b488d3ef8ca010d15122b152db77dc94c22", size = 33413639 }, + { url = "https://files.pythonhosted.org/packages/71/bc/35957d88645476307e4839712642896689df442f3e53b0fa016ecf8a3357/scipy-1.16.3-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:d3837938ae715fc0fe3c39c0202de3a8853aff22ca66781ddc2ade7554b7e2cc", size = 35704729 }, + { url = "https://files.pythonhosted.org/packages/3b/15/89105e659041b1ca11c386e9995aefacd513a78493656e57789f9d9eab61/scipy-1.16.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:aadd23f98f9cb069b3bd64ddc900c4d277778242e961751f77a8cb5c4b946fb0", size = 36086251 }, + { url = "https://files.pythonhosted.org/packages/1a/87/c0ea673ac9c6cc50b3da2196d860273bc7389aa69b64efa8493bdd25b093/scipy-1.16.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:b7c5f1bda1354d6a19bc6af73a649f8285ca63ac6b52e64e658a5a11d4d69800", size = 38716681 }, + { url = "https://files.pythonhosted.org/packages/91/06/837893227b043fb9b0d13e4bd7586982d8136cb249ffb3492930dab905b8/scipy-1.16.3-cp314-cp314-win_amd64.whl", hash = "sha256:e5d42a9472e7579e473879a1990327830493a7047506d58d73fc429b84c1d49d", size = 39358423 }, + { url = "https://files.pythonhosted.org/packages/95/03/28bce0355e4d34a7c034727505a02d19548549e190bedd13a721e35380b7/scipy-1.16.3-cp314-cp314-win_arm64.whl", hash = "sha256:6020470b9d00245926f2d5bb93b119ca0340f0d564eb6fbaad843eaebf9d690f", size = 26135027 }, + { url = "https://files.pythonhosted.org/packages/b2/6f/69f1e2b682efe9de8fe9f91040f0cd32f13cfccba690512ba4c582b0bc29/scipy-1.16.3-cp314-cp314t-macosx_10_14_x86_64.whl", hash = "sha256:e1d27cbcb4602680a49d787d90664fa4974063ac9d4134813332a8c53dbe667c", size = 37028379 }, + { url = "https://files.pythonhosted.org/packages/7c/2d/e826f31624a5ebbab1cd93d30fd74349914753076ed0593e1d56a98c4fb4/scipy-1.16.3-cp314-cp314t-macosx_12_0_arm64.whl", hash = "sha256:9b9c9c07b6d56a35777a1b4cc8966118fb16cfd8daf6743867d17d36cfad2d40", size = 29400052 }, + { url = "https://files.pythonhosted.org/packages/69/27/d24feb80155f41fd1f156bf144e7e049b4e2b9dd06261a242905e3bc7a03/scipy-1.16.3-cp314-cp314t-macosx_14_0_arm64.whl", hash = "sha256:3a4c460301fb2cffb7f88528f30b3127742cff583603aa7dc964a52c463b385d", size = 21391183 }, + { url = "https://files.pythonhosted.org/packages/f8/d3/1b229e433074c5738a24277eca520a2319aac7465eea7310ea6ae0e98ae2/scipy-1.16.3-cp314-cp314t-macosx_14_0_x86_64.whl", hash = "sha256:f667a4542cc8917af1db06366d3f78a5c8e83badd56409f94d1eac8d8d9133fa", size = 23930174 }, + { url = "https://files.pythonhosted.org/packages/16/9d/d9e148b0ec680c0f042581a2be79a28a7ab66c0c4946697f9e7553ead337/scipy-1.16.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:f379b54b77a597aa7ee5e697df0d66903e41b9c85a6dd7946159e356319158e8", size = 33497852 }, + { url = "https://files.pythonhosted.org/packages/2f/22/4e5f7561e4f98b7bea63cf3fd7934bff1e3182e9f1626b089a679914d5c8/scipy-1.16.3-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:4aff59800a3b7f786b70bfd6ab551001cb553244988d7d6b8299cb1ea653b353", size = 35798595 }, + { url = "https://files.pythonhosted.org/packages/83/42/6644d714c179429fc7196857866f219fef25238319b650bb32dde7bf7a48/scipy-1.16.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:da7763f55885045036fabcebd80144b757d3db06ab0861415d1c3b7c69042146", size = 36186269 }, + { url = "https://files.pythonhosted.org/packages/ac/70/64b4d7ca92f9cf2e6fc6aaa2eecf80bb9b6b985043a9583f32f8177ea122/scipy-1.16.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:ffa6eea95283b2b8079b821dc11f50a17d0571c92b43e2b5b12764dc5f9b285d", size = 38802779 }, + { url = "https://files.pythonhosted.org/packages/61/82/8d0e39f62764cce5ffd5284131e109f07cf8955aef9ab8ed4e3aa5e30539/scipy-1.16.3-cp314-cp314t-win_amd64.whl", hash = "sha256:d9f48cafc7ce94cf9b15c6bffdc443a81a27bf7075cf2dcd5c8b40f85d10c4e7", size = 39471128 }, + { url = "https://files.pythonhosted.org/packages/64/47/a494741db7280eae6dc033510c319e34d42dd41b7ac0c7ead39354d1a2b5/scipy-1.16.3-cp314-cp314t-win_arm64.whl", hash = "sha256:21d9d6b197227a12dcbf9633320a4e34c6b0e51c57268df255a0942983bac562", size = 26464127 }, ] [[package]] @@ -3047,63 +3066,63 @@ dependencies = [ { name = "numpy" }, { name = "pandas" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/86/59/a451d7420a77ab0b98f7affa3a1d78a313d2f7281a57afb1a34bae8ab412/seaborn-0.13.2.tar.gz", hash = "sha256:93e60a40988f4d65e9f4885df477e2fdaff6b73a9ded434c1ab356dd57eefff7", size = 1457696, upload-time = "2024-01-25T13:21:52.551Z" } +sdist = { url = "https://files.pythonhosted.org/packages/86/59/a451d7420a77ab0b98f7affa3a1d78a313d2f7281a57afb1a34bae8ab412/seaborn-0.13.2.tar.gz", hash = "sha256:93e60a40988f4d65e9f4885df477e2fdaff6b73a9ded434c1ab356dd57eefff7", size = 1457696 } wheels = [ - { url = "https://files.pythonhosted.org/packages/83/11/00d3c3dfc25ad54e731d91449895a79e4bf2384dc3ac01809010ba88f6d5/seaborn-0.13.2-py3-none-any.whl", hash = "sha256:636f8336facf092165e27924f223d3c62ca560b1f2bb5dff7ab7fad265361987", size = 294914, upload-time = "2024-01-25T13:21:49.598Z" }, + { url = "https://files.pythonhosted.org/packages/83/11/00d3c3dfc25ad54e731d91449895a79e4bf2384dc3ac01809010ba88f6d5/seaborn-0.13.2-py3-none-any.whl", hash = "sha256:636f8336facf092165e27924f223d3c62ca560b1f2bb5dff7ab7fad265361987", size = 294914 }, ] [[package]] name = "send2trash" version = "1.8.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/fd/3a/aec9b02217bb79b87bbc1a21bc6abc51e3d5dcf65c30487ac96c0908c722/Send2Trash-1.8.3.tar.gz", hash = "sha256:b18e7a3966d99871aefeb00cfbcfdced55ce4871194810fc71f4aa484b953abf", size = 17394, upload-time = "2024-04-07T00:01:09.267Z" } +sdist = { url = "https://files.pythonhosted.org/packages/fd/3a/aec9b02217bb79b87bbc1a21bc6abc51e3d5dcf65c30487ac96c0908c722/Send2Trash-1.8.3.tar.gz", hash = "sha256:b18e7a3966d99871aefeb00cfbcfdced55ce4871194810fc71f4aa484b953abf", size = 17394 } wheels = [ - { url = "https://files.pythonhosted.org/packages/40/b0/4562db6223154aa4e22f939003cb92514c79f3d4dccca3444253fd17f902/Send2Trash-1.8.3-py3-none-any.whl", hash = "sha256:0c31227e0bd08961c7665474a3d1ef7193929fedda4233843689baa056be46c9", size = 18072, upload-time = "2024-04-07T00:01:07.438Z" }, + { url = "https://files.pythonhosted.org/packages/40/b0/4562db6223154aa4e22f939003cb92514c79f3d4dccca3444253fd17f902/Send2Trash-1.8.3-py3-none-any.whl", hash = "sha256:0c31227e0bd08961c7665474a3d1ef7193929fedda4233843689baa056be46c9", size = 18072 }, ] [[package]] name = "setuptools" version = "80.9.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/18/5d/3bf57dcd21979b887f014ea83c24ae194cfcd12b9e0fda66b957c69d1fca/setuptools-80.9.0.tar.gz", hash = "sha256:f36b47402ecde768dbfafc46e8e4207b4360c654f1f3bb84475f0a28628fb19c", size = 1319958, upload-time = "2025-05-27T00:56:51.443Z" } +sdist = { url = "https://files.pythonhosted.org/packages/18/5d/3bf57dcd21979b887f014ea83c24ae194cfcd12b9e0fda66b957c69d1fca/setuptools-80.9.0.tar.gz", hash = "sha256:f36b47402ecde768dbfafc46e8e4207b4360c654f1f3bb84475f0a28628fb19c", size = 1319958 } wheels = [ - { url = "https://files.pythonhosted.org/packages/a3/dc/17031897dae0efacfea57dfd3a82fdd2a2aeb58e0ff71b77b87e44edc772/setuptools-80.9.0-py3-none-any.whl", hash = "sha256:062d34222ad13e0cc312a4c02d73f059e86a4acbfbdea8f8f76b28c99f306922", size = 1201486, upload-time = "2025-05-27T00:56:49.664Z" }, + { url = "https://files.pythonhosted.org/packages/a3/dc/17031897dae0efacfea57dfd3a82fdd2a2aeb58e0ff71b77b87e44edc772/setuptools-80.9.0-py3-none-any.whl", hash = "sha256:062d34222ad13e0cc312a4c02d73f059e86a4acbfbdea8f8f76b28c99f306922", size = 1201486 }, ] [[package]] name = "six" version = "1.17.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/94/e7/b2c673351809dca68a0e064b6af791aa332cf192da575fd474ed7d6f16a2/six-1.17.0.tar.gz", hash = "sha256:ff70335d468e7eb6ec65b95b99d3a2836546063f63acc5171de367e834932a81", size = 34031, upload-time = "2024-12-04T17:35:28.174Z" } +sdist = { url = "https://files.pythonhosted.org/packages/94/e7/b2c673351809dca68a0e064b6af791aa332cf192da575fd474ed7d6f16a2/six-1.17.0.tar.gz", hash = "sha256:ff70335d468e7eb6ec65b95b99d3a2836546063f63acc5171de367e834932a81", size = 34031 } wheels = [ - { url = "https://files.pythonhosted.org/packages/b7/ce/149a00dd41f10bc29e5921b496af8b574d8413afcd5e30dfa0ed46c2cc5e/six-1.17.0-py2.py3-none-any.whl", hash = "sha256:4721f391ed90541fddacab5acf947aa0d3dc7d27b2e1e8eda2be8970586c3274", size = 11050, upload-time = "2024-12-04T17:35:26.475Z" }, + { url = "https://files.pythonhosted.org/packages/b7/ce/149a00dd41f10bc29e5921b496af8b574d8413afcd5e30dfa0ed46c2cc5e/six-1.17.0-py2.py3-none-any.whl", hash = "sha256:4721f391ed90541fddacab5acf947aa0d3dc7d27b2e1e8eda2be8970586c3274", size = 11050 }, ] [[package]] name = "sniffio" version = "1.3.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a2/87/a6771e1546d97e7e041b6ae58d80074f81b7d5121207425c964ddf5cfdbd/sniffio-1.3.1.tar.gz", hash = "sha256:f4324edc670a0f49750a81b895f35c3adb843cca46f0530f79fc1babb23789dc", size = 20372, upload-time = "2024-02-25T23:20:04.057Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a2/87/a6771e1546d97e7e041b6ae58d80074f81b7d5121207425c964ddf5cfdbd/sniffio-1.3.1.tar.gz", hash = "sha256:f4324edc670a0f49750a81b895f35c3adb843cca46f0530f79fc1babb23789dc", size = 20372 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e9/44/75a9c9421471a6c4805dbf2356f7c181a29c1879239abab1ea2cc8f38b40/sniffio-1.3.1-py3-none-any.whl", hash = "sha256:2f6da418d1f1e0fddd844478f41680e794e6051915791a034ff65e5f100525a2", size = 10235, upload-time = "2024-02-25T23:20:01.196Z" }, + { url = "https://files.pythonhosted.org/packages/e9/44/75a9c9421471a6c4805dbf2356f7c181a29c1879239abab1ea2cc8f38b40/sniffio-1.3.1-py3-none-any.whl", hash = "sha256:2f6da418d1f1e0fddd844478f41680e794e6051915791a034ff65e5f100525a2", size = 10235 }, ] [[package]] name = "snowballstemmer" version = "3.0.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/75/a7/9810d872919697c9d01295633f5d574fb416d47e535f258272ca1f01f447/snowballstemmer-3.0.1.tar.gz", hash = "sha256:6d5eeeec8e9f84d4d56b847692bacf79bc2c8e90c7f80ca4444ff8b6f2e52895", size = 105575, upload-time = "2025-05-09T16:34:51.843Z" } +sdist = { url = "https://files.pythonhosted.org/packages/75/a7/9810d872919697c9d01295633f5d574fb416d47e535f258272ca1f01f447/snowballstemmer-3.0.1.tar.gz", hash = "sha256:6d5eeeec8e9f84d4d56b847692bacf79bc2c8e90c7f80ca4444ff8b6f2e52895", size = 105575 } wheels = [ - { url = "https://files.pythonhosted.org/packages/c8/78/3565d011c61f5a43488987ee32b6f3f656e7f107ac2782dd57bdd7d91d9a/snowballstemmer-3.0.1-py3-none-any.whl", hash = "sha256:6cd7b3897da8d6c9ffb968a6781fa6532dce9c3618a4b127d920dab764a19064", size = 103274, upload-time = "2025-05-09T16:34:50.371Z" }, + { url = "https://files.pythonhosted.org/packages/c8/78/3565d011c61f5a43488987ee32b6f3f656e7f107ac2782dd57bdd7d91d9a/snowballstemmer-3.0.1-py3-none-any.whl", hash = "sha256:6cd7b3897da8d6c9ffb968a6781fa6532dce9c3618a4b127d920dab764a19064", size = 103274 }, ] [[package]] name = "soupsieve" version = "2.8" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/6d/e6/21ccce3262dd4889aa3332e5a119a3491a95e8f60939870a3a035aabac0d/soupsieve-2.8.tar.gz", hash = "sha256:e2dd4a40a628cb5f28f6d4b0db8800b8f581b65bb380b97de22ba5ca8d72572f", size = 103472, upload-time = "2025-08-27T15:39:51.78Z" } +sdist = { url = "https://files.pythonhosted.org/packages/6d/e6/21ccce3262dd4889aa3332e5a119a3491a95e8f60939870a3a035aabac0d/soupsieve-2.8.tar.gz", hash = "sha256:e2dd4a40a628cb5f28f6d4b0db8800b8f581b65bb380b97de22ba5ca8d72572f", size = 103472 } wheels = [ - { url = "https://files.pythonhosted.org/packages/14/a0/bb38d3b76b8cae341dad93a2dd83ab7462e6dbcdd84d43f54ee60a8dc167/soupsieve-2.8-py3-none-any.whl", hash = "sha256:0cc76456a30e20f5d7f2e14a98a4ae2ee4e5abdc7c5ea0aafe795f344bc7984c", size = 36679, upload-time = "2025-08-27T15:39:50.179Z" }, + { url = "https://files.pythonhosted.org/packages/14/a0/bb38d3b76b8cae341dad93a2dd83ab7462e6dbcdd84d43f54ee60a8dc167/soupsieve-2.8-py3-none-any.whl", hash = "sha256:0cc76456a30e20f5d7f2e14a98a4ae2ee4e5abdc7c5ea0aafe795f344bc7984c", size = 36679 }, ] [[package]] @@ -3129,9 +3148,9 @@ dependencies = [ { name = "sphinxcontrib-qthelp" }, { name = "sphinxcontrib-serializinghtml" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/38/ad/4360e50ed56cb483667b8e6dadf2d3fda62359593faabbe749a27c4eaca6/sphinx-8.2.3.tar.gz", hash = "sha256:398ad29dee7f63a75888314e9424d40f52ce5a6a87ae88e7071e80af296ec348", size = 8321876, upload-time = "2025-03-02T22:31:59.658Z" } +sdist = { url = "https://files.pythonhosted.org/packages/38/ad/4360e50ed56cb483667b8e6dadf2d3fda62359593faabbe749a27c4eaca6/sphinx-8.2.3.tar.gz", hash = "sha256:398ad29dee7f63a75888314e9424d40f52ce5a6a87ae88e7071e80af296ec348", size = 8321876 } wheels = [ - { url = "https://files.pythonhosted.org/packages/31/53/136e9eca6e0b9dc0e1962e2c908fbea2e5ac000c2a2fbd9a35797958c48b/sphinx-8.2.3-py3-none-any.whl", hash = "sha256:4405915165f13521d875a8c29c8970800a0141c14cc5416a38feca4ea5d9b9c3", size = 3589741, upload-time = "2025-03-02T22:31:56.836Z" }, + { url = "https://files.pythonhosted.org/packages/31/53/136e9eca6e0b9dc0e1962e2c908fbea2e5ac000c2a2fbd9a35797958c48b/sphinx-8.2.3-py3-none-any.whl", hash = "sha256:4405915165f13521d875a8c29c8970800a0141c14cc5416a38feca4ea5d9b9c3", size = 3589741 }, ] [[package]] @@ -3141,9 +3160,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/34/4f/4fd5583678bb7dc8afa69e9b309e6a99ee8d79ad3a4728f4e52fd7cb37c7/sphinx_autodoc_typehints-3.5.2.tar.gz", hash = "sha256:5fcd4a3eb7aa89424c1e2e32bedca66edc38367569c9169a80f4b3e934171fdb", size = 37839, upload-time = "2025-10-16T00:50:15.743Z" } +sdist = { url = "https://files.pythonhosted.org/packages/34/4f/4fd5583678bb7dc8afa69e9b309e6a99ee8d79ad3a4728f4e52fd7cb37c7/sphinx_autodoc_typehints-3.5.2.tar.gz", hash = "sha256:5fcd4a3eb7aa89424c1e2e32bedca66edc38367569c9169a80f4b3e934171fdb", size = 37839 } wheels = [ - { url = "https://files.pythonhosted.org/packages/05/f2/9657c98a66973b7c35bfd48ba65d1922860de9598fbb535cd96e3f58a908/sphinx_autodoc_typehints-3.5.2-py3-none-any.whl", hash = "sha256:0accd043619f53c86705958e323b419e41667917045ac9215d7be1b493648d8c", size = 21184, upload-time = "2025-10-16T00:50:13.973Z" }, + { url = "https://files.pythonhosted.org/packages/05/f2/9657c98a66973b7c35bfd48ba65d1922860de9598fbb535cd96e3f58a908/sphinx_autodoc_typehints-3.5.2-py3-none-any.whl", hash = "sha256:0accd043619f53c86705958e323b419e41667917045ac9215d7be1b493648d8c", size = 21184 }, ] [[package]] @@ -3154,45 +3173,45 @@ dependencies = [ { name = "pillow" }, { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/cd/e5/9ccd6ecd492043123adb465cba504217b9f0a82e2cb5b1d7249c648497c6/sphinx_gallery-0.19.0.tar.gz", hash = "sha256:8400cb5240ad642e28a612fdba0667f725d0505a9be0222d0243de60e8af2eb3", size = 471479, upload-time = "2025-02-13T03:24:50.081Z" } +sdist = { url = "https://files.pythonhosted.org/packages/cd/e5/9ccd6ecd492043123adb465cba504217b9f0a82e2cb5b1d7249c648497c6/sphinx_gallery-0.19.0.tar.gz", hash = "sha256:8400cb5240ad642e28a612fdba0667f725d0505a9be0222d0243de60e8af2eb3", size = 471479 } wheels = [ - { url = "https://files.pythonhosted.org/packages/77/c7/52b48aec16b26c52aba854d03a3a31e0681150301dac1bea2243645a69e7/sphinx_gallery-0.19.0-py3-none-any.whl", hash = "sha256:4c28751973f81769d5bbbf5e4ebaa0dc49dff8c48eb7f11131eb5f6e4aa25f0e", size = 455923, upload-time = "2025-02-13T03:24:47.697Z" }, + { url = "https://files.pythonhosted.org/packages/77/c7/52b48aec16b26c52aba854d03a3a31e0681150301dac1bea2243645a69e7/sphinx_gallery-0.19.0-py3-none-any.whl", hash = "sha256:4c28751973f81769d5bbbf5e4ebaa0dc49dff8c48eb7f11131eb5f6e4aa25f0e", size = 455923 }, ] [[package]] name = "sphinxcontrib-applehelp" version = "2.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ba/6e/b837e84a1a704953c62ef8776d45c3e8d759876b4a84fe14eba2859106fe/sphinxcontrib_applehelp-2.0.0.tar.gz", hash = "sha256:2f29ef331735ce958efa4734873f084941970894c6090408b079c61b2e1c06d1", size = 20053, upload-time = "2024-07-29T01:09:00.465Z" } +sdist = { url = "https://files.pythonhosted.org/packages/ba/6e/b837e84a1a704953c62ef8776d45c3e8d759876b4a84fe14eba2859106fe/sphinxcontrib_applehelp-2.0.0.tar.gz", hash = "sha256:2f29ef331735ce958efa4734873f084941970894c6090408b079c61b2e1c06d1", size = 20053 } wheels = [ - { url = "https://files.pythonhosted.org/packages/5d/85/9ebeae2f76e9e77b952f4b274c27238156eae7979c5421fba91a28f4970d/sphinxcontrib_applehelp-2.0.0-py3-none-any.whl", hash = "sha256:4cd3f0ec4ac5dd9c17ec65e9ab272c9b867ea77425228e68ecf08d6b28ddbdb5", size = 119300, upload-time = "2024-07-29T01:08:58.99Z" }, + { url = "https://files.pythonhosted.org/packages/5d/85/9ebeae2f76e9e77b952f4b274c27238156eae7979c5421fba91a28f4970d/sphinxcontrib_applehelp-2.0.0-py3-none-any.whl", hash = "sha256:4cd3f0ec4ac5dd9c17ec65e9ab272c9b867ea77425228e68ecf08d6b28ddbdb5", size = 119300 }, ] [[package]] name = "sphinxcontrib-devhelp" version = "2.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f6/d2/5beee64d3e4e747f316bae86b55943f51e82bb86ecd325883ef65741e7da/sphinxcontrib_devhelp-2.0.0.tar.gz", hash = "sha256:411f5d96d445d1d73bb5d52133377b4248ec79db5c793ce7dbe59e074b4dd1ad", size = 12967, upload-time = "2024-07-29T01:09:23.417Z" } +sdist = { url = "https://files.pythonhosted.org/packages/f6/d2/5beee64d3e4e747f316bae86b55943f51e82bb86ecd325883ef65741e7da/sphinxcontrib_devhelp-2.0.0.tar.gz", hash = "sha256:411f5d96d445d1d73bb5d52133377b4248ec79db5c793ce7dbe59e074b4dd1ad", size = 12967 } wheels = [ - { url = "https://files.pythonhosted.org/packages/35/7a/987e583882f985fe4d7323774889ec58049171828b58c2217e7f79cdf44e/sphinxcontrib_devhelp-2.0.0-py3-none-any.whl", hash = "sha256:aefb8b83854e4b0998877524d1029fd3e6879210422ee3780459e28a1f03a8a2", size = 82530, upload-time = "2024-07-29T01:09:21.945Z" }, + { url = "https://files.pythonhosted.org/packages/35/7a/987e583882f985fe4d7323774889ec58049171828b58c2217e7f79cdf44e/sphinxcontrib_devhelp-2.0.0-py3-none-any.whl", hash = "sha256:aefb8b83854e4b0998877524d1029fd3e6879210422ee3780459e28a1f03a8a2", size = 82530 }, ] [[package]] name = "sphinxcontrib-htmlhelp" version = "2.1.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/43/93/983afd9aa001e5201eab16b5a444ed5b9b0a7a010541e0ddfbbfd0b2470c/sphinxcontrib_htmlhelp-2.1.0.tar.gz", hash = "sha256:c9e2916ace8aad64cc13a0d233ee22317f2b9025b9cf3295249fa985cc7082e9", size = 22617, upload-time = "2024-07-29T01:09:37.889Z" } +sdist = { url = "https://files.pythonhosted.org/packages/43/93/983afd9aa001e5201eab16b5a444ed5b9b0a7a010541e0ddfbbfd0b2470c/sphinxcontrib_htmlhelp-2.1.0.tar.gz", hash = "sha256:c9e2916ace8aad64cc13a0d233ee22317f2b9025b9cf3295249fa985cc7082e9", size = 22617 } wheels = [ - { url = "https://files.pythonhosted.org/packages/0a/7b/18a8c0bcec9182c05a0b3ec2a776bba4ead82750a55ff798e8d406dae604/sphinxcontrib_htmlhelp-2.1.0-py3-none-any.whl", hash = "sha256:166759820b47002d22914d64a075ce08f4c46818e17cfc9470a9786b759b19f8", size = 98705, upload-time = "2024-07-29T01:09:36.407Z" }, + { url = "https://files.pythonhosted.org/packages/0a/7b/18a8c0bcec9182c05a0b3ec2a776bba4ead82750a55ff798e8d406dae604/sphinxcontrib_htmlhelp-2.1.0-py3-none-any.whl", hash = "sha256:166759820b47002d22914d64a075ce08f4c46818e17cfc9470a9786b759b19f8", size = 98705 }, ] [[package]] name = "sphinxcontrib-jsmath" version = "1.0.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/b2/e8/9ed3830aeed71f17c026a07a5097edcf44b692850ef215b161b8ad875729/sphinxcontrib-jsmath-1.0.1.tar.gz", hash = "sha256:a9925e4a4587247ed2191a22df5f6970656cb8ca2bd6284309578f2153e0c4b8", size = 5787, upload-time = "2019-01-21T16:10:16.347Z" } +sdist = { url = "https://files.pythonhosted.org/packages/b2/e8/9ed3830aeed71f17c026a07a5097edcf44b692850ef215b161b8ad875729/sphinxcontrib-jsmath-1.0.1.tar.gz", hash = "sha256:a9925e4a4587247ed2191a22df5f6970656cb8ca2bd6284309578f2153e0c4b8", size = 5787 } wheels = [ - { url = "https://files.pythonhosted.org/packages/c2/42/4c8646762ee83602e3fb3fbe774c2fac12f317deb0b5dbeeedd2d3ba4b77/sphinxcontrib_jsmath-1.0.1-py2.py3-none-any.whl", hash = "sha256:2ec2eaebfb78f3f2078e73666b1415417a116cc848b72e5172e596c871103178", size = 5071, upload-time = "2019-01-21T16:10:14.333Z" }, + { url = "https://files.pythonhosted.org/packages/c2/42/4c8646762ee83602e3fb3fbe774c2fac12f317deb0b5dbeeedd2d3ba4b77/sphinxcontrib_jsmath-1.0.1-py2.py3-none-any.whl", hash = "sha256:2ec2eaebfb78f3f2078e73666b1415417a116cc848b72e5172e596c871103178", size = 5071 }, ] [[package]] @@ -3203,27 +3222,27 @@ dependencies = [ { name = "pyyaml" }, { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/97/69/bf039237ad260073e8c02f820b3e00dc34f3a2de20aff7861e6b19d2f8c5/sphinxcontrib_mermaid-1.0.0.tar.gz", hash = "sha256:2e8ab67d3e1e2816663f9347d026a8dee4a858acdd4ad32dd1c808893db88146", size = 15153, upload-time = "2024-10-12T16:33:03.863Z" } +sdist = { url = "https://files.pythonhosted.org/packages/97/69/bf039237ad260073e8c02f820b3e00dc34f3a2de20aff7861e6b19d2f8c5/sphinxcontrib_mermaid-1.0.0.tar.gz", hash = "sha256:2e8ab67d3e1e2816663f9347d026a8dee4a858acdd4ad32dd1c808893db88146", size = 15153 } wheels = [ - { url = "https://files.pythonhosted.org/packages/cd/c8/784b9ac6ea08aa594c1a4becbd0dbe77186785362e31fd633b8c6ae0197a/sphinxcontrib_mermaid-1.0.0-py3-none-any.whl", hash = "sha256:60b72710ea02087f212028feb09711225fbc2e343a10d34822fe787510e1caa3", size = 9597, upload-time = "2024-10-12T16:33:02.303Z" }, + { url = "https://files.pythonhosted.org/packages/cd/c8/784b9ac6ea08aa594c1a4becbd0dbe77186785362e31fd633b8c6ae0197a/sphinxcontrib_mermaid-1.0.0-py3-none-any.whl", hash = "sha256:60b72710ea02087f212028feb09711225fbc2e343a10d34822fe787510e1caa3", size = 9597 }, ] [[package]] name = "sphinxcontrib-qthelp" version = "2.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/68/bc/9104308fc285eb3e0b31b67688235db556cd5b0ef31d96f30e45f2e51cae/sphinxcontrib_qthelp-2.0.0.tar.gz", hash = "sha256:4fe7d0ac8fc171045be623aba3e2a8f613f8682731f9153bb2e40ece16b9bbab", size = 17165, upload-time = "2024-07-29T01:09:56.435Z" } +sdist = { url = "https://files.pythonhosted.org/packages/68/bc/9104308fc285eb3e0b31b67688235db556cd5b0ef31d96f30e45f2e51cae/sphinxcontrib_qthelp-2.0.0.tar.gz", hash = "sha256:4fe7d0ac8fc171045be623aba3e2a8f613f8682731f9153bb2e40ece16b9bbab", size = 17165 } wheels = [ - { url = "https://files.pythonhosted.org/packages/27/83/859ecdd180cacc13b1f7e857abf8582a64552ea7a061057a6c716e790fce/sphinxcontrib_qthelp-2.0.0-py3-none-any.whl", hash = "sha256:b18a828cdba941ccd6ee8445dbe72ffa3ef8cbe7505d8cd1fa0d42d3f2d5f3eb", size = 88743, upload-time = "2024-07-29T01:09:54.885Z" }, + { url = "https://files.pythonhosted.org/packages/27/83/859ecdd180cacc13b1f7e857abf8582a64552ea7a061057a6c716e790fce/sphinxcontrib_qthelp-2.0.0-py3-none-any.whl", hash = "sha256:b18a828cdba941ccd6ee8445dbe72ffa3ef8cbe7505d8cd1fa0d42d3f2d5f3eb", size = 88743 }, ] [[package]] name = "sphinxcontrib-serializinghtml" version = "2.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/3b/44/6716b257b0aa6bfd51a1b31665d1c205fb12cb5ad56de752dfa15657de2f/sphinxcontrib_serializinghtml-2.0.0.tar.gz", hash = "sha256:e9d912827f872c029017a53f0ef2180b327c3f7fd23c87229f7a8e8b70031d4d", size = 16080, upload-time = "2024-07-29T01:10:09.332Z" } +sdist = { url = "https://files.pythonhosted.org/packages/3b/44/6716b257b0aa6bfd51a1b31665d1c205fb12cb5ad56de752dfa15657de2f/sphinxcontrib_serializinghtml-2.0.0.tar.gz", hash = "sha256:e9d912827f872c029017a53f0ef2180b327c3f7fd23c87229f7a8e8b70031d4d", size = 16080 } wheels = [ - { url = "https://files.pythonhosted.org/packages/52/a7/d2782e4e3f77c8450f727ba74a8f12756d5ba823d81b941f1b04da9d033a/sphinxcontrib_serializinghtml-2.0.0-py3-none-any.whl", hash = "sha256:6e2cb0eef194e10c27ec0023bfeb25badbbb5868244cf5bc5bdc04e4464bf331", size = 92072, upload-time = "2024-07-29T01:10:08.203Z" }, + { url = "https://files.pythonhosted.org/packages/52/a7/d2782e4e3f77c8450f727ba74a8f12756d5ba823d81b941f1b04da9d033a/sphinxcontrib_serializinghtml-2.0.0-py3-none-any.whl", hash = "sha256:6e2cb0eef194e10c27ec0023bfeb25badbbb5868244cf5bc5bdc04e4464bf331", size = 92072 }, ] [[package]] @@ -3234,33 +3253,33 @@ dependencies = [ { name = "greenlet", marker = "platform_machine == 'AMD64' or platform_machine == 'WIN32' or platform_machine == 'aarch64' or platform_machine == 'amd64' or platform_machine == 'ppc64le' or platform_machine == 'win32' or platform_machine == 'x86_64'" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/f0/f2/840d7b9496825333f532d2e3976b8eadbf52034178aac53630d09fe6e1ef/sqlalchemy-2.0.44.tar.gz", hash = "sha256:0ae7454e1ab1d780aee69fd2aae7d6b8670a581d8847f2d1e0f7ddfbf47e5a22", size = 9819830, upload-time = "2025-10-10T14:39:12.935Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/e3/81/15d7c161c9ddf0900b076b55345872ed04ff1ed6a0666e5e94ab44b0163c/sqlalchemy-2.0.44-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:0fe3917059c7ab2ee3f35e77757062b1bea10a0b6ca633c58391e3f3c6c488dd", size = 2140517, upload-time = "2025-10-10T15:36:15.64Z" }, - { url = "https://files.pythonhosted.org/packages/d4/d5/4abd13b245c7d91bdf131d4916fd9e96a584dac74215f8b5bc945206a974/sqlalchemy-2.0.44-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:de4387a354ff230bc979b46b2207af841dc8bf29847b6c7dbe60af186d97aefa", size = 2130738, upload-time = "2025-10-10T15:36:16.91Z" }, - { url = "https://files.pythonhosted.org/packages/cb/3c/8418969879c26522019c1025171cefbb2a8586b6789ea13254ac602986c0/sqlalchemy-2.0.44-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:c3678a0fb72c8a6a29422b2732fe423db3ce119c34421b5f9955873eb9b62c1e", size = 3304145, upload-time = "2025-10-10T15:34:19.569Z" }, - { url = "https://files.pythonhosted.org/packages/94/2d/fdb9246d9d32518bda5d90f4b65030b9bf403a935cfe4c36a474846517cb/sqlalchemy-2.0.44-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3cf6872a23601672d61a68f390e44703442639a12ee9dd5a88bbce52a695e46e", size = 3304511, upload-time = "2025-10-10T15:47:05.088Z" }, - { url = "https://files.pythonhosted.org/packages/7d/fb/40f2ad1da97d5c83f6c1269664678293d3fe28e90ad17a1093b735420549/sqlalchemy-2.0.44-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:329aa42d1be9929603f406186630135be1e7a42569540577ba2c69952b7cf399", size = 3235161, upload-time = "2025-10-10T15:34:21.193Z" }, - { url = "https://files.pythonhosted.org/packages/95/cb/7cf4078b46752dca917d18cf31910d4eff6076e5b513c2d66100c4293d83/sqlalchemy-2.0.44-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:70e03833faca7166e6a9927fbee7c27e6ecde436774cd0b24bbcc96353bce06b", size = 3261426, upload-time = "2025-10-10T15:47:07.196Z" }, - { url = "https://files.pythonhosted.org/packages/f8/3b/55c09b285cb2d55bdfa711e778bdffdd0dc3ffa052b0af41f1c5d6e582fa/sqlalchemy-2.0.44-cp311-cp311-win32.whl", hash = "sha256:253e2f29843fb303eca6b2fc645aca91fa7aa0aa70b38b6950da92d44ff267f3", size = 2105392, upload-time = "2025-10-10T15:38:20.051Z" }, - { url = "https://files.pythonhosted.org/packages/c7/23/907193c2f4d680aedbfbdf7bf24c13925e3c7c292e813326c1b84a0b878e/sqlalchemy-2.0.44-cp311-cp311-win_amd64.whl", hash = "sha256:7a8694107eb4308a13b425ca8c0e67112f8134c846b6e1f722698708741215d5", size = 2130293, upload-time = "2025-10-10T15:38:21.601Z" }, - { url = "https://files.pythonhosted.org/packages/62/c4/59c7c9b068e6813c898b771204aad36683c96318ed12d4233e1b18762164/sqlalchemy-2.0.44-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:72fea91746b5890f9e5e0997f16cbf3d53550580d76355ba2d998311b17b2250", size = 2139675, upload-time = "2025-10-10T16:03:31.064Z" }, - { url = "https://files.pythonhosted.org/packages/d6/ae/eeb0920537a6f9c5a3708e4a5fc55af25900216bdb4847ec29cfddf3bf3a/sqlalchemy-2.0.44-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:585c0c852a891450edbb1eaca8648408a3cc125f18cf433941fa6babcc359e29", size = 2127726, upload-time = "2025-10-10T16:03:35.934Z" }, - { url = "https://files.pythonhosted.org/packages/d8/d5/2ebbabe0379418eda8041c06b0b551f213576bfe4c2f09d77c06c07c8cc5/sqlalchemy-2.0.44-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9b94843a102efa9ac68a7a30cd46df3ff1ed9c658100d30a725d10d9c60a2f44", size = 3327603, upload-time = "2025-10-10T15:35:28.322Z" }, - { url = "https://files.pythonhosted.org/packages/45/e5/5aa65852dadc24b7d8ae75b7efb8d19303ed6ac93482e60c44a585930ea5/sqlalchemy-2.0.44-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:119dc41e7a7defcefc57189cfa0e61b1bf9c228211aba432b53fb71ef367fda1", size = 3337842, upload-time = "2025-10-10T15:43:45.431Z" }, - { url = "https://files.pythonhosted.org/packages/41/92/648f1afd3f20b71e880ca797a960f638d39d243e233a7082c93093c22378/sqlalchemy-2.0.44-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:0765e318ee9179b3718c4fd7ba35c434f4dd20332fbc6857a5e8df17719c24d7", size = 3264558, upload-time = "2025-10-10T15:35:29.93Z" }, - { url = "https://files.pythonhosted.org/packages/40/cf/e27d7ee61a10f74b17740918e23cbc5bc62011b48282170dc4c66da8ec0f/sqlalchemy-2.0.44-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:2e7b5b079055e02d06a4308d0481658e4f06bc7ef211567edc8f7d5dce52018d", size = 3301570, upload-time = "2025-10-10T15:43:48.407Z" }, - { url = "https://files.pythonhosted.org/packages/3b/3d/3116a9a7b63e780fb402799b6da227435be878b6846b192f076d2f838654/sqlalchemy-2.0.44-cp312-cp312-win32.whl", hash = "sha256:846541e58b9a81cce7dee8329f352c318de25aa2f2bbe1e31587eb1f057448b4", size = 2103447, upload-time = "2025-10-10T15:03:21.678Z" }, - { url = "https://files.pythonhosted.org/packages/25/83/24690e9dfc241e6ab062df82cc0df7f4231c79ba98b273fa496fb3dd78ed/sqlalchemy-2.0.44-cp312-cp312-win_amd64.whl", hash = "sha256:7cbcb47fd66ab294703e1644f78971f6f2f1126424d2b300678f419aa73c7b6e", size = 2130912, upload-time = "2025-10-10T15:03:24.656Z" }, - { url = "https://files.pythonhosted.org/packages/45/d3/c67077a2249fdb455246e6853166360054c331db4613cda3e31ab1cadbef/sqlalchemy-2.0.44-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:ff486e183d151e51b1d694c7aa1695747599bb00b9f5f604092b54b74c64a8e1", size = 2135479, upload-time = "2025-10-10T16:03:37.671Z" }, - { url = "https://files.pythonhosted.org/packages/2b/91/eabd0688330d6fd114f5f12c4f89b0d02929f525e6bf7ff80aa17ca802af/sqlalchemy-2.0.44-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:0b1af8392eb27b372ddb783b317dea0f650241cea5bd29199b22235299ca2e45", size = 2123212, upload-time = "2025-10-10T16:03:41.755Z" }, - { url = "https://files.pythonhosted.org/packages/b0/bb/43e246cfe0e81c018076a16036d9b548c4cc649de241fa27d8d9ca6f85ab/sqlalchemy-2.0.44-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2b61188657e3a2b9ac4e8f04d6cf8e51046e28175f79464c67f2fd35bceb0976", size = 3255353, upload-time = "2025-10-10T15:35:31.221Z" }, - { url = "https://files.pythonhosted.org/packages/b9/96/c6105ed9a880abe346b64d3b6ddef269ddfcab04f7f3d90a0bf3c5a88e82/sqlalchemy-2.0.44-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b87e7b91a5d5973dda5f00cd61ef72ad75a1db73a386b62877d4875a8840959c", size = 3260222, upload-time = "2025-10-10T15:43:50.124Z" }, - { url = "https://files.pythonhosted.org/packages/44/16/1857e35a47155b5ad927272fee81ae49d398959cb749edca6eaa399b582f/sqlalchemy-2.0.44-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:15f3326f7f0b2bfe406ee562e17f43f36e16167af99c4c0df61db668de20002d", size = 3189614, upload-time = "2025-10-10T15:35:32.578Z" }, - { url = "https://files.pythonhosted.org/packages/88/ee/4afb39a8ee4fc786e2d716c20ab87b5b1fb33d4ac4129a1aaa574ae8a585/sqlalchemy-2.0.44-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:1e77faf6ff919aa8cd63f1c4e561cac1d9a454a191bb864d5dd5e545935e5a40", size = 3226248, upload-time = "2025-10-10T15:43:51.862Z" }, - { url = "https://files.pythonhosted.org/packages/32/d5/0e66097fc64fa266f29a7963296b40a80d6a997b7ac13806183700676f86/sqlalchemy-2.0.44-cp313-cp313-win32.whl", hash = "sha256:ee51625c2d51f8baadf2829fae817ad0b66b140573939dd69284d2ba3553ae73", size = 2101275, upload-time = "2025-10-10T15:03:26.096Z" }, - { url = "https://files.pythonhosted.org/packages/03/51/665617fe4f8c6450f42a6d8d69243f9420f5677395572c2fe9d21b493b7b/sqlalchemy-2.0.44-cp313-cp313-win_amd64.whl", hash = "sha256:c1c80faaee1a6c3428cecf40d16a2365bcf56c424c92c2b6f0f9ad204b899e9e", size = 2127901, upload-time = "2025-10-10T15:03:27.548Z" }, - { url = "https://files.pythonhosted.org/packages/9c/5e/6a29fa884d9fb7ddadf6b69490a9d45fded3b38541713010dad16b77d015/sqlalchemy-2.0.44-py3-none-any.whl", hash = "sha256:19de7ca1246fbef9f9d1bff8f1ab25641569df226364a0e40457dc5457c54b05", size = 1928718, upload-time = "2025-10-10T15:29:45.32Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/f0/f2/840d7b9496825333f532d2e3976b8eadbf52034178aac53630d09fe6e1ef/sqlalchemy-2.0.44.tar.gz", hash = "sha256:0ae7454e1ab1d780aee69fd2aae7d6b8670a581d8847f2d1e0f7ddfbf47e5a22", size = 9819830 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/e3/81/15d7c161c9ddf0900b076b55345872ed04ff1ed6a0666e5e94ab44b0163c/sqlalchemy-2.0.44-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:0fe3917059c7ab2ee3f35e77757062b1bea10a0b6ca633c58391e3f3c6c488dd", size = 2140517 }, + { url = "https://files.pythonhosted.org/packages/d4/d5/4abd13b245c7d91bdf131d4916fd9e96a584dac74215f8b5bc945206a974/sqlalchemy-2.0.44-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:de4387a354ff230bc979b46b2207af841dc8bf29847b6c7dbe60af186d97aefa", size = 2130738 }, + { url = "https://files.pythonhosted.org/packages/cb/3c/8418969879c26522019c1025171cefbb2a8586b6789ea13254ac602986c0/sqlalchemy-2.0.44-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:c3678a0fb72c8a6a29422b2732fe423db3ce119c34421b5f9955873eb9b62c1e", size = 3304145 }, + { url = "https://files.pythonhosted.org/packages/94/2d/fdb9246d9d32518bda5d90f4b65030b9bf403a935cfe4c36a474846517cb/sqlalchemy-2.0.44-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3cf6872a23601672d61a68f390e44703442639a12ee9dd5a88bbce52a695e46e", size = 3304511 }, + { url = "https://files.pythonhosted.org/packages/7d/fb/40f2ad1da97d5c83f6c1269664678293d3fe28e90ad17a1093b735420549/sqlalchemy-2.0.44-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:329aa42d1be9929603f406186630135be1e7a42569540577ba2c69952b7cf399", size = 3235161 }, + { url = "https://files.pythonhosted.org/packages/95/cb/7cf4078b46752dca917d18cf31910d4eff6076e5b513c2d66100c4293d83/sqlalchemy-2.0.44-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:70e03833faca7166e6a9927fbee7c27e6ecde436774cd0b24bbcc96353bce06b", size = 3261426 }, + { url = "https://files.pythonhosted.org/packages/f8/3b/55c09b285cb2d55bdfa711e778bdffdd0dc3ffa052b0af41f1c5d6e582fa/sqlalchemy-2.0.44-cp311-cp311-win32.whl", hash = "sha256:253e2f29843fb303eca6b2fc645aca91fa7aa0aa70b38b6950da92d44ff267f3", size = 2105392 }, + { url = "https://files.pythonhosted.org/packages/c7/23/907193c2f4d680aedbfbdf7bf24c13925e3c7c292e813326c1b84a0b878e/sqlalchemy-2.0.44-cp311-cp311-win_amd64.whl", hash = "sha256:7a8694107eb4308a13b425ca8c0e67112f8134c846b6e1f722698708741215d5", size = 2130293 }, + { url = "https://files.pythonhosted.org/packages/62/c4/59c7c9b068e6813c898b771204aad36683c96318ed12d4233e1b18762164/sqlalchemy-2.0.44-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:72fea91746b5890f9e5e0997f16cbf3d53550580d76355ba2d998311b17b2250", size = 2139675 }, + { url = "https://files.pythonhosted.org/packages/d6/ae/eeb0920537a6f9c5a3708e4a5fc55af25900216bdb4847ec29cfddf3bf3a/sqlalchemy-2.0.44-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:585c0c852a891450edbb1eaca8648408a3cc125f18cf433941fa6babcc359e29", size = 2127726 }, + { url = "https://files.pythonhosted.org/packages/d8/d5/2ebbabe0379418eda8041c06b0b551f213576bfe4c2f09d77c06c07c8cc5/sqlalchemy-2.0.44-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9b94843a102efa9ac68a7a30cd46df3ff1ed9c658100d30a725d10d9c60a2f44", size = 3327603 }, + { url = "https://files.pythonhosted.org/packages/45/e5/5aa65852dadc24b7d8ae75b7efb8d19303ed6ac93482e60c44a585930ea5/sqlalchemy-2.0.44-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:119dc41e7a7defcefc57189cfa0e61b1bf9c228211aba432b53fb71ef367fda1", size = 3337842 }, + { url = "https://files.pythonhosted.org/packages/41/92/648f1afd3f20b71e880ca797a960f638d39d243e233a7082c93093c22378/sqlalchemy-2.0.44-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:0765e318ee9179b3718c4fd7ba35c434f4dd20332fbc6857a5e8df17719c24d7", size = 3264558 }, + { url = "https://files.pythonhosted.org/packages/40/cf/e27d7ee61a10f74b17740918e23cbc5bc62011b48282170dc4c66da8ec0f/sqlalchemy-2.0.44-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:2e7b5b079055e02d06a4308d0481658e4f06bc7ef211567edc8f7d5dce52018d", size = 3301570 }, + { url = "https://files.pythonhosted.org/packages/3b/3d/3116a9a7b63e780fb402799b6da227435be878b6846b192f076d2f838654/sqlalchemy-2.0.44-cp312-cp312-win32.whl", hash = "sha256:846541e58b9a81cce7dee8329f352c318de25aa2f2bbe1e31587eb1f057448b4", size = 2103447 }, + { url = "https://files.pythonhosted.org/packages/25/83/24690e9dfc241e6ab062df82cc0df7f4231c79ba98b273fa496fb3dd78ed/sqlalchemy-2.0.44-cp312-cp312-win_amd64.whl", hash = "sha256:7cbcb47fd66ab294703e1644f78971f6f2f1126424d2b300678f419aa73c7b6e", size = 2130912 }, + { url = "https://files.pythonhosted.org/packages/45/d3/c67077a2249fdb455246e6853166360054c331db4613cda3e31ab1cadbef/sqlalchemy-2.0.44-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:ff486e183d151e51b1d694c7aa1695747599bb00b9f5f604092b54b74c64a8e1", size = 2135479 }, + { url = "https://files.pythonhosted.org/packages/2b/91/eabd0688330d6fd114f5f12c4f89b0d02929f525e6bf7ff80aa17ca802af/sqlalchemy-2.0.44-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:0b1af8392eb27b372ddb783b317dea0f650241cea5bd29199b22235299ca2e45", size = 2123212 }, + { url = "https://files.pythonhosted.org/packages/b0/bb/43e246cfe0e81c018076a16036d9b548c4cc649de241fa27d8d9ca6f85ab/sqlalchemy-2.0.44-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2b61188657e3a2b9ac4e8f04d6cf8e51046e28175f79464c67f2fd35bceb0976", size = 3255353 }, + { url = "https://files.pythonhosted.org/packages/b9/96/c6105ed9a880abe346b64d3b6ddef269ddfcab04f7f3d90a0bf3c5a88e82/sqlalchemy-2.0.44-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b87e7b91a5d5973dda5f00cd61ef72ad75a1db73a386b62877d4875a8840959c", size = 3260222 }, + { url = "https://files.pythonhosted.org/packages/44/16/1857e35a47155b5ad927272fee81ae49d398959cb749edca6eaa399b582f/sqlalchemy-2.0.44-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:15f3326f7f0b2bfe406ee562e17f43f36e16167af99c4c0df61db668de20002d", size = 3189614 }, + { url = "https://files.pythonhosted.org/packages/88/ee/4afb39a8ee4fc786e2d716c20ab87b5b1fb33d4ac4129a1aaa574ae8a585/sqlalchemy-2.0.44-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:1e77faf6ff919aa8cd63f1c4e561cac1d9a454a191bb864d5dd5e545935e5a40", size = 3226248 }, + { url = "https://files.pythonhosted.org/packages/32/d5/0e66097fc64fa266f29a7963296b40a80d6a997b7ac13806183700676f86/sqlalchemy-2.0.44-cp313-cp313-win32.whl", hash = "sha256:ee51625c2d51f8baadf2829fae817ad0b66b140573939dd69284d2ba3553ae73", size = 2101275 }, + { url = "https://files.pythonhosted.org/packages/03/51/665617fe4f8c6450f42a6d8d69243f9420f5677395572c2fe9d21b493b7b/sqlalchemy-2.0.44-cp313-cp313-win_amd64.whl", hash = "sha256:c1c80faaee1a6c3428cecf40d16a2365bcf56c424c92c2b6f0f9ad204b899e9e", size = 2127901 }, + { url = "https://files.pythonhosted.org/packages/9c/5e/6a29fa884d9fb7ddadf6b69490a9d45fded3b38541713010dad16b77d015/sqlalchemy-2.0.44-py3-none-any.whl", hash = "sha256:19de7ca1246fbef9f9d1bff8f1ab25641569df226364a0e40457dc5457c54b05", size = 1928718 }, ] [[package]] @@ -3272,9 +3291,21 @@ dependencies = [ { name = "executing" }, { name = "pure-eval" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/28/e3/55dcc2cfbc3ca9c29519eb6884dd1415ecb53b0e934862d3559ddcb7e20b/stack_data-0.6.3.tar.gz", hash = "sha256:836a778de4fec4dcd1dcd89ed8abff8a221f58308462e1c4aa2a3cf30148f0b9", size = 44707, upload-time = "2023-09-30T13:58:05.479Z" } +sdist = { url = "https://files.pythonhosted.org/packages/28/e3/55dcc2cfbc3ca9c29519eb6884dd1415ecb53b0e934862d3559ddcb7e20b/stack_data-0.6.3.tar.gz", hash = "sha256:836a778de4fec4dcd1dcd89ed8abff8a221f58308462e1c4aa2a3cf30148f0b9", size = 44707 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/f1/7b/ce1eafaf1a76852e2ec9b22edecf1daa58175c090266e9f6c64afcd81d91/stack_data-0.6.3-py3-none-any.whl", hash = "sha256:d5558e0c25a4cb0853cddad3d77da9891a08cb85dd9f9f91b9f8cd66e511e695", size = 24521 }, +] + +[[package]] +name = "sympy" +version = "1.14.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "mpmath" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/83/d3/803453b36afefb7c2bb238361cd4ae6125a569b4db67cd9e79846ba2d68c/sympy-1.14.0.tar.gz", hash = "sha256:d3d3fe8df1e5a0b42f0e7bdf50541697dbe7d23746e894990c030e2b05e72517", size = 7793921 } wheels = [ - { url = "https://files.pythonhosted.org/packages/f1/7b/ce1eafaf1a76852e2ec9b22edecf1daa58175c090266e9f6c64afcd81d91/stack_data-0.6.3-py3-none-any.whl", hash = "sha256:d5558e0c25a4cb0853cddad3d77da9891a08cb85dd9f9f91b9f8cd66e511e695", size = 24521, upload-time = "2023-09-30T13:58:03.53Z" }, + { url = "https://files.pythonhosted.org/packages/a2/09/77d55d46fd61b4a135c444fc97158ef34a095e5681d0a6c10b75bf356191/sympy-1.14.0-py3-none-any.whl", hash = "sha256:e091cc3e99d2141a0ba2847328f5479b05d94a6635cb96148ccb3f34671bd8f5", size = 6299353 }, ] [[package]] @@ -3284,18 +3315,18 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pytest" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/c1/90/1a442d21527009d4b40f37fe50b606ebb68a6407142c2b5cc508c34b696b/syrupy-5.0.0.tar.gz", hash = "sha256:3282fe963fa5d4d3e47231b16d1d4d0f4523705e8199eeb99a22a1bc9f5942f2", size = 48881, upload-time = "2025-09-28T21:15:12.783Z" } +sdist = { url = "https://files.pythonhosted.org/packages/c1/90/1a442d21527009d4b40f37fe50b606ebb68a6407142c2b5cc508c34b696b/syrupy-5.0.0.tar.gz", hash = "sha256:3282fe963fa5d4d3e47231b16d1d4d0f4523705e8199eeb99a22a1bc9f5942f2", size = 48881 } wheels = [ - { url = "https://files.pythonhosted.org/packages/9d/9a/6c68aad2ccfce6e2eeebbf5bb709d0240592eb51ff142ec4c8fbf3c2460a/syrupy-5.0.0-py3-none-any.whl", hash = "sha256:c848e1a980ca52a28715cd2d2b4d434db424699c05653bd1158fb31cf56e9546", size = 49087, upload-time = "2025-09-28T21:15:11.639Z" }, + { url = "https://files.pythonhosted.org/packages/9d/9a/6c68aad2ccfce6e2eeebbf5bb709d0240592eb51ff142ec4c8fbf3c2460a/syrupy-5.0.0-py3-none-any.whl", hash = "sha256:c848e1a980ca52a28715cd2d2b4d434db424699c05653bd1158fb31cf56e9546", size = 49087 }, ] [[package]] name = "tabulate" version = "0.9.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ec/fe/802052aecb21e3797b8f7902564ab6ea0d60ff8ca23952079064155d1ae1/tabulate-0.9.0.tar.gz", hash = "sha256:0095b12bf5966de529c0feb1fa08671671b3368eec77d7ef7ab114be2c068b3c", size = 81090, upload-time = "2022-10-06T17:21:48.54Z" } +sdist = { url = "https://files.pythonhosted.org/packages/ec/fe/802052aecb21e3797b8f7902564ab6ea0d60ff8ca23952079064155d1ae1/tabulate-0.9.0.tar.gz", hash = "sha256:0095b12bf5966de529c0feb1fa08671671b3368eec77d7ef7ab114be2c068b3c", size = 81090 } wheels = [ - { url = "https://files.pythonhosted.org/packages/40/44/4a5f08c96eb108af5cb50b41f76142f0afa346dfa99d5296fe7202a11854/tabulate-0.9.0-py3-none-any.whl", hash = "sha256:024ca478df22e9340661486f85298cff5f6dcdba14f3813e8830015b9ed1948f", size = 35252, upload-time = "2022-10-06T17:21:44.262Z" }, + { url = "https://files.pythonhosted.org/packages/40/44/4a5f08c96eb108af5cb50b41f76142f0afa346dfa99d5296fe7202a11854/tabulate-0.9.0-py3-none-any.whl", hash = "sha256:024ca478df22e9340661486f85298cff5f6dcdba14f3813e8830015b9ed1948f", size = 35252 }, ] [[package]] @@ -3307,18 +3338,18 @@ dependencies = [ { name = "pywinpty", marker = "os_name == 'nt'" }, { name = "tornado" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/8a/11/965c6fd8e5cc254f1fe142d547387da17a8ebfd75a3455f637c663fb38a0/terminado-0.18.1.tar.gz", hash = "sha256:de09f2c4b85de4765f7714688fff57d3e75bad1f909b589fde880460c753fd2e", size = 32701, upload-time = "2024-03-12T14:34:39.026Z" } +sdist = { url = "https://files.pythonhosted.org/packages/8a/11/965c6fd8e5cc254f1fe142d547387da17a8ebfd75a3455f637c663fb38a0/terminado-0.18.1.tar.gz", hash = "sha256:de09f2c4b85de4765f7714688fff57d3e75bad1f909b589fde880460c753fd2e", size = 32701 } wheels = [ - { url = "https://files.pythonhosted.org/packages/6a/9e/2064975477fdc887e47ad42157e214526dcad8f317a948dee17e1659a62f/terminado-0.18.1-py3-none-any.whl", hash = "sha256:a4468e1b37bb318f8a86514f65814e1afc977cf29b3992a4500d9dd305dcceb0", size = 14154, upload-time = "2024-03-12T14:34:36.569Z" }, + { url = "https://files.pythonhosted.org/packages/6a/9e/2064975477fdc887e47ad42157e214526dcad8f317a948dee17e1659a62f/terminado-0.18.1-py3-none-any.whl", hash = "sha256:a4468e1b37bb318f8a86514f65814e1afc977cf29b3992a4500d9dd305dcceb0", size = 14154 }, ] [[package]] name = "threadpoolctl" version = "3.6.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/b7/4d/08c89e34946fce2aec4fbb45c9016efd5f4d7f24af8e5d93296e935631d8/threadpoolctl-3.6.0.tar.gz", hash = "sha256:8ab8b4aa3491d812b623328249fab5302a68d2d71745c8a4c719a2fcaba9f44e", size = 21274, upload-time = "2025-03-13T13:49:23.031Z" } +sdist = { url = "https://files.pythonhosted.org/packages/b7/4d/08c89e34946fce2aec4fbb45c9016efd5f4d7f24af8e5d93296e935631d8/threadpoolctl-3.6.0.tar.gz", hash = "sha256:8ab8b4aa3491d812b623328249fab5302a68d2d71745c8a4c719a2fcaba9f44e", size = 21274 } wheels = [ - { url = "https://files.pythonhosted.org/packages/32/d5/f9a850d79b0851d1d4ef6456097579a9005b31fea68726a4ae5f2d82ddd9/threadpoolctl-3.6.0-py3-none-any.whl", hash = "sha256:43a0b8fd5a2928500110039e43a5eed8480b918967083ea48dc3ab9f13c4a7fb", size = 18638, upload-time = "2025-03-13T13:49:21.846Z" }, + { url = "https://files.pythonhosted.org/packages/32/d5/f9a850d79b0851d1d4ef6456097579a9005b31fea68726a4ae5f2d82ddd9/threadpoolctl-3.6.0-py3-none-any.whl", hash = "sha256:43a0b8fd5a2928500110039e43a5eed8480b918967083ea48dc3ab9f13c4a7fb", size = 18638 }, ] [[package]] @@ -3328,73 +3359,73 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "webencodings" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/7a/fd/7a5ee21fd08ff70d3d33a5781c255cbe779659bd03278feb98b19ee550f4/tinycss2-1.4.0.tar.gz", hash = "sha256:10c0972f6fc0fbee87c3edb76549357415e94548c1ae10ebccdea16fb404a9b7", size = 87085, upload-time = "2024-10-24T14:58:29.895Z" } +sdist = { url = "https://files.pythonhosted.org/packages/7a/fd/7a5ee21fd08ff70d3d33a5781c255cbe779659bd03278feb98b19ee550f4/tinycss2-1.4.0.tar.gz", hash = "sha256:10c0972f6fc0fbee87c3edb76549357415e94548c1ae10ebccdea16fb404a9b7", size = 87085 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e6/34/ebdc18bae6aa14fbee1a08b63c015c72b64868ff7dae68808ab500c492e2/tinycss2-1.4.0-py3-none-any.whl", hash = "sha256:3a49cf47b7675da0b15d0c6e1df8df4ebd96e9394bb905a5775adb0d884c5289", size = 26610, upload-time = "2024-10-24T14:58:28.029Z" }, + { url = "https://files.pythonhosted.org/packages/e6/34/ebdc18bae6aa14fbee1a08b63c015c72b64868ff7dae68808ab500c492e2/tinycss2-1.4.0-py3-none-any.whl", hash = "sha256:3a49cf47b7675da0b15d0c6e1df8df4ebd96e9394bb905a5775adb0d884c5289", size = 26610 }, ] [[package]] name = "tornado" version = "6.5.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/09/ce/1eb500eae19f4648281bb2186927bb062d2438c2e5093d1360391afd2f90/tornado-6.5.2.tar.gz", hash = "sha256:ab53c8f9a0fa351e2c0741284e06c7a45da86afb544133201c5cc8578eb076a0", size = 510821, upload-time = "2025-08-08T18:27:00.78Z" } +sdist = { url = "https://files.pythonhosted.org/packages/09/ce/1eb500eae19f4648281bb2186927bb062d2438c2e5093d1360391afd2f90/tornado-6.5.2.tar.gz", hash = "sha256:ab53c8f9a0fa351e2c0741284e06c7a45da86afb544133201c5cc8578eb076a0", size = 510821 } wheels = [ - { url = "https://files.pythonhosted.org/packages/f6/48/6a7529df2c9cc12efd2e8f5dd219516184d703b34c06786809670df5b3bd/tornado-6.5.2-cp39-abi3-macosx_10_9_universal2.whl", hash = "sha256:2436822940d37cde62771cff8774f4f00b3c8024fe482e16ca8387b8a2724db6", size = 442563, upload-time = "2025-08-08T18:26:42.945Z" }, - { url = "https://files.pythonhosted.org/packages/f2/b5/9b575a0ed3e50b00c40b08cbce82eb618229091d09f6d14bce80fc01cb0b/tornado-6.5.2-cp39-abi3-macosx_10_9_x86_64.whl", hash = "sha256:583a52c7aa94ee046854ba81d9ebb6c81ec0fd30386d96f7640c96dad45a03ef", size = 440729, upload-time = "2025-08-08T18:26:44.473Z" }, - { url = "https://files.pythonhosted.org/packages/1b/4e/619174f52b120efcf23633c817fd3fed867c30bff785e2cd5a53a70e483c/tornado-6.5.2-cp39-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b0fe179f28d597deab2842b86ed4060deec7388f1fd9c1b4a41adf8af058907e", size = 444295, upload-time = "2025-08-08T18:26:46.021Z" }, - { url = "https://files.pythonhosted.org/packages/95/fa/87b41709552bbd393c85dd18e4e3499dcd8983f66e7972926db8d96aa065/tornado-6.5.2-cp39-abi3-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b186e85d1e3536d69583d2298423744740986018e393d0321df7340e71898882", size = 443644, upload-time = "2025-08-08T18:26:47.625Z" }, - { url = "https://files.pythonhosted.org/packages/f9/41/fb15f06e33d7430ca89420283a8762a4e6b8025b800ea51796ab5e6d9559/tornado-6.5.2-cp39-abi3-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e792706668c87709709c18b353da1f7662317b563ff69f00bab83595940c7108", size = 443878, upload-time = "2025-08-08T18:26:50.599Z" }, - { url = "https://files.pythonhosted.org/packages/11/92/fe6d57da897776ad2e01e279170ea8ae726755b045fe5ac73b75357a5a3f/tornado-6.5.2-cp39-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:06ceb1300fd70cb20e43b1ad8aaee0266e69e7ced38fa910ad2e03285009ce7c", size = 444549, upload-time = "2025-08-08T18:26:51.864Z" }, - { url = "https://files.pythonhosted.org/packages/9b/02/c8f4f6c9204526daf3d760f4aa555a7a33ad0e60843eac025ccfd6ff4a93/tornado-6.5.2-cp39-abi3-musllinux_1_2_i686.whl", hash = "sha256:74db443e0f5251be86cbf37929f84d8c20c27a355dd452a5cfa2aada0d001ec4", size = 443973, upload-time = "2025-08-08T18:26:53.625Z" }, - { url = "https://files.pythonhosted.org/packages/ae/2d/f5f5707b655ce2317190183868cd0f6822a1121b4baeae509ceb9590d0bd/tornado-6.5.2-cp39-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:b5e735ab2889d7ed33b32a459cac490eda71a1ba6857b0118de476ab6c366c04", size = 443954, upload-time = "2025-08-08T18:26:55.072Z" }, - { url = "https://files.pythonhosted.org/packages/e8/59/593bd0f40f7355806bf6573b47b8c22f8e1374c9b6fd03114bd6b7a3dcfd/tornado-6.5.2-cp39-abi3-win32.whl", hash = "sha256:c6f29e94d9b37a95013bb669616352ddb82e3bfe8326fccee50583caebc8a5f0", size = 445023, upload-time = "2025-08-08T18:26:56.677Z" }, - { url = "https://files.pythonhosted.org/packages/c7/2a/f609b420c2f564a748a2d80ebfb2ee02a73ca80223af712fca591386cafb/tornado-6.5.2-cp39-abi3-win_amd64.whl", hash = "sha256:e56a5af51cc30dd2cae649429af65ca2f6571da29504a07995175df14c18f35f", size = 445427, upload-time = "2025-08-08T18:26:57.91Z" }, - { url = "https://files.pythonhosted.org/packages/5e/4f/e1f65e8f8c76d73658b33d33b81eed4322fb5085350e4328d5c956f0c8f9/tornado-6.5.2-cp39-abi3-win_arm64.whl", hash = "sha256:d6c33dc3672e3a1f3618eb63b7ef4683a7688e7b9e6e8f0d9aa5726360a004af", size = 444456, upload-time = "2025-08-08T18:26:59.207Z" }, + { url = "https://files.pythonhosted.org/packages/f6/48/6a7529df2c9cc12efd2e8f5dd219516184d703b34c06786809670df5b3bd/tornado-6.5.2-cp39-abi3-macosx_10_9_universal2.whl", hash = "sha256:2436822940d37cde62771cff8774f4f00b3c8024fe482e16ca8387b8a2724db6", size = 442563 }, + { url = "https://files.pythonhosted.org/packages/f2/b5/9b575a0ed3e50b00c40b08cbce82eb618229091d09f6d14bce80fc01cb0b/tornado-6.5.2-cp39-abi3-macosx_10_9_x86_64.whl", hash = "sha256:583a52c7aa94ee046854ba81d9ebb6c81ec0fd30386d96f7640c96dad45a03ef", size = 440729 }, + { url = "https://files.pythonhosted.org/packages/1b/4e/619174f52b120efcf23633c817fd3fed867c30bff785e2cd5a53a70e483c/tornado-6.5.2-cp39-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b0fe179f28d597deab2842b86ed4060deec7388f1fd9c1b4a41adf8af058907e", size = 444295 }, + { url = "https://files.pythonhosted.org/packages/95/fa/87b41709552bbd393c85dd18e4e3499dcd8983f66e7972926db8d96aa065/tornado-6.5.2-cp39-abi3-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b186e85d1e3536d69583d2298423744740986018e393d0321df7340e71898882", size = 443644 }, + { url = "https://files.pythonhosted.org/packages/f9/41/fb15f06e33d7430ca89420283a8762a4e6b8025b800ea51796ab5e6d9559/tornado-6.5.2-cp39-abi3-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e792706668c87709709c18b353da1f7662317b563ff69f00bab83595940c7108", size = 443878 }, + { url = "https://files.pythonhosted.org/packages/11/92/fe6d57da897776ad2e01e279170ea8ae726755b045fe5ac73b75357a5a3f/tornado-6.5.2-cp39-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:06ceb1300fd70cb20e43b1ad8aaee0266e69e7ced38fa910ad2e03285009ce7c", size = 444549 }, + { url = "https://files.pythonhosted.org/packages/9b/02/c8f4f6c9204526daf3d760f4aa555a7a33ad0e60843eac025ccfd6ff4a93/tornado-6.5.2-cp39-abi3-musllinux_1_2_i686.whl", hash = "sha256:74db443e0f5251be86cbf37929f84d8c20c27a355dd452a5cfa2aada0d001ec4", size = 443973 }, + { url = "https://files.pythonhosted.org/packages/ae/2d/f5f5707b655ce2317190183868cd0f6822a1121b4baeae509ceb9590d0bd/tornado-6.5.2-cp39-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:b5e735ab2889d7ed33b32a459cac490eda71a1ba6857b0118de476ab6c366c04", size = 443954 }, + { url = "https://files.pythonhosted.org/packages/e8/59/593bd0f40f7355806bf6573b47b8c22f8e1374c9b6fd03114bd6b7a3dcfd/tornado-6.5.2-cp39-abi3-win32.whl", hash = "sha256:c6f29e94d9b37a95013bb669616352ddb82e3bfe8326fccee50583caebc8a5f0", size = 445023 }, + { url = "https://files.pythonhosted.org/packages/c7/2a/f609b420c2f564a748a2d80ebfb2ee02a73ca80223af712fca591386cafb/tornado-6.5.2-cp39-abi3-win_amd64.whl", hash = "sha256:e56a5af51cc30dd2cae649429af65ca2f6571da29504a07995175df14c18f35f", size = 445427 }, + { url = "https://files.pythonhosted.org/packages/5e/4f/e1f65e8f8c76d73658b33d33b81eed4322fb5085350e4328d5c956f0c8f9/tornado-6.5.2-cp39-abi3-win_arm64.whl", hash = "sha256:d6c33dc3672e3a1f3618eb63b7ef4683a7688e7b9e6e8f0d9aa5726360a004af", size = 444456 }, ] [[package]] name = "traitlets" version = "5.14.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/eb/79/72064e6a701c2183016abbbfedaba506d81e30e232a68c9f0d6f6fcd1574/traitlets-5.14.3.tar.gz", hash = "sha256:9ed0579d3502c94b4b3732ac120375cda96f923114522847de4b3bb98b96b6b7", size = 161621, upload-time = "2024-04-19T11:11:49.746Z" } +sdist = { url = "https://files.pythonhosted.org/packages/eb/79/72064e6a701c2183016abbbfedaba506d81e30e232a68c9f0d6f6fcd1574/traitlets-5.14.3.tar.gz", hash = "sha256:9ed0579d3502c94b4b3732ac120375cda96f923114522847de4b3bb98b96b6b7", size = 161621 } wheels = [ - { url = "https://files.pythonhosted.org/packages/00/c0/8f5d070730d7836adc9c9b6408dec68c6ced86b304a9b26a14df072a6e8c/traitlets-5.14.3-py3-none-any.whl", hash = "sha256:b74e89e397b1ed28cc831db7aea759ba6640cb3de13090ca145426688ff1ac4f", size = 85359, upload-time = "2024-04-19T11:11:46.763Z" }, + { url = "https://files.pythonhosted.org/packages/00/c0/8f5d070730d7836adc9c9b6408dec68c6ced86b304a9b26a14df072a6e8c/traitlets-5.14.3-py3-none-any.whl", hash = "sha256:b74e89e397b1ed28cc831db7aea759ba6640cb3de13090ca145426688ff1ac4f", size = 85359 }, ] [[package]] name = "typing-extensions" version = "4.15.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/72/94/1a15dd82efb362ac84269196e94cf00f187f7ed21c242792a923cdb1c61f/typing_extensions-4.15.0.tar.gz", hash = "sha256:0cea48d173cc12fa28ecabc3b837ea3cf6f38c6d1136f85cbaaf598984861466", size = 109391, upload-time = "2025-08-25T13:49:26.313Z" } +sdist = { url = "https://files.pythonhosted.org/packages/72/94/1a15dd82efb362ac84269196e94cf00f187f7ed21c242792a923cdb1c61f/typing_extensions-4.15.0.tar.gz", hash = "sha256:0cea48d173cc12fa28ecabc3b837ea3cf6f38c6d1136f85cbaaf598984861466", size = 109391 } wheels = [ - { url = "https://files.pythonhosted.org/packages/18/67/36e9267722cc04a6b9f15c7f3441c2363321a3ea07da7ae0c0707beb2a9c/typing_extensions-4.15.0-py3-none-any.whl", hash = "sha256:f0fa19c6845758ab08074a0cfa8b7aecb71c999ca73d62883bc25cc018c4e548", size = 44614, upload-time = "2025-08-25T13:49:24.86Z" }, + { url = "https://files.pythonhosted.org/packages/18/67/36e9267722cc04a6b9f15c7f3441c2363321a3ea07da7ae0c0707beb2a9c/typing_extensions-4.15.0-py3-none-any.whl", hash = "sha256:f0fa19c6845758ab08074a0cfa8b7aecb71c999ca73d62883bc25cc018c4e548", size = 44614 }, ] [[package]] name = "tzdata" version = "2025.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/95/32/1a225d6164441be760d75c2c42e2780dc0873fe382da3e98a2e1e48361e5/tzdata-2025.2.tar.gz", hash = "sha256:b60a638fcc0daffadf82fe0f57e53d06bdec2f36c4df66280ae79bce6bd6f2b9", size = 196380, upload-time = "2025-03-23T13:54:43.652Z" } +sdist = { url = "https://files.pythonhosted.org/packages/95/32/1a225d6164441be760d75c2c42e2780dc0873fe382da3e98a2e1e48361e5/tzdata-2025.2.tar.gz", hash = "sha256:b60a638fcc0daffadf82fe0f57e53d06bdec2f36c4df66280ae79bce6bd6f2b9", size = 196380 } wheels = [ - { url = "https://files.pythonhosted.org/packages/5c/23/c7abc0ca0a1526a0774eca151daeb8de62ec457e77262b66b359c3c7679e/tzdata-2025.2-py2.py3-none-any.whl", hash = "sha256:1a403fada01ff9221ca8044d701868fa132215d84beb92242d9acd2147f667a8", size = 347839, upload-time = "2025-03-23T13:54:41.845Z" }, + { url = "https://files.pythonhosted.org/packages/5c/23/c7abc0ca0a1526a0774eca151daeb8de62ec457e77262b66b359c3c7679e/tzdata-2025.2-py2.py3-none-any.whl", hash = "sha256:1a403fada01ff9221ca8044d701868fa132215d84beb92242d9acd2147f667a8", size = 347839 }, ] [[package]] name = "uri-template" version = "1.3.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/31/c7/0336f2bd0bcbada6ccef7aaa25e443c118a704f828a0620c6fa0207c1b64/uri-template-1.3.0.tar.gz", hash = "sha256:0e00f8eb65e18c7de20d595a14336e9f337ead580c70934141624b6d1ffdacc7", size = 21678, upload-time = "2023-06-21T01:49:05.374Z" } +sdist = { url = "https://files.pythonhosted.org/packages/31/c7/0336f2bd0bcbada6ccef7aaa25e443c118a704f828a0620c6fa0207c1b64/uri-template-1.3.0.tar.gz", hash = "sha256:0e00f8eb65e18c7de20d595a14336e9f337ead580c70934141624b6d1ffdacc7", size = 21678 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e7/00/3fca040d7cf8a32776d3d81a00c8ee7457e00f80c649f1e4a863c8321ae9/uri_template-1.3.0-py3-none-any.whl", hash = "sha256:a44a133ea12d44a0c0f06d7d42a52d71282e77e2f937d8abd5655b8d56fc1363", size = 11140, upload-time = "2023-06-21T01:49:03.467Z" }, + { url = "https://files.pythonhosted.org/packages/e7/00/3fca040d7cf8a32776d3d81a00c8ee7457e00f80c649f1e4a863c8321ae9/uri_template-1.3.0-py3-none-any.whl", hash = "sha256:a44a133ea12d44a0c0f06d7d42a52d71282e77e2f937d8abd5655b8d56fc1363", size = 11140 }, ] [[package]] name = "urllib3" version = "2.5.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/15/22/9ee70a2574a4f4599c47dd506532914ce044817c7752a79b6a51286319bc/urllib3-2.5.0.tar.gz", hash = "sha256:3fc47733c7e419d4bc3f6b3dc2b4f890bb743906a30d56ba4a5bfa4bbff92760", size = 393185, upload-time = "2025-06-18T14:07:41.644Z" } +sdist = { url = "https://files.pythonhosted.org/packages/15/22/9ee70a2574a4f4599c47dd506532914ce044817c7752a79b6a51286319bc/urllib3-2.5.0.tar.gz", hash = "sha256:3fc47733c7e419d4bc3f6b3dc2b4f890bb743906a30d56ba4a5bfa4bbff92760", size = 393185 } wheels = [ - { url = "https://files.pythonhosted.org/packages/a7/c2/fe1e52489ae3122415c51f387e221dd0773709bad6c6cdaa599e8a2c5185/urllib3-2.5.0-py3-none-any.whl", hash = "sha256:e6b01673c0fa6a13e374b50871808eb3bf7046c4b125b216f6bf1cc604cff0dc", size = 129795, upload-time = "2025-06-18T14:07:40.39Z" }, + { url = "https://files.pythonhosted.org/packages/a7/c2/fe1e52489ae3122415c51f387e221dd0773709bad6c6cdaa599e8a2c5185/urllib3-2.5.0-py3-none-any.whl", hash = "sha256:e6b01673c0fa6a13e374b50871808eb3bf7046c4b125b216f6bf1cc604cff0dc", size = 129795 }, ] [[package]] @@ -3406,36 +3437,36 @@ dependencies = [ { name = "filelock" }, { name = "platformdirs" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/20/28/e6f1a6f655d620846bd9df527390ecc26b3805a0c5989048c210e22c5ca9/virtualenv-20.35.4.tar.gz", hash = "sha256:643d3914d73d3eeb0c552cbb12d7e82adf0e504dbf86a3182f8771a153a1971c", size = 6028799, upload-time = "2025-10-29T06:57:40.511Z" } +sdist = { url = "https://files.pythonhosted.org/packages/20/28/e6f1a6f655d620846bd9df527390ecc26b3805a0c5989048c210e22c5ca9/virtualenv-20.35.4.tar.gz", hash = "sha256:643d3914d73d3eeb0c552cbb12d7e82adf0e504dbf86a3182f8771a153a1971c", size = 6028799 } wheels = [ - { url = "https://files.pythonhosted.org/packages/79/0c/c05523fa3181fdf0c9c52a6ba91a23fbf3246cc095f26f6516f9c60e6771/virtualenv-20.35.4-py3-none-any.whl", hash = "sha256:c21c9cede36c9753eeade68ba7d523529f228a403463376cf821eaae2b650f1b", size = 6005095, upload-time = "2025-10-29T06:57:37.598Z" }, + { url = "https://files.pythonhosted.org/packages/79/0c/c05523fa3181fdf0c9c52a6ba91a23fbf3246cc095f26f6516f9c60e6771/virtualenv-20.35.4-py3-none-any.whl", hash = "sha256:c21c9cede36c9753eeade68ba7d523529f228a403463376cf821eaae2b650f1b", size = 6005095 }, ] [[package]] name = "watchdog" version = "6.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/db/7d/7f3d619e951c88ed75c6037b246ddcf2d322812ee8ea189be89511721d54/watchdog-6.0.0.tar.gz", hash = "sha256:9ddf7c82fda3ae8e24decda1338ede66e1c99883db93711d8fb941eaa2d8c282", size = 131220, upload-time = "2024-11-01T14:07:13.037Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/e0/24/d9be5cd6642a6aa68352ded4b4b10fb0d7889cb7f45814fb92cecd35f101/watchdog-6.0.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:6eb11feb5a0d452ee41f824e271ca311a09e250441c262ca2fd7ebcf2461a06c", size = 96393, upload-time = "2024-11-01T14:06:31.756Z" }, - { url = "https://files.pythonhosted.org/packages/63/7a/6013b0d8dbc56adca7fdd4f0beed381c59f6752341b12fa0886fa7afc78b/watchdog-6.0.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:ef810fbf7b781a5a593894e4f439773830bdecb885e6880d957d5b9382a960d2", size = 88392, upload-time = "2024-11-01T14:06:32.99Z" }, - { url = "https://files.pythonhosted.org/packages/d1/40/b75381494851556de56281e053700e46bff5b37bf4c7267e858640af5a7f/watchdog-6.0.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:afd0fe1b2270917c5e23c2a65ce50c2a4abb63daafb0d419fde368e272a76b7c", size = 89019, upload-time = "2024-11-01T14:06:34.963Z" }, - { url = "https://files.pythonhosted.org/packages/39/ea/3930d07dafc9e286ed356a679aa02d777c06e9bfd1164fa7c19c288a5483/watchdog-6.0.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:bdd4e6f14b8b18c334febb9c4425a878a2ac20efd1e0b231978e7b150f92a948", size = 96471, upload-time = "2024-11-01T14:06:37.745Z" }, - { url = "https://files.pythonhosted.org/packages/12/87/48361531f70b1f87928b045df868a9fd4e253d9ae087fa4cf3f7113be363/watchdog-6.0.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:c7c15dda13c4eb00d6fb6fc508b3c0ed88b9d5d374056b239c4ad1611125c860", size = 88449, upload-time = "2024-11-01T14:06:39.748Z" }, - { url = "https://files.pythonhosted.org/packages/5b/7e/8f322f5e600812e6f9a31b75d242631068ca8f4ef0582dd3ae6e72daecc8/watchdog-6.0.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:6f10cb2d5902447c7d0da897e2c6768bca89174d0c6e1e30abec5421af97a5b0", size = 89054, upload-time = "2024-11-01T14:06:41.009Z" }, - { url = "https://files.pythonhosted.org/packages/68/98/b0345cabdce2041a01293ba483333582891a3bd5769b08eceb0d406056ef/watchdog-6.0.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:490ab2ef84f11129844c23fb14ecf30ef3d8a6abafd3754a6f75ca1e6654136c", size = 96480, upload-time = "2024-11-01T14:06:42.952Z" }, - { url = "https://files.pythonhosted.org/packages/85/83/cdf13902c626b28eedef7ec4f10745c52aad8a8fe7eb04ed7b1f111ca20e/watchdog-6.0.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:76aae96b00ae814b181bb25b1b98076d5fc84e8a53cd8885a318b42b6d3a5134", size = 88451, upload-time = "2024-11-01T14:06:45.084Z" }, - { url = "https://files.pythonhosted.org/packages/fe/c4/225c87bae08c8b9ec99030cd48ae9c4eca050a59bf5c2255853e18c87b50/watchdog-6.0.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:a175f755fc2279e0b7312c0035d52e27211a5bc39719dd529625b1930917345b", size = 89057, upload-time = "2024-11-01T14:06:47.324Z" }, - { url = "https://files.pythonhosted.org/packages/a9/c7/ca4bf3e518cb57a686b2feb4f55a1892fd9a3dd13f470fca14e00f80ea36/watchdog-6.0.0-py3-none-manylinux2014_aarch64.whl", hash = "sha256:7607498efa04a3542ae3e05e64da8202e58159aa1fa4acddf7678d34a35d4f13", size = 79079, upload-time = "2024-11-01T14:06:59.472Z" }, - { url = "https://files.pythonhosted.org/packages/5c/51/d46dc9332f9a647593c947b4b88e2381c8dfc0942d15b8edc0310fa4abb1/watchdog-6.0.0-py3-none-manylinux2014_armv7l.whl", hash = "sha256:9041567ee8953024c83343288ccc458fd0a2d811d6a0fd68c4c22609e3490379", size = 79078, upload-time = "2024-11-01T14:07:01.431Z" }, - { url = "https://files.pythonhosted.org/packages/d4/57/04edbf5e169cd318d5f07b4766fee38e825d64b6913ca157ca32d1a42267/watchdog-6.0.0-py3-none-manylinux2014_i686.whl", hash = "sha256:82dc3e3143c7e38ec49d61af98d6558288c415eac98486a5c581726e0737c00e", size = 79076, upload-time = "2024-11-01T14:07:02.568Z" }, - { url = "https://files.pythonhosted.org/packages/ab/cc/da8422b300e13cb187d2203f20b9253e91058aaf7db65b74142013478e66/watchdog-6.0.0-py3-none-manylinux2014_ppc64.whl", hash = "sha256:212ac9b8bf1161dc91bd09c048048a95ca3a4c4f5e5d4a7d1b1a7d5752a7f96f", size = 79077, upload-time = "2024-11-01T14:07:03.893Z" }, - { url = "https://files.pythonhosted.org/packages/2c/3b/b8964e04ae1a025c44ba8e4291f86e97fac443bca31de8bd98d3263d2fcf/watchdog-6.0.0-py3-none-manylinux2014_ppc64le.whl", hash = "sha256:e3df4cbb9a450c6d49318f6d14f4bbc80d763fa587ba46ec86f99f9e6876bb26", size = 79078, upload-time = "2024-11-01T14:07:05.189Z" }, - { url = "https://files.pythonhosted.org/packages/62/ae/a696eb424bedff7407801c257d4b1afda455fe40821a2be430e173660e81/watchdog-6.0.0-py3-none-manylinux2014_s390x.whl", hash = "sha256:2cce7cfc2008eb51feb6aab51251fd79b85d9894e98ba847408f662b3395ca3c", size = 79077, upload-time = "2024-11-01T14:07:06.376Z" }, - { url = "https://files.pythonhosted.org/packages/b5/e8/dbf020b4d98251a9860752a094d09a65e1b436ad181faf929983f697048f/watchdog-6.0.0-py3-none-manylinux2014_x86_64.whl", hash = "sha256:20ffe5b202af80ab4266dcd3e91aae72bf2da48c0d33bdb15c66658e685e94e2", size = 79078, upload-time = "2024-11-01T14:07:07.547Z" }, - { url = "https://files.pythonhosted.org/packages/07/f6/d0e5b343768e8bcb4cda79f0f2f55051bf26177ecd5651f84c07567461cf/watchdog-6.0.0-py3-none-win32.whl", hash = "sha256:07df1fdd701c5d4c8e55ef6cf55b8f0120fe1aef7ef39a1c6fc6bc2e606d517a", size = 79065, upload-time = "2024-11-01T14:07:09.525Z" }, - { url = "https://files.pythonhosted.org/packages/db/d9/c495884c6e548fce18a8f40568ff120bc3a4b7b99813081c8ac0c936fa64/watchdog-6.0.0-py3-none-win_amd64.whl", hash = "sha256:cbafb470cf848d93b5d013e2ecb245d4aa1c8fd0504e863ccefa32445359d680", size = 79070, upload-time = "2024-11-01T14:07:10.686Z" }, - { url = "https://files.pythonhosted.org/packages/33/e8/e40370e6d74ddba47f002a32919d91310d6074130fe4e17dabcafc15cbf1/watchdog-6.0.0-py3-none-win_ia64.whl", hash = "sha256:a1914259fa9e1454315171103c6a30961236f508b9b623eae470268bbcc6a22f", size = 79067, upload-time = "2024-11-01T14:07:11.845Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/db/7d/7f3d619e951c88ed75c6037b246ddcf2d322812ee8ea189be89511721d54/watchdog-6.0.0.tar.gz", hash = "sha256:9ddf7c82fda3ae8e24decda1338ede66e1c99883db93711d8fb941eaa2d8c282", size = 131220 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/e0/24/d9be5cd6642a6aa68352ded4b4b10fb0d7889cb7f45814fb92cecd35f101/watchdog-6.0.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:6eb11feb5a0d452ee41f824e271ca311a09e250441c262ca2fd7ebcf2461a06c", size = 96393 }, + { url = "https://files.pythonhosted.org/packages/63/7a/6013b0d8dbc56adca7fdd4f0beed381c59f6752341b12fa0886fa7afc78b/watchdog-6.0.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:ef810fbf7b781a5a593894e4f439773830bdecb885e6880d957d5b9382a960d2", size = 88392 }, + { url = "https://files.pythonhosted.org/packages/d1/40/b75381494851556de56281e053700e46bff5b37bf4c7267e858640af5a7f/watchdog-6.0.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:afd0fe1b2270917c5e23c2a65ce50c2a4abb63daafb0d419fde368e272a76b7c", size = 89019 }, + { url = "https://files.pythonhosted.org/packages/39/ea/3930d07dafc9e286ed356a679aa02d777c06e9bfd1164fa7c19c288a5483/watchdog-6.0.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:bdd4e6f14b8b18c334febb9c4425a878a2ac20efd1e0b231978e7b150f92a948", size = 96471 }, + { url = "https://files.pythonhosted.org/packages/12/87/48361531f70b1f87928b045df868a9fd4e253d9ae087fa4cf3f7113be363/watchdog-6.0.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:c7c15dda13c4eb00d6fb6fc508b3c0ed88b9d5d374056b239c4ad1611125c860", size = 88449 }, + { url = "https://files.pythonhosted.org/packages/5b/7e/8f322f5e600812e6f9a31b75d242631068ca8f4ef0582dd3ae6e72daecc8/watchdog-6.0.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:6f10cb2d5902447c7d0da897e2c6768bca89174d0c6e1e30abec5421af97a5b0", size = 89054 }, + { url = "https://files.pythonhosted.org/packages/68/98/b0345cabdce2041a01293ba483333582891a3bd5769b08eceb0d406056ef/watchdog-6.0.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:490ab2ef84f11129844c23fb14ecf30ef3d8a6abafd3754a6f75ca1e6654136c", size = 96480 }, + { url = "https://files.pythonhosted.org/packages/85/83/cdf13902c626b28eedef7ec4f10745c52aad8a8fe7eb04ed7b1f111ca20e/watchdog-6.0.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:76aae96b00ae814b181bb25b1b98076d5fc84e8a53cd8885a318b42b6d3a5134", size = 88451 }, + { url = "https://files.pythonhosted.org/packages/fe/c4/225c87bae08c8b9ec99030cd48ae9c4eca050a59bf5c2255853e18c87b50/watchdog-6.0.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:a175f755fc2279e0b7312c0035d52e27211a5bc39719dd529625b1930917345b", size = 89057 }, + { url = "https://files.pythonhosted.org/packages/a9/c7/ca4bf3e518cb57a686b2feb4f55a1892fd9a3dd13f470fca14e00f80ea36/watchdog-6.0.0-py3-none-manylinux2014_aarch64.whl", hash = "sha256:7607498efa04a3542ae3e05e64da8202e58159aa1fa4acddf7678d34a35d4f13", size = 79079 }, + { url = "https://files.pythonhosted.org/packages/5c/51/d46dc9332f9a647593c947b4b88e2381c8dfc0942d15b8edc0310fa4abb1/watchdog-6.0.0-py3-none-manylinux2014_armv7l.whl", hash = "sha256:9041567ee8953024c83343288ccc458fd0a2d811d6a0fd68c4c22609e3490379", size = 79078 }, + { url = "https://files.pythonhosted.org/packages/d4/57/04edbf5e169cd318d5f07b4766fee38e825d64b6913ca157ca32d1a42267/watchdog-6.0.0-py3-none-manylinux2014_i686.whl", hash = "sha256:82dc3e3143c7e38ec49d61af98d6558288c415eac98486a5c581726e0737c00e", size = 79076 }, + { url = "https://files.pythonhosted.org/packages/ab/cc/da8422b300e13cb187d2203f20b9253e91058aaf7db65b74142013478e66/watchdog-6.0.0-py3-none-manylinux2014_ppc64.whl", hash = "sha256:212ac9b8bf1161dc91bd09c048048a95ca3a4c4f5e5d4a7d1b1a7d5752a7f96f", size = 79077 }, + { url = "https://files.pythonhosted.org/packages/2c/3b/b8964e04ae1a025c44ba8e4291f86e97fac443bca31de8bd98d3263d2fcf/watchdog-6.0.0-py3-none-manylinux2014_ppc64le.whl", hash = "sha256:e3df4cbb9a450c6d49318f6d14f4bbc80d763fa587ba46ec86f99f9e6876bb26", size = 79078 }, + { url = "https://files.pythonhosted.org/packages/62/ae/a696eb424bedff7407801c257d4b1afda455fe40821a2be430e173660e81/watchdog-6.0.0-py3-none-manylinux2014_s390x.whl", hash = "sha256:2cce7cfc2008eb51feb6aab51251fd79b85d9894e98ba847408f662b3395ca3c", size = 79077 }, + { url = "https://files.pythonhosted.org/packages/b5/e8/dbf020b4d98251a9860752a094d09a65e1b436ad181faf929983f697048f/watchdog-6.0.0-py3-none-manylinux2014_x86_64.whl", hash = "sha256:20ffe5b202af80ab4266dcd3e91aae72bf2da48c0d33bdb15c66658e685e94e2", size = 79078 }, + { url = "https://files.pythonhosted.org/packages/07/f6/d0e5b343768e8bcb4cda79f0f2f55051bf26177ecd5651f84c07567461cf/watchdog-6.0.0-py3-none-win32.whl", hash = "sha256:07df1fdd701c5d4c8e55ef6cf55b8f0120fe1aef7ef39a1c6fc6bc2e606d517a", size = 79065 }, + { url = "https://files.pythonhosted.org/packages/db/d9/c495884c6e548fce18a8f40568ff120bc3a4b7b99813081c8ac0c936fa64/watchdog-6.0.0-py3-none-win_amd64.whl", hash = "sha256:cbafb470cf848d93b5d013e2ecb245d4aa1c8fd0504e863ccefa32445359d680", size = 79070 }, + { url = "https://files.pythonhosted.org/packages/33/e8/e40370e6d74ddba47f002a32919d91310d6074130fe4e17dabcafc15cbf1/watchdog-6.0.0-py3-none-win_ia64.whl", hash = "sha256:a1914259fa9e1454315171103c6a30961236f508b9b623eae470268bbcc6a22f", size = 79067 }, ] [[package]] @@ -3445,136 +3476,136 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "anyio" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/c2/c9/8869df9b2a2d6c59d79220a4db37679e74f807c559ffe5265e08b227a210/watchfiles-1.1.1.tar.gz", hash = "sha256:a173cb5c16c4f40ab19cecf48a534c409f7ea983ab8fed0741304a1c0a31b3f2", size = 94440, upload-time = "2025-10-14T15:06:21.08Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/1f/f8/2c5f479fb531ce2f0564eda479faecf253d886b1ab3630a39b7bf7362d46/watchfiles-1.1.1-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:f57b396167a2565a4e8b5e56a5a1c537571733992b226f4f1197d79e94cf0ae5", size = 406529, upload-time = "2025-10-14T15:04:32.899Z" }, - { url = "https://files.pythonhosted.org/packages/fe/cd/f515660b1f32f65df671ddf6f85bfaca621aee177712874dc30a97397977/watchfiles-1.1.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:421e29339983e1bebc281fab40d812742268ad057db4aee8c4d2bce0af43b741", size = 394384, upload-time = "2025-10-14T15:04:33.761Z" }, - { url = "https://files.pythonhosted.org/packages/7b/c3/28b7dc99733eab43fca2d10f55c86e03bd6ab11ca31b802abac26b23d161/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:6e43d39a741e972bab5d8100b5cdacf69db64e34eb19b6e9af162bccf63c5cc6", size = 448789, upload-time = "2025-10-14T15:04:34.679Z" }, - { url = "https://files.pythonhosted.org/packages/4a/24/33e71113b320030011c8e4316ccca04194bf0cbbaeee207f00cbc7d6b9f5/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:f537afb3276d12814082a2e9b242bdcf416c2e8fd9f799a737990a1dbe906e5b", size = 460521, upload-time = "2025-10-14T15:04:35.963Z" }, - { url = "https://files.pythonhosted.org/packages/f4/c3/3c9a55f255aa57b91579ae9e98c88704955fa9dac3e5614fb378291155df/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b2cd9e04277e756a2e2d2543d65d1e2166d6fd4c9b183f8808634fda23f17b14", size = 488722, upload-time = "2025-10-14T15:04:37.091Z" }, - { url = "https://files.pythonhosted.org/packages/49/36/506447b73eb46c120169dc1717fe2eff07c234bb3232a7200b5f5bd816e9/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:5f3f58818dc0b07f7d9aa7fe9eb1037aecb9700e63e1f6acfed13e9fef648f5d", size = 596088, upload-time = "2025-10-14T15:04:38.39Z" }, - { url = "https://files.pythonhosted.org/packages/82/ab/5f39e752a9838ec4d52e9b87c1e80f1ee3ccdbe92e183c15b6577ab9de16/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:9bb9f66367023ae783551042d31b1d7fd422e8289eedd91f26754a66f44d5cff", size = 472923, upload-time = "2025-10-14T15:04:39.666Z" }, - { url = "https://files.pythonhosted.org/packages/af/b9/a419292f05e302dea372fa7e6fda5178a92998411f8581b9830d28fb9edb/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:aebfd0861a83e6c3d1110b78ad54704486555246e542be3e2bb94195eabb2606", size = 456080, upload-time = "2025-10-14T15:04:40.643Z" }, - { url = "https://files.pythonhosted.org/packages/b0/c3/d5932fd62bde1a30c36e10c409dc5d54506726f08cb3e1d8d0ba5e2bc8db/watchfiles-1.1.1-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:5fac835b4ab3c6487b5dbad78c4b3724e26bcc468e886f8ba8cc4306f68f6701", size = 629432, upload-time = "2025-10-14T15:04:41.789Z" }, - { url = "https://files.pythonhosted.org/packages/f7/77/16bddd9779fafb795f1a94319dc965209c5641db5bf1edbbccace6d1b3c0/watchfiles-1.1.1-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:399600947b170270e80134ac854e21b3ccdefa11a9529a3decc1327088180f10", size = 623046, upload-time = "2025-10-14T15:04:42.718Z" }, - { url = "https://files.pythonhosted.org/packages/46/ef/f2ecb9a0f342b4bfad13a2787155c6ee7ce792140eac63a34676a2feeef2/watchfiles-1.1.1-cp311-cp311-win32.whl", hash = "sha256:de6da501c883f58ad50db3a32ad397b09ad29865b5f26f64c24d3e3281685849", size = 271473, upload-time = "2025-10-14T15:04:43.624Z" }, - { url = "https://files.pythonhosted.org/packages/94/bc/f42d71125f19731ea435c3948cad148d31a64fccde3867e5ba4edee901f9/watchfiles-1.1.1-cp311-cp311-win_amd64.whl", hash = "sha256:35c53bd62a0b885bf653ebf6b700d1bf05debb78ad9292cf2a942b23513dc4c4", size = 287598, upload-time = "2025-10-14T15:04:44.516Z" }, - { url = "https://files.pythonhosted.org/packages/57/c9/a30f897351f95bbbfb6abcadafbaca711ce1162f4db95fc908c98a9165f3/watchfiles-1.1.1-cp311-cp311-win_arm64.whl", hash = "sha256:57ca5281a8b5e27593cb7d82c2ac927ad88a96ed406aa446f6344e4328208e9e", size = 277210, upload-time = "2025-10-14T15:04:45.883Z" }, - { url = "https://files.pythonhosted.org/packages/74/d5/f039e7e3c639d9b1d09b07ea412a6806d38123f0508e5f9b48a87b0a76cc/watchfiles-1.1.1-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:8c89f9f2f740a6b7dcc753140dd5e1ab9215966f7a3530d0c0705c83b401bd7d", size = 404745, upload-time = "2025-10-14T15:04:46.731Z" }, - { url = "https://files.pythonhosted.org/packages/a5/96/a881a13aa1349827490dab2d363c8039527060cfcc2c92cc6d13d1b1049e/watchfiles-1.1.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:bd404be08018c37350f0d6e34676bd1e2889990117a2b90070b3007f172d0610", size = 391769, upload-time = "2025-10-14T15:04:48.003Z" }, - { url = "https://files.pythonhosted.org/packages/4b/5b/d3b460364aeb8da471c1989238ea0e56bec24b6042a68046adf3d9ddb01c/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:8526e8f916bb5b9a0a777c8317c23ce65de259422bba5b31325a6fa6029d33af", size = 449374, upload-time = "2025-10-14T15:04:49.179Z" }, - { url = "https://files.pythonhosted.org/packages/b9/44/5769cb62d4ed055cb17417c0a109a92f007114a4e07f30812a73a4efdb11/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:2edc3553362b1c38d9f06242416a5d8e9fe235c204a4072e988ce2e5bb1f69f6", size = 459485, upload-time = "2025-10-14T15:04:50.155Z" }, - { url = "https://files.pythonhosted.org/packages/19/0c/286b6301ded2eccd4ffd0041a1b726afda999926cf720aab63adb68a1e36/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:30f7da3fb3f2844259cba4720c3fc7138eb0f7b659c38f3bfa65084c7fc7abce", size = 488813, upload-time = "2025-10-14T15:04:51.059Z" }, - { url = "https://files.pythonhosted.org/packages/c7/2b/8530ed41112dd4a22f4dcfdb5ccf6a1baad1ff6eed8dc5a5f09e7e8c41c7/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:f8979280bdafff686ba5e4d8f97840f929a87ed9cdf133cbbd42f7766774d2aa", size = 594816, upload-time = "2025-10-14T15:04:52.031Z" }, - { url = "https://files.pythonhosted.org/packages/ce/d2/f5f9fb49489f184f18470d4f99f4e862a4b3e9ac2865688eb2099e3d837a/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:dcc5c24523771db3a294c77d94771abcfcb82a0e0ee8efd910c37c59ec1b31bb", size = 475186, upload-time = "2025-10-14T15:04:53.064Z" }, - { url = "https://files.pythonhosted.org/packages/cf/68/5707da262a119fb06fbe214d82dd1fe4a6f4af32d2d14de368d0349eb52a/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:1db5d7ae38ff20153d542460752ff397fcf5c96090c1230803713cf3147a6803", size = 456812, upload-time = "2025-10-14T15:04:55.174Z" }, - { url = "https://files.pythonhosted.org/packages/66/ab/3cbb8756323e8f9b6f9acb9ef4ec26d42b2109bce830cc1f3468df20511d/watchfiles-1.1.1-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:28475ddbde92df1874b6c5c8aaeb24ad5be47a11f87cde5a28ef3835932e3e94", size = 630196, upload-time = "2025-10-14T15:04:56.22Z" }, - { url = "https://files.pythonhosted.org/packages/78/46/7152ec29b8335f80167928944a94955015a345440f524d2dfe63fc2f437b/watchfiles-1.1.1-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:36193ed342f5b9842edd3532729a2ad55c4160ffcfa3700e0d54be496b70dd43", size = 622657, upload-time = "2025-10-14T15:04:57.521Z" }, - { url = "https://files.pythonhosted.org/packages/0a/bf/95895e78dd75efe9a7f31733607f384b42eb5feb54bd2eb6ed57cc2e94f4/watchfiles-1.1.1-cp312-cp312-win32.whl", hash = "sha256:859e43a1951717cc8de7f4c77674a6d389b106361585951d9e69572823f311d9", size = 272042, upload-time = "2025-10-14T15:04:59.046Z" }, - { url = "https://files.pythonhosted.org/packages/87/0a/90eb755f568de2688cb220171c4191df932232c20946966c27a59c400850/watchfiles-1.1.1-cp312-cp312-win_amd64.whl", hash = "sha256:91d4c9a823a8c987cce8fa2690923b069966dabb196dd8d137ea2cede885fde9", size = 288410, upload-time = "2025-10-14T15:05:00.081Z" }, - { url = "https://files.pythonhosted.org/packages/36/76/f322701530586922fbd6723c4f91ace21364924822a8772c549483abed13/watchfiles-1.1.1-cp312-cp312-win_arm64.whl", hash = "sha256:a625815d4a2bdca61953dbba5a39d60164451ef34c88d751f6c368c3ea73d404", size = 278209, upload-time = "2025-10-14T15:05:01.168Z" }, - { url = "https://files.pythonhosted.org/packages/bb/f4/f750b29225fe77139f7ae5de89d4949f5a99f934c65a1f1c0b248f26f747/watchfiles-1.1.1-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:130e4876309e8686a5e37dba7d5e9bc77e6ed908266996ca26572437a5271e18", size = 404321, upload-time = "2025-10-14T15:05:02.063Z" }, - { url = "https://files.pythonhosted.org/packages/2b/f9/f07a295cde762644aa4c4bb0f88921d2d141af45e735b965fb2e87858328/watchfiles-1.1.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:5f3bde70f157f84ece3765b42b4a52c6ac1a50334903c6eaf765362f6ccca88a", size = 391783, upload-time = "2025-10-14T15:05:03.052Z" }, - { url = "https://files.pythonhosted.org/packages/bc/11/fc2502457e0bea39a5c958d86d2cb69e407a4d00b85735ca724bfa6e0d1a/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:14e0b1fe858430fc0251737ef3824c54027bedb8c37c38114488b8e131cf8219", size = 449279, upload-time = "2025-10-14T15:05:04.004Z" }, - { url = "https://files.pythonhosted.org/packages/e3/1f/d66bc15ea0b728df3ed96a539c777acfcad0eb78555ad9efcaa1274688f0/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:f27db948078f3823a6bb3b465180db8ebecf26dd5dae6f6180bd87383b6b4428", size = 459405, upload-time = "2025-10-14T15:05:04.942Z" }, - { url = "https://files.pythonhosted.org/packages/be/90/9f4a65c0aec3ccf032703e6db02d89a157462fbb2cf20dd415128251cac0/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:059098c3a429f62fc98e8ec62b982230ef2c8df68c79e826e37b895bc359a9c0", size = 488976, upload-time = "2025-10-14T15:05:05.905Z" }, - { url = "https://files.pythonhosted.org/packages/37/57/ee347af605d867f712be7029bb94c8c071732a4b44792e3176fa3c612d39/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:bfb5862016acc9b869bb57284e6cb35fdf8e22fe59f7548858e2f971d045f150", size = 595506, upload-time = "2025-10-14T15:05:06.906Z" }, - { url = "https://files.pythonhosted.org/packages/a8/78/cc5ab0b86c122047f75e8fc471c67a04dee395daf847d3e59381996c8707/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:319b27255aacd9923b8a276bb14d21a5f7ff82564c744235fc5eae58d95422ae", size = 474936, upload-time = "2025-10-14T15:05:07.906Z" }, - { url = "https://files.pythonhosted.org/packages/62/da/def65b170a3815af7bd40a3e7010bf6ab53089ef1b75d05dd5385b87cf08/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c755367e51db90e75b19454b680903631d41f9e3607fbd941d296a020c2d752d", size = 456147, upload-time = "2025-10-14T15:05:09.138Z" }, - { url = "https://files.pythonhosted.org/packages/57/99/da6573ba71166e82d288d4df0839128004c67d2778d3b566c138695f5c0b/watchfiles-1.1.1-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:c22c776292a23bfc7237a98f791b9ad3144b02116ff10d820829ce62dff46d0b", size = 630007, upload-time = "2025-10-14T15:05:10.117Z" }, - { url = "https://files.pythonhosted.org/packages/a8/51/7439c4dd39511368849eb1e53279cd3454b4a4dbace80bab88feeb83c6b5/watchfiles-1.1.1-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:3a476189be23c3686bc2f4321dd501cb329c0a0469e77b7b534ee10129ae6374", size = 622280, upload-time = "2025-10-14T15:05:11.146Z" }, - { url = "https://files.pythonhosted.org/packages/95/9c/8ed97d4bba5db6fdcdb2b298d3898f2dd5c20f6b73aee04eabe56c59677e/watchfiles-1.1.1-cp313-cp313-win32.whl", hash = "sha256:bf0a91bfb5574a2f7fc223cf95eeea79abfefa404bf1ea5e339c0c1560ae99a0", size = 272056, upload-time = "2025-10-14T15:05:12.156Z" }, - { url = "https://files.pythonhosted.org/packages/1f/f3/c14e28429f744a260d8ceae18bf58c1d5fa56b50d006a7a9f80e1882cb0d/watchfiles-1.1.1-cp313-cp313-win_amd64.whl", hash = "sha256:52e06553899e11e8074503c8e716d574adeeb7e68913115c4b3653c53f9bae42", size = 288162, upload-time = "2025-10-14T15:05:13.208Z" }, - { url = "https://files.pythonhosted.org/packages/dc/61/fe0e56c40d5cd29523e398d31153218718c5786b5e636d9ae8ae79453d27/watchfiles-1.1.1-cp313-cp313-win_arm64.whl", hash = "sha256:ac3cc5759570cd02662b15fbcd9d917f7ecd47efe0d6b40474eafd246f91ea18", size = 277909, upload-time = "2025-10-14T15:05:14.49Z" }, - { url = "https://files.pythonhosted.org/packages/79/42/e0a7d749626f1e28c7108a99fb9bf524b501bbbeb9b261ceecde644d5a07/watchfiles-1.1.1-cp313-cp313t-macosx_10_12_x86_64.whl", hash = "sha256:563b116874a9a7ce6f96f87cd0b94f7faf92d08d0021e837796f0a14318ef8da", size = 403389, upload-time = "2025-10-14T15:05:15.777Z" }, - { url = "https://files.pythonhosted.org/packages/15/49/08732f90ce0fbbc13913f9f215c689cfc9ced345fb1bcd8829a50007cc8d/watchfiles-1.1.1-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:3ad9fe1dae4ab4212d8c91e80b832425e24f421703b5a42ef2e4a1e215aff051", size = 389964, upload-time = "2025-10-14T15:05:16.85Z" }, - { url = "https://files.pythonhosted.org/packages/27/0d/7c315d4bd5f2538910491a0393c56bf70d333d51bc5b34bee8e68e8cea19/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ce70f96a46b894b36eba678f153f052967a0d06d5b5a19b336ab0dbbd029f73e", size = 448114, upload-time = "2025-10-14T15:05:17.876Z" }, - { url = "https://files.pythonhosted.org/packages/c3/24/9e096de47a4d11bc4df41e9d1e61776393eac4cb6eb11b3e23315b78b2cc/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:cb467c999c2eff23a6417e58d75e5828716f42ed8289fe6b77a7e5a91036ca70", size = 460264, upload-time = "2025-10-14T15:05:18.962Z" }, - { url = "https://files.pythonhosted.org/packages/cc/0f/e8dea6375f1d3ba5fcb0b3583e2b493e77379834c74fd5a22d66d85d6540/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:836398932192dae4146c8f6f737d74baeac8b70ce14831a239bdb1ca882fc261", size = 487877, upload-time = "2025-10-14T15:05:20.094Z" }, - { url = "https://files.pythonhosted.org/packages/ac/5b/df24cfc6424a12deb41503b64d42fbea6b8cb357ec62ca84a5a3476f654a/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:743185e7372b7bc7c389e1badcc606931a827112fbbd37f14c537320fca08620", size = 595176, upload-time = "2025-10-14T15:05:21.134Z" }, - { url = "https://files.pythonhosted.org/packages/8f/b5/853b6757f7347de4e9b37e8cc3289283fb983cba1ab4d2d7144694871d9c/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:afaeff7696e0ad9f02cbb8f56365ff4686ab205fcf9c4c5b6fdfaaa16549dd04", size = 473577, upload-time = "2025-10-14T15:05:22.306Z" }, - { url = "https://files.pythonhosted.org/packages/e1/f7/0a4467be0a56e80447c8529c9fce5b38eab4f513cb3d9bf82e7392a5696b/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3f7eb7da0eb23aa2ba036d4f616d46906013a68caf61b7fdbe42fc8b25132e77", size = 455425, upload-time = "2025-10-14T15:05:23.348Z" }, - { url = "https://files.pythonhosted.org/packages/8e/e0/82583485ea00137ddf69bc84a2db88bd92ab4a6e3c405e5fb878ead8d0e7/watchfiles-1.1.1-cp313-cp313t-musllinux_1_1_aarch64.whl", hash = "sha256:831a62658609f0e5c64178211c942ace999517f5770fe9436be4c2faeba0c0ef", size = 628826, upload-time = "2025-10-14T15:05:24.398Z" }, - { url = "https://files.pythonhosted.org/packages/28/9a/a785356fccf9fae84c0cc90570f11702ae9571036fb25932f1242c82191c/watchfiles-1.1.1-cp313-cp313t-musllinux_1_1_x86_64.whl", hash = "sha256:f9a2ae5c91cecc9edd47e041a930490c31c3afb1f5e6d71de3dc671bfaca02bf", size = 622208, upload-time = "2025-10-14T15:05:25.45Z" }, - { url = "https://files.pythonhosted.org/packages/c3/f4/0872229324ef69b2c3edec35e84bd57a1289e7d3fe74588048ed8947a323/watchfiles-1.1.1-cp314-cp314-macosx_10_12_x86_64.whl", hash = "sha256:d1715143123baeeaeadec0528bb7441103979a1d5f6fd0e1f915383fea7ea6d5", size = 404315, upload-time = "2025-10-14T15:05:26.501Z" }, - { url = "https://files.pythonhosted.org/packages/7b/22/16d5331eaed1cb107b873f6ae1b69e9ced582fcf0c59a50cd84f403b1c32/watchfiles-1.1.1-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:39574d6370c4579d7f5d0ad940ce5b20db0e4117444e39b6d8f99db5676c52fd", size = 390869, upload-time = "2025-10-14T15:05:27.649Z" }, - { url = "https://files.pythonhosted.org/packages/b2/7e/5643bfff5acb6539b18483128fdc0ef2cccc94a5b8fbda130c823e8ed636/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:7365b92c2e69ee952902e8f70f3ba6360d0d596d9299d55d7d386df84b6941fb", size = 449919, upload-time = "2025-10-14T15:05:28.701Z" }, - { url = "https://files.pythonhosted.org/packages/51/2e/c410993ba5025a9f9357c376f48976ef0e1b1aefb73b97a5ae01a5972755/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:bfff9740c69c0e4ed32416f013f3c45e2ae42ccedd1167ef2d805c000b6c71a5", size = 460845, upload-time = "2025-10-14T15:05:30.064Z" }, - { url = "https://files.pythonhosted.org/packages/8e/a4/2df3b404469122e8680f0fcd06079317e48db58a2da2950fb45020947734/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b27cf2eb1dda37b2089e3907d8ea92922b673c0c427886d4edc6b94d8dfe5db3", size = 489027, upload-time = "2025-10-14T15:05:31.064Z" }, - { url = "https://files.pythonhosted.org/packages/ea/84/4587ba5b1f267167ee715b7f66e6382cca6938e0a4b870adad93e44747e6/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:526e86aced14a65a5b0ec50827c745597c782ff46b571dbfe46192ab9e0b3c33", size = 595615, upload-time = "2025-10-14T15:05:32.074Z" }, - { url = "https://files.pythonhosted.org/packages/6a/0f/c6988c91d06e93cd0bb3d4a808bcf32375ca1904609835c3031799e3ecae/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:04e78dd0b6352db95507fd8cb46f39d185cf8c74e4cf1e4fbad1d3df96faf510", size = 474836, upload-time = "2025-10-14T15:05:33.209Z" }, - { url = "https://files.pythonhosted.org/packages/b4/36/ded8aebea91919485b7bbabbd14f5f359326cb5ec218cd67074d1e426d74/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5c85794a4cfa094714fb9c08d4a218375b2b95b8ed1666e8677c349906246c05", size = 455099, upload-time = "2025-10-14T15:05:34.189Z" }, - { url = "https://files.pythonhosted.org/packages/98/e0/8c9bdba88af756a2fce230dd365fab2baf927ba42cd47521ee7498fd5211/watchfiles-1.1.1-cp314-cp314-musllinux_1_1_aarch64.whl", hash = "sha256:74d5012b7630714b66be7b7b7a78855ef7ad58e8650c73afc4c076a1f480a8d6", size = 630626, upload-time = "2025-10-14T15:05:35.216Z" }, - { url = "https://files.pythonhosted.org/packages/2a/84/a95db05354bf2d19e438520d92a8ca475e578c647f78f53197f5a2f17aaf/watchfiles-1.1.1-cp314-cp314-musllinux_1_1_x86_64.whl", hash = "sha256:8fbe85cb3201c7d380d3d0b90e63d520f15d6afe217165d7f98c9c649654db81", size = 622519, upload-time = "2025-10-14T15:05:36.259Z" }, - { url = "https://files.pythonhosted.org/packages/1d/ce/d8acdc8de545de995c339be67711e474c77d643555a9bb74a9334252bd55/watchfiles-1.1.1-cp314-cp314-win32.whl", hash = "sha256:3fa0b59c92278b5a7800d3ee7733da9d096d4aabcfabb9a928918bd276ef9b9b", size = 272078, upload-time = "2025-10-14T15:05:37.63Z" }, - { url = "https://files.pythonhosted.org/packages/c4/c9/a74487f72d0451524be827e8edec251da0cc1fcf111646a511ae752e1a3d/watchfiles-1.1.1-cp314-cp314-win_amd64.whl", hash = "sha256:c2047d0b6cea13b3316bdbafbfa0c4228ae593d995030fda39089d36e64fc03a", size = 287664, upload-time = "2025-10-14T15:05:38.95Z" }, - { url = "https://files.pythonhosted.org/packages/df/b8/8ac000702cdd496cdce998c6f4ee0ca1f15977bba51bdf07d872ebdfc34c/watchfiles-1.1.1-cp314-cp314-win_arm64.whl", hash = "sha256:842178b126593addc05acf6fce960d28bc5fae7afbaa2c6c1b3a7b9460e5be02", size = 277154, upload-time = "2025-10-14T15:05:39.954Z" }, - { url = "https://files.pythonhosted.org/packages/47/a8/e3af2184707c29f0f14b1963c0aace6529f9d1b8582d5b99f31bbf42f59e/watchfiles-1.1.1-cp314-cp314t-macosx_10_12_x86_64.whl", hash = "sha256:88863fbbc1a7312972f1c511f202eb30866370ebb8493aef2812b9ff28156a21", size = 403820, upload-time = "2025-10-14T15:05:40.932Z" }, - { url = "https://files.pythonhosted.org/packages/c0/ec/e47e307c2f4bd75f9f9e8afbe3876679b18e1bcec449beca132a1c5ffb2d/watchfiles-1.1.1-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:55c7475190662e202c08c6c0f4d9e345a29367438cf8e8037f3155e10a88d5a5", size = 390510, upload-time = "2025-10-14T15:05:41.945Z" }, - { url = "https://files.pythonhosted.org/packages/d5/a0/ad235642118090f66e7b2f18fd5c42082418404a79205cdfca50b6309c13/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3f53fa183d53a1d7a8852277c92b967ae99c2d4dcee2bfacff8868e6e30b15f7", size = 448408, upload-time = "2025-10-14T15:05:43.385Z" }, - { url = "https://files.pythonhosted.org/packages/df/85/97fa10fd5ff3332ae17e7e40e20784e419e28521549780869f1413742e9d/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:6aae418a8b323732fa89721d86f39ec8f092fc2af67f4217a2b07fd3e93c6101", size = 458968, upload-time = "2025-10-14T15:05:44.404Z" }, - { url = "https://files.pythonhosted.org/packages/47/c2/9059c2e8966ea5ce678166617a7f75ecba6164375f3b288e50a40dc6d489/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f096076119da54a6080e8920cbdaac3dbee667eb91dcc5e5b78840b87415bd44", size = 488096, upload-time = "2025-10-14T15:05:45.398Z" }, - { url = "https://files.pythonhosted.org/packages/94/44/d90a9ec8ac309bc26db808a13e7bfc0e4e78b6fc051078a554e132e80160/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:00485f441d183717038ed2e887a7c868154f216877653121068107b227a2f64c", size = 596040, upload-time = "2025-10-14T15:05:46.502Z" }, - { url = "https://files.pythonhosted.org/packages/95/68/4e3479b20ca305cfc561db3ed207a8a1c745ee32bf24f2026a129d0ddb6e/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a55f3e9e493158d7bfdb60a1165035f1cf7d320914e7b7ea83fe22c6023b58fc", size = 473847, upload-time = "2025-10-14T15:05:47.484Z" }, - { url = "https://files.pythonhosted.org/packages/4f/55/2af26693fd15165c4ff7857e38330e1b61ab8c37d15dc79118cdba115b7a/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8c91ed27800188c2ae96d16e3149f199d62f86c7af5f5f4d2c61a3ed8cd3666c", size = 455072, upload-time = "2025-10-14T15:05:48.928Z" }, - { url = "https://files.pythonhosted.org/packages/66/1d/d0d200b10c9311ec25d2273f8aad8c3ef7cc7ea11808022501811208a750/watchfiles-1.1.1-cp314-cp314t-musllinux_1_1_aarch64.whl", hash = "sha256:311ff15a0bae3714ffb603e6ba6dbfba4065ab60865d15a6ec544133bdb21099", size = 629104, upload-time = "2025-10-14T15:05:49.908Z" }, - { url = "https://files.pythonhosted.org/packages/e3/bd/fa9bb053192491b3867ba07d2343d9f2252e00811567d30ae8d0f78136fe/watchfiles-1.1.1-cp314-cp314t-musllinux_1_1_x86_64.whl", hash = "sha256:a916a2932da8f8ab582f242c065f5c81bed3462849ca79ee357dd9551b0e9b01", size = 622112, upload-time = "2025-10-14T15:05:50.941Z" }, - { url = "https://files.pythonhosted.org/packages/d3/8e/e500f8b0b77be4ff753ac94dc06b33d8f0d839377fee1b78e8c8d8f031bf/watchfiles-1.1.1-pp311-pypy311_pp73-macosx_10_12_x86_64.whl", hash = "sha256:db476ab59b6765134de1d4fe96a1a9c96ddf091683599be0f26147ea1b2e4b88", size = 408250, upload-time = "2025-10-14T15:06:10.264Z" }, - { url = "https://files.pythonhosted.org/packages/bd/95/615e72cd27b85b61eec764a5ca51bd94d40b5adea5ff47567d9ebc4d275a/watchfiles-1.1.1-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:89eef07eee5e9d1fda06e38822ad167a044153457e6fd997f8a858ab7564a336", size = 396117, upload-time = "2025-10-14T15:06:11.28Z" }, - { url = "https://files.pythonhosted.org/packages/c9/81/e7fe958ce8a7fb5c73cc9fb07f5aeaf755e6aa72498c57d760af760c91f8/watchfiles-1.1.1-pp311-pypy311_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ce19e06cbda693e9e7686358af9cd6f5d61312ab8b00488bc36f5aabbaf77e24", size = 450493, upload-time = "2025-10-14T15:06:12.321Z" }, - { url = "https://files.pythonhosted.org/packages/6e/d4/ed38dd3b1767193de971e694aa544356e63353c33a85d948166b5ff58b9e/watchfiles-1.1.1-pp311-pypy311_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3e6f39af2eab0118338902798b5aa6664f46ff66bc0280de76fca67a7f262a49", size = 457546, upload-time = "2025-10-14T15:06:13.372Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/c2/c9/8869df9b2a2d6c59d79220a4db37679e74f807c559ffe5265e08b227a210/watchfiles-1.1.1.tar.gz", hash = "sha256:a173cb5c16c4f40ab19cecf48a534c409f7ea983ab8fed0741304a1c0a31b3f2", size = 94440 } +wheels = [ + { url = "https://files.pythonhosted.org/packages/1f/f8/2c5f479fb531ce2f0564eda479faecf253d886b1ab3630a39b7bf7362d46/watchfiles-1.1.1-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:f57b396167a2565a4e8b5e56a5a1c537571733992b226f4f1197d79e94cf0ae5", size = 406529 }, + { url = "https://files.pythonhosted.org/packages/fe/cd/f515660b1f32f65df671ddf6f85bfaca621aee177712874dc30a97397977/watchfiles-1.1.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:421e29339983e1bebc281fab40d812742268ad057db4aee8c4d2bce0af43b741", size = 394384 }, + { url = "https://files.pythonhosted.org/packages/7b/c3/28b7dc99733eab43fca2d10f55c86e03bd6ab11ca31b802abac26b23d161/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:6e43d39a741e972bab5d8100b5cdacf69db64e34eb19b6e9af162bccf63c5cc6", size = 448789 }, + { url = "https://files.pythonhosted.org/packages/4a/24/33e71113b320030011c8e4316ccca04194bf0cbbaeee207f00cbc7d6b9f5/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:f537afb3276d12814082a2e9b242bdcf416c2e8fd9f799a737990a1dbe906e5b", size = 460521 }, + { url = "https://files.pythonhosted.org/packages/f4/c3/3c9a55f255aa57b91579ae9e98c88704955fa9dac3e5614fb378291155df/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b2cd9e04277e756a2e2d2543d65d1e2166d6fd4c9b183f8808634fda23f17b14", size = 488722 }, + { url = "https://files.pythonhosted.org/packages/49/36/506447b73eb46c120169dc1717fe2eff07c234bb3232a7200b5f5bd816e9/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:5f3f58818dc0b07f7d9aa7fe9eb1037aecb9700e63e1f6acfed13e9fef648f5d", size = 596088 }, + { url = "https://files.pythonhosted.org/packages/82/ab/5f39e752a9838ec4d52e9b87c1e80f1ee3ccdbe92e183c15b6577ab9de16/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:9bb9f66367023ae783551042d31b1d7fd422e8289eedd91f26754a66f44d5cff", size = 472923 }, + { url = "https://files.pythonhosted.org/packages/af/b9/a419292f05e302dea372fa7e6fda5178a92998411f8581b9830d28fb9edb/watchfiles-1.1.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:aebfd0861a83e6c3d1110b78ad54704486555246e542be3e2bb94195eabb2606", size = 456080 }, + { url = "https://files.pythonhosted.org/packages/b0/c3/d5932fd62bde1a30c36e10c409dc5d54506726f08cb3e1d8d0ba5e2bc8db/watchfiles-1.1.1-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:5fac835b4ab3c6487b5dbad78c4b3724e26bcc468e886f8ba8cc4306f68f6701", size = 629432 }, + { url = "https://files.pythonhosted.org/packages/f7/77/16bddd9779fafb795f1a94319dc965209c5641db5bf1edbbccace6d1b3c0/watchfiles-1.1.1-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:399600947b170270e80134ac854e21b3ccdefa11a9529a3decc1327088180f10", size = 623046 }, + { url = "https://files.pythonhosted.org/packages/46/ef/f2ecb9a0f342b4bfad13a2787155c6ee7ce792140eac63a34676a2feeef2/watchfiles-1.1.1-cp311-cp311-win32.whl", hash = "sha256:de6da501c883f58ad50db3a32ad397b09ad29865b5f26f64c24d3e3281685849", size = 271473 }, + { url = "https://files.pythonhosted.org/packages/94/bc/f42d71125f19731ea435c3948cad148d31a64fccde3867e5ba4edee901f9/watchfiles-1.1.1-cp311-cp311-win_amd64.whl", hash = "sha256:35c53bd62a0b885bf653ebf6b700d1bf05debb78ad9292cf2a942b23513dc4c4", size = 287598 }, + { url = "https://files.pythonhosted.org/packages/57/c9/a30f897351f95bbbfb6abcadafbaca711ce1162f4db95fc908c98a9165f3/watchfiles-1.1.1-cp311-cp311-win_arm64.whl", hash = "sha256:57ca5281a8b5e27593cb7d82c2ac927ad88a96ed406aa446f6344e4328208e9e", size = 277210 }, + { url = "https://files.pythonhosted.org/packages/74/d5/f039e7e3c639d9b1d09b07ea412a6806d38123f0508e5f9b48a87b0a76cc/watchfiles-1.1.1-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:8c89f9f2f740a6b7dcc753140dd5e1ab9215966f7a3530d0c0705c83b401bd7d", size = 404745 }, + { url = "https://files.pythonhosted.org/packages/a5/96/a881a13aa1349827490dab2d363c8039527060cfcc2c92cc6d13d1b1049e/watchfiles-1.1.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:bd404be08018c37350f0d6e34676bd1e2889990117a2b90070b3007f172d0610", size = 391769 }, + { url = "https://files.pythonhosted.org/packages/4b/5b/d3b460364aeb8da471c1989238ea0e56bec24b6042a68046adf3d9ddb01c/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:8526e8f916bb5b9a0a777c8317c23ce65de259422bba5b31325a6fa6029d33af", size = 449374 }, + { url = "https://files.pythonhosted.org/packages/b9/44/5769cb62d4ed055cb17417c0a109a92f007114a4e07f30812a73a4efdb11/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:2edc3553362b1c38d9f06242416a5d8e9fe235c204a4072e988ce2e5bb1f69f6", size = 459485 }, + { url = "https://files.pythonhosted.org/packages/19/0c/286b6301ded2eccd4ffd0041a1b726afda999926cf720aab63adb68a1e36/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:30f7da3fb3f2844259cba4720c3fc7138eb0f7b659c38f3bfa65084c7fc7abce", size = 488813 }, + { url = "https://files.pythonhosted.org/packages/c7/2b/8530ed41112dd4a22f4dcfdb5ccf6a1baad1ff6eed8dc5a5f09e7e8c41c7/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:f8979280bdafff686ba5e4d8f97840f929a87ed9cdf133cbbd42f7766774d2aa", size = 594816 }, + { url = "https://files.pythonhosted.org/packages/ce/d2/f5f9fb49489f184f18470d4f99f4e862a4b3e9ac2865688eb2099e3d837a/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:dcc5c24523771db3a294c77d94771abcfcb82a0e0ee8efd910c37c59ec1b31bb", size = 475186 }, + { url = "https://files.pythonhosted.org/packages/cf/68/5707da262a119fb06fbe214d82dd1fe4a6f4af32d2d14de368d0349eb52a/watchfiles-1.1.1-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:1db5d7ae38ff20153d542460752ff397fcf5c96090c1230803713cf3147a6803", size = 456812 }, + { url = "https://files.pythonhosted.org/packages/66/ab/3cbb8756323e8f9b6f9acb9ef4ec26d42b2109bce830cc1f3468df20511d/watchfiles-1.1.1-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:28475ddbde92df1874b6c5c8aaeb24ad5be47a11f87cde5a28ef3835932e3e94", size = 630196 }, + { url = "https://files.pythonhosted.org/packages/78/46/7152ec29b8335f80167928944a94955015a345440f524d2dfe63fc2f437b/watchfiles-1.1.1-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:36193ed342f5b9842edd3532729a2ad55c4160ffcfa3700e0d54be496b70dd43", size = 622657 }, + { url = "https://files.pythonhosted.org/packages/0a/bf/95895e78dd75efe9a7f31733607f384b42eb5feb54bd2eb6ed57cc2e94f4/watchfiles-1.1.1-cp312-cp312-win32.whl", hash = "sha256:859e43a1951717cc8de7f4c77674a6d389b106361585951d9e69572823f311d9", size = 272042 }, + { url = "https://files.pythonhosted.org/packages/87/0a/90eb755f568de2688cb220171c4191df932232c20946966c27a59c400850/watchfiles-1.1.1-cp312-cp312-win_amd64.whl", hash = "sha256:91d4c9a823a8c987cce8fa2690923b069966dabb196dd8d137ea2cede885fde9", size = 288410 }, + { url = "https://files.pythonhosted.org/packages/36/76/f322701530586922fbd6723c4f91ace21364924822a8772c549483abed13/watchfiles-1.1.1-cp312-cp312-win_arm64.whl", hash = "sha256:a625815d4a2bdca61953dbba5a39d60164451ef34c88d751f6c368c3ea73d404", size = 278209 }, + { url = "https://files.pythonhosted.org/packages/bb/f4/f750b29225fe77139f7ae5de89d4949f5a99f934c65a1f1c0b248f26f747/watchfiles-1.1.1-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:130e4876309e8686a5e37dba7d5e9bc77e6ed908266996ca26572437a5271e18", size = 404321 }, + { url = "https://files.pythonhosted.org/packages/2b/f9/f07a295cde762644aa4c4bb0f88921d2d141af45e735b965fb2e87858328/watchfiles-1.1.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:5f3bde70f157f84ece3765b42b4a52c6ac1a50334903c6eaf765362f6ccca88a", size = 391783 }, + { url = "https://files.pythonhosted.org/packages/bc/11/fc2502457e0bea39a5c958d86d2cb69e407a4d00b85735ca724bfa6e0d1a/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:14e0b1fe858430fc0251737ef3824c54027bedb8c37c38114488b8e131cf8219", size = 449279 }, + { url = "https://files.pythonhosted.org/packages/e3/1f/d66bc15ea0b728df3ed96a539c777acfcad0eb78555ad9efcaa1274688f0/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:f27db948078f3823a6bb3b465180db8ebecf26dd5dae6f6180bd87383b6b4428", size = 459405 }, + { url = "https://files.pythonhosted.org/packages/be/90/9f4a65c0aec3ccf032703e6db02d89a157462fbb2cf20dd415128251cac0/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:059098c3a429f62fc98e8ec62b982230ef2c8df68c79e826e37b895bc359a9c0", size = 488976 }, + { url = "https://files.pythonhosted.org/packages/37/57/ee347af605d867f712be7029bb94c8c071732a4b44792e3176fa3c612d39/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:bfb5862016acc9b869bb57284e6cb35fdf8e22fe59f7548858e2f971d045f150", size = 595506 }, + { url = "https://files.pythonhosted.org/packages/a8/78/cc5ab0b86c122047f75e8fc471c67a04dee395daf847d3e59381996c8707/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:319b27255aacd9923b8a276bb14d21a5f7ff82564c744235fc5eae58d95422ae", size = 474936 }, + { url = "https://files.pythonhosted.org/packages/62/da/def65b170a3815af7bd40a3e7010bf6ab53089ef1b75d05dd5385b87cf08/watchfiles-1.1.1-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c755367e51db90e75b19454b680903631d41f9e3607fbd941d296a020c2d752d", size = 456147 }, + { url = "https://files.pythonhosted.org/packages/57/99/da6573ba71166e82d288d4df0839128004c67d2778d3b566c138695f5c0b/watchfiles-1.1.1-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:c22c776292a23bfc7237a98f791b9ad3144b02116ff10d820829ce62dff46d0b", size = 630007 }, + { url = "https://files.pythonhosted.org/packages/a8/51/7439c4dd39511368849eb1e53279cd3454b4a4dbace80bab88feeb83c6b5/watchfiles-1.1.1-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:3a476189be23c3686bc2f4321dd501cb329c0a0469e77b7b534ee10129ae6374", size = 622280 }, + { url = "https://files.pythonhosted.org/packages/95/9c/8ed97d4bba5db6fdcdb2b298d3898f2dd5c20f6b73aee04eabe56c59677e/watchfiles-1.1.1-cp313-cp313-win32.whl", hash = "sha256:bf0a91bfb5574a2f7fc223cf95eeea79abfefa404bf1ea5e339c0c1560ae99a0", size = 272056 }, + { url = "https://files.pythonhosted.org/packages/1f/f3/c14e28429f744a260d8ceae18bf58c1d5fa56b50d006a7a9f80e1882cb0d/watchfiles-1.1.1-cp313-cp313-win_amd64.whl", hash = "sha256:52e06553899e11e8074503c8e716d574adeeb7e68913115c4b3653c53f9bae42", size = 288162 }, + { url = "https://files.pythonhosted.org/packages/dc/61/fe0e56c40d5cd29523e398d31153218718c5786b5e636d9ae8ae79453d27/watchfiles-1.1.1-cp313-cp313-win_arm64.whl", hash = "sha256:ac3cc5759570cd02662b15fbcd9d917f7ecd47efe0d6b40474eafd246f91ea18", size = 277909 }, + { url = "https://files.pythonhosted.org/packages/79/42/e0a7d749626f1e28c7108a99fb9bf524b501bbbeb9b261ceecde644d5a07/watchfiles-1.1.1-cp313-cp313t-macosx_10_12_x86_64.whl", hash = "sha256:563b116874a9a7ce6f96f87cd0b94f7faf92d08d0021e837796f0a14318ef8da", size = 403389 }, + { url = "https://files.pythonhosted.org/packages/15/49/08732f90ce0fbbc13913f9f215c689cfc9ced345fb1bcd8829a50007cc8d/watchfiles-1.1.1-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:3ad9fe1dae4ab4212d8c91e80b832425e24f421703b5a42ef2e4a1e215aff051", size = 389964 }, + { url = "https://files.pythonhosted.org/packages/27/0d/7c315d4bd5f2538910491a0393c56bf70d333d51bc5b34bee8e68e8cea19/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ce70f96a46b894b36eba678f153f052967a0d06d5b5a19b336ab0dbbd029f73e", size = 448114 }, + { url = "https://files.pythonhosted.org/packages/c3/24/9e096de47a4d11bc4df41e9d1e61776393eac4cb6eb11b3e23315b78b2cc/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:cb467c999c2eff23a6417e58d75e5828716f42ed8289fe6b77a7e5a91036ca70", size = 460264 }, + { url = "https://files.pythonhosted.org/packages/cc/0f/e8dea6375f1d3ba5fcb0b3583e2b493e77379834c74fd5a22d66d85d6540/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:836398932192dae4146c8f6f737d74baeac8b70ce14831a239bdb1ca882fc261", size = 487877 }, + { url = "https://files.pythonhosted.org/packages/ac/5b/df24cfc6424a12deb41503b64d42fbea6b8cb357ec62ca84a5a3476f654a/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:743185e7372b7bc7c389e1badcc606931a827112fbbd37f14c537320fca08620", size = 595176 }, + { url = "https://files.pythonhosted.org/packages/8f/b5/853b6757f7347de4e9b37e8cc3289283fb983cba1ab4d2d7144694871d9c/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:afaeff7696e0ad9f02cbb8f56365ff4686ab205fcf9c4c5b6fdfaaa16549dd04", size = 473577 }, + { url = "https://files.pythonhosted.org/packages/e1/f7/0a4467be0a56e80447c8529c9fce5b38eab4f513cb3d9bf82e7392a5696b/watchfiles-1.1.1-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3f7eb7da0eb23aa2ba036d4f616d46906013a68caf61b7fdbe42fc8b25132e77", size = 455425 }, + { url = "https://files.pythonhosted.org/packages/8e/e0/82583485ea00137ddf69bc84a2db88bd92ab4a6e3c405e5fb878ead8d0e7/watchfiles-1.1.1-cp313-cp313t-musllinux_1_1_aarch64.whl", hash = "sha256:831a62658609f0e5c64178211c942ace999517f5770fe9436be4c2faeba0c0ef", size = 628826 }, + { url = "https://files.pythonhosted.org/packages/28/9a/a785356fccf9fae84c0cc90570f11702ae9571036fb25932f1242c82191c/watchfiles-1.1.1-cp313-cp313t-musllinux_1_1_x86_64.whl", hash = "sha256:f9a2ae5c91cecc9edd47e041a930490c31c3afb1f5e6d71de3dc671bfaca02bf", size = 622208 }, + { url = "https://files.pythonhosted.org/packages/c3/f4/0872229324ef69b2c3edec35e84bd57a1289e7d3fe74588048ed8947a323/watchfiles-1.1.1-cp314-cp314-macosx_10_12_x86_64.whl", hash = "sha256:d1715143123baeeaeadec0528bb7441103979a1d5f6fd0e1f915383fea7ea6d5", size = 404315 }, + { url = "https://files.pythonhosted.org/packages/7b/22/16d5331eaed1cb107b873f6ae1b69e9ced582fcf0c59a50cd84f403b1c32/watchfiles-1.1.1-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:39574d6370c4579d7f5d0ad940ce5b20db0e4117444e39b6d8f99db5676c52fd", size = 390869 }, + { url = "https://files.pythonhosted.org/packages/b2/7e/5643bfff5acb6539b18483128fdc0ef2cccc94a5b8fbda130c823e8ed636/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:7365b92c2e69ee952902e8f70f3ba6360d0d596d9299d55d7d386df84b6941fb", size = 449919 }, + { url = "https://files.pythonhosted.org/packages/51/2e/c410993ba5025a9f9357c376f48976ef0e1b1aefb73b97a5ae01a5972755/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:bfff9740c69c0e4ed32416f013f3c45e2ae42ccedd1167ef2d805c000b6c71a5", size = 460845 }, + { url = "https://files.pythonhosted.org/packages/8e/a4/2df3b404469122e8680f0fcd06079317e48db58a2da2950fb45020947734/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b27cf2eb1dda37b2089e3907d8ea92922b673c0c427886d4edc6b94d8dfe5db3", size = 489027 }, + { url = "https://files.pythonhosted.org/packages/ea/84/4587ba5b1f267167ee715b7f66e6382cca6938e0a4b870adad93e44747e6/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:526e86aced14a65a5b0ec50827c745597c782ff46b571dbfe46192ab9e0b3c33", size = 595615 }, + { url = "https://files.pythonhosted.org/packages/6a/0f/c6988c91d06e93cd0bb3d4a808bcf32375ca1904609835c3031799e3ecae/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:04e78dd0b6352db95507fd8cb46f39d185cf8c74e4cf1e4fbad1d3df96faf510", size = 474836 }, + { url = "https://files.pythonhosted.org/packages/b4/36/ded8aebea91919485b7bbabbd14f5f359326cb5ec218cd67074d1e426d74/watchfiles-1.1.1-cp314-cp314-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:5c85794a4cfa094714fb9c08d4a218375b2b95b8ed1666e8677c349906246c05", size = 455099 }, + { url = "https://files.pythonhosted.org/packages/98/e0/8c9bdba88af756a2fce230dd365fab2baf927ba42cd47521ee7498fd5211/watchfiles-1.1.1-cp314-cp314-musllinux_1_1_aarch64.whl", hash = "sha256:74d5012b7630714b66be7b7b7a78855ef7ad58e8650c73afc4c076a1f480a8d6", size = 630626 }, + { url = "https://files.pythonhosted.org/packages/2a/84/a95db05354bf2d19e438520d92a8ca475e578c647f78f53197f5a2f17aaf/watchfiles-1.1.1-cp314-cp314-musllinux_1_1_x86_64.whl", hash = "sha256:8fbe85cb3201c7d380d3d0b90e63d520f15d6afe217165d7f98c9c649654db81", size = 622519 }, + { url = "https://files.pythonhosted.org/packages/1d/ce/d8acdc8de545de995c339be67711e474c77d643555a9bb74a9334252bd55/watchfiles-1.1.1-cp314-cp314-win32.whl", hash = "sha256:3fa0b59c92278b5a7800d3ee7733da9d096d4aabcfabb9a928918bd276ef9b9b", size = 272078 }, + { url = "https://files.pythonhosted.org/packages/c4/c9/a74487f72d0451524be827e8edec251da0cc1fcf111646a511ae752e1a3d/watchfiles-1.1.1-cp314-cp314-win_amd64.whl", hash = "sha256:c2047d0b6cea13b3316bdbafbfa0c4228ae593d995030fda39089d36e64fc03a", size = 287664 }, + { url = "https://files.pythonhosted.org/packages/df/b8/8ac000702cdd496cdce998c6f4ee0ca1f15977bba51bdf07d872ebdfc34c/watchfiles-1.1.1-cp314-cp314-win_arm64.whl", hash = "sha256:842178b126593addc05acf6fce960d28bc5fae7afbaa2c6c1b3a7b9460e5be02", size = 277154 }, + { url = "https://files.pythonhosted.org/packages/47/a8/e3af2184707c29f0f14b1963c0aace6529f9d1b8582d5b99f31bbf42f59e/watchfiles-1.1.1-cp314-cp314t-macosx_10_12_x86_64.whl", hash = "sha256:88863fbbc1a7312972f1c511f202eb30866370ebb8493aef2812b9ff28156a21", size = 403820 }, + { url = "https://files.pythonhosted.org/packages/c0/ec/e47e307c2f4bd75f9f9e8afbe3876679b18e1bcec449beca132a1c5ffb2d/watchfiles-1.1.1-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:55c7475190662e202c08c6c0f4d9e345a29367438cf8e8037f3155e10a88d5a5", size = 390510 }, + { url = "https://files.pythonhosted.org/packages/d5/a0/ad235642118090f66e7b2f18fd5c42082418404a79205cdfca50b6309c13/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3f53fa183d53a1d7a8852277c92b967ae99c2d4dcee2bfacff8868e6e30b15f7", size = 448408 }, + { url = "https://files.pythonhosted.org/packages/df/85/97fa10fd5ff3332ae17e7e40e20784e419e28521549780869f1413742e9d/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:6aae418a8b323732fa89721d86f39ec8f092fc2af67f4217a2b07fd3e93c6101", size = 458968 }, + { url = "https://files.pythonhosted.org/packages/47/c2/9059c2e8966ea5ce678166617a7f75ecba6164375f3b288e50a40dc6d489/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f096076119da54a6080e8920cbdaac3dbee667eb91dcc5e5b78840b87415bd44", size = 488096 }, + { url = "https://files.pythonhosted.org/packages/94/44/d90a9ec8ac309bc26db808a13e7bfc0e4e78b6fc051078a554e132e80160/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:00485f441d183717038ed2e887a7c868154f216877653121068107b227a2f64c", size = 596040 }, + { url = "https://files.pythonhosted.org/packages/95/68/4e3479b20ca305cfc561db3ed207a8a1c745ee32bf24f2026a129d0ddb6e/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a55f3e9e493158d7bfdb60a1165035f1cf7d320914e7b7ea83fe22c6023b58fc", size = 473847 }, + { url = "https://files.pythonhosted.org/packages/4f/55/2af26693fd15165c4ff7857e38330e1b61ab8c37d15dc79118cdba115b7a/watchfiles-1.1.1-cp314-cp314t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8c91ed27800188c2ae96d16e3149f199d62f86c7af5f5f4d2c61a3ed8cd3666c", size = 455072 }, + { url = "https://files.pythonhosted.org/packages/66/1d/d0d200b10c9311ec25d2273f8aad8c3ef7cc7ea11808022501811208a750/watchfiles-1.1.1-cp314-cp314t-musllinux_1_1_aarch64.whl", hash = "sha256:311ff15a0bae3714ffb603e6ba6dbfba4065ab60865d15a6ec544133bdb21099", size = 629104 }, + { url = "https://files.pythonhosted.org/packages/e3/bd/fa9bb053192491b3867ba07d2343d9f2252e00811567d30ae8d0f78136fe/watchfiles-1.1.1-cp314-cp314t-musllinux_1_1_x86_64.whl", hash = "sha256:a916a2932da8f8ab582f242c065f5c81bed3462849ca79ee357dd9551b0e9b01", size = 622112 }, + { url = "https://files.pythonhosted.org/packages/d3/8e/e500f8b0b77be4ff753ac94dc06b33d8f0d839377fee1b78e8c8d8f031bf/watchfiles-1.1.1-pp311-pypy311_pp73-macosx_10_12_x86_64.whl", hash = "sha256:db476ab59b6765134de1d4fe96a1a9c96ddf091683599be0f26147ea1b2e4b88", size = 408250 }, + { url = "https://files.pythonhosted.org/packages/bd/95/615e72cd27b85b61eec764a5ca51bd94d40b5adea5ff47567d9ebc4d275a/watchfiles-1.1.1-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:89eef07eee5e9d1fda06e38822ad167a044153457e6fd997f8a858ab7564a336", size = 396117 }, + { url = "https://files.pythonhosted.org/packages/c9/81/e7fe958ce8a7fb5c73cc9fb07f5aeaf755e6aa72498c57d760af760c91f8/watchfiles-1.1.1-pp311-pypy311_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ce19e06cbda693e9e7686358af9cd6f5d61312ab8b00488bc36f5aabbaf77e24", size = 450493 }, + { url = "https://files.pythonhosted.org/packages/6e/d4/ed38dd3b1767193de971e694aa544356e63353c33a85d948166b5ff58b9e/watchfiles-1.1.1-pp311-pypy311_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3e6f39af2eab0118338902798b5aa6664f46ff66bc0280de76fca67a7f262a49", size = 457546 }, ] [[package]] name = "wcwidth" version = "0.2.14" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/24/30/6b0809f4510673dc723187aeaf24c7f5459922d01e2f794277a3dfb90345/wcwidth-0.2.14.tar.gz", hash = "sha256:4d478375d31bc5395a3c55c40ccdf3354688364cd61c4f6adacaa9215d0b3605", size = 102293, upload-time = "2025-09-22T16:29:53.023Z" } +sdist = { url = "https://files.pythonhosted.org/packages/24/30/6b0809f4510673dc723187aeaf24c7f5459922d01e2f794277a3dfb90345/wcwidth-0.2.14.tar.gz", hash = "sha256:4d478375d31bc5395a3c55c40ccdf3354688364cd61c4f6adacaa9215d0b3605", size = 102293 } wheels = [ - { url = "https://files.pythonhosted.org/packages/af/b5/123f13c975e9f27ab9c0770f514345bd406d0e8d3b7a0723af9d43f710af/wcwidth-0.2.14-py2.py3-none-any.whl", hash = "sha256:a7bb560c8aee30f9957e5f9895805edd20602f2d7f720186dfd906e82b4982e1", size = 37286, upload-time = "2025-09-22T16:29:51.641Z" }, + { url = "https://files.pythonhosted.org/packages/af/b5/123f13c975e9f27ab9c0770f514345bd406d0e8d3b7a0723af9d43f710af/wcwidth-0.2.14-py2.py3-none-any.whl", hash = "sha256:a7bb560c8aee30f9957e5f9895805edd20602f2d7f720186dfd906e82b4982e1", size = 37286 }, ] [[package]] name = "webcolors" version = "25.10.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/1d/7a/eb316761ec35664ea5174709a68bbd3389de60d4a1ebab8808bfc264ed67/webcolors-25.10.0.tar.gz", hash = "sha256:62abae86504f66d0f6364c2a8520de4a0c47b80c03fc3a5f1815fedbef7c19bf", size = 53491, upload-time = "2025-10-31T07:51:03.977Z" } +sdist = { url = "https://files.pythonhosted.org/packages/1d/7a/eb316761ec35664ea5174709a68bbd3389de60d4a1ebab8808bfc264ed67/webcolors-25.10.0.tar.gz", hash = "sha256:62abae86504f66d0f6364c2a8520de4a0c47b80c03fc3a5f1815fedbef7c19bf", size = 53491 } wheels = [ - { url = "https://files.pythonhosted.org/packages/e2/cc/e097523dd85c9cf5d354f78310927f1656c422bd7b2613b2db3e3f9a0f2c/webcolors-25.10.0-py3-none-any.whl", hash = "sha256:032c727334856fc0b968f63daa252a1ac93d33db2f5267756623c210e57a4f1d", size = 14905, upload-time = "2025-10-31T07:51:01.778Z" }, + { url = "https://files.pythonhosted.org/packages/e2/cc/e097523dd85c9cf5d354f78310927f1656c422bd7b2613b2db3e3f9a0f2c/webcolors-25.10.0-py3-none-any.whl", hash = "sha256:032c727334856fc0b968f63daa252a1ac93d33db2f5267756623c210e57a4f1d", size = 14905 }, ] [[package]] name = "webencodings" version = "0.5.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/0b/02/ae6ceac1baeda530866a85075641cec12989bd8d31af6d5ab4a3e8c92f47/webencodings-0.5.1.tar.gz", hash = "sha256:b36a1c245f2d304965eb4e0a82848379241dc04b865afcc4aab16748587e1923", size = 9721, upload-time = "2017-04-05T20:21:34.189Z" } +sdist = { url = "https://files.pythonhosted.org/packages/0b/02/ae6ceac1baeda530866a85075641cec12989bd8d31af6d5ab4a3e8c92f47/webencodings-0.5.1.tar.gz", hash = "sha256:b36a1c245f2d304965eb4e0a82848379241dc04b865afcc4aab16748587e1923", size = 9721 } wheels = [ - { url = "https://files.pythonhosted.org/packages/f4/24/2a3e3df732393fed8b3ebf2ec078f05546de641fe1b667ee316ec1dcf3b7/webencodings-0.5.1-py2.py3-none-any.whl", hash = "sha256:a0af1213f3c2226497a97e2b3aa01a7e4bee4f403f95be16fc9acd2947514a78", size = 11774, upload-time = "2017-04-05T20:21:32.581Z" }, + { url = "https://files.pythonhosted.org/packages/f4/24/2a3e3df732393fed8b3ebf2ec078f05546de641fe1b667ee316ec1dcf3b7/webencodings-0.5.1-py2.py3-none-any.whl", hash = "sha256:a0af1213f3c2226497a97e2b3aa01a7e4bee4f403f95be16fc9acd2947514a78", size = 11774 }, ] [[package]] name = "websocket-client" version = "1.9.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/2c/41/aa4bf9664e4cda14c3b39865b12251e8e7d239f4cd0e3cc1b6c2ccde25c1/websocket_client-1.9.0.tar.gz", hash = "sha256:9e813624b6eb619999a97dc7958469217c3176312b3a16a4bd1bc7e08a46ec98", size = 70576, upload-time = "2025-10-07T21:16:36.495Z" } +sdist = { url = "https://files.pythonhosted.org/packages/2c/41/aa4bf9664e4cda14c3b39865b12251e8e7d239f4cd0e3cc1b6c2ccde25c1/websocket_client-1.9.0.tar.gz", hash = "sha256:9e813624b6eb619999a97dc7958469217c3176312b3a16a4bd1bc7e08a46ec98", size = 70576 } wheels = [ - { url = "https://files.pythonhosted.org/packages/34/db/b10e48aa8fff7407e67470363eac595018441cf32d5e1001567a7aeba5d2/websocket_client-1.9.0-py3-none-any.whl", hash = "sha256:af248a825037ef591efbf6ed20cc5faa03d3b47b9e5a2230a529eeee1c1fc3ef", size = 82616, upload-time = "2025-10-07T21:16:34.951Z" }, + { url = "https://files.pythonhosted.org/packages/34/db/b10e48aa8fff7407e67470363eac595018441cf32d5e1001567a7aeba5d2/websocket_client-1.9.0-py3-none-any.whl", hash = "sha256:af248a825037ef591efbf6ed20cc5faa03d3b47b9e5a2230a529eeee1c1fc3ef", size = 82616 }, ] [[package]] name = "widgetsnbextension" version = "4.0.15" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/bd/f4/c67440c7fb409a71b7404b7aefcd7569a9c0d6bd071299bf4198ae7a5d95/widgetsnbextension-4.0.15.tar.gz", hash = "sha256:de8610639996f1567952d763a5a41af8af37f2575a41f9852a38f947eb82a3b9", size = 1097402, upload-time = "2025-11-01T21:15:55.178Z" } +sdist = { url = "https://files.pythonhosted.org/packages/bd/f4/c67440c7fb409a71b7404b7aefcd7569a9c0d6bd071299bf4198ae7a5d95/widgetsnbextension-4.0.15.tar.gz", hash = "sha256:de8610639996f1567952d763a5a41af8af37f2575a41f9852a38f947eb82a3b9", size = 1097402 } wheels = [ - { url = "https://files.pythonhosted.org/packages/3f/0e/fa3b193432cfc60c93b42f3be03365f5f909d2b3ea410295cf36df739e31/widgetsnbextension-4.0.15-py3-none-any.whl", hash = "sha256:8156704e4346a571d9ce73b84bee86a29906c9abfd7223b7228a28899ccf3366", size = 2196503, upload-time = "2025-11-01T21:15:53.565Z" }, + { url = "https://files.pythonhosted.org/packages/3f/0e/fa3b193432cfc60c93b42f3be03365f5f909d2b3ea410295cf36df739e31/widgetsnbextension-4.0.15-py3-none-any.whl", hash = "sha256:8156704e4346a571d9ce73b84bee86a29906c9abfd7223b7228a28899ccf3366", size = 2196503 }, ] [[package]] name = "zipp" version = "3.23.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e3/02/0f2892c661036d50ede074e376733dca2ae7c6eb617489437771209d4180/zipp-3.23.0.tar.gz", hash = "sha256:a07157588a12518c9d4034df3fbbee09c814741a33ff63c05fa29d26a2404166", size = 25547, upload-time = "2025-06-08T17:06:39.4Z" } +sdist = { url = "https://files.pythonhosted.org/packages/e3/02/0f2892c661036d50ede074e376733dca2ae7c6eb617489437771209d4180/zipp-3.23.0.tar.gz", hash = "sha256:a07157588a12518c9d4034df3fbbee09c814741a33ff63c05fa29d26a2404166", size = 25547 } wheels = [ - { url = "https://files.pythonhosted.org/packages/2e/54/647ade08bf0db230bfea292f893923872fd20be6ac6f53b2b936ba839d75/zipp-3.23.0-py3-none-any.whl", hash = "sha256:071652d6115ed432f5ce1d34c336c0adfd6a884660d1e9712a256d3d3bd4b14e", size = 10276, upload-time = "2025-06-08T17:06:38.034Z" }, + { url = "https://files.pythonhosted.org/packages/2e/54/647ade08bf0db230bfea292f893923872fd20be6ac6f53b2b936ba839d75/zipp-3.23.0-py3-none-any.whl", hash = "sha256:071652d6115ed432f5ce1d34c336c0adfd6a884660d1e9712a256d3d3bd4b14e", size = 10276 }, ] From 1a1d2504a712049199267987819d48a6d3b35ffb Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Tue, 6 Jan 2026 17:57:42 -0800 Subject: [PATCH 08/30] switch line length to 88 for pretty printing --- python/egglog/pretty.py | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/python/egglog/pretty.py b/python/egglog/pretty.py index 6b80b860..fb05cc00 100644 --- a/python/egglog/pretty.py +++ b/python/egglog/pretty.py @@ -26,7 +26,7 @@ ] MAX_LINE_LENGTH = 110 LINE_DIFFERENCE = 10 -BLACK_MODE = black.Mode(line_length=180) +BLACK_MODE = black.Mode(line_length=88) # Use this special character in place of the args, so that if the args are inlined # in the viz, they will replace it From c13a54f9c90c6c5e8ac88c0f9bb58b319075f3cd Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Tue, 6 Jan 2026 17:59:46 -0800 Subject: [PATCH 09/30] Add reshape --- docs/explanation/polynomials.ipynb | 528 +++++++++++++++++++++++++++++ polynomials_sympy.py | 33 -- python/egglog/exp/array_api.py | 122 ++++++- python/egglog/exp/polynomials.py | 13 + 4 files changed, 662 insertions(+), 34 deletions(-) create mode 100644 docs/explanation/polynomials.ipynb delete mode 100644 polynomials_sympy.py diff --git a/docs/explanation/polynomials.ipynb b/docs/explanation/polynomials.ipynb new file mode 100644 index 00000000..068e2d1e --- /dev/null +++ b/docs/explanation/polynomials.ipynb @@ -0,0 +1,528 @@ +{ + "cells": [ + { + "cell_type": "code", + "execution_count": 1, + "id": "bea1a7f2", + "metadata": {}, + "outputs": [ + { + "data": { + "text/latex": [ + "$\\displaystyle \\frac{\\left(\\left(\\left(bp_{1} q_{1} + bp_{2} q_{4} + bp_{3} q_{7} + bp_{4} q_{10}\\right) \\left(bpp_{1} q_{2} + bpp_{2} q_{5} + bpp_{3} q_{8} + bpp_{4} q_{11}\\right) - \\left(bp_{1} q_{2} + bp_{2} q_{5} + bp_{3} q_{8} + bp_{4} q_{11}\\right) \\left(bpp_{1} q_{1} + bpp_{2} q_{4} + bpp_{3} q_{7} + bpp_{4} q_{10}\\right)\\right)^{2} + \\left(- \\left(bp_{1} q_{1} + bp_{2} q_{4} + bp_{3} q_{7} + bp_{4} q_{10}\\right) \\left(bpp_{1} q_{3} + bpp_{2} q_{6} + bpp_{3} q_{9} + bpp_{4} q_{12}\\right) + \\left(bp_{1} q_{3} + bp_{2} q_{6} + bp_{3} q_{9} + bp_{4} q_{12}\\right) \\left(bpp_{1} q_{1} + bpp_{2} q_{4} + bpp_{3} q_{7} + bpp_{4} q_{10}\\right)\\right)^{2} + \\left(\\left(bp_{1} q_{2} + bp_{2} q_{5} + bp_{3} q_{8} + bp_{4} q_{11}\\right) \\left(bpp_{1} q_{3} + bpp_{2} q_{6} + bpp_{3} q_{9} + bpp_{4} q_{12}\\right) - \\left(bp_{1} q_{3} + bp_{2} q_{6} + bp_{3} q_{9} + bp_{4} q_{12}\\right) \\left(bpp_{1} q_{2} + bpp_{2} q_{5} + bpp_{3} q_{8} + bpp_{4} q_{11}\\right)\\right)^{2}\\right)^{1.0}}{\\left(\\left(bp_{1} q_{1} + bp_{2} q_{4} + bp_{3} q_{7} + bp_{4} q_{10}\\right)^{2} + \\left(bp_{1} q_{2} + bp_{2} q_{5} + bp_{3} q_{8} + bp_{4} q_{11}\\right)^{2} + \\left(bp_{1} q_{3} + bp_{2} q_{6} + bp_{3} q_{9} + bp_{4} q_{12}\\right)^{2}\\right)^{3.0}}$" + ], + "text/plain": [ + "(((bp1*q1 + bp2*q4 + bp3*q7 + bp4*q10)*(bpp1*q2 + bpp2*q5 + bpp3*q8 + bpp4*q11) - (bp1*q2 + bp2*q5 + bp3*q8 + bp4*q11)*(bpp1*q1 + bpp2*q4 + bpp3*q7 + bpp4*q10))**2 + (-(bp1*q1 + bp2*q4 + bp3*q7 + bp4*q10)*(bpp1*q3 + bpp2*q6 + bpp3*q9 + bpp4*q12) + (bp1*q3 + bp2*q6 + bp3*q9 + bp4*q12)*(bpp1*q1 + bpp2*q4 + bpp3*q7 + bpp4*q10))**2 + ((bp1*q2 + bp2*q5 + bp3*q8 + bp4*q11)*(bpp1*q3 + bpp2*q6 + bpp3*q9 + bpp4*q12) - (bp1*q3 + bp2*q6 + bp3*q9 + bp4*q12)*(bpp1*q2 + bpp2*q5 + bpp3*q8 + bpp4*q11))**2)**1.0/((bp1*q1 + bp2*q4 + bp3*q7 + bp4*q10)**2 + (bp1*q2 + bp2*q5 + bp3*q8 + bp4*q11)**2 + (bp1*q3 + bp2*q6 + bp3*q9 + bp4*q12)**2)**3.0" + ] + }, + "execution_count": 1, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "from sympy import Array, Symbol, tensorcontraction, tensorproduct\n", + "\n", + "\n", + "def bending_function_sympy(Q, Bp, Bpp):\n", + " QM = Q.reshape(4, 3).transpose()\n", + "\n", + " # Projections (3-vector each)\n", + "\n", + " yip = tensorcontraction(tensorproduct(QM, Bp), (1, 2))\n", + " yipp = tensorcontraction(tensorproduct(QM, Bpp), (1, 2))\n", + "\n", + " def cross(a: Array, b: Array):\n", + " \"\"\"\n", + " 3d cross product\n", + " https://reference.wolfram.com/language/ref/Cross.html\n", + " \"\"\"\n", + " return Array([\n", + " a[1] * b[2] - a[2] * b[1],\n", + " a[2] * b[0] - a[0] * b[2],\n", + " a[0] * b[1] - a[1] * b[0],\n", + " ])\n", + "\n", + " def norm3(arr: Array):\n", + " x, y, z = arr[0], arr[1], arr[2]\n", + " return (x**2 + y**2 + z**2) ** (0.5)\n", + "\n", + " return (norm3(cross(yip, yipp)) / (norm3(yip) ** 3)) ** 2\n", + "\n", + "\n", + "bending_function_sympy(\n", + " Array([Symbol(f\"q{i}\") for i in range(1, 13)]),\n", + " Array([Symbol(f\"bp{i}\") for i in range(1, 5)]),\n", + " Array([Symbol(f\"bpp{i}\") for i in range(1, 5)]),\n", + ")" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "fdd3917b", + "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "(5.68091761739469e-5, np.float64(5.680917617394691e-05))" + ] + }, + "execution_count": 2, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "import numpy as np\n", + "\n", + "# create random array inputs\n", + "ng = np.random.default_rng()\n", + "q_np = ng.random(12).astype(float)\n", + "bp_np = ng.random(4).astype(float)\n", + "bpp_np = ng.random(4).astype(float)\n", + "\n", + "\n", + "def bending_function(Q, Bp, Bpp):\n", + " xp = Q.__array_namespace__()\n", + " QM = xp.reshape(Q, (4, 3)).T\n", + "\n", + " yip = xp.tensordot(QM, Bp, axes=([1], [0]))\n", + " yipp = xp.tensordot(QM, Bpp, axes=([1], [0]))\n", + "\n", + " num = xp.linalg.vector_norm(xp.linalg.cross(yip, yipp))\n", + " den = xp.linalg.vector_norm(yip) ** 3\n", + " return (num / den) ** 2\n", + "\n", + "\n", + "bending_function(q_np, bp_np, bpp_np)\n", + "\n", + "# Try sympy on random inputs to make sure they agree\n", + "(\n", + " bending_function_sympy(\n", + " Array(q_np.tolist()),\n", + " Array(bp_np.tolist()),\n", + " Array(bpp_np.tolist()),\n", + " ),\n", + " bending_function(q_np, bp_np, bpp_np),\n", + ")" + ] + }, + { + "cell_type": "code", + "execution_count": 3, + "id": "76a0eb98", + "metadata": {}, + "outputs": [ + { + "data": { + "text/html": [ + "
_NDArray_1 = reshape(\n",
+       "    NDArray.vector(\n",
+       "        TupleValue.from_vec(\n",
+       "            Vec[Value](q1, q2, q3, q4, q5, q6, q7, q8, q9, q10, q11, q12)\n",
+       "        )\n",
+       "    ),\n",
+       "    TupleInt.from_vec(Vec[Int](Int(4), Int(3))),\n",
+       ").T\n",
+       "_IntOrPairTupleInts_1 = IntOrPairTupleInts.pair(\n",
+       "    TupleInt.from_vec(Vec[Int](Int(1))), TupleInt.from_vec(Vec[Int](Int(0)))\n",
+       ")\n",
+       "_NDArray_2 = tensordot(\n",
+       "    _NDArray_1,\n",
+       "    NDArray.vector(TupleValue.from_vec(Vec[Value](bp1, bp2, bp3, bp4))),\n",
+       "    _IntOrPairTupleInts_1,\n",
+       ")\n",
+       "(\n",
+       "    vector_norm(\n",
+       "        cross(\n",
+       "            _NDArray_2,\n",
+       "            tensordot(\n",
+       "                _NDArray_1,\n",
+       "                NDArray.vector(TupleValue.from_vec(Vec[Value](bpp1, bpp2, bpp3, bpp4))),\n",
+       "                _IntOrPairTupleInts_1,\n",
+       "            ),\n",
+       "        )\n",
+       "    )\n",
+       "    / (vector_norm(_NDArray_2) ** NDArray.scalar(Value.int(Int(3))))\n",
+       ") ** NDArray.scalar(Value.int(Int(2)))\n",
+       "
\n" + ], + "text/latex": [ + "\\begin{Verbatim}[commandchars=\\\\\\{\\}]\n", + "\\PY{n}{\\PYZus{}NDArray\\PYZus{}1} \\PY{o}{=} \\PY{n}{reshape}\\PY{p}{(}\n", + " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\n", + " \\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\n", + " \\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Value}\\PY{p}{]}\\PY{p}{(}\\PY{n}{q1}\\PY{p}{,} \\PY{n}{q2}\\PY{p}{,} \\PY{n}{q3}\\PY{p}{,} \\PY{n}{q4}\\PY{p}{,} \\PY{n}{q5}\\PY{p}{,} \\PY{n}{q6}\\PY{p}{,} \\PY{n}{q7}\\PY{p}{,} \\PY{n}{q8}\\PY{p}{,} \\PY{n}{q9}\\PY{p}{,} \\PY{n}{q10}\\PY{p}{,} \\PY{n}{q11}\\PY{p}{,} \\PY{n}{q12}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Int}\\PY{p}{]}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{4}\\PY{p}{)}\\PY{p}{,} \\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + "\\PY{p}{)}\\PY{o}{.}\\PY{n}{T}\n", + "\\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1} \\PY{o}{=} \\PY{n}{IntOrPairTupleInts}\\PY{o}{.}\\PY{n}{pair}\\PY{p}{(}\n", + " \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Int}\\PY{p}{]}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{1}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,} \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Int}\\PY{p}{]}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{0}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", + "\\PY{p}{)}\n", + "\\PY{n}{\\PYZus{}NDArray\\PYZus{}2} \\PY{o}{=} \\PY{n}{tensordot}\\PY{p}{(}\n", + " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,}\n", + " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Value}\\PY{p}{]}\\PY{p}{(}\\PY{n}{bp1}\\PY{p}{,} \\PY{n}{bp2}\\PY{p}{,} \\PY{n}{bp3}\\PY{p}{,} \\PY{n}{bp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1}\\PY{p}{,}\n", + "\\PY{p}{)}\n", + "\\PY{p}{(}\n", + " \\PY{n}{vector\\PYZus{}norm}\\PY{p}{(}\n", + " \\PY{n}{cross}\\PY{p}{(}\n", + " \\PY{n}{\\PYZus{}NDArray\\PYZus{}2}\\PY{p}{,}\n", + " \\PY{n}{tensordot}\\PY{p}{(}\n", + " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,}\n", + " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Value}\\PY{p}{]}\\PY{p}{(}\\PY{n}{bpp1}\\PY{p}{,} \\PY{n}{bpp2}\\PY{p}{,} \\PY{n}{bpp3}\\PY{p}{,} \\PY{n}{bpp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1}\\PY{p}{,}\n", + " \\PY{p}{)}\\PY{p}{,}\n", + " \\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{/} \\PY{p}{(}\\PY{n}{vector\\PYZus{}norm}\\PY{p}{(}\\PY{n}{\\PYZus{}NDArray\\PYZus{}2}\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{scalar}\\PY{p}{(}\\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", + "\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{scalar}\\PY{p}{(}\\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", + "\\end{Verbatim}\n" + ], + "text/plain": [ + "_NDArray_1 = reshape(\n", + " NDArray.vector(\n", + " TupleValue.from_vec(\n", + " Vec[Value](q1, q2, q3, q4, q5, q6, q7, q8, q9, q10, q11, q12)\n", + " )\n", + " ),\n", + " TupleInt.from_vec(Vec[Int](Int(4), Int(3))),\n", + ").T\n", + "_IntOrPairTupleInts_1 = IntOrPairTupleInts.pair(\n", + " TupleInt.from_vec(Vec[Int](Int(1))), TupleInt.from_vec(Vec[Int](Int(0)))\n", + ")\n", + "_NDArray_2 = tensordot(\n", + " _NDArray_1,\n", + " NDArray.vector(TupleValue.from_vec(Vec[Value](bp1, bp2, bp3, bp4))),\n", + " _IntOrPairTupleInts_1,\n", + ")\n", + "(\n", + " vector_norm(\n", + " cross(\n", + " _NDArray_2,\n", + " tensordot(\n", + " _NDArray_1,\n", + " NDArray.vector(TupleValue.from_vec(Vec[Value](bpp1, bpp2, bpp3, bpp4))),\n", + " _IntOrPairTupleInts_1,\n", + " ),\n", + " )\n", + " )\n", + " / (vector_norm(_NDArray_2) ** NDArray.scalar(Value.int(Int(3))))\n", + ") ** NDArray.scalar(Value.int(Int(2)))" + ] + }, + "metadata": {}, + "output_type": "display_data" + } + ], + "source": [ + "import egglog\n", + "import egglog.exp.array_api as enp\n", + "\n", + "Bp = enp.NDArray.vector([egglog.constant(f\"bp{i}\", enp.Value) for i in range(1, 5)])\n", + "Bpp = enp.NDArray.vector([egglog.constant(f\"bpp{i}\", enp.Value) for i in range(1, 5)])\n", + "Q = enp.NDArray.vector([egglog.constant(f\"q{i}\", enp.Value) for i in range(1, 13)])\n", + "res = bending_function(Q, Bp, Bpp)\n", + "res" + ] + }, + { + "cell_type": "code", + "execution_count": 4, + "id": "6fad95ab", + "metadata": {}, + "outputs": [ + { + "name": "stderr", + "output_type": "stream", + "text": [ + "In 1:1-70: (let __expr_-333516976945593818 (egglog_exp_array_api_Int___init__ 3))\n", + "Global `__expr_-333516976945593818` should start with `$`. Enable `--strict-mode` to turn this warning into an error. Suppressing additional warnings of this type.\n" + ] + }, + { + "data": { + "text/html": [ + "
_NDArray_1 = reshape(\n",
+       "    NDArray.vector(\n",
+       "        TupleValue.from_vec(Vec(q1, q2, q3, q4, q5, q6, q7, q8, q9, q10, q11, q12))\n",
+       "    ),\n",
+       "    TupleInt.from_vec(Vec(Int(4), Int(3))),\n",
+       ").T\n",
+       "_IntOrPairTupleInts_1 = IntOrPairTupleInts.pair(\n",
+       "    TupleInt.from_vec(Vec(Int(1))), TupleInt.from_vec(Vec(Int(0)))\n",
+       ")\n",
+       "_NDArray_2 = tensordot(\n",
+       "    _NDArray_1,\n",
+       "    NDArray.vector(TupleValue.from_vec(Vec(bp1, bp2, bp3, bp4))),\n",
+       "    _IntOrPairTupleInts_1,\n",
+       ")\n",
+       "(\n",
+       "    vector_norm(\n",
+       "        cross(\n",
+       "            _NDArray_2,\n",
+       "            tensordot(\n",
+       "                _NDArray_1,\n",
+       "                NDArray.vector(TupleValue.from_vec(Vec(bpp1, bpp2, bpp3, bpp4))),\n",
+       "                _IntOrPairTupleInts_1,\n",
+       "            ),\n",
+       "        )\n",
+       "    )\n",
+       "    / (vector_norm(_NDArray_2) ** NDArray.scalar(Value.int(Int(3))))\n",
+       ") ** NDArray.scalar(Value.int(Int(2)))\n",
+       "
\n" + ], + "text/latex": [ + "\\begin{Verbatim}[commandchars=\\\\\\{\\}]\n", + "\\PY{n}{\\PYZus{}NDArray\\PYZus{}1} \\PY{o}{=} \\PY{n}{reshape}\\PY{p}{(}\n", + " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\n", + " \\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{q1}\\PY{p}{,} \\PY{n}{q2}\\PY{p}{,} \\PY{n}{q3}\\PY{p}{,} \\PY{n}{q4}\\PY{p}{,} \\PY{n}{q5}\\PY{p}{,} \\PY{n}{q6}\\PY{p}{,} \\PY{n}{q7}\\PY{p}{,} \\PY{n}{q8}\\PY{p}{,} \\PY{n}{q9}\\PY{p}{,} \\PY{n}{q10}\\PY{p}{,} \\PY{n}{q11}\\PY{p}{,} \\PY{n}{q12}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{4}\\PY{p}{)}\\PY{p}{,} \\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + "\\PY{p}{)}\\PY{o}{.}\\PY{n}{T}\n", + "\\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1} \\PY{o}{=} \\PY{n}{IntOrPairTupleInts}\\PY{o}{.}\\PY{n}{pair}\\PY{p}{(}\n", + " \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{1}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,} \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{0}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", + "\\PY{p}{)}\n", + "\\PY{n}{\\PYZus{}NDArray\\PYZus{}2} \\PY{o}{=} \\PY{n}{tensordot}\\PY{p}{(}\n", + " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,}\n", + " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{bp1}\\PY{p}{,} \\PY{n}{bp2}\\PY{p}{,} \\PY{n}{bp3}\\PY{p}{,} \\PY{n}{bp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1}\\PY{p}{,}\n", + "\\PY{p}{)}\n", + "\\PY{p}{(}\n", + " \\PY{n}{vector\\PYZus{}norm}\\PY{p}{(}\n", + " \\PY{n}{cross}\\PY{p}{(}\n", + " \\PY{n}{\\PYZus{}NDArray\\PYZus{}2}\\PY{p}{,}\n", + " \\PY{n}{tensordot}\\PY{p}{(}\n", + " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,}\n", + " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{bpp1}\\PY{p}{,} \\PY{n}{bpp2}\\PY{p}{,} \\PY{n}{bpp3}\\PY{p}{,} \\PY{n}{bpp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1}\\PY{p}{,}\n", + " \\PY{p}{)}\\PY{p}{,}\n", + " \\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{/} \\PY{p}{(}\\PY{n}{vector\\PYZus{}norm}\\PY{p}{(}\\PY{n}{\\PYZus{}NDArray\\PYZus{}2}\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{scalar}\\PY{p}{(}\\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", + "\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{scalar}\\PY{p}{(}\\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", + "\\end{Verbatim}\n" + ], + "text/plain": [ + "_NDArray_1 = reshape(\n", + " NDArray.vector(\n", + " TupleValue.from_vec(Vec(q1, q2, q3, q4, q5, q6, q7, q8, q9, q10, q11, q12))\n", + " ),\n", + " TupleInt.from_vec(Vec(Int(4), Int(3))),\n", + ").T\n", + "_IntOrPairTupleInts_1 = IntOrPairTupleInts.pair(\n", + " TupleInt.from_vec(Vec(Int(1))), TupleInt.from_vec(Vec(Int(0)))\n", + ")\n", + "_NDArray_2 = tensordot(\n", + " _NDArray_1,\n", + " NDArray.vector(TupleValue.from_vec(Vec(bp1, bp2, bp3, bp4))),\n", + " _IntOrPairTupleInts_1,\n", + ")\n", + "(\n", + " vector_norm(\n", + " cross(\n", + " _NDArray_2,\n", + " tensordot(\n", + " _NDArray_1,\n", + " NDArray.vector(TupleValue.from_vec(Vec(bpp1, bpp2, bpp3, bpp4))),\n", + " _IntOrPairTupleInts_1,\n", + " ),\n", + " )\n", + " )\n", + " / (vector_norm(_NDArray_2) ** NDArray.scalar(Value.int(Int(3))))\n", + ") ** NDArray.scalar(Value.int(Int(2)))" + ] + }, + "metadata": {}, + "output_type": "display_data" + } + ], + "source": [ + "egraph = egglog.EGraph()\n", + "egraph.register(res)\n", + "egraph.run(enp.array_api_ruleset)\n", + "egraph.extract(res)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d2707b6f", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "egglog (3.13.11)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.13.11" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/polynomials_sympy.py b/polynomials_sympy.py deleted file mode 100644 index afdeac7e..00000000 --- a/polynomials_sympy.py +++ /dev/null @@ -1,33 +0,0 @@ -from sympy import Array, Symbol, tensorcontraction, tensorproduct - -# Parameters -Bp = Array([Symbol(f"bp{i}") for i in range(1, 5)]) -Bpp = Array([Symbol(f"bpp{i}") for i in range(1, 5)]) - -Q = Array([Symbol(f"q{i}") for i in range(1, 13)]) -QM = Q.reshape(4, 3).transpose() - -# Projections (3-vector each) -yip = tensorcontraction(tensorproduct(QM, Bp), (1, 2)) -yipp = tensorcontraction(tensorproduct(QM, Bpp), (1, 2)) - - -def cross(a: Array, b: Array): - """ - 3d cross product - https://reference.wolfram.com/language/ref/Cross.html - """ - return Array([ - a[1] * b[2] - a[2] * b[1], - a[2] * b[0] - a[0] * b[2], - a[0] * b[1] - a[1] * b[0], - ]) - - -def norm3(arr: Array): - x, y, z = arr[0], arr[1], arr[2] - return (x**2 + y**2 + z**2) ** (0.5) - - -FunctionBending = (norm3(cross(yip, yipp)) / (norm3(yip) ** 3)) ** 2 -print(FunctionBending) diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index b69d8212..2bbe59ec 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -520,6 +520,15 @@ def deselect(self, indices: TupleIntLike) -> TupleInt: indices = cast("TupleInt", indices) return TupleInt.range(self.length()).filter(lambda i: ~indices.contains(i)).map(lambda i: self[i]) + def reverse(self) -> TupleInt: + return TupleInt(self.length(), lambda i: self[self.length() - i - 1]) + + def last(self) -> Int: + return self[self.length() - 1] + + def drop_last(self) -> TupleInt: + return TupleInt(self.length() - 1, self.__getitem__) + converter(Vec[Int], TupleInt, lambda x: TupleInt.from_vec(x)) @@ -1282,6 +1291,8 @@ def _ndarray( # if_ rewrite(NDArray.if_(TRUE, x, x1)).to(x), rewrite(NDArray.if_(FALSE, x, x1)).to(x1), + # convert to scalar + rewrite(NDArray(TupleInt.EMPTY, dtype, idx_fn)).to(NDArray.scalar(idx_fn(TupleInt.EMPTY))), ] @@ -1646,6 +1657,49 @@ def real(x: NDArray) -> NDArray: ... def conj(x: NDArray) -> NDArray: ... +class IntOrPairTupleInts(Expr): + """ + Either an integer or a pair of tuple of integers. + + Used for the TensorDot axes argument. + """ + + @classmethod + def int(cls, value: IntLike) -> IntOrPairTupleInts: ... + + @classmethod + def pair(cls, left: TupleIntLike, right: TupleIntLike) -> IntOrPairTupleInts: ... + + +converter(Int, IntOrPairTupleInts, IntOrPairTupleInts.int) +converter( + tuple, IntOrPairTupleInts, lambda x: IntOrPairTupleInts.pair(convert(x[0], TupleInt), convert(x[1], TupleInt)) +) + + +@function +def tensordot(x1: NDArrayLike, x2: NDArrayLike, axes: IntOrPairTupleInts) -> NDArray: + """ + https://data-apis.org/array-api/2022.12/API_specification/generated/array_api.tensordot.html + """ + + +@function +def vector_norm(x: NDArrayLike) -> NDArray: + """ + https://data-apis.org/array-api/2022.12/extensions/generated/array_api.linalg.vector_norm.html + TODO: support axis + """ + + +@function +def cross(a: NDArrayLike, b: NDArrayLike) -> NDArray: + """ + https://data-apis.org/array-api/2022.12/extensions/generated/array_api.linalg.cross.html + TODO: support axis + """ + + linalg = sys.modules[__name__] @@ -1976,7 +2030,73 @@ def array_api_vec_to_cons_ruleset( ) -array_api_combined_ruleset = array_api_ruleset | array_api_vec_to_cons_ruleset +@function(ruleset=array_api_ruleset) +def ravel_index(index: TupleIntLike, shape: TupleIntLike) -> Int: + """ + Convert a multi-dimensional index to a flat index. + + https://numpy.org/doc/stable/reference/generated/numpy.ravel_multi_index.html#numpy.ravel_multi_index + + >>> int(ravel_index((3, 4), (7, 6))) + 22 + >>> int(ravel_index((6, 5), (7, 6))) + 41 + >>> int(ravel_index((6, 1), (7, 6))) + 37 + >>> int(ravel_index((3, 1, 4, 1), (6, 7, 8, 9))) + 1621 + """ + index = cast("TupleInt", index) + shape = cast("TupleInt", shape) + + return TupleInt.range(shape.length()).foldl(lambda res, i: res * shape[i] + index[i], Int(0)) + + +@function(ruleset=array_api_ruleset) +def unravel_index(flat_index: IntLike, shape: TupleIntLike) -> TupleInt: + """ + Convert a flat index to a multi-dimensional index. + + https://numpy.org/doc/stable/reference/generated/numpy.unravel_index.html + + >>> tuple(map(int, unravel_index(22, (7, 6)))) + (3, 4) + >>> tuple(map(int, unravel_index(41, (7, 6)))) + (6, 5) + >>> tuple(map(int, unravel_index(37, (7, 6)))) + (6, 1) + >>> tuple(map(int, unravel_index(1621, (6, 7, 8, 9)))) + (3, 1, 4, 1) + """ + shape = cast("TupleInt", shape) + + return ( + shape.reverse() + .foldl_tuple_int( + # Store remainder as last item in accumulator + lambda acc, dim: acc.drop_last().append((r := acc.last()) % dim).append(r // dim), + TupleInt.EMPTY.append(flat_index), + ) + .drop_last() + .reverse() + ) + + +@ruleset +def array_api_functional_ruleset( + old_shape: TupleInt, + shape: TupleInt, + ob: OptionalBool, + dtype: DType, + idx_fn: Callable[[TupleInt], Value], +): + # TODO: Support -1 in shape like numpy does + yield rewrite(reshape(NDArray(old_shape, dtype, idx_fn), shape, ob)).to( + NDArray(shape, dtype, lambda idx: idx_fn(unravel_index(ravel_index(idx, shape), old_shape))) + ) + + +array_api_combined_ruleset = array_api_ruleset | array_api_vec_to_cons_ruleset | array_api_functional_ruleset array_api_schedule = array_api_combined_ruleset.saturate() _CURRENT_EGRAPH: None | EGraph = None diff --git a/python/egglog/exp/polynomials.py b/python/egglog/exp/polynomials.py index ebc2429c..2f596b55 100644 --- a/python/egglog/exp/polynomials.py +++ b/python/egglog/exp/polynomials.py @@ -1,3 +1,11 @@ +# # Optimizing Polynomials +# +# This post explore a few different ways of optimizing polynomials in Egglog. This is mean to see if we can +# represent addition and multiplication through built in multiset data structures in egglog if this can help +# avoid some of the issues with associtativity/commutativity blowup. + +# + +# First we can define a generic number type # mypy: disable-error-code="empty-body" from __future__ import annotations @@ -22,6 +30,9 @@ def __pow__(self, power: NumberLike) -> Number: ... def __neg__(self) -> Number: ... +# Then we can define a large polynomial, based on output from a paper on simulating cloths +# - + NumberLike: TypeAlias = Number | i64Like converter(i64, Number, Number) @@ -134,6 +145,8 @@ def __neg__(self) -> Number: ... + (bp4 * q12 + bp1 * q3 + bp2 * q6 + bp3 * q9) ** 2 ) ** 3 +# - + print("saving initial expression to initial.py") INITIAL_STR = "from egglog.exp.polynomials import *\n\n" Path("tmp/initial.py").write_text(INITIAL_STR + str(res)) From 8795aabe2121f5b3a4c133cb5c2421912ada1310 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Tue, 13 Jan 2026 16:13:53 -0800 Subject: [PATCH 10/30] tmp --- docs/explanation/polynomials.ipynb | 160 +++++++++-------- python/egglog/exp/array_api.py | 278 ++++++++++++++++++++++++----- python/egglog/exp/array_api_jit.py | 6 +- python/tests/test_array_api.py | 3 +- 4 files changed, 328 insertions(+), 119 deletions(-) diff --git a/docs/explanation/polynomials.ipynb b/docs/explanation/polynomials.ipynb index 068e2d1e..3908a285 100644 --- a/docs/explanation/polynomials.ipynb +++ b/docs/explanation/polynomials.ipynb @@ -59,37 +59,44 @@ }, { "cell_type": "code", - "execution_count": null, + "execution_count": 2, + "id": "7071fa5d", + "metadata": {}, + "outputs": [], + "source": [ + "import numpy as np\n", + "\n", + "# create random array inputs\n", + "ng = np.random.default_rng()\n", + "q_np = ng.random(12).astype(float)\n", + "bp_np = ng.random(4).astype(float)\n", + "bpp_np = ng.random(4).astype(float)" + ] + }, + { + "cell_type": "code", + "execution_count": 3, "id": "fdd3917b", "metadata": {}, "outputs": [ { "data": { "text/plain": [ - "(5.68091761739469e-5, np.float64(5.680917617394691e-05))" + "(0.00171842130320933, np.float64(0.0017184213032093308))" ] }, - "execution_count": 2, + "execution_count": 3, "metadata": {}, "output_type": "execute_result" } ], "source": [ - "import numpy as np\n", - "\n", - "# create random array inputs\n", - "ng = np.random.default_rng()\n", - "q_np = ng.random(12).astype(float)\n", - "bp_np = ng.random(4).astype(float)\n", - "bpp_np = ng.random(4).astype(float)\n", - "\n", - "\n", "def bending_function(Q, Bp, Bpp):\n", " xp = Q.__array_namespace__()\n", " QM = xp.reshape(Q, (4, 3)).T\n", "\n", - " yip = xp.tensordot(QM, Bp, axes=([1], [0]))\n", - " yipp = xp.tensordot(QM, Bpp, axes=([1], [0]))\n", + " yip = xp.vecdot(QM, Bp)\n", + " yipp = xp.vecdot(QM, Bpp)\n", "\n", " num = xp.linalg.vector_norm(xp.linalg.cross(yip, yipp))\n", " den = xp.linalg.vector_norm(yip) ** 3\n", @@ -111,7 +118,7 @@ }, { "cell_type": "code", - "execution_count": 3, + "execution_count": 4, "id": "76a0eb98", "metadata": {}, "outputs": [ @@ -200,22 +207,16 @@ " ),\n", " TupleInt.from_vec(Vec[Int](Int(4), Int(3))),\n", ").T\n", - "_IntOrPairTupleInts_1 = IntOrPairTupleInts.pair(\n", - " TupleInt.from_vec(Vec[Int](Int(1))), TupleInt.from_vec(Vec[Int](Int(0)))\n", - ")\n", - "_NDArray_2 = tensordot(\n", - " _NDArray_1,\n", - " NDArray.vector(TupleValue.from_vec(Vec[Value](bp1, bp2, bp3, bp4))),\n", - " _IntOrPairTupleInts_1,\n", + "_NDArray_2 = vecdot(\n", + " _NDArray_1, NDArray.vector(TupleValue.from_vec(Vec[Value](bp1, bp2, bp3, bp4)))\n", ")\n", "(\n", " vector_norm(\n", " cross(\n", " _NDArray_2,\n", - " tensordot(\n", + " vecdot(\n", " _NDArray_1,\n", " NDArray.vector(TupleValue.from_vec(Vec[Value](bpp1, bpp2, bpp3, bpp4))),\n", - " _IntOrPairTupleInts_1,\n", " ),\n", " )\n", " )\n", @@ -233,22 +234,16 @@ " \\PY{p}{)}\\PY{p}{,}\n", " \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Int}\\PY{p}{]}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{4}\\PY{p}{)}\\PY{p}{,} \\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", "\\PY{p}{)}\\PY{o}{.}\\PY{n}{T}\n", - "\\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1} \\PY{o}{=} \\PY{n}{IntOrPairTupleInts}\\PY{o}{.}\\PY{n}{pair}\\PY{p}{(}\n", - " \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Int}\\PY{p}{]}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{1}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,} \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Int}\\PY{p}{]}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{0}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", - "\\PY{p}{)}\n", - "\\PY{n}{\\PYZus{}NDArray\\PYZus{}2} \\PY{o}{=} \\PY{n}{tensordot}\\PY{p}{(}\n", - " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,}\n", - " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Value}\\PY{p}{]}\\PY{p}{(}\\PY{n}{bp1}\\PY{p}{,} \\PY{n}{bp2}\\PY{p}{,} \\PY{n}{bp3}\\PY{p}{,} \\PY{n}{bp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", - " \\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1}\\PY{p}{,}\n", + "\\PY{n}{\\PYZus{}NDArray\\PYZus{}2} \\PY{o}{=} \\PY{n}{vecdot}\\PY{p}{(}\n", + " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Value}\\PY{p}{]}\\PY{p}{(}\\PY{n}{bp1}\\PY{p}{,} \\PY{n}{bp2}\\PY{p}{,} \\PY{n}{bp3}\\PY{p}{,} \\PY{n}{bp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", "\\PY{p}{)}\n", "\\PY{p}{(}\n", " \\PY{n}{vector\\PYZus{}norm}\\PY{p}{(}\n", " \\PY{n}{cross}\\PY{p}{(}\n", " \\PY{n}{\\PYZus{}NDArray\\PYZus{}2}\\PY{p}{,}\n", - " \\PY{n}{tensordot}\\PY{p}{(}\n", + " \\PY{n}{vecdot}\\PY{p}{(}\n", " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,}\n", " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{[}\\PY{n}{Value}\\PY{p}{]}\\PY{p}{(}\\PY{n}{bpp1}\\PY{p}{,} \\PY{n}{bpp2}\\PY{p}{,} \\PY{n}{bpp3}\\PY{p}{,} \\PY{n}{bpp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", - " \\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1}\\PY{p}{,}\n", " \\PY{p}{)}\\PY{p}{,}\n", " \\PY{p}{)}\n", " \\PY{p}{)}\n", @@ -265,22 +260,16 @@ " ),\n", " TupleInt.from_vec(Vec[Int](Int(4), Int(3))),\n", ").T\n", - "_IntOrPairTupleInts_1 = IntOrPairTupleInts.pair(\n", - " TupleInt.from_vec(Vec[Int](Int(1))), TupleInt.from_vec(Vec[Int](Int(0)))\n", - ")\n", - "_NDArray_2 = tensordot(\n", - " _NDArray_1,\n", - " NDArray.vector(TupleValue.from_vec(Vec[Value](bp1, bp2, bp3, bp4))),\n", - " _IntOrPairTupleInts_1,\n", + "_NDArray_2 = vecdot(\n", + " _NDArray_1, NDArray.vector(TupleValue.from_vec(Vec[Value](bp1, bp2, bp3, bp4)))\n", ")\n", "(\n", " vector_norm(\n", " cross(\n", " _NDArray_2,\n", - " tensordot(\n", + " vecdot(\n", " _NDArray_1,\n", " NDArray.vector(TupleValue.from_vec(Vec[Value](bpp1, bpp2, bpp3, bpp4))),\n", - " _IntOrPairTupleInts_1,\n", " ),\n", " )\n", " )\n", @@ -305,7 +294,7 @@ }, { "cell_type": "code", - "execution_count": 4, + "execution_count": 5, "id": "6fad95ab", "metadata": {}, "outputs": [ @@ -313,8 +302,8 @@ "name": "stderr", "output_type": "stream", "text": [ - "In 1:1-70: (let __expr_-333516976945593818 (egglog_exp_array_api_Int___init__ 3))\n", - "Global `__expr_-333516976945593818` should start with `$`. Enable `--strict-mode` to turn this warning into an error. Suppressing additional warnings of this type.\n" + "In 1:1-69: (let __expr_518171328674535131 (egglog_exp_array_api_Int___init__ 3))\n", + "Global `__expr_518171328674535131` should start with `$`. Enable `--strict-mode` to turn this warning into an error. Suppressing additional warnings of this type.\n" ] }, { @@ -400,22 +389,16 @@ " ),\n", " TupleInt.from_vec(Vec(Int(4), Int(3))),\n", ").T\n", - "_IntOrPairTupleInts_1 = IntOrPairTupleInts.pair(\n", - " TupleInt.from_vec(Vec(Int(1))), TupleInt.from_vec(Vec(Int(0)))\n", - ")\n", - "_NDArray_2 = tensordot(\n", - " _NDArray_1,\n", - " NDArray.vector(TupleValue.from_vec(Vec(bp1, bp2, bp3, bp4))),\n", - " _IntOrPairTupleInts_1,\n", + "_NDArray_2 = vecdot(\n", + " _NDArray_1, NDArray.vector(TupleValue.from_vec(Vec(bp1, bp2, bp3, bp4)))\n", ")\n", "(\n", " vector_norm(\n", " cross(\n", " _NDArray_2,\n", - " tensordot(\n", + " vecdot(\n", " _NDArray_1,\n", " NDArray.vector(TupleValue.from_vec(Vec(bpp1, bpp2, bpp3, bpp4))),\n", - " _IntOrPairTupleInts_1,\n", " ),\n", " )\n", " )\n", @@ -431,22 +414,16 @@ " \\PY{p}{)}\\PY{p}{,}\n", " \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{4}\\PY{p}{)}\\PY{p}{,} \\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", "\\PY{p}{)}\\PY{o}{.}\\PY{n}{T}\n", - "\\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1} \\PY{o}{=} \\PY{n}{IntOrPairTupleInts}\\PY{o}{.}\\PY{n}{pair}\\PY{p}{(}\n", - " \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{1}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,} \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{0}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", - "\\PY{p}{)}\n", - "\\PY{n}{\\PYZus{}NDArray\\PYZus{}2} \\PY{o}{=} \\PY{n}{tensordot}\\PY{p}{(}\n", - " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,}\n", - " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{bp1}\\PY{p}{,} \\PY{n}{bp2}\\PY{p}{,} \\PY{n}{bp3}\\PY{p}{,} \\PY{n}{bp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", - " \\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1}\\PY{p}{,}\n", + "\\PY{n}{\\PYZus{}NDArray\\PYZus{}2} \\PY{o}{=} \\PY{n}{vecdot}\\PY{p}{(}\n", + " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{bp1}\\PY{p}{,} \\PY{n}{bp2}\\PY{p}{,} \\PY{n}{bp3}\\PY{p}{,} \\PY{n}{bp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", "\\PY{p}{)}\n", "\\PY{p}{(}\n", " \\PY{n}{vector\\PYZus{}norm}\\PY{p}{(}\n", " \\PY{n}{cross}\\PY{p}{(}\n", " \\PY{n}{\\PYZus{}NDArray\\PYZus{}2}\\PY{p}{,}\n", - " \\PY{n}{tensordot}\\PY{p}{(}\n", + " \\PY{n}{vecdot}\\PY{p}{(}\n", " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,}\n", " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{bpp1}\\PY{p}{,} \\PY{n}{bpp2}\\PY{p}{,} \\PY{n}{bpp3}\\PY{p}{,} \\PY{n}{bpp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", - " \\PY{n}{\\PYZus{}IntOrPairTupleInts\\PYZus{}1}\\PY{p}{,}\n", " \\PY{p}{)}\\PY{p}{,}\n", " \\PY{p}{)}\n", " \\PY{p}{)}\n", @@ -461,22 +438,16 @@ " ),\n", " TupleInt.from_vec(Vec(Int(4), Int(3))),\n", ").T\n", - "_IntOrPairTupleInts_1 = IntOrPairTupleInts.pair(\n", - " TupleInt.from_vec(Vec(Int(1))), TupleInt.from_vec(Vec(Int(0)))\n", - ")\n", - "_NDArray_2 = tensordot(\n", - " _NDArray_1,\n", - " NDArray.vector(TupleValue.from_vec(Vec(bp1, bp2, bp3, bp4))),\n", - " _IntOrPairTupleInts_1,\n", + "_NDArray_2 = vecdot(\n", + " _NDArray_1, NDArray.vector(TupleValue.from_vec(Vec(bp1, bp2, bp3, bp4)))\n", ")\n", "(\n", " vector_norm(\n", " cross(\n", " _NDArray_2,\n", - " tensordot(\n", + " vecdot(\n", " _NDArray_1,\n", " NDArray.vector(TupleValue.from_vec(Vec(bpp1, bpp2, bpp3, bpp4))),\n", - " _IntOrPairTupleInts_1,\n", " ),\n", " )\n", " )\n", @@ -497,9 +468,52 @@ }, { "cell_type": "code", - "execution_count": null, + "execution_count": 6, "id": "d2707b6f", "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "array([Value.int(Int(10)), 2], dtype=object)" + ] + }, + "execution_count": 6, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "np.array([enp.Value.int(10), 2], dtype=None)" + ] + }, + { + "cell_type": "code", + "execution_count": 7, + "id": "e6b4ff0a", + "metadata": {}, + "outputs": [ + { + "data": { + "text/plain": [ + "array(TupleValue.from_vec(Vec[Value](Value.int(Int(1)), Value.int(Int(2)))),\n", + " dtype=object)" + ] + }, + "execution_count": 7, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "np.array(enp.TupleValue.from_vec((1, 2)))" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "52b48740", + "metadata": {}, "outputs": [], "source": [] } diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index 2bbe59ec..4269c0a3 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -345,9 +345,15 @@ def __init__(self, value: f64Like) -> None: ... @property def to_f64(self) -> f64: ... + @property + def to_big_rat(self) -> BigRat: ... + @method(preserve=True) def eval(self) -> float: - return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_f64) + try: + return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_f64) + except EggSmolError: + return float(try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_big_rat)) def abs(self) -> Float: ... @@ -388,6 +394,7 @@ def __ge__(self, other: FloatLike) -> Boolean: ... def _float(fl: Float, f: f64, f2: f64, i: i64, r: BigRat, r1: BigRat, i_: Int): return [ rule(eq(fl).to(Float(f))).then(set_(fl.to_f64).to(f)), + rule(eq(fl).to(Float.rational(r))).then(set_(fl.to_big_rat).to(r)), rewrite(Float.from_int(Int(i))).to(Float(f64.from_i64(i))), rewrite(Float(f).abs()).to(Float(f), f >= 0.0), rewrite(Float(f).abs()).to(Float(-f), f < 0.0), @@ -506,6 +513,9 @@ def product(self) -> Int: def map_tuple_int(self, f: Callable[[Int], TupleInt]) -> TupleTupleInt: return TupleTupleInt(self.length(), lambda i: f(self[i])) + def map_value(self, f: Callable[[Int], Value]) -> TupleValue: + return TupleValue(self.length(), lambda i: f(self[i])) + def select(self, indices: TupleIntLike) -> TupleInt: """ Return a new tuple with the elements at the given indices @@ -803,6 +813,7 @@ def _isdtype(d: DType, k1: IsDtypeKind, k2: IsDtypeKind): class Value(Expr, ruleset=array_api_ruleset): NEVER: ClassVar[Value] + # TODO: Rename to avoid name conflicts @classmethod def int(cls, i: IntLike) -> Value: ... @@ -814,13 +825,16 @@ def bool(cls, b: BooleanLike) -> Value: ... def isfinite(self) -> Boolean: ... - def __lt__(self, other: ValueLike) -> Value: ... + def __lt__(self, other: ValueLike) -> Boolean: ... + def __le__(self, other: ValueLike) -> Boolean: ... + def __gt__(self, other: ValueLike) -> Boolean: ... + def __ge__(self, other: ValueLike) -> Boolean: ... + def __eq__(self, other: ValueLike) -> Boolean: ... # type: ignore[override] def __truediv__(self, other: ValueLike) -> Value: ... - def __mul__(self, other: ValueLike) -> Value: ... - def __add__(self, other: ValueLike) -> Value: ... + def __sub__(self, other: ValueLike) -> Value: ... def astype(self, dtype: DType) -> Value: ... @@ -838,6 +852,9 @@ def to_bool(self) -> Boolean: ... @property def to_int(self) -> Int: ... + @property + def to_float(self) -> Float: ... + @property def to_truthy_value(self) -> Value: """ @@ -853,7 +870,11 @@ def sqrt(self) -> Value: ... @classmethod def if_(cls, b: BooleanLike, i: ValueLike, j: ValueLike) -> Value: ... - def __eq__(self, other: ValueLike) -> Boolean: ... # type: ignore[override] + def __int__(self) -> int: # type: ignore[valid-type] + return self.to_int.eval() + + def __float__(self) -> float: # type: ignore[valid-type] + return self.to_float.eval() ValueLike: TypeAlias = Value | IntLike | FloatLike | BooleanLike @@ -875,6 +896,7 @@ def _value(i: Int, f: Float, b: Boolean, v: Value, v1: Value, i1: Int, f1: Float yield rewrite(Value.bool(b).to_bool).to(b) yield rewrite(Value.int(i).to_int).to(i) + yield rewrite(Value.float(f).to_float).to(f) yield rewrite(Value.bool(b).to_truthy_value).to(Value.bool(b)) # TODO: Add more rules for to_bool_value @@ -895,10 +917,35 @@ def _value(i: Int, f: Float, b: Boolean, v: Value, v1: Value, i1: Int, f1: Float yield rewrite(Value.int(i) == Value.int(i1)).to(i == i1) yield rewrite(Value.float(f) == Value.float(f1)).to(f == f1) yield rewrite(Value.bool(b) == Value.bool(b1)).to(b == b1) + # >= + yield rewrite(Value.int(i) >= Value.int(i1)).to(i >= i1) + yield rewrite(Value.float(f) >= Value.float(f1)).to(f >= f1) + # <= + yield rewrite(Value.int(i) <= Value.int(i1)).to(i <= i1) + yield rewrite(Value.float(f) <= Value.float(f1)).to(f <= f1) + # > + yield rewrite(Value.int(i) > Value.int(i1)).to(i > i1) + yield rewrite(Value.float(f) > Value.float(f1)).to(f > f1) + # < + yield rewrite(Value.int(i) < Value.int(i1)).to(i < i1) + yield rewrite(Value.float(f) < Value.float(f1)).to(f < f1) + + # / + yield rewrite(Value.float(f) / Value.float(f1)).to(Value.float(f / f1)) + # * + yield rewrite(Value.float(f) * Value.float(f1)).to(Value.float(f * f1)) + yield rewrite(Value.int(i) * Value.int(i1)).to(Value.int(i * i1)) + # + + yield rewrite(Value.float(f) + Value.float(f1)).to(Value.float(f + f1)) + yield rewrite(Value.int(i) + Value.int(i1)).to(Value.int(i + i1)) + # - + yield rewrite(Value.float(f) - Value.float(f1)).to(Value.float(f - f1)) + yield rewrite(Value.int(i) - Value.int(i1)).to(Value.int(i - i1)) class TupleValue(Expr, ruleset=array_api_ruleset): EMPTY: ClassVar[TupleValue] + NEVER: ClassVar[TupleValue] def __init__(self, length: IntLike, idx_fn: Callable[[Int], Value]) -> None: ... @@ -916,9 +963,10 @@ def __add__(self, other: TupleValueLike) -> TupleValue: def length(self) -> Int: ... - def __getitem__(self, i: Int) -> Value: ... + def __getitem__(self, i: IntLike) -> Value: ... def foldl_boolean(self, f: Callable[[Boolean, Value], Boolean], init: BooleanLike) -> Boolean: ... + def foldl_value(self, f: Callable[[Value, Value], Value], init: ValueLike) -> Value: ... def contains(self, value: ValueLike) -> Boolean: value = cast("Value", value) @@ -930,6 +978,9 @@ def from_tuple_int(cls, ti: TupleIntLike) -> TupleValue: ti = cast("TupleInt", ti) return TupleValue(ti.length(), lambda i: Value.int(ti[i])) + @classmethod + def if_(cls, b: BooleanLike, i: TupleValueLike, j: TupleValueLike) -> TupleValue: ... + converter(Vec[Value], TupleValue, lambda x: TupleValue.from_vec(x)) converter(TupleInt, TupleValue, lambda x: TupleValue.from_tuple_int(x)) @@ -949,6 +1000,7 @@ def _tuple_value( tv: TupleValue, tv1: TupleValue, bool_f: Callable[[Boolean, Value], Boolean], + value_f: Callable[[Value, Value], Value], b: Boolean, ): yield rewrite(TupleValue(length, idx_fn).length()).to(length) @@ -974,6 +1026,73 @@ def _tuple_value( yield rewrite(TupleValue.EMPTY.foldl_boolean(bool_f, b), subsume=True).to(b) yield rewrite(tv.append(v).foldl_boolean(bool_f, b), subsume=True).to(bool_f(tv.foldl_boolean(bool_f, b), v)) + # fold value + yield rewrite(TupleValue.EMPTY.foldl_value(value_f, v), subsume=True).to(v) + yield rewrite(tv.append(v).foldl_value(value_f, v1), subsume=True).to(value_f(tv.foldl_value(value_f, v1), v)) + + # unify append + yield rule(eq(tv.append(v)).to(tv1.append(v1))).then(union(tv).with_(tv1), union(v).with_(v1)) + + # if + yield rewrite(TupleValue.if_(TRUE, tv, tv1), subsume=True).to(tv) + yield rewrite(TupleValue.if_(FALSE, tv, tv1), subsume=True).to(tv1) + + +class TupleTupleValue(Expr, ruleset=array_api_ruleset): + EMPTY: ClassVar[TupleTupleValue] + + def __init__(self, length: IntLike, idx_fn: Callable[[Int], TupleValue]) -> None: ... + + def append(self, i: TupleValueLike) -> TupleTupleValue: ... + + @classmethod + def from_vec(cls, vec: Vec[TupleValue]) -> TupleTupleValue: ... + + def length(self) -> Int: ... + + def __getitem__(self, i: IntLike) -> TupleValue: ... + + +converter(tuple, TupleTupleValue, lambda x: TupleTupleValue.from_vec(Vec(*(convert(i, TupleValue) for i in x)))) +converter(list, TupleTupleValue, lambda x: TupleTupleValue.from_vec(Vec(*(convert(i, TupleValue) for i in x)))) +TupleTupleValueLike: TypeAlias = TupleTupleValue | list[TupleValueLike] | tuple[TupleValueLike, ...] + + +@array_api_ruleset.register +def _tuple_tuple_value( + length: Int, + idx_fn: Callable[[Int], TupleValue], + k: i64, + idx: Int, + vs: Vec[TupleValue], + v: TupleValue, + v1: TupleValue, + tv: TupleTupleValue, + tv1: TupleTupleValue, +): + yield rewrite(TupleTupleValue(length, idx_fn).length()).to(length) + yield rewrite(TupleTupleValue(length, idx_fn)[idx]).to(idx_fn(check_index(idx, length))) + + # cons access + yield rewrite(TupleTupleValue.EMPTY.length()).to(Int(0)) + yield rewrite(TupleTupleValue.EMPTY[idx]).to(TupleValue.NEVER) + yield rewrite(tv.append(v).length()).to(tv.length() + 1) + yield rewrite(tv.append(v)[idx]).to(TupleValue.if_(idx == tv.length(), v, tv[idx])) + + # functional to cons + yield rewrite(TupleTupleValue(0, idx_fn), subsume=True).to(TupleTupleValue.EMPTY) + yield rewrite(TupleTupleValue(Int(k), idx_fn), subsume=True).to( + TupleTupleValue(k - 1, idx_fn).append(idx_fn(Int(k - 1))), k > 0 + ) + + # cons to vec + yield rewrite(TupleTupleValue.EMPTY).to(TupleTupleValue.from_vec(Vec[TupleValue]())) + yield rewrite(TupleTupleValue.from_vec(vs).append(v)).to(TupleTupleValue.from_vec(vs.append(Vec(v)))) + + # from_vec support? Not sure why this isn't there on other vecs and how to do this best, if should convert to cons or what... + yield rewrite(TupleTupleValue.from_vec(vs).length()).to(Int(vs.length())) + yield rewrite(TupleTupleValue.from_vec(vs)[Int(k)]).to(vs[k]) + # unify append yield rule(eq(tv.append(v)).to(tv1.append(v1))).then(union(tv).with_(tv1), union(v).with_(v1)) @@ -1094,6 +1213,18 @@ class Device(Expr, ruleset=array_api_ruleset): ... class NDArray(Expr, ruleset=array_api_ruleset): + """ + NDArray implementation following the Array API Standard. + + >>> NDArray.vector((1, 2, 3)).eval() + (Value.int(Int(1)), Value.int(Int(2)), Value.int(Int(3))) + >>> NDArray.vector((1, 2, 3)).eval_numpy("int64") + array([1, 2, 3]) + >>> NDArray.matrix(((1, 2), (3, 4))).eval_numpy("int64") + array([[1, 2], + [3, 4]]) + """ + def __init__(self, shape: TupleIntLike, dtype: DType, idx_fn: Callable[[TupleInt], Value]) -> None: ... NEVER: ClassVar[NDArray] @@ -1208,7 +1339,8 @@ def __rxor__(self, other: NDArray) -> NDArray: ... def __ror__(self, other: NDArray) -> NDArray: ... @classmethod - def scalar(cls, value: Value) -> NDArray: + def scalar(cls, value: ValueLike) -> NDArray: + value = cast("Value", value) return NDArray(TupleInt.EMPTY, value.dtype, lambda _: value) def to_value(self) -> Value: @@ -1228,7 +1360,18 @@ def T(self) -> NDArray: """ @classmethod - def vector(cls, values: TupleValueLike) -> NDArray: ... + def vector(cls, values: TupleValueLike) -> NDArray: + values = cast("TupleValue", values) + return NDArray((values.length(),), values[0].dtype, lambda idx: values[idx[0]]) + + @classmethod + def matrix(cls, values: TupleTupleValueLike) -> NDArray: + values = cast("TupleTupleValue", values) + return NDArray( + (values.length(), values[0].length()), + values[0][0].dtype, + lambda idx: values[idx[0]][idx[1]], + ) def index(self, indices: TupleIntLike) -> Value: """ @@ -1238,6 +1381,56 @@ def index(self, indices: TupleIntLike) -> Value: @classmethod def if_(cls, b: BooleanLike, i: NDArrayLike, j: NDArrayLike) -> NDArray: ... + @method(preserve=True) + def eval_vecs(self) -> VecValuesRecursive: + """ + Evals to a nested Vec of values representing the array. It will be extracted and simplified by the e-graph. + """ + # Share an e-graph for the computation of shape and eval + egraph = _get_current_egraph() + with set_array_api_egraph(egraph): + shape = self.shape.eval() + + def _inner_values(current_index: tuple[int, ...], remaining_dims: tuple[Int, ...]) -> VecValuesRecursive: + if not remaining_dims: + return self.index(current_index) + return Vec(*(_inner_values((*current_index, i), remaining_dims[1:]) for i in range(remaining_dims[0]))) + + res = _inner_values((), shape) + egraph.register(res) + egraph.run(array_api_schedule) + return egraph.extract(res) + + @method(preserve=True) + def eval(self) -> PyTupleValuesRecursive: + """ + Evals to a nested tuple of values representing the array. + """ + + def _to_tuple(v: VecValuesRecursive) -> PyTupleValuesRecursive: + if isinstance(v, Value): + return v + return tuple(_to_tuple(i) for i in v) + + return _to_tuple(self.eval_vecs()) + + @method(preserve=True) + def eval_numpy(self, dtype: np.dtype | None = None) -> np.ndarray: + """ + Evals to a numpy ndarray. + """ + return np.array(self.eval(), dtype=dtype) + + @method(preserve=True) + def __array__(self, dtype=None, copy=None) -> np.ndarray: + if copy is False: + msg = "NDArray.__array__ with copy=False is not supported" + raise NotImplementedError(msg) + return self.eval_numpy(dtype=dtype) + + +VecValuesRecursive: TypeAlias = "Value | Vec[VecValuesRecursive]" +PyTupleValuesRecursive: TypeAlias = Value | tuple["PyTupleValuesRecursive", ...] NDArrayLike: TypeAlias = NDArray | ValueLike | TupleValueLike @@ -1263,6 +1456,8 @@ def _ndarray( idx_fn: Callable[[TupleInt], Value], idx: TupleInt, tv: TupleValue, + v: Value, + v1: Value, ): return [ rewrite(NDArray(shape, dtype, idx_fn).shape).to(shape), @@ -1274,18 +1469,17 @@ def _ndarray( rewrite(x.to_value()).to(x.index(TupleInt.EMPTY)), rewrite(NDArray.vector(tv).to_values()).to(tv), # TODO: Push these down to float - rewrite(NDArray.scalar(Value.float(f)) / NDArray.scalar(Value.float(f))).to( - NDArray.scalar(Value.float(Float(1.0))) - ), - rewrite(NDArray.scalar(Value.float(f)) - NDArray.scalar(Value.float(f))).to( - NDArray.scalar(Value.float(Float(0.0))) - ), - rewrite(NDArray.scalar(Value.float(Float(fi1))) > NDArray.scalar(Value.float(Float(fi2)))).to( - NDArray.scalar(Value.bool(TRUE)), fi1 > fi2 - ), - rewrite(NDArray.scalar(Value.float(Float(fi1))) > NDArray.scalar(Value.float(Float(fi2)))).to( - NDArray.scalar(Value.bool(FALSE)), fi1 <= fi2 - ), + rewrite(NDArray.scalar(v) / NDArray.scalar(v)).to(NDArray.scalar(v / v)), + rewrite(NDArray.scalar(v) + NDArray.scalar(v)).to(NDArray.scalar(v + v)), + rewrite(NDArray.scalar(v) * NDArray.scalar(v)).to(NDArray.scalar(v * v)), + # - + rewrite(NDArray.scalar(v) - NDArray.scalar(v)).to(NDArray.scalar(v - v)), + # Comparisons + rewrite(NDArray.scalar(v) < NDArray.scalar(v1)).to(NDArray.scalar(v < v1)), + rewrite(NDArray.scalar(v) <= NDArray.scalar(v1)).to(NDArray.scalar(v <= v1)), + rewrite(NDArray.scalar(v) == NDArray.scalar(v1)).to(NDArray.scalar(v == v1)), + rewrite(NDArray.scalar(v) > NDArray.scalar(v1)).to(NDArray.scalar(v > v1)), + rewrite(NDArray.scalar(v) >= NDArray.scalar(v1)).to(NDArray.scalar(v >= v1)), # Transpose of tranpose is the original array rewrite(x.T.T).to(x), # if_ @@ -1657,31 +1851,29 @@ def real(x: NDArray) -> NDArray: ... def conj(x: NDArray) -> NDArray: ... -class IntOrPairTupleInts(Expr): +@function(ruleset=array_api_ruleset) +def vecdot(x1: NDArrayLike, x2: NDArrayLike) -> NDArray: """ - Either an integer or a pair of tuple of integers. + https://data-apis.org/array-api/2022.12/API_specification/generated/array_api.vecdot.html + https://numpy.org/doc/stable/reference/generated/numpy.vecdot.html - Used for the TensorDot axes argument. - """ + TODO: Support axis, complex numbers, and broadcasting - @classmethod - def int(cls, value: IntLike) -> IntOrPairTupleInts: ... - - @classmethod - def pair(cls, left: TupleIntLike, right: TupleIntLike) -> IntOrPairTupleInts: ... - - -converter(Int, IntOrPairTupleInts, IntOrPairTupleInts.int) -converter( - tuple, IntOrPairTupleInts, lambda x: IntOrPairTupleInts.pair(convert(x[0], TupleInt), convert(x[1], TupleInt)) -) - - -@function -def tensordot(x1: NDArrayLike, x2: NDArrayLike, axes: IntOrPairTupleInts) -> NDArray: - """ - https://data-apis.org/array-api/2022.12/API_specification/generated/array_api.tensordot.html + >>> v = NDArray.matrix([[0., 5., 0.], [0., 0., 10.], [0., 6., 8.]]) + >>> n = NDArray.vector([0., 0.6, 0.8]) + >>> vecdot(v, n).eval_numpy("float64") + array([ 3., 8., 10.]) """ + x1 = cast("NDArray", x1) + x2 = cast("NDArray", x2) + + return NDArray( + x1.shape.drop_last(), + x1.dtype, + lambda idx: TupleInt.range(x1.shape.last()) + .map_value(lambda i: x1.index(idx.append(i)) * x2.index(idx.append(i))) + .foldl_value(Value.__add__, Value.float(0)), + ) @function @@ -1798,7 +1990,7 @@ def _interval_analaysis( NDArray.scalar(Value.bool(possible_values(x.index(ALL_INDICES).to_truthy_value).contains(Value.bool(TRUE)))) ), # Indexing x < y is the same as broadcasting the index and then indexing both and then comparing - rewrite((x < y).index(idx)).to(x_value < y_value), + rewrite((x < y).index(idx)).to(Value.bool(x_value < y_value)), # Same for x / y rewrite((x / y).index(idx)).to(x_value / y_value), # Indexing a scalar is the same as the scalar @@ -1832,7 +2024,7 @@ def _interval_analaysis( # Define v < 0 to be false, if greater_zero(v) rule( greater_zero(v), - eq(v1).to(v < Value.int(Int(0))), + eq(v1).to(Value.bool(v < Value.int(Int(0)))), ).then( union(v1).with_(Value.bool(FALSE)), ), diff --git a/python/egglog/exp/array_api_jit.py b/python/egglog/exp/array_api_jit.py index 529b4a41..df22229a 100644 --- a/python/egglog/exp/array_api_jit.py +++ b/python/egglog/exp/array_api_jit.py @@ -5,7 +5,7 @@ import numpy as np from egglog import EGraph, greedy_dag_cost_model -from egglog.exp.array_api import NDArray, set_array_api_egraph, try_evaling +from egglog.exp.array_api import NDArray, set_array_api_egraph from egglog.exp.array_api_numba import array_api_numba_schedule from egglog.exp.array_api_program_gen import EvalProgram, array_api_program_gen_schedule, ndarray_function_two_program @@ -29,7 +29,9 @@ def jit( if handle_optimized_expr: handle_optimized_expr(res_optimized) fn_program = EvalProgram(program, {"np": np}) - return cast("X", try_evaling(egraph, array_api_program_gen_schedule, fn_program, fn_program.as_py_object)) + egraph.register(fn_program) + egraph.run(array_api_program_gen_schedule) + return cast("X", fn_program.as_py_object.value) def function_to_program(fn: Callable, save_egglog_string: bool) -> tuple[EGraph, NDArray, NDArray, Program]: diff --git a/python/tests/test_array_api.py b/python/tests/test_array_api.py index 34564ddc..42fe3e8c 100644 --- a/python/tests/test_array_api.py +++ b/python/tests/test_array_api.py @@ -389,7 +389,8 @@ def test_run_lda(fn_thunk, benchmark): print("Generating egglog source for test") egraph, _, _, program = function_to_program(lda, True) egraph.register(program.compile()) - try_evaling(egraph, array_api_program_gen_combined_ruleset.saturate(), program, program.statements) + egraph.run(array_api_program_gen_combined_ruleset.saturate()) + egraph.extract(program.statements) name = "python.egg" print("Saving to", name) Path(name).write_text(egraph.as_egglog_string) From c2112a4ecf99171a1420f74215deb98cc08c3f58 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Wed, 21 Jan 2026 13:03:22 -0800 Subject: [PATCH 11/30] tmp --- docs/explanation/2026_01_11_containers.py | 54 + docs/explanation/polynomials.ipynb | 1121 +++++++++++++++++++-- pyproject.toml | 4 +- python/egglog/builtins.py | 17 +- python/egglog/conversion.py | 2 +- python/egglog/deconstruct.py | 24 +- python/egglog/egraph_state.py | 2 +- python/egglog/exp/array_api.py | 238 ++++- python/egglog/exp/polynomials.py | 4 +- python/egglog/pretty.py | 13 +- python/egglog/runtime.py | 3 +- python/egglog/type_constraint_solver.py | 10 +- 12 files changed, 1351 insertions(+), 141 deletions(-) create mode 100644 docs/explanation/2026_01_11_containers.py diff --git a/docs/explanation/2026_01_11_containers.py b/docs/explanation/2026_01_11_containers.py new file mode 100644 index 00000000..b95fc289 --- /dev/null +++ b/docs/explanation/2026_01_11_containers.py @@ -0,0 +1,54 @@ +# # Container Primitive Sorts +# +# In egglog, we not only have primitive sorts like `i64`, `f64` and `String`, but also container +# sorts like `Vec`, `Set` and `Map`. Similar to other primitives, they have a number of built-in +# functions that are defined on them. They are implemented in Rust and egglog can also be extended +# with extra user defined functions on these container sorts as well as entirely new sorts. +# +# For example, the vector sort `Vec` represents a variable-length ordered collection of elements. +# It supports indexing, length retrieval, appending elements, and more: + +# + +# mypy: disable-error-code="empty-body" + +from __future__ import annotations +from typing import TypeAlias +from egglog import * + + +egraph = EGraph(save_egglog_string=True) +# vectors support indexing +egraph.extract(Vec(i64(0), i64(1), i64(2))[0]) + +# - + +# This is translated into egglog primitives which execute "eagerly", i.e. they don't have to wait for a rule to replace +# their execution with concrete values. This also means they can also execute on concrete values directly, not on +# uninterpreted functions. + +print(egraph.as_egglog_string) + +# As an example, let's look at implementing polynomial expressions in egglog: + + +# + +class Num(Expr): + def __init__(self, value: i64Like) -> None: ... + @method(cost=2) + def __add__(self, other: NumLike) -> Num: ... + @method(cost=10) + def __mul__(self, other: NumLike) -> Num: ... + + # These will be translated to non-reversed ones + def __radd__(self, other: NumLike) -> Num: ... + def __rmul__(self, other: NumLike) -> Num: ... + + +NumLike: TypeAlias = Num | StringLike | i64Like +converter(i64, Num, Num) + +(x, y, z) = vars_("x y z", Num) +(p := x * (y * x + z) + 100 * z) +# - + +# Now let's say we want to find the lowest cost way to compute this by potentially factoring it. diff --git a/docs/explanation/polynomials.ipynb b/docs/explanation/polynomials.ipynb index 3908a285..12f1dd11 100644 --- a/docs/explanation/polynomials.ipynb +++ b/docs/explanation/polynomials.ipynb @@ -7,21 +7,42 @@ "metadata": {}, "outputs": [ { - "data": { - "text/latex": [ - "$\\displaystyle \\frac{\\left(\\left(\\left(bp_{1} q_{1} + bp_{2} q_{4} + bp_{3} q_{7} + bp_{4} q_{10}\\right) \\left(bpp_{1} q_{2} + bpp_{2} q_{5} + bpp_{3} q_{8} + bpp_{4} q_{11}\\right) - \\left(bp_{1} q_{2} + bp_{2} q_{5} + bp_{3} q_{8} + bp_{4} q_{11}\\right) \\left(bpp_{1} q_{1} + bpp_{2} q_{4} + bpp_{3} q_{7} + bpp_{4} q_{10}\\right)\\right)^{2} + \\left(- \\left(bp_{1} q_{1} + bp_{2} q_{4} + bp_{3} q_{7} + bp_{4} q_{10}\\right) \\left(bpp_{1} q_{3} + bpp_{2} q_{6} + bpp_{3} q_{9} + bpp_{4} q_{12}\\right) + \\left(bp_{1} q_{3} + bp_{2} q_{6} + bp_{3} q_{9} + bp_{4} q_{12}\\right) \\left(bpp_{1} q_{1} + bpp_{2} q_{4} + bpp_{3} q_{7} + bpp_{4} q_{10}\\right)\\right)^{2} + \\left(\\left(bp_{1} q_{2} + bp_{2} q_{5} + bp_{3} q_{8} + bp_{4} q_{11}\\right) \\left(bpp_{1} q_{3} + bpp_{2} q_{6} + bpp_{3} q_{9} + bpp_{4} q_{12}\\right) - \\left(bp_{1} q_{3} + bp_{2} q_{6} + bp_{3} q_{9} + bp_{4} q_{12}\\right) \\left(bpp_{1} q_{2} + bpp_{2} q_{5} + bpp_{3} q_{8} + bpp_{4} q_{11}\\right)\\right)^{2}\\right)^{1.0}}{\\left(\\left(bp_{1} q_{1} + bp_{2} q_{4} + bp_{3} q_{7} + bp_{4} q_{10}\\right)^{2} + \\left(bp_{1} q_{2} + bp_{2} q_{5} + bp_{3} q_{8} + bp_{4} q_{11}\\right)^{2} + \\left(bp_{1} q_{3} + bp_{2} q_{6} + bp_{3} q_{9} + bp_{4} q_{12}\\right)^{2}\\right)^{3.0}}$" - ], - "text/plain": [ - "(((bp1*q1 + bp2*q4 + bp3*q7 + bp4*q10)*(bpp1*q2 + bpp2*q5 + bpp3*q8 + bpp4*q11) - (bp1*q2 + bp2*q5 + bp3*q8 + bp4*q11)*(bpp1*q1 + bpp2*q4 + bpp3*q7 + bpp4*q10))**2 + (-(bp1*q1 + bp2*q4 + bp3*q7 + bp4*q10)*(bpp1*q3 + bpp2*q6 + bpp3*q9 + bpp4*q12) + (bp1*q3 + bp2*q6 + bp3*q9 + bp4*q12)*(bpp1*q1 + bpp2*q4 + bpp3*q7 + bpp4*q10))**2 + ((bp1*q2 + bp2*q5 + bp3*q8 + bp4*q11)*(bpp1*q3 + bpp2*q6 + bpp3*q9 + bpp4*q12) - (bp1*q3 + bp2*q6 + bp3*q9 + bp4*q12)*(bpp1*q2 + bpp2*q5 + bpp3*q8 + bpp4*q11))**2)**1.0/((bp1*q1 + bp2*q4 + bp3*q7 + bp4*q10)**2 + (bp1*q2 + bp2*q5 + bp3*q8 + bp4*q11)**2 + (bp1*q3 + bp2*q6 + bp3*q9 + bp4*q12)**2)**3.0" - ] - }, - "execution_count": 1, - "metadata": {}, - "output_type": "execute_result" + "name": "stdout", + "output_type": "stream", + "text": [ + "(\n", + " (\n", + " (bp1 * q1 + bp2 * q4 + bp3 * q7 + bp4 * q10)\n", + " * (bpp1 * q2 + bpp2 * q5 + bpp3 * q8 + bpp4 * q11)\n", + " - (bp1 * q2 + bp2 * q5 + bp3 * q8 + bp4 * q11)\n", + " * (bpp1 * q1 + bpp2 * q4 + bpp3 * q7 + bpp4 * q10)\n", + " )\n", + " ** 2\n", + " + (\n", + " -(bp1 * q1 + bp2 * q4 + bp3 * q7 + bp4 * q10)\n", + " * (bpp1 * q3 + bpp2 * q6 + bpp3 * q9 + bpp4 * q12)\n", + " + (bp1 * q3 + bp2 * q6 + bp3 * q9 + bp4 * q12)\n", + " * (bpp1 * q1 + bpp2 * q4 + bpp3 * q7 + bpp4 * q10)\n", + " )\n", + " ** 2\n", + " + (\n", + " (bp1 * q2 + bp2 * q5 + bp3 * q8 + bp4 * q11)\n", + " * (bpp1 * q3 + bpp2 * q6 + bpp3 * q9 + bpp4 * q12)\n", + " - (bp1 * q3 + bp2 * q6 + bp3 * q9 + bp4 * q12)\n", + " * (bpp1 * q2 + bpp2 * q5 + bpp3 * q8 + bpp4 * q11)\n", + " )\n", + " ** 2\n", + ") ** 1.0 / (\n", + " (bp1 * q1 + bp2 * q4 + bp3 * q7 + bp4 * q10) ** 2\n", + " + (bp1 * q2 + bp2 * q5 + bp3 * q8 + bp4 * q11) ** 2\n", + " + (bp1 * q3 + bp2 * q6 + bp3 * q9 + bp4 * q12) ** 2\n", + ") ** 3.0\n" + ] } ], "source": [ "from sympy import Array, Symbol, tensorcontraction, tensorproduct\n", + "import black\n", "\n", "\n", "def bending_function_sympy(Q, Bp, Bpp):\n", @@ -50,16 +71,17 @@ " return (norm3(cross(yip, yipp)) / (norm3(yip) ** 3)) ** 2\n", "\n", "\n", - "bending_function_sympy(\n", + "sympy_res = bending_function_sympy(\n", " Array([Symbol(f\"q{i}\") for i in range(1, 13)]),\n", " Array([Symbol(f\"bp{i}\") for i in range(1, 5)]),\n", " Array([Symbol(f\"bpp{i}\") for i in range(1, 5)]),\n", - ")" + ")\n", + "print(black.format_str(repr(sympy_res), mode=black.Mode(line_length=88)).strip())" ] }, { "cell_type": "code", - "execution_count": 2, + "execution_count": null, "id": "7071fa5d", "metadata": {}, "outputs": [], @@ -68,9 +90,15 @@ "\n", "# create random array inputs\n", "ng = np.random.default_rng()\n", + "# control points\n", "q_np = ng.random(12).astype(float)\n", + "# bernstein coefficients\n", "bp_np = ng.random(4).astype(float)\n", - "bpp_np = ng.random(4).astype(float)" + "bpp_np = ng.random(4).astype(float)\n", + "# applicaiton layer\n", + "# polynomial layer\n", + "# - next step do deriviates from mathematica\n", + "# egraph layer" ] }, { @@ -82,7 +110,7 @@ { "data": { "text/plain": [ - "(0.00171842130320933, np.float64(0.0017184213032093308))" + "(0.00303248851892518, np.float64(0.0030324885189251874))" ] }, "execution_count": 3, @@ -97,8 +125,7 @@ "\n", " yip = xp.vecdot(QM, Bp)\n", " yipp = xp.vecdot(QM, Bpp)\n", - "\n", - " num = xp.linalg.vector_norm(xp.linalg.cross(yip, yipp))\n", + " num = xp.linalg.vector_norm(xp.cross(yip, yipp))\n", " den = xp.linalg.vector_norm(yip) ** 3\n", " return (num / den) ** 2\n", "\n", @@ -220,7 +247,7 @@ " ),\n", " )\n", " )\n", - " / (vector_norm(_NDArray_2) ** NDArray.scalar(Value.int(Int(3))))\n", + " / vector_norm(_NDArray_2) ** NDArray.scalar(Value.int(Int(3)))\n", ") ** NDArray.scalar(Value.int(Int(2)))\n", "\n" ], @@ -247,7 +274,7 @@ " \\PY{p}{)}\\PY{p}{,}\n", " \\PY{p}{)}\n", " \\PY{p}{)}\n", - " \\PY{o}{/} \\PY{p}{(}\\PY{n}{vector\\PYZus{}norm}\\PY{p}{(}\\PY{n}{\\PYZus{}NDArray\\PYZus{}2}\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{scalar}\\PY{p}{(}\\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{o}{/} \\PY{n}{vector\\PYZus{}norm}\\PY{p}{(}\\PY{n}{\\PYZus{}NDArray\\PYZus{}2}\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{scalar}\\PY{p}{(}\\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", "\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{scalar}\\PY{p}{(}\\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", "\\end{Verbatim}\n" ], @@ -273,7 +300,7 @@ " ),\n", " )\n", " )\n", - " / (vector_norm(_NDArray_2) ** NDArray.scalar(Value.int(Int(3))))\n", + " / vector_norm(_NDArray_2) ** NDArray.scalar(Value.int(Int(3)))\n", ") ** NDArray.scalar(Value.int(Int(2)))" ] }, @@ -298,14 +325,6 @@ "id": "6fad95ab", "metadata": {}, "outputs": [ - { - "name": "stderr", - "output_type": "stream", - "text": [ - "In 1:1-69: (let __expr_518171328674535131 (egglog_exp_array_api_Int___init__ 3))\n", - "Global `__expr_518171328674535131` should start with `$`. Enable `--strict-mode` to turn this warning into an error. Suppressing additional warnings of this type.\n" - ] - }, { "data": { "text/html": [ @@ -383,76 +402,64 @@ ".output_html .vg { color: #19177C } /* Name.Variable.Global */\n", ".output_html .vi { color: #19177C } /* Name.Variable.Instance */\n", ".output_html .vm { color: #19177C } /* Name.Variable.Magic */\n", - ".output_html .il { color: #666 } /* Literal.Number.Integer.Long */
_NDArray_1 = reshape(\n",
-       "    NDArray.vector(\n",
-       "        TupleValue.from_vec(Vec(q1, q2, q3, q4, q5, q6, q7, q8, q9, q10, q11, q12))\n",
-       "    ),\n",
-       "    TupleInt.from_vec(Vec(Int(4), Int(3))),\n",
-       ").T\n",
-       "_NDArray_2 = vecdot(\n",
-       "    _NDArray_1, NDArray.vector(TupleValue.from_vec(Vec(bp1, bp2, bp3, bp4)))\n",
-       ")\n",
+       ".output_html .il { color: #666 } /* Literal.Number.Integer.Long */
_Value_1 = q2 * bp1 + q5 * bp2 + q8 * bp3 + q11 * bp4\n",
+       "_Value_2 = q3 * bpp1 + q6 * bpp2 + q9 * bpp3 + q12 * bpp4\n",
+       "_Value_3 = q3 * bp1 + q6 * bp2 + q9 * bp3 + q12 * bp4\n",
+       "_Value_4 = q2 * bpp1 + q5 * bpp2 + q8 * bpp3 + q11 * bpp4\n",
+       "_Value_5 = q1 * bpp1 + q4 * bpp2 + q7 * bpp3 + q10 * bpp4\n",
+       "_Value_6 = q1 * bp1 + q4 * bp2 + q7 * bp3 + q10 * bp4\n",
        "(\n",
-       "    vector_norm(\n",
-       "        cross(\n",
-       "            _NDArray_2,\n",
-       "            vecdot(\n",
-       "                _NDArray_1,\n",
-       "                NDArray.vector(TupleValue.from_vec(Vec(bpp1, bpp2, bpp3, bpp4))),\n",
-       "            ),\n",
-       "        )\n",
-       "    )\n",
-       "    / (vector_norm(_NDArray_2) ** NDArray.scalar(Value.int(Int(3))))\n",
-       ") ** NDArray.scalar(Value.int(Int(2)))\n",
+       "    (_Value_1 * _Value_2 - _Value_3 * _Value_4) ** Value.int(Int(2))\n",
+       "    + (_Value_3 * _Value_5 - _Value_6 * _Value_2) ** Value.int(Int(2))\n",
+       "    + (_Value_6 * _Value_4 - _Value_1 * _Value_5) ** Value.int(Int(2))\n",
+       ") / (\n",
+       "    _Value_6 ** Value.int(Int(2))\n",
+       "    + _Value_1 ** Value.int(Int(2))\n",
+       "    + _Value_3 ** Value.int(Int(2))\n",
+       ") ** Value.int(\n",
+       "    Int(3)\n",
+       ")\n",
        "
\n" ], "text/latex": [ "\\begin{Verbatim}[commandchars=\\\\\\{\\}]\n", - "\\PY{n}{\\PYZus{}NDArray\\PYZus{}1} \\PY{o}{=} \\PY{n}{reshape}\\PY{p}{(}\n", - " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\n", - " \\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{q1}\\PY{p}{,} \\PY{n}{q2}\\PY{p}{,} \\PY{n}{q3}\\PY{p}{,} \\PY{n}{q4}\\PY{p}{,} \\PY{n}{q5}\\PY{p}{,} \\PY{n}{q6}\\PY{p}{,} \\PY{n}{q7}\\PY{p}{,} \\PY{n}{q8}\\PY{p}{,} \\PY{n}{q9}\\PY{p}{,} \\PY{n}{q10}\\PY{p}{,} \\PY{n}{q11}\\PY{p}{,} \\PY{n}{q12}\\PY{p}{)}\\PY{p}{)}\n", - " \\PY{p}{)}\\PY{p}{,}\n", - " \\PY{n}{TupleInt}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{4}\\PY{p}{)}\\PY{p}{,} \\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", - "\\PY{p}{)}\\PY{o}{.}\\PY{n}{T}\n", - "\\PY{n}{\\PYZus{}NDArray\\PYZus{}2} \\PY{o}{=} \\PY{n}{vecdot}\\PY{p}{(}\n", - " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{bp1}\\PY{p}{,} \\PY{n}{bp2}\\PY{p}{,} \\PY{n}{bp3}\\PY{p}{,} \\PY{n}{bp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", - "\\PY{p}{)}\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}1} \\PY{o}{=} \\PY{n}{q2} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{+} \\PY{n}{q5} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{+} \\PY{n}{q8} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{+} \\PY{n}{q11} \\PY{o}{*} \\PY{n}{bp4}\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}2} \\PY{o}{=} \\PY{n}{q3} \\PY{o}{*} \\PY{n}{bpp1} \\PY{o}{+} \\PY{n}{q6} \\PY{o}{*} \\PY{n}{bpp2} \\PY{o}{+} \\PY{n}{q9} \\PY{o}{*} \\PY{n}{bpp3} \\PY{o}{+} \\PY{n}{q12} \\PY{o}{*} \\PY{n}{bpp4}\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}3} \\PY{o}{=} \\PY{n}{q3} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{+} \\PY{n}{q6} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{+} \\PY{n}{q9} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{+} \\PY{n}{q12} \\PY{o}{*} \\PY{n}{bp4}\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}4} \\PY{o}{=} \\PY{n}{q2} \\PY{o}{*} \\PY{n}{bpp1} \\PY{o}{+} \\PY{n}{q5} \\PY{o}{*} \\PY{n}{bpp2} \\PY{o}{+} \\PY{n}{q8} \\PY{o}{*} \\PY{n}{bpp3} \\PY{o}{+} \\PY{n}{q11} \\PY{o}{*} \\PY{n}{bpp4}\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}5} \\PY{o}{=} \\PY{n}{q1} \\PY{o}{*} \\PY{n}{bpp1} \\PY{o}{+} \\PY{n}{q4} \\PY{o}{*} \\PY{n}{bpp2} \\PY{o}{+} \\PY{n}{q7} \\PY{o}{*} \\PY{n}{bpp3} \\PY{o}{+} \\PY{n}{q10} \\PY{o}{*} \\PY{n}{bpp4}\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}6} \\PY{o}{=} \\PY{n}{q1} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{+} \\PY{n}{q4} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{+} \\PY{n}{q7} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{+} \\PY{n}{q10} \\PY{o}{*} \\PY{n}{bp4}\n", "\\PY{p}{(}\n", - " \\PY{n}{vector\\PYZus{}norm}\\PY{p}{(}\n", - " \\PY{n}{cross}\\PY{p}{(}\n", - " \\PY{n}{\\PYZus{}NDArray\\PYZus{}2}\\PY{p}{,}\n", - " \\PY{n}{vecdot}\\PY{p}{(}\n", - " \\PY{n}{\\PYZus{}NDArray\\PYZus{}1}\\PY{p}{,}\n", - " \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{vector}\\PY{p}{(}\\PY{n}{TupleValue}\\PY{o}{.}\\PY{n}{from\\PYZus{}vec}\\PY{p}{(}\\PY{n}{Vec}\\PY{p}{(}\\PY{n}{bpp1}\\PY{p}{,} \\PY{n}{bpp2}\\PY{p}{,} \\PY{n}{bpp3}\\PY{p}{,} \\PY{n}{bpp4}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", - " \\PY{p}{)}\\PY{p}{,}\n", - " \\PY{p}{)}\n", - " \\PY{p}{)}\n", - " \\PY{o}{/} \\PY{p}{(}\\PY{n}{vector\\PYZus{}norm}\\PY{p}{(}\\PY{n}{\\PYZus{}NDArray\\PYZus{}2}\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{scalar}\\PY{p}{(}\\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", - "\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{NDArray}\\PY{o}{.}\\PY{n}{scalar}\\PY{p}{(}\\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}1} \\PY{o}{*} \\PY{n}{\\PYZus{}Value\\PYZus{}2} \\PY{o}{\\PYZhy{}} \\PY{n}{\\PYZus{}Value\\PYZus{}3} \\PY{o}{*} \\PY{n}{\\PYZus{}Value\\PYZus{}4}\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}3} \\PY{o}{*} \\PY{n}{\\PYZus{}Value\\PYZus{}5} \\PY{o}{\\PYZhy{}} \\PY{n}{\\PYZus{}Value\\PYZus{}6} \\PY{o}{*} \\PY{n}{\\PYZus{}Value\\PYZus{}2}\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}6} \\PY{o}{*} \\PY{n}{\\PYZus{}Value\\PYZus{}4} \\PY{o}{\\PYZhy{}} \\PY{n}{\\PYZus{}Value\\PYZus{}1} \\PY{o}{*} \\PY{n}{\\PYZus{}Value\\PYZus{}5}\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + "\\PY{p}{)} \\PY{o}{/} \\PY{p}{(}\n", + " \\PY{n}{\\PYZus{}Value\\PYZus{}6} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{\\PYZus{}Value\\PYZus{}1} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{\\PYZus{}Value\\PYZus{}3} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + "\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\n", + " \\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\n", + "\\PY{p}{)}\n", "\\end{Verbatim}\n" ], "text/plain": [ - "_NDArray_1 = reshape(\n", - " NDArray.vector(\n", - " TupleValue.from_vec(Vec(q1, q2, q3, q4, q5, q6, q7, q8, q9, q10, q11, q12))\n", - " ),\n", - " TupleInt.from_vec(Vec(Int(4), Int(3))),\n", - ").T\n", - "_NDArray_2 = vecdot(\n", - " _NDArray_1, NDArray.vector(TupleValue.from_vec(Vec(bp1, bp2, bp3, bp4)))\n", - ")\n", + "_Value_1 = q2 * bp1 + q5 * bp2 + q8 * bp3 + q11 * bp4\n", + "_Value_2 = q3 * bpp1 + q6 * bpp2 + q9 * bpp3 + q12 * bpp4\n", + "_Value_3 = q3 * bp1 + q6 * bp2 + q9 * bp3 + q12 * bp4\n", + "_Value_4 = q2 * bpp1 + q5 * bpp2 + q8 * bpp3 + q11 * bpp4\n", + "_Value_5 = q1 * bpp1 + q4 * bpp2 + q7 * bpp3 + q10 * bpp4\n", + "_Value_6 = q1 * bp1 + q4 * bp2 + q7 * bp3 + q10 * bp4\n", "(\n", - " vector_norm(\n", - " cross(\n", - " _NDArray_2,\n", - " vecdot(\n", - " _NDArray_1,\n", - " NDArray.vector(TupleValue.from_vec(Vec(bpp1, bpp2, bpp3, bpp4))),\n", - " ),\n", - " )\n", - " )\n", - " / (vector_norm(_NDArray_2) ** NDArray.scalar(Value.int(Int(3))))\n", - ") ** NDArray.scalar(Value.int(Int(2)))" + " (_Value_1 * _Value_2 - _Value_3 * _Value_4) ** Value.int(Int(2))\n", + " + (_Value_3 * _Value_5 - _Value_6 * _Value_2) ** Value.int(Int(2))\n", + " + (_Value_6 * _Value_4 - _Value_1 * _Value_5) ** Value.int(Int(2))\n", + ") / (\n", + " _Value_6 ** Value.int(Int(2))\n", + " + _Value_1 ** Value.int(Int(2))\n", + " + _Value_3 ** Value.int(Int(2))\n", + ") ** Value.int(\n", + " Int(3)\n", + ")" ] }, "metadata": {}, @@ -460,22 +467,31 @@ } ], "source": [ - "egraph = egglog.EGraph()\n", - "egraph.register(res)\n", - "egraph.run(enp.array_api_ruleset)\n", - "egraph.extract(res)" + "# egraph = egglog.EGraph()\n", + "# egraph.register(res)\n", + "# egraph.run(enp.array_api_combined_ruleset.saturate())\n", + "# egraph.extract(res)\n", + "res_simp = res.eval()\n", + "res_simp" ] }, { "cell_type": "code", - "execution_count": 6, - "id": "d2707b6f", + "execution_count": null, + "id": "6264bc9b", "metadata": {}, "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "62\n" + ] + }, { "data": { "text/plain": [ - "array([Value.int(Int(10)), 2], dtype=object)" + "GreedyDagCost(total=ArithmeticCost(muls=30, divs=1, adds=22, subs=3, exps=7))" ] }, "execution_count": 6, @@ -484,38 +500,933 @@ } ], "source": [ - "np.array([enp.Value.int(10), 2], dtype=None)" + "from __future__ import annotations\n", + "from dataclasses import dataclass\n", + "from functools import total_ordering\n", + "\n", + "\n", + "@total_ordering\n", + "@dataclass(frozen=True)\n", + "class ArithmeticCost:\n", + " \"\"\"\n", + " Cost type where *, +, and ** are the same and then / is more than all of them.\n", + " \"\"\"\n", + "\n", + " muls: int = 0\n", + " divs: int = 0\n", + " adds: int = 0\n", + " subs: int = 0\n", + " exps: int = 0\n", + "\n", + " @property\n", + " def not_div_ops(self) -> int:\n", + " return self.muls + self.adds + self.exps + self.subs\n", + "\n", + " def __eq__(self, other: ArithmeticCost) -> bool:\n", + " return self.not_div_ops == other.not_div_ops and self.divs == other.divs\n", + "\n", + " def __gt__(self, other: ArithmeticCost) -> bool:\n", + " if self.divs != other.divs:\n", + " return self.divs > other.divs\n", + " return self.not_div_ops > other.not_div_ops\n", + "\n", + " def __add__(self, other: ArithmeticCost) -> ArithmeticCost:\n", + " return ArithmeticCost(\n", + " muls=self.muls + other.muls,\n", + " divs=self.divs + other.divs,\n", + " adds=self.adds + other.adds,\n", + " exps=self.exps + other.exps,\n", + " subs=self.subs + other.subs,\n", + " )\n", + "\n", + " def __sub__(self, other: ArithmeticCost) -> ArithmeticCost:\n", + " return ArithmeticCost(\n", + " muls=self.muls - other.muls,\n", + " divs=self.divs - other.divs,\n", + " adds=self.adds - other.adds,\n", + " exps=self.exps - other.exps,\n", + " subs=self.subs - other.subs,\n", + " )\n", + "\n", + "\n", + "@egglog.greedy_dag_cost_model\n", + "def arith_cost_model(egraph: egglog.EGraph, expr: egglog.Expr, children_costs: list[ArithmeticCost]) -> ArithmeticCost:\n", + " # named variables are free\n", + " if egglog.get_constant_name(expr) is not None:\n", + " return ArithmeticCost()\n", + " # literals are free\n", + " if egglog.get_literal_value(expr) is not None:\n", + " return ArithmeticCost()\n", + " match egglog.get_callable_fn(expr):\n", + " case enp.Value.__add__:\n", + " c = ArithmeticCost(adds=1)\n", + " case enp.Value.__sub__:\n", + " c = ArithmeticCost(subs=1)\n", + " case enp.Value.__mul__:\n", + " c = ArithmeticCost(muls=1)\n", + " case enp.Value.__truediv__:\n", + " c = ArithmeticCost(divs=1)\n", + " case enp.Value.__pow__:\n", + " c = ArithmeticCost(exps=1)\n", + " case enp.Int | enp.Value.int:\n", + " c = ArithmeticCost()\n", + " case _ as fn:\n", + " raise NotImplementedError(f\"Unknown expr for arith cost model: {fn or expr}\")\n", + " return sum(children_costs, c)\n", + "\n", + "\n", + "egraph = egglog.EGraph()\n", + "egraph.register(res_simp)\n", + "cost = egraph.extract(res_simp, cost_model=arith_cost_model, include_cost=True)[1]\n", + "print(cost.total.not_div_ops)\n", + "cost" + ] + }, + { + "cell_type": "markdown", + "id": "ceeaa84f", + "metadata": {}, + "source": [ + "Now let's try distributing..." ] }, { "cell_type": "code", "execution_count": 7, - "id": "e6b4ff0a", + "id": "f18caf30", "metadata": {}, "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "233\n", + "GreedyDagCost(total=ArithmeticCost(muls=120, divs=1, adds=58, subs=48, exps=7))\n" + ] + }, { "data": { + "text/html": [ + "
(\n",
+       "    (\n",
+       "        q2 * bp1 * (q3 * bpp1)\n",
+       "        + q2 * bp1 * (q6 * bpp2)\n",
+       "        + q2 * bp1 * (q9 * bpp3)\n",
+       "        + q2 * bp1 * (q12 * bpp4)\n",
+       "        + (\n",
+       "            q5 * bp2 * (q3 * bpp1)\n",
+       "            + q5 * bp2 * (q6 * bpp2)\n",
+       "            + q5 * bp2 * (q9 * bpp3)\n",
+       "            + q5 * bp2 * (q12 * bpp4)\n",
+       "        )\n",
+       "        + (\n",
+       "            q8 * bp3 * (q3 * bpp1)\n",
+       "            + q8 * bp3 * (q6 * bpp2)\n",
+       "            + q8 * bp3 * (q9 * bpp3)\n",
+       "            + q8 * bp3 * (q12 * bpp4)\n",
+       "        )\n",
+       "        + (\n",
+       "            q11 * bp4 * (q3 * bpp1)\n",
+       "            + q11 * bp4 * (q6 * bpp2)\n",
+       "            + q11 * bp4 * (q9 * bpp3)\n",
+       "            + q11 * bp4 * (q12 * bpp4)\n",
+       "        )\n",
+       "        - q3 * bp1 * (q2 * bpp1)\n",
+       "        - q6 * bp2 * (q2 * bpp1)\n",
+       "        - q3 * bp1 * (q5 * bpp2)\n",
+       "        - q6 * bp2 * (q5 * bpp2)\n",
+       "        - q3 * bp1 * (q8 * bpp3)\n",
+       "        - q6 * bp2 * (q8 * bpp3)\n",
+       "        - q3 * bp1 * (q11 * bpp4)\n",
+       "        - q6 * bp2 * (q11 * bpp4)\n",
+       "        - q9 * bp3 * (q2 * bpp1)\n",
+       "        - q9 * bp3 * (q5 * bpp2)\n",
+       "        - q9 * bp3 * (q8 * bpp3)\n",
+       "        - q9 * bp3 * (q11 * bpp4)\n",
+       "        - q12 * bp4 * (q2 * bpp1)\n",
+       "        - q12 * bp4 * (q5 * bpp2)\n",
+       "        - q12 * bp4 * (q8 * bpp3)\n",
+       "        - q12 * bp4 * (q11 * bpp4)\n",
+       "    )\n",
+       "    ** Value.int(Int(2))\n",
+       "    + (\n",
+       "        q3 * bp1 * (q1 * bpp1)\n",
+       "        + q3 * bp1 * (q4 * bpp2)\n",
+       "        + q3 * bp1 * (q7 * bpp3)\n",
+       "        + q3 * bp1 * (q10 * bpp4)\n",
+       "        + (\n",
+       "            q6 * bp2 * (q1 * bpp1)\n",
+       "            + q6 * bp2 * (q4 * bpp2)\n",
+       "            + q6 * bp2 * (q7 * bpp3)\n",
+       "            + q6 * bp2 * (q10 * bpp4)\n",
+       "        )\n",
+       "        + (\n",
+       "            q9 * bp3 * (q1 * bpp1)\n",
+       "            + q9 * bp3 * (q4 * bpp2)\n",
+       "            + q9 * bp3 * (q7 * bpp3)\n",
+       "            + q9 * bp3 * (q10 * bpp4)\n",
+       "        )\n",
+       "        + (\n",
+       "            q12 * bp4 * (q1 * bpp1)\n",
+       "            + q12 * bp4 * (q4 * bpp2)\n",
+       "            + q12 * bp4 * (q7 * bpp3)\n",
+       "            + q12 * bp4 * (q10 * bpp4)\n",
+       "        )\n",
+       "        - q1 * bp1 * (q3 * bpp1)\n",
+       "        - q4 * bp2 * (q3 * bpp1)\n",
+       "        - q1 * bp1 * (q6 * bpp2)\n",
+       "        - q4 * bp2 * (q6 * bpp2)\n",
+       "        - q1 * bp1 * (q9 * bpp3)\n",
+       "        - q4 * bp2 * (q9 * bpp3)\n",
+       "        - q1 * bp1 * (q12 * bpp4)\n",
+       "        - q4 * bp2 * (q12 * bpp4)\n",
+       "        - q7 * bp3 * (q3 * bpp1)\n",
+       "        - q7 * bp3 * (q6 * bpp2)\n",
+       "        - q7 * bp3 * (q9 * bpp3)\n",
+       "        - q7 * bp3 * (q12 * bpp4)\n",
+       "        - q10 * bp4 * (q3 * bpp1)\n",
+       "        - q10 * bp4 * (q6 * bpp2)\n",
+       "        - q10 * bp4 * (q9 * bpp3)\n",
+       "        - q10 * bp4 * (q12 * bpp4)\n",
+       "    )\n",
+       "    ** Value.int(Int(2))\n",
+       "    + (\n",
+       "        q1 * bp1 * (q2 * bpp1)\n",
+       "        + q1 * bp1 * (q5 * bpp2)\n",
+       "        + q1 * bp1 * (q8 * bpp3)\n",
+       "        + q1 * bp1 * (q11 * bpp4)\n",
+       "        + (\n",
+       "            q4 * bp2 * (q2 * bpp1)\n",
+       "            + q4 * bp2 * (q5 * bpp2)\n",
+       "            + q4 * bp2 * (q8 * bpp3)\n",
+       "            + q4 * bp2 * (q11 * bpp4)\n",
+       "        )\n",
+       "        + (\n",
+       "            q7 * bp3 * (q2 * bpp1)\n",
+       "            + q7 * bp3 * (q5 * bpp2)\n",
+       "            + q7 * bp3 * (q8 * bpp3)\n",
+       "            + q7 * bp3 * (q11 * bpp4)\n",
+       "        )\n",
+       "        + (\n",
+       "            q10 * bp4 * (q2 * bpp1)\n",
+       "            + q10 * bp4 * (q5 * bpp2)\n",
+       "            + q10 * bp4 * (q8 * bpp3)\n",
+       "            + q10 * bp4 * (q11 * bpp4)\n",
+       "        )\n",
+       "        - q2 * bp1 * (q1 * bpp1)\n",
+       "        - q5 * bp2 * (q1 * bpp1)\n",
+       "        - q2 * bp1 * (q4 * bpp2)\n",
+       "        - q5 * bp2 * (q4 * bpp2)\n",
+       "        - q2 * bp1 * (q7 * bpp3)\n",
+       "        - q5 * bp2 * (q7 * bpp3)\n",
+       "        - q2 * bp1 * (q10 * bpp4)\n",
+       "        - q5 * bp2 * (q10 * bpp4)\n",
+       "        - q8 * bp3 * (q1 * bpp1)\n",
+       "        - q8 * bp3 * (q4 * bpp2)\n",
+       "        - q8 * bp3 * (q7 * bpp3)\n",
+       "        - q8 * bp3 * (q10 * bpp4)\n",
+       "        - q11 * bp4 * (q1 * bpp1)\n",
+       "        - q11 * bp4 * (q4 * bpp2)\n",
+       "        - q11 * bp4 * (q7 * bpp3)\n",
+       "        - q11 * bp4 * (q10 * bpp4)\n",
+       "    )\n",
+       "    ** Value.int(Int(2))\n",
+       ") / (\n",
+       "    (q1 * bp1 + q4 * bp2 + q7 * bp3 + q10 * bp4) ** Value.int(Int(2))\n",
+       "    + (q2 * bp1 + q5 * bp2 + q8 * bp3 + q11 * bp4) ** Value.int(Int(2))\n",
+       "    + (q3 * bp1 + q6 * bp2 + q9 * bp3 + q12 * bp4) ** Value.int(Int(2))\n",
+       ") ** Value.int(\n",
+       "    Int(3)\n",
+       ")\n",
+       "
\n" + ], + "text/latex": [ + "\\begin{Verbatim}[commandchars=\\\\\\{\\}]\n", + "\\PY{p}{(}\n", + " \\PY{p}{(}\n", + " \\PY{n}{q2} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q3} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q2} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q6} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q2} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q9} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q2} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q12} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\n", + " \\PY{n}{q5} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q3} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q5} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q6} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q5} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q9} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q5} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q12} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\n", + " \\PY{n}{q8} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q3} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q8} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q6} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q8} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q9} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q8} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q12} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\n", + " \\PY{n}{q11} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q3} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q11} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q6} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q11} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q9} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q11} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q12} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q3} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q2} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q6} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q2} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q3} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q5} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q6} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q5} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q3} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q8} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q6} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q8} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q3} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q11} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q6} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q11} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q9} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q2} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q9} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q5} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q9} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q8} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q9} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q11} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q12} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q2} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q12} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q5} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q12} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q8} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q12} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q11} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\n", + " \\PY{n}{q3} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q1} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q3} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q4} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q3} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q7} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q3} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q10} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\n", + " \\PY{n}{q6} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q1} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q6} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q4} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q6} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q7} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q6} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q10} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\n", + " \\PY{n}{q9} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q1} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q9} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q4} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q9} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q7} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q9} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q10} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\n", + " \\PY{n}{q12} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q1} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q12} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q4} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q12} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q7} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q12} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q10} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q1} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q3} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q4} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q3} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q1} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q6} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q4} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q6} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q1} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q9} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q4} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q9} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q1} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q12} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q4} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q12} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q7} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q3} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q7} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q6} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q7} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q9} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q7} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q12} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q10} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q3} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q10} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q6} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q10} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q9} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q10} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q12} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\n", + " \\PY{n}{q1} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q2} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q1} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q5} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q1} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q8} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q1} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q11} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\n", + " \\PY{n}{q4} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q2} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q4} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q5} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q4} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q8} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q4} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q11} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\n", + " \\PY{n}{q7} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q2} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q7} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q5} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q7} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q8} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q7} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q11} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\n", + " \\PY{n}{q10} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q2} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q10} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q5} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q10} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q8} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{n}{q10} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q11} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q2} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q1} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q5} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q1} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q2} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q4} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q5} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q4} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q2} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q7} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q5} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q7} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q2} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q10} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q5} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q10} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q8} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q1} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q8} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q4} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q8} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q7} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q8} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q10} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q11} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q1} \\PY{o}{*} \\PY{n}{bpp1}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q11} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q4} \\PY{o}{*} \\PY{n}{bpp2}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q11} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q7} \\PY{o}{*} \\PY{n}{bpp3}\\PY{p}{)}\n", + " \\PY{o}{\\PYZhy{}} \\PY{n}{q11} \\PY{o}{*} \\PY{n}{bp4} \\PY{o}{*} \\PY{p}{(}\\PY{n}{q10} \\PY{o}{*} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + "\\PY{p}{)} \\PY{o}{/} \\PY{p}{(}\n", + " \\PY{p}{(}\\PY{n}{q1} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{+} \\PY{n}{q4} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{+} \\PY{n}{q7} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{+} \\PY{n}{q10} \\PY{o}{*} \\PY{n}{bp4}\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\\PY{n}{q2} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{+} \\PY{n}{q5} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{+} \\PY{n}{q8} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{+} \\PY{n}{q11} \\PY{o}{*} \\PY{n}{bp4}\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{o}{+} \\PY{p}{(}\\PY{n}{q3} \\PY{o}{*} \\PY{n}{bp1} \\PY{o}{+} \\PY{n}{q6} \\PY{o}{*} \\PY{n}{bp2} \\PY{o}{+} \\PY{n}{q9} \\PY{o}{*} \\PY{n}{bp3} \\PY{o}{+} \\PY{n}{q12} \\PY{o}{*} \\PY{n}{bp4}\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + "\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\n", + " \\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\n", + "\\PY{p}{)}\n", + "\\end{Verbatim}\n" + ], "text/plain": [ - "array(TupleValue.from_vec(Vec[Value](Value.int(Int(1)), Value.int(Int(2)))),\n", - " dtype=object)" + "(\n", + " (\n", + " q2 * bp1 * (q3 * bpp1)\n", + " + q2 * bp1 * (q6 * bpp2)\n", + " + q2 * bp1 * (q9 * bpp3)\n", + " + q2 * bp1 * (q12 * bpp4)\n", + " + (\n", + " q5 * bp2 * (q3 * bpp1)\n", + " + q5 * bp2 * (q6 * bpp2)\n", + " + q5 * bp2 * (q9 * bpp3)\n", + " + q5 * bp2 * (q12 * bpp4)\n", + " )\n", + " + (\n", + " q8 * bp3 * (q3 * bpp1)\n", + " + q8 * bp3 * (q6 * bpp2)\n", + " + q8 * bp3 * (q9 * bpp3)\n", + " + q8 * bp3 * (q12 * bpp4)\n", + " )\n", + " + (\n", + " q11 * bp4 * (q3 * bpp1)\n", + " + q11 * bp4 * (q6 * bpp2)\n", + " + q11 * bp4 * (q9 * bpp3)\n", + " + q11 * bp4 * (q12 * bpp4)\n", + " )\n", + " - q3 * bp1 * (q2 * bpp1)\n", + " - q6 * bp2 * (q2 * bpp1)\n", + " - q3 * bp1 * (q5 * bpp2)\n", + " - q6 * bp2 * (q5 * bpp2)\n", + " - q3 * bp1 * (q8 * bpp3)\n", + " - q6 * bp2 * (q8 * bpp3)\n", + " - q3 * bp1 * (q11 * bpp4)\n", + " - q6 * bp2 * (q11 * bpp4)\n", + " - q9 * bp3 * (q2 * bpp1)\n", + " - q9 * bp3 * (q5 * bpp2)\n", + " - q9 * bp3 * (q8 * bpp3)\n", + " - q9 * bp3 * (q11 * bpp4)\n", + " - q12 * bp4 * (q2 * bpp1)\n", + " - q12 * bp4 * (q5 * bpp2)\n", + " - q12 * bp4 * (q8 * bpp3)\n", + " - q12 * bp4 * (q11 * bpp4)\n", + " )\n", + " ** Value.int(Int(2))\n", + " + (\n", + " q3 * bp1 * (q1 * bpp1)\n", + " + q3 * bp1 * (q4 * bpp2)\n", + " + q3 * bp1 * (q7 * bpp3)\n", + " + q3 * bp1 * (q10 * bpp4)\n", + " + (\n", + " q6 * bp2 * (q1 * bpp1)\n", + " + q6 * bp2 * (q4 * bpp2)\n", + " + q6 * bp2 * (q7 * bpp3)\n", + " + q6 * bp2 * (q10 * bpp4)\n", + " )\n", + " + (\n", + " q9 * bp3 * (q1 * bpp1)\n", + " + q9 * bp3 * (q4 * bpp2)\n", + " + q9 * bp3 * (q7 * bpp3)\n", + " + q9 * bp3 * (q10 * bpp4)\n", + " )\n", + " + (\n", + " q12 * bp4 * (q1 * bpp1)\n", + " + q12 * bp4 * (q4 * bpp2)\n", + " + q12 * bp4 * (q7 * bpp3)\n", + " + q12 * bp4 * (q10 * bpp4)\n", + " )\n", + " - q1 * bp1 * (q3 * bpp1)\n", + " - q4 * bp2 * (q3 * bpp1)\n", + " - q1 * bp1 * (q6 * bpp2)\n", + " - q4 * bp2 * (q6 * bpp2)\n", + " - q1 * bp1 * (q9 * bpp3)\n", + " - q4 * bp2 * (q9 * bpp3)\n", + " - q1 * bp1 * (q12 * bpp4)\n", + " - q4 * bp2 * (q12 * bpp4)\n", + " - q7 * bp3 * (q3 * bpp1)\n", + " - q7 * bp3 * (q6 * bpp2)\n", + " - q7 * bp3 * (q9 * bpp3)\n", + " - q7 * bp3 * (q12 * bpp4)\n", + " - q10 * bp4 * (q3 * bpp1)\n", + " - q10 * bp4 * (q6 * bpp2)\n", + " - q10 * bp4 * (q9 * bpp3)\n", + " - q10 * bp4 * (q12 * bpp4)\n", + " )\n", + " ** Value.int(Int(2))\n", + " + (\n", + " q1 * bp1 * (q2 * bpp1)\n", + " + q1 * bp1 * (q5 * bpp2)\n", + " + q1 * bp1 * (q8 * bpp3)\n", + " + q1 * bp1 * (q11 * bpp4)\n", + " + (\n", + " q4 * bp2 * (q2 * bpp1)\n", + " + q4 * bp2 * (q5 * bpp2)\n", + " + q4 * bp2 * (q8 * bpp3)\n", + " + q4 * bp2 * (q11 * bpp4)\n", + " )\n", + " + (\n", + " q7 * bp3 * (q2 * bpp1)\n", + " + q7 * bp3 * (q5 * bpp2)\n", + " + q7 * bp3 * (q8 * bpp3)\n", + " + q7 * bp3 * (q11 * bpp4)\n", + " )\n", + " + (\n", + " q10 * bp4 * (q2 * bpp1)\n", + " + q10 * bp4 * (q5 * bpp2)\n", + " + q10 * bp4 * (q8 * bpp3)\n", + " + q10 * bp4 * (q11 * bpp4)\n", + " )\n", + " - q2 * bp1 * (q1 * bpp1)\n", + " - q5 * bp2 * (q1 * bpp1)\n", + " - q2 * bp1 * (q4 * bpp2)\n", + " - q5 * bp2 * (q4 * bpp2)\n", + " - q2 * bp1 * (q7 * bpp3)\n", + " - q5 * bp2 * (q7 * bpp3)\n", + " - q2 * bp1 * (q10 * bpp4)\n", + " - q5 * bp2 * (q10 * bpp4)\n", + " - q8 * bp3 * (q1 * bpp1)\n", + " - q8 * bp3 * (q4 * bpp2)\n", + " - q8 * bp3 * (q7 * bpp3)\n", + " - q8 * bp3 * (q10 * bpp4)\n", + " - q11 * bp4 * (q1 * bpp1)\n", + " - q11 * bp4 * (q4 * bpp2)\n", + " - q11 * bp4 * (q7 * bpp3)\n", + " - q11 * bp4 * (q10 * bpp4)\n", + " )\n", + " ** Value.int(Int(2))\n", + ") / (\n", + " (q1 * bp1 + q4 * bp2 + q7 * bp3 + q10 * bp4) ** Value.int(Int(2))\n", + " + (q2 * bp1 + q5 * bp2 + q8 * bp3 + q11 * bp4) ** Value.int(Int(2))\n", + " + (q3 * bp1 + q6 * bp2 + q9 * bp3 + q12 * bp4) ** Value.int(Int(2))\n", + ") ** Value.int(\n", + " Int(3)\n", + ")" ] }, - "execution_count": 7, "metadata": {}, - "output_type": "execute_result" + "output_type": "display_data" } ], "source": [ - "np.array(enp.TupleValue.from_vec((1, 2)))" + "@egglog.ruleset\n", + "def distribute(a: enp.Value, b: enp.Value, c: enp.Value):\n", + " yield egglog.rewrite((a + b) * c, subsume=True).to(a * c + b * c)\n", + " yield egglog.rewrite(c * (a + b), subsume=True).to(c * a + c * b)\n", + " yield egglog.rewrite((a - b) * c, subsume=True).to(a * c - b * c)\n", + " yield egglog.rewrite(c * (a - b), subsume=True).to(c * a - c * b)\n", + " # Push down subtraction\n", + " yield egglog.rewrite(a - (b + c), subsume=True).to(a - b - c)\n", + " yield egglog.rewrite(a - (b - c), subsume=True).to(a - b + c)\n", + "\n", + "\n", + "egraph.run(distribute.saturate())\n", + "res, cost = egraph.extract(res_simp, cost_model=arith_cost_model, include_cost=True)\n", + "print(cost.total.not_div_ops)\n", + "print(cost)\n", + "res" + ] + }, + { + "cell_type": "code", + "execution_count": 8, + "id": "92dd05d5", + "metadata": {}, + "outputs": [ + { + "data": { + "text/html": [ + "
_Value_1 = polynomial(\n",
+       "    MultiSet(\n",
+       "        MultiSet(q2, bp1), MultiSet(bp2, q5), MultiSet(bp3, q8), MultiSet(q11, bp4)\n",
+       "    )\n",
+       ")\n",
+       "_Value_2 = polynomial(\n",
+       "    MultiSet(\n",
+       "        MultiSet(bpp1, q3), MultiSet(q6, bpp2), MultiSet(q9, bpp3), MultiSet(q12, bpp4)\n",
+       "    )\n",
+       ")\n",
+       "_Value_3 = polynomial(\n",
+       "    MultiSet(\n",
+       "        MultiSet(bp1, q3), MultiSet(bp2, q6), MultiSet(q9, bp3), MultiSet(q12, bp4)\n",
+       "    )\n",
+       ")\n",
+       "_Value_4 = polynomial(\n",
+       "    MultiSet(\n",
+       "        MultiSet(bpp1, q2), MultiSet(q5, bpp2), MultiSet(q8, bpp3), MultiSet(bpp4, q11)\n",
+       "    )\n",
+       ")\n",
+       "_Value_5 = polynomial(\n",
+       "    MultiSet(\n",
+       "        MultiSet(bpp1, q1), MultiSet(bpp2, q4), MultiSet(q7, bpp3), MultiSet(bpp4, q10)\n",
+       "    )\n",
+       ")\n",
+       "_Value_6 = polynomial(\n",
+       "    MultiSet(\n",
+       "        MultiSet(bp1, q1), MultiSet(bp2, q4), MultiSet(q7, bp3), MultiSet(q10, bp4)\n",
+       "    )\n",
+       ")\n",
+       "polynomial(\n",
+       "    MultiSet(\n",
+       "        MultiSet(\n",
+       "            polynomial(\n",
+       "                MultiSet(\n",
+       "                    MultiSet(_Value_1, _Value_2),\n",
+       "                    MultiSet(_Value_3, _Value_4, Value.int(Int(-1))),\n",
+       "                )\n",
+       "            )\n",
+       "            ** Value.int(Int(2))\n",
+       "        ),\n",
+       "        MultiSet(\n",
+       "            polynomial(\n",
+       "                MultiSet(\n",
+       "                    MultiSet(_Value_3, _Value_5),\n",
+       "                    MultiSet(_Value_6, _Value_2, Value.int(Int(-1))),\n",
+       "                )\n",
+       "            )\n",
+       "            ** Value.int(Int(2))\n",
+       "        ),\n",
+       "        MultiSet(\n",
+       "            polynomial(\n",
+       "                MultiSet(\n",
+       "                    MultiSet(_Value_4, _Value_6),\n",
+       "                    MultiSet(_Value_1, _Value_5, Value.int(Int(-1))),\n",
+       "                )\n",
+       "            )\n",
+       "            ** Value.int(Int(2))\n",
+       "        ),\n",
+       "    )\n",
+       ") / polynomial(\n",
+       "    MultiSet(\n",
+       "        MultiSet(_Value_6 ** Value.int(Int(2))),\n",
+       "        MultiSet(_Value_1 ** Value.int(Int(2))),\n",
+       "        MultiSet(_Value_3 ** Value.int(Int(2))),\n",
+       "    )\n",
+       ") ** Value.int(\n",
+       "    Int(3)\n",
+       ")\n",
+       "
\n" + ], + "text/latex": [ + "\\begin{Verbatim}[commandchars=\\\\\\{\\}]\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}1} \\PY{o}{=} \\PY{n}{polynomial}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q2}\\PY{p}{,} \\PY{n}{bp1}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bp2}\\PY{p}{,} \\PY{n}{q5}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bp3}\\PY{p}{,} \\PY{n}{q8}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q11}\\PY{p}{,} \\PY{n}{bp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + "\\PY{p}{)}\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}2} \\PY{o}{=} \\PY{n}{polynomial}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bpp1}\\PY{p}{,} \\PY{n}{q3}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q6}\\PY{p}{,} \\PY{n}{bpp2}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q9}\\PY{p}{,} \\PY{n}{bpp3}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q12}\\PY{p}{,} \\PY{n}{bpp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + "\\PY{p}{)}\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}3} \\PY{o}{=} \\PY{n}{polynomial}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bp1}\\PY{p}{,} \\PY{n}{q3}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bp2}\\PY{p}{,} \\PY{n}{q6}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q9}\\PY{p}{,} \\PY{n}{bp3}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q12}\\PY{p}{,} \\PY{n}{bp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + "\\PY{p}{)}\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}4} \\PY{o}{=} \\PY{n}{polynomial}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bpp1}\\PY{p}{,} \\PY{n}{q2}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q5}\\PY{p}{,} \\PY{n}{bpp2}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q8}\\PY{p}{,} \\PY{n}{bpp3}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bpp4}\\PY{p}{,} \\PY{n}{q11}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + "\\PY{p}{)}\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}5} \\PY{o}{=} \\PY{n}{polynomial}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bpp1}\\PY{p}{,} \\PY{n}{q1}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bpp2}\\PY{p}{,} \\PY{n}{q4}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q7}\\PY{p}{,} \\PY{n}{bpp3}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bpp4}\\PY{p}{,} \\PY{n}{q10}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + "\\PY{p}{)}\n", + "\\PY{n}{\\PYZus{}Value\\PYZus{}6} \\PY{o}{=} \\PY{n}{polynomial}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bp1}\\PY{p}{,} \\PY{n}{q1}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{bp2}\\PY{p}{,} \\PY{n}{q4}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q7}\\PY{p}{,} \\PY{n}{bp3}\\PY{p}{)}\\PY{p}{,} \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{q10}\\PY{p}{,} \\PY{n}{bp4}\\PY{p}{)}\n", + " \\PY{p}{)}\n", + "\\PY{p}{)}\n", + "\\PY{n}{polynomial}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{polynomial}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}1}\\PY{p}{,} \\PY{n}{\\PYZus{}Value\\PYZus{}2}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}3}\\PY{p}{,} \\PY{n}{\\PYZus{}Value\\PYZus{}4}\\PY{p}{,} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{o}{\\PYZhy{}}\\PY{l+m+mi}{1}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{polynomial}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}3}\\PY{p}{,} \\PY{n}{\\PYZus{}Value\\PYZus{}5}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}6}\\PY{p}{,} \\PY{n}{\\PYZus{}Value\\PYZus{}2}\\PY{p}{,} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{o}{\\PYZhy{}}\\PY{l+m+mi}{1}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{polynomial}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}4}\\PY{p}{,} \\PY{n}{\\PYZus{}Value\\PYZus{}6}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}1}\\PY{p}{,} \\PY{n}{\\PYZus{}Value\\PYZus{}5}\\PY{p}{,} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{o}{\\PYZhy{}}\\PY{l+m+mi}{1}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{p}{)}\n", + " \\PY{p}{)}\n", + " \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\n", + " \\PY{p}{)}\\PY{p}{,}\n", + " \\PY{p}{)}\n", + "\\PY{p}{)} \\PY{o}{/} \\PY{n}{polynomial}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}6} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}1} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{n}{MultiSet}\\PY{p}{(}\\PY{n}{\\PYZus{}Value\\PYZus{}3} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{2}\\PY{p}{)}\\PY{p}{)}\\PY{p}{)}\\PY{p}{,}\n", + " \\PY{p}{)}\n", + "\\PY{p}{)} \\PY{o}{*}\\PY{o}{*} \\PY{n}{Value}\\PY{o}{.}\\PY{n}{int}\\PY{p}{(}\n", + " \\PY{n}{Int}\\PY{p}{(}\\PY{l+m+mi}{3}\\PY{p}{)}\n", + "\\PY{p}{)}\n", + "\\end{Verbatim}\n" + ], + "text/plain": [ + "_Value_1 = polynomial(\n", + " MultiSet(\n", + " MultiSet(q2, bp1), MultiSet(bp2, q5), MultiSet(bp3, q8), MultiSet(q11, bp4)\n", + " )\n", + ")\n", + "_Value_2 = polynomial(\n", + " MultiSet(\n", + " MultiSet(bpp1, q3), MultiSet(q6, bpp2), MultiSet(q9, bpp3), MultiSet(q12, bpp4)\n", + " )\n", + ")\n", + "_Value_3 = polynomial(\n", + " MultiSet(\n", + " MultiSet(bp1, q3), MultiSet(bp2, q6), MultiSet(q9, bp3), MultiSet(q12, bp4)\n", + " )\n", + ")\n", + "_Value_4 = polynomial(\n", + " MultiSet(\n", + " MultiSet(bpp1, q2), MultiSet(q5, bpp2), MultiSet(q8, bpp3), MultiSet(bpp4, q11)\n", + " )\n", + ")\n", + "_Value_5 = polynomial(\n", + " MultiSet(\n", + " MultiSet(bpp1, q1), MultiSet(bpp2, q4), MultiSet(q7, bpp3), MultiSet(bpp4, q10)\n", + " )\n", + ")\n", + "_Value_6 = polynomial(\n", + " MultiSet(\n", + " MultiSet(bp1, q1), MultiSet(bp2, q4), MultiSet(q7, bp3), MultiSet(q10, bp4)\n", + " )\n", + ")\n", + "polynomial(\n", + " MultiSet(\n", + " MultiSet(\n", + " polynomial(\n", + " MultiSet(\n", + " MultiSet(_Value_1, _Value_2),\n", + " MultiSet(_Value_3, _Value_4, Value.int(Int(-1))),\n", + " )\n", + " )\n", + " ** Value.int(Int(2))\n", + " ),\n", + " MultiSet(\n", + " polynomial(\n", + " MultiSet(\n", + " MultiSet(_Value_3, _Value_5),\n", + " MultiSet(_Value_6, _Value_2, Value.int(Int(-1))),\n", + " )\n", + " )\n", + " ** Value.int(Int(2))\n", + " ),\n", + " MultiSet(\n", + " polynomial(\n", + " MultiSet(\n", + " MultiSet(_Value_4, _Value_6),\n", + " MultiSet(_Value_1, _Value_5, Value.int(Int(-1))),\n", + " )\n", + " )\n", + " ** Value.int(Int(2))\n", + " ),\n", + " )\n", + ") / polynomial(\n", + " MultiSet(\n", + " MultiSet(_Value_6 ** Value.int(Int(2))),\n", + " MultiSet(_Value_1 ** Value.int(Int(2))),\n", + " MultiSet(_Value_3 ** Value.int(Int(2))),\n", + " )\n", + ") ** Value.int(\n", + " Int(3)\n", + ")" + ] + }, + "metadata": {}, + "output_type": "display_data" + } + ], + "source": [ + "egraph = egglog.EGraph()\n", + "egraph.register(res_simp)\n", + "egraph.run(enp.polynomial_schedule)\n", + "egraph.extract(res_simp)" ] }, { "cell_type": "code", "execution_count": null, - "id": "52b48740", + "id": "a1484b1d", "metadata": {}, "outputs": [], - "source": [] + "source": [ + "# CSE while doing polynomial to bin ops, i.e. a*c vs c*a\n", + "\n", + "# enhance with bernstein coefficients and derivatives" + ] } ], "metadata": { diff --git a/pyproject.toml b/pyproject.toml index bc3cc972..42116778 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -146,8 +146,6 @@ ignore = [ "ANN201", # Allow uppercase args "N803", - # allow generic df name - "PD901", # Allow future anywhere in file "F404", # allow imports anywhere in cell @@ -206,6 +204,8 @@ ignore = [ "TC003", # allow eq without hash "PLW1641", + # allow non module file for docs + "INP001", ] select = ["ALL"] diff --git a/python/egglog/builtins.py b/python/egglog/builtins.py index f52e6dfd..46246ea2 100644 --- a/python/egglog/builtins.py +++ b/python/egglog/builtins.py @@ -57,6 +57,7 @@ "i64Like", "join", "multiset_flat_map", + "multiset_fold", "multiset_not_contains_swapped", "multiset_remove_swapped", "py_eval", @@ -284,8 +285,11 @@ def bool_le(self, other: i64Like) -> Bool: ... @method(egg_fn="bool->=") def bool_ge(self, other: i64Like) -> Bool: ... + @method(egg_fn="abs") + def __abs__(self) -> i64: ... + -# The types which can be convertered into an i64 +# The types which can be converted into an i64 i64Like: TypeAlias = i64 | int # noqa: N816, PYI042 converter(int, i64, i64) @@ -351,6 +355,9 @@ def __rtruediv__(self, other: f64Like) -> f64: ... def __rmod__(self, other: f64Like) -> f64: ... + @method(egg_fn="abs") + def __abs__(self) -> f64: ... + @method(egg_fn="<") def __lt__(self, other: f64Like) -> Unit: # type: ignore[has-type] ... @@ -588,7 +595,7 @@ def pick(self) -> T: ... def __add__(self, other: MultiSet[T]) -> MultiSet[T]: ... @method(egg_fn="unstable-multiset-map", reverse_args=True) - def map(self, f: Callable[[T], T]) -> MultiSet[T]: ... + def map(self, f: Callable[[T], V]) -> MultiSet[V]: ... @method(egg_fn="unstable-multiset-fill-index") def fill_index(self, f: Callable[[MultiSet[T], T], i64]) -> Unit: ... @@ -609,7 +616,7 @@ def filter(self, f: Callable[[T], Unit]) -> MultiSet[T]: ... def reset_counts(self) -> MultiSet[T]: ... -# TODO: Move to method when partial suppors reverse_args +# TODO: Move to method when partial supports reverse_args @function(egg_fn="unstable-multiset-flat-map", builtin=True) def multiset_flat_map(f: Callable[[T], MultiSet[T]], xs: MultiSet[T]) -> MultiSet[T]: ... @@ -622,6 +629,10 @@ def multiset_remove_swapped(x: T, xs: MultiSet[T]) -> MultiSet[T]: ... def multiset_not_contains_swapped(x: T, xs: MultiSet[T]) -> Unit: ... +@function(egg_fn="multiset-fold", builtin=True) +def multiset_fold(f: Callable[[T, T], T], initial: T, xs: MultiSet[T]) -> T: ... + + converter( tuple, MultiSet, diff --git a/python/egglog/conversion.py b/python/egglog/conversion.py index 88f70f0b..9fecffe2 100644 --- a/python/egglog/conversion.py +++ b/python/egglog/conversion.py @@ -232,7 +232,7 @@ def resolve_literal( """ arg_type = resolve_type(arg) - # If we have any type variables, dont bother trying to resolve the literal, just return the arg + # If we have any type variables, don't bother trying to resolve the literal, just return the arg try: tp_just = tp.to_just() except TypeVarError: diff --git a/python/egglog/deconstruct.py b/python/egglog/deconstruct.py index 26a35622..65951683 100644 --- a/python/egglog/deconstruct.py +++ b/python/egglog/deconstruct.py @@ -23,7 +23,14 @@ T = TypeVar("T", bound=BaseExpr) TS = TypeVarTuple("TS", default=Unpack[tuple[BaseExpr, ...]]) -__all__ = ["get_callable_args", "get_callable_fn", "get_let_name", "get_literal_value", "get_var_name"] +__all__ = [ + "get_callable_args", + "get_callable_fn", + "get_constant_name", + "get_let_name", + "get_literal_value", + "get_var_name", +] @overload @@ -74,6 +81,19 @@ def get_literal_value(x: object) -> object: return None +def get_constant_name(x: BaseExpr) -> Ident | None: + """ + Check if the expression is a constant and return its name. + If it is not a constant, return None. + """ + if not isinstance(x, RuntimeExpr): + raise TypeError(f"Expected Expression, got {type(x).__name__}") + match x.__egg_typed_expr__.expr: + case CallDecl(ConstantRef(ident)): + return ident + return None + + def get_let_name(x: BaseExpr) -> str | None: """ Check if the expression is a `let` expression and return the name of the variable. @@ -169,7 +189,7 @@ def _deconstruct_call_decl( ), arg_exprs egg_bound = ( JustTypeRef(call.callable.ident, call.bound_tp_params or ()) - if isinstance(call.callable, ClassMethodRef) + if isinstance(call.callable, (ClassMethodRef, MethodRef)) else None ) diff --git a/python/egglog/egraph_state.py b/python/egglog/egraph_state.py index b720f038..6326ae99 100644 --- a/python/egglog/egraph_state.py +++ b/python/egglog/egraph_state.py @@ -533,7 +533,7 @@ def _transform_let(self, typed_expr: TypedExprDecl) -> TypedExprDecl | None: Rewrites this expression as a let binding if it's not already a let binding. """ # TODO: Replace with counter so that it works with hash collisions and is more stable - var_decl = LetRefDecl(f"__expr_{hash(typed_expr)}") + var_decl = LetRefDecl(f"$__expr_{hash(typed_expr)}") if var_decl in self.expr_to_egg_cache: return None var_egg = self._expr_to_egg(var_decl) diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index 4269c0a3..ea908cff 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -23,8 +23,8 @@ It is troublesome to have to redefine lists for every type. It would be nice to have generic types, but they are not implemented yet. -We are gauranteed that all lists with known lengths will be represented as cons/empty. To safely use lists, use -the `.length` and `.__getitem__` methods, unles you want to to depend on it having known length, in which +We are guaranteed that all lists with known lengths will be represented as cons/empty. To safely use lists, use +the `.length` and `.__getitem__` methods, unless you want to depend on it having known length, in which case you can match directly on the cons list. To be a list, you must implement two methods: @@ -41,7 +41,7 @@ Also all lists constructors must be converted to the functional representation, so that we can match on it and convert lists with known lengths into cons lists and into vectors. -This is neccessary so that known length lists are properly materialized during extraction. +This is necessary so that known length lists are properly materialized during extraction. Q: Why are they implemented as SNOC lists instead of CONS lists? A: So that when converting from functional to lists we can use the same index function by starting at the end and folding @@ -62,6 +62,7 @@ import sys from collections.abc import Callable from copy import copy +from functools import partial from types import EllipsisType from typing import TYPE_CHECKING, Any, ClassVar, TypeAlias, cast @@ -149,6 +150,7 @@ def __invert__(self) -> Int: ... def __lt__(self, other: IntLike) -> Boolean: ... def __le__(self, other: IntLike) -> Boolean: ... + def __abs__(self) -> Int: ... def __eq__(self, other: IntLike) -> Boolean: # type: ignore[override] ... @@ -287,6 +289,7 @@ def _int(i: i64, j: i64, r: Boolean, o: Int, b: Int): yield rewrite(Int(i) << Int(j)).to(Int(i << j)) yield rewrite(Int(i) >> Int(j)).to(Int(i >> j)) yield rewrite(~Int(i)).to(Int(~i)) + yield rewrite(abs(Int(i))).to(Int(abs(i))) yield rewrite(Int.if_(TRUE, o, b), subsume=True).to(o) yield rewrite(Int.if_(FALSE, o, b), subsume=True).to(b) @@ -371,6 +374,7 @@ def __mul__(self, other: FloatLike) -> Float: ... def __add__(self, other: FloatLike) -> Float: ... def __sub__(self, other: FloatLike) -> Float: ... + def __abs__(self) -> Float: ... def __pow__(self, other: FloatLike) -> Float: ... def __round__(self, ndigits: OptionalIntLike = None) -> Float: ... @@ -424,8 +428,8 @@ def _float(fl: Float, f: f64, f2: f64, i: i64, r: BigRat, r1: BigRat, i_: Int): rewrite(Float(f) < Float(f2)).to(TRUE, f < f2), rewrite(Float.rational(r) == Float.rational(r)).to(TRUE), rewrite(Float.rational(r) == Float.rational(r1)).to(FALSE, ne(r).to(r1)), - # round rewrite(Float.rational(r).__round__()).to(Float.rational(r.round())), + rewrite(abs(Float(f))).to(Float(abs(f))), ] @@ -513,6 +517,7 @@ def product(self) -> Int: def map_tuple_int(self, f: Callable[[Int], TupleInt]) -> TupleTupleInt: return TupleTupleInt(self.length(), lambda i: f(self[i])) + @method(subsume=True) def map_value(self, f: Callable[[Int], Value]) -> TupleValue: return TupleValue(self.length(), lambda i: f(self[i])) @@ -558,8 +563,14 @@ def _tuple_int( ti: TupleInt, ti2: TupleInt, k: i64, + vi: Vec[Int], ): return [ + # TODO: Just remove tuple and instead use map on vec to materialize indices? + rewrite(TupleInt.from_vec(vi)).to(TupleInt.EMPTY, vi.length() == i64(0)), + rewrite(TupleInt.from_vec(vi)).to( + TupleInt.from_vec(vi.pop()).append(vi[vi.length() - 1]), vi.length() > i64(0) + ), rule(eq(ti).to(TupleInt.from_vec(vs))).then(set_(ti.to_vec).to(vs)), # Functional access rewrite(TupleInt(i, idx_fn).length()).to(i), @@ -835,6 +846,9 @@ def __truediv__(self, other: ValueLike) -> Value: ... def __mul__(self, other: ValueLike) -> Value: ... def __add__(self, other: ValueLike) -> Value: ... def __sub__(self, other: ValueLike) -> Value: ... + def __pow__(self, other: ValueLike) -> Value: ... + + def __abs__(self) -> Value: ... def astype(self, dtype: DType) -> Value: ... @@ -887,7 +901,7 @@ def __float__(self) -> float: # type: ignore[valid-type] @array_api_ruleset.register -def _value(i: Int, f: Float, b: Boolean, v: Value, v1: Value, i1: Int, f1: Float, b1: Boolean): +def _value(i: Int, f: Float, b: Boolean, v: Value, v1: Value, v2: Value, i1: Int, f1: Float, b1: Boolean): # Default dtypes # https://data-apis.org/array-api/latest/API_specification/data_types.html?highlight=dtype#default-data-types yield rewrite(Value.int(i).dtype).to(DType.int64) @@ -941,6 +955,24 @@ def _value(i: Int, f: Float, b: Boolean, v: Value, v1: Value, i1: Int, f1: Float # - yield rewrite(Value.float(f) - Value.float(f1)).to(Value.float(f - f1)) yield rewrite(Value.int(i) - Value.int(i1)).to(Value.int(i - i1)) + # ** + yield rewrite(Value.float(f) ** Value.float(f1)).to(Value.float(f**f1)) + yield rewrite(Value.int(i) ** Value.int(i1)).to(Value.int(i**i1)) + yield rewrite(Value.int(i) ** Value.float(f1)).to(Value.float(Float.from_int(i) ** f1)) + + # abs + yield rewrite(abs(Value.int(i))).to(Value.int(abs(i))) + yield rewrite(abs(Value.float(f))).to(Value.float(abs(f))) + # abs(x) **2 = x**2 + yield rewrite(abs(v) ** Value.float(Float.rational(BigRat(2, 1)))).to(v ** Value.float(2)) + + # ** distributes over division + yield rewrite((v1 / v) ** v2, subsume=True).to(v1**v2 / (v**v2)) + # x ** y ** z = x ** (y * z) + yield rewrite((v**v1) ** v2, subsume=True).to(v ** (v1 * v2)) + yield rewrite(Value.float(f) * Value.int(i)).to(Value.float(f * Float.from_int(i))) + yield rewrite(v ** Value.float(Float.rational(BigRat(1, 1)))).to(v) + yield rewrite(Value.float(Float.from_int(i))).to(Value.int(i)) class TupleValue(Expr, ruleset=array_api_ruleset): @@ -967,6 +999,8 @@ def __getitem__(self, i: IntLike) -> Value: ... def foldl_boolean(self, f: Callable[[Boolean, Value], Boolean], init: BooleanLike) -> Boolean: ... def foldl_value(self, f: Callable[[Value, Value], Value], init: ValueLike) -> Value: ... + def map_value(self, f: Callable[[Value], Value]) -> TupleValue: + return TupleValue(self.length(), lambda i: f(self[i])) def contains(self, value: ValueLike) -> Boolean: value = cast("Value", value) @@ -1338,6 +1372,8 @@ def __rxor__(self, other: NDArray) -> NDArray: ... def __ror__(self, other: NDArray) -> NDArray: ... + def __abs__(self) -> NDArray: ... + @classmethod def scalar(cls, value: ValueLike) -> NDArray: value = cast("Value", value) @@ -1358,6 +1394,12 @@ def T(self) -> NDArray: """ https://data-apis.org/array-api/2022.12/API_specification/generated/array_api.array.T.html#array_api.array.T """ + # Only works on 2D arrays + return NDArray( + (self.shape[1], self.shape[0]), + self.dtype, + lambda idx: self.index((idx[1], idx[0])), + ) @classmethod def vector(cls, values: TupleValueLike) -> NDArray: @@ -1458,6 +1500,9 @@ def _ndarray( tv: TupleValue, v: Value, v1: Value, + l: Int, + vi: Vec[Int], + shape_idx_fn: Callable[[Int], Int], ): return [ rewrite(NDArray(shape, dtype, idx_fn).shape).to(shape), @@ -1468,6 +1513,10 @@ def _ndarray( # Converting to a value requires a scalar bool value rewrite(x.to_value()).to(x.index(TupleInt.EMPTY)), rewrite(NDArray.vector(tv).to_values()).to(tv), + rewrite(NDArray(TupleInt.from_vec(vi), dtype, idx_fn).to_values(), subsume=True).to( + TupleValue(vi[0], lambda i: idx_fn(TupleInt.EMPTY.append(i))), + vi.length() == i64(1), + ), # TODO: Push these down to float rewrite(NDArray.scalar(v) / NDArray.scalar(v)).to(NDArray.scalar(v / v)), rewrite(NDArray.scalar(v) + NDArray.scalar(v)).to(NDArray.scalar(v + v)), @@ -1482,11 +1531,16 @@ def _ndarray( rewrite(NDArray.scalar(v) >= NDArray.scalar(v1)).to(NDArray.scalar(v >= v1)), # Transpose of tranpose is the original array rewrite(x.T.T).to(x), + # rewrite(reshape(x, shape).T, subsume=True).to(reshape(x, shape.reverse())), + # rewrite(reshape(x, shape).shape).to(shape), # if_ rewrite(NDArray.if_(TRUE, x, x1)).to(x), rewrite(NDArray.if_(FALSE, x, x1)).to(x1), # convert to scalar rewrite(NDArray(TupleInt.EMPTY, dtype, idx_fn)).to(NDArray.scalar(idx_fn(TupleInt.EMPTY))), + # Scalars should push operators down + rewrite(NDArray.scalar(v) / NDArray.scalar(v1)).to(NDArray.scalar(v / v1)), + rewrite(NDArray.scalar(v) ** NDArray.scalar(v1)).to(NDArray.scalar(v**v1)), ] @@ -1786,10 +1840,6 @@ def square(x: NDArray) -> NDArray: ... def any(x: NDArray) -> NDArray: ... -@function(egg_fn="ndarray-abs") -def abs(x: NDArray) -> NDArray: ... - - @function(egg_fn="ndarray-log") def log(x: NDArray) -> NDArray: ... @@ -1851,13 +1901,13 @@ def real(x: NDArray) -> NDArray: ... def conj(x: NDArray) -> NDArray: ... -@function(ruleset=array_api_ruleset) +@function(ruleset=array_api_ruleset, subsume=True) def vecdot(x1: NDArrayLike, x2: NDArrayLike) -> NDArray: """ https://data-apis.org/array-api/2022.12/API_specification/generated/array_api.vecdot.html https://numpy.org/doc/stable/reference/generated/numpy.vecdot.html - TODO: Support axis, complex numbers, and broadcasting + TODO: Support axis, complex numbers, broadcasting, and more than matrix-vector >>> v = NDArray.matrix([[0., 5., 0.], [0., 0., 10.], [0., 6., 8.]]) >>> n = NDArray.vector([0., 0.6, 0.8]) @@ -1870,26 +1920,54 @@ def vecdot(x1: NDArrayLike, x2: NDArrayLike) -> NDArray: return NDArray( x1.shape.drop_last(), x1.dtype, - lambda idx: TupleInt.range(x1.shape.last()) - .map_value(lambda i: x1.index(idx.append(i)) * x2.index(idx.append(i))) - .foldl_value(Value.__add__, Value.float(0)), + lambda idx: ( + TupleInt.range(x1.shape.last()) + .map_value(lambda i: x1.index(idx.append(i)) * x2.index((i,))) + .foldl_value(Value.__add__, Value.float(0)) + ), ) -@function +@function(ruleset=array_api_ruleset, subsume=True) def vector_norm(x: NDArrayLike) -> NDArray: """ https://data-apis.org/array-api/2022.12/extensions/generated/array_api.linalg.vector_norm.html TODO: support axis + >>> x = NDArray.vector([1, 2, 3, 4, 5, 6, 7, 8, 9]) + >>> vector_norm(x).eval_numpy("float64") + array(16.88194302) """ + # https://numpy.org/doc/stable/reference/generated/numpy.linalg.norm.html#numpy.linalg.norm + # sum(abs(x)**ord)**(1./ord) where ord=2 + x = cast("NDArray", x) + # Only works on vectors + return NDArray.scalar( + x.to_values().map_value(lambda v: abs(v) ** Value.float(Float(2.0))).foldl_value(Value.__add__, Value.float(0)) + ** Value.float(Float(0.5)) + ) -@function +@function(ruleset=array_api_ruleset, subsume=True) def cross(a: NDArrayLike, b: NDArrayLike) -> NDArray: """ https://data-apis.org/array-api/2022.12/extensions/generated/array_api.linalg.cross.html - TODO: support axis + TODO: support axis, and more than two vecs + + >>> x = NDArray.vector([1, 2, 3]) + >>> y = NDArray.vector([4, 5, 6]) + >>> cross(x, y).eval_numpy("int64") + array([-3, 6, -3]) """ + a = cast("NDArray", a) + b = cast("NDArray", b) + return NDArray( + (3,), + a.dtype, + lambda idx: ( + (a.index(((idx[0] + 1) % 3,)) * b.index(((idx[0] + 2) % 3,))) + - (a.index(((idx[0] + 2) % 3,)) * b.index(((idx[0] + 1) % 3,))) + ), + ) linalg = sys.modules[__name__] @@ -2283,7 +2361,7 @@ def array_api_functional_ruleset( idx_fn: Callable[[TupleInt], Value], ): # TODO: Support -1 in shape like numpy does - yield rewrite(reshape(NDArray(old_shape, dtype, idx_fn), shape, ob)).to( + yield rewrite(reshape(NDArray(old_shape, dtype, idx_fn), shape, ob), subsume=True).to( NDArray(shape, dtype, lambda idx: idx_fn(unravel_index(ravel_index(idx, shape), old_shape))) ) @@ -2329,3 +2407,127 @@ def try_evaling(egraph: EGraph, schedule: Schedule, expr: Expr, prim_expr: Built e.add_note(f"Cannot evaluate {egraph.extract(expr)}") raise return extracted.value # type: ignore[attr-defined] + + +## +# Polynomials +## + + +@function +def monomial(x: MultiSetLike[Value, ValueLike]) -> Value: ... + + +@function(merge=lambda old, new: new) +def get_monomial(x: Value) -> MultiSet[Value]: + """ + Only defined on monomials: + + get_monomial(monomial(xs)) => xs + """ + + +@function(merge=lambda old, new: new) +def get_sole_polynomial(xs: MultiSet[Value]) -> MultiSet[MultiSet[Value]]: + """ + Only defined on monomials that contain a single polynomial: + + get_sole_polynomial(MultiSet(polynomial(xs))) => xs + """ + + +@function +def polynomial(x: MultiSetLike[MultiSet[Value], MultiSetLike[Value, ValueLike]]) -> Value: ... + + +@ruleset +def to_polynomial_ruleset( + n1: Value, + n2: Value, + n3: Value, + mss: MultiSet[MultiSet[Value]], + mss1: MultiSet[MultiSet[Value]], +): + yield rewrite(n1 - n2, subsume=True).to(n1 + (Value.int(-1) * n2)) + yield rule( + eq(n3).to(n1 + n2), + name="add", + ).then( + union(n3).with_(polynomial(MultiSet(MultiSet(n1), MultiSet(n2)))), + set_(get_sole_polynomial(MultiSet(n3))).to(MultiSet(MultiSet(n1), MultiSet(n2))), + delete(n1 + n2), + ) + yield rule( + eq(n3).to(n1 * n2), + name="mul", + ).then( + union(n3).with_(monomial(MultiSet(n1, n2))), + set_(get_monomial(n3)).to(MultiSet(n1, n2)), + delete(n1 * n2), + # MultiSet(n1, n2).fill_index(ms_index), + ) + yield rule( + eq(n1).to(polynomial(mss)), + mss1 == mss.map(partial(multiset_flat_map, get_monomial)), + mss != mss1, + name="unwrap monomial", + ).then( + union(n1).with_(polynomial(mss1)), + delete(polynomial(mss)), + set_(get_sole_polynomial(MultiSet(n1))).to(mss1), + ) + yield rule( + eq(n1).to(polynomial(mss)), + mss1 == multiset_flat_map(UnstableFn(get_sole_polynomial), mss), + mss != mss1, + name="unwrap polynomial", + ).then( + union(n1).with_(polynomial(mss1)), + delete(polynomial(mss)), + set_(get_sole_polynomial(MultiSet(n1))).to(mss1), + ) + + +@ruleset +def factor_ruleset( + n: Value, + mss: MultiSet[MultiSet[Value]], + counts: MultiSet[Value], + factor: Value, + divided: MultiSet[MultiSet[Value]], + remainder: MultiSet[MultiSet[Value]], +): + yield rule( + eq(n).to(polynomial(mss)), + # Find factor that shows up in most monomials, at least two of them + counts == MultiSet.sum_multisets(mss.map(MultiSet[Value].reset_counts)), + eq(factor).to(counts.pick_max()), + # Only factor out if it term appears in more than one monomial + counts.count(factor) > 1, + # map, including only those factor that contain the factor, removing them from that + # other items are omitted from the map + divided == mss.map(partial(multiset_remove_swapped, factor)), + # remainder is those monomials that do not contain the factor + remainder == mss.filter(partial(multiset_not_contains_swapped, factor)), + name="factor", + ).then( + union(n).with_(polynomial(MultiSet(MultiSet(factor, polynomial(divided))) + remainder)), + # delete(polynomial(mss)), + ) + + +@ruleset +def from_polynomial_ruleset(mss: MultiSet[MultiSet[Value]]): + mul: Callable[[Value, Value], Value] = Value.__mul__ + yield rewrite(polynomial(mss)).to( + multiset_fold( + Value.__add__, + Value.int(0), + mss.map( + partial(multiset_fold, mul, Value.int(1)), + ), + ) + ) + + +polynomial_schedule = to_polynomial_ruleset.saturate() + factor_ruleset.saturate() diff --git a/python/egglog/exp/polynomials.py b/python/egglog/exp/polynomials.py index 2f596b55..26eccdeb 100644 --- a/python/egglog/exp/polynomials.py +++ b/python/egglog/exp/polynomials.py @@ -1,8 +1,8 @@ # # Optimizing Polynomials # # This post explore a few different ways of optimizing polynomials in Egglog. This is mean to see if we can -# represent addition and multiplication through built in multiset data structures in egglog if this can help -# avoid some of the issues with associtativity/commutativity blowup. +# represent addition and multiplication through built-in multiset data structures in egglog if this can help +# avoid some of the issues with associativity/commutativity blowup. # + # First we can define a generic number type diff --git a/python/egglog/pretty.py b/python/egglog/pretty.py index fb05cc00..d0089c8c 100644 --- a/python/egglog/pretty.py +++ b/python/egglog/pretty.py @@ -1,5 +1,5 @@ """ -Pretty printing for declerations. +Pretty printing for declarations. """ from __future__ import annotations @@ -24,7 +24,7 @@ "pretty_callable_ref", "pretty_decl", ] -MAX_LINE_LENGTH = 110 +MAX_LINE_LENGTH = 88 LINE_DIFFERENCE = 10 BLACK_MODE = black.Mode(line_length=88) @@ -96,6 +96,9 @@ def pretty_decl( if wrapping_fn: expr = f"{wrapping_fn}({expr})" program = "\n".join([*pretty.statements, expr]) + # First unparse AST to get consistent formatting, then use black to format it nicely + ast_tree = ast.parse(program, mode="exec") + program = ast.unparse(ast_tree) try: # TODO: Try replacing with ruff for speed # https://github.com/amyreese/ruff-api @@ -254,7 +257,7 @@ def __call__( if decl in self.names: return self.names[decl] expr, tp_name = self.uncached(decl, unwrap_lit=unwrap_lit, parens=parens, ruleset_ident=ruleset_ident) - # We use a heuristic to decide whether to name this sub-expression as a variable + # We use a heuristic to decide whether to name this sub-expression as a variable. # The rough goal is to reduce the number of newlines, given our line length of ~180 # We determine it's worth making a new line for this expression if the total characters # it would take up is > than some constant (~ line length). @@ -273,8 +276,8 @@ def uncached( # noqa: C901, PLR0911, PLR0912 self, decl: AllDecls, *, unwrap_lit: bool, parens: bool, ruleset_ident: Ident | None ) -> tuple[str, str]: """ - Returns a tuple of a string value of the decleration and the "type" to use when create a memoized cached version - for de-duplication. + Returns a tuple of a string value of the declaration and the "type" to use when create a memoized cached version + for deduplication. """ match decl: case LitDecl(value): diff --git a/python/egglog/runtime.py b/python/egglog/runtime.py index fa43947b..b0885d43 100644 --- a/python/egglog/runtime.py +++ b/python/egglog/runtime.py @@ -476,6 +476,7 @@ def __getattribute__(cls, name: str) -> Any: @dataclass class RuntimeFunction(DelayedDeclerations, metaclass=RuntimeFunctionMeta): __egg_ref_thunk__: Callable[[], CallableRef] + # Either they bound class for something like `Vec[Int].create` or a RuntimeExpr for bound methods # bound methods need to store RuntimeExpr not just TypedExprDecl, so they can mutate the expr if required on self __egg_bound__: JustTypeRef | RuntimeExpr | None = None @@ -587,7 +588,7 @@ def __call__( # noqa: C901 bound_params = ( cast("JustTypeRef", bound_tp).args if isinstance(self.__egg_ref__, ClassMethodRef | InitRef) else () ) - # If we were using unstable-app to call a funciton, add that function back as the first arg. + # If we were using unstable-app to call a function, add that function back as the first arg. if function_value: arg_exprs = (function_value, *arg_exprs) expr_decl = CallDecl(self.__egg_ref__, arg_exprs, bound_params) diff --git a/python/egglog/type_constraint_solver.py b/python/egglog/type_constraint_solver.py index cfc46d4b..d8b6d9e8 100644 --- a/python/egglog/type_constraint_solver.py +++ b/python/egglog/type_constraint_solver.py @@ -1,4 +1,12 @@ -"""Provides a class for solving type constraints.""" +""" +Provides a class for solving type constraints. + + +Usages: + +When trying to resolve a literal to a value + +""" from __future__ import annotations From 529fbf4a662c15ebd19ff6759ecf532557972ec0 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Wed, 21 Jan 2026 16:16:19 -0800 Subject: [PATCH 12/30] tmp --- python/egglog/declarations.py | 28 +++---- python/egglog/egraph.py | 2 +- python/egglog/runtime.py | 6 +- python/egglog/type_constraint_solver.py | 89 ++++++++------------- python/tests/test_runtime.py | 6 +- python/tests/test_type_constraint_solver.py | 2 +- 6 files changed, 55 insertions(+), 78 deletions(-) diff --git a/python/egglog/declarations.py b/python/egglog/declarations.py index a7e62392..bce00cfc 100644 --- a/python/egglog/declarations.py +++ b/python/egglog/declarations.py @@ -41,7 +41,6 @@ "ChangeDecl", "ClassDecl", "ClassMethodRef", - "ClassTypeVarRef", "ClassVariableRef", "CombinedRulesetDecl", "CommandDecl", @@ -93,6 +92,7 @@ "TypeOrVarRef", "TypeRefWithVars", "TypeVarError", + "TypeVarRef", "TypedExprDecl", "UnboundVarDecl", "UnionDecl", @@ -270,7 +270,7 @@ def check_binary_method_with_types(self, method_name: str, self_type: JustTypeRe """ Checks if the class has a binary method compatible with the given types. """ - vars: dict[ClassTypeVarRef, JustTypeRef] = {} + vars: dict[TypeVarRef, JustTypeRef] = {} if callable_decl := self._classes[self_type.ident].methods.get(method_name): match callable_decl.signature: case FunctionSignature((self_arg_type, other_arg_type)) if self_arg_type.matches_just( @@ -283,7 +283,7 @@ def check_binary_method_with_self_type(self, method_name: str, self_type: JustTy """ Checks if the class has a binary method with the given name and self type. Returns the other type if it exists. """ - vars: dict[ClassTypeVarRef, JustTypeRef] = {} + vars: dict[TypeVarRef, JustTypeRef] = {} class_decl = self._classes.get(self_type.ident) if class_decl is None: return None @@ -298,7 +298,7 @@ def check_binary_method_with_other_type(self, method_name: str, other_type: Just Returns the types which are compatible with the given binary method name and other type. """ for class_decl in self._classes.values(): - vars: dict[ClassTypeVarRef, JustTypeRef] = {} + vars: dict[TypeVarRef, JustTypeRef] = {} if callable_decl := class_decl.methods.get(method_name): match callable_decl.signature: case FunctionSignature((self_arg_type, other_arg_type)) if other_arg_type.matches_just( @@ -320,7 +320,7 @@ def get_paramaterized_class(self, ident: Ident) -> TypeRefWithVars: @dataclass class ClassDecl: egg_name: str | None = None - type_vars: tuple[ClassTypeVarRef, ...] = () + type_vars: tuple[TypeVarRef, ...] = () builtin: bool = False init: ConstructorDecl | FunctionDecl | None = None class_methods: dict[str, FunctionDecl | ConstructorDecl] = field(default_factory=dict) @@ -372,7 +372,7 @@ def __str__(self) -> str: # mapping of name and module of resolved typevars to runtime values # so that when spitting them back out again can use same instance # since equality is based on identity not value -_RESOLVED_TYPEVARS: dict[ClassTypeVarRef, TypeVar] = {} +_RESOLVED_TYPEVARS: dict[TypeVarRef, TypeVar] = {} class TypeVarError(RuntimeError): @@ -380,14 +380,14 @@ class TypeVarError(RuntimeError): @dataclass(frozen=True) -class ClassTypeVarRef: +class TypeVarRef: """ - A class type variable represents one of the types of the class, if it is a generic class. + A generic type variable reference. """ ident: Ident - def to_just(self, vars: dict[ClassTypeVarRef, JustTypeRef] | None = None) -> JustTypeRef: + def to_just(self, vars: dict[TypeVarRef, JustTypeRef] | None = None) -> JustTypeRef: if vars is None or self not in vars: raise TypeVarError(f"Cannot convert type variable {self} to concrete type without variable bindings") return vars[self] @@ -396,7 +396,7 @@ def __str__(self) -> str: return str(self.to_type_var()) @classmethod - def from_type_var(cls, typevar: TypeVar) -> ClassTypeVarRef: + def from_type_var(cls, typevar: TypeVar) -> TypeVarRef: res = cls(Ident(typevar.__name__, typevar.__module__)) _RESOLVED_TYPEVARS[res] = typevar return res @@ -404,7 +404,7 @@ def from_type_var(cls, typevar: TypeVar) -> ClassTypeVarRef: def to_type_var(self) -> TypeVar: return _RESOLVED_TYPEVARS[self] - def matches_just(self, vars: dict[ClassTypeVarRef, JustTypeRef], other: JustTypeRef) -> bool: + def matches_just(self, vars: dict[TypeVarRef, JustTypeRef], other: JustTypeRef) -> bool: """ Checks if this type variable matches the given JustTypeRef, including type variables. """ @@ -419,7 +419,7 @@ class TypeRefWithVars: ident: Ident args: tuple[TypeOrVarRef, ...] = () - def to_just(self, vars: dict[ClassTypeVarRef, JustTypeRef] | None = None) -> JustTypeRef: + def to_just(self, vars: dict[TypeVarRef, JustTypeRef] | None = None) -> JustTypeRef: return JustTypeRef(self.ident, tuple(a.to_just(vars) for a in self.args)) def __str__(self) -> str: @@ -427,7 +427,7 @@ def __str__(self) -> str: return f"{self.ident.name}[{', '.join(str(a) for a in self.args)}]" return str(self.ident.name) - def matches_just(self, vars: dict[ClassTypeVarRef, JustTypeRef], other: JustTypeRef) -> bool: + def matches_just(self, vars: dict[TypeVarRef, JustTypeRef], other: JustTypeRef) -> bool: """ Checks if this type reference matches the given JustTypeRef, including type variables. """ @@ -438,7 +438,7 @@ def matches_just(self, vars: dict[ClassTypeVarRef, JustTypeRef], other: JustType ) -TypeOrVarRef: TypeAlias = ClassTypeVarRef | TypeRefWithVars +TypeOrVarRef: TypeAlias = TypeVarRef | TypeRefWithVars ## # Callables References diff --git a/python/egglog/egraph.py b/python/egglog/egraph.py index fa5cceb4..183375c7 100644 --- a/python/egglog/egraph.py +++ b/python/egglog/egraph.py @@ -398,7 +398,7 @@ def _generate_class_decls( # noqa: C901,PLR0912 # Get the generic params from the orig bases generic class namespace["__orig_bases__"][1].__parameters__ if "__orig_bases__" in namespace else [] ) - type_vars = tuple(ClassTypeVarRef.from_type_var(p) for p in parameters) + type_vars = tuple(TypeVarRef.from_type_var(p) for p in parameters) del parameters cls_decl = ClassDecl( egg_sort, type_vars, builtin, match_args=namespace.pop("__match_args__", ()), doc=namespace.pop("__doc__", None) diff --git a/python/egglog/runtime.py b/python/egglog/runtime.py index b0885d43..fa34b384 100644 --- a/python/egglog/runtime.py +++ b/python/egglog/runtime.py @@ -158,7 +158,7 @@ def resolve_type_annotation(tp: object) -> tuple[DeclerationsLike, TypeOrVarRef] resolve the decls if need be. """ if isinstance(tp, TypeVar): - return None, ClassTypeVarRef.from_type_var(tp) + return None, TypeVarRef.from_type_var(tp) # If there is a union, then we assume the first item is the type we want, and the others are types that can be converted to that type. if get_origin(tp) == Union: first, *_rest = get_args(tp) @@ -182,7 +182,7 @@ def inverse_resolve_type_annotation(decls_thunk: Callable[[], Declarations], tp: """ Inverse of resolve_type_annotation """ - if isinstance(tp, ClassTypeVarRef): + if isinstance(tp, TypeVarRef): return tp.to_type_var() return RuntimeClass(decls_thunk, tp) @@ -353,7 +353,7 @@ def __getitem__(self, args: object) -> RuntimeClass: # if we already have some args bound and some not, then we shold replace all existing args of typevars with new # args if old_args := self.__egg_tp__.args: - is_typevar = [isinstance(arg, ClassTypeVarRef) for arg in old_args] + is_typevar = [isinstance(arg, TypeVarRef) for arg in old_args] if sum(is_typevar) != len(new_args): raise TypeError(f"Expected {sum(is_typevar)} typevars, got {len(new_args)}") new_args_list = list(new_args) diff --git a/python/egglog/type_constraint_solver.py b/python/egglog/type_constraint_solver.py index d8b6d9e8..a8dcfd9e 100644 --- a/python/egglog/type_constraint_solver.py +++ b/python/egglog/type_constraint_solver.py @@ -10,7 +10,6 @@ from __future__ import annotations -from collections import defaultdict from dataclasses import dataclass, field from itertools import chain, repeat from typing import TYPE_CHECKING, assert_never @@ -34,24 +33,19 @@ class TypeConstraintSolver: Given some typevars and types, solves the constraints to resolve the typevars. """ - _decls: Declarations = field(repr=False) - # Mapping of class ident to mapping of bound class typevar to type - _cls_typevar_index_to_type: defaultdict[Ident, dict[ClassTypeVarRef, JustTypeRef]] = field( - default_factory=lambda: defaultdict(dict) - ) + # Mapping of typevar index to inferred type for each class + _typevar_to_type: dict[Ident, JustTypeRef] = field(default_factory=dict, init=False) - def bind_class(self, ref: JustTypeRef) -> None: + def bind_class(self, ref: JustTypeRef, decls: Declarations) -> None: """ Bind the typevars of a class to the given types. Used for a situation like Map[int, str].create(). + + This is the same as binding the typevars of the class to the given types. """ - name = ref.ident - cls_typevars = self._decls.get_class_decl(name).type_vars - if len(cls_typevars) != len(ref.args): - raise TypeConstraintError(f"Mismatch of typevars {cls_typevars} and {ref}") - bound_typevars = self._cls_typevar_index_to_type[name] - for i, arg in enumerate(ref.args): - bound_typevars[cls_typevars[i]] = arg + cls_typevars = decls.get_class_decl(ref.ident).type_vars + for typevar, arg in zip(cls_typevars, ref.args, strict=True): + self.infer_typevars(typevar, arg) def infer_arg_types( self, @@ -59,61 +53,46 @@ def infer_arg_types( fn_return: TypeOrVarRef, fn_var_args: TypeOrVarRef | None, return_: JustTypeRef, - cls_ident: Ident | None, - ) -> tuple[Iterable[JustTypeRef], tuple[JustTypeRef, ...]]: + ) -> Iterable[JustTypeRef]: """ Given a return type, infer the argument types. If there is a variable arg, it returns an infinite iterable. - - Also returns the bound type params if the class name is passed in. """ - self.infer_typevars(fn_return, return_, cls_ident) - arg_types: Iterable[JustTypeRef] = [self.substitute_typevars(a, cls_ident) for a in fn_args] - if fn_var_args: - # Need to be generator so it can be infinite for variable args - arg_types = chain(arg_types, repeat(self.substitute_typevars(fn_var_args, cls_ident))) - bound_typevars = ( - tuple( - v - # Sort by the index of the typevar in the class - for _, v in sorted( - self._cls_typevar_index_to_type[cls_ident].items(), - key=lambda kv: self._decls.get_class_decl(cls_ident).type_vars.index(kv[0]), - ) - ) - if cls_ident - else () - ) - return arg_types, bound_typevars - - def infer_typevars(self, fn_arg: TypeOrVarRef, arg: JustTypeRef, cls_ident: Ident | None = None) -> None: + self.infer_typevars(fn_return, return_) + for fn_arg in fn_args: + yield self.substitute_typevars(fn_arg) + if fn_var_args is not None: + var_arg_type = self.substitute_typevars(fn_var_args) + yield from chain(repeat(var_arg_type)) + + def infer_typevars(self, fn_arg: TypeOrVarRef, arg: JustTypeRef) -> None: + """ + Infer typevars from a function argument and a given type, raises TypeConstraintError if they are incompatible. + """ match fn_arg: case TypeRefWithVars(cls_ident, fn_args): if cls_ident != arg.ident: raise TypeConstraintError(f"Expected {cls_ident}, got {arg.ident}") for inner_fn_arg, inner_arg in zip(fn_args, arg.args, strict=True): - self.infer_typevars(inner_fn_arg, inner_arg, cls_ident) - case ClassTypeVarRef(): - if cls_ident is None: - msg = "Cannot infer typevar without class name" - raise RuntimeError(msg) - - class_typevars = self._cls_typevar_index_to_type[cls_ident] - if fn_arg in class_typevars: - if class_typevars[fn_arg] != arg: - raise TypeConstraintError(f"Expected {class_typevars[fn_arg]}, got {arg}") + self.infer_typevars(inner_fn_arg, inner_arg) + case TypeVarRef(typevar_ident): + if typevar_ident in self._typevar_to_type: + if self._typevar_to_type[typevar_ident] != arg: + raise TypeConstraintError(f"Expected {self._typevar_to_type[typevar_ident]}, got {arg}") else: - class_typevars[fn_arg] = arg + self._typevar_to_type[typevar_ident] = arg case _: assert_never(fn_arg) - def substitute_typevars(self, tp: TypeOrVarRef, cls_ident: Ident | None = None) -> JustTypeRef: + def substitute_typevars(self, tp: TypeOrVarRef) -> JustTypeRef: + """ + Substitute typevars in a type with their inferred types, raises TypeConstraintError if a typevar is unresolved. + """ match tp: - case ClassTypeVarRef(): - assert cls_ident is not None + case TypeVarRef(tyepvar_ident): try: - return self._cls_typevar_index_to_type[cls_ident][tp] + return self._typevar_to_type[tyepvar_ident] except KeyError as e: - raise TypeConstraintError(f"Not enough bound typevars for {tp!r} in class {cls_ident}") from e + raise TypeConstraintError(f"Unresolved type variable: {tyepvar_ident}") from e case TypeRefWithVars(name, args): - return JustTypeRef(name, tuple(self.substitute_typevars(arg, cls_ident or name) for arg in args)) + return JustTypeRef(name, tuple(self.substitute_typevars(arg) for arg in args)) assert_never(tp) diff --git a/python/tests/test_runtime.py b/python/tests/test_runtime.py index e747ac79..873e7595 100644 --- a/python/tests/test_runtime.py +++ b/python/tests/test_runtime.py @@ -12,9 +12,7 @@ def test_type_str(): decls = Declarations( _classes={ Ident.builtin("i64"): ClassDecl(), - Ident.builtin("Map"): ClassDecl( - type_vars=(ClassTypeVarRef(Ident.builtin("K")), ClassTypeVarRef(Ident.builtin("V"))) - ), + Ident.builtin("Map"): ClassDecl(type_vars=(TypeVarRef(Ident.builtin("K")), TypeVarRef(Ident.builtin("V")))), } ) i64 = RuntimeClass(Thunk.value(decls), TypeRefWithVars(Ident.builtin("i64"))) @@ -40,7 +38,7 @@ def test_function_call(): def test_classmethod_call(): - K, V = ClassTypeVarRef(Ident.builtin("K")), ClassTypeVarRef(Ident.builtin("V")) + K, V = TypeVarRef(Ident.builtin("K")), TypeVarRef(Ident.builtin("V")) decls = Declarations( _classes={ Ident.builtin("i64"): ClassDecl(), diff --git a/python/tests/test_type_constraint_solver.py b/python/tests/test_type_constraint_solver.py index f809d511..a9c2d1c1 100644 --- a/python/tests/test_type_constraint_solver.py +++ b/python/tests/test_type_constraint_solver.py @@ -7,7 +7,7 @@ i64 = JustTypeRef(Ident("i64")) unit = JustTypeRef(Ident("Unit")) -K, V = ClassTypeVarRef(Ident("K")), ClassTypeVarRef(Ident("V")) +K, V = TypeVarRef(Ident("K")), TypeVarRef(Ident("V")) map = TypeRefWithVars(Ident("Map"), (K, V)) map_i64_unit = JustTypeRef(Ident("Map"), (i64, unit)) decls = Declarations(_classes={Ident("Map"): ClassDecl(type_vars=(K, V))}) From e391e1eb2f3c5f44df3aecb641dc34db358bac21 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Thu, 22 Jan 2026 13:34:22 -0800 Subject: [PATCH 13/30] tmp --- python/egglog/builtins.py | 7 ++- python/egglog/conversion.py | 5 +- python/egglog/egraph.py | 1 + python/egglog/egraph_state.py | 60 ++++++++++----------- python/egglog/exp/array_api_program_gen.py | 2 +- python/egglog/runtime.py | 17 +++--- python/egglog/type_constraint_solver.py | 16 +++--- python/tests/test_type_constraint_solver.py | 32 +++++------ 8 files changed, 67 insertions(+), 73 deletions(-) diff --git a/python/egglog/builtins.py b/python/egglog/builtins.py index 46246ea2..2e370e18 100644 --- a/python/egglog/builtins.py +++ b/python/egglog/builtins.py @@ -409,7 +409,7 @@ def eval(self) -> dict[T, V]: @property def value(self) -> dict[T, V]: d = {} - while args := get_callable_args(self, Map[T, V].insert): + while args := get_callable_args(self, Map.insert): # type: ignore[var-annotated] self, k, v = args # noqa: PLW0642 d[k] = v if get_callable_args(self, Map.empty) is None: @@ -992,7 +992,7 @@ def __init__(self, *args: T) -> None: ... def empty(cls) -> Vec[T]: ... @method(egg_fn="vec-append") - def append(self, *others: Vec[T]) -> Vec[T]: ... + def append(self, *others: VecLike[T, T]) -> Vec[T]: ... @method(egg_fn="vec-push") def push(self, value: T) -> Vec[T]: ... @@ -1033,6 +1033,9 @@ def set(self, index: i64Like, value: T) -> Vec[T]: ... VecLike: TypeAlias = Vec[T] | tuple[TO, ...] | list[TO] +v = Vec(i64(10)) +v.append([i64(10)]) + class PyObject(BuiltinExpr, egg_sort="PyObject"): @method(preserve=True) diff --git a/python/egglog/conversion.py b/python/egglog/conversion.py index 9fecffe2..6455d2b6 100644 --- a/python/egglog/conversion.py +++ b/python/egglog/conversion.py @@ -221,7 +221,6 @@ def resolve_literal( arg: object, decls: Callable[[], Declarations] = retrieve_conversion_decls, tcs: TypeConstraintSolver | None = None, - cls_ident: Ident | None = None, ) -> RuntimeExpr: """ Try to convert an object to a type, raising a ConvertError if it is not possible. @@ -240,7 +239,7 @@ def resolve_literal( # args first based on the existing type constraint solver if tcs: try: - tp_just = tcs.substitute_typevars(tp, cls_ident) + tp_just = tcs.substitute_typevars(tp) # If we can't resolve the type var yet, then just assume it is the right value except TypeConstraintError: assert isinstance(arg, RuntimeExpr), f"Expected a runtime expression, got {type(arg)}" @@ -250,7 +249,7 @@ def resolve_literal( assert isinstance(arg, RuntimeExpr), f"Expected a runtime expression, got {arg}" return arg if tcs: - tcs.infer_typevars(tp, tp_just, cls_ident) + tcs.infer_typevars(tp, tp_just) if arg_type == tp_just: # If the type is an egg type, it has to be a runtime expr assert isinstance(arg, RuntimeExpr) diff --git a/python/egglog/egraph.py b/python/egglog/egraph.py index 183375c7..3ca56745 100644 --- a/python/egglog/egraph.py +++ b/python/egglog/egraph.py @@ -328,6 +328,7 @@ def __new__( # type: ignore[misc] cls_ident = Ident(name, _get_module(prev_frame)) # Pass in an instance of the class so that when we are generating the decls # we can update them eagerly so that we can access the methods in the class body + # TODO: How should we normalize unparameterized classes? Should they have args of the typevars? runtime_cls = RuntimeClass(None, TypeRefWithVars(cls_ident)) # type: ignore[arg-type] # Store frame so that we can get live access to updated locals/globals diff --git a/python/egglog/egraph_state.py b/python/egglog/egraph_state.py index 6326ae99..78e97878 100644 --- a/python/egglog/egraph_state.py +++ b/python/egglog/egraph_state.py @@ -796,23 +796,22 @@ def _unstable_fn_value_to_expr( continue if signature.semantic_return_type.ident != return_tp.ident: continue - tcs = TypeConstraintSolver(self.__egg_decls__) + tcs = TypeConstraintSolver() - arg_types, bound_tp_params = tcs.infer_arg_types( - signature.arg_types, signature.semantic_return_type, signature.var_arg_type, return_tp, None + arg_types = tcs.infer_arg_types( + signature.arg_types, signature.semantic_return_type, signature.var_arg_type, return_tp ) args = tuple( TypedExprDecl(tp, self.value_to_expr(tp, v)) for tp, v in zip(arg_types, partial_args, strict=False) ) - - call_decl = CallDecl( - callable_ref, - args, - # Don't include bound type params if this is just a method, we only needed them for type resolution - # but dont need to store them - bound_tp_params if isinstance(callable_ref, ClassMethodRef | InitRef) else (), - ) + if isinstance(callable_ref, ClassMethodRef | InitRef): + bound_tp_params = tuple( + map(tcs.substitute_typevars, self.__egg_decls__.get_class_decl(callable_ref.ident).type_vars) + ) + else: + bound_tp_params = () + call_decl = CallDecl(callable_ref, args, bound_tp_params) return PartialCallDecl(call_decl) raise ValueError(f"Function '{name}' not found") @@ -909,11 +908,7 @@ def from_expr(self, tp: JustTypeRef, term: bindings._Term) -> TypedExprDecl: assert_never(term) return TypedExprDecl(tp, expr_decl) - def from_call( - self, - tp: JustTypeRef, - term: bindings.TermApp, # additional_arg_tps: tuple[JustTypeRef, ...] - ) -> CallDecl: + def from_call(self, tp: JustTypeRef, term: bindings.TermApp) -> CallDecl: """ Convert a call to a CallDecl. @@ -931,33 +926,32 @@ def from_call( signature = self.decls.get_callable_decl(callable_ref).signature assert isinstance(signature, FunctionSignature) if isinstance(callable_ref, ClassMethodRef | InitRef | MethodRef): - # Need OR in case we have class method whose class whas never added as a sort, which would happen + # Need OR in case we have class method whose class was never added as a sort, which would happen # if the class method didn't return that type and no other function did. In this case, we don't need - # to care about the type vars and we we don't need to bind any possible type. + # to care about the type vars and we don't need to bind any possible type. possible_types = self.state._get_possible_types(callable_ref.ident) or [None] - cls_name = callable_ref.ident else: possible_types = [None] - cls_name = None for possible_type in possible_types: - tcs = TypeConstraintSolver(self.decls) + tcs = TypeConstraintSolver() if possible_type and possible_type.args: - tcs.bind_class(possible_type) + tcs.bind_class(possible_type, self.decls) try: - arg_types, bound_tp_params = tcs.infer_arg_types( - signature.arg_types, signature.semantic_return_type, signature.var_arg_type, tp, cls_name + arg_types = tcs.infer_arg_types( + signature.arg_types, signature.semantic_return_type, signature.var_arg_type, tp ) + # Include this in try because of iterable + a_tp = list(zip(term.args, arg_types, strict=False)) except TypeConstraintError: continue - args = tuple(self.resolve_term(a, tp) for a, tp in zip(term.args, arg_types, strict=False)) - - return CallDecl( - callable_ref, - args, - # Don't include bound type params if this is just a method, we only needed them for type resolution - # but dont need to store them - bound_tp_params if isinstance(callable_ref, ClassMethodRef | InitRef) and not args else (), - ) + args = tuple(self.resolve_term(a, tp) for a, tp in a_tp) + if not args and isinstance(callable_ref, ClassMethodRef | InitRef): + bound_tp_params = tuple( + map(tcs.substitute_typevars, self.decls.get_class_decl(callable_ref.ident).type_vars) + ) + else: + bound_tp_params = () + return CallDecl(callable_ref, args, bound_tp_params) raise ValueError( f"Could not find callable ref for call {term}. None of these refs matched the types: {self.state.egg_fn_to_callable_refs[term.name]}" ) diff --git a/python/egglog/exp/array_api_program_gen.py b/python/egglog/exp/array_api_program_gen.py index 57027f1c..47138841 100644 --- a/python/egglog/exp/array_api_program_gen.py +++ b/python/egglog/exp/array_api_program_gen.py @@ -144,7 +144,7 @@ def _value_program(i: Int, b: Boolean, f: Float, x: NDArray, v1: Value, v2: Valu yield rewrite(value_program(Value.float(f))).to(float_program(f)) # Could add .item() but we usually dont need it. yield rewrite(value_program(x.to_value())).to(ndarray_program(x)) - yield rewrite(value_program(v1 < v2)).to(Program("(") + value_program(v1) + " < " + value_program(v2) + ")") + yield rewrite(bool_program(v1 < v2)).to(Program("(") + value_program(v1) + " < " + value_program(v2) + ")") yield rewrite(value_program(v1 / v2)).to(Program("(") + value_program(v1) + " / " + value_program(v2) + ")") yield rewrite(value_program(v1 + v2)).to(Program("(") + value_program(v1) + " + " + value_program(v2) + ")") yield rewrite(value_program(v1 * v2)).to(Program("(") + value_program(v1) + " * " + value_program(v2) + ")") diff --git a/python/egglog/runtime.py b/python/egglog/runtime.py index fa34b384..7c9144c4 100644 --- a/python/egglog/runtime.py +++ b/python/egglog/runtime.py @@ -350,7 +350,7 @@ def __getitem__(self, args: object) -> RuntimeClass: "tuple[tuple[DeclerationsLike, ...], tuple[TypeOrVarRef, ...]]", zip(*(resolve_type_annotation(arg) for arg in args), strict=False), ) - # if we already have some args bound and some not, then we shold replace all existing args of typevars with new + # if we already have some args bound and some not, then we should replace all existing args of typevars with new # args if old_args := self.__egg_tp__.args: is_typevar = [isinstance(arg, TypeVarRef) for arg in old_args] @@ -550,7 +550,7 @@ def __call__( # noqa: C901 assert not bound.kwargs args = bound.args - tcs = TypeConstraintSolver(decls) + tcs = TypeConstraintSolver() bound_tp = ( None if self.__egg_bound__ is None @@ -564,27 +564,24 @@ def __call__( # noqa: C901 # Don't bind class if we have a first class function arg, b/c we don't support that yet and not function_value ): - tcs.bind_class(bound_tp) + tcs.bind_class(bound_tp, decls) assert (operator.ge if signature.var_arg_type else operator.eq)(len(args), len(signature.arg_types)) # Hack to allow being explicit on function types when casting. # noqa: FIX004 - # TODO: Replace type analysis class binding stuff - # with instead binders of location per call origination - cls_ident = bound_tp.ident if bound_tp else None for _fn_tp in _egg_function_types or (): try: _fn_tp_just = _fn_tp.to_just() except TypeVarError: continue - tcs.bind_class(_fn_tp_just) + tcs.bind_class(_fn_tp_just, decls) if _fn_tp_just.args: - cls_ident = _fn_tp_just.ident + pass upcasted_args = [ - resolve_literal(cast("TypeOrVarRef", tp), arg, Thunk.value(decls), tcs=tcs, cls_ident=cls_ident) + resolve_literal(cast("TypeOrVarRef", tp), arg, Thunk.value(decls), tcs) for arg, tp in zip_longest(args, signature.arg_types, fillvalue=signature.var_arg_type) ] decls.update(*upcasted_args) arg_exprs = tuple(arg.__egg_typed_expr__ for arg in upcasted_args) - return_tp = tcs.substitute_typevars(signature.semantic_return_type, cls_ident) + return_tp = tcs.substitute_typevars(signature.semantic_return_type) bound_params = ( cast("JustTypeRef", bound_tp).args if isinstance(self.__egg_ref__, ClassMethodRef | InitRef) else () ) diff --git a/python/egglog/type_constraint_solver.py b/python/egglog/type_constraint_solver.py index a8dcfd9e..69841313 100644 --- a/python/egglog/type_constraint_solver.py +++ b/python/egglog/type_constraint_solver.py @@ -58,11 +58,11 @@ def infer_arg_types( Given a return type, infer the argument types. If there is a variable arg, it returns an infinite iterable. """ self.infer_typevars(fn_return, return_) - for fn_arg in fn_args: - yield self.substitute_typevars(fn_arg) - if fn_var_args is not None: - var_arg_type = self.substitute_typevars(fn_var_args) - yield from chain(repeat(var_arg_type)) + arg_types = [self.substitute_typevars(fn_arg) for fn_arg in fn_args] + if fn_var_args is None: + return arg_types + var_arg_type = self.substitute_typevars(fn_var_args) + return chain(arg_types, repeat(var_arg_type)) def infer_typevars(self, fn_arg: TypeOrVarRef, arg: JustTypeRef) -> None: """ @@ -88,11 +88,11 @@ def substitute_typevars(self, tp: TypeOrVarRef) -> JustTypeRef: Substitute typevars in a type with their inferred types, raises TypeConstraintError if a typevar is unresolved. """ match tp: - case TypeVarRef(tyepvar_ident): + case TypeVarRef(typevar_ident): try: - return self._typevar_to_type[tyepvar_ident] + return self._typevar_to_type[typevar_ident] except KeyError as e: - raise TypeConstraintError(f"Unresolved type variable: {tyepvar_ident}") from e + raise TypeConstraintError(f"Unresolved type variable: {typevar_ident}") from e case TypeRefWithVars(name, args): return JustTypeRef(name, tuple(self.substitute_typevars(arg) for arg in args)) assert_never(tp) diff --git a/python/tests/test_type_constraint_solver.py b/python/tests/test_type_constraint_solver.py index a9c2d1c1..799f6551 100644 --- a/python/tests/test_type_constraint_solver.py +++ b/python/tests/test_type_constraint_solver.py @@ -14,40 +14,40 @@ def test_simple() -> None: - tcs = TypeConstraintSolver(Declarations()) + tcs = TypeConstraintSolver() tcs.infer_typevars(i64.to_var(), i64) assert tcs.substitute_typevars(i64.to_var()) == i64 def test_wrong_arg() -> None: - tcs = TypeConstraintSolver(Declarations()) + tcs = TypeConstraintSolver() with pytest.raises(TypeConstraintError): tcs.infer_typevars(i64.to_var(), unit) def test_generic() -> None: - tcs = TypeConstraintSolver(Declarations()) - tcs.infer_typevars(map, map_i64_unit, Ident("Map")) - tcs.infer_typevars(K, i64, Ident("Map")) - assert tcs.substitute_typevars(V, Ident("Map")) == unit + tcs = TypeConstraintSolver() + tcs.infer_typevars(map, map_i64_unit) + tcs.infer_typevars(K, i64) + assert tcs.substitute_typevars(V) == unit def test_generic_wrong() -> None: - tcs = TypeConstraintSolver(Declarations()) - tcs.infer_typevars(map, map_i64_unit, Ident("Map")) + tcs = TypeConstraintSolver() + tcs.infer_typevars(map, map_i64_unit) with pytest.raises(TypeConstraintError): - tcs.infer_typevars(K, unit, Ident("Map")) + tcs.infer_typevars(K, unit) def test_bound() -> None: - bound_cs = TypeConstraintSolver(decls) - bound_cs.bind_class(map_i64_unit) - bound_cs.infer_typevars(K, i64, Ident("Map")) - assert bound_cs.substitute_typevars(V, Ident("Map")) == unit + bound_cs = TypeConstraintSolver() + bound_cs.bind_class(map_i64_unit, decls) + bound_cs.infer_typevars(K, i64) + assert bound_cs.substitute_typevars(V) == unit def test_bound_wrong(): - bound_cs = TypeConstraintSolver(decls) - bound_cs.bind_class(map_i64_unit) + bound_cs = TypeConstraintSolver() + bound_cs.bind_class(map_i64_unit, decls) with pytest.raises(TypeConstraintError): - bound_cs.infer_typevars(K, unit, Ident("Map")) + bound_cs.infer_typevars(K, unit) From a4f58a242f64ce191f9af3005a7c5b9f40d20442 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Thu, 22 Jan 2026 17:27:53 -0800 Subject: [PATCH 14/30] Fix type analysis --- python/egglog/conversion.py | 9 ++++--- python/egglog/type_constraint_solver.py | 33 +++++++++++++++++++++++++ 2 files changed, 38 insertions(+), 4 deletions(-) diff --git a/python/egglog/conversion.py b/python/egglog/conversion.py index 6455d2b6..1257b380 100644 --- a/python/egglog/conversion.py +++ b/python/egglog/conversion.py @@ -239,13 +239,14 @@ def resolve_literal( # args first based on the existing type constraint solver if tcs: try: - tp_just = tcs.substitute_typevars(tp) + tp_just = tcs.substitute_typevars_try_function(tp, arg, decls) # If we can't resolve the type var yet, then just assume it is the right value - except TypeConstraintError: - assert isinstance(arg, RuntimeExpr), f"Expected a runtime expression, got {type(arg)}" + except TypeConstraintError as e: + if not isinstance(arg, RuntimeExpr): + raise ConvertError(f"Cannot convert {arg} of type {arg_type} to {tp}") from e tp_just = arg.__egg_typed_expr__.tp else: - # If this is a var, it has to be a runtime expession + # If this is a var, it has to be a runtime expression assert isinstance(arg, RuntimeExpr), f"Expected a runtime expression, got {arg}" return arg if tcs: diff --git a/python/egglog/type_constraint_solver.py b/python/egglog/type_constraint_solver.py index 69841313..79fd3c42 100644 --- a/python/egglog/type_constraint_solver.py +++ b/python/egglog/type_constraint_solver.py @@ -96,3 +96,36 @@ def substitute_typevars(self, tp: TypeOrVarRef) -> JustTypeRef: case TypeRefWithVars(name, args): return JustTypeRef(name, tuple(self.substitute_typevars(arg) for arg in args)) assert_never(tp) + + def substitute_typevars_try_function( + self, tp: TypeOrVarRef, value: Callable, decls: Callable[[], Declarations] + ) -> JustTypeRef: + """ + Try to substitute typevars in a type with their inferred types. + + If this fails and we have an UnstableFn type and a function value, we can try to infer the typevars by calling + it with the input types, if we can resolve those + """ + from .runtime import RuntimeExpr # noqa: PLC0415 + + try: + return self.substitute_typevars(tp) + except TypeConstraintError: + if isinstance(tp, TypeVarRef) or tp.ident != Ident.builtin("UnstableFn") or not callable(value): + raise + dummy_args = [ + RuntimeExpr.__from_values__(decls(), TypedExprDecl(self.substitute_typevars(arg_tp), DummyDecl())) + for arg_tp in tp.args[1:] + ] + try: + result = value(*dummy_args) + except Exception as e: + raise TypeConstraintError( + f"Function {value} raised an exception when called with dummy args to infer return type: {e}" + ) from e + if not isinstance(result, RuntimeExpr): + raise TypeConstraintError( + f"Function {value} did not return a RuntimeExpr, got {type(result)}, so cannot infer return type" + ) + self.infer_typevars(tp.args[0], result.__egg_typed_expr__.tp) + return self.substitute_typevars(tp) From c282b592bd84841e409523e92f21c6c34607f8d6 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Wed, 28 Jan 2026 15:23:13 -0800 Subject: [PATCH 15/30] Try fixing type resolution again --- python/egglog/conversion.py | 34 ++------------ python/egglog/declarations.py | 39 +++++++++++++++- python/egglog/deconstruct.py | 4 +- python/egglog/egraph_state.py | 51 +++++++++----------- python/egglog/exp/array_api.py | 2 +- python/egglog/exp/polynomials.py | 2 +- python/egglog/runtime.py | 62 ++++++++++++------------- python/egglog/type_constraint_solver.py | 6 +-- python/tests/test_high_level.py | 2 +- 9 files changed, 101 insertions(+), 101 deletions(-) diff --git a/python/egglog/conversion.py b/python/egglog/conversion.py index 1257b380..1bbbefbd 100644 --- a/python/egglog/conversion.py +++ b/python/egglog/conversion.py @@ -11,13 +11,11 @@ from .pretty import * from .runtime import * from .thunk import * -from .type_constraint_solver import TypeConstraintError if TYPE_CHECKING: from collections.abc import Generator from .egraph import BaseExpr - from .type_constraint_solver import TypeConstraintSolver __all__ = ["ConvertError", "convert", "converter", "get_type_args"] # Mapping from (source type, target type) to and function which takes in the runtimes values of the source and return the target @@ -220,41 +218,17 @@ def resolve_literal( tp: TypeOrVarRef, arg: object, decls: Callable[[], Declarations] = retrieve_conversion_decls, - tcs: TypeConstraintSolver | None = None, ) -> RuntimeExpr: """ Try to convert an object to a type, raising a ConvertError if it is not possible. - If the type has vars in it, they will be tried to be resolved into concrete vars based on the type constraint solver. - If it cannot be resolved, we assume that the value passed in will resolve it. """ - arg_type = resolve_type(arg) - - # If we have any type variables, don't bother trying to resolve the literal, just return the arg - try: - tp_just = tp.to_just() - except TypeVarError: - # If this is a generic arg but passed in a non runtime expression, try to resolve the generic - # args first based on the existing type constraint solver - if tcs: - try: - tp_just = tcs.substitute_typevars_try_function(tp, arg, decls) - # If we can't resolve the type var yet, then just assume it is the right value - except TypeConstraintError as e: - if not isinstance(arg, RuntimeExpr): - raise ConvertError(f"Cannot convert {arg} of type {arg_type} to {tp}") from e - tp_just = arg.__egg_typed_expr__.tp - else: - # If this is a var, it has to be a runtime expression - assert isinstance(arg, RuntimeExpr), f"Expected a runtime expression, got {arg}" - return arg - if tcs: - tcs.infer_typevars(tp, tp_just) - if arg_type == tp_just: - # If the type is an egg type, it has to be a runtime expr - assert isinstance(arg, RuntimeExpr) + # If this is a runtime expression that could match the type already, just return it + if isinstance(arg, RuntimeExpr) and tp.matches_just({}, arg.__egg_typed_expr__.tp): return arg + tp_just = tp.to_just() + arg_type = resolve_type(arg) if arg is DUMMY_VALUE: return RuntimeExpr.__from_values__(decls(), TypedExprDecl(tp_just, DummyDecl())) if (conversion := _lookup_conversion(arg_type, tp_just)) is not None: diff --git a/python/egglog/declarations.py b/python/egglog/declarations.py index bce00cfc..de6fef91 100644 --- a/python/egglog/declarations.py +++ b/python/egglog/declarations.py @@ -8,6 +8,7 @@ from dataclasses import dataclass, field from functools import cached_property +from itertools import chain, repeat from typing import ( TYPE_CHECKING, ClassVar, @@ -413,6 +414,13 @@ def matches_just(self, vars: dict[TypeVarRef, JustTypeRef], other: JustTypeRef) vars[self] = other return True + @property + def vars(self) -> set[TypeVarRef]: + """ + Returns all type variables in this type reference. + """ + return {self} + @dataclass(frozen=True) class TypeRefWithVars: @@ -437,6 +445,16 @@ def matches_just(self, vars: dict[TypeVarRef, JustTypeRef], other: JustTypeRef) and all(a.matches_just(vars, b) for a, b in zip(self.args, other.args, strict=True)) ) + @property + def vars(self) -> set[TypeVarRef]: + """ + Returns all type variables in this type reference. + """ + vars = set[TypeVarRef]() + for arg in self.args: + vars.update(arg.vars) + return vars + TypeOrVarRef: TypeAlias = TypeVarRef | TypeRefWithVars @@ -589,6 +607,25 @@ def semantic_return_type(self) -> TypeOrVarRef: def mutates(self) -> bool: return self.return_type is None + @property + def arg_vars(self) -> set[TypeVarRef]: + """ + Returns all type variables in the argument types. + """ + vars = set[TypeVarRef]() + for arg in self.arg_types: + vars.update(arg.vars) + if self.var_arg_type: + vars.update(self.var_arg_type.vars) + return vars + + @property + def all_args(self) -> Iterable[TypeOrVarRef]: + """ + Returns all argument types, including var args. + """ + return chain(self.arg_types, (repeat(self.var_arg_type) if self.var_arg_type else [])) + @dataclass(frozen=True) class FunctionDecl: @@ -675,7 +712,7 @@ def __new__(cls, *args: object, **kwargs: object) -> Self: """ Pool CallDecls so that they can be compared by identity more quickly. - Neccessary bc we search for common parents when serializing CallDecl trees to egglog to + Necessary bc we search for common parents when serializing CallDecl trees to egglog to only serialize each sub-tree once. """ # normalize the args/kwargs to a tuple so that they can be compared diff --git a/python/egglog/deconstruct.py b/python/egglog/deconstruct.py index 65951683..879c34ce 100644 --- a/python/egglog/deconstruct.py +++ b/python/egglog/deconstruct.py @@ -188,8 +188,8 @@ def _deconstruct_call_decl( TypeRefWithVars(call.callable.ident, tuple(tp.to_var() for tp in (call.bound_tp_params or []))), ), arg_exprs egg_bound = ( - JustTypeRef(call.callable.ident, call.bound_tp_params or ()) - if isinstance(call.callable, (ClassMethodRef, MethodRef)) + JustTypeRef(call.callable.ident, call.bound_tp_params) + if isinstance(call.callable, (ClassMethodRef, MethodRef, InitRef)) and call.bound_tp_params else None ) diff --git a/python/egglog/egraph_state.py b/python/egglog/egraph_state.py index 78e97878..00089ba6 100644 --- a/python/egglog/egraph_state.py +++ b/python/egglog/egraph_state.py @@ -461,7 +461,9 @@ def type_ref_to_egg(self, ref: JustTypeRef) -> str: decl = self.__egg_decls__._classes[ref.ident] self.type_ref_to_egg_sort[ref] = egg_name = (not ref.args and decl.egg_name) or _generate_type_egg_name(ref) self.egg_sort_to_type_ref[egg_name] = ref - if not decl.builtin or ref.args: + + if decl.builtin: + # If this has args, create a new parameterized version of the builtin class if ref.args: if ref.ident == Ident.builtin("UnstableFn"): # UnstableFn is a special case, where the rest of args are collected into a call @@ -478,18 +480,18 @@ def type_ref_to_egg(self, ref: JustTypeRef) -> str: ] else: type_args = [bindings.Var(span(), self.type_ref_to_egg(a)) for a in ref.args] - args = (self.type_ref_to_egg(JustTypeRef(ref.ident)), type_args) - else: - args = None - self.egraph.run_program(bindings.Sort(span(), egg_name, args)) - # For builtin classes, let's also make sure we have the mapping of all egg fn names for class methods, because - # these can be created even without adding them to the e-graph, like `vec-empty` which can be extracted - # even if you never use that function. - if decl.builtin: + assert decl.egg_name + self.egraph.run_program(bindings.Sort(span(), egg_name, (decl.egg_name, type_args))) + + # For builtin classes, let's also make sure we have the mapping of all egg fn names for class methods. + # these can be created even without adding them to the e-graph, like `vec-empty` which can be extracted + # even if you never use that function. for method_name in decl.class_methods: self.callable_ref_to_egg(ClassMethodRef(ref.ident, method_name)) if decl.init: self.callable_ref_to_egg(InitRef(ref.ident)) + else: + self.egraph.run_program(bindings.Sort(span(), egg_name, None)) return egg_name @@ -760,7 +762,7 @@ def value_to_expr(self, tp: JustTypeRef, value: bindings.Value) -> ExprDecl: # return CallDecl( InitRef(Ident.builtin("Set")), tuple(TypedExprDecl(v_tp, self.value_to_expr(v_tp, x)) for x in xs_), - (v_tp,), + (v_tp,) if not xs_ else (), ) case "Vec": xs = self.egraph.value_to_vec(value) @@ -768,7 +770,7 @@ def value_to_expr(self, tp: JustTypeRef, value: bindings.Value) -> ExprDecl: # return CallDecl( InitRef(Ident.builtin("Vec")), tuple(TypedExprDecl(v_tp, self.value_to_expr(v_tp, x)) for x in xs), - (v_tp,), + (v_tp,) if not xs else (), ) case "MultiSet": xs = self.egraph.value_to_multiset(value) @@ -776,7 +778,7 @@ def value_to_expr(self, tp: JustTypeRef, value: bindings.Value) -> ExprDecl: # return CallDecl( InitRef(Ident.builtin("MultiSet")), tuple(TypedExprDecl(v_tp, self.value_to_expr(v_tp, x)) for x in xs), - (v_tp,), + (v_tp,) if not xs else (), ) case "UnstableFn": _names, _args = self.egraph.value_to_function(value) @@ -796,22 +798,13 @@ def _unstable_fn_value_to_expr( continue if signature.semantic_return_type.ident != return_tp.ident: continue - tcs = TypeConstraintSolver() - - arg_types = tcs.infer_arg_types( + arg_types = TypeConstraintSolver().infer_arg_types( signature.arg_types, signature.semantic_return_type, signature.var_arg_type, return_tp ) - args = tuple( TypedExprDecl(tp, self.value_to_expr(tp, v)) for tp, v in zip(arg_types, partial_args, strict=False) ) - if isinstance(callable_ref, ClassMethodRef | InitRef): - bound_tp_params = tuple( - map(tcs.substitute_typevars, self.__egg_decls__.get_class_decl(callable_ref.ident).type_vars) - ) - else: - bound_tp_params = () - call_decl = CallDecl(callable_ref, args, bound_tp_params) + call_decl = CallDecl(callable_ref, args) return PartialCallDecl(call_decl) raise ValueError(f"Function '{name}' not found") @@ -936,6 +929,9 @@ def from_call(self, tp: JustTypeRef, term: bindings.TermApp) -> CallDecl: tcs = TypeConstraintSolver() if possible_type and possible_type.args: tcs.bind_class(possible_type, self.decls) + bound_args = possible_type.args + else: + bound_args = () try: arg_types = tcs.infer_arg_types( signature.arg_types, signature.semantic_return_type, signature.var_arg_type, tp @@ -945,12 +941,9 @@ def from_call(self, tp: JustTypeRef, term: bindings.TermApp) -> CallDecl: except TypeConstraintError: continue args = tuple(self.resolve_term(a, tp) for a, tp in a_tp) - if not args and isinstance(callable_ref, ClassMethodRef | InitRef): - bound_tp_params = tuple( - map(tcs.substitute_typevars, self.decls.get_class_decl(callable_ref.ident).type_vars) - ) - else: - bound_tp_params = () + # Only save bound tp params if needed for inferring return type + # this is true if the set of set of type vars in the return are not a subset of those in the args + bound_tp_params = () if signature.semantic_return_type.vars.issubset(signature.arg_vars) else bound_args return CallDecl(callable_ref, args, bound_tp_params) raise ValueError( f"Could not find callable ref for call {term}. None of these refs matched the types: {self.state.egg_fn_to_callable_refs[term.name]}" diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index ea908cff..a713d2d7 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -2500,7 +2500,7 @@ def factor_ruleset( yield rule( eq(n).to(polynomial(mss)), # Find factor that shows up in most monomials, at least two of them - counts == MultiSet.sum_multisets(mss.map(MultiSet[Value].reset_counts)), + counts == MultiSet.sum_multisets(mss.map(MultiSet.reset_counts)), eq(factor).to(counts.pick_max()), # Only factor out if it term appears in more than one monomial counts.count(factor) > 1, diff --git a/python/egglog/exp/polynomials.py b/python/egglog/exp/polynomials.py index 26eccdeb..1d58b964 100644 --- a/python/egglog/exp/polynomials.py +++ b/python/egglog/exp/polynomials.py @@ -253,7 +253,7 @@ def factor_ruleset( yield rule( n == polynomial(mss), # Find factor that shows up in most monomials, at least two of them - counts == MultiSet.sum_multisets(mss.map(MultiSet[Number].reset_counts)), + counts == MultiSet.sum_multisets(mss.map(MultiSet.reset_counts)), factor == counts.pick_max(), # Only factor out if it term appears in more than one monomial counts.count(factor) > 1, diff --git a/python/egglog/runtime.py b/python/egglog/runtime.py index 7c9144c4..1e7e16c5 100644 --- a/python/egglog/runtime.py +++ b/python/egglog/runtime.py @@ -17,7 +17,6 @@ from collections.abc import Callable from dataclasses import InitVar, dataclass, replace from inspect import Parameter, Signature -from itertools import zip_longest from typing import TYPE_CHECKING, Any, TypeVar, Union, assert_never, cast, get_args, get_origin import cloudpickle @@ -398,23 +397,18 @@ def __getattr__(self, name: str) -> RuntimeFunction | RuntimeExpr | Callable: self.__egg_decls_thunk__, Thunk.value(TypedExprDecl(return_tp.type_ref, CallDecl(ClassVariableRef(self.__egg_tp__.ident, name)))), ) + bound = self.__egg_tp__.to_just() if self.__egg_tp__.args else None if name in cls_decl.class_methods: return RuntimeFunction( - self.__egg_decls_thunk__, - Thunk.value(ClassMethodRef(self.__egg_tp__.ident, name)), - self.__egg_tp__.to_just(), + self.__egg_decls_thunk__, Thunk.value(ClassMethodRef(self.__egg_tp__.ident, name)), bound ) # allow referencing properties and methods as class variables as well if name in cls_decl.properties: return RuntimeFunction( - self.__egg_decls_thunk__, - Thunk.value(PropertyRef(self.__egg_tp__.ident, name)), - self.__egg_tp__.to_just(), + self.__egg_decls_thunk__, Thunk.value(PropertyRef(self.__egg_tp__.ident, name)), bound ) if name in cls_decl.methods: - return RuntimeFunction( - self.__egg_decls_thunk__, Thunk.value(MethodRef(self.__egg_tp__.ident, name)), self.__egg_tp__.to_just() - ) + return RuntimeFunction(self.__egg_decls_thunk__, Thunk.value(MethodRef(self.__egg_tp__.ident, name)), bound) msg = f"Class {self.__egg_tp__.ident} has no method {name}" raise AttributeError(msg) from None @@ -504,7 +498,7 @@ def __hash__(self) -> int: def __egg_ref__(self) -> CallableRef: return self.__egg_ref_thunk__() - def __call__( # noqa: C901 + def __call__( # noqa: C901,PLR0912 self, *args: object, _egg_function_types: tuple[TypeOrVarRef, ...] | None = None, **kwargs: object ) -> RuntimeExpr | None: from .conversion import resolve_literal # noqa: PLC0415 @@ -551,20 +545,14 @@ def __call__( # noqa: C901 args = bound.args tcs = TypeConstraintSolver() - bound_tp = ( - None - if self.__egg_bound__ is None - else self.__egg_bound__.__egg_typed_expr__.tp - if isinstance(self.__egg_bound__, RuntimeExpr) - else self.__egg_bound__ - ) - if ( - bound_tp - and bound_tp.args - # Don't bind class if we have a first class function arg, b/c we don't support that yet - and not function_value - ): - tcs.bind_class(bound_tp, decls) + if isinstance(self.__egg_bound__, JustTypeRef) and self.__egg_bound__.args: + if function_value: + msg = "Cannot have both bound type params and function value" + raise ValueError(msg) + tcs.bind_class(self.__egg_bound__, decls) + bound_tp_params = self.__egg_bound__.args + else: + bound_tp_params = () assert (operator.ge if signature.var_arg_type else operator.eq)(len(args), len(signature.arg_types)) # Hack to allow being explicit on function types when casting. # noqa: FIX004 for _fn_tp in _egg_function_types or (): @@ -575,20 +563,29 @@ def __call__( # noqa: C901 tcs.bind_class(_fn_tp_just, decls) if _fn_tp_just.args: pass + # Try using any runtime expressions passed in to help infer typevars + for arg, tp in zip(args, signature.all_args, strict=False): + if not isinstance(arg, RuntimeExpr): + continue + try: + tcs.infer_typevars(tp, arg.__egg_typed_expr__.tp) + # If this leads to an incompatibility, just skip it, since it could need to be upcasted + except TypeConstraintError: + continue + # Now at this point we should be able to resolve all the typevars upcasted_args = [ - resolve_literal(cast("TypeOrVarRef", tp), arg, Thunk.value(decls), tcs) - for arg, tp in zip_longest(args, signature.arg_types, fillvalue=signature.var_arg_type) + resolve_literal( + tcs.substitute_typevars_try_function(tp, arg, Thunk.value(decls)).to_var(), arg, Thunk.value(decls) + ) + for arg, tp in zip(args, signature.all_args, strict=False) ] decls.update(*upcasted_args) arg_exprs = tuple(arg.__egg_typed_expr__ for arg in upcasted_args) return_tp = tcs.substitute_typevars(signature.semantic_return_type) - bound_params = ( - cast("JustTypeRef", bound_tp).args if isinstance(self.__egg_ref__, ClassMethodRef | InitRef) else () - ) # If we were using unstable-app to call a function, add that function back as the first arg. if function_value: arg_exprs = (function_value, *arg_exprs) - expr_decl = CallDecl(self.__egg_ref__, arg_exprs, bound_params) + expr_decl = CallDecl(self.__egg_ref__, arg_exprs, bound_tp_params) typed_expr_decl = TypedExprDecl(return_tp, expr_decl) # If there is not return type, we are mutating the first arg if not signature.return_type: @@ -901,8 +898,7 @@ def create_callable(decls: Declarations, ref: CallableRef) -> RuntimeClass | Run case InitRef(name): return RuntimeClass(Thunk.value(decls), TypeRefWithVars(name)) case FunctionRef() | MethodRef() | ClassMethodRef() | PropertyRef() | UnnamedFunctionRef(): - bound = JustTypeRef(ref.ident) if isinstance(ref, ClassMethodRef) else None - return RuntimeFunction(Thunk.value(decls), Thunk.value(ref), bound) + return RuntimeFunction(Thunk.value(decls), Thunk.value(ref), None) case ConstantRef(name): tp = decls._constants[name].type_ref case ClassVariableRef(cls_name, var_name): diff --git a/python/egglog/type_constraint_solver.py b/python/egglog/type_constraint_solver.py index 79fd3c42..9efe008e 100644 --- a/python/egglog/type_constraint_solver.py +++ b/python/egglog/type_constraint_solver.py @@ -10,6 +10,7 @@ from __future__ import annotations +from collections.abc import Callable from dataclasses import dataclass, field from itertools import chain, repeat from typing import TYPE_CHECKING, assert_never @@ -120,9 +121,8 @@ def substitute_typevars_try_function( try: result = value(*dummy_args) except Exception as e: - raise TypeConstraintError( - f"Function {value} raised an exception when called with dummy args to infer return type: {e}" - ) from e + e.add_note(f"While trying to infer return type of {value} by calling it") + raise if not isinstance(result, RuntimeExpr): raise TypeConstraintError( f"Function {value} did not return a RuntimeExpr, got {type(result)}, so cannot infer return type" diff --git a/python/tests/test_high_level.py b/python/tests/test_high_level.py index 173e817a..03b5e74c 100644 --- a/python/tests/test_high_level.py +++ b/python/tests/test_high_level.py @@ -1245,7 +1245,7 @@ def my_f(xs: Vec[i64]) -> E: ... # cost = 2 x = i64(10) # cost = 3 + 2 = 5 - xs = Vec[i64](x) + xs = Vec(x) # cost = 100 res = E() # cost = 1 + 5 = 6 From e21d7d40b19e6882ebf06f8ccd99a0086645376f Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Wed, 28 Jan 2026 21:32:09 -0800 Subject: [PATCH 16/30] tmp --- python/egglog/builtins.py | 3 + python/egglog/exp/array_api.py | 63 ++++------ python/egglog/exp/array_api_jit.py | 2 +- python/egglog/exp/array_api_program_gen.py | 2 +- python/egglog/pretty.py | 7 +- .../TestLoopNest.test_index_codegen[expr].py | 33 +++-- .../test_array_api/test_jit[lda][code].py | 64 ---------- .../test_array_api/test_jit[lda][expr].py | 95 -------------- .../test_jit[lda][initial_expr].py | 119 ------------------ .../test_array_api/test_jit[tuple][expr].py | 6 +- .../test_jit[tuple][initial_expr].py | 6 +- .../test_program_compile[tuple][expr].py | 2 +- python/tests/test_pretty.py | 9 +- 13 files changed, 72 insertions(+), 339 deletions(-) delete mode 100644 python/tests/__snapshots__/test_array_api/test_jit[lda][code].py delete mode 100644 python/tests/__snapshots__/test_array_api/test_jit[lda][expr].py delete mode 100644 python/tests/__snapshots__/test_array_api/test_jit[lda][initial_expr].py diff --git a/python/egglog/builtins.py b/python/egglog/builtins.py index 2e370e18..0bcc155b 100644 --- a/python/egglog/builtins.py +++ b/python/egglog/builtins.py @@ -1021,6 +1021,9 @@ def remove(self, index: i64Like) -> Vec[T]: ... @method(egg_fn="vec-set") def set(self, index: i64Like, value: T) -> Vec[T]: ... + @method(egg_fn="vec-union") + def __or__(self, other: Vec[T]) -> Vec[T]: ... + for sequence_type in (list, tuple): converter( diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index a713d2d7..c15bdba1 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -1,53 +1,26 @@ """ - +Experimental Array API support. ## Lists Lists have two main constructors: - `List(length, idx_fn)` -- `List.EMPTY` / `initial.append(last)` +- `List.from_vec(vs)` -This is so that they can be defined either with a known fixed integer length (the cons list type) or a symbolic +This is so that they can be defined either with a known fixed integer length or a symbolic length that could not be resolved to an integer. -There are rewrites to convert between these constructors in both directions. The only limitation however is that -`length` has to a real i64 in order to be converted to a cons list. - -When you are writing a function that uses ints, feel free to the `__getitem__` or `length()` methods or match -directly on `List()` constructor. If you can write your function using that interface please do. But for some other -methods whether the resulting length/index function is dependent on the rest of it, you can only define it with a known -length, so you can then use the const list constructors. - -We also support creating lists from vectors. These can be converted one to one to the snoc list representation. - -It is troublesome to have to redefine lists for every type. It would be nice to have generic types, but they are not implemented yet. - -We are guaranteed that all lists with known lengths will be represented as cons/empty. To safely use lists, use -the `.length` and `.__getitem__` methods, unless you want to depend on it having known length, in which -case you can match directly on the cons list. - -To be a list, you must implement two methods: +Both constructors must implement two methods: * `l.length() -> Int` * `l.__getitem__(i: Int) -> T` -There are three main types of constructors for lists which all implement these methods: - -* Functional `List(length, idx_fn)` -* cons (well reversed cons) lists `List.EMPTY` and `l.append(x)` -* Vectors `List.from_vec(vec)` - -Also all lists constructors must be converted to the functional representation, so that we can match on it -and convert lists with known lengths into cons lists and into vectors. - -This is necessary so that known length lists are properly materialized during extraction. - -Q: Why are they implemented as SNOC lists instead of CONS lists? -A: So that when converting from functional to lists we can use the same index function by starting at the end and folding - that way recursively. +Lists with a known length will be subsumed into the vector representation. +Lists that have vecs that are equal will have the elements unified. +Methods that transform lists should also subsume, so that the vector version will be preferred. """ # mypy: disable-error-code="empty-body" @@ -89,6 +62,8 @@ class Boolean(Expr, ruleset=array_api_ruleset): + NEVER: ClassVar[Boolean] + def __init__(self, value: BoolLike) -> None: ... @method(preserve=True) @@ -479,6 +454,7 @@ def __len__(self) -> int: def __iter__(self) -> Iterator[Int]: return iter(self.eval()) + @method(merge=Vec.__or__) # type: ignore[prop-decorator] @property def to_vec(self) -> Vec[Int]: ... @@ -646,6 +622,7 @@ def __len__(self) -> int: def __iter__(self) -> Iterator[TupleInt]: return iter(self.eval()) + @method(merge=Vec.__or__) # type: ignore[prop-decorator] @property def to_vec(self) -> Vec[TupleInt]: ... @@ -836,7 +813,8 @@ def bool(cls, b: BooleanLike) -> Value: ... def isfinite(self) -> Boolean: ... - def __lt__(self, other: ValueLike) -> Boolean: ... + # TODO: Fix + def __lt__(self, other: ValueLike) -> Value: ... def __le__(self, other: ValueLike) -> Boolean: ... def __gt__(self, other: ValueLike) -> Boolean: ... def __ge__(self, other: ValueLike) -> Boolean: ... @@ -941,8 +919,8 @@ def _value(i: Int, f: Float, b: Boolean, v: Value, v1: Value, v2: Value, i1: Int yield rewrite(Value.int(i) > Value.int(i1)).to(i > i1) yield rewrite(Value.float(f) > Value.float(f1)).to(f > f1) # < - yield rewrite(Value.int(i) < Value.int(i1)).to(i < i1) - yield rewrite(Value.float(f) < Value.float(f1)).to(f < f1) + yield rewrite(Value.int(i) < Value.int(i1)).to(Value.bool(i < i1)) + yield rewrite(Value.float(f) < Value.float(f1)).to(Value.bool(f < f1)) # / yield rewrite(Value.float(f) / Value.float(f1)).to(Value.float(f / f1)) @@ -1573,6 +1551,7 @@ def __len__(self) -> int: def __iter__(self) -> Iterator[NDArray]: return iter(self.eval()) + @method(merge=Vec.__or__) # type: ignore[prop-decorator] @property def to_vec(self) -> Vec[NDArray]: ... @@ -1933,9 +1912,9 @@ def vector_norm(x: NDArrayLike) -> NDArray: """ https://data-apis.org/array-api/2022.12/extensions/generated/array_api.linalg.vector_norm.html TODO: support axis - >>> x = NDArray.vector([1, 2, 3, 4, 5, 6, 7, 8, 9]) - >>> vector_norm(x).eval_numpy("float64") - array(16.88194302) + # >>> x = NDArray.vector([1, 2, 3, 4, 5, 6, 7, 8, 9]) + # >>> vector_norm(x).eval_numpy("float64") + # array(16.88194302) """ # https://numpy.org/doc/stable/reference/generated/numpy.linalg.norm.html#numpy.linalg.norm # sum(abs(x)**ord)**(1./ord) where ord=2 @@ -2068,7 +2047,7 @@ def _interval_analaysis( NDArray.scalar(Value.bool(possible_values(x.index(ALL_INDICES).to_truthy_value).contains(Value.bool(TRUE)))) ), # Indexing x < y is the same as broadcasting the index and then indexing both and then comparing - rewrite((x < y).index(idx)).to(Value.bool(x_value < y_value)), + rewrite((x < y).index(idx)).to(x_value < y_value), # Same for x / y rewrite((x / y).index(idx)).to(x_value / y_value), # Indexing a scalar is the same as the scalar @@ -2102,7 +2081,7 @@ def _interval_analaysis( # Define v < 0 to be false, if greater_zero(v) rule( greater_zero(v), - eq(v1).to(Value.bool(v < Value.int(Int(0)))), + eq(v1).to(v < Value.int(Int(0))), ).then( union(v1).with_(Value.bool(FALSE)), ), diff --git a/python/egglog/exp/array_api_jit.py b/python/egglog/exp/array_api_jit.py index df22229a..3587acfc 100644 --- a/python/egglog/exp/array_api_jit.py +++ b/python/egglog/exp/array_api_jit.py @@ -31,7 +31,7 @@ def jit( fn_program = EvalProgram(program, {"np": np}) egraph.register(fn_program) egraph.run(array_api_program_gen_schedule) - return cast("X", fn_program.as_py_object.value) + return cast("X", egraph.extract(fn_program.as_py_object).value) def function_to_program(fn: Callable, save_egglog_string: bool) -> tuple[EGraph, NDArray, NDArray, Program]: diff --git a/python/egglog/exp/array_api_program_gen.py b/python/egglog/exp/array_api_program_gen.py index 47138841..57027f1c 100644 --- a/python/egglog/exp/array_api_program_gen.py +++ b/python/egglog/exp/array_api_program_gen.py @@ -144,7 +144,7 @@ def _value_program(i: Int, b: Boolean, f: Float, x: NDArray, v1: Value, v2: Valu yield rewrite(value_program(Value.float(f))).to(float_program(f)) # Could add .item() but we usually dont need it. yield rewrite(value_program(x.to_value())).to(ndarray_program(x)) - yield rewrite(bool_program(v1 < v2)).to(Program("(") + value_program(v1) + " < " + value_program(v2) + ")") + yield rewrite(value_program(v1 < v2)).to(Program("(") + value_program(v1) + " < " + value_program(v2) + ")") yield rewrite(value_program(v1 / v2)).to(Program("(") + value_program(v1) + " / " + value_program(v2) + ")") yield rewrite(value_program(v1 + v2)).to(Program("(") + value_program(v1) + " + " + value_program(v2) + ")") yield rewrite(value_program(v1 * v2)).to(Program("(") + value_program(v1) + " * " + value_program(v2) + ")") diff --git a/python/egglog/pretty.py b/python/egglog/pretty.py index d0089c8c..3beee835 100644 --- a/python/egglog/pretty.py +++ b/python/egglog/pretty.py @@ -26,7 +26,7 @@ ] MAX_LINE_LENGTH = 88 LINE_DIFFERENCE = 10 -BLACK_MODE = black.Mode(line_length=88) +BLACK_MODE = black.Mode(line_length=MAX_LINE_LENGTH) # Use this special character in place of the args, so that if the args are inlined # in the viz, they will replace it @@ -97,7 +97,10 @@ def pretty_decl( expr = f"{wrapping_fn}({expr})" program = "\n".join([*pretty.statements, expr]) # First unparse AST to get consistent formatting, then use black to format it nicely - ast_tree = ast.parse(program, mode="exec") + try: + ast_tree = ast.parse(program, mode="exec") + except SyntaxError: + return program program = ast.unparse(ast_tree) try: # TODO: Try replacing with ruff for speed diff --git a/python/tests/__snapshots__/test_array_api/TestLoopNest.test_index_codegen[expr].py b/python/tests/__snapshots__/test_array_api/TestLoopNest.test_index_codegen[expr].py index a80e7566..3e673568 100644 --- a/python/tests/__snapshots__/test_array_api/TestLoopNest.test_index_codegen[expr].py +++ b/python/tests/__snapshots__/test_array_api/TestLoopNest.test_index_codegen[expr].py @@ -1,13 +1,26 @@ -_Value_1 = NDArray.var("X").index(TupleInt.from_vec(Vec[Int](Int(0), Int(0), Int.var("i"), Int.var("j")))) -_Value_2 = NDArray.var("X").index(TupleInt.from_vec(Vec[Int](Int(0), Int(1), Int.var("i"), Int.var("j")))) -_Value_3 = NDArray.var("X").index(TupleInt.from_vec(Vec[Int](Int(1), Int(0), Int.var("i"), Int.var("j")))) -_Value_4 = NDArray.var("X").index(TupleInt.from_vec(Vec[Int](Int(1), Int(1), Int.var("i"), Int.var("j")))) -_Value_5 = NDArray.var("X").index(TupleInt.from_vec(Vec[Int](Int(2), Int(0), Int.var("i"), Int.var("j")))) -_Value_6 = NDArray.var("X").index(TupleInt.from_vec(Vec[Int](Int(2), Int(1), Int.var("i"), Int.var("j")))) +_Value_1 = NDArray.var("X").index( + TupleInt.from_vec(Vec(Int(0), Int(0), Int.var("i"), Int.var("j"))) +) +_Value_2 = NDArray.var("X").index( + TupleInt.from_vec(Vec(Int(0), Int(1), Int.var("i"), Int.var("j"))) +) +_Value_3 = NDArray.var("X").index( + TupleInt.from_vec(Vec(Int(1), Int(0), Int.var("i"), Int.var("j"))) +) +_Value_4 = NDArray.var("X").index( + TupleInt.from_vec(Vec(Int(1), Int(1), Int.var("i"), Int.var("j"))) +) +_Value_5 = NDArray.var("X").index( + TupleInt.from_vec(Vec(Int(2), Int(0), Int.var("i"), Int.var("j"))) +) +_Value_6 = NDArray.var("X").index( + TupleInt.from_vec(Vec(Int(2), Int(1), Int.var("i"), Int.var("j"))) +) ( - ( - ((((_Value_1.conj() * _Value_1).real() + (_Value_2.conj() * _Value_2).real()) + (_Value_3.conj() * _Value_3).real()) + (_Value_4.conj() * _Value_4).real()) - + (_Value_5.conj() * _Value_5).real() - ) + (_Value_1.conj() * _Value_1).real() + + (_Value_2.conj() * _Value_2).real() + + (_Value_3.conj() * _Value_3).real() + + (_Value_4.conj() * _Value_4).real() + + (_Value_5.conj() * _Value_5).real() + (_Value_6.conj() * _Value_6).real() ).sqrt() \ No newline at end of file diff --git a/python/tests/__snapshots__/test_array_api/test_jit[lda][code].py b/python/tests/__snapshots__/test_array_api/test_jit[lda][code].py deleted file mode 100644 index 7bb9f1ea..00000000 --- a/python/tests/__snapshots__/test_array_api/test_jit[lda][code].py +++ /dev/null @@ -1,64 +0,0 @@ -def __fn(X, y): - assert X.dtype == np.dtype(np.float64) - assert X.shape == (150, 4, ) - assert np.all(np.isfinite(X)) - assert y.dtype == np.dtype(np.int64) - assert y.shape == (150, ) - assert set(np.unique(y)) == set((0, 1, 2, )) - _0 = y == np.array(0) - _1 = np.sum(_0) - _2 = y == np.array(1) - _3 = np.sum(_2) - _4 = y == np.array(2) - _5 = np.sum(_4) - _6 = np.array((_1, _3, _5, )).astype(np.dtype(np.float64)) - _7 = _6 / np.array(float(150)) - _8 = np.zeros((3, 4, ), dtype=np.dtype(np.float64)) - _9 = np.sum(X[_0], axis=0) - _10 = _9 / np.array(X[_0].shape[0]) - _8[0, :,] = _10 - _11 = np.sum(X[_2], axis=0) - _12 = _11 / np.array(X[_2].shape[0]) - _8[1, :,] = _12 - _13 = np.sum(X[_4], axis=0) - _14 = _13 / np.array(X[_4].shape[0]) - _8[2, :,] = _14 - _15 = _7 @ _8 - _16 = X - _15 - _17 = np.sqrt(np.asarray(np.array(float(1 / 147)), np.dtype(np.float64))) - _18 = X[_0] - _8[0, :,] - _19 = X[_2] - _8[1, :,] - _20 = X[_4] - _8[2, :,] - _21 = np.concatenate((_18, _19, _20, ), axis=0) - _22 = np.sum(_21, axis=0) - _23 = _22 / np.array(_21.shape[0]) - _24 = np.expand_dims(_23, 0) - _25 = _21 - _24 - _26 = np.square(_25) - _27 = np.sum(_26, axis=0) - _28 = _27 / np.array(_26.shape[0]) - _29 = np.sqrt(_28) - _30 = _29 == np.array(0) - _29[_30] = np.array(float(1)) - _31 = _21 / _29 - _32 = _17 * _31 - _33 = np.linalg.svd(_32, full_matrices=False) - _34 = _33[1] > np.array(0.0001) - _35 = _34.astype(np.dtype(np.int32)) - _36 = np.sum(_35) - _37 = _33[2][:_36, :,] / _29 - _38 = _37.T / _33[1][:_36] - _39 = np.array(150) * _7 - _40 = _39 * np.array(float(1 / 2)) - _41 = np.sqrt(_40) - _42 = _8 - _15 - _43 = _41 * _42.T - _44 = _43.T @ _38 - _45 = np.linalg.svd(_44, full_matrices=False) - _46 = np.array(0.0001) * _45[1][0] - _47 = _45[1] > _46 - _48 = _47.astype(np.dtype(np.int32)) - _49 = np.sum(_48) - _50 = _38 @ _45[2].T[:, :_49,] - _51 = _16 @ _50 - return _51[:, :2,] diff --git a/python/tests/__snapshots__/test_array_api/test_jit[lda][expr].py b/python/tests/__snapshots__/test_array_api/test_jit[lda][expr].py deleted file mode 100644 index 0de1df3d..00000000 --- a/python/tests/__snapshots__/test_array_api/test_jit[lda][expr].py +++ /dev/null @@ -1,95 +0,0 @@ -_NDArray_1 = NDArray.var("X") -assume_dtype(_NDArray_1, DType.float64) -assume_shape(_NDArray_1, TupleInt.from_vec(Vec[Int](Int(150), Int(4)))) -assume_isfinite(_NDArray_1) -_NDArray_2 = NDArray.var("y") -assume_dtype(_NDArray_2, DType.int64) -assume_shape(_NDArray_2, TupleInt.from_vec(Vec[Int](Int(150)))) -assume_value_one_of(_NDArray_2, TupleValue.from_vec(Vec[Value](Value.int(Int(0)), Value.int(Int(1)), Value.int(Int(2))))) -_NDArray_3 = astype( - NDArray.vector( - TupleValue.from_vec( - Vec[Value]( - sum(_NDArray_2 == NDArray.scalar(Value.int(Int(0)))).to_value(), - sum(_NDArray_2 == NDArray.scalar(Value.int(Int(1)))).to_value(), - sum(_NDArray_2 == NDArray.scalar(Value.int(Int(2)))).to_value(), - ) - ) - ), - DType.float64, -) / NDArray.scalar(Value.float(Float.rational(BigRat(BigInt.from_string("150"), BigInt.from_string("1"))))) -_NDArray_4 = zeros(TupleInt.from_vec(Vec[Int](Int(3), Int(4))), OptionalDType.some(DType.float64), OptionalDevice.some(_NDArray_1.device)) -_MultiAxisIndexKeyItem_1 = MultiAxisIndexKeyItem.slice(Slice()) -_IndexKey_1 = IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec[MultiAxisIndexKeyItem](MultiAxisIndexKeyItem.int(Int(0)), _MultiAxisIndexKeyItem_1))) -_NDArray_5 = _NDArray_1[IndexKey.ndarray(_NDArray_2 == NDArray.scalar(Value.int(Int(0))))] -_OptionalIntOrTuple_1 = OptionalIntOrTuple.some(IntOrTuple.int(Int(0))) -_NDArray_4[_IndexKey_1] = sum(_NDArray_5, _OptionalIntOrTuple_1) / NDArray.scalar(Value.int(_NDArray_5.shape[Int(0)])) -_IndexKey_2 = IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec[MultiAxisIndexKeyItem](MultiAxisIndexKeyItem.int(Int(1)), _MultiAxisIndexKeyItem_1))) -_NDArray_6 = _NDArray_1[IndexKey.ndarray(_NDArray_2 == NDArray.scalar(Value.int(Int(1))))] -_NDArray_4[_IndexKey_2] = sum(_NDArray_6, _OptionalIntOrTuple_1) / NDArray.scalar(Value.int(_NDArray_6.shape[Int(0)])) -_IndexKey_3 = IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec[MultiAxisIndexKeyItem](MultiAxisIndexKeyItem.int(Int(2)), _MultiAxisIndexKeyItem_1))) -_NDArray_7 = _NDArray_1[IndexKey.ndarray(_NDArray_2 == NDArray.scalar(Value.int(Int(2))))] -_NDArray_4[_IndexKey_3] = sum(_NDArray_7, _OptionalIntOrTuple_1) / NDArray.scalar(Value.int(_NDArray_7.shape[Int(0)])) -_NDArray_8 = concat( - TupleNDArray.from_vec(Vec[NDArray](_NDArray_5 - _NDArray_4[_IndexKey_1], _NDArray_6 - _NDArray_4[_IndexKey_2], _NDArray_7 - _NDArray_4[_IndexKey_3])), OptionalInt.some(Int(0)) -) -_NDArray_9 = square(_NDArray_8 - expand_dims(sum(_NDArray_8, _OptionalIntOrTuple_1) / NDArray.scalar(Value.int(_NDArray_8.shape[Int(0)])))) -_NDArray_10 = sqrt(sum(_NDArray_9, _OptionalIntOrTuple_1) / NDArray.scalar(Value.int(_NDArray_9.shape[Int(0)]))) -_NDArray_11 = copy(_NDArray_10) -_NDArray_11[IndexKey.ndarray(_NDArray_10 == NDArray.scalar(Value.int(Int(0))))] = NDArray.scalar( - Value.float(Float.rational(BigRat(BigInt.from_string("1"), BigInt.from_string("1")))) -) -_TupleNDArray_1 = svd( - sqrt( - asarray( - NDArray.scalar(Value.float(Float.rational(BigRat(BigInt.from_string("1"), BigInt.from_string("147"))))), - OptionalDType.some(DType.float64), - OptionalBool.none, - OptionalDevice.some(_NDArray_1.device), - ) - ) - * (_NDArray_8 / _NDArray_11), - Boolean(False), -) -_Slice_1 = Slice(OptionalInt.none, OptionalInt.some(sum(astype(_TupleNDArray_1[Int(1)] > NDArray.scalar(Value.float(Float(0.0001))), DType.int32)).to_value().to_int)) -_NDArray_12 = ( - _TupleNDArray_1[Int(2)][IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec[MultiAxisIndexKeyItem](MultiAxisIndexKeyItem.slice(_Slice_1), _MultiAxisIndexKeyItem_1)))] - / _NDArray_11 -).T / _TupleNDArray_1[Int(1)][IndexKey.slice(_Slice_1)] -_TupleNDArray_2 = svd( - ( - sqrt((NDArray.scalar(Value.int(Int(150))) * _NDArray_3) * NDArray.scalar(Value.float(Float.rational(BigRat(BigInt.from_string("1"), BigInt.from_string("2")))))) - * (_NDArray_4 - (_NDArray_3 @ _NDArray_4)).T - ).T - @ _NDArray_12, - Boolean(False), -) -( - (_NDArray_1 - (_NDArray_3 @ _NDArray_4)) - @ ( - _NDArray_12 - @ _TupleNDArray_2[Int(2)].T[ - IndexKey.multi_axis( - MultiAxisIndexKey.from_vec( - Vec[MultiAxisIndexKeyItem]( - _MultiAxisIndexKeyItem_1, - MultiAxisIndexKeyItem.slice( - Slice( - OptionalInt.none, - OptionalInt.some( - sum(astype(_TupleNDArray_2[Int(1)] > (NDArray.scalar(Value.float(Float(0.0001))) * _TupleNDArray_2[Int(1)][IndexKey.int(Int(0))]), DType.int32)) - .to_value() - .to_int - ), - ) - ), - ) - ) - ) - ] - ) -)[ - IndexKey.multi_axis( - MultiAxisIndexKey.from_vec(Vec[MultiAxisIndexKeyItem](_MultiAxisIndexKeyItem_1, MultiAxisIndexKeyItem.slice(Slice(OptionalInt.none, OptionalInt.some(Int(2)))))) - ) -] \ No newline at end of file diff --git a/python/tests/__snapshots__/test_array_api/test_jit[lda][initial_expr].py b/python/tests/__snapshots__/test_array_api/test_jit[lda][initial_expr].py deleted file mode 100644 index 1601d464..00000000 --- a/python/tests/__snapshots__/test_array_api/test_jit[lda][initial_expr].py +++ /dev/null @@ -1,119 +0,0 @@ -_NDArray_1 = NDArray.var("X") -assume_dtype(_NDArray_1, DType.float64) -assume_shape(_NDArray_1, TupleInt.from_vec(Vec[Int](Int(150), Int(4)))) -assume_isfinite(_NDArray_1) -_NDArray_2 = NDArray.var("y") -assume_dtype(_NDArray_2, DType.int64) -assume_shape(_NDArray_2, TupleInt.from_vec(Vec[Int](Int(150)))) -_TupleValue_1 = TupleValue.from_vec(Vec[Value](Value.int(Int(0)), Value.int(Int(1)), Value.int(Int(2)))) -assume_value_one_of(_NDArray_2, _TupleValue_1) -_NDArray_3 = zeros( - TupleInt.from_vec(Vec[Int](NDArray.vector(_TupleValue_1).shape[Int(0)], asarray(_NDArray_1).shape[Int(1)])), - OptionalDType.some(asarray(_NDArray_1).dtype), - OptionalDevice.some(asarray(_NDArray_1).device), -) -_MultiAxisIndexKeyItem_1 = MultiAxisIndexKeyItem.slice(Slice()) -_IndexKey_1 = IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec(MultiAxisIndexKeyItem.int(Int(0)), _MultiAxisIndexKeyItem_1))) -_IndexKey_2 = IndexKey.ndarray(unique_inverse(_NDArray_2)[Int(1)] == NDArray.scalar(Value.int(Int(0)))) -_OptionalIntOrTuple_1 = OptionalIntOrTuple.some(IntOrTuple.int(Int(0))) -_NDArray_3[_IndexKey_1] = mean(asarray(_NDArray_1)[_IndexKey_2], _OptionalIntOrTuple_1) -_IndexKey_3 = IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec(MultiAxisIndexKeyItem.int(Int(1)), _MultiAxisIndexKeyItem_1))) -_IndexKey_4 = IndexKey.ndarray(unique_inverse(_NDArray_2)[Int(1)] == NDArray.scalar(Value.int(Int(1)))) -_NDArray_3[_IndexKey_3] = mean(asarray(_NDArray_1)[_IndexKey_4], _OptionalIntOrTuple_1) -_IndexKey_5 = IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec(MultiAxisIndexKeyItem.int(Int(2)), _MultiAxisIndexKeyItem_1))) -_IndexKey_6 = IndexKey.ndarray(unique_inverse(_NDArray_2)[Int(1)] == NDArray.scalar(Value.int(Int(2)))) -_NDArray_3[_IndexKey_5] = mean(asarray(_NDArray_1)[_IndexKey_6], _OptionalIntOrTuple_1) -_NDArray_4 = zeros(TupleInt.from_vec(Vec[Int](Int(3), Int(4))), OptionalDType.some(DType.float64), OptionalDevice.some(_NDArray_1.device)) -_IndexKey_7 = IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec[MultiAxisIndexKeyItem](MultiAxisIndexKeyItem.int(Int(0)), _MultiAxisIndexKeyItem_1))) -_NDArray_4[_IndexKey_7] = mean(_NDArray_1[_IndexKey_2], _OptionalIntOrTuple_1) -_IndexKey_8 = IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec[MultiAxisIndexKeyItem](MultiAxisIndexKeyItem.int(Int(1)), _MultiAxisIndexKeyItem_1))) -_NDArray_4[_IndexKey_8] = mean(_NDArray_1[_IndexKey_4], _OptionalIntOrTuple_1) -_IndexKey_9 = IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec[MultiAxisIndexKeyItem](MultiAxisIndexKeyItem.int(Int(2)), _MultiAxisIndexKeyItem_1))) -_NDArray_4[_IndexKey_9] = mean(_NDArray_1[_IndexKey_6], _OptionalIntOrTuple_1) -_NDArray_5 = concat( - TupleNDArray.from_vec( - Vec[NDArray]( - _NDArray_1[IndexKey.ndarray(_NDArray_2 == NDArray.scalar(Value.int(Int(0))))] - _NDArray_4[_IndexKey_7], - _NDArray_1[IndexKey.ndarray(_NDArray_2 == NDArray.scalar(Value.int(Int(1))))] - _NDArray_4[_IndexKey_8], - _NDArray_1[IndexKey.ndarray(_NDArray_2 == NDArray.scalar(Value.int(Int(2))))] - _NDArray_4[_IndexKey_9], - ) - ), - OptionalInt.some(Int(0)), -) -_NDArray_6 = std(_NDArray_5, _OptionalIntOrTuple_1) -_NDArray_6[IndexKey.ndarray(std(_NDArray_5, _OptionalIntOrTuple_1) == NDArray.scalar(Value.int(Int(0))))] = NDArray.scalar( - Value.float(Float.rational(BigRat(BigInt.from_string("1"), BigInt.from_string("1")))) -) -_TupleNDArray_1 = svd( - sqrt( - asarray( - NDArray.scalar(Value.float(Float.rational(BigRat(BigInt.from_string("1"), BigInt.from_string("147"))))), - OptionalDType.some(DType.float64), - OptionalBool.none, - OptionalDevice.some(_NDArray_1.device), - ) - ) - * (_NDArray_5 / _NDArray_6), - Boolean(False), -) -_Slice_1 = Slice(OptionalInt.none, OptionalInt.some(sum(astype(_TupleNDArray_1[Int(1)] > NDArray.scalar(Value.float(Float(0.0001))), DType.int32)).to_value().to_int)) -_NDArray_7 = asarray(reshape(asarray(_NDArray_2), TupleInt.from_vec(Vec[Int](Int(-1))))) -_NDArray_8 = unique_values(concat(TupleNDArray.from_vec(Vec[NDArray](unique_values(asarray(_NDArray_7)))))) -_NDArray_9 = std( - concat( - TupleNDArray.from_vec( - Vec[NDArray]( - asarray(_NDArray_1)[IndexKey.ndarray(_NDArray_7 == _NDArray_8[IndexKey.int(Int(0))])] - _NDArray_3[_IndexKey_1], - asarray(_NDArray_1)[IndexKey.ndarray(_NDArray_7 == _NDArray_8[IndexKey.int(Int(1))])] - _NDArray_3[_IndexKey_3], - asarray(_NDArray_1)[IndexKey.ndarray(_NDArray_7 == _NDArray_8[IndexKey.int(Int(2))])] - _NDArray_3[_IndexKey_5], - ) - ), - OptionalInt.some(Int(0)), - ), - _OptionalIntOrTuple_1, -) -_NDArray_10 = copy(_NDArray_9) -_NDArray_10[IndexKey.ndarray(_NDArray_9 == NDArray.scalar(Value.int(Int(0))))] = NDArray.scalar(Value.float(Float(1.0))) -_NDArray_11 = astype(unique_counts(_NDArray_2)[Int(1)], DType.float64) / NDArray.scalar(Value.float(Float.rational(BigRat(BigInt.from_string("150"), BigInt.from_string("1"))))) -_TupleNDArray_2 = svd( - ( - sqrt((NDArray.scalar(Value.int(Int(150))) * _NDArray_11) * NDArray.scalar(Value.float(Float.rational(BigRat(BigInt.from_string("1"), BigInt.from_string("2")))))) - * (_NDArray_4 - (_NDArray_11 @ _NDArray_4)).T - ).T - @ ( - ( - _TupleNDArray_1[Int(2)][IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec[MultiAxisIndexKeyItem](MultiAxisIndexKeyItem.slice(_Slice_1), _MultiAxisIndexKeyItem_1)))] - / _NDArray_6 - ).T - / _TupleNDArray_1[Int(1)][IndexKey.slice(_Slice_1)] - ), - Boolean(False), -) -( - (asarray(_NDArray_1) - ((astype(unique_counts(_NDArray_2)[Int(1)], asarray(_NDArray_1).dtype) / NDArray.scalar(Value.float(Float(150.0)))) @ _NDArray_3)) - @ ( - ( - (_TupleNDArray_1[Int(2)][IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec(MultiAxisIndexKeyItem.slice(_Slice_1), _MultiAxisIndexKeyItem_1)))] / _NDArray_10).T - / _TupleNDArray_1[Int(1)][IndexKey.slice(_Slice_1)] - ) - @ _TupleNDArray_2[Int(2)].T[ - IndexKey.multi_axis( - MultiAxisIndexKey.from_vec( - Vec( - _MultiAxisIndexKeyItem_1, - MultiAxisIndexKeyItem.slice( - Slice( - OptionalInt.none, - OptionalInt.some( - sum(astype(_TupleNDArray_2[Int(1)] > (NDArray.scalar(Value.float(Float(0.0001))) * _TupleNDArray_2[Int(1)][IndexKey.int(Int(0))]), DType.int32)) - .to_value() - .to_int - ), - ) - ), - ) - ) - ) - ] - ) -)[IndexKey.multi_axis(MultiAxisIndexKey.from_vec(Vec(_MultiAxisIndexKeyItem_1, MultiAxisIndexKeyItem.slice(Slice(OptionalInt.none, OptionalInt.some(Int(2)))))))] \ No newline at end of file diff --git a/python/tests/__snapshots__/test_array_api/test_jit[tuple][expr].py b/python/tests/__snapshots__/test_array_api/test_jit[tuple][expr].py index fd442e81..b7f9f977 100644 --- a/python/tests/__snapshots__/test_array_api/test_jit[tuple][expr].py +++ b/python/tests/__snapshots__/test_array_api/test_jit[tuple][expr].py @@ -1 +1,5 @@ -NDArray.var("x")[IndexKey.int((NDArray.var("x").shape + TupleInt.from_vec(Vec[Int](Int(1), Int(2))))[Int(100)])] \ No newline at end of file +NDArray.var("x")[ + IndexKey.int( + (NDArray.var("x").shape + TupleInt.from_vec(Vec(Int(1), Int(2))))[Int(100)] + ) +] \ No newline at end of file diff --git a/python/tests/__snapshots__/test_array_api/test_jit[tuple][initial_expr].py b/python/tests/__snapshots__/test_array_api/test_jit[tuple][initial_expr].py index fd442e81..436c9622 100644 --- a/python/tests/__snapshots__/test_array_api/test_jit[tuple][initial_expr].py +++ b/python/tests/__snapshots__/test_array_api/test_jit[tuple][initial_expr].py @@ -1 +1,5 @@ -NDArray.var("x")[IndexKey.int((NDArray.var("x").shape + TupleInt.from_vec(Vec[Int](Int(1), Int(2))))[Int(100)])] \ No newline at end of file +NDArray.var("x")[ + IndexKey.int( + (NDArray.var("x").shape + TupleInt.from_vec(Vec[Int](Int(1), Int(2))))[Int(100)] + ) +] \ No newline at end of file diff --git a/python/tests/__snapshots__/test_array_api/test_program_compile[tuple][expr].py b/python/tests/__snapshots__/test_array_api/test_program_compile[tuple][expr].py index 327edb60..f8e7feb6 100644 --- a/python/tests/__snapshots__/test_array_api/test_program_compile[tuple][expr].py +++ b/python/tests/__snapshots__/test_array_api/test_program_compile[tuple][expr].py @@ -1 +1 @@ -tuple_value_program(TupleValue.from_vec(Vec[Value](Value.int(Int(1)), Value.int(Int(2))))) \ No newline at end of file +tuple_value_program(TupleValue.from_vec(Vec(Value.int(Int(1)), Value.int(Int(2))))) \ No newline at end of file diff --git a/python/tests/test_pretty.py b/python/tests/test_pretty.py index 3c19c85f..7502b6d8 100644 --- a/python/tests/test_pretty.py +++ b/python/tests/test_pretty.py @@ -106,7 +106,12 @@ def binary(x: A, y: A) -> A: ... def my_very_long_function_name() -> A: ... -long_line = my_very_long_function_name() + my_very_long_function_name() + my_very_long_function_name() +long_line = ( + my_very_long_function_name() + + my_very_long_function_name() + + my_very_long_function_name() + + my_very_long_function_name() +) r = ruleset(name="r") @@ -150,7 +155,7 @@ def __repr__(self) -> str: pytest.param(has_default(A()), "has_default()", id="has default"), pytest.param( rewrite(long_line).to(long_line), - "_A_1 = (my_very_long_function_name() + my_very_long_function_name()) + my_very_long_function_name()\nrewrite(_A_1).to(_A_1)", + "_A_1 = (\n my_very_long_function_name()\n + my_very_long_function_name()\n + my_very_long_function_name()\n + my_very_long_function_name()\n)\nrewrite(_A_1).to(_A_1)", id="wrap long line", ), pytest.param(A() - A(), "A() - A()", id="subtraction"), From 81113884c6cc40d9f745e79966b19304a336242d Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Thu, 29 Jan 2026 09:54:33 -0800 Subject: [PATCH 17/30] fix abs --- python/egglog/exp/array_api.py | 12 +++++++++--- 1 file changed, 9 insertions(+), 3 deletions(-) diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index c15bdba1..1eee0f38 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -264,7 +264,7 @@ def _int(i: i64, j: i64, r: Boolean, o: Int, b: Int): yield rewrite(Int(i) << Int(j)).to(Int(i << j)) yield rewrite(Int(i) >> Int(j)).to(Int(i >> j)) yield rewrite(~Int(i)).to(Int(~i)) - yield rewrite(abs(Int(i))).to(Int(abs(i))) + yield rewrite(Int(i).__abs__()).to(Int(i.__abs__())) yield rewrite(Int.if_(TRUE, o, b), subsume=True).to(o) yield rewrite(Int.if_(FALSE, o, b), subsume=True).to(b) @@ -404,7 +404,7 @@ def _float(fl: Float, f: f64, f2: f64, i: i64, r: BigRat, r1: BigRat, i_: Int): rewrite(Float.rational(r) == Float.rational(r)).to(TRUE), rewrite(Float.rational(r) == Float.rational(r1)).to(FALSE, ne(r).to(r1)), rewrite(Float.rational(r).__round__()).to(Float.rational(r.round())), - rewrite(abs(Float(f))).to(Float(abs(f))), + rewrite(Float(f).__abs__()).to(Float(f.__abs__())), ] @@ -1819,6 +1819,10 @@ def square(x: NDArray) -> NDArray: ... def any(x: NDArray) -> NDArray: ... +@function(egg_fn="ndarray-abs") +def abs(x: NDArray) -> NDArray: ... + + @function(egg_fn="ndarray-log") def log(x: NDArray) -> NDArray: ... @@ -1921,7 +1925,9 @@ def vector_norm(x: NDArrayLike) -> NDArray: x = cast("NDArray", x) # Only works on vectors return NDArray.scalar( - x.to_values().map_value(lambda v: abs(v) ** Value.float(Float(2.0))).foldl_value(Value.__add__, Value.float(0)) + x.to_values() + .map_value(lambda v: v.__abs__() ** Value.float(Float(2.0))) + .foldl_value(Value.__add__, Value.float(0)) ** Value.float(Float(0.5)) ) From 8ded220e8766351466cafee4d9510e124a2625c3 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Thu, 29 Jan 2026 09:55:28 -0800 Subject: [PATCH 18/30] Add sum --- python/egglog/exp/array_api.py | 3 +++ 1 file changed, 3 insertions(+) diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index 1eee0f38..c0a09757 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -1272,6 +1272,9 @@ def size(self) -> Int: ... def __len__(self) -> int: return self.size.eval() + @method(egg_fn="sum") + def sum(self, axis: OptionalIntOrTuple = None) -> NDArray: ... + @method(preserve=True) def __iter__(self) -> Iterator[NDArray]: for i in range(len(self)): From a2f5123c6b20fbf887e473d5d73aa28bede7884c Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Thu, 29 Jan 2026 09:55:36 -0800 Subject: [PATCH 19/30] abs --- python/egglog/exp/array_api.py | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index c0a09757..6652dc37 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -939,10 +939,10 @@ def _value(i: Int, f: Float, b: Boolean, v: Value, v1: Value, v2: Value, i1: Int yield rewrite(Value.int(i) ** Value.float(f1)).to(Value.float(Float.from_int(i) ** f1)) # abs - yield rewrite(abs(Value.int(i))).to(Value.int(abs(i))) - yield rewrite(abs(Value.float(f))).to(Value.float(abs(f))) + yield rewrite(Value.int(i).__abs__()).to(Value.int(i.__abs__())) + yield rewrite(Value.float(f).__abs__()).to(Value.float(f.__abs__())) # abs(x) **2 = x**2 - yield rewrite(abs(v) ** Value.float(Float.rational(BigRat(2, 1)))).to(v ** Value.float(2)) + yield rewrite(v.__abs__() ** Value.float(Float.rational(BigRat(2, 1)))).to(v ** Value.float(2)) # ** distributes over division yield rewrite((v1 / v) ** v2, subsume=True).to(v1**v2 / (v**v2)) From b08088a8351deac40b5b0b60ae75dbecf9de74dd Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Thu, 29 Jan 2026 10:03:44 -0800 Subject: [PATCH 20/30] spelling --- python/egglog/declarations.py | 8 ++++---- python/egglog/egraph.py | 6 +++--- 2 files changed, 7 insertions(+), 7 deletions(-) diff --git a/python/egglog/declarations.py b/python/egglog/declarations.py index de6fef91..3b01de4a 100644 --- a/python/egglog/declarations.py +++ b/python/egglog/declarations.py @@ -1,7 +1,7 @@ """ Data only descriptions of the components of an egraph and the expressions. -We seperate it it into two pieces, the references the declerations, so that we can report mutually recursive types. +We separate it it into two pieces, the references the declarations, so that we can report mutually recursive types. """ from __future__ import annotations @@ -310,9 +310,9 @@ def check_binary_method_with_other_type(self, method_name: str, other_type: Just def get_class_decl(self, ident: Ident) -> ClassDecl: return self._classes[ident] - def get_paramaterized_class(self, ident: Ident) -> TypeRefWithVars: + def get_parameterized_class(self, ident: Ident) -> TypeRefWithVars: """ - Returns a class reference with type parameters, if the class is paramaterized. + Returns a class reference with type parameters, if the class is parameterized. """ type_vars = self._classes[ident].type_vars return TypeRefWithVars(ident, type_vars) @@ -754,7 +754,7 @@ class PartialCallDecl: Note it does not need to have any args, in which case it's just a function pointer. - Seperated from the call decl so it's clear it is translated to a `unstable-fn` call. + Separated from the call decl so it's clear it is translated to a `unstable-fn` call. """ call: CallDecl diff --git a/python/egglog/egraph.py b/python/egglog/egraph.py index 3ca56745..13e8c549 100644 --- a/python/egglog/egraph.py +++ b/python/egglog/egraph.py @@ -589,7 +589,7 @@ def _fn_decl( else: var_arg_type = None arg_types = tuple( - decls.get_paramaterized_class(ref.ident) + decls.get_parameterized_class(ref.ident) if i == 0 and isinstance(ref, MethodRef | PropertyRef) else resolve_type_annotation_mutate(decls, hints[t.name]) for i, t in enumerate(params) @@ -604,7 +604,7 @@ def _fn_decl( decls.update(*arg_defaults) return_type = ( - decls.get_paramaterized_class(ref.ident) + decls.get_parameterized_class(ref.ident) if isinstance(ref, InitRef) else arg_types[0] if mutates_first_arg @@ -778,7 +778,7 @@ def _add_default_rewrite_function( arg_exprs: list[RuntimeExpr | RuntimeClass] = [RuntimeExpr.__from_values__(decls, a) for a in args] # If this is a classmethod, add the class as the first arg if isinstance(ref, ClassMethodRef): - tp = decls.get_paramaterized_class(ref.ident) + tp = decls.get_parameterized_class(ref.ident) arg_exprs.insert(0, RuntimeClass(Thunk.value(decls), tp)) with set_current_ruleset(ruleset): res = fn(*arg_exprs) From 75f69abba6c3bb6c4bd60b8ea3f3eb267210842c Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Fri, 30 Jan 2026 02:38:32 -0800 Subject: [PATCH 21/30] tmp --- .github/AGENTS.md | 2 +- AGENTS.md | 1327 +++++++++++++++++++++++++++++++++++++++++++++ 2 files changed, 1328 insertions(+), 1 deletion(-) create mode 100644 AGENTS.md diff --git a/.github/AGENTS.md b/.github/AGENTS.md index 1e0f18d8..97824fc9 100644 --- a/.github/AGENTS.md +++ b/.github/AGENTS.md @@ -140,7 +140,7 @@ The compiled extension artifact `python/egglog/bindings.cpython-*.so` is generat ## Code Style Preferences 1. **Imports**: Follow Ruff's import sorting -2. **Naming**: +2. **Naming**: - Python: snake_case for functions and variables, PascalCase for classes - Rust: Follow standard Rust conventions 3. **Comments**: Use clear, explanatory comments for complex logic diff --git a/AGENTS.md b/AGENTS.md new file mode 100644 index 00000000..8f72db75 --- /dev/null +++ b/AGENTS.md @@ -0,0 +1,1327 @@ + + +# Debug notes for egglog / python bindings (array_api focus) + +This is a short scratchpad of things learned while debugging `python/tests/test_array_api.py::test_jit[lda]`. + +## How evaluation works (python bindings) +- `Boolean.to_bool` is a primitive `Bool` output. If no rule sets it, extraction fails with `lookup of function ... Boolean_to_bool`. +- `try_evaling(...)` in `python/egglog/exp/array_api.py` first tries `egraph.extract(prim_expr)`, then registers the expr and runs `array_api_schedule`. If that fails it retries with a fresh `EGraph` to avoid cross-expression contradictions. Panics inside rules (e.g., `False cannot equal True`) still bubble. +- A common failure path is: a boolean expression doesn’t reduce to `TRUE/FALSE` so `to_bool` never gets set. + +## Vecs, to_vec, and illegal merges +- `Vec[...]` is a primitive sort in egg-smol. You cannot rewrite or union two Vec values safely; this causes `Illegal merge attempted for function ..._to_vec` or `Cannot union values of sort Vec[...]`. +- `TupleInt.to_vec` was wired via `set_(ti.to_vec).to(vs)` when `ti == TupleInt.from_vec(vs)`. If multiple Vec representations become equal (e.g., `vec-of` vs `append`), this can cause illegal merges. +- If you ever add `array_api_vec_to_cons_ruleset` to the main schedule, it can create multiple Vec representations and re-trigger illegal merges. Keeping vec-to-cons rules out of the main schedule avoids this class of panic. +- As a temporary mitigation I added a merge on `TupleInt.to_vec` to keep the old Vec (`@method(merge=lambda old,_new: old)`), but this can mask real inconsistencies. + +## Tuple/Vec helpers that unblock evaluation +- To allow extraction to reason about tuple shapes, these rewrites are useful: + - `TupleInt.from_vec(vs).length() -> Int(vs.length())` + - `TupleInt.from_vec(vs)[Int(k)] -> vs[k]` guarded by `k >= 0` and `k < vs.length()` + - `TupleValue.from_vec(vs).length() -> Int(vs.length())` +- Guard `vec-get` accesses; unguarded rules can produce `vec-get failed` panics when indices are not provably in-bounds. + +## LDA failure shape (what expression was stuck) +- The failing boolean in `test_jit[lda]` eventually reduces to the sklearn priors check: + - `abs(sum(astype(unique_counts(y)[1], dtype) / 150.0) - 1.0) > 1e-5` +- The system needs a rule that normalizes `sum(astype(unique_counts(x)[1], dtype) / Float.from_int(x.size))` to `1.0`. +- Without that, the boolean never reduces to `TRUE/FALSE`, so `Boolean.to_bool` lookup fails. + +## concat / unique_values simplifications +- `concat(TupleNDArray.EMPTY.append(x)) -> x` exists, but `concat(TupleNDArray.from_vec(vs))` with `vs.length()==1` also needs a rewrite to avoid leaving a nested `concat` term. +- `unique_values(x)` rewrites to `NDArray.vector(possible_values(x.index(ALL_INDICES)))`, which pushes the problem into `possible_values(...)` and tuple lengths. If `possible_values(...)` doesn’t reduce to a concrete `TupleValue`, shape queries can get stuck. + +## Common panic/error messages and likely causes +- `lookup of function ... Boolean_to_bool failed`: no rewrite set the primitive `Bool` for that boolean expression. +- `Illegal merge attempted for function ..._to_vec`: two distinct Vec values were merged for a function output. +- `vec-get failed`: a rewrite attempted `vs[k]` without a provable `0 <= k < vs.length()`. +- `False cannot equal True`: a contradictory rule chain produced both booleans in the same e-class. + +## Files worth checking first +- `python/egglog/exp/array_api.py`: rulesets, `try_evaling`, tuple/vec conversions, ndarray ops. +- `python/egglog/egraph_state.py`: error paths and how rule commands are compiled. +- `python/egglog/exp/program_gen.py`: example of a safe `@method(merge=...)` on properties. + +# Context7 + +Use context7 MCP server on https://context7.com/egraphs-good/egglog-python to understand docs. + +Here is a copy of the summary + +# egglog Python Library + +egglog is a Python library providing high-level bindings to the Rust [egglog](https://github.com/egraphs-good/egglog/) library, enabling e-graph-based equality saturation in Python. E-graphs are a powerful data structure that efficiently represents many equivalent programs simultaneously, making them ideal for program optimization, theorem proving, and symbolic computation tasks. + +The library offers a Pythonic API for defining custom expression types, rewrite rules, and Datalog-style relational rules. It supports automatic term extraction based on cost models, union-find operations for equivalence classes, and built-in primitive types (integers, floats, strings, rationals, vectors, sets, maps). The core workflow involves creating an EGraph, registering expressions and rewrite rules, running saturation, and extracting optimized results. + +## EGraph - Core E-Graph Operations + +The EGraph class is the central data structure that maintains equivalence classes of expressions. It supports registering expressions, running rewrite rules, checking facts, and extracting optimal expressions based on cost models. + +```python +from egglog import * + +# Create an EGraph instance +egraph = EGraph() + +# Define a custom expression type +class Num(Expr): + def __init__(self, value: i64Like) -> None: ... + @classmethod + def var(cls, name: StringLike) -> Num: ... + def __add__(self, other: Num) -> Num: ... + def __mul__(self, other: Num) -> Num: ... + +# Register expressions with let() to get references +expr1 = egraph.let("expr1", Num(2) * (Num.var("x") + Num(3))) +expr2 = egraph.let("expr2", Num(6) + Num(2) * Num.var("x")) + +# Register expressions directly +egraph.register(Num(1) + Num(2)) + +# Run rules for 10 iterations +egraph.run(10) + +# Extract the lowest-cost equivalent expression +result = egraph.extract(expr1) + +# Extract with cost information +result, cost = egraph.extract(expr1, include_cost=True) + +# Check if expressions are equivalent +egraph.check(expr1 == expr2) # Raises if not equivalent + +# Check that expressions are NOT equivalent +egraph.check_fail(Num(1) == Num(2)) + +# Push/pop state for backtracking +egraph.push() +egraph.register(Num(100)) +egraph.pop() # Reverts state + +# Context manager for automatic push/pop +with egraph: + egraph.run(5) + result = egraph.extract(expr1) +# State reverted here +``` + +## Expr - Defining Custom Expression Types + +Subclass Expr to define domain-specific languages with typed constructors, methods, and operators. Methods become egglog functions automatically. + +```python +from egglog import * +from typing import TypeAlias, ClassVar + +# Define a math expression type +class Math(Expr): + # Constructor with i64 parameter + def __init__(self, value: i64Like) -> None: ... + + # Class method constructor + @classmethod + def var(cls, name: StringLike) -> Math: ... + + # Operators become egglog functions + def __add__(self, other: Math) -> Math: ... + def __mul__(self, other: Math) -> Math: ... + def __truediv__(self, other: Math) -> Math: ... + + # Property-style functions + @property + def is_zero(self) -> Unit: ... + + # Class variables (constants) + ZERO: ClassVar[Math] + +# Type alias for automatic conversion +MathLike: TypeAlias = Math | i64Like | StringLike + +# Register converters so 2 + Math(3) works +converter(i64, Math, Math) +converter(String, Math, Math.var) + +# Usage +egraph = EGraph() +x = Math.var("x") +expr = x * 2 + 3 # Automatically converts 2 and 3 to Math +egraph.register(expr) +``` + +## rewrite() - Defining Rewrite Rules + +The rewrite() function creates conditional rewrite rules that transform expressions when patterns match. Rules are added to rulesets and executed during egraph.run(). + +```python +from egglog import * + +class Num(Expr): + def __init__(self, value: i64Like) -> None: ... + @classmethod + def var(cls, name: StringLike) -> Num: ... + def __add__(self, other: Num) -> Num: ... + def __mul__(self, other: Num) -> Num: ... + +converter(i64, Num, Num) +converter(String, Num, Num.var) + +egraph = EGraph() + +# Create pattern variables +a, b, c = vars_("a b c", Num) +i, j = vars_("i j", i64) + +# Register rewrite rules using decorator pattern +@egraph.register +def _(x: Num, y: Num, z: Num): + # Commutativity + yield rewrite(x + y).to(y + x) + yield rewrite(x * y).to(y * x) + # Associativity + yield rewrite(x + (y + z)).to((x + y) + z) + yield rewrite(x * (y * z)).to((x * y) * z) + # Distributivity + yield rewrite(x * (y + z)).to((x * y) + (x * z)) + +# Constant folding with primitive operations +@egraph.register +def _(i: i64, j: i64): + yield rewrite(Num(i) + Num(j)).to(Num(i + j)) + yield rewrite(Num(i) * Num(j)).to(Num(i * j)) + +# Conditional rewrites +@egraph.register +def _(x: Num, y: Num): + # Only rewrite x/x to 1 if x.is_nonzero fact exists + yield rewrite(x / x).to(Num(1), x.is_nonzero) + +# Bidirectional rewrites (works both directions) +@egraph.register +def _(x: Num, y: Num, z: Num): + yield birewrite(x + (y + z)).to((x + y) + z) + +# Run rules and verify equivalence +expr1 = egraph.let("e1", Num(2) * (Num.var("x") + Num(3))) +expr2 = egraph.let("e2", Num(6) + Num(2) * Num.var("x")) +egraph.run(10) +egraph.check(expr1 == expr2) +``` + +## rule() - Defining Datalog-Style Rules + +The rule() function creates Datalog-style rules with arbitrary actions (not just rewrites). Rules query facts and trigger actions like union, set, or panic. + +```python +from egglog import * + +# Define relations for graph connectivity +edge = relation("edge", i64, i64) +path = relation("path", i64, i64) + +egraph = EGraph() + +# Insert edge facts +egraph.register( + edge(i64(1), i64(2)), + edge(i64(2), i64(3)), + edge(i64(3), i64(4)), +) + +# Datalog rules: derive path from edges +@egraph.register +def _(a: i64, b: i64, c: i64): + # Base case: edge implies path + yield rule(edge(a, b)).then(path(a, b)) + # Transitive case: path + edge implies longer path + yield rule(path(a, b), edge(b, c)).then(path(a, c)) + +# Run until saturation (fixed point) +egraph.run(run().saturate()) + +# Check derived facts +egraph.check(path(i64(1), i64(4))) + +# Functions with merge semantics (e.g., shortest path) +@function(merge=lambda old, new: old.min(new)) +def dist(from_: i64Like, to: i64Like) -> i64: ... + +egraph = EGraph() +egraph.register(set_(dist(1, 2)).to(i64(10))) +egraph.register(set_(dist(2, 3)).to(i64(5))) + +@egraph.register +def _(a: i64, b: i64, c: i64, ab: i64, bc: i64): + yield rule(dist(a, b) == ab).then(set_(dist(a, a)).to(i64(0))) + yield rule(dist(a, b) == ab, dist(b, c) == bc).then( + set_(dist(a, c)).to(ab + bc) + ) + +egraph.run(run().saturate()) +egraph.check(eq(dist(1, 3)).to(15)) +``` + +## ruleset() - Organizing and Scheduling Rules + +Rulesets group related rules together for controlled execution. Schedules compose rulesets with operations like saturation, repetition, and sequencing. + +```python +from egglog import * + +class Num(Expr): + def __init__(self, value: i64Like) -> None: ... + @classmethod + def var(cls, name: StringLike) -> Num: ... + def __add__(self, other: Num) -> Num: ... + def __mul__(self, other: Num) -> Num: ... + +converter(i64, Num, Num) +converter(String, Num, Num.var) + +# Create separate rulesets for different concerns +analysis_rules = ruleset() +optimization_rules = ruleset() + +# Add rules to analysis ruleset +@analysis_rules.register +def _(x: Num, y: Num): + yield rewrite(Num(0) + x).to(x) + yield rewrite(Num(1) * x).to(x) + +# Add rules to optimization ruleset +@optimization_rules.register +def _(x: Num, y: Num, z: Num): + yield rewrite(x + y).to(y + x) + yield rewrite(x * (y + z)).to(x * y + x * z) + +egraph = EGraph() +expr = egraph.let("expr", Num(1) * (Num.var("x") + Num(0))) + +# Run analysis to saturation, then optimize +egraph.run(analysis_rules.saturate() + optimization_rules * 3) + +# Complex schedules with repetition +schedule = (analysis_rules.saturate() + optimization_rules) * 10 +egraph.run(schedule) + +# Use backoff scheduler to prevent rule explosion +egraph.run(run(optimization_rules, scheduler=back_off(match_limit=1000)) * 10) + +# Combine multiple rulesets +combined = analysis_rules | optimization_rules +egraph.run(combined.saturate()) + +# Run until facts are true +x = var("x", Num) +egraph.run(10, eq(expr).to(Num.var("x")), ruleset=optimization_rules) +``` + +## Built-in Types - Primitives and Containers + +egglog provides built-in primitive types (i64, f64, String, Bool, Rational, BigInt, BigRat) and container types (Vec, Set, Map, MultiSet) with full operator support. + +```python +from egglog import * +from fractions import Fraction + +egraph = EGraph() + +# Integer operations +x = i64(10) +y = i64(3) +egraph.register(x + y, x - y, x * y, x / y, x % y) +egraph.check(i64(10) + i64(3) == i64(13)) + +# Comparisons return Unit (existence facts) +egraph.check(i64(5) > i64(3)) +egraph.check(i64(3) <= i64(5)) + +# Evaluate primitives to Python values +result = int(i64(10) + i64(5)) # Returns 15 +assert result == 15 + +# Float operations +f = f64(3.14) * f64(2.0) +egraph.register(f) + +# String operations +s = String("hello") + String(" world") +egraph.register(s) +egraph.check(eq(s).to(String("hello world"))) + +# Rational numbers +r = Rational(1, 2) + Rational(1, 3) # 5/6 +assert r.value == Fraction(5, 6) + +# Vectors (immutable lists) +v = Vec(i64(1), i64(2), i64(3)) +egraph.register(v.push(i64(4))) # Returns new Vec +egraph.check(v.length() == i64(3)) +egraph.check(v[0] == i64(1)) + +# Convert to Python +python_tuple = v.value # Returns (i64(1), i64(2), i64(3)) + +# Sets with set operations +s1 = Set(i64(1), i64(2), i64(3)) +s2 = Set(i64(2), i64(3), i64(4)) +egraph.register(s1 | s2) # Union +egraph.register(s1 & s2) # Intersection +egraph.register(s1 - s2) # Difference + +# Maps (dictionaries) +m = Map[i64, String].empty().insert(i64(1), String("one")) +egraph.register(m) +egraph.check(m[i64(1)] == String("one")) +``` + +## function() - Defining Custom Functions + +The @function decorator creates egglog functions with optional merge semantics, costs, and default rewrites from function bodies. + +```python +from egglog import * + +# Simple function declaration +@function +def fib(n: i64Like) -> i64: ... + +# Function with merge semantics (keeps minimum) +@function(merge=lambda old, new: old.min(new)) +def shortest_path(from_: i64Like, to: i64Like) -> i64: ... + +# Function with custom egglog name +@function(egg_fn="my-custom-name") +def custom_func(x: i64Like) -> i64: ... + +# Function with cost for extraction +@function(cost=10) +def expensive_op(x: i64Like) -> i64: ... + +# Function with default rewrite (body becomes rewrite rule) +@function(ruleset=my_ruleset, subsume=True) +def double(x: i64Like) -> i64: + return x + x # Automatically creates: rewrite(double(x)).to(x + x) + +# Unextractable function (won't appear in extracted terms) +@function(unextractable=True) +def helper(x: i64Like) -> i64: ... + +egraph = EGraph() + +# Use set_ to define function values +egraph.register( + set_(fib(0)).to(i64(0)), + set_(fib(1)).to(i64(1)), +) + +# Rules can derive function values +@egraph.register +def _(n: i64, a: i64, b: i64): + yield rule( + fib(n) == a, + fib(n + 1) == b + ).then(set_(fib(n + 2)).to(a + b)) + +egraph.run(run().saturate()) +egraph.check(eq(fib(10)).to(55)) + +# Query function values +values = egraph.function_values(fib, length=10) # Returns dict of fib values +``` + +## constant() and var() - Creating Named Values + +The constant() function creates named zero-argument functions, while var() creates pattern variables for use in rewrite rules. + +```python +from egglog import * + +class Num(Expr): + def __init__(self, value: i64Like) -> None: ... + def __add__(self, other: Num) -> Num: ... + def __mul__(self, other: Num) -> Num: ... + +converter(i64, Num, Num) + +# Create a named constant +x = constant("x", Num) +y = constant("y", Num) + +egraph = EGraph() +egraph.register(x + y) + +# Constants with default values (creates rewrite to the value) +pi = constant("pi", Num, Num(314)) # pi rewrites to Num(314) + +# Pattern variables for rules +a = var("a", Num) +b = var("b", Num) + +# Multiple variables at once +p, q, r = vars_("p q r", Num) + +# Use in rewrite rules +@egraph.register +def _(a: Num, b: Num): + yield rewrite(a + b).to(b + a) + +# Variables can have custom egglog names +custom_var = var("myvar", Num, egg_name="custom-egglog-name") +``` + +## union() and set_() - E-Graph Actions + +Actions modify the e-graph by unioning expressions (making them equivalent) or setting function values. + +```python +from egglog import * + +class Term(Expr): + def __init__(self, name: StringLike) -> None: ... + def f(self) -> Term: ... + +@function +def cost(t: Term) -> i64: ... + +egraph = EGraph() + +a = egraph.let("a", Term("a")) +b = egraph.let("b", Term("b")) + +# Union makes two expressions equivalent +egraph.register(union(a).with_(b)) +egraph.check(a == b) # Now equivalent + +# set_ assigns a value to a function call +egraph.register(set_(cost(a)).to(i64(10))) +egraph.check(eq(cost(a)).to(10)) + +# Actions in rules +@egraph.register +def _(x: Term, y: Term): + # When f(x) == y, union x with y + yield rule(x.f() == y).then(union(x).with_(y)) + + # Set cost based on structure + yield rule(x.f() == y, cost(y) == i64(5)).then( + set_(cost(x)).to(i64(6)) + ) + +# Multiple actions in one rule +@egraph.register +def _(x: Term, y: Term, c: i64): + yield rule(x.f() == y, cost(y) == c).then( + set_(cost(x)).to(c + 1), + union(x.f().f()).with_(y) + ) +``` + +## UnstableFn - First-Class Functions + +UnstableFn provides first-class function values that can be passed around, partially applied, and called within the e-graph. + +```python +from egglog import * +from functools import partial + +class Num(Expr): + def __init__(self, value: i64Like) -> None: ... + def __add__(self, other: Num) -> Num: ... + +converter(i64, Num, Num) + +# Define a function that takes a callable +@function +def apply_twice(f: UnstableFn[Num, Num], x: Num) -> Num: ... + +egraph = EGraph() + +# Create function values from lambdas +add_one = UnstableFn(lambda x: x + Num(1)) + +# Partial application +add_to_ten = UnstableFn(Num.__add__, Num(10)) + +# Register and use +egraph.register(apply_twice(add_one, Num(5))) + +# Rules with higher-order functions +@egraph.register +def _(f: UnstableFn[Num, Num], x: Num): + yield rewrite(apply_twice(f, x)).to(f(f(x))) + +egraph.run(10) + +# Map over collections +v = Vec(Num(1), Num(2), Num(3)) +# MultiSet supports map +ms = MultiSet(Num(1), Num(2)) +mapped = ms.map(lambda x: x + Num(10)) + +# Get the underlying callable +fn_value = add_one.value # Returns the lambda +``` + +## Extraction and Cost Models + +Extract optimal expressions from the e-graph using configurable cost models. Custom costs enable domain-specific optimization. + +```python +from egglog import * + +class Op(Expr): + def __init__(self, value: i64Like) -> None: ... + + @method(cost=1) # Low cost + def __add__(self, other: Op) -> Op: ... + + @method(cost=10) # High cost - prefer add over mul + def __mul__(self, other: Op) -> Op: ... + +converter(i64, Op, Op) + +egraph = EGraph() + +@egraph.register +def _(x: Op): + yield rewrite(x * Op(2)).to(x + x) # Cheaper alternative + +expr = egraph.let("expr", Op.var("x") * Op(2)) +egraph.run(10) + +# Basic extraction (uses AST size by default) +result = egraph.extract(expr) + +# Extraction with cost +result, cost = egraph.extract(expr, include_cost=True) + +# Extract multiple variants +variants = egraph.extract_multiple(expr, n=5) + +# Custom per-node costs using set_cost +class Matrix(Expr): + def __init__(self, rows: i64Like, cols: i64Like) -> None: ... + def __matmul__(self, other: Matrix) -> Matrix: ... + + @property + def row(self) -> i64: ... + @property + def col(self) -> i64: ... + +@egraph.register +def _(x: Matrix, y: Matrix, r: i64, m: i64, c: i64): + # Cost based on matrix dimensions + yield rule( + y @ z, + r == y.row, + m == y.col, + c == z.col + ).then(set_cost(y @ z, r * m * c)) + +# Custom cost model function +def my_cost_model(egraph: EGraph, expr: BaseExpr, children_costs: list[int]) -> int: + base = 1 # Base cost per node + return base + sum(children_costs) + +result, cost = egraph.extract(expr, include_cost=True, cost_model=my_cost_model) + +# DAG cost model (counts shared subexpressions once) +dag_model = greedy_dag_cost_model() +result, dag_cost = egraph.extract(expr, include_cost=True, cost_model=dag_model) +``` + +## PyObject - Python Interop + +PyObject enables embedding arbitrary Python objects in the e-graph, supporting dynamic code evaluation and integration with Python libraries. + +```python +from egglog import * + +egraph = EGraph() + +# Wrap any Python object +obj = PyObject([1, 2, 3]) +egraph.register(obj) + +# Get the Python value back +python_list = obj.value # Returns [1, 2, 3] + +# Call PyObjects as functions +fn = PyObject(lambda x, y: x + y) +result = fn(PyObject(1), PyObject(2)) + +# Python eval in the e-graph +code_result = py_eval("1 + 2") # Returns PyObject(3) + +# With globals/locals +py_eval("x + 1", globals=PyObject({"x": 10})) + +# Execute Python code +py_exec("y = x * 2", locals=PyObject({"x": 5})) + +# Pattern matching on PyObject +match obj: + case PyObject(value=v): + print(f"Got value: {v}") + +# Convert functions to callable PyObjects +@function +def apply_python(f: PyObject, x: PyObject) -> PyObject: + return f(x) + +# Rules with Python objects +@egraph.register +def _(f: PyObject, x: PyObject, result: PyObject): + yield rule( + apply_python(f, x) == result + ).then( + # Can trigger Python-side effects via PyObject + set_(some_log(x)).to(result) + ) +``` + +## Summary + +egglog provides a powerful framework for equality saturation and term rewriting in Python. The primary use case is program optimization, where expressions are added to an e-graph, equivalence-preserving rewrite rules are applied to saturation, and then the optimal expression is extracted using a cost model. This pattern applies to compiler optimization, theorem proving, symbolic mathematics, and domain-specific language implementations. + +Integration patterns typically involve: (1) defining a custom Expr subclass representing your domain's AST, (2) registering converters for ergonomic Python-to-egglog type coercion, (3) defining rewrite rules in rulesets for modular scheduling, (4) combining analysis rules (which derive facts) with optimization rules (which add equivalent terms), and (5) extracting results using appropriate cost models. The library seamlessly integrates with Python's type system, supports Datalog-style relational queries for complex analyses, and provides first-class functions via UnstableFn for higher-order transformations. +# egglog Python Library + +egglog is a Python library providing high-level bindings to the Rust [egglog](https://github.com/egraphs-good/egglog/) library, enabling e-graph-based equality saturation in Python. E-graphs are a powerful data structure that efficiently represents many equivalent programs simultaneously, making them ideal for program optimization, theorem proving, and symbolic computation tasks. + +The library offers a Pythonic API for defining custom expression types, rewrite rules, and Datalog-style relational rules. It supports automatic term extraction based on cost models, union-find operations for equivalence classes, and built-in primitive types (integers, floats, strings, rationals, vectors, sets, maps). The core workflow involves creating an EGraph, registering expressions and rewrite rules, running saturation, and extracting optimized results. + +## EGraph - Core E-Graph Operations + +The EGraph class is the central data structure that maintains equivalence classes of expressions. It supports registering expressions, running rewrite rules, checking facts, and extracting optimal expressions based on cost models. + +```python +from egglog import * + +# Create an EGraph instance +egraph = EGraph() + +# Define a custom expression type +class Num(Expr): + def __init__(self, value: i64Like) -> None: ... + @classmethod + def var(cls, name: StringLike) -> Num: ... + def __add__(self, other: Num) -> Num: ... + def __mul__(self, other: Num) -> Num: ... + +# Register expressions with let() to get references +expr1 = egraph.let("expr1", Num(2) * (Num.var("x") + Num(3))) +expr2 = egraph.let("expr2", Num(6) + Num(2) * Num.var("x")) + +# Register expressions directly +egraph.register(Num(1) + Num(2)) + +# Run rules for 10 iterations +egraph.run(10) + +# Extract the lowest-cost equivalent expression +result = egraph.extract(expr1) + +# Extract with cost information +result, cost = egraph.extract(expr1, include_cost=True) + +# Check if expressions are equivalent +egraph.check(expr1 == expr2) # Raises if not equivalent + +# Check that expressions are NOT equivalent +egraph.check_fail(Num(1) == Num(2)) + +# Push/pop state for backtracking +egraph.push() +egraph.register(Num(100)) +egraph.pop() # Reverts state + +# Context manager for automatic push/pop +with egraph: + egraph.run(5) + result = egraph.extract(expr1) +# State reverted here +``` + +## Expr - Defining Custom Expression Types + +Subclass Expr to define domain-specific languages with typed constructors, methods, and operators. Methods become egglog functions automatically. + +```python +from egglog import * +from typing import TypeAlias, ClassVar + +# Define a math expression type +class Math(Expr): + # Constructor with i64 parameter + def __init__(self, value: i64Like) -> None: ... + + # Class method constructor + @classmethod + def var(cls, name: StringLike) -> Math: ... + + # Operators become egglog functions + def __add__(self, other: Math) -> Math: ... + def __mul__(self, other: Math) -> Math: ... + def __truediv__(self, other: Math) -> Math: ... + + # Property-style functions + @property + def is_zero(self) -> Unit: ... + + # Class variables (constants) + ZERO: ClassVar[Math] + +# Type alias for automatic conversion +MathLike: TypeAlias = Math | i64Like | StringLike + +# Register converters so 2 + Math(3) works +converter(i64, Math, Math) +converter(String, Math, Math.var) + +# Usage +egraph = EGraph() +x = Math.var("x") +expr = x * 2 + 3 # Automatically converts 2 and 3 to Math +egraph.register(expr) +``` + +## rewrite() - Defining Rewrite Rules + +The rewrite() function creates conditional rewrite rules that transform expressions when patterns match. Rules are added to rulesets and executed during egraph.run(). + +```python +from egglog import * + +class Num(Expr): + def __init__(self, value: i64Like) -> None: ... + @classmethod + def var(cls, name: StringLike) -> Num: ... + def __add__(self, other: Num) -> Num: ... + def __mul__(self, other: Num) -> Num: ... + +converter(i64, Num, Num) +converter(String, Num, Num.var) + +egraph = EGraph() + +# Create pattern variables +a, b, c = vars_("a b c", Num) +i, j = vars_("i j", i64) + +# Register rewrite rules using decorator pattern +@egraph.register +def _(x: Num, y: Num, z: Num): + # Commutativity + yield rewrite(x + y).to(y + x) + yield rewrite(x * y).to(y * x) + # Associativity + yield rewrite(x + (y + z)).to((x + y) + z) + yield rewrite(x * (y * z)).to((x * y) * z) + # Distributivity + yield rewrite(x * (y + z)).to((x * y) + (x * z)) + +# Constant folding with primitive operations +@egraph.register +def _(i: i64, j: i64): + yield rewrite(Num(i) + Num(j)).to(Num(i + j)) + yield rewrite(Num(i) * Num(j)).to(Num(i * j)) + +# Conditional rewrites +@egraph.register +def _(x: Num, y: Num): + # Only rewrite x/x to 1 if x.is_nonzero fact exists + yield rewrite(x / x).to(Num(1), x.is_nonzero) + +# Bidirectional rewrites (works both directions) +@egraph.register +def _(x: Num, y: Num, z: Num): + yield birewrite(x + (y + z)).to((x + y) + z) + +# Run rules and verify equivalence +expr1 = egraph.let("e1", Num(2) * (Num.var("x") + Num(3))) +expr2 = egraph.let("e2", Num(6) + Num(2) * Num.var("x")) +egraph.run(10) +egraph.check(expr1 == expr2) +``` + +## rule() - Defining Datalog-Style Rules + +The rule() function creates Datalog-style rules with arbitrary actions (not just rewrites). Rules query facts and trigger actions like union, set, or panic. + +```python +from egglog import * + +# Define relations for graph connectivity +edge = relation("edge", i64, i64) +path = relation("path", i64, i64) + +egraph = EGraph() + +# Insert edge facts +egraph.register( + edge(i64(1), i64(2)), + edge(i64(2), i64(3)), + edge(i64(3), i64(4)), +) + +# Datalog rules: derive path from edges +@egraph.register +def _(a: i64, b: i64, c: i64): + # Base case: edge implies path + yield rule(edge(a, b)).then(path(a, b)) + # Transitive case: path + edge implies longer path + yield rule(path(a, b), edge(b, c)).then(path(a, c)) + +# Run until saturation (fixed point) +egraph.run(run().saturate()) + +# Check derived facts +egraph.check(path(i64(1), i64(4))) + +# Functions with merge semantics (e.g., shortest path) +@function(merge=lambda old, new: old.min(new)) +def dist(from_: i64Like, to: i64Like) -> i64: ... + +egraph = EGraph() +egraph.register(set_(dist(1, 2)).to(i64(10))) +egraph.register(set_(dist(2, 3)).to(i64(5))) + +@egraph.register +def _(a: i64, b: i64, c: i64, ab: i64, bc: i64): + yield rule(dist(a, b) == ab).then(set_(dist(a, a)).to(i64(0))) + yield rule(dist(a, b) == ab, dist(b, c) == bc).then( + set_(dist(a, c)).to(ab + bc) + ) + +egraph.run(run().saturate()) +egraph.check(eq(dist(1, 3)).to(15)) +``` + +## ruleset() - Organizing and Scheduling Rules + +Rulesets group related rules together for controlled execution. Schedules compose rulesets with operations like saturation, repetition, and sequencing. + +```python +from egglog import * + +class Num(Expr): + def __init__(self, value: i64Like) -> None: ... + @classmethod + def var(cls, name: StringLike) -> Num: ... + def __add__(self, other: Num) -> Num: ... + def __mul__(self, other: Num) -> Num: ... + +converter(i64, Num, Num) +converter(String, Num, Num.var) + +# Create separate rulesets for different concerns +analysis_rules = ruleset() +optimization_rules = ruleset() + +# Add rules to analysis ruleset +@analysis_rules.register +def _(x: Num, y: Num): + yield rewrite(Num(0) + x).to(x) + yield rewrite(Num(1) * x).to(x) + +# Add rules to optimization ruleset +@optimization_rules.register +def _(x: Num, y: Num, z: Num): + yield rewrite(x + y).to(y + x) + yield rewrite(x * (y + z)).to(x * y + x * z) + +egraph = EGraph() +expr = egraph.let("expr", Num(1) * (Num.var("x") + Num(0))) + +# Run analysis to saturation, then optimize +egraph.run(analysis_rules.saturate() + optimization_rules * 3) + +# Complex schedules with repetition +schedule = (analysis_rules.saturate() + optimization_rules) * 10 +egraph.run(schedule) + +# Use backoff scheduler to prevent rule explosion +egraph.run(run(optimization_rules, scheduler=back_off(match_limit=1000)) * 10) + +# Combine multiple rulesets +combined = analysis_rules | optimization_rules +egraph.run(combined.saturate()) + +# Run until facts are true +x = var("x", Num) +egraph.run(10, eq(expr).to(Num.var("x")), ruleset=optimization_rules) +``` + +## Built-in Types - Primitives and Containers + +egglog provides built-in primitive types (i64, f64, String, Bool, Rational, BigInt, BigRat) and container types (Vec, Set, Map, MultiSet) with full operator support. + +```python +from egglog import * +from fractions import Fraction + +egraph = EGraph() + +# Integer operations +x = i64(10) +y = i64(3) +egraph.register(x + y, x - y, x * y, x / y, x % y) +egraph.check(i64(10) + i64(3) == i64(13)) + +# Comparisons return Unit (existence facts) +egraph.check(i64(5) > i64(3)) +egraph.check(i64(3) <= i64(5)) + +# Evaluate primitives to Python values +result = int(i64(10) + i64(5)) # Returns 15 +assert result == 15 + +# Float operations +f = f64(3.14) * f64(2.0) +egraph.register(f) + +# String operations +s = String("hello") + String(" world") +egraph.register(s) +egraph.check(eq(s).to(String("hello world"))) + +# Rational numbers +r = Rational(1, 2) + Rational(1, 3) # 5/6 +assert r.value == Fraction(5, 6) + +# Vectors (immutable lists) +v = Vec(i64(1), i64(2), i64(3)) +egraph.register(v.push(i64(4))) # Returns new Vec +egraph.check(v.length() == i64(3)) +egraph.check(v[0] == i64(1)) + +# Convert to Python +python_tuple = v.value # Returns (i64(1), i64(2), i64(3)) + +# Sets with set operations +s1 = Set(i64(1), i64(2), i64(3)) +s2 = Set(i64(2), i64(3), i64(4)) +egraph.register(s1 | s2) # Union +egraph.register(s1 & s2) # Intersection +egraph.register(s1 - s2) # Difference + +# Maps (dictionaries) +m = Map[i64, String].empty().insert(i64(1), String("one")) +egraph.register(m) +egraph.check(m[i64(1)] == String("one")) +``` + +## function() - Defining Custom Functions + +The @function decorator creates egglog functions with optional merge semantics, costs, and default rewrites from function bodies. + +```python +from egglog import * + +# Simple function declaration +@function +def fib(n: i64Like) -> i64: ... + +# Function with merge semantics (keeps minimum) +@function(merge=lambda old, new: old.min(new)) +def shortest_path(from_: i64Like, to: i64Like) -> i64: ... + +# Function with custom egglog name +@function(egg_fn="my-custom-name") +def custom_func(x: i64Like) -> i64: ... + +# Function with cost for extraction +@function(cost=10) +def expensive_op(x: i64Like) -> i64: ... + +# Function with default rewrite (body becomes rewrite rule) +@function(ruleset=my_ruleset, subsume=True) +def double(x: i64Like) -> i64: + return x + x # Automatically creates: rewrite(double(x)).to(x + x) + +# Unextractable function (won't appear in extracted terms) +@function(unextractable=True) +def helper(x: i64Like) -> i64: ... + +egraph = EGraph() + +# Use set_ to define function values +egraph.register( + set_(fib(0)).to(i64(0)), + set_(fib(1)).to(i64(1)), +) + +# Rules can derive function values +@egraph.register +def _(n: i64, a: i64, b: i64): + yield rule( + fib(n) == a, + fib(n + 1) == b + ).then(set_(fib(n + 2)).to(a + b)) + +egraph.run(run().saturate()) +egraph.check(eq(fib(10)).to(55)) + +# Query function values +values = egraph.function_values(fib, length=10) # Returns dict of fib values +``` + +## constant() and var() - Creating Named Values + +The constant() function creates named zero-argument functions, while var() creates pattern variables for use in rewrite rules. + +```python +from egglog import * + +class Num(Expr): + def __init__(self, value: i64Like) -> None: ... + def __add__(self, other: Num) -> Num: ... + def __mul__(self, other: Num) -> Num: ... + +converter(i64, Num, Num) + +# Create a named constant +x = constant("x", Num) +y = constant("y", Num) + +egraph = EGraph() +egraph.register(x + y) + +# Constants with default values (creates rewrite to the value) +pi = constant("pi", Num, Num(314)) # pi rewrites to Num(314) + +# Pattern variables for rules +a = var("a", Num) +b = var("b", Num) + +# Multiple variables at once +p, q, r = vars_("p q r", Num) + +# Use in rewrite rules +@egraph.register +def _(a: Num, b: Num): + yield rewrite(a + b).to(b + a) + +# Variables can have custom egglog names +custom_var = var("myvar", Num, egg_name="custom-egglog-name") +``` + +## union() and set_() - E-Graph Actions + +Actions modify the e-graph by unioning expressions (making them equivalent) or setting function values. + +```python +from egglog import * + +class Term(Expr): + def __init__(self, name: StringLike) -> None: ... + def f(self) -> Term: ... + +@function +def cost(t: Term) -> i64: ... + +egraph = EGraph() + +a = egraph.let("a", Term("a")) +b = egraph.let("b", Term("b")) + +# Union makes two expressions equivalent +egraph.register(union(a).with_(b)) +egraph.check(a == b) # Now equivalent + +# set_ assigns a value to a function call +egraph.register(set_(cost(a)).to(i64(10))) +egraph.check(eq(cost(a)).to(10)) + +# Actions in rules +@egraph.register +def _(x: Term, y: Term): + # When f(x) == y, union x with y + yield rule(x.f() == y).then(union(x).with_(y)) + + # Set cost based on structure + yield rule(x.f() == y, cost(y) == i64(5)).then( + set_(cost(x)).to(i64(6)) + ) + +# Multiple actions in one rule +@egraph.register +def _(x: Term, y: Term, c: i64): + yield rule(x.f() == y, cost(y) == c).then( + set_(cost(x)).to(c + 1), + union(x.f().f()).with_(y) + ) +``` + +## UnstableFn - First-Class Functions + +UnstableFn provides first-class function values that can be passed around, partially applied, and called within the e-graph. + +```python +from egglog import * +from functools import partial + +class Num(Expr): + def __init__(self, value: i64Like) -> None: ... + def __add__(self, other: Num) -> Num: ... + +converter(i64, Num, Num) + +# Define a function that takes a callable +@function +def apply_twice(f: UnstableFn[Num, Num], x: Num) -> Num: ... + +egraph = EGraph() + +# Create function values from lambdas +add_one = UnstableFn(lambda x: x + Num(1)) + +# Partial application +add_to_ten = UnstableFn(Num.__add__, Num(10)) + +# Register and use +egraph.register(apply_twice(add_one, Num(5))) + +# Rules with higher-order functions +@egraph.register +def _(f: UnstableFn[Num, Num], x: Num): + yield rewrite(apply_twice(f, x)).to(f(f(x))) + +egraph.run(10) + +# Map over collections +v = Vec(Num(1), Num(2), Num(3)) +# MultiSet supports map +ms = MultiSet(Num(1), Num(2)) +mapped = ms.map(lambda x: x + Num(10)) + +# Get the underlying callable +fn_value = add_one.value # Returns the lambda +``` + +## Extraction and Cost Models + +Extract optimal expressions from the e-graph using configurable cost models. Custom costs enable domain-specific optimization. + +```python +from egglog import * + +class Op(Expr): + def __init__(self, value: i64Like) -> None: ... + + @method(cost=1) # Low cost + def __add__(self, other: Op) -> Op: ... + + @method(cost=10) # High cost - prefer add over mul + def __mul__(self, other: Op) -> Op: ... + +converter(i64, Op, Op) + +egraph = EGraph() + +@egraph.register +def _(x: Op): + yield rewrite(x * Op(2)).to(x + x) # Cheaper alternative + +expr = egraph.let("expr", Op.var("x") * Op(2)) +egraph.run(10) + +# Basic extraction (uses AST size by default) +result = egraph.extract(expr) + +# Extraction with cost +result, cost = egraph.extract(expr, include_cost=True) + +# Extract multiple variants +variants = egraph.extract_multiple(expr, n=5) + +# Custom per-node costs using set_cost +class Matrix(Expr): + def __init__(self, rows: i64Like, cols: i64Like) -> None: ... + def __matmul__(self, other: Matrix) -> Matrix: ... + + @property + def row(self) -> i64: ... + @property + def col(self) -> i64: ... + +@egraph.register +def _(x: Matrix, y: Matrix, r: i64, m: i64, c: i64): + # Cost based on matrix dimensions + yield rule( + y @ z, + r == y.row, + m == y.col, + c == z.col + ).then(set_cost(y @ z, r * m * c)) + +# Custom cost model function +def my_cost_model(egraph: EGraph, expr: BaseExpr, children_costs: list[int]) -> int: + base = 1 # Base cost per node + return base + sum(children_costs) + +result, cost = egraph.extract(expr, include_cost=True, cost_model=my_cost_model) + +# DAG cost model (counts shared subexpressions once) +dag_model = greedy_dag_cost_model() +result, dag_cost = egraph.extract(expr, include_cost=True, cost_model=dag_model) +``` + +## PyObject - Python Interop + +PyObject enables embedding arbitrary Python objects in the e-graph, supporting dynamic code evaluation and integration with Python libraries. + +```python +from egglog import * + +egraph = EGraph() + +# Wrap any Python object +obj = PyObject([1, 2, 3]) +egraph.register(obj) + +# Get the Python value back +python_list = obj.value # Returns [1, 2, 3] + +# Call PyObjects as functions +fn = PyObject(lambda x, y: x + y) +result = fn(PyObject(1), PyObject(2)) + +# Python eval in the e-graph +code_result = py_eval("1 + 2") # Returns PyObject(3) + +# With globals/locals +py_eval("x + 1", globals=PyObject({"x": 10})) + +# Execute Python code +py_exec("y = x * 2", locals=PyObject({"x": 5})) + +# Pattern matching on PyObject +match obj: + case PyObject(value=v): + print(f"Got value: {v}") + +# Convert functions to callable PyObjects +@function +def apply_python(f: PyObject, x: PyObject) -> PyObject: + return f(x) + +# Rules with Python objects +@egraph.register +def _(f: PyObject, x: PyObject, result: PyObject): + yield rule( + apply_python(f, x) == result + ).then( + # Can trigger Python-side effects via PyObject + set_(some_log(x)).to(result) + ) +``` + +## Summary + +egglog provides a powerful framework for equality saturation and term rewriting in Python. The primary use case is program optimization, where expressions are added to an e-graph, equivalence-preserving rewrite rules are applied to saturation, and then the optimal expression is extracted using a cost model. This pattern applies to compiler optimization, theorem proving, symbolic mathematics, and domain-specific language implementations. + +Integration patterns typically involve: (1) defining a custom Expr subclass representing your domain's AST, (2) registering converters for ergonomic Python-to-egglog type coercion, (3) defining rewrite rules in rulesets for modular scheduling, (4) combining analysis rules (which derive facts) with optimization rules (which add equivalent terms), and (5) extracting results using appropriate cost models. The library seamlessly integrates with Python's type system, supports Datalog-style relational queries for complex analyses, and provides first-class functions via UnstableFn for higher-order transformations. From de2f0a8df5c23343080fbf531d7e372810a90297 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Fri, 30 Jan 2026 02:38:39 -0800 Subject: [PATCH 22/30] tmp --- Cargo.lock | 9 +- Cargo.toml | 1 + python/egglog/builtins.py | 173 +++--- python/egglog/conversion.py | 2 +- python/egglog/declarations.py | 36 +- python/egglog/egraph.py | 6 +- python/egglog/egraph_state.py | 12 +- python/egglog/exp/array_api.py | 987 ++++++++++++++++++--------------- python/egglog/runtime.py | 11 +- python/egglog/thunk.py | 2 +- src/egraph.rs | 14 +- 11 files changed, 690 insertions(+), 563 deletions(-) diff --git a/Cargo.lock b/Cargo.lock index 8c93e722..632f72ef 100644 --- a/Cargo.lock +++ b/Cargo.lock @@ -478,6 +478,7 @@ dependencies = [ "pyo3-log", "rayon", "serde_json", + "tempfile", "uuid", ] @@ -1135,9 +1136,9 @@ checksum = "357703d41365b4b27c590e3ed91eabb1b663f07c4c084095e60cbed4362dff0d" [[package]] name = "rustix" -version = "1.1.2" +version = "1.1.3" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "cd15f8a2c5551a84d56efdc1cd049089e409ac19a3072d5037a17fd70719ff3e" +checksum = "146c9e247ccc180c1f61615433868c99f3de3ae256a30a43b49f67c2d9171f34" dependencies = [ "bitflags", "errno", @@ -1271,9 +1272,9 @@ checksum = "df7f62577c25e07834649fc3b39fafdc597c0a3527dc1c60129201ccfcbaa50c" [[package]] name = "tempfile" -version = "3.23.0" +version = "3.24.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "2d31c77bdf42a745371d260a26ca7163f1e0924b64afa0b688e61b5a9fa02f16" +checksum = "655da9c7eb6305c55742045d5a8d2037996d61d8de95806335c7c86ce0f82e9c" dependencies = [ "fastrand", "getrandom", diff --git a/Cargo.toml b/Cargo.toml index 3b8eacd5..f4c21127 100644 --- a/Cargo.toml +++ b/Cargo.toml @@ -28,6 +28,7 @@ ordered-float = "5" uuid = { version = "1.18", features = ["v4"] } rayon = "1.11" base64 = "0.22.1" +tempfile = "3.24.0" # Use patched version of egglog in experimental [patch.'https://github.com/egraphs-good/egglog'] diff --git a/python/egglog/builtins.py b/python/egglog/builtins.py index 0bcc155b..4f69586d 100644 --- a/python/egglog/builtins.py +++ b/python/egglog/builtins.py @@ -81,7 +81,7 @@ def __str__(self) -> str: class Unit(BuiltinExpr, egg_sort="Unit"): """ - The unit type. This is used to reprsent if a value exists in the e-graph or not. + The unit type. This is used to represent if a value exists in the e-graph or not. """ def __init__(self) -> None: ... @@ -288,6 +288,9 @@ def bool_ge(self, other: i64Like) -> Bool: ... @method(egg_fn="abs") def __abs__(self) -> i64: ... + @method(egg_fn="vec-range") + def range(self) -> Vec[i64]: ... + # The types which can be converted into an i64 i64Like: TypeAlias = i64 | int # noqa: N816, PYI042 @@ -1024,6 +1027,9 @@ def set(self, index: i64Like, value: T) -> Vec[T]: ... @method(egg_fn="vec-union") def __or__(self, other: Vec[T]) -> Vec[T]: ... + @method(egg_fn="unstable-vec-map", reverse_args=True) + def map(self, fn: Callable[[T], V]) -> Vec[V]: ... + for sequence_type in (list, tuple): converter( @@ -1036,87 +1042,6 @@ def __or__(self, other: Vec[T]) -> Vec[T]: ... VecLike: TypeAlias = Vec[T] | tuple[TO, ...] | list[TO] -v = Vec(i64(10)) -v.append([i64(10)]) - - -class PyObject(BuiltinExpr, egg_sort="PyObject"): - @method(preserve=True) - @deprecated("use .value") - def eval(self) -> object: - return self.value - - @method(preserve=True) # type: ignore[prop-decorator] - @property - def value(self) -> object: - expr = cast("RuntimeExpr", self).__egg_typed_expr__.expr - if not isinstance(expr, PyObjectDecl): - raise ExprValueError(self, "PyObject(x)") - return cloudpickle.loads(expr.pickled) - - __match_args__ = ("value",) - - def __init__(self, value: object) -> None: ... - - @method(egg_fn="py-call") - def __call__(self, *args: object) -> PyObject: ... - - @method(egg_fn="py-call-extended") - def call_extended(self, args: PyObject, kwargs: PyObject) -> PyObject: - """ - Call the PyObject with the given args and kwargs PyObjects. - """ - - @method(egg_fn="py-from-string") - @classmethod - def from_string(cls, s: StringLike) -> PyObject: ... - - @method(egg_fn="py-to-string") - def to_string(self) -> String: ... - - @method(egg_fn="py-to-bool") - def to_bool(self) -> Bool: ... - - @method(egg_fn="py-dict-update") - def dict_update(self, *keys_and_values: object) -> PyObject: ... - - @method(egg_fn="py-from-int") - @classmethod - def from_int(cls, i: i64Like) -> PyObject: ... - - @method(egg_fn="py-dict") - @classmethod - def dict(cls, *keys_and_values: object) -> PyObject: ... - - -converter(object, PyObject, PyObject) - - -@function(builtin=True, egg_fn="py-eval") -def py_eval(code: StringLike, globals: object = PyObject.dict(), locals: object = PyObject.dict()) -> PyObject: ... - - -class PyObjectFunction(Protocol): - def __call__(self, *__args: PyObject) -> PyObject: ... - - -@deprecated("use PyObject(fn) directly") -def py_eval_fn(fn: Callable) -> PyObjectFunction: - """ - Takes a python callable and maps it to a callable which takes and returns PyObjects. - - It translates it to a call which uses `py_eval` to call the function, passing in the - args as locals, and using the globals from function. - """ - return PyObject(fn) - - -@function(builtin=True, egg_fn="py-exec") -def py_exec(code: StringLike, globals: object = PyObject.dict(), locals: object = PyObject.dict()) -> PyObject: - """ - Copies the locals, execs the Python code, and returns the locals with any updates. - """ - TS = TypeVarTuple("TS") @@ -1167,9 +1092,9 @@ def __call__(self, *args: *TS) -> T: ... # Method Type is for builtins like __getitem__ -converter(MethodType, UnstableFn, lambda m: UnstableFn[*get_type_args()](m.__func__, m.__self__)) -converter(RuntimeFunction, UnstableFn, lambda rf: UnstableFn[*get_type_args()](rf)) -converter(partial, UnstableFn, lambda p: UnstableFn[*get_type_args()](p.func, *p.args)) +converter(MethodType, UnstableFn, lambda m: UnstableFn[*get_type_args()](m.__func__, m.__self__)) # type: ignore[operator, misc] +converter(RuntimeFunction, UnstableFn, lambda rf: UnstableFn[*get_type_args()](rf)) # type: ignore[operator, misc] +converter(partial, UnstableFn, lambda p: UnstableFn[*get_type_args()](p.func, *p.args)) # type: ignore[operator, misc] def _convert_function(fn: FunctionType) -> UnstableFn: @@ -1207,5 +1132,83 @@ def _convert_function(fn: FunctionType) -> UnstableFn: converter(FunctionType, UnstableFn, _convert_function) +class PyObject(BuiltinExpr, egg_sort="PyObject"): + @method(preserve=True) + @deprecated("use .value") + def eval(self) -> object: + return self.value + + @method(preserve=True) # type: ignore[prop-decorator] + @property + def value(self) -> object: + expr = cast("RuntimeExpr", self).__egg_typed_expr__.expr + if not isinstance(expr, PyObjectDecl): + raise ExprValueError(self, "PyObject(x)") + return cloudpickle.loads(expr.pickled) + + __match_args__ = ("value",) + + def __init__(self, value: object) -> None: ... + + @method(egg_fn="py-call") + def __call__(self, *args: object) -> PyObject: ... + + @method(egg_fn="py-call-extended") + def call_extended(self, args: PyObject, kwargs: PyObject) -> PyObject: + """ + Call the PyObject with the given args and kwargs PyObjects. + """ + + @method(egg_fn="py-from-string") + @classmethod + def from_string(cls, s: StringLike) -> PyObject: ... + + @method(egg_fn="py-to-string") + def to_string(self) -> String: ... + + @method(egg_fn="py-to-bool") + def to_bool(self) -> Bool: ... + + @method(egg_fn="py-dict-update") + def dict_update(self, *keys_and_values: object) -> PyObject: ... + + @method(egg_fn="py-from-int") + @classmethod + def from_int(cls, i: i64Like) -> PyObject: ... + + @method(egg_fn="py-dict") + @classmethod + def dict(cls, *keys_and_values: object) -> PyObject: ... + + +converter(object, PyObject, PyObject) + + +@function(builtin=True, egg_fn="py-eval") +def py_eval(code: StringLike, globals: object = PyObject.dict(), locals: object = PyObject.dict()) -> PyObject: ... + + +class PyObjectFunction(Protocol): + def __call__(self, *__args: PyObject) -> PyObject: ... + + +@deprecated("use PyObject(fn) directly") +def py_eval_fn(fn: Callable) -> PyObjectFunction: + """ + Takes a python callable and maps it to a callable which takes and returns PyObjects. + + It translates it to a call which uses `py_eval` to call the function, passing in the + args as locals, and using the globals from function. + """ + return PyObject(fn) + + +@function(builtin=True, egg_fn="py-exec") +def py_exec(code: StringLike, globals: object = PyObject.dict(), locals: object = PyObject.dict()) -> PyObject: + """ + Copies the locals, execs the Python code, and returns the locals with any updates. + """ + + Container: TypeAlias = Map | Set | MultiSet | Vec | UnstableFn Primitive: TypeAlias = String | Bool | i64 | f64 | Rational | BigInt | BigRat | PyObject | Unit diff --git a/python/egglog/conversion.py b/python/egglog/conversion.py index 1bbbefbd..ad6bccf8 100644 --- a/python/egglog/conversion.py +++ b/python/egglog/conversion.py @@ -24,7 +24,7 @@ _CONVERSION_DECLS = Declarations.create() # Defer a list of declerations to be added to the global declerations, so that we can not trigger them procesing # until we need them -_TO_PROCESS_DECLS: list[DeclerationsLike] = [] +_TO_PROCESS_DECLS: list[DeclarationsLike] = [] def retrieve_conversion_decls() -> Declarations: diff --git a/python/egglog/declarations.py b/python/egglog/declarations.py index 3b01de4a..fa454f2b 100644 --- a/python/egglog/declarations.py +++ b/python/egglog/declarations.py @@ -50,9 +50,9 @@ "ConstructorDecl", "Declarations", "Declarations", - "DeclerationsLike", + "DeclarationsLike", "DefaultRewriteDecl", - "DelayedDeclerations", + "DelayedDeclarations", "DummyDecl", "EqDecl", "ExprActionDecl", @@ -63,7 +63,7 @@ "FunctionRef", "FunctionSignature", "GetCostDecl", - "HasDeclerations", + "HasDeclarations", "Ident", "InitRef", "JustTypeRef", @@ -101,12 +101,12 @@ "ValueDecl", "collect_unbound_vars", "replace_typed_expr", - "upcast_declerations", + "upcast_declarations", ] @dataclass(match_args=False) -class DelayedDeclerations: +class DelayedDeclarations: __egg_decls_thunk__: Callable[[], Declarations] = field(repr=False) @property @@ -122,20 +122,20 @@ def __egg_decls__(self) -> Declarations: @runtime_checkable -class HasDeclerations(Protocol): +class HasDeclarations(Protocol): @property def __egg_decls__(self) -> Declarations: ... -DeclerationsLike: TypeAlias = Union[HasDeclerations, None, "Declarations"] +DeclarationsLike: TypeAlias = Union[HasDeclarations, None, "Declarations"] -def upcast_declerations(declerations_like: Iterable[DeclerationsLike]) -> list[Declarations]: +def upcast_declarations(declarations_like: Iterable[DeclarationsLike]) -> list[Declarations]: d = [] - for l in declerations_like: + for l in declarations_like: if l is None: continue - if isinstance(l, HasDeclerations): + if isinstance(l, HasDeclarations): d.append(l.__egg_decls__) elif isinstance(l, Declarations): d.append(l) @@ -179,8 +179,8 @@ def default_ruleset(self) -> RulesetDecl: return ruleset @classmethod - def create(cls, *others: DeclerationsLike) -> Declarations: - others = upcast_declerations(others) + def create(cls, *others: DeclarationsLike) -> Declarations: + others = upcast_declarations(others) if not others: return Declarations() first, *rest = others @@ -195,26 +195,26 @@ def copy(self) -> Declarations: self.update_other(new) return new - def update(self, *others: DeclerationsLike) -> None: + def update(self, *others: DeclarationsLike) -> None: for other in others: self |= other - def __or__(self, other: DeclerationsLike) -> Declarations: + def __or__(self, other: DeclarationsLike) -> Declarations: result = self.copy() result |= other return result - def __ior__(self, other: DeclerationsLike) -> Self: + def __ior__(self, other: DeclarationsLike) -> Self: if other is None: return self - if isinstance(other, HasDeclerations): + if isinstance(other, HasDeclarations): other = other.__egg_decls__ other.update_other(self) return self def update_other(self, other: Declarations) -> None: """ - Updates the other decl with these values in palce. + Updates the other decl with these values in place. """ other._functions |= self._functions other._classes |= self._classes @@ -325,7 +325,7 @@ class ClassDecl: builtin: bool = False init: ConstructorDecl | FunctionDecl | None = None class_methods: dict[str, FunctionDecl | ConstructorDecl] = field(default_factory=dict) - # These have to be seperate from class_methods so that printing them can be done easily + # These have to be separate from class_methods so that printing them can be done easily class_variables: dict[str, ConstantDecl] = field(default_factory=dict) methods: dict[str, FunctionDecl | ConstructorDecl] = field(default_factory=dict) properties: dict[str, FunctionDecl | ConstructorDecl] = field(default_factory=dict) diff --git a/python/egglog/egraph.py b/python/egglog/egraph.py index 13e8c549..7ee0ad81 100644 --- a/python/egglog/egraph.py +++ b/python/egglog/egraph.py @@ -871,7 +871,7 @@ def __post_init__(self, seminaive: bool, save_egglog_string: bool) -> None: egraph = bindings.EGraph(seminaive=seminaive, record=save_egglog_string) self._state = EGraphState(egraph) - def _add_decls(self, *decls: DeclerationsLike) -> None: + def _add_decls(self, *decls: DeclarationsLike) -> None: for d in decls: self._state.__egg_decls__ |= d @@ -1064,7 +1064,7 @@ def _run_extract(self, expr: RuntimeExpr, n: int) -> bindings._CommandOutput: try: return self._egraph.run_program(cmd)[0] except BaseException as e: - e.add_note("while extracting expr:\n" + str(expr)) + e.add_note("while extracting: " + str(expr)) raise def push(self) -> None: @@ -1384,7 +1384,7 @@ def ruleset( @dataclass -class Schedule(DelayedDeclerations): +class Schedule(DelayedDeclarations): """ A composition of some rulesets, either composing them sequentially, running them repeatedly, running them till saturation, or running until some facts are met """ diff --git a/python/egglog/egraph_state.py b/python/egglog/egraph_state.py index 00089ba6..fc270ae0 100644 --- a/python/egglog/egraph_state.py +++ b/python/egglog/egraph_state.py @@ -42,13 +42,13 @@ def span(frame_index: int = 0) -> bindings.RustSpan: @dataclass class EGraphState: """ - State of the EGraph declerations and rulesets, so when we pop/push the stack we know whats defined. + State of the EGraph declarations and rulesets, so when we pop/push the stack we know whats defined. Used for converting to/from egg and for pretty printing. """ egraph: bindings.EGraph - # The decleratons we have added. + # The declarations we have added. __egg_decls__: Declarations = field(default_factory=Declarations) # Mapping of added rulesets to the added rules rulesets: dict[Ident, set[RewriteOrRuleDecl]] = field(default_factory=dict) @@ -466,16 +466,14 @@ def type_ref_to_egg(self, ref: JustTypeRef) -> str: # If this has args, create a new parameterized version of the builtin class if ref.args: if ref.ident == Ident.builtin("UnstableFn"): - # UnstableFn is a special case, where the rest of args are collected into a call - if len(ref.args) < 2: - msg = "Zero argument higher order functions not supported" - raise NotImplementedError(msg) type_args: list[bindings._Expr] = [ bindings.Call( span(), self.type_ref_to_egg(ref.args[1]), [bindings.Var(span(), self.type_ref_to_egg(a)) for a in ref.args[2:]], - ), + ) + if len(ref.args) > 1 + else bindings.Lit(span(), bindings.Unit()), bindings.Var(span(), self.type_ref_to_egg(ref.args[0])), ] else: diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index 6652dc37..3dc11653 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -1,26 +1,5 @@ """ Experimental Array API support. - -## Lists - -Lists have two main constructors: - -- `List(length, idx_fn)` -- `List.from_vec(vs)` - -This is so that they can be defined either with a known fixed integer length or a symbolic -length that could not be resolved to an integer. - -Both constructors must implement two methods: - -* `l.length() -> Int` -* `l.__getitem__(i: Int) -> T` - -Lists with a known length will be subsumed into the vector representation. - -Lists that have vecs that are equal will have the elements unified. - -Methods that transform lists should also subsume, so that the vector version will be preferred. """ # mypy: disable-error-code="empty-body" @@ -36,6 +15,7 @@ from collections.abc import Callable from copy import copy from functools import partial +from tempfile import NamedTemporaryFile from types import EllipsisType from typing import TYPE_CHECKING, Any, ClassVar, TypeAlias, cast @@ -62,12 +42,22 @@ class Boolean(Expr, ruleset=array_api_ruleset): + """ + A boolean expression + """ + NEVER: ClassVar[Boolean] def __init__(self, value: BoolLike) -> None: ... @method(preserve=True) def __bool__(self) -> bool: + """ + >>> bool(Boolean(True)) + True + >>> bool(Boolean(False)) + False + """ return self.eval() @method(preserve=True) @@ -85,6 +75,15 @@ def __invert__(self) -> Boolean: ... def __eq__(self, other: BooleanLike) -> Boolean: ... # type: ignore[override] + @classmethod + def if_(cls, b: BooleanLike, i: Callable[[], Boolean], j: Callable[[], Boolean]) -> Boolean: + """ + Returns i() if b is True, else j(). Wrapped in callables to avoid eager evaluation. + + >>> bool(Boolean.if_(TRUE, lambda: Boolean(True), lambda: Boolean(False))) + True + """ + BooleanLike = Boolean | BoolLike @@ -94,7 +93,7 @@ def __eq__(self, other: BooleanLike) -> Boolean: ... # type: ignore[override] @array_api_ruleset.register -def _bool(x: Boolean, i: Int, j: Int, b: Bool): +def _bool(x: Boolean, i: Int, j: Int, b: Bool, bt: Callable[[], Boolean], bf: Callable[[], Boolean]): return [ rule(eq(x).to(Boolean(b))).then(set_(x.to_bool).to(b)), rewrite(TRUE | x).to(TRUE), @@ -107,6 +106,8 @@ def _bool(x: Boolean, i: Int, j: Int, b: Bool): rewrite(x == x).to(TRUE), # noqa: PLR0124 rewrite(FALSE == TRUE).to(FALSE), rewrite(TRUE == FALSE).to(FALSE), + rewrite(Boolean.if_(TRUE, bt, bf), subsume=True).to(bt()), + rewrite(Boolean.if_(FALSE, bt, bf), subsume=True).to(bf()), ] @@ -229,11 +230,17 @@ def __bool__(self) -> bool: return bool(self.eval()) @classmethod - def if_(cls, b: BooleanLike, i: IntLike, j: IntLike) -> Int: ... + def if_(cls, b: BooleanLike, i: Callable[[], Int], j: Callable[[], Int]) -> Int: + """ + Returns i() if b is True, else j(). Wrapped in callables to avoid eager evaluation. + + >>> int(Int.if_(TRUE, lambda: Int(1), lambda: Int(2))) + 1 + """ @array_api_ruleset.register -def _int(i: i64, j: i64, r: Boolean, o: Int, b: Int): +def _int(i: i64, j: i64, r: Boolean, o: Int, b: Int, ot: Callable[[], Int], bt: Callable[[], Int]): yield rewrite(Int(i) == Int(i)).to(TRUE) yield rule(eq(r).to(Int(i) == Int(j)), ne(i).to(j)).then(union(r).with_(FALSE)) @@ -266,8 +273,8 @@ def _int(i: i64, j: i64, r: Boolean, o: Int, b: Int): yield rewrite(~Int(i)).to(Int(~i)) yield rewrite(Int(i).__abs__()).to(Int(i.__abs__())) - yield rewrite(Int.if_(TRUE, o, b), subsume=True).to(o) - yield rewrite(Int.if_(FALSE, o, b), subsume=True).to(b) + yield rewrite(Int.if_(TRUE, ot, bt), subsume=True).to(ot()) + yield rewrite(Int.if_(FALSE, ot, bt), subsume=True).to(bt()) yield rewrite(o.__round__(OptionalInt.none)).to(o) @@ -287,7 +294,20 @@ def check_index(length: IntLike, idx: IntLike) -> Int: """ length = cast("Int", length) idx = cast("Int", idx) - return Int.if_(((idx >= 0) & (idx < length)), idx, Int.NEVER) + return Int.if_(((idx >= 0) & (idx < length)), lambda: idx, lambda: Int.NEVER) + + +class OptionalInt(Expr, ruleset=array_api_ruleset): + none: ClassVar[OptionalInt] + + @classmethod + def some(cls, value: Int) -> OptionalInt: ... + + +OptionalIntLike: TypeAlias = OptionalInt | IntLike | None + +converter(type(None), OptionalInt, lambda _: OptionalInt.none) +converter(Int, OptionalInt, OptionalInt.some) # @array_api_ruleset.register @@ -377,7 +397,7 @@ def _float(fl: Float, f: f64, f2: f64, i: i64, r: BigRat, r1: BigRat, i_: Int): rewrite(Float.from_int(Int(i))).to(Float(f64.from_i64(i))), rewrite(Float(f).abs()).to(Float(f), f >= 0.0), rewrite(Float(f).abs()).to(Float(-f), f < 0.0), - # Convert from float to rationl, if its a whole number i.e. can be converted to int + # Convert from float to rational, if its a whole number i.e. can be converted to int rewrite(Float(f)).to(Float.rational(BigRat(f.to_i64(), 1)), eq(f64.from_i64(f.to_i64())).to(f)), # always convert from int to rational rewrite(Float.from_int(Int(i))).to(Float.rational(BigRat(i, 1))), @@ -410,44 +430,77 @@ def _float(fl: Float, f: f64, f2: f64, i: i64, r: BigRat, r1: BigRat, i_: Int): class TupleInt(Expr, ruleset=array_api_ruleset): """ - Should act like a tuple[int, ...] + A tuple of integers. - All constructors should be rewritten to the functional semantics in the __init__ method. - """ + The following is true for all types of tuple: - @classmethod - def var(cls, name: StringLike) -> TupleInt: ... + Tuples have two main constructors: - def __init__(self, length: IntLike, idx_fn: Callable[[Int], Int]) -> None: ... + - `Tuple[T](vs: Vec[T]=[])` + - `Tuple.fn(length: Int, idx_fn: Callable[[Int], T])` - EMPTY: ClassVar[TupleInt] - NEVER: ClassVar[TupleInt] + This is so that they can be defined either with a known fixed integer length or a symbolic + length that could not be resolved to an integer. - def append(self, i: IntLike) -> TupleInt: ... + Both constructors must implement two methods: - @classmethod - def single(cls, i: Int) -> TupleInt: - return TupleInt(Int(1), lambda _: i) + * `l.length() -> Int` + * `l.__getitem__(i: Int) -> T` - @method(subsume=True) - @classmethod - def range(cls, stop: IntLike) -> TupleInt: - return TupleInt(stop, lambda i: i) + Lists with a known length will be subsumed into the vector representation. + + Lists that have vecs that are equal will have the elements unified. + + Methods that transform lists should also subsume, so that the vector version will be preferred. + + Lists from a vec also have `l.to_vec` set to the original vec. + """ + + def __init__(self, vec: VecLike[Int, IntLike] = Vec[Int].empty()) -> None: + """ + Create a TupleInt from a Vec of Ints. + + >>> list(TupleInt(Vec(i64(1), i64(2), i64(3)))) + [i64(1), i64(2), i64(3)] + >>> list(TupleInt()) + [] + """ @classmethod - def from_vec(cls, vec: VecLike[Int, IntLike]) -> TupleInt: ... + def fn(cls, length: IntLike, idx_fn: Callable[[Int], Int]) -> TupleInt: + """ + Create a TupleInt from a length and an index function. - def __add__(self, other: TupleIntLike) -> TupleInt: - other = cast("TupleInt", other) - return TupleInt( - self.length() + other.length(), lambda i: Int.if_(i < self.length(), self[i], other[i - self.length()]) - ) + >>> list(TupleInt.fn(3, lambda i: i * 10)) + [i64(0), i64(10), i64(20)] + """ - def length(self) -> Int: ... - def __getitem__(self, i: IntLike) -> Int: ... + def length(self) -> Int: + """ + Return the length of the tuple. + + >>> int(TupleInt([1, 2, 3]).length()) + 3 + >>> int(TupleInt.fn(5, lambda i: i).length()) + 5 + """ + + def __getitem__(self, i: IntLike) -> Int: + """ + Return the integer at index i. + + >>> int(TupleInt([10, 20, 30])[1]) + 20 + >>> int(TupleInt(3, lambda i: i * 10)[2]) + 20 + """ @method(preserve=True) def __len__(self) -> int: + """ + >>> len(TupleInt([1, 2, 3])) + 3 + """ return self.length().eval() @method(preserve=True) @@ -456,50 +509,180 @@ def __iter__(self) -> Iterator[Int]: @method(merge=Vec.__or__) # type: ignore[prop-decorator] @property - def to_vec(self) -> Vec[Int]: ... + def to_vec(self) -> Vec[Int]: + """ + Returns the Vec[Int] representation of the TupleInt. + """ @method(preserve=True) def eval(self) -> tuple[Int, ...]: + """ + Returns the evaluated tuple of Ints. + """ return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_vec) - def foldl(self, f: Callable[[Int, Int], Int], init: Int) -> Int: ... - def foldl_boolean(self, f: Callable[[Boolean, Int], Boolean], init: Boolean) -> Boolean: ... - def foldl_tuple_int(self, f: Callable[[TupleInt, Int], TupleInt], init: TupleIntLike) -> TupleInt: ... + def append(self, i: IntLike) -> TupleInt: + """ + Append an integer to the end of the tuple. + + >>> ti = TupleInt.range(3) + >>> ti2 = ti.append(3) + >>> list(ti2) + [i64(0), i64(1), i64(2), i64(3)] + """ + return TupleInt.fn( + self.length() + 1, lambda j: Int.if_(j == self.length(), lambda: cast("Int", i), lambda: self[j]) + ) + + def __add__(self, other: TupleIntLike) -> TupleInt: + """ + Concatenate two TupleInts. + >>> ti1 = TupleInt.range(3) + >>> ti2 = TupleInt.range(2) + >>> ti3 = ti1 + ti2 + >>> list(ti3) + [Int(0), Int(1), Int(2), Int(0), Int(1)] + """ + other = cast("TupleInt", other) + return TupleInt.fn( + self.length() + other.length(), + lambda i: Int.if_(i < self.length(), lambda: self[i], lambda: other[i - self.length()]), + ) + + def drop(self, n: Int) -> TupleInt: + """ + Return a new tuple with the first n elements dropped. + + >>> ti = TupleInt([1, 2, 3, 4]) + >>> list(ti.drop(2)) + [i64(3), i64(4)] + """ + return TupleInt.fn(self.length() - n, lambda i: self[i + n]) + + def last(self) -> Int: + """ + Return the last element in the tuple. + + >>> ti = TupleInt([1, 2, 3]) + >>> int(ti.last()) + 3 + """ + return self[self.length() - 1] + + def drop_last(self) -> TupleInt: + """ + Return a new tuple with the last element dropped. + + >>> ti = TupleInt([1, 2, 3]) + >>> list(ti.drop_last()) + [i64(1), i64(2)] + """ + return TupleInt.fn(self.length() - 1, self.__getitem__) + + @classmethod + def range(cls, stop: IntLike) -> TupleInt: + """ + Create a TupleInt with the integers from 0 to stop - 1. + >>> list(TupleInt.range(5)) + [Int(0), Int(1), Int(2), Int(3), Int(4)] + """ + return TupleInt.fn(stop, lambda i: i) + + def foldl(self, f: Callable[[Int, Int], Int], init: Int) -> Int: + """ + Fold the tuple from the left with the given function and initial value. + + >>> ti = TupleInt([1, 2, 3]) + >>> int(ti.foldl(lambda acc, x: acc + x, i64(0))) + 6 + """ + return Int.if_(self.length() == 0, lambda: init, lambda: f(self.drop_last().foldl(f, init), self.last())) + + def foldl_boolean(self, f: Callable[[Boolean, Int], Boolean], init: Boolean) -> Boolean: + """ + Fold the tuple from the left with the given boolean function and initial value. + + >>> ti = TupleInt([1, 2, 3]) + >>> bool(ti.foldl_boolean(lambda acc, x: acc | (x == i64(2)), FALSE)) + True + >>> bool(ti.foldl_boolean(lambda acc, x: acc & (x < i64(3)), TRUE)) + False + """ + return Boolean.if_( + self.length() == 0, lambda: init, lambda: f(self.drop_last().foldl_boolean(f, init), self.last()) + ) + + def foldl_tuple_int(self, f: Callable[[TupleInt, Int], TupleInt], init: TupleIntLike) -> TupleInt: + """ + Fold the tuple from the left with the given tuple function and initial value. + + >>> ti = TupleInt([1, 2, 3]) + >>> ti2 = ti.foldl_tuple_int(lambda acc, x: acc.append(x * 2), TupleInt()) + >>> list(ti2) + [Int(2), Int(4), Int(6)] + """ + init = cast("TupleInt", init) + return TupleInt.if_( + self.length() == 0, lambda: init, lambda: f(self.drop_last().foldl_tuple_int(f, init), self.last()) + ) - @method(subsume=True) def contains(self, i: Int) -> Boolean: + """ + Returns True if the tuple contains the given integer. + + >>> ti = TupleInt([1, 2, 3]) + >>> bool(ti.contains(i64(2))) + True + >>> bool(ti.contains(i64(4))) + False + """ return self.foldl_boolean(lambda acc, j: acc | (i == j), FALSE) - @method(subsume=True) def filter(self, f: Callable[[Int], Boolean]) -> TupleInt: + """ + Returns a new tuple with only the elements that satisfy the given predicate. + + >>> ti = TupleInt([1, 2, 3, 4]) + >>> list(ti.filter(lambda x: x % i64(2) == i64(0))) + [i64(2), i64(4)] + >>> list(ti.filter(lambda x: x > i64(2))) + [i64(3), i64(4)] + """ return self.foldl_tuple_int( - lambda acc, v: TupleInt.if_(f(v), acc.append(v), acc), - TupleInt.EMPTY, + lambda acc, v: TupleInt.if_(f(v), lambda: acc.append(v), lambda: acc), + TupleInt(), ) - @method(subsume=True) - def map(self, f: Callable[[Int], Int]) -> TupleInt: - return TupleInt(self.length(), lambda i: f(self[i])) - @classmethod - def if_(cls, b: BooleanLike, i: TupleIntLike, j: TupleIntLike) -> TupleInt: ... + def if_(cls, b: BooleanLike, i: Callable[[], TupleInt], j: Callable[[], TupleInt]) -> TupleInt: + """ + Returns i() if b is True, else j(). Wrapped in callables to avoid eager evaluation. - def drop(self, n: Int) -> TupleInt: - return TupleInt(self.length() - n, lambda i: self[i + n]) + >>> ti1 = TupleInt([1, 2]) + >>> ti2 = TupleInt([3, 4]) + >>> ti = TupleInt.if_(TRUE, lambda: ti1, lambda: ti2) + >>> list(ti) + [i64(1), i64(2)] + """ def product(self) -> Int: - return self.foldl(lambda acc, i: acc * i, Int(1)) - - def map_tuple_int(self, f: Callable[[Int], TupleInt]) -> TupleTupleInt: - return TupleTupleInt(self.length(), lambda i: f(self[i])) + """ + Return the product of all elements in the tuple. - @method(subsume=True) - def map_value(self, f: Callable[[Int], Value]) -> TupleValue: - return TupleValue(self.length(), lambda i: f(self[i])) + >>> ti = TupleInt([1, 2, 3, 4]) + >>> int(ti.product()) + 24 + """ + return self.foldl(lambda acc, i: acc * i, Int(1)) def select(self, indices: TupleIntLike) -> TupleInt: """ Return a new tuple with the elements at the given indices + + >>> ti = TupleInt([10, 20, 30, 40]) + >>> indices = TupleInt([1, 3]) + >>> list(ti.select(indices)) + [Int(20), Int(40)] """ indices = cast("TupleInt", indices) return indices.map(lambda i: self[i]) @@ -507,22 +690,62 @@ def select(self, indices: TupleIntLike) -> TupleInt: def deselect(self, indices: TupleIntLike) -> TupleInt: """ Return a new tuple with the elements not at the given indices + + >>> ti = TupleInt([10, 20, 30, 40]) + >>> indices = TupleInt([1, 3]) + >>> list(ti.deselect(indices)) + [i64(10), i64(30)] """ indices = cast("TupleInt", indices) return TupleInt.range(self.length()).filter(lambda i: ~indices.contains(i)).map(lambda i: self[i]) def reverse(self) -> TupleInt: - return TupleInt(self.length(), lambda i: self[self.length() - i - 1]) + """ + Return a new tuple with the elements in reverse order. - def last(self) -> Int: - return self[self.length() - 1] + >>> ti = TupleInt([1, 2, 3]) + >>> list(ti.reverse()) + [Int(3), Int(2), Int(1)] + """ + return TupleInt.fn(self.length(), lambda i: self[self.length() - i - 1]) - def drop_last(self) -> TupleInt: - return TupleInt(self.length() - 1, self.__getitem__) + def map(self, f: Callable[[Int], Int]) -> TupleInt: + """ + Returns a new tuple with each element transformed by the given function. + >>> ti = TupleInt([1, 2, 3]) + >>> list(ti.map(lambda x: x * i64(2))) + [i64(2), i64(4), i64(6)] + """ + return TupleInt.fn(self.length(), lambda i: f(self[i])) -converter(Vec[Int], TupleInt, lambda x: TupleInt.from_vec(x)) + # Put at bottom so can use previous methods when resolving + def map_tuple_int(self, f: Callable[[Int], TupleInt]) -> TupleTupleInt: + """ + Returns a new tuple of TupleInts with each element transformed by the given function. + + >>> ti = TupleInt([1, 2]) + >>> tti = ti.map_tuple_int(lambda x: TupleInt([x, x + 10])) + >>> list(tti[0]) + [i64(1), i64(11)] + >>> list(tti[1]) + [i64(2), i64(12)] + """ + return TupleTupleInt.fn(self.length(), lambda i: f(self[i])) + def map_value(self, f: Callable[[Int], Value]) -> TupleValue: + """ + Returns a new tuple of Values with each element transformed by the given function. + + >>> ti = TupleInt([1, 2]) + >>> tv = ti.map_value(lambda x: Value.from_int(x * i64(3))) + >>> list(tv) + [Value(i64(3)), Value(i64(6))] + """ + return TupleValue.fn(self.length(), lambda i: f(self[i])) + + +converter(Vec[Int], TupleInt, TupleInt) TupleIntLike: TypeAlias = TupleInt | VecLike[Int, IntLike] @@ -530,90 +753,33 @@ def drop_last(self) -> TupleInt: def _tuple_int( i: Int, i2: Int, - f: Callable[[Int, Int], Int], - bool_f: Callable[[Boolean, Int], Boolean], idx_fn: Callable[[Int], Int], - tuple_int_f: Callable[[TupleInt, Int], TupleInt], vs: Vec[Int], - b: Boolean, ti: TupleInt, - ti2: TupleInt, k: i64, - vi: Vec[Int], + lt: Callable[[], TupleInt], + lf: Callable[[], TupleInt], ): - return [ - # TODO: Just remove tuple and instead use map on vec to materialize indices? - rewrite(TupleInt.from_vec(vi)).to(TupleInt.EMPTY, vi.length() == i64(0)), - rewrite(TupleInt.from_vec(vi)).to( - TupleInt.from_vec(vi.pop()).append(vi[vi.length() - 1]), vi.length() > i64(0) - ), - rule(eq(ti).to(TupleInt.from_vec(vs))).then(set_(ti.to_vec).to(vs)), - # Functional access - rewrite(TupleInt(i, idx_fn).length()).to(i), - rewrite(TupleInt(i, idx_fn)[i2]).to(idx_fn(check_index(i, i2))), - # cons access - rewrite(TupleInt.EMPTY.length()).to(Int(0)), - rewrite(TupleInt.EMPTY[i]).to(Int.NEVER), - rewrite(ti.append(i).length()).to(ti.length() + 1), - rewrite(ti.append(i)[i2]).to(Int.if_(i2 == ti.length(), i, ti[i2])), - # cons to functional (removed this so that there is not infinite replacements between the,) - # rewrite(TupleInt.EMPTY).to(TupleInt(0, lambda _: Int.NEVER)), - # rewrite(TupleInt(i, idx_fn).append(i2)).to(TupleInt(i + 1, lambda j: Int.if_(j == i, i2, idx_fn(j)))), - # functional to cons - rewrite(TupleInt(0, idx_fn), subsume=True).to(TupleInt.EMPTY), - rewrite(TupleInt(Int(k), idx_fn), subsume=True).to(TupleInt(k - 1, idx_fn).append(idx_fn(Int(k - 1))), k > 0), - # cons to vec - rewrite(TupleInt.EMPTY).to(TupleInt.from_vec(Vec[Int]())), - rewrite(TupleInt.from_vec(vs).append(i)).to(TupleInt.from_vec(vs.append(Vec(i)))), - # fold - rewrite(TupleInt.EMPTY.foldl(f, i), subsume=True).to(i), - rewrite(ti.append(i2).foldl(f, i), subsume=True).to(f(ti.foldl(f, i), i2)), - # fold boolean - rewrite(TupleInt.EMPTY.foldl_boolean(bool_f, b), subsume=True).to(b), - rewrite(ti.append(i2).foldl_boolean(bool_f, b), subsume=True).to(bool_f(ti.foldl_boolean(bool_f, b), i2)), - # fold tuple_int - rewrite(TupleInt.EMPTY.foldl_tuple_int(tuple_int_f, ti), subsume=True).to(ti), - rewrite(ti.append(i2).foldl_tuple_int(tuple_int_f, ti2), subsume=True).to( - tuple_int_f(ti.foldl_tuple_int(tuple_int_f, ti2), i2) - ), - # if_ - rewrite(TupleInt.if_(TRUE, ti, ti2), subsume=True).to(ti), - rewrite(TupleInt.if_(FALSE, ti, ti2), subsume=True).to(ti2), - # unify append - rule(eq(ti.append(i)).to(ti2.append(i2))).then(union(ti).with_(ti2), union(i).with_(i2)), - ] + yield rule(eq(ti).to(TupleInt(vs))).then(set_(ti.to_vec).to(vs)) + yield rewrite(TupleInt.fn(i2, idx_fn).length()).to(i2) + yield rewrite(TupleInt.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) -class TupleTupleInt(Expr, ruleset=array_api_ruleset): - @classmethod - def var(cls, name: StringLike) -> TupleTupleInt: ... + yield rewrite(TupleInt(vs).length()).to(Int(vs.length())) + yield rewrite(TupleInt(vs)[Int(k)]).to(vs[k]) - EMPTY: ClassVar[TupleTupleInt] + yield rewrite(TupleInt.fn(Int(k), idx_fn), subsume=True).to(TupleInt(k.range().map(lambda i: idx_fn(Int(i))))) - def __init__(self, length: IntLike, idx_fn: Callable[[Int], TupleInt]) -> None: ... + yield rewrite(TupleInt.if_(TRUE, lt, lf)).to(lt()) + yield rewrite(TupleInt.if_(FALSE, lt, lf)).to(lf()) - @method(subsume=True) - @classmethod - def single(cls, i: TupleIntLike) -> TupleTupleInt: - i = cast("TupleInt", i) - return TupleTupleInt(1, lambda _: i) - @method(subsume=True) +class TupleTupleInt(Expr, ruleset=array_api_ruleset): + def __init__(self, vec: VecLike[TupleInt, TupleIntLike] = ()) -> None: ... @classmethod - def from_vec(cls, vec: Vec[TupleInt]) -> TupleTupleInt: ... - - def append(self, i: TupleIntLike) -> TupleTupleInt: ... - - def __add__(self, other: TupleTupleIntLike) -> TupleTupleInt: - other = cast("TupleTupleInt", other) - return TupleTupleInt( - self.length() + other.length(), - lambda i: TupleInt.if_(i < self.length(), self[i], other[i - self.length()]), - ) - + def fn(cls, length: IntLike, idx_fn: Callable[[Int], TupleInt]) -> TupleTupleInt: ... def length(self) -> Int: ... def __getitem__(self, i: IntLike) -> TupleInt: ... - @method(preserve=True) def __len__(self) -> int: return self.length().eval() @@ -625,18 +791,43 @@ def __iter__(self) -> Iterator[TupleInt]: @method(merge=Vec.__or__) # type: ignore[prop-decorator] @property def to_vec(self) -> Vec[TupleInt]: ... - @method(preserve=True) def eval(self) -> tuple[TupleInt, ...]: return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_vec) + def append(self, i: TupleIntLike) -> TupleTupleInt: + return TupleTupleInt.fn( + self.length() + 1, lambda j: TupleInt.if_(j == self.length(), lambda: cast("TupleInt", i), lambda: self[j]) + ) + + def __add__(self, other: TupleTupleIntLike) -> TupleTupleInt: + other = cast("TupleTupleInt", other) + return TupleTupleInt.fn( + self.length() + other.length(), + lambda i: TupleInt.if_(i < self.length(), lambda: self[i], lambda: other[i - self.length()]), + ) + def drop(self, n: Int) -> TupleTupleInt: - return TupleTupleInt(self.length() - n, lambda i: self[i + n]) + return TupleTupleInt.fn(self.length() - n, lambda i: self[i + n]) def map_int(self, f: Callable[[TupleInt], Int]) -> TupleInt: - return TupleInt(self.length(), lambda i: f(self[i])) + return TupleInt.fn(self.length(), lambda i: f(self[i])) + + def foldl_value(self, f: Callable[[Value, TupleInt], Value], init: ValueLike) -> Value: + return Value.if_( + self.length() == 0, + lambda: cast("Value", init), + lambda: f(self.drop_last().foldl_value(f, init), self.last()), + ) + + def last(self) -> TupleInt: + return self[self.length() - 1] + + def drop_last(self) -> TupleTupleInt: + return TupleTupleInt.fn(self.length() - 1, self.__getitem__) - def foldl_value(self, f: Callable[[Value, TupleInt], Value], init: ValueLike) -> Value: ... + @classmethod + def if_(cls, b: BooleanLike, i: Callable[[], TupleTupleInt], j: Callable[[], TupleTupleInt]) -> TupleTupleInt: ... @method(subsume=True) def product(self) -> TupleTupleInt: @@ -646,73 +837,49 @@ def product(self) -> TupleTupleInt: https://docs.python.org/3/library/itertools.html#itertools.product https://github.com/saulshanabrook/saulshanabrook/discussions/39 + + >>> list(TupleTupleInt([TupleInt([1, 2]), TupleInt([3, 4])]).product()) + [TupleInt([1, 3]), TupleInt([1, 4]), TupleInt([2, 3]), TupleInt([2, 4])] """ - return TupleTupleInt( + return TupleTupleInt.fn( self.map_int(lambda x: x.length()).product(), - lambda i: TupleInt( + lambda i: TupleInt.fn( self.length(), lambda j: self[j][(i // self.drop(j + 1).map_int(lambda x: x.length()).product()) % self[j].length()], ), ) -converter(Vec[TupleInt], TupleTupleInt, lambda x: TupleTupleInt.from_vec(x)) +converter(Vec[TupleInt], TupleTupleInt, lambda x: TupleTupleInt(x)) TupleTupleIntLike: TypeAlias = TupleTupleInt | VecLike[TupleInt, TupleIntLike] @array_api_ruleset.register def _tuple_tuple_int( - length: Int, - fn: Callable[[TupleInt], Int], + i: Int, + i2: Int, idx_fn: Callable[[Int], TupleInt], - f: Callable[[Value, TupleInt], Value], - i: Value, - k: i64, - idx: Int, vs: Vec[TupleInt], - ti: TupleInt, - ti1: TupleInt, - tti: TupleTupleInt, - tti1: TupleTupleInt, + ti: TupleTupleInt, + k: i64, + lt: Callable[[], TupleTupleInt], + lf: Callable[[], TupleTupleInt], ): - yield rule(eq(tti).to(TupleTupleInt.from_vec(vs))).then(set_(tti.to_vec).to(vs)) - yield rewrite(TupleTupleInt(length, idx_fn).length()).to(length) - yield rewrite(TupleTupleInt(length, idx_fn)[idx]).to(idx_fn(check_index(idx, length))) - - # cons access - yield rewrite(TupleTupleInt.EMPTY.length()).to(Int(0)) - yield rewrite(TupleTupleInt.EMPTY[idx]).to(TupleInt.NEVER) - yield rewrite(tti.append(ti).length()).to(tti.length() + 1) - yield rewrite(tti.append(ti)[idx]).to(TupleInt.if_(idx == tti.length(), ti, tti[idx])) - - # functional to cons - yield rewrite(TupleTupleInt(0, idx_fn), subsume=True).to(TupleTupleInt.EMPTY) - yield rewrite(TupleTupleInt(Int(k), idx_fn), subsume=True).to( - TupleTupleInt(k - 1, idx_fn).append(idx_fn(Int(k - 1))), k > 0 - ) - # cons to vec - yield rewrite(TupleTupleInt.EMPTY).to(TupleTupleInt.from_vec(Vec[TupleInt]())) - yield rewrite(TupleTupleInt.from_vec(vs).append(ti)).to(TupleTupleInt.from_vec(vs.append(Vec(ti)))) - # fold value - yield rewrite(TupleTupleInt.EMPTY.foldl_value(f, i), subsume=True).to(i) - yield rewrite(tti.append(ti).foldl_value(f, i), subsume=True).to(f(tti.foldl_value(f, i), ti)) + yield rule(eq(ti).to(TupleTupleInt(vs))).then(set_(ti.to_vec).to(vs)) - # unify append - yield rule(eq(tti.append(ti)).to(tti1.append(ti1))).then(union(tti).with_(tti1), union(ti).with_(ti1)) + yield rewrite(TupleTupleInt.fn(i2, idx_fn).length()).to(i2) + yield rewrite(TupleTupleInt.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) + yield rewrite(TupleTupleInt(vs).length()).to(Int(vs.length())) + yield rewrite(TupleTupleInt(vs)[Int(k)]).to(vs[k]) -class OptionalInt(Expr, ruleset=array_api_ruleset): - none: ClassVar[OptionalInt] - - @classmethod - def some(cls, value: Int) -> OptionalInt: ... - - -OptionalIntLike: TypeAlias = OptionalInt | IntLike | None + yield rewrite(TupleTupleInt.fn(Int(k), idx_fn), subsume=True).to( + TupleTupleInt(k.range().map(lambda i: idx_fn(Int(i)))) + ) -converter(type(None), OptionalInt, lambda _: OptionalInt.none) -converter(Int, OptionalInt, OptionalInt.some) + yield rewrite(TupleTupleInt.if_(TRUE, lt, lf)).to(lt()) + yield rewrite(TupleTupleInt.if_(FALSE, lt, lf)).to(lf()) class DType(Expr, ruleset=array_api_ruleset): @@ -794,10 +961,6 @@ def _isdtype(d: DType, k1: IsDtypeKind, k2: IsDtypeKind): ] -# TODO: Add pushdown for math on scalars to values -# and add replacements - - class Value(Expr, ruleset=array_api_ruleset): NEVER: ClassVar[Value] @@ -860,7 +1023,7 @@ def real(self) -> Value: ... def sqrt(self) -> Value: ... @classmethod - def if_(cls, b: BooleanLike, i: ValueLike, j: ValueLike) -> Value: ... + def if_(cls, b: BooleanLike, i: Callable[[], Value], j: Callable[[], Value]) -> Value: ... def __int__(self) -> int: # type: ignore[valid-type] return self.to_int.eval() @@ -879,7 +1042,19 @@ def __float__(self) -> float: # type: ignore[valid-type] @array_api_ruleset.register -def _value(i: Int, f: Float, b: Boolean, v: Value, v1: Value, v2: Value, i1: Int, f1: Float, b1: Boolean): +def _value( + i: Int, + f: Float, + b: Boolean, + v: Value, + v1: Value, + v2: Value, + i1: Int, + f1: Float, + b1: Boolean, + vt: Callable[[], Value], + v1t: Callable[[], Value], +): # Default dtypes # https://data-apis.org/array-api/latest/API_specification/data_types.html?highlight=dtype#default-data-types yield rewrite(Value.int(i).dtype).to(DType.int64) @@ -902,8 +1077,8 @@ def _value(i: Int, f: Float, b: Boolean, v: Value, v1: Value, v2: Value, i1: Int yield rewrite(Value.float(Float.rational(BigRat(0, 1))) + v).to(v) - yield rewrite(Value.if_(TRUE, v, v1)).to(v) - yield rewrite(Value.if_(FALSE, v, v1)).to(v1) + yield rewrite(Value.if_(TRUE, vt, v1t)).to(vt()) + yield rewrite(Value.if_(FALSE, vt, v1t)).to(v1t()) # == yield rewrite(Value.int(i) == Value.int(i1)).to(i == i1) @@ -954,31 +1129,60 @@ def _value(i: Int, f: Float, b: Boolean, v: Value, v1: Value, v2: Value, i1: Int class TupleValue(Expr, ruleset=array_api_ruleset): - EMPTY: ClassVar[TupleValue] - NEVER: ClassVar[TupleValue] + def __init__(self, vec: VecLike[Value, ValueLike] = ()) -> None: ... + @classmethod + def fn(cls, length: IntLike, idx_fn: Callable[[Int], Value]) -> TupleValue: ... + def length(self) -> Int: ... + def __getitem__(self, i: IntLike) -> Value: ... + @method(preserve=True) + def __len__(self) -> int: + return self.length().eval() - def __init__(self, length: IntLike, idx_fn: Callable[[Int], Value]) -> None: ... + @method(preserve=True) + def __iter__(self) -> Iterator[Value]: + return iter(self.eval()) - def append(self, i: ValueLike) -> TupleValue: ... + @method(merge=Vec.__or__) # type: ignore[prop-decorator] + @property + def to_vec(self) -> Vec[Value]: ... + @method(preserve=True) + def eval(self) -> tuple[Value, ...]: + return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_vec) - @classmethod - def from_vec(cls, vec: Vec[Value]) -> TupleValue: ... + def append(self, i: ValueLike) -> TupleValue: + return TupleValue.fn( + self.length() + 1, lambda j: Value.if_(j == self.length(), lambda: cast("Value", i), lambda: self[j]) + ) def __add__(self, other: TupleValueLike) -> TupleValue: other = cast("TupleValue", other) - return TupleValue( + return TupleValue.fn( self.length() + other.length(), - lambda i: Value.if_(i < self.length(), self[i], other[i - self.length()]), + lambda i: Value.if_(i < self.length(), lambda: self[i], lambda: other[i - self.length()]), ) - def length(self) -> Int: ... + def last(self) -> Value: + return self[self.length() - 1] - def __getitem__(self, i: IntLike) -> Value: ... + def drop_last(self) -> TupleValue: + return TupleValue.fn(self.length() - 1, self.__getitem__) + + def foldl_boolean(self, f: Callable[[Boolean, Value], Boolean], init: BooleanLike) -> Boolean: + return Boolean.if_( + self.length() == 0, + lambda: cast("Boolean", init), + lambda: f(self.drop_last().foldl_boolean(f, init), self.last()), + ) + + def foldl_value(self, f: Callable[[Value, Value], Value], init: ValueLike) -> Value: + return Value.if_( + self.length() == 0, + lambda: cast("Value", init), + lambda: f(self.drop_last().foldl_value(f, init), self.last()), + ) - def foldl_boolean(self, f: Callable[[Boolean, Value], Boolean], init: BooleanLike) -> Boolean: ... - def foldl_value(self, f: Callable[[Value, Value], Value], init: ValueLike) -> Value: ... def map_value(self, f: Callable[[Value], Value]) -> TupleValue: - return TupleValue(self.length(), lambda i: f(self[i])) + return TupleValue.fn(self.length(), lambda i: f(self[i])) def contains(self, value: ValueLike) -> Boolean: value = cast("Value", value) @@ -988,13 +1192,13 @@ def contains(self, value: ValueLike) -> Boolean: @classmethod def from_tuple_int(cls, ti: TupleIntLike) -> TupleValue: ti = cast("TupleInt", ti) - return TupleValue(ti.length(), lambda i: Value.int(ti[i])) + return TupleValue.fn(ti.length(), lambda i: Value.int(ti[i])) @classmethod - def if_(cls, b: BooleanLike, i: TupleValueLike, j: TupleValueLike) -> TupleValue: ... + def if_(cls, b: BooleanLike, i: Callable[[], TupleValue], j: Callable[[], TupleValue]) -> TupleValue: ... -converter(Vec[Value], TupleValue, lambda x: TupleValue.from_vec(x)) +converter(Vec[Value], TupleValue, lambda x: TupleValue(x)) converter(TupleInt, TupleValue, lambda x: TupleValue.from_tuple_int(x)) TupleValueLike: TypeAlias = TupleValue | VecLike[Value, ValueLike] | TupleIntLike @@ -1002,111 +1206,71 @@ def if_(cls, b: BooleanLike, i: TupleValueLike, j: TupleValueLike) -> TupleValue @array_api_ruleset.register def _tuple_value( - length: Int, + i: Int, + i2: Int, idx_fn: Callable[[Int], Value], - k: i64, - idx: Int, vs: Vec[Value], - v: Value, - v1: Value, - tv: TupleValue, - tv1: TupleValue, - bool_f: Callable[[Boolean, Value], Boolean], - value_f: Callable[[Value, Value], Value], - b: Boolean, + ti: TupleValue, + k: i64, + lt: Callable[[], TupleValue], + lf: Callable[[], TupleValue], ): - yield rewrite(TupleValue(length, idx_fn).length()).to(length) - yield rewrite(TupleValue(length, idx_fn)[idx]).to(idx_fn(check_index(idx, length))) - - # cons access - yield rewrite(TupleValue.EMPTY.length()).to(Int(0)) - yield rewrite(TupleValue.EMPTY[idx]).to(Value.NEVER) - yield rewrite(tv.append(v).length()).to(tv.length() + 1) - yield rewrite(tv.append(v)[idx]).to(Value.if_(idx == tv.length(), v, tv[idx])) - - # functional to cons - yield rewrite(TupleValue(0, idx_fn), subsume=True).to(TupleValue.EMPTY) - yield rewrite(TupleValue(Int(k), idx_fn), subsume=True).to( - TupleValue(k - 1, idx_fn).append(idx_fn(Int(k - 1))), k > 0 - ) - - # cons to vec - yield rewrite(TupleValue.EMPTY).to(TupleValue.from_vec(Vec[Value]())) - yield rewrite(TupleValue.from_vec(vs).append(v)).to(TupleValue.from_vec(vs.append(Vec(v)))) + yield rule(eq(ti).to(TupleValue(vs))).then(set_(ti.to_vec).to(vs)) - # fold boolean - yield rewrite(TupleValue.EMPTY.foldl_boolean(bool_f, b), subsume=True).to(b) - yield rewrite(tv.append(v).foldl_boolean(bool_f, b), subsume=True).to(bool_f(tv.foldl_boolean(bool_f, b), v)) + yield rewrite(TupleValue.fn(i2, idx_fn).length()).to(i2) + yield rewrite(TupleValue.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) - # fold value - yield rewrite(TupleValue.EMPTY.foldl_value(value_f, v), subsume=True).to(v) - yield rewrite(tv.append(v).foldl_value(value_f, v1), subsume=True).to(value_f(tv.foldl_value(value_f, v1), v)) + yield rewrite(TupleValue(vs).length()).to(Int(vs.length())) + yield rewrite(TupleValue(vs)[Int(k)]).to(vs[k]) - # unify append - yield rule(eq(tv.append(v)).to(tv1.append(v1))).then(union(tv).with_(tv1), union(v).with_(v1)) + yield rewrite(TupleValue.fn(Int(k), idx_fn), subsume=True).to(TupleValue(k.range().map(lambda i: idx_fn(Int(i))))) - # if - yield rewrite(TupleValue.if_(TRUE, tv, tv1), subsume=True).to(tv) - yield rewrite(TupleValue.if_(FALSE, tv, tv1), subsume=True).to(tv1) + yield rewrite(TupleValue.if_(TRUE, lt, lf)).to(lt()) + yield rewrite(TupleValue.if_(FALSE, lt, lf)).to(lf()) class TupleTupleValue(Expr, ruleset=array_api_ruleset): - EMPTY: ClassVar[TupleTupleValue] - - def __init__(self, length: IntLike, idx_fn: Callable[[Int], TupleValue]) -> None: ... - - def append(self, i: TupleValueLike) -> TupleTupleValue: ... - + def __init__(self, vec: VecLike[TupleValue, TupleValueLike] = ()) -> None: ... @classmethod - def from_vec(cls, vec: Vec[TupleValue]) -> TupleTupleValue: ... - + def fn(cls, length: IntLike, idx_fn: Callable[[Int], TupleValue]) -> TupleTupleValue: ... def length(self) -> Int: ... - def __getitem__(self, i: IntLike) -> TupleValue: ... + @method(preserve=True) + def __len__(self) -> int: + return self.length().eval() + + @method(preserve=True) + def __iter__(self) -> Iterator[TupleValue]: + return iter(self.eval()) + + @method(merge=Vec.__or__) # type: ignore[prop-decorator] + @property + def to_vec(self) -> Vec[TupleValue]: ... + @method(preserve=True) + def eval(self) -> tuple[TupleValue, ...]: + return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_vec) -converter(tuple, TupleTupleValue, lambda x: TupleTupleValue.from_vec(Vec(*(convert(i, TupleValue) for i in x)))) -converter(list, TupleTupleValue, lambda x: TupleTupleValue.from_vec(Vec(*(convert(i, TupleValue) for i in x)))) +converter(tuple, TupleTupleValue, lambda x: TupleTupleValue(Vec(*(convert(i, TupleValue) for i in x)))) +converter(list, TupleTupleValue, lambda x: TupleTupleValue(Vec(*(convert(i, TupleValue) for i in x)))) TupleTupleValueLike: TypeAlias = TupleTupleValue | list[TupleValueLike] | tuple[TupleValueLike, ...] @array_api_ruleset.register def _tuple_tuple_value( - length: Int, - idx_fn: Callable[[Int], TupleValue], - k: i64, - idx: Int, - vs: Vec[TupleValue], - v: TupleValue, - v1: TupleValue, - tv: TupleTupleValue, - tv1: TupleTupleValue, + i: Int, i2: Int, idx_fn: Callable[[Int], TupleValue], vs: Vec[TupleValue], ti: TupleTupleValue, k: i64 ): - yield rewrite(TupleTupleValue(length, idx_fn).length()).to(length) - yield rewrite(TupleTupleValue(length, idx_fn)[idx]).to(idx_fn(check_index(idx, length))) - - # cons access - yield rewrite(TupleTupleValue.EMPTY.length()).to(Int(0)) - yield rewrite(TupleTupleValue.EMPTY[idx]).to(TupleValue.NEVER) - yield rewrite(tv.append(v).length()).to(tv.length() + 1) - yield rewrite(tv.append(v)[idx]).to(TupleValue.if_(idx == tv.length(), v, tv[idx])) - - # functional to cons - yield rewrite(TupleTupleValue(0, idx_fn), subsume=True).to(TupleTupleValue.EMPTY) - yield rewrite(TupleTupleValue(Int(k), idx_fn), subsume=True).to( - TupleTupleValue(k - 1, idx_fn).append(idx_fn(Int(k - 1))), k > 0 - ) + yield rule(eq(ti).to(TupleTupleValue(vs))).then(set_(ti.to_vec).to(vs)) - # cons to vec - yield rewrite(TupleTupleValue.EMPTY).to(TupleTupleValue.from_vec(Vec[TupleValue]())) - yield rewrite(TupleTupleValue.from_vec(vs).append(v)).to(TupleTupleValue.from_vec(vs.append(Vec(v)))) + yield rewrite(TupleTupleValue.fn(i2, idx_fn).length()).to(i2) + yield rewrite(TupleTupleValue.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) - # from_vec support? Not sure why this isn't there on other vecs and how to do this best, if should convert to cons or what... - yield rewrite(TupleTupleValue.from_vec(vs).length()).to(Int(vs.length())) - yield rewrite(TupleTupleValue.from_vec(vs)[Int(k)]).to(vs[k]) + yield rewrite(TupleTupleValue(vs).length()).to(Int(vs.length())) + yield rewrite(TupleTupleValue(vs)[Int(k)]).to(vs[k]) - # unify append - yield rule(eq(tv.append(v)).to(tv1.append(v1))).then(union(tv).with_(tv1), union(v).with_(v1)) + yield rewrite(TupleTupleValue.fn(Int(k), idx_fn), subsume=True).to( + TupleTupleValue(k.range().map(lambda i: idx_fn(Int(i)))) + ) @function @@ -1273,7 +1437,7 @@ def __len__(self) -> int: return self.size.eval() @method(egg_fn="sum") - def sum(self, axis: OptionalIntOrTuple = None) -> NDArray: ... + def sum(self, axis: OptionalIntOrTupleLike = None) -> NDArray: ... @method(preserve=True) def __iter__(self) -> Iterator[NDArray]: @@ -1358,7 +1522,7 @@ def __abs__(self) -> NDArray: ... @classmethod def scalar(cls, value: ValueLike) -> NDArray: value = cast("Value", value) - return NDArray(TupleInt.EMPTY, value.dtype, lambda _: value) + return NDArray(TupleInt(), value.dtype, lambda _: value) def to_value(self) -> Value: """ @@ -1402,7 +1566,7 @@ def index(self, indices: TupleIntLike) -> Value: """ @classmethod - def if_(cls, b: BooleanLike, i: NDArrayLike, j: NDArrayLike) -> NDArray: ... + def if_(cls, b: BooleanLike, i: Callable[[], NDArray], j: Callable[[], NDArray]) -> NDArray: ... @method(preserve=True) def eval_vecs(self) -> VecValuesRecursive: @@ -1470,10 +1634,6 @@ def __array__(self, dtype=None, copy=None) -> np.ndarray: def _ndarray( x: NDArray, x1: NDArray, - b: Boolean, - f: Float, - fi1: f64, - fi2: f64, shape: TupleInt, dtype: DType, idx_fn: Callable[[TupleInt], Value], @@ -1481,9 +1641,9 @@ def _ndarray( tv: TupleValue, v: Value, v1: Value, - l: Int, vi: Vec[Int], - shape_idx_fn: Callable[[Int], Int], + xt: Callable[[], NDArray], + x1t: Callable[[], NDArray], ): return [ rewrite(NDArray(shape, dtype, idx_fn).shape).to(shape), @@ -1492,10 +1652,10 @@ def _ndarray( rewrite(x.ndim).to(x.shape.length()), # rewrite(NDArray.scalar(Value.bool(b)).to_bool()).to(b), # Converting to a value requires a scalar bool value - rewrite(x.to_value()).to(x.index(TupleInt.EMPTY)), + rewrite(x.to_value()).to(x.index(TupleInt())), rewrite(NDArray.vector(tv).to_values()).to(tv), - rewrite(NDArray(TupleInt.from_vec(vi), dtype, idx_fn).to_values(), subsume=True).to( - TupleValue(vi[0], lambda i: idx_fn(TupleInt.EMPTY.append(i))), + rewrite(NDArray(TupleInt(vi), dtype, idx_fn).to_values(), subsume=True).to( + TupleValue.fn(vi[0], lambda i: idx_fn(TupleInt([i]))), vi.length() == i64(1), ), # TODO: Push these down to float @@ -1510,15 +1670,15 @@ def _ndarray( rewrite(NDArray.scalar(v) == NDArray.scalar(v1)).to(NDArray.scalar(v == v1)), rewrite(NDArray.scalar(v) > NDArray.scalar(v1)).to(NDArray.scalar(v > v1)), rewrite(NDArray.scalar(v) >= NDArray.scalar(v1)).to(NDArray.scalar(v >= v1)), - # Transpose of tranpose is the original array + # Transpose of transpose is the original array rewrite(x.T.T).to(x), # rewrite(reshape(x, shape).T, subsume=True).to(reshape(x, shape.reverse())), # rewrite(reshape(x, shape).shape).to(shape), # if_ - rewrite(NDArray.if_(TRUE, x, x1)).to(x), - rewrite(NDArray.if_(FALSE, x, x1)).to(x1), + rewrite(NDArray.if_(TRUE, xt, x1t)).to(xt()), + rewrite(NDArray.if_(FALSE, xt, x1t)).to(x1t()), # convert to scalar - rewrite(NDArray(TupleInt.EMPTY, dtype, idx_fn)).to(NDArray.scalar(idx_fn(TupleInt.EMPTY))), + rewrite(NDArray(TupleInt(), dtype, idx_fn)).to(NDArray.scalar(idx_fn(TupleInt()))), # Scalars should push operators down rewrite(NDArray.scalar(v) / NDArray.scalar(v1)).to(NDArray.scalar(v / v1)), rewrite(NDArray.scalar(v) ** NDArray.scalar(v1)).to(NDArray.scalar(v**v1)), @@ -1526,26 +1686,11 @@ def _ndarray( class TupleNDArray(Expr, ruleset=array_api_ruleset): - EMPTY: ClassVar[TupleNDArray] - - def __init__(self, length: IntLike, idx_fn: Callable[[Int], NDArray]) -> None: ... - - def append(self, i: NDArrayLike) -> TupleNDArray: ... - + def __init__(self, vec: VecLike[NDArray, NDArrayLike] = ()) -> None: ... @classmethod - def from_vec(cls, vec: Vec[NDArray]) -> TupleNDArray: ... - - def __add__(self, other: TupleNDArrayLike) -> TupleNDArray: - other = cast("TupleNDArray", other) - return TupleNDArray( - self.length() + other.length(), - lambda i: NDArray.if_(i < self.length(), self[i], other[i - self.length()]), - ) - + def fn(cls, length: IntLike, idx_fn: Callable[[Int], NDArray]) -> TupleNDArray: ... def length(self) -> Int: ... - def __getitem__(self, i: IntLike) -> NDArray: ... - @method(preserve=True) def __len__(self) -> int: return self.length().eval() @@ -1557,51 +1702,50 @@ def __iter__(self) -> Iterator[NDArray]: @method(merge=Vec.__or__) # type: ignore[prop-decorator] @property def to_vec(self) -> Vec[NDArray]: ... - @method(preserve=True) def eval(self) -> tuple[NDArray, ...]: return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_vec) + def append(self, i: NDArrayLike) -> TupleNDArray: + return TupleNDArray.fn( + self.length() + 1, lambda j: NDArray.if_(j == self.length(), lambda: cast("NDArray", i), lambda: self[j]) + ) + + def __add__(self, other: TupleValueLike) -> TupleNDArray: + other = cast("TupleNDArray", other) + return TupleNDArray.fn( + self.length() + other.length(), + lambda i: NDArray.if_(i < self.length(), lambda: self[i], lambda: other[i - self.length()]), + ) + -converter(Vec[NDArray], TupleNDArray, lambda x: TupleNDArray.from_vec(x)) +converter(Vec[NDArray], TupleNDArray, lambda x: TupleNDArray(x)) TupleNDArrayLike: TypeAlias = TupleNDArray | VecLike[NDArray, NDArrayLike] @array_api_ruleset.register def _tuple_ndarray( - length: Int, + i: Int, + i2: Int, idx_fn: Callable[[Int], NDArray], - k: i64, - idx: Int, vs: Vec[NDArray], - v: NDArray, - v1: NDArray, - tv: TupleNDArray, - tv1: TupleNDArray, - b: Boolean, + ti: TupleNDArray, + k: i64, + lt: Callable[[], TupleNDArray], + lf: Callable[[], TupleNDArray], ): - yield rule(eq(tv).to(TupleNDArray.from_vec(vs))).then(set_(tv.to_vec).to(vs)) - yield rewrite(TupleNDArray(length, idx_fn).length()).to(length) - yield rewrite(TupleNDArray(length, idx_fn)[idx]).to(idx_fn(check_index(idx, length))) - - # cons access - yield rewrite(TupleNDArray.EMPTY.length()).to(Int(0)) - yield rewrite(TupleNDArray.EMPTY[idx]).to(NDArray.NEVER) - yield rewrite(tv.append(v).length()).to(tv.length() + 1) - yield rewrite(tv.append(v)[idx]).to(NDArray.if_(idx == tv.length(), v, tv[idx])) - # functional to cons - yield rewrite(TupleNDArray(0, idx_fn), subsume=True).to(TupleNDArray.EMPTY) - yield rewrite(TupleNDArray(Int(k), idx_fn), subsume=True).to( - TupleNDArray(k - 1, idx_fn).append(idx_fn(Int(k - 1))), k > 0 - ) + yield rule(eq(ti).to(TupleNDArray(vs))).then(set_(ti.to_vec).to(vs)) + + yield rewrite(TupleNDArray.fn(i2, idx_fn).length()).to(i2) + yield rewrite(TupleNDArray.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) - # cons to vec - yield rewrite(TupleNDArray.EMPTY).to(TupleNDArray.from_vec(Vec[NDArray]())) - yield rewrite(TupleNDArray.from_vec(vs).append(v)).to(TupleNDArray.from_vec(vs.append(Vec(v)))) + yield rewrite(TupleNDArray(vs).length()).to(Int(vs.length())) + yield rewrite(TupleNDArray(vs)[Int(k)]).to(vs[k]) - # unify append - yield rule(eq(tv.append(v)).to(tv1.append(v1))).then(union(tv).with_(tv1), union(v).with_(v1)) + yield rewrite(TupleNDArray.fn(Int(k), idx_fn), subsume=True).to( + TupleNDArray(k.range().map(lambda i: idx_fn(Int(i)))) + ) class OptionalBool(Expr, ruleset=array_api_ruleset): @@ -1648,29 +1792,21 @@ def some(cls, value: TupleIntLike) -> OptionalTupleInt: ... converter(TupleInt, OptionalTupleInt, lambda x: OptionalTupleInt.some(x)) -class IntOrTuple(Expr, ruleset=array_api_ruleset): - none: ClassVar[IntOrTuple] +class OptionalIntOrTuple(Expr, ruleset=array_api_ruleset): + none: ClassVar[OptionalIntOrTuple] @classmethod - def int(cls, value: Int) -> IntOrTuple: ... + def int(cls, value: Int) -> OptionalIntOrTuple: ... @classmethod - def tuple(cls, value: TupleIntLike) -> IntOrTuple: ... + def tuple(cls, value: TupleIntLike) -> OptionalIntOrTuple: ... -converter(Int, IntOrTuple, lambda v: IntOrTuple.int(v)) -converter(TupleInt, IntOrTuple, lambda v: IntOrTuple.tuple(v)) - - -class OptionalIntOrTuple(Expr, ruleset=array_api_ruleset): - none: ClassVar[OptionalIntOrTuple] - - @classmethod - def some(cls, value: IntOrTuple) -> OptionalIntOrTuple: ... - +OptionalIntOrTupleLike: TypeAlias = OptionalIntOrTuple | None | IntLike | TupleIntLike converter(type(None), OptionalIntOrTuple, lambda _: OptionalIntOrTuple.none) -converter(IntOrTuple, OptionalIntOrTuple, lambda v: OptionalIntOrTuple.some(v)) +converter(Int, OptionalIntOrTuple, lambda v: OptionalIntOrTuple.int(v)) +converter(TupleInt, OptionalIntOrTuple, lambda v: OptionalIntOrTuple.tuple(v)) @function @@ -1683,7 +1819,7 @@ def asarray( @array_api_ruleset.register -def _assarray(a: NDArray, d: OptionalDType, ob: OptionalBool): +def _asarray(a: NDArray, d: OptionalDType, ob: OptionalBool): yield rewrite(asarray(a, d, ob).ndim).to(a.ndim) # asarray doesn't change ndim yield rewrite(asarray(a)).to(a) @@ -1770,10 +1906,10 @@ def concat(arrays: TupleNDArrayLike, axis: OptionalInt = OptionalInt.none) -> ND @array_api_ruleset.register -def _concat(x: NDArray): +def _concat(vs: Vec[NDArray]): return [ # only support no-op concat for now - rewrite(concat(TupleNDArray.EMPTY.append(x))).to(x), + rewrite(concat(TupleNDArray(vs))).to(vs[0], vs.length() == i64(1)), ] @@ -1805,7 +1941,7 @@ def unique_counts(x: NDArray) -> TupleNDArray: def _unique_counts(x: NDArray, c: NDArray, tv: TupleValue, v: Value, dtype: DType): return [ # rewrite(unique_counts(x).length()).to(Int(2)), - rewrite(unique_counts(x)).to(TupleNDArray(2, unique_counts(x).__getitem__)), + rewrite(unique_counts(x)).to(TupleNDArray.fn(2, unique_counts(x).__getitem__)), # Sum of all unique counts is the size of the array rewrite(sum(unique_counts(x)[Int(1)])).to(NDArray.scalar(Value.int(x.size))), # Same but with astype in the middle @@ -1850,7 +1986,7 @@ def unique_inverse(x: NDArray) -> TupleNDArray: def _unique_inverse(x: NDArray, i: Int): return [ # rewrite(unique_inverse(x).length()).to(Int(2)), - rewrite(unique_inverse(x)).to(TupleNDArray(2, unique_inverse(x).__getitem__)), + rewrite(unique_inverse(x)).to(TupleNDArray.fn(2, unique_inverse(x).__getitem__)), # Shape of unique_inverse first element is same as shape of unique_values rewrite(unique_inverse(x)[Int(0)]).to(unique_values(x)), ] @@ -1972,7 +2108,7 @@ def svd(x: NDArray, full_matrices: Boolean = TRUE) -> TupleNDArray: def _linalg(x: NDArray, full_matrices: Boolean): return [ # rewrite(svd(x, full_matrices).length()).to(Int(3)), - rewrite(svd(x, full_matrices)).to(TupleNDArray(3, svd(x, full_matrices).__getitem__)), + rewrite(svd(x, full_matrices)).to(TupleNDArray.fn(3, svd(x, full_matrices).__getitem__)), ] @@ -2095,7 +2231,7 @@ def _interval_analaysis( union(v1).with_(Value.bool(FALSE)), ), # possible values of bool is bool - rewrite(possible_values(Value.bool(b))).to(TupleValue.EMPTY.append(Value.bool(b))), + rewrite(possible_values(Value.bool(b))).to(TupleValue([Value.bool(b)])), # casting to a type preserves if > 0 rule( eq(v1).to(v.astype(dtype)), @@ -2123,14 +2259,14 @@ def _demand_shape(compound: NDArray, inner: NDArray) -> Command: @array_api_ruleset.register def _scalar_math(v: Value, vs: TupleValue, i: Int): - yield rewrite(NDArray.scalar(v).shape).to(TupleInt.EMPTY) + yield rewrite(NDArray.scalar(v).shape).to(TupleInt()) yield rewrite(NDArray.scalar(v).dtype).to(v.dtype) - yield rewrite(NDArray.scalar(v).index(TupleInt.EMPTY)).to(v) + yield rewrite(NDArray.scalar(v).index(TupleInt())).to(v) @array_api_ruleset.register def _vector_math(v: Value, vs: TupleValue, ti: TupleInt): - yield rewrite(NDArray.vector(vs).shape).to(TupleInt.single(vs.length())) + yield rewrite(NDArray.vector(vs).shape).to(TupleInt([vs.length()])) yield rewrite(NDArray.vector(vs).dtype).to(vs[Int(0)].dtype) yield rewrite(NDArray.vector(vs).index(ti)).to(vs[ti[0]]) @@ -2155,7 +2291,7 @@ def _reshape_math(x: NDArray, shape: TupleInt, copy: OptionalBool): @array_api_ruleset.register def _indexing_pushdown(x: NDArray, shape: TupleInt, copy: OptionalBool, i: Int): # rewrite full getitem to indexec - yield rewrite(x[IndexKey.int(i)]).to(NDArray.scalar(x.index(TupleInt.single(i)))) + yield rewrite(x[IndexKey.int(i)]).to(NDArray.scalar(x.index(TupleInt([i])))) # TODO: Multi index rewrite as well if all are ints @@ -2260,34 +2396,6 @@ def _size(x: NDArray): yield rewrite(x.size).to(x.shape.foldl(Int.__mul__, Int(1))) -# Seperate rulseset so we can use it in program gen -@ruleset -def array_api_vec_to_cons_ruleset( - vs: Vec[Int], - vv: Vec[Value], - vn: Vec[NDArray], - vt: Vec[TupleInt], -): - yield rewrite(TupleInt.from_vec(vs)).to(TupleInt.EMPTY, eq(vs.length()).to(i64(0))) - yield rewrite(TupleInt.from_vec(vs)).to( - TupleInt.from_vec(vs.remove(vs.length() - 1)).append(vs[vs.length() - 1]), ne(vs.length()).to(i64(0)) - ) - - yield rewrite(TupleValue.from_vec(vv)).to(TupleValue.EMPTY, eq(vv.length()).to(i64(0))) - yield rewrite(TupleValue.from_vec(vv)).to( - TupleValue.from_vec(vv.remove(vv.length() - 1)).append(vv[vv.length() - 1]), ne(vv.length()).to(i64(0)) - ) - - yield rewrite(TupleTupleInt.from_vec(vt)).to(TupleTupleInt.EMPTY, eq(vt.length()).to(i64(0))) - yield rewrite(TupleTupleInt.from_vec(vt)).to( - TupleTupleInt.from_vec(vt.remove(vt.length() - 1)).append(vt[vt.length() - 1]), ne(vt.length()).to(i64(0)) - ) - yield rewrite(TupleNDArray.from_vec(vn)).to(TupleNDArray.EMPTY, eq(vn.length()).to(i64(0))) - yield rewrite(TupleNDArray.from_vec(vn)).to( - TupleNDArray.from_vec(vn.remove(vn.length() - 1)).append(vn[vn.length() - 1]), ne(vn.length()).to(i64(0)) - ) - - @function(ruleset=array_api_ruleset) def ravel_index(index: TupleIntLike, shape: TupleIntLike) -> Int: """ @@ -2333,7 +2441,7 @@ def unravel_index(flat_index: IntLike, shape: TupleIntLike) -> TupleInt: .foldl_tuple_int( # Store remainder as last item in accumulator lambda acc, dim: acc.drop_last().append((r := acc.last()) % dim).append(r // dim), - TupleInt.EMPTY.append(flat_index), + TupleInt([flat_index]), ) .drop_last() .reverse() @@ -2354,8 +2462,8 @@ def array_api_functional_ruleset( ) -array_api_combined_ruleset = array_api_ruleset | array_api_vec_to_cons_ruleset | array_api_functional_ruleset -array_api_schedule = array_api_combined_ruleset.saturate() +array_api_combined_ruleset = array_api_ruleset | array_api_functional_ruleset +array_api_schedule = (array_api_combined_ruleset + run()).saturate() _CURRENT_EGRAPH: None | EGraph = None @@ -2373,7 +2481,7 @@ def set_array_api_egraph(egraph: EGraph) -> Iterator[None]: def _get_current_egraph() -> EGraph: - return _CURRENT_EGRAPH or EGraph() + return _CURRENT_EGRAPH or EGraph(save_egglog_string=True) def try_evaling(egraph: EGraph, schedule: Schedule, expr: Expr, prim_expr: BuiltinExpr) -> Any: @@ -2382,19 +2490,26 @@ def try_evaling(egraph: EGraph, schedule: Schedule, expr: Expr, prim_expr: Built if it fails, display the egraph and raise an error. """ try: - extracted = egraph.extract(prim_expr) + return egraph.extract(prim_expr).value # type: ignore[attr-defined] except EggSmolError: - # If this primitive doesn't exist in the egraph, we need to try to create it by - # registering the expression and running the schedule - egraph.register(expr) + pass + # If this primitive doesn't exist in the egraph, we need to try to create it by + # registering the expression and running the schedule + egraph.register(expr) + try: egraph.run(schedule) - try: - extracted = egraph.extract(prim_expr) - except BaseException as e: - # egraph.display(n_inline_leaves=1, split_primitive_outputs=True) - e.add_note(f"Cannot evaluate {egraph.extract(expr)}") - raise - return extracted.value # type: ignore[attr-defined] + except EggSmolError as e: + # Write out the egraph for debugging + with NamedTemporaryFile(mode="w", suffix=".egg", delete=False) as f: + f.write(egraph.as_egglog_string) + e.add_note(f"EGraph written to {f.name} for debugging") + raise + try: + return egraph.extract(prim_expr).value # type: ignore[attr-defined] + except BaseException as e: + # egraph.display(n_inline_leaves=1, split_primitive_outputs=True) + e.add_note(f"Cannot evaluate {egraph.extract(expr)}") + raise ## diff --git a/python/egglog/runtime.py b/python/egglog/runtime.py index 1e7e16c5..4a17c524 100644 --- a/python/egglog/runtime.py +++ b/python/egglog/runtime.py @@ -142,14 +142,14 @@ def resolve_type_annotation_mutate(decls: Declarations, tp: object) -> TypeOrVarRef: """ - Wrap resolve_type_annotation to mutate decls, as a helper for internal use in sitations where that is more ergonomic. + Wrap resolve_type_annotation to mutate decls, as a helper for internal use in situations where that is more ergonomic. """ new_decls, tp = resolve_type_annotation(tp) decls |= new_decls return tp -def resolve_type_annotation(tp: object) -> tuple[DeclerationsLike, TypeOrVarRef]: +def resolve_type_annotation(tp: object) -> tuple[DeclarationsLike, TypeOrVarRef]: """ Resolves a type object into a type reference. @@ -254,7 +254,7 @@ def __get__(self, obj: object, owner: RuntimeClass | None = None) -> Callable: @dataclass(match_args=False) -class RuntimeClass(DelayedDeclerations, metaclass=ClassFactory): +class RuntimeClass(DelayedDeclarations, metaclass=ClassFactory): __egg_tp__: TypeRefWithVars # True if we want `__parameters__` to be recognized by `Union`, which means we can't inherit from `type` directly. _egg_has_params: InitVar[bool] = False @@ -409,7 +409,6 @@ def __getattr__(self, name: str) -> RuntimeFunction | RuntimeExpr | Callable: ) if name in cls_decl.methods: return RuntimeFunction(self.__egg_decls_thunk__, Thunk.value(MethodRef(self.__egg_tp__.ident, name)), bound) - msg = f"Class {self.__egg_tp__.ident} has no method {name}" raise AttributeError(msg) from None @@ -468,7 +467,7 @@ def __getattribute__(cls, name: str) -> Any: @dataclass -class RuntimeFunction(DelayedDeclerations, metaclass=RuntimeFunctionMeta): +class RuntimeFunction(DelayedDeclarations, metaclass=RuntimeFunctionMeta): __egg_ref_thunk__: Callable[[], CallableRef] # Either they bound class for something like `Vec[Int].create` or a RuntimeExpr for bound methods # bound methods need to store RuntimeExpr not just TypedExprDecl, so they can mutate the expr if required on self @@ -647,7 +646,7 @@ def to_py_signature(sig: FunctionSignature, decls: Declarations, optional_args: @dataclass -class RuntimeExpr(DelayedDeclerations): +class RuntimeExpr(DelayedDeclarations): __egg_typed_expr_thunk__: Callable[[], TypedExprDecl] def __post_init__(self) -> None: diff --git a/python/egglog/thunk.py b/python/egglog/thunk.py index 4363449e..89e900d1 100644 --- a/python/egglog/thunk.py +++ b/python/egglog/thunk.py @@ -63,7 +63,7 @@ def __call__(self) -> T: res = fn(*args) except Exception as e: self.state = Error(e, context) - raise e from None + raise else: self.state = Resolved(res) return res diff --git a/src/egraph.rs b/src/egraph.rs index dac71e43..a13d53fb 100644 --- a/src/egraph.rs +++ b/src/egraph.rs @@ -4,6 +4,7 @@ use crate::conversions::*; use crate::error::{EggResult, WrappedError}; use crate::py_object_sort::{PyObjectSort, PyPickledValue, load}; use crate::serialize::SerializedEGraph; +use std::io::Write; use egglog::prelude::{RustSpan, Span, add_base_sort}; use egglog::{SerializeConfig, span}; @@ -11,6 +12,7 @@ use log::info; use num_bigint::BigInt; use num_rational::{BigRational, Rational64}; use pyo3::prelude::*; +use tempfile::NamedTempFile; use std::collections::{BTreeMap, BTreeSet}; use std::path::PathBuf; @@ -60,11 +62,19 @@ impl EGraph { ) -> EggResult> { let mut commands: Vec = commands.into_iter().map(|x| x.into()).collect(); let mut cmds_str = String::new(); + // Write cmds to temporary file for better error messages + let mut file = NamedTempFile::new().unwrap(); + for cmd in &commands { - cmds_str = cmds_str + &cmd.to_string() + "\n"; + let cmd_string = cmd.to_string(); + writeln!(file, "{}", cmd_string).unwrap(); + cmds_str = cmds_str + &cmd_string + "\n"; } + // Keep so that we can lookup errors later + let path = Some(file.keep().unwrap().1.to_str().unwrap().to_string()); + // Parse all commands so that type analysis works properly - commands = self.egraph.parser.get_program_from_string(None, &cmds_str).unwrap(); + commands = self.egraph.parser.get_program_from_string(path.clone(), &cmds_str).unwrap(); if let Some(cmds) = &mut self.cmds { cmds.push_str(&cmds_str); } From 6b3aabc45c5d08ac3ecda97ea0f729208552324f Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Mon, 2 Feb 2026 12:27:37 -0800 Subject: [PATCH 23/30] tmp --- docs/reference/python-integration.md | 65 ++++++++++++++++++++++++++++ python/egglog/exp/array_api.py | 17 +++++--- 2 files changed, 75 insertions(+), 7 deletions(-) diff --git a/docs/reference/python-integration.md b/docs/reference/python-integration.md index 2789a51d..d0a0b5f2 100644 --- a/docs/reference/python-integration.md +++ b/docs/reference/python-integration.md @@ -679,6 +679,71 @@ r = ruleset( egraph.saturate(r) ``` +## Debugging and Inspection + +When a rewrite or rule causes an unexpected equality, these hooks are the fastest ways to +figure out which rules fired and what the e-graph contains. + +### Run reports and rule counts + +`EGraph.run(...)` returns a `RunReport` that includes counts and timings per rule. + +```{code-cell} python +egraph = EGraph() +egraph.register(Math(2) + Math(100)) +report = egraph.run(3, ruleset=ruleset(rewrite(Math(2) + Math(100)).to(Math(102)))) + +# How many times each rule matched in this run: +report.num_matches_per_rule + +# Total time spent searching/applying each rule: +report.search_and_apply_time_per_rule +``` + +You can also retrieve cumulative stats for the current e-graph: + +```{code-cell} python +egraph = EGraph() +egraph.register(Math(1) + Math(2)) +egraph.run(2) +stats = egraph.stats() +stats.num_matches_per_rule +``` + +### Serialize the e-graph + +If you create the e-graph with `save_egglog_string=True`, you can dump the program +sent to egglog for offline inspection or minimization: + +```{code-cell} python +egraph = EGraph(save_egglog_string=True) +egraph.register(Math(1) + Math(2)) +egraph.run(2) +egglog_program = egraph.as_egglog_string +``` + +For structural inspection, the internal serializer can be used to produce JSON or +Graphviz output. These are especially useful when an unsound rewrite merges +unexpected e-classes. + +```{code-cell} python +egraph = EGraph() +egraph.register(Math(1) + Math(2)) +egraph.run(2) +serialized = egraph._serialize(split_primitive_outputs=True) # internal helper +json_blob = serialized.to_json() +dot = serialized.to_dot() +``` + +### Common pitfalls (rule authoring) + +- Primitive container sorts like `Vec[...]` should not be merged or unioned. Avoid + using merge functions that combine Vec outputs, and prefer one-way `set_` rules. +- Guard vector indexing rules with bounds checks (`0 <= k < vs.length()`) to avoid + `vec-get failed` panics and unsound conclusions. +- Be careful with rules that build terms with negative lengths (e.g., `length - 1`); + ensure they only fire when the length is proven positive. + ## Custom Cost Models By default, when extracting from the e-graph, we use a simple cost model, that looks at the costs assigned to each diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index 3dc11653..5c69d519 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -766,7 +766,7 @@ def _tuple_int( yield rewrite(TupleInt.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) yield rewrite(TupleInt(vs).length()).to(Int(vs.length())) - yield rewrite(TupleInt(vs)[Int(k)]).to(vs[k]) + yield rewrite(TupleInt(vs)[Int(k)]).to(vs[k], k >= 0, k < vs.length()) yield rewrite(TupleInt.fn(Int(k), idx_fn), subsume=True).to(TupleInt(k.range().map(lambda i: idx_fn(Int(i))))) @@ -872,7 +872,7 @@ def _tuple_tuple_int( yield rewrite(TupleTupleInt.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) yield rewrite(TupleTupleInt(vs).length()).to(Int(vs.length())) - yield rewrite(TupleTupleInt(vs)[Int(k)]).to(vs[k]) + yield rewrite(TupleTupleInt(vs)[Int(k)]).to(vs[k], k >= 0, k < vs.length()) yield rewrite(TupleTupleInt.fn(Int(k), idx_fn), subsume=True).to( TupleTupleInt(k.range().map(lambda i: idx_fn(Int(i)))) @@ -1221,7 +1221,7 @@ def _tuple_value( yield rewrite(TupleValue.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) yield rewrite(TupleValue(vs).length()).to(Int(vs.length())) - yield rewrite(TupleValue(vs)[Int(k)]).to(vs[k]) + yield rewrite(TupleValue(vs)[Int(k)]).to(vs[k], k >= 0, k < vs.length()) yield rewrite(TupleValue.fn(Int(k), idx_fn), subsume=True).to(TupleValue(k.range().map(lambda i: idx_fn(Int(i))))) @@ -1266,7 +1266,7 @@ def _tuple_tuple_value( yield rewrite(TupleTupleValue.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) yield rewrite(TupleTupleValue(vs).length()).to(Int(vs.length())) - yield rewrite(TupleTupleValue(vs)[Int(k)]).to(vs[k]) + yield rewrite(TupleTupleValue(vs)[Int(k)]).to(vs[k], k >= 0, k < vs.length()) yield rewrite(TupleTupleValue.fn(Int(k), idx_fn), subsume=True).to( TupleTupleValue(k.range().map(lambda i: idx_fn(Int(i)))) @@ -1741,7 +1741,7 @@ def _tuple_ndarray( yield rewrite(TupleNDArray.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) yield rewrite(TupleNDArray(vs).length()).to(Int(vs.length())) - yield rewrite(TupleNDArray(vs)[Int(k)]).to(vs[k]) + yield rewrite(TupleNDArray(vs)[Int(k)]).to(vs[k], k >= 0, k < vs.length()) yield rewrite(TupleNDArray.fn(Int(k), idx_fn), subsume=True).to( TupleNDArray(k.range().map(lambda i: idx_fn(Int(i)))) @@ -2486,8 +2486,11 @@ def _get_current_egraph() -> EGraph: def try_evaling(egraph: EGraph, schedule: Schedule, expr: Expr, prim_expr: BuiltinExpr) -> Any: """ - Try evaling the expression that will result in a primitive expression being fill. - if it fails, display the egraph and raise an error. + Try evaluating an expression that should produce a primitive (e.g., Bool/i64). + If extraction fails, register the expr, run the schedule, and retry. + On egglog panics we dump the .egg program for debugging. + A common failure mode is that no rule ever sets the primitive output + (e.g., `Boolean.to_bool` / `Int.to_i64`), so extraction fails. """ try: return egraph.extract(prim_expr).value # type: ignore[attr-defined] From afe9c824d42e28d59853349d571973c4964f5ec6 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Mon, 2 Feb 2026 12:29:29 -0800 Subject: [PATCH 24/30] tmp --- python/egglog/exp/vecdot_example.py | 36 +++++++++++++++++++++++++++++ 1 file changed, 36 insertions(+) create mode 100644 python/egglog/exp/vecdot_example.py diff --git a/python/egglog/exp/vecdot_example.py b/python/egglog/exp/vecdot_example.py new file mode 100644 index 00000000..c8fa4a58 --- /dev/null +++ b/python/egglog/exp/vecdot_example.py @@ -0,0 +1,36 @@ +from egglog.exp.array_api import * + +v = NDArray.matrix([[0.0, 5.0, 0.0], [0.0, 0.0, 10.0], [0.0, 6.0, 8.0]]) +n = NDArray.vector([0.0, 0.6, 0.8]) +res = vecdot(v, n) +# This fails with EggSmolError: Panic: Illegal merge attempted for function egglog_exp_array_api_Int_to_i64 +# assert str(res.eval_numpy("float64")) == "array([ 3., 8., 10.])" + +# Trying to debug by inlining the code for eval + + +egraph = EGraph() +egraph.register(res.shape) +egraph.run(array_api_schedule) +assert eq(egraph.extract(res.shape)).to(TupleInt(Vec(Int(3)))) +idxed = res.index((0,)) +egraph.register(res.index((0,))) + +# This is what fails +# egraph.run(array_api_schedule) +# print(egraph.extract(res.index((0,)))) +# Trying to debug by running step by step + +i = 0 +while (report := egraph.run(array_api_combined_ruleset + run())).updated: + print(f"Step {i}:") + # If we want to look at which rules were applied: + # matches = [k for k, v in report.num_matches_per_rule.items() if v > 0] + # print(f"Step {i}: applied rules: {matches}") + + # If we want to see the current extraction: + # print(egraph.extract(res.index((0,)))) + + # If we want to look at e-graph json: + # print(egraph._serialize().to_json()) + i += 1 From 1aecccb252a66d893b58c4e4874b16db43c14e41 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Tue, 3 Feb 2026 12:05:05 -0800 Subject: [PATCH 25/30] tmp --- python/egglog/bindings.pyi | 21 ++++++++++ python/egglog/egraph.py | 55 ++++++++++++++++++------ python/egglog/egraph_state.py | 3 +- python/egglog/exp/vecdot_example.py | 17 +++++--- src/egraph.rs | 5 +++ src/freeze.rs | 65 +++++++++++++++++++++++++++++ src/lib.rs | 1 + 7 files changed, 149 insertions(+), 18 deletions(-) create mode 100644 src/freeze.rs diff --git a/python/egglog/bindings.pyi b/python/egglog/bindings.pyi index 7e585dab..b598336c 100644 --- a/python/egglog/bindings.pyi +++ b/python/egglog/bindings.pyi @@ -147,6 +147,7 @@ class EGraph: def value_to_function(self, v: Value) -> tuple[str, list[Value]]: ... def value_to_set(self, v: Value) -> set[Value]: ... # def dynamic_cost_model_enode_cost(self, func: str, args: list[Value]) -> int: ... + def freeze(self) -> FrozenEGraph: ... @final class Value: @@ -885,3 +886,23 @@ class Extractor(Generic[_COST]): def extract_variants( self, egraph: EGraph, termdag: TermDag, value: Value, nvariants: int, sort: str ) -> list[tuple[_COST, _Term]]: ... + +## +# Frozen +## + +@final +class FrozenEGraph: + functions: dict[str, FrozenFunction] + +@final +class FrozenFunction: + input_sorts: list[str] + output_sort: str + rows: list[FrozenRow] + +@final +class FrozenRow: + subsumed: bool + inputs: list[Value] + output: Value diff --git a/python/egglog/egraph.py b/python/egglog/egraph.py index 7ee0ad81..0601df16 100644 --- a/python/egglog/egraph.py +++ b/python/egglog/egraph.py @@ -1335,6 +1335,48 @@ def has_custom_cost(self, fn: ExprCallable) -> bool: resolved, _ = resolve_callable(fn) return resolved in self._state.cost_callables + def debug_print(self) -> None: + """ + Prints the internal state of the egraph for debugging purposes. + """ + print("=== EGraph Debug Print ===") + print("Mapping from functions to their e-class") + for name, fn in self._egraph.freeze().functions.items(): + for row in fn.rows: + call = self._values_to_expr(row.inputs, name) + # None for let calls we cant resolve + if call is None: + continue + res = RuntimeExpr.__from_values__( + self.__egg_decls__, + TypedExprDecl( + tp=call.__egg_typed_expr__.tp, + expr=self._state.value_to_expr(tp=call.__egg_typed_expr__.tp, value=row.output), + ), + ) + equality = eq(call).to(res) + debug_str = str(equality) + if row.subsumed: + debug_str += " # subsumed" + print(debug_str) + print("=== End EGraph Debug Print ===") + + def _values_to_expr(self, args: list[bindings._Value], name: str) -> RuntimeExpr | None: + if name not in self._state.egg_fn_to_callable_refs: + return None + (callable_ref,) = self._state.egg_fn_to_callable_refs[name] + signature = self.__egg_decls__.get_callable_decl(callable_ref).signature + assert isinstance(signature, FunctionSignature) + arg_exprs = [ + TypedExprDecl(tp.to_just(), self._state.value_to_expr(tp.to_just(), arg)) + for (arg, tp) in zip(args, signature.arg_types, strict=True) + ] + res_type = signature.semantic_return_type.to_just() + return RuntimeExpr.__from_values__( + self.__egg_decls__, + TypedExprDecl(res_type, CallDecl(callable_ref, tuple(arg_exprs))), + ) + # Either a constant or a function. ExprCallable: TypeAlias = Callable[..., BaseExpr] | BaseExpr @@ -2214,18 +2256,7 @@ def enode_cost(self, name: str, args: list[bindings.Value]) -> int: return self.enode_cost_results[(name, tuple(args))] except KeyError: pass - (callable_ref,) = self.egraph._state.egg_fn_to_callable_refs[name] - signature = self.egraph.__egg_decls__.get_callable_decl(callable_ref).signature - assert isinstance(signature, FunctionSignature) - arg_exprs = [ - TypedExprDecl(tp.to_just(), self.egraph._state.value_to_expr(tp.to_just(), arg)) - for (arg, tp) in zip(args, signature.arg_types, strict=True) - ] - res_type = signature.semantic_return_type.to_just() - res = RuntimeExpr.__from_values__( - self.egraph.__egg_decls__, - TypedExprDecl(res_type, CallDecl(callable_ref, tuple(arg_exprs))), - ) + res = self.egraph._values_to_expr(args, name) index = len(self.enode_cost_expressions) self.enode_cost_expressions.append(res) self.enode_cost_results[(name, tuple(args))] = index diff --git a/python/egglog/egraph_state.py b/python/egglog/egraph_state.py index fc270ae0..f14059a6 100644 --- a/python/egglog/egraph_state.py +++ b/python/egglog/egraph_state.py @@ -783,7 +783,8 @@ def value_to_expr(self, tp: JustTypeRef, value: bindings.Value) -> ExprDecl: # return_tp, *arg_types = tp.args return self._unstable_fn_value_to_expr(_names, _args, return_tp, arg_types) case _: - raise NotImplementedError(f"Value to expr not implemented for type {tp.ident}") + # If this is not a builtin type, or we don't know how to convert it, just return as value + return ValueDecl(value) def _unstable_fn_value_to_expr( self, name: str, partial_args: list[bindings.Value], return_tp: JustTypeRef, _arg_types: list[JustTypeRef] diff --git a/python/egglog/exp/vecdot_example.py b/python/egglog/exp/vecdot_example.py index c8fa4a58..2ba958c9 100644 --- a/python/egglog/exp/vecdot_example.py +++ b/python/egglog/exp/vecdot_example.py @@ -1,7 +1,10 @@ from egglog.exp.array_api import * -v = NDArray.matrix([[0.0, 5.0, 0.0], [0.0, 0.0, 10.0], [0.0, 6.0, 8.0]]) -n = NDArray.vector([0.0, 0.6, 0.8]) +# v = NDArray.matrix([[0.0, 5.0, 0.0], [0.0, 0.0, 10.0], [0.0, 6.0, 8.0]]) +# n = NDArray.vector([0.0, 0.6, 0.8]) +# smaller example +v = NDArray.matrix([[1, 2], [3, 4]]) +n = NDArray.vector([3, 4]) res = vecdot(v, n) # This fails with EggSmolError: Panic: Illegal merge attempted for function egglog_exp_array_api_Int_to_i64 # assert str(res.eval_numpy("float64")) == "array([ 3., 8., 10.])" @@ -12,7 +15,7 @@ egraph = EGraph() egraph.register(res.shape) egraph.run(array_api_schedule) -assert eq(egraph.extract(res.shape)).to(TupleInt(Vec(Int(3)))) +assert eq(egraph.extract(res.shape)).to(TupleInt(Vec(Int(2)))) idxed = res.index((0,)) egraph.register(res.index((0,))) @@ -22,8 +25,14 @@ # Trying to debug by running step by step i = 0 +# egraph.saturate(array_api_combined_ruleset + run(), visualize=True, n_inline_leaves=2, split_primitive_outputs=True) while (report := egraph.run(array_api_combined_ruleset + run())).updated: print(f"Step {i}:") + rules_applied = [(k, v) for k, v in report.num_matches_per_rule.items() if v > 0] + for rule, count in rules_applied: + print(f" Applied rule {rule} {count} time(s)") + # print out all e-classes + egraph.debug_print() # If we want to look at which rules were applied: # matches = [k for k, v in report.num_matches_per_rule.items() if v > 0] # print(f"Step {i}: applied rules: {matches}") @@ -31,6 +40,4 @@ # If we want to see the current extraction: # print(egraph.extract(res.index((0,)))) - # If we want to look at e-graph json: - # print(egraph._serialize().to_json()) i += 1 diff --git a/src/egraph.rs b/src/egraph.rs index a13d53fb..e6291150 100644 --- a/src/egraph.rs +++ b/src/egraph.rs @@ -2,6 +2,7 @@ use crate::conversions::*; use crate::error::{EggResult, WrappedError}; +use crate::freeze::FrozenEGraph; use crate::py_object_sort::{PyObjectSort, PyPickledValue, load}; use crate::serialize::SerializedEGraph; use std::io::Write; @@ -239,6 +240,10 @@ impl EGraph { ) } + fn freeze(&self) -> FrozenEGraph { + FrozenEGraph::from_egraph(&self.egraph) + } + // fn dynamic_cost_model_enode_cost( // &self, // func: String, diff --git a/src/freeze.rs b/src/freeze.rs new file mode 100644 index 00000000..5ce89ba5 --- /dev/null +++ b/src/freeze.rs @@ -0,0 +1,65 @@ +// Freeze an egglog, turning it an immutable structure that can be printed, serialized, or added back to an e-graph. + +use std::{collections::HashMap, fmt::Display}; + +use egglog::EGraph; +use pyo3::prelude::*; + +use crate::{conversions::Command, egraph::Value}; + +#[pyclass(eq, frozen, get_all)] +#[derive(PartialEq, Eq, Clone, Hash)] +pub struct FrozenRow { + subsumed: bool, + inputs: Vec, + output: Value, +} + +#[pyclass(eq, frozen, hash, get_all)] +#[derive(PartialEq, Eq, Clone, Hash)] +pub struct FrozenFunction { + input_sorts: Vec, + output_sort: String, + rows: Vec, +} + +#[pyclass(eq, frozen, get_all)] +#[derive(PartialEq, Eq, Clone)] +pub struct FrozenEGraph { + functions: HashMap, +} + +impl FrozenEGraph { + /// Convert this frozen e-graph into a list of egglog commands that can reconstruct it, giv + pub fn from_egraph(egraph: &EGraph) -> FrozenEGraph { + let mut functions = HashMap::new(); + for (fname, func) in &egraph.functions { + let mut rows = Vec::new(); + egraph.backend.for_each(func.backend_id, |row| { + let frozen_row = FrozenRow { + subsumed: row.subsumed, + inputs: row.vals[..row.vals.len() - 1] + .iter() + .cloned() + .map(Value) + .collect(), + output: Value(*row.vals.last().unwrap()), + }; + rows.push(frozen_row); + }); + let frozen_function = FrozenFunction { + input_sorts: func + .schema() + .input + .iter() + .map(|s| s.name().to_string()) + .collect(), + output_sort: func.schema().output.name().to_string(), + rows, + }; + functions.insert(fname.clone(), frozen_function); + } + + FrozenEGraph { functions } + } +} diff --git a/src/lib.rs b/src/lib.rs index 723f5059..7ff42943 100644 --- a/src/lib.rs +++ b/src/lib.rs @@ -6,6 +6,7 @@ mod py_object_sort; mod serialize; mod termdag; mod utils; +mod freeze; use pyo3::prelude::*; From 3aab22f4e554a9993b3b4648bd783f13504b71e1 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Wed, 4 Feb 2026 16:36:56 -0800 Subject: [PATCH 26/30] tmp --- python/egglog/builtins.py | 12 +- python/egglog/conversion.py | 5 +- python/egglog/exp/array_api.py | 976 ++++++++++++--------- python/egglog/exp/array_api_numba.py | 4 +- python/egglog/exp/array_api_program_gen.py | 11 +- python/egglog/exp/vecdot_example.py | 71 +- python/tests/test_array_api.py | 10 +- src/serialize.rs | 2 +- 8 files changed, 620 insertions(+), 471 deletions(-) diff --git a/python/egglog/builtins.py b/python/egglog/builtins.py index 4f69586d..62c1a776 100644 --- a/python/egglog/builtins.py +++ b/python/egglog/builtins.py @@ -534,9 +534,7 @@ def rebuild(self) -> Set[T]: ... converter( set, Set, - lambda t: Set[get_type_args()[0]]( # type: ignore[misc,operator] - *(convert(x, get_type_args()[0]) for x in t) - ), + lambda t: Set(*(convert(x, get_type_args()[0]) for x in t)) if t else Set[get_type_args()[0]].empty(), # type: ignore[misc] ) SetLike: TypeAlias = Set[T] | set[TO] @@ -639,9 +637,7 @@ def multiset_fold(f: Callable[[T, T], T], initial: T, xs: MultiSet[T]) -> T: ... converter( tuple, MultiSet, - lambda t: MultiSet[get_type_args()[0]]( # type: ignore[misc,operator] - *(convert(x, get_type_args()[0]) for x in t) - ), + lambda t: MultiSet(*(convert(x, get_type_args()[0]) for x in t)) if t else MultiSet[get_type_args()[0]](), # type: ignore[operator,misc] ) MultiSetLike: TypeAlias = MultiSet[T] | tuple[TO, ...] @@ -1035,9 +1031,7 @@ def map(self, fn: Callable[[T], V]) -> Vec[V]: ... converter( sequence_type, Vec, - lambda t: Vec[get_type_args()[0]]( # type: ignore[misc,operator] - *(convert(x, get_type_args()[0]) for x in t) - ), + lambda t: Vec(*(convert(x, get_type_args()[0]) for x in t)) if t else Vec[get_type_args()[0]].empty(), # type: ignore[misc] ) VecLike: TypeAlias = Vec[T] | tuple[TO, ...] | list[TO] diff --git a/python/egglog/conversion.py b/python/egglog/conversion.py index ad6bccf8..514107b6 100644 --- a/python/egglog/conversion.py +++ b/python/egglog/conversion.py @@ -118,7 +118,8 @@ def convert(source: object, target: type[V]) -> V: """ Convert a source object to a target type. """ - assert isinstance(target, RuntimeClass) + # if not issubclass(target, RuntimeClass): + # raise TypeError(f"Expected target type to be a egglog type, got {target} of type {type(target)}") return cast("V", resolve_literal(target.__egg_tp__, source, target.__egg_decls_thunk__)) @@ -132,7 +133,7 @@ def convert_to_same_type(source: object, target: RuntimeExpr) -> RuntimeExpr: def process_tp(tp: type | RuntimeClass) -> JustTypeRef | type: """ - Process a type before converting it, to add it to the global declerations and resolve to a ref. + Process a type before converting it, to add it to the global declarations and resolve to a ref. """ if isinstance(tp, RuntimeClass): _TO_PROCESS_DECLS.append(tp) diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index 5c69d519..0c282c70 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -14,10 +14,10 @@ import sys from collections.abc import Callable from copy import copy +from fractions import Fraction from functools import partial -from tempfile import NamedTemporaryFile from types import EllipsisType -from typing import TYPE_CHECKING, Any, ClassVar, TypeAlias, cast +from typing import TYPE_CHECKING, ClassVar, Protocol, TypeAlias, TypeVar, cast import numpy as np @@ -62,10 +62,15 @@ def __bool__(self) -> bool: @method(preserve=True) def eval(self) -> bool: - return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_bool) + return try_evaling(self) + @method(preserve=True) # type: ignore[prop-decorator] @property - def to_bool(self) -> Bool: ... + def value(self) -> bool: + match get_callable_args(self, Boolean): + case (b,): + return cast("Bool", b).value + raise ExprValueError(self, "Boolean(b)") def __or__(self, other: BooleanLike) -> Boolean: ... @@ -93,9 +98,10 @@ def if_(cls, b: BooleanLike, i: Callable[[], Boolean], j: Callable[[], Boolean]) @array_api_ruleset.register -def _bool(x: Boolean, i: Int, j: Int, b: Bool, bt: Callable[[], Boolean], bf: Callable[[], Boolean]): +def _bool( + x: Boolean, y: Boolean, i: Int, j: Int, b: Bool, b1: Bool, bt: Callable[[], Boolean], bf: Callable[[], Boolean] +): return [ - rule(eq(x).to(Boolean(b))).then(set_(x.to_bool).to(b)), rewrite(TRUE | x).to(TRUE), rewrite(FALSE | x).to(x), rewrite(TRUE & x).to(x), @@ -108,6 +114,7 @@ def _bool(x: Boolean, i: Int, j: Int, b: Bool, bt: Callable[[], Boolean], bf: Ca rewrite(TRUE == FALSE).to(FALSE), rewrite(Boolean.if_(TRUE, bt, bf), subsume=True).to(bt()), rewrite(Boolean.if_(FALSE, bt, bf), subsume=True).to(bf()), + rule(eq(Boolean(b)).to(Boolean(b1)), ne(b).to(b1)).then(panic("Different booleans cannot be equal")), ] @@ -206,12 +213,17 @@ def __rxor__(self, other: IntLike) -> Int: ... def __ror__(self, other: IntLike) -> Int: ... - @property - def to_i64(self) -> i64: ... - @method(preserve=True) def eval(self) -> int: - return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_i64) + return try_evaling(self) + + @method(preserve=True) # type: ignore[prop-decorator] + @property + def value(self) -> int: + match get_callable_args(self, Int): + case (i,): + return cast("i64", i).value + raise ExprValueError(self, "Int(i)") @method(preserve=True) def __index__(self) -> int: @@ -256,8 +268,6 @@ def _int(i: i64, j: i64, r: Boolean, o: Int, b: Int, ot: Callable[[], Int], bt: yield rule(eq(r).to(Int(i) > Int(j)), i > j).then(union(r).with_(TRUE)) yield rule(eq(r).to(Int(i) > Int(j)), i < j).then(union(r).with_(FALSE)) - yield rule(eq(o).to(Int(j))).then(set_(o.to_i64).to(j)) - yield rule(eq(Int(i)).to(Int(j)), ne(i).to(j)).then(panic("Real ints cannot be equal to different ints")) yield rewrite(Int(i) + Int(j)).to(Int(i + j)) @@ -280,6 +290,8 @@ def _int(i: i64, j: i64, r: Boolean, o: Int, b: Int, ot: Callable[[], Int], bt: # Never cannot be equal to anything real yield rule(eq(Int.NEVER).to(Int(i))).then(panic("Int.NEVER cannot be equal to any real int")) + # If two integers are equal, panic + yield rule(eq(Int(i)).to(Int(j)), ne(i).to(j)).then(panic("Different ints cannot be equal")) converter(i64, Int, lambda x: Int(x)) @@ -340,28 +352,33 @@ class Float(Expr, ruleset=array_api_ruleset): @method(cost=3) def __init__(self, value: f64Like) -> None: ... - @property - def to_f64(self) -> f64: ... - - @property - def to_big_rat(self) -> BigRat: ... + @method(cost=2) + @classmethod + def rational(cls, r: BigRat) -> Float: ... @method(preserve=True) - def eval(self) -> float: - try: - return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_f64) - except EggSmolError: - return float(try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_big_rat)) + def eval(self) -> float | Fraction: + return try_evaling(self) - def abs(self) -> Float: ... + @method(preserve=True) # type: ignore[prop-decorator] + @property + def value(self) -> float | Fraction: + match get_callable_args(self, Float.rational): + case (r,): + return r.value + match get_callable_args(self, Float): + case (f,): + return cast("f64", f).value + raise ExprValueError(self, "Float(f) or Float.rational(r)") - @method(cost=2) - @classmethod - def rational(cls, r: BigRat) -> Float: ... + def __float__(self) -> float: + return float(self.eval()) @classmethod def from_int(cls, i: IntLike) -> Float: ... + def abs(self) -> Float: ... + def __truediv__(self, other: FloatLike) -> Float: ... def __mul__(self, other: FloatLike) -> Float: ... @@ -392,8 +409,6 @@ def __ge__(self, other: FloatLike) -> Boolean: ... @array_api_ruleset.register def _float(fl: Float, f: f64, f2: f64, i: i64, r: BigRat, r1: BigRat, i_: Int): return [ - rule(eq(fl).to(Float(f))).then(set_(fl.to_f64).to(f)), - rule(eq(fl).to(Float.rational(r))).then(set_(fl.to_big_rat).to(r)), rewrite(Float.from_int(Int(i))).to(Float(f64.from_i64(i))), rewrite(Float(f).abs()).to(Float(f), f >= 0.0), rewrite(Float(f).abs()).to(Float(-f), f < 0.0), @@ -425,6 +440,8 @@ def _float(fl: Float, f: f64, f2: f64, i: i64, r: BigRat, r1: BigRat, i_: Int): rewrite(Float.rational(r) == Float.rational(r1)).to(FALSE, ne(r).to(r1)), rewrite(Float.rational(r).__round__()).to(Float.rational(r.round())), rewrite(Float(f).__abs__()).to(Float(f.__abs__())), + # Two different floats cannot be equal + rule(eq(Float(f)).to(Float(f2)), ne(f).to(f2)).then(panic("Different floats cannot be equal")), ] @@ -451,9 +468,7 @@ class TupleInt(Expr, ruleset=array_api_ruleset): Lists that have vecs that are equal will have the elements unified. - Methods that transform lists should also subsume, so that the vector version will be preferred. - - Lists from a vec also have `l.to_vec` set to the original vec. + Methods that transform lists should also subsume or be unextractable, so that the vector version will be preferred. """ def __init__(self, vec: VecLike[Int, IntLike] = Vec[Int].empty()) -> None: @@ -507,20 +522,22 @@ def __len__(self) -> int: def __iter__(self) -> Iterator[Int]: return iter(self.eval()) - @method(merge=Vec.__or__) # type: ignore[prop-decorator] - @property - def to_vec(self) -> Vec[Int]: - """ - Returns the Vec[Int] representation of the TupleInt. - """ - @method(preserve=True) def eval(self) -> tuple[Int, ...]: """ Returns the evaluated tuple of Ints. """ - return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_vec) + return try_evaling(self) + @method(preserve=True) # type: ignore[prop-decorator] + @property + def value(self) -> tuple[Int, ...]: + match get_callable_args(self, TupleInt): + case (vec,): + return tuple(cast("Vec[Int]", vec)) + raise ExprValueError(self, "TupleInt(vec)") + + @method(unextractable=True) def append(self, i: IntLike) -> TupleInt: """ Append an integer to the end of the tuple. @@ -534,6 +551,7 @@ def append(self, i: IntLike) -> TupleInt: self.length() + 1, lambda j: Int.if_(j == self.length(), lambda: cast("Int", i), lambda: self[j]) ) + @method(unextractable=True) def __add__(self, other: TupleIntLike) -> TupleInt: """ Concatenate two TupleInts. @@ -549,16 +567,29 @@ def __add__(self, other: TupleIntLike) -> TupleInt: lambda i: Int.if_(i < self.length(), lambda: self[i], lambda: other[i - self.length()]), ) - def drop(self, n: Int) -> TupleInt: + @method(unextractable=True) + def drop(self, n: IntLike) -> TupleInt: """ Return a new tuple with the first n elements dropped. >>> ti = TupleInt([1, 2, 3, 4]) >>> list(ti.drop(2)) - [i64(3), i64(4)] + [Int(3), Int(4)] """ return TupleInt.fn(self.length() - n, lambda i: self[i + n]) + @method(unextractable=True) + def rest(self) -> TupleInt: + """ + Return a new tuple with the first element dropped. + + >>> ti = TupleInt([1, 2, 3]) + >>> list(ti.rest()) + [Int(2), Int(3)] + """ + return self.drop(i64(1)) + + @method(unextractable=True) def last(self) -> Int: """ Return the last element in the tuple. @@ -569,6 +600,7 @@ def last(self) -> Int: """ return self[self.length() - 1] + @method(unextractable=True) def drop_last(self) -> TupleInt: """ Return a new tuple with the last element dropped. @@ -579,6 +611,7 @@ def drop_last(self) -> TupleInt: """ return TupleInt.fn(self.length() - 1, self.__getitem__) + @method(unextractable=True) @classmethod def range(cls, stop: IntLike) -> TupleInt: """ @@ -588,6 +621,7 @@ def range(cls, stop: IntLike) -> TupleInt: """ return TupleInt.fn(stop, lambda i: i) + @method(unextractable=True) def foldl(self, f: Callable[[Int, Int], Int], init: Int) -> Int: """ Fold the tuple from the left with the given function and initial value. @@ -598,6 +632,7 @@ def foldl(self, f: Callable[[Int, Int], Int], init: Int) -> Int: """ return Int.if_(self.length() == 0, lambda: init, lambda: f(self.drop_last().foldl(f, init), self.last())) + @method(unextractable=True) def foldl_boolean(self, f: Callable[[Boolean, Int], Boolean], init: Boolean) -> Boolean: """ Fold the tuple from the left with the given boolean function and initial value. @@ -612,6 +647,7 @@ def foldl_boolean(self, f: Callable[[Boolean, Int], Boolean], init: Boolean) -> self.length() == 0, lambda: init, lambda: f(self.drop_last().foldl_boolean(f, init), self.last()) ) + @method(unextractable=True) def foldl_tuple_int(self, f: Callable[[TupleInt, Int], TupleInt], init: TupleIntLike) -> TupleInt: """ Fold the tuple from the left with the given tuple function and initial value. @@ -626,6 +662,21 @@ def foldl_tuple_int(self, f: Callable[[TupleInt, Int], TupleInt], init: TupleInt self.length() == 0, lambda: init, lambda: f(self.drop_last().foldl_tuple_int(f, init), self.last()) ) + @method(unextractable=True) + def foldl_value(self, f: Callable[[Value, Int], Value], init: ValueLike) -> Value: + """ + Fold the tuple from the left with the given value function and initial value. + >>> ti = TupleInt([1, 2, 3]) + >>> v = ti.foldl_value(lambda acc, x: Value.from_int(x) + acc, Value.from_int(0)) + >>> int(v.to_int) + 6 + """ + init = cast("Value", init) + return Value.if_( + self.length() == 0, lambda: init, lambda: f(self.drop_last().foldl_value(f, init), self.last()) + ) + + @method(unextractable=True) def contains(self, i: Int) -> Boolean: """ Returns True if the tuple contains the given integer. @@ -638,15 +689,16 @@ def contains(self, i: Int) -> Boolean: """ return self.foldl_boolean(lambda acc, j: acc | (i == j), FALSE) + @method(unextractable=True) def filter(self, f: Callable[[Int], Boolean]) -> TupleInt: """ Returns a new tuple with only the elements that satisfy the given predicate. >>> ti = TupleInt([1, 2, 3, 4]) - >>> list(ti.filter(lambda x: x % i64(2) == i64(0))) - [i64(2), i64(4)] - >>> list(ti.filter(lambda x: x > i64(2))) - [i64(3), i64(4)] + >>> list(ti.filter(lambda x: x % Int(2) == Int(0))) + [Int(2), Int(4)] + >>> list(ti.filter(lambda x: x > Int(2))) + [Int(3), Int(4)] """ return self.foldl_tuple_int( lambda acc, v: TupleInt.if_(f(v), lambda: acc.append(v), lambda: acc), @@ -665,6 +717,7 @@ def if_(cls, b: BooleanLike, i: Callable[[], TupleInt], j: Callable[[], TupleInt [i64(1), i64(2)] """ + @method(unextractable=True) def product(self) -> Int: """ Return the product of all elements in the tuple. @@ -675,6 +728,7 @@ def product(self) -> Int: """ return self.foldl(lambda acc, i: acc * i, Int(1)) + @method(unextractable=True) def select(self, indices: TupleIntLike) -> TupleInt: """ Return a new tuple with the elements at the given indices @@ -687,6 +741,7 @@ def select(self, indices: TupleIntLike) -> TupleInt: indices = cast("TupleInt", indices) return indices.map(lambda i: self[i]) + @method(unextractable=True) def deselect(self, indices: TupleIntLike) -> TupleInt: """ Return a new tuple with the elements not at the given indices @@ -694,11 +749,12 @@ def deselect(self, indices: TupleIntLike) -> TupleInt: >>> ti = TupleInt([10, 20, 30, 40]) >>> indices = TupleInt([1, 3]) >>> list(ti.deselect(indices)) - [i64(10), i64(30)] + [Int(10), Int(30)] """ indices = cast("TupleInt", indices) return TupleInt.range(self.length()).filter(lambda i: ~indices.contains(i)).map(lambda i: self[i]) + @method(unextractable=True) def reverse(self) -> TupleInt: """ Return a new tuple with the elements in reverse order. @@ -709,17 +765,19 @@ def reverse(self) -> TupleInt: """ return TupleInt.fn(self.length(), lambda i: self[self.length() - i - 1]) + @method(unextractable=True) def map(self, f: Callable[[Int], Int]) -> TupleInt: """ Returns a new tuple with each element transformed by the given function. - >>> ti = TupleInt([1, 2, 3]) - >>> list(ti.map(lambda x: x * i64(2))) - [i64(2), i64(4), i64(6)] + >>> ti = TupleInt([1, 2]) + >>> list(ti.map(lambda x: x * Int(2))) + [Int(2), Int(4)] """ return TupleInt.fn(self.length(), lambda i: f(self[i])) # Put at bottom so can use previous methods when resolving + @method(unextractable=True) def map_tuple_int(self, f: Callable[[Int], TupleInt]) -> TupleTupleInt: """ Returns a new tuple of TupleInts with each element transformed by the given function. @@ -727,20 +785,21 @@ def map_tuple_int(self, f: Callable[[Int], TupleInt]) -> TupleTupleInt: >>> ti = TupleInt([1, 2]) >>> tti = ti.map_tuple_int(lambda x: TupleInt([x, x + 10])) >>> list(tti[0]) - [i64(1), i64(11)] + [Int(1), Int(11)] >>> list(tti[1]) - [i64(2), i64(12)] + [Int(2), Int(12)] """ return TupleTupleInt.fn(self.length(), lambda i: f(self[i])) + @method(unextractable=True) def map_value(self, f: Callable[[Int], Value]) -> TupleValue: """ Returns a new tuple of Values with each element transformed by the given function. >>> ti = TupleInt([1, 2]) - >>> tv = ti.map_value(lambda x: Value.from_int(x * i64(3))) + >>> tv = ti.map_value(lambda x: Value.from_int(x * 3)) >>> list(tv) - [Value(i64(3)), Value(i64(6))] + [Value.from_int(Int(3)), Value.from_int(Int(6))] """ return TupleValue.fn(self.length(), lambda i: f(self[i])) @@ -755,23 +814,25 @@ def _tuple_int( i2: Int, idx_fn: Callable[[Int], Int], vs: Vec[Int], + vs2: Vec[Int], ti: TupleInt, k: i64, lt: Callable[[], TupleInt], lf: Callable[[], TupleInt], ): - yield rule(eq(ti).to(TupleInt(vs))).then(set_(ti.to_vec).to(vs)) + # Unify the elements of equal tuples + yield rule(eq(ti).to(TupleInt(vs)), eq(ti).to(TupleInt(vs2)), vs != vs2).then(vs | vs2) - yield rewrite(TupleInt.fn(i2, idx_fn).length()).to(i2) - yield rewrite(TupleInt.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) + yield rewrite(TupleInt.fn(i2, idx_fn).length(), subsume=True).to(i2) + yield rewrite(TupleInt.fn(i2, idx_fn)[i], subsume=True).to(idx_fn(check_index(i2, i))) - yield rewrite(TupleInt(vs).length()).to(Int(vs.length())) - yield rewrite(TupleInt(vs)[Int(k)]).to(vs[k], k >= 0, k < vs.length()) + yield rewrite(TupleInt(vs).length(), subsume=True).to(Int(vs.length())) + yield rewrite(TupleInt(vs)[Int(k)], subsume=True).to(vs[k]) - yield rewrite(TupleInt.fn(Int(k), idx_fn), subsume=True).to(TupleInt(k.range().map(lambda i: idx_fn(Int(i))))) + yield rewrite(TupleInt.if_(TRUE, lt, lf), subsume=True).to(lt()) + yield rewrite(TupleInt.if_(FALSE, lt, lf), subsume=True).to(lf()) - yield rewrite(TupleInt.if_(TRUE, lt, lf)).to(lt()) - yield rewrite(TupleInt.if_(FALSE, lt, lf)).to(lf()) + yield rewrite(TupleInt.fn(Int(k), idx_fn), subsume=True).to(TupleInt(k.range().map(lambda i: idx_fn(Int(i))))) class TupleTupleInt(Expr, ruleset=array_api_ruleset): @@ -788,18 +849,25 @@ def __len__(self) -> int: def __iter__(self) -> Iterator[TupleInt]: return iter(self.eval()) - @method(merge=Vec.__or__) # type: ignore[prop-decorator] - @property - def to_vec(self) -> Vec[TupleInt]: ... @method(preserve=True) def eval(self) -> tuple[TupleInt, ...]: - return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_vec) + return try_evaling(self) + + @method(preserve=True) # type: ignore[prop-decorator] + @property + def value(self) -> tuple[TupleInt, ...]: + match get_callable_args(self, TupleTupleInt): + case (vec,): + return tuple(cast("Vec[TupleInt]", vec)) + raise ExprValueError(self, "TupleTupleInt(vec)") + @method(unextractable=True) def append(self, i: TupleIntLike) -> TupleTupleInt: return TupleTupleInt.fn( self.length() + 1, lambda j: TupleInt.if_(j == self.length(), lambda: cast("TupleInt", i), lambda: self[j]) ) + @method(unextractable=True) def __add__(self, other: TupleTupleIntLike) -> TupleTupleInt: other = cast("TupleTupleInt", other) return TupleTupleInt.fn( @@ -807,12 +875,15 @@ def __add__(self, other: TupleTupleIntLike) -> TupleTupleInt: lambda i: TupleInt.if_(i < self.length(), lambda: self[i], lambda: other[i - self.length()]), ) + @method(unextractable=True) def drop(self, n: Int) -> TupleTupleInt: return TupleTupleInt.fn(self.length() - n, lambda i: self[i + n]) + @method(unextractable=True) def map_int(self, f: Callable[[TupleInt], Int]) -> TupleInt: return TupleInt.fn(self.length(), lambda i: f(self[i])) + @method(unextractable=True) def foldl_value(self, f: Callable[[Value, TupleInt], Value], init: ValueLike) -> Value: return Value.if_( self.length() == 0, @@ -820,16 +891,18 @@ def foldl_value(self, f: Callable[[Value, TupleInt], Value], init: ValueLike) -> lambda: f(self.drop_last().foldl_value(f, init), self.last()), ) + @method(unextractable=True) def last(self) -> TupleInt: return self[self.length() - 1] + @method(unextractable=True) def drop_last(self) -> TupleTupleInt: return TupleTupleInt.fn(self.length() - 1, self.__getitem__) @classmethod def if_(cls, b: BooleanLike, i: Callable[[], TupleTupleInt], j: Callable[[], TupleTupleInt]) -> TupleTupleInt: ... - @method(subsume=True) + @method(unextractable=True) def product(self) -> TupleTupleInt: """ Cartesian product of inputs @@ -861,25 +934,26 @@ def _tuple_tuple_int( i2: Int, idx_fn: Callable[[Int], TupleInt], vs: Vec[TupleInt], + vs2: Vec[TupleInt], ti: TupleTupleInt, k: i64, lt: Callable[[], TupleTupleInt], lf: Callable[[], TupleTupleInt], ): - yield rule(eq(ti).to(TupleTupleInt(vs))).then(set_(ti.to_vec).to(vs)) + yield rule(eq(ti).to(TupleTupleInt(vs)), eq(ti).to(TupleTupleInt(vs2)), vs != vs2).then(vs | vs2) - yield rewrite(TupleTupleInt.fn(i2, idx_fn).length()).to(i2) - yield rewrite(TupleTupleInt.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) + yield rewrite(TupleTupleInt.fn(i2, idx_fn).length(), subsume=True).to(i2) + yield rewrite(TupleTupleInt.fn(i2, idx_fn)[i], subsume=True).to(idx_fn(check_index(i2, i))) - yield rewrite(TupleTupleInt(vs).length()).to(Int(vs.length())) - yield rewrite(TupleTupleInt(vs)[Int(k)]).to(vs[k], k >= 0, k < vs.length()) + yield rewrite(TupleTupleInt(vs).length(), subsume=True).to(Int(vs.length())) + yield rewrite(TupleTupleInt(vs)[Int(k)], subsume=True).to(vs[k]) yield rewrite(TupleTupleInt.fn(Int(k), idx_fn), subsume=True).to( TupleTupleInt(k.range().map(lambda i: idx_fn(Int(i)))) ) - yield rewrite(TupleTupleInt.if_(TRUE, lt, lf)).to(lt()) - yield rewrite(TupleTupleInt.if_(FALSE, lt, lf)).to(lf()) + yield rewrite(TupleTupleInt.if_(TRUE, lt, lf), subsume=True).to(lt()) + yield rewrite(TupleTupleInt.if_(FALSE, lt, lf), subsume=True).to(lf()) class DType(Expr, ruleset=array_api_ruleset): @@ -908,7 +982,7 @@ def __eq__(self, other: DType) -> Boolean: # type: ignore[override] @array_api_ruleset.register def _(): for l, r in itertools.product(_DTYPES, repeat=2): - yield rewrite(l == r).to(TRUE if l is r else FALSE) + yield rewrite(l == r, subsume=True).to(TRUE if l is r else FALSE) class IsDtypeKind(Expr, ruleset=array_api_ruleset): @@ -964,15 +1038,14 @@ def _isdtype(d: DType, k1: IsDtypeKind, k2: IsDtypeKind): class Value(Expr, ruleset=array_api_ruleset): NEVER: ClassVar[Value] - # TODO: Rename to avoid name conflicts @classmethod - def int(cls, i: IntLike) -> Value: ... + def from_int(cls, i: IntLike) -> Value: ... @classmethod - def float(cls, f: FloatLike) -> Value: ... + def from_float(cls, f: FloatLike) -> Value: ... @classmethod - def bool(cls, b: BooleanLike) -> Value: ... + def from_bool(cls, b: BooleanLike) -> Value: ... def isfinite(self) -> Boolean: ... @@ -1001,14 +1074,11 @@ def dtype(self) -> DType: Default dtype for this scalar value """ - @property - def to_bool(self) -> Boolean: ... - @property def to_int(self) -> Int: ... @property - def to_float(self) -> Float: ... + def to_bool(self) -> Boolean: ... @property def to_truthy_value(self) -> Value: @@ -1025,19 +1095,33 @@ def sqrt(self) -> Value: ... @classmethod def if_(cls, b: BooleanLike, i: Callable[[], Value], j: Callable[[], Value]) -> Value: ... - def __int__(self) -> int: # type: ignore[valid-type] - return self.to_int.eval() + def __int__(self) -> int: + return int(self.value) + + def __float__(self) -> float: + return float(self.value) - def __float__(self) -> float: # type: ignore[valid-type] - return self.to_float.eval() + @method(preserve=True) # type: ignore[prop-decorator] + @property + def value(self) -> bool | int | float | Fraction: + match get_callable_args(self, Value.from_int): + case (i,): + return cast("Int", i).value + match get_callable_args(self, Value.from_float): + case (f,): + return cast("Float", f).value + match get_callable_args(self, Value.from_bool): + case (b,): + return cast("Boolean", b).value + raise ExprValueError(self, "Value.int|float|bool(...)") ValueLike: TypeAlias = Value | IntLike | FloatLike | BooleanLike -converter(Int, Value, Value.int) -converter(Float, Value, Value.float) -converter(Boolean, Value, Value.bool) +converter(Int, Value, Value.from_int) +converter(Float, Value, Value.from_float) +converter(Boolean, Value, Value.from_bool) converter(Value, Int, lambda x: x.to_int, 10) @@ -1057,75 +1141,74 @@ def _value( ): # Default dtypes # https://data-apis.org/array-api/latest/API_specification/data_types.html?highlight=dtype#default-data-types - yield rewrite(Value.int(i).dtype).to(DType.int64) - yield rewrite(Value.float(f).dtype).to(DType.float64) - yield rewrite(Value.bool(b).dtype).to(DType.bool) + yield rewrite(Value.from_int(i).dtype).to(DType.int64) + yield rewrite(Value.from_float(f).dtype).to(DType.float64) + yield rewrite(Value.from_bool(b).dtype).to(DType.bool) - yield rewrite(Value.bool(b).to_bool).to(b) - yield rewrite(Value.int(i).to_int).to(i) - yield rewrite(Value.float(f).to_float).to(f) + yield rewrite(Value.from_int(i).to_int).to(i) + yield rewrite(Value.from_bool(b).to_bool).to(b) - yield rewrite(Value.bool(b).to_truthy_value).to(Value.bool(b)) + yield rewrite(Value.from_bool(b).to_truthy_value).to(Value.from_bool(b)) # TODO: Add more rules for to_bool_value - yield rewrite(Value.float(f).conj()).to(Value.float(f)) - yield rewrite(Value.float(f).real()).to(Value.float(f)) - yield rewrite(Value.int(i).real()).to(Value.int(i)) - yield rewrite(Value.int(i).conj()).to(Value.int(i)) + yield rewrite(Value.from_float(f).conj()).to(Value.from_float(f)) + yield rewrite(Value.from_float(f).real()).to(Value.from_float(f)) + yield rewrite(Value.from_int(i).real()).to(Value.from_int(i)) + yield rewrite(Value.from_int(i).conj()).to(Value.from_int(i)) - yield rewrite(Value.float(f).sqrt()).to(Value.float(f ** (0.5))) + yield rewrite(Value.from_float(f).sqrt()).to(Value.from_float(f ** (0.5))) - yield rewrite(Value.float(Float.rational(BigRat(0, 1))) + v).to(v) + yield rewrite(Value.from_float(Float.rational(BigRat(0, 1))) + v).to(v) yield rewrite(Value.if_(TRUE, vt, v1t)).to(vt()) yield rewrite(Value.if_(FALSE, vt, v1t)).to(v1t()) # == - yield rewrite(Value.int(i) == Value.int(i1)).to(i == i1) - yield rewrite(Value.float(f) == Value.float(f1)).to(f == f1) - yield rewrite(Value.bool(b) == Value.bool(b1)).to(b == b1) + yield rewrite(Value.from_int(i) == Value.from_int(i1)).to(i == i1) + yield rewrite(Value.from_float(f) == Value.from_float(f1)).to(f == f1) + yield rewrite(Value.from_bool(b) == Value.from_bool(b1)).to(b == b1) # >= - yield rewrite(Value.int(i) >= Value.int(i1)).to(i >= i1) - yield rewrite(Value.float(f) >= Value.float(f1)).to(f >= f1) + yield rewrite(Value.from_int(i) >= Value.from_int(i1)).to(i >= i1) + yield rewrite(Value.from_float(f) >= Value.from_float(f1)).to(f >= f1) # <= - yield rewrite(Value.int(i) <= Value.int(i1)).to(i <= i1) - yield rewrite(Value.float(f) <= Value.float(f1)).to(f <= f1) + yield rewrite(Value.from_int(i) <= Value.from_int(i1)).to(i <= i1) + yield rewrite(Value.from_float(f) <= Value.from_float(f1)).to(f <= f1) # > - yield rewrite(Value.int(i) > Value.int(i1)).to(i > i1) - yield rewrite(Value.float(f) > Value.float(f1)).to(f > f1) + yield rewrite(Value.from_int(i) > Value.from_int(i1)).to(i > i1) + yield rewrite(Value.from_float(f) > Value.from_float(f1)).to(f > f1) # < - yield rewrite(Value.int(i) < Value.int(i1)).to(Value.bool(i < i1)) - yield rewrite(Value.float(f) < Value.float(f1)).to(Value.bool(f < f1)) + yield rewrite(Value.from_int(i) < Value.from_int(i1)).to(Value.from_bool(i < i1)) + yield rewrite(Value.from_float(f) < Value.from_float(f1)).to(Value.from_bool(f < f1)) # / - yield rewrite(Value.float(f) / Value.float(f1)).to(Value.float(f / f1)) + yield rewrite(Value.from_float(f) / Value.from_float(f1)).to(Value.from_float(f / f1)) # * - yield rewrite(Value.float(f) * Value.float(f1)).to(Value.float(f * f1)) - yield rewrite(Value.int(i) * Value.int(i1)).to(Value.int(i * i1)) + yield rewrite(Value.from_float(f) * Value.from_float(f1)).to(Value.from_float(f * f1)) + yield rewrite(Value.from_int(i) * Value.from_int(i1)).to(Value.from_int(i * i1)) # + - yield rewrite(Value.float(f) + Value.float(f1)).to(Value.float(f + f1)) - yield rewrite(Value.int(i) + Value.int(i1)).to(Value.int(i + i1)) + yield rewrite(Value.from_float(f) + Value.from_float(f1)).to(Value.from_float(f + f1)) + yield rewrite(Value.from_int(i) + Value.from_int(i1)).to(Value.from_int(i + i1)) # - - yield rewrite(Value.float(f) - Value.float(f1)).to(Value.float(f - f1)) - yield rewrite(Value.int(i) - Value.int(i1)).to(Value.int(i - i1)) + yield rewrite(Value.from_float(f) - Value.from_float(f1)).to(Value.from_float(f - f1)) + yield rewrite(Value.from_int(i) - Value.from_int(i1)).to(Value.from_int(i - i1)) # ** - yield rewrite(Value.float(f) ** Value.float(f1)).to(Value.float(f**f1)) - yield rewrite(Value.int(i) ** Value.int(i1)).to(Value.int(i**i1)) - yield rewrite(Value.int(i) ** Value.float(f1)).to(Value.float(Float.from_int(i) ** f1)) + yield rewrite(Value.from_float(f) ** Value.from_float(f1)).to(Value.from_float(f**f1)) + yield rewrite(Value.from_int(i) ** Value.from_int(i1)).to(Value.from_int(i**i1)) + yield rewrite(Value.from_int(i) ** Value.from_float(f1)).to(Value.from_float(Float.from_int(i) ** f1)) # abs - yield rewrite(Value.int(i).__abs__()).to(Value.int(i.__abs__())) - yield rewrite(Value.float(f).__abs__()).to(Value.float(f.__abs__())) + yield rewrite(Value.from_int(i).__abs__()).to(Value.from_int(i.__abs__())) + yield rewrite(Value.from_float(f).__abs__()).to(Value.from_float(f.__abs__())) # abs(x) **2 = x**2 - yield rewrite(v.__abs__() ** Value.float(Float.rational(BigRat(2, 1)))).to(v ** Value.float(2)) + yield rewrite(v.__abs__() ** Value.from_float(Float.rational(BigRat(2, 1)))).to(v ** Value.from_float(2)) # ** distributes over division yield rewrite((v1 / v) ** v2, subsume=True).to(v1**v2 / (v**v2)) # x ** y ** z = x ** (y * z) yield rewrite((v**v1) ** v2, subsume=True).to(v ** (v1 * v2)) - yield rewrite(Value.float(f) * Value.int(i)).to(Value.float(f * Float.from_int(i))) - yield rewrite(v ** Value.float(Float.rational(BigRat(1, 1)))).to(v) - yield rewrite(Value.float(Float.from_int(i))).to(Value.int(i)) + yield rewrite(Value.from_float(f) * Value.from_int(i)).to(Value.from_float(f * Float.from_int(i))) + yield rewrite(v ** Value.from_float(Float.rational(BigRat(1, 1)))).to(v) + yield rewrite(Value.from_float(Float.from_int(i))).to(Value.from_int(i)) class TupleValue(Expr, ruleset=array_api_ruleset): @@ -1142,18 +1225,25 @@ def __len__(self) -> int: def __iter__(self) -> Iterator[Value]: return iter(self.eval()) - @method(merge=Vec.__or__) # type: ignore[prop-decorator] - @property - def to_vec(self) -> Vec[Value]: ... @method(preserve=True) def eval(self) -> tuple[Value, ...]: - return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_vec) + return try_evaling(self) + + @method(preserve=True) # type: ignore[prop-decorator] + @property + def value(self) -> tuple[Value, ...]: + match get_callable_args(self, TupleValue): + case (vec,): + return tuple(cast("Vec[Value]", vec)) + raise ExprValueError(self, "TupleValue(vec)") + @method(unextractable=True) def append(self, i: ValueLike) -> TupleValue: return TupleValue.fn( self.length() + 1, lambda j: Value.if_(j == self.length(), lambda: cast("Value", i), lambda: self[j]) ) + @method(unextractable=True) def __add__(self, other: TupleValueLike) -> TupleValue: other = cast("TupleValue", other) return TupleValue.fn( @@ -1161,12 +1251,15 @@ def __add__(self, other: TupleValueLike) -> TupleValue: lambda i: Value.if_(i < self.length(), lambda: self[i], lambda: other[i - self.length()]), ) + @method(unextractable=True) def last(self) -> Value: return self[self.length() - 1] + @method(unextractable=True) def drop_last(self) -> TupleValue: return TupleValue.fn(self.length() - 1, self.__getitem__) + @method(unextractable=True) def foldl_boolean(self, f: Callable[[Boolean, Value], Boolean], init: BooleanLike) -> Boolean: return Boolean.if_( self.length() == 0, @@ -1174,6 +1267,7 @@ def foldl_boolean(self, f: Callable[[Boolean, Value], Boolean], init: BooleanLik lambda: f(self.drop_last().foldl_boolean(f, init), self.last()), ) + @method(subsume=True) def foldl_value(self, f: Callable[[Value, Value], Value], init: ValueLike) -> Value: return Value.if_( self.length() == 0, @@ -1181,18 +1275,20 @@ def foldl_value(self, f: Callable[[Value, Value], Value], init: ValueLike) -> Va lambda: f(self.drop_last().foldl_value(f, init), self.last()), ) + @method(unextractable=True) def map_value(self, f: Callable[[Value], Value]) -> TupleValue: return TupleValue.fn(self.length(), lambda i: f(self[i])) + @method(unextractable=True) def contains(self, value: ValueLike) -> Boolean: value = cast("Value", value) return self.foldl_boolean(lambda acc, j: acc | (value == j), FALSE) - @method(subsume=True) + @method(unextractable=True) @classmethod def from_tuple_int(cls, ti: TupleIntLike) -> TupleValue: ti = cast("TupleInt", ti) - return TupleValue.fn(ti.length(), lambda i: Value.int(ti[i])) + return TupleValue.fn(ti.length(), lambda i: Value.from_int(ti[i])) @classmethod def if_(cls, b: BooleanLike, i: Callable[[], TupleValue], j: Callable[[], TupleValue]) -> TupleValue: ... @@ -1210,67 +1306,24 @@ def _tuple_value( i2: Int, idx_fn: Callable[[Int], Value], vs: Vec[Value], + vs2: Vec[Value], ti: TupleValue, k: i64, lt: Callable[[], TupleValue], lf: Callable[[], TupleValue], ): - yield rule(eq(ti).to(TupleValue(vs))).then(set_(ti.to_vec).to(vs)) + yield rule(eq(ti).to(TupleValue(vs)), eq(ti).to(TupleValue(vs2)), vs != vs2).then(vs | vs2) - yield rewrite(TupleValue.fn(i2, idx_fn).length()).to(i2) - yield rewrite(TupleValue.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) + yield rewrite(TupleValue.fn(i2, idx_fn).length(), subsume=True).to(i2) + yield rewrite(TupleValue.fn(i2, idx_fn)[i], subsume=True).to(idx_fn(check_index(i2, i))) - yield rewrite(TupleValue(vs).length()).to(Int(vs.length())) - yield rewrite(TupleValue(vs)[Int(k)]).to(vs[k], k >= 0, k < vs.length()) + yield rewrite(TupleValue(vs).length(), subsume=True).to(Int(vs.length())) + yield rewrite(TupleValue(vs)[Int(k)], subsume=True).to(vs[k], k >= 0, k < vs.length()) yield rewrite(TupleValue.fn(Int(k), idx_fn), subsume=True).to(TupleValue(k.range().map(lambda i: idx_fn(Int(i))))) - yield rewrite(TupleValue.if_(TRUE, lt, lf)).to(lt()) - yield rewrite(TupleValue.if_(FALSE, lt, lf)).to(lf()) - - -class TupleTupleValue(Expr, ruleset=array_api_ruleset): - def __init__(self, vec: VecLike[TupleValue, TupleValueLike] = ()) -> None: ... - @classmethod - def fn(cls, length: IntLike, idx_fn: Callable[[Int], TupleValue]) -> TupleTupleValue: ... - def length(self) -> Int: ... - def __getitem__(self, i: IntLike) -> TupleValue: ... - @method(preserve=True) - def __len__(self) -> int: - return self.length().eval() - - @method(preserve=True) - def __iter__(self) -> Iterator[TupleValue]: - return iter(self.eval()) - - @method(merge=Vec.__or__) # type: ignore[prop-decorator] - @property - def to_vec(self) -> Vec[TupleValue]: ... - @method(preserve=True) - def eval(self) -> tuple[TupleValue, ...]: - return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_vec) - - -converter(tuple, TupleTupleValue, lambda x: TupleTupleValue(Vec(*(convert(i, TupleValue) for i in x)))) -converter(list, TupleTupleValue, lambda x: TupleTupleValue(Vec(*(convert(i, TupleValue) for i in x)))) -TupleTupleValueLike: TypeAlias = TupleTupleValue | list[TupleValueLike] | tuple[TupleValueLike, ...] - - -@array_api_ruleset.register -def _tuple_tuple_value( - i: Int, i2: Int, idx_fn: Callable[[Int], TupleValue], vs: Vec[TupleValue], ti: TupleTupleValue, k: i64 -): - yield rule(eq(ti).to(TupleTupleValue(vs))).then(set_(ti.to_vec).to(vs)) - - yield rewrite(TupleTupleValue.fn(i2, idx_fn).length()).to(i2) - yield rewrite(TupleTupleValue.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) - - yield rewrite(TupleTupleValue(vs).length()).to(Int(vs.length())) - yield rewrite(TupleTupleValue(vs)[Int(k)]).to(vs[k], k >= 0, k < vs.length()) - - yield rewrite(TupleTupleValue.fn(Int(k), idx_fn), subsume=True).to( - TupleTupleValue(k.range().map(lambda i: idx_fn(Int(i)))) - ) + yield rewrite(TupleValue.if_(TRUE, lt, lf), subsume=True).to(lt()) + yield rewrite(TupleValue.if_(FALSE, lt, lf), subsume=True).to(lf()) @function @@ -1388,23 +1441,196 @@ class Device(Expr, ruleset=array_api_ruleset): ... ALL_INDICES: TupleInt = constant("ALL_INDICES", TupleInt) +class RecursiveValue(Expr): + """ + Either a value or vec of RecursiveValues + + >>> convert(Value.from_int(42), RecursiveValue) + RecursiveValue(Value.from_int(Int(42))) + >>> convert((1, 2, 3), RecursiveValue) + RecursiveValue.vec( + Vec( + RecursiveValue(Value.from_int(Int(1))), + RecursiveValue(Value.from_int(Int(2))), + RecursiveValue(Value.from_int(Int(3))), + ) + ) + >>> convert(((1,), (2,)), RecursiveValue) + RecursiveValue.vec( + Vec( + RecursiveValue.vec(Vec(RecursiveValue(Value.from_int(Int(1))))), + RecursiveValue.vec(Vec(RecursiveValue(Value.from_int(Int(2))))), + ) + ) + """ + + def __init__(self, value: ValueLike) -> None: ... + + @classmethod + def vec(cls, vec: VecLike[RecursiveValue, RecursiveValueLike]) -> RecursiveValue: ... + + def __getitem__(self, index: TupleIntLike) -> Value: + """ + Index into the RecursiveValue with the given indices. It should match the shape. + + >>> rv = convert(((1, 2), (3, 4)), RecursiveValue) + >>> int(rv[TupleInt([0, 1])]) + 2 + """ + + @property + def shape(self) -> TupleInt: + """ + Shape of the RecursiveValue. + + >>> rv = convert(((1,), (3,)), RecursiveValue) + >>> list(rv.shape) + [Int(2), Int(1)] + """ + + # @method(preserve=True) # type: ignore[prop-decorator] + # @property + # def value(self) -> PyTupleValuesRecursive: + # """ + # Unwraps the RecursiveValue into either a Value or a nested tuple of Values. + + # >>> convert(((1, 2), (3, 4)), RecursiveValue).value + # ((Value.from_int(Int(1)), Value.from_int(Int(2))), (Value.from_int(Int(3)), Value.from_int(Int(4)))) + # """ + # match get_callable_args(self, RecursiveValue): + # case (value,): + # return cast("Value", value) + # match get_callable_args(self, RecursiveValue.vec): + # case (vec,): + # return tuple(v.value for v in cast("Vec[RecursiveValue]", vec)) + # raise ExprValueError(self, "RecursiveValue or RecursiveValue.vec") + + +PyTupleValuesRecursive: TypeAlias = Value | tuple["PyTupleValuesRecursive", ...] + +RecursiveValueLike: TypeAlias = RecursiveValue | VecLike[RecursiveValue, "RecursiveValueLike"] | ValueLike + +converter(Vec[RecursiveValue], RecursiveValue, lambda x: RecursiveValue.vec(x)) +converter(Value, RecursiveValue, lambda x: RecursiveValue(x)) + + +@array_api_ruleset.register +def _recursive_value( + i: Int, + i2: Int, + v: Value, + vs: Vec[RecursiveValue], + ti: TupleInt, + k: i64, + lt: Callable[[], RecursiveValue], + lf: Callable[[], RecursiveValue], + vi: Vec[Int], +): + yield rewrite(RecursiveValue(v).shape).to(TupleInt(())) + yield rewrite(RecursiveValue.vec(vs).shape).to(TupleInt((vs.length(),)) + vs[0].shape, vs.length() > 0) + yield rewrite(RecursiveValue.vec(vs).shape).to(TupleInt((0,)), vs.length() == i64(0)) + + yield rewrite(RecursiveValue(v)[ti], subsume=True).to(v) # Assume ti is empty + yield rewrite(RecursiveValue.vec(vs)[TupleInt(vi)], subsume=True).to( + vs[k][TupleInt(vi.remove(0))], + eq(vi[0]).to(Int(k)), + ) + + class NDArray(Expr, ruleset=array_api_ruleset): """ NDArray implementation following the Array API Standard. - >>> NDArray.vector((1, 2, 3)).eval() - (Value.int(Int(1)), Value.int(Int(2)), Value.int(Int(3))) - >>> NDArray.vector((1, 2, 3)).eval_numpy("int64") + >>> NDArray((1, 2, 3)).eval() + (Value.from_int(Int(1)), Value.from_int(Int(2)), Value.from_int(Int(3))) + >>> NDArray((1, 2, 3)).eval_numpy("int64") array([1, 2, 3]) - >>> NDArray.matrix(((1, 2), (3, 4))).eval_numpy("int64") + >>> NDArray(((1, 2), (3, 4))).eval_numpy("int64") array([[1, 2], [3, 4]]) """ - def __init__(self, shape: TupleIntLike, dtype: DType, idx_fn: Callable[[TupleInt], Value]) -> None: ... + def __init__(self, values: RecursiveValueLike) -> None: ... + + @classmethod + def fn(cls, shape: TupleIntLike, dtype: DType, idx_fn: Callable[[TupleInt], Value]) -> NDArray: ... NEVER: ClassVar[NDArray] + @classmethod + def from_tuple_value(cls, tv: TupleValueLike) -> NDArray: + """ + Creates an vector NDArray from a tuple of values. + + >>> NDArray.from_tuple_value((1, 2)).eval_numpy("int64") + array([1, 2]) + """ + tv = cast("TupleValue", tv) + return NDArray.fn( + TupleInt((tv.length(),)), + tv[0].dtype, + lambda idx: tv[idx[0]], + ) + + @method(preserve=True) + def eval_vecs(self) -> VecValuesRecursive: + """ + Evals to a nested Vec of values representing the array. It will be extracted and simplified by the e-graph. + """ + # Share an e-graph for the computation of shape and eval + egraph = _get_current_egraph() + with set_array_api_egraph(egraph): + shape = self.shape.eval() + + def _inner_values(current_index: tuple[int, ...], remaining_dims: tuple[Int, ...]) -> VecValuesRecursive: + if not remaining_dims: + return self.index(current_index) + return Vec(*(_inner_values((*current_index, i), remaining_dims[1:]) for i in range(remaining_dims[0]))) + + res = _inner_values((), shape) + egraph.register(res) + egraph.run(array_api_schedule) + return egraph.extract(res) + + @method(preserve=True) + def eval(self) -> PyTupleValuesRecursive: + """ + Evals to a nested tuple of values representing the array. + """ + + def _to_tuple(v: VecValuesRecursive) -> PyTupleValuesRecursive: + if isinstance(v, Value): + return v + return tuple(_to_tuple(i) for i in v) + + return _to_tuple(self.eval_vecs()) + + @method(preserve=True) + def eval_numpy(self, dtype: np.dtype | None = None) -> np.ndarray: + """ + Evals to a numpy ndarray. + """ + print(self.eval()[0]) + return np.array(self.eval(), dtype=dtype) + + @method(preserve=True) + def __array__(self, dtype=None, copy=None) -> np.ndarray: + if copy is False: + msg = "NDArray.__array__ with copy=False is not supported" + raise NotImplementedError(msg) + return self.eval_numpy(dtype=dtype) + + # @method(preserve=True) # type: ignore[prop-decorator] + # @property + # def value(self) -> PyTupleValuesRecursive: + # """ + # Evals to a nested tuple of values representing the array. + # """ + # match get_callable_args(self, NDArray): + # case (values,): + # return cast("RecursiveValue", values).value + # raise ExprValueError(self, "NDArray(values)") + @method(cost=200) @classmethod def var(cls, name: StringLike) -> NDArray: ... @@ -1414,7 +1640,8 @@ def __array_namespace__(self, api_version: object = None) -> ModuleType: return sys.modules[__name__] @property - def ndim(self) -> Int: ... + def ndim(self) -> Int: + return self.shape.length() @property def dtype(self) -> DType: ... @@ -1427,7 +1654,7 @@ def shape(self) -> TupleInt: ... @method(preserve=True) def __bool__(self) -> bool: - return self.to_value().to_bool.eval() + return self.index(()).to_bool.eval() @property def size(self) -> Int: ... @@ -1441,8 +1668,17 @@ def sum(self, axis: OptionalIntOrTupleLike = None) -> NDArray: ... @method(preserve=True) def __iter__(self) -> Iterator[NDArray]: - for i in range(len(self)): - yield self[IndexKey.int(Int(i))] + """ + Only for 1D arrays: https://data-apis.org/array-api/latest/API_specification/generated/array_api.array.__getitem__.html + + >>> list(NDArray((1, 2, 3))) + [NDArray(RecursiveValue(Value.from_int(Int(1)))), NDArray(RecursiveValue(Value.from_int(Int(2)))), NDArray(RecursiveValue(Value.from_int(Int(3))))] + """ + inner = self.eval() + if isinstance(inner, Value): + msg = "Cannot iterate over a 0D array" + raise TypeError(msg) + return map(NDArray, inner) def __getitem__(self, key: IndexKeyLike) -> NDArray: ... @@ -1519,47 +1755,18 @@ def __ror__(self, other: NDArray) -> NDArray: ... def __abs__(self) -> NDArray: ... - @classmethod - def scalar(cls, value: ValueLike) -> NDArray: - value = cast("Value", value) - return NDArray(TupleInt(), value.dtype, lambda _: value) - - def to_value(self) -> Value: - """ - Returns the value if this is a scalar. - """ - - def to_values(self) -> TupleValue: - """ - Returns the value if this is a vector. - """ - @property def T(self) -> NDArray: """ https://data-apis.org/array-api/2022.12/API_specification/generated/array_api.array.T.html#array_api.array.T """ # Only works on 2D arrays - return NDArray( + return NDArray.fn( (self.shape[1], self.shape[0]), self.dtype, lambda idx: self.index((idx[1], idx[0])), ) - @classmethod - def vector(cls, values: TupleValueLike) -> NDArray: - values = cast("TupleValue", values) - return NDArray((values.length(),), values[0].dtype, lambda idx: values[idx[0]]) - - @classmethod - def matrix(cls, values: TupleTupleValueLike) -> NDArray: - values = cast("TupleTupleValue", values) - return NDArray( - (values.length(), values[0].length()), - values[0][0].dtype, - lambda idx: values[idx[0]][idx[1]], - ) - def index(self, indices: TupleIntLike) -> Value: """ Return the value at the given indices. @@ -1568,120 +1775,56 @@ def index(self, indices: TupleIntLike) -> Value: @classmethod def if_(cls, b: BooleanLike, i: Callable[[], NDArray], j: Callable[[], NDArray]) -> NDArray: ... - @method(preserve=True) - def eval_vecs(self) -> VecValuesRecursive: - """ - Evals to a nested Vec of values representing the array. It will be extracted and simplified by the e-graph. - """ - # Share an e-graph for the computation of shape and eval - egraph = _get_current_egraph() - with set_array_api_egraph(egraph): - shape = self.shape.eval() - - def _inner_values(current_index: tuple[int, ...], remaining_dims: tuple[Int, ...]) -> VecValuesRecursive: - if not remaining_dims: - return self.index(current_index) - return Vec(*(_inner_values((*current_index, i), remaining_dims[1:]) for i in range(remaining_dims[0]))) - - res = _inner_values((), shape) - egraph.register(res) - egraph.run(array_api_schedule) - return egraph.extract(res) - - @method(preserve=True) - def eval(self) -> PyTupleValuesRecursive: - """ - Evals to a nested tuple of values representing the array. - """ - - def _to_tuple(v: VecValuesRecursive) -> PyTupleValuesRecursive: - if isinstance(v, Value): - return v - return tuple(_to_tuple(i) for i in v) - - return _to_tuple(self.eval_vecs()) - - @method(preserve=True) - def eval_numpy(self, dtype: np.dtype | None = None) -> np.ndarray: - """ - Evals to a numpy ndarray. - """ - return np.array(self.eval(), dtype=dtype) - - @method(preserve=True) - def __array__(self, dtype=None, copy=None) -> np.ndarray: - if copy is False: - msg = "NDArray.__array__ with copy=False is not supported" - raise NotImplementedError(msg) - return self.eval_numpy(dtype=dtype) - VecValuesRecursive: TypeAlias = "Value | Vec[VecValuesRecursive]" -PyTupleValuesRecursive: TypeAlias = Value | tuple["PyTupleValuesRecursive", ...] -NDArrayLike: TypeAlias = NDArray | ValueLike | TupleValueLike +NDArrayLike: TypeAlias = NDArray | RecursiveValueLike converter(NDArray, IndexKey, lambda v: IndexKey.ndarray(v)) -converter(Value, NDArray, lambda v: NDArray.scalar(v)) +converter(RecursiveValue, NDArray, lambda v: NDArray(v)) # Need this if we want to use ints in slices of arrays coming from 1d arrays, but make it more expensive # to prefer upcasting in the other direction when we can, which is safer at runtime -converter(NDArray, Value, lambda n: n.to_value(), 100) -converter(TupleValue, NDArray, lambda v: NDArray.vector(v)) -converter(TupleInt, TupleValue, lambda v: TupleValue.from_tuple_int(v)) +converter(NDArray, Value, lambda n: n.index(()), 100) @array_api_ruleset.register def _ndarray( x: NDArray, - x1: NDArray, shape: TupleInt, dtype: DType, idx_fn: Callable[[TupleInt], Value], idx: TupleInt, - tv: TupleValue, v: Value, v1: Value, - vi: Vec[Int], xt: Callable[[], NDArray], x1t: Callable[[], NDArray], + rv: RecursiveValue, + vi: Vec[Int], + i: i64, ): return [ - rewrite(NDArray(shape, dtype, idx_fn).shape).to(shape), - rewrite(NDArray(shape, dtype, idx_fn).dtype).to(dtype), - rewrite(NDArray(shape, dtype, idx_fn).index(idx), subsume=True).to(idx_fn(idx)), - rewrite(x.ndim).to(x.shape.length()), - # rewrite(NDArray.scalar(Value.bool(b)).to_bool()).to(b), - # Converting to a value requires a scalar bool value - rewrite(x.to_value()).to(x.index(TupleInt())), - rewrite(NDArray.vector(tv).to_values()).to(tv), - rewrite(NDArray(TupleInt(vi), dtype, idx_fn).to_values(), subsume=True).to( - TupleValue.fn(vi[0], lambda i: idx_fn(TupleInt([i]))), - vi.length() == i64(1), - ), - # TODO: Push these down to float - rewrite(NDArray.scalar(v) / NDArray.scalar(v)).to(NDArray.scalar(v / v)), - rewrite(NDArray.scalar(v) + NDArray.scalar(v)).to(NDArray.scalar(v + v)), - rewrite(NDArray.scalar(v) * NDArray.scalar(v)).to(NDArray.scalar(v * v)), - # - - rewrite(NDArray.scalar(v) - NDArray.scalar(v)).to(NDArray.scalar(v - v)), + rewrite(NDArray.fn(shape, dtype, idx_fn).shape, subsume=True).to(shape), + rewrite(NDArray.fn(shape, dtype, idx_fn).dtype, subsume=True).to(dtype), + rewrite(NDArray.fn(shape, dtype, idx_fn).index(idx), subsume=True).to(idx_fn(idx)), + rewrite(NDArray(rv).shape, subsume=True).to(rv.shape), + rewrite(NDArray(rv).index(idx), subsume=True).to(rv[idx]), + # TODO: Special case scalar ops for now + rewrite(NDArray(v) / NDArray(v), subsume=True).to(NDArray(v / v)), + rewrite(NDArray(v) + NDArray(v), subsume=True).to(NDArray(v + v)), + rewrite(NDArray(v) * NDArray(v), subsume=True).to(NDArray(v * v)), + rewrite(NDArray(v) ** NDArray(v1), subsume=True).to(NDArray(v**v1)), + rewrite(NDArray(v) - NDArray(v), subsume=True).to(NDArray(v - v)), # Comparisons - rewrite(NDArray.scalar(v) < NDArray.scalar(v1)).to(NDArray.scalar(v < v1)), - rewrite(NDArray.scalar(v) <= NDArray.scalar(v1)).to(NDArray.scalar(v <= v1)), - rewrite(NDArray.scalar(v) == NDArray.scalar(v1)).to(NDArray.scalar(v == v1)), - rewrite(NDArray.scalar(v) > NDArray.scalar(v1)).to(NDArray.scalar(v > v1)), - rewrite(NDArray.scalar(v) >= NDArray.scalar(v1)).to(NDArray.scalar(v >= v1)), + rewrite(NDArray(v) < NDArray(v1), subsume=True).to(NDArray(v < v1)), + rewrite(NDArray(v) <= NDArray(v1), subsume=True).to(NDArray(v <= v1)), + rewrite(NDArray(v) == NDArray(v1), subsume=True).to(NDArray(v == v1)), + rewrite(NDArray(v) > NDArray(v1), subsume=True).to(NDArray(v > v1)), + rewrite(NDArray(v) >= NDArray(v1), subsume=True).to(NDArray(v >= v1)), # Transpose of transpose is the original array - rewrite(x.T.T).to(x), - # rewrite(reshape(x, shape).T, subsume=True).to(reshape(x, shape.reverse())), - # rewrite(reshape(x, shape).shape).to(shape), + rewrite(x.T.T, subsume=True).to(x), # if_ - rewrite(NDArray.if_(TRUE, xt, x1t)).to(xt()), - rewrite(NDArray.if_(FALSE, xt, x1t)).to(x1t()), - # convert to scalar - rewrite(NDArray(TupleInt(), dtype, idx_fn)).to(NDArray.scalar(idx_fn(TupleInt()))), - # Scalars should push operators down - rewrite(NDArray.scalar(v) / NDArray.scalar(v1)).to(NDArray.scalar(v / v1)), - rewrite(NDArray.scalar(v) ** NDArray.scalar(v1)).to(NDArray.scalar(v**v1)), + rewrite(NDArray.if_(TRUE, xt, x1t), subsume=True).to(xt()), + rewrite(NDArray.if_(FALSE, xt, x1t), subsume=True).to(x1t()), ] @@ -1699,18 +1842,25 @@ def __len__(self) -> int: def __iter__(self) -> Iterator[NDArray]: return iter(self.eval()) - @method(merge=Vec.__or__) # type: ignore[prop-decorator] - @property - def to_vec(self) -> Vec[NDArray]: ... @method(preserve=True) def eval(self) -> tuple[NDArray, ...]: - return try_evaling(_get_current_egraph(), array_api_schedule, self, self.to_vec) + return try_evaling(self) + @method(preserve=True) # type: ignore[prop-decorator] + @property + def value(self) -> tuple[NDArray, ...]: + match get_callable_args(self, TupleNDArray): + case (vec,): + return tuple(cast("Vec[NDArray]", vec)) + raise ExprValueError(self, "TupleNDArray(vec)") + + @method(unextractable=True) def append(self, i: NDArrayLike) -> TupleNDArray: return TupleNDArray.fn( self.length() + 1, lambda j: NDArray.if_(j == self.length(), lambda: cast("NDArray", i), lambda: self[j]) ) + @method(unextractable=True) def __add__(self, other: TupleValueLike) -> TupleNDArray: other = cast("TupleNDArray", other) return TupleNDArray.fn( @@ -1730,21 +1880,21 @@ def _tuple_ndarray( i2: Int, idx_fn: Callable[[Int], NDArray], vs: Vec[NDArray], + vs2: Vec[NDArray], ti: TupleNDArray, k: i64, lt: Callable[[], TupleNDArray], lf: Callable[[], TupleNDArray], ): - yield rule(eq(ti).to(TupleNDArray(vs))).then(set_(ti.to_vec).to(vs)) + yield rule(eq(ti).to(TupleNDArray(vs)), eq(ti).to(TupleNDArray(vs2)), vs != vs2).then(vs | vs2) + yield rewrite(TupleNDArray.fn(i2, idx_fn).length(), subsume=True).to(i2) + yield rewrite(TupleNDArray.fn(i2, idx_fn)[i], subsume=True).to(idx_fn(check_index(i2, i))) - yield rewrite(TupleNDArray.fn(i2, idx_fn).length()).to(i2) - yield rewrite(TupleNDArray.fn(i2, idx_fn)[i]).to(idx_fn(check_index(i, i2))) - - yield rewrite(TupleNDArray(vs).length()).to(Int(vs.length())) - yield rewrite(TupleNDArray(vs)[Int(k)]).to(vs[k], k >= 0, k < vs.length()) + yield rewrite(TupleNDArray(vs).length(), subsume=True).to(Int(vs.length())) + yield rewrite(TupleNDArray(vs)[Int(k)], subsume=True).to(vs[k], k >= 0, k < vs.length()) yield rewrite(TupleNDArray.fn(Int(k), idx_fn), subsume=True).to( - TupleNDArray(k.range().map(lambda i: idx_fn(Int(i)))) + TupleNDArray(k.range().map(lambda i: idx_fn(Int(i)))), k >= 0 ) @@ -1838,7 +1988,7 @@ def sum(x: NDArray, axis: OptionalIntOrTuple = OptionalIntOrTuple.none) -> NDArr @array_api_ruleset.register def _sum(x: NDArray, y: NDArray, v: Value, dtype: DType): return [ - rewrite(sum(x / NDArray.scalar(v))).to(sum(x) / NDArray.scalar(v)), + rewrite(sum(x / NDArray(v))).to(sum(x) / NDArray(v)), # Sum of 0D array is ] @@ -1921,9 +2071,7 @@ def astype(x: NDArray, dtype: DType) -> NDArray: ... def _astype(x: NDArray, dtype: DType, i: i64): return [ rewrite(astype(x, dtype).dtype).to(dtype), - rewrite(astype(NDArray.scalar(Value.int(Int(i))), float64)).to( - NDArray.scalar(Value.float(Float(f64.from_i64(i)))) - ), + rewrite(astype(NDArray(Value.from_int(Int(i))), float64)).to(NDArray(Value.from_float(Float(f64.from_i64(i))))), ] @@ -1943,10 +2091,10 @@ def _unique_counts(x: NDArray, c: NDArray, tv: TupleValue, v: Value, dtype: DTyp # rewrite(unique_counts(x).length()).to(Int(2)), rewrite(unique_counts(x)).to(TupleNDArray.fn(2, unique_counts(x).__getitem__)), # Sum of all unique counts is the size of the array - rewrite(sum(unique_counts(x)[Int(1)])).to(NDArray.scalar(Value.int(x.size))), + rewrite(sum(unique_counts(x)[Int(1)])).to(NDArray(Value.from_int(x.size))), # Same but with astype in the middle # TODO: Replace - rewrite(sum(astype(unique_counts(x)[Int(1)], dtype))).to(astype(NDArray.scalar(Value.int(x.size)), dtype)), + rewrite(sum(astype(unique_counts(x)[Int(1)], dtype))).to(astype(NDArray(Value.from_int(x.size)), dtype)), ] @@ -1969,7 +2117,7 @@ def log(x: NDArray) -> NDArray: ... @array_api_ruleset.register def _abs(f: Float): return [ - rewrite(abs(NDArray.scalar(Value.float(f)))).to(NDArray.scalar(Value.float(f.abs()))), + rewrite(abs(NDArray(Value.from_float(f)))).to(NDArray(Value.from_float(f.abs()))), ] @@ -2023,7 +2171,7 @@ def real(x: NDArray) -> NDArray: ... def conj(x: NDArray) -> NDArray: ... -@function(ruleset=array_api_ruleset, subsume=True) +@function(ruleset=array_api_ruleset, unextractable=True) def vecdot(x1: NDArrayLike, x2: NDArrayLike) -> NDArray: """ https://data-apis.org/array-api/2022.12/API_specification/generated/array_api.vecdot.html @@ -2031,31 +2179,31 @@ def vecdot(x1: NDArrayLike, x2: NDArrayLike) -> NDArray: TODO: Support axis, complex numbers, broadcasting, and more than matrix-vector - >>> v = NDArray.matrix([[0., 5., 0.], [0., 0., 10.], [0., 6., 8.]]) - >>> n = NDArray.vector([0., 0.6, 0.8]) + >>> v = NDArray([[0., 5., 0.], [0., 0., 10.], [0., 6., 8.]]) + >>> n = NDArray([0., 0.6, 0.8]) >>> vecdot(v, n).eval_numpy("float64") array([ 3., 8., 10.]) """ x1 = cast("NDArray", x1) x2 = cast("NDArray", x2) - return NDArray( + return NDArray.fn( x1.shape.drop_last(), x1.dtype, lambda idx: ( TupleInt.range(x1.shape.last()) .map_value(lambda i: x1.index(idx.append(i)) * x2.index((i,))) - .foldl_value(Value.__add__, Value.float(0)) + .foldl_value(Value.__add__, Value.from_float(0)) ), ) -@function(ruleset=array_api_ruleset, subsume=True) +@function(ruleset=array_api_ruleset, unextractable=True) def vector_norm(x: NDArrayLike) -> NDArray: """ https://data-apis.org/array-api/2022.12/extensions/generated/array_api.linalg.vector_norm.html TODO: support axis - # >>> x = NDArray.vector([1, 2, 3, 4, 5, 6, 7, 8, 9]) + # >>> x = NDArray([1, 2, 3, 4, 5, 6, 7, 8, 9]) # >>> vector_norm(x).eval_numpy("float64") # array(16.88194302) """ @@ -2063,28 +2211,29 @@ def vector_norm(x: NDArrayLike) -> NDArray: # sum(abs(x)**ord)**(1./ord) where ord=2 x = cast("NDArray", x) # Only works on vectors - return NDArray.scalar( - x.to_values() - .map_value(lambda v: v.__abs__() ** Value.float(Float(2.0))) - .foldl_value(Value.__add__, Value.float(0)) - ** Value.float(Float(0.5)) + return NDArray( + TupleInt.range(x.shape[0]).foldl_value( + lambda acc, i: acc + (x.index((i,)).__abs__() ** Value.from_float(Float(2.0))), + Value.from_float(Float(0.0)), + ) + ** Value.from_float(Float(0.5)) ) -@function(ruleset=array_api_ruleset, subsume=True) +@function(ruleset=array_api_ruleset, unextractable=True) def cross(a: NDArrayLike, b: NDArrayLike) -> NDArray: """ https://data-apis.org/array-api/2022.12/extensions/generated/array_api.linalg.cross.html TODO: support axis, and more than two vecs - >>> x = NDArray.vector([1, 2, 3]) - >>> y = NDArray.vector([4, 5, 6]) + >>> x = NDArray([1, 2, 3]) + >>> y = NDArray([4, 5, 6]) >>> cross(x, y).eval_numpy("int64") array([-3, 6, -3]) """ a = cast("NDArray", a) b = cast("NDArray", b) - return NDArray( + return NDArray.fn( (3,), a.dtype, lambda idx: ( @@ -2112,7 +2261,7 @@ def _linalg(x: NDArray, full_matrices: Boolean): ] -@function(ruleset=array_api_ruleset) +@function(ruleset=array_api_ruleset, unextractable=True) def ndindex(shape: TupleIntLike) -> TupleTupleInt: """ https://numpy.org/doc/stable/reference/generated/numpy.ndindex.html @@ -2124,7 +2273,7 @@ def ndindex(shape: TupleIntLike) -> TupleTupleInt: ## # Interval analysis # -# to analyze `any(((astype(unique_counts(NDArray.var("y"))[Int(1)], DType.float64) / NDArray.scalar(Value.float(Float(150.0))) < NDArray.scalar(Value.int(Int(0)))).bool()`` +# to analyze `any(((astype(unique_counts(NDArray.var("y"))[Int(1)], DType.float64) / NDArray(Value.float(Float(150.0))) < NDArray(Value.from_int(Int(0)))).bool()`` ## greater_zero = relation("greater_zero", Value) @@ -2145,9 +2294,9 @@ def ndindex(shape: TupleIntLike) -> TupleTupleInt: # ... -# any((astype(unique_counts(_NDArray_1)[Int(1)], DType.float64) / NDArray.scalar(Value.float(Float(150.0)))) < NDArray.scalar(Value.int(Int(0)))).to_bool() +# any((astype(unique_counts(_NDArray_1)[Int(1)], DType.float64) / NDArray(Value.float(Float(150.0)))) < NDArray(Value.from_int(Int(0)))).to_bool() -# sum(astype(unique_counts(_NDArray_1)[Int(1)], DType.float64) / NDArray.scalar(Value.int(Int(150)))) +# sum(astype(unique_counts(_NDArray_1)[Int(1)], DType.float64) / NDArray(Value.from_int(Int(150)))) # And also # def @@ -2187,20 +2336,22 @@ def _interval_analaysis( x_value = x.index(broadcast_index(x.shape, res_shape, idx)) y_value = y.index(broadcast_index(y.shape, res_shape, idx)) return [ - # Calling any on an array gives back a sclar, which is true if any of the values are truthy + # Calling any on an array gives back a scalar, which is true if any of the values are truthy rewrite(any(x)).to( - NDArray.scalar(Value.bool(possible_values(x.index(ALL_INDICES).to_truthy_value).contains(Value.bool(TRUE)))) + NDArray( + Value.from_bool(possible_values(x.index(ALL_INDICES).to_truthy_value).contains(Value.from_bool(TRUE))) + ) ), # Indexing x < y is the same as broadcasting the index and then indexing both and then comparing rewrite((x < y).index(idx)).to(x_value < y_value), # Same for x / y rewrite((x / y).index(idx)).to(x_value / y_value), # Indexing a scalar is the same as the scalar - rewrite(NDArray.scalar(v).index(idx)).to(v), + rewrite(NDArray(v).index(idx)).to(v), # Indexing of astype is same as astype of indexing rewrite(astype(x, dtype).index(idx)).to(x.index(idx).astype(dtype)), - # rule(eq(y).to(x < NDArray.scalar(Value.int(Int(0)))), ndarray_all_greater_0(x)).then(ndarray_all_false(y)), - # rule(eq(y).to(any(x)), ndarray_all_false(x)).then(union(y).with_(NDArray.scalar(Value.bool(FALSE)))), + # rule(eq(y).to(x < NDArray(Value.from_int(Int(0)))), ndarray_all_greater_0(x)).then(ndarray_all_false(y)), + # rule(eq(y).to(any(x)), ndarray_all_false(x)).then(union(y).with_(NDArray(Value.bool(FALSE)))), # Indexing into unique counts counts are all positive rule( eq(v).to(unique_counts(x)[Int(1)].index(idx)), @@ -2213,9 +2364,9 @@ def _interval_analaysis( greater_zero(v1), ), # Min value of scalar is scalar itself - rule(eq(v).to(Value.float(Float(f))), f > 0.0).then(greater_zero(v)), - rule(eq(v).to(Value.int(Int(i))), i > 0).then(greater_zero(v)), - # If we have divison of v and v1, and both greater than zero, then the result is greater than zero + rule(eq(v).to(Value.from_float(Float(f))), f > 0.0).then(greater_zero(v)), + rule(eq(v).to(Value.from_int(Int(i))), i > 0).then(greater_zero(v)), + # If we have division of v and v1, and both greater than zero, then the result is greater than zero rule( greater_zero(v), greater_zero(v1), @@ -2226,12 +2377,12 @@ def _interval_analaysis( # Define v < 0 to be false, if greater_zero(v) rule( greater_zero(v), - eq(v1).to(v < Value.int(Int(0))), + eq(v1).to(v < Value.from_int(Int(0))), ).then( - union(v1).with_(Value.bool(FALSE)), + union(v1).with_(Value.from_bool(FALSE)), ), # possible values of bool is bool - rewrite(possible_values(Value.bool(b))).to(TupleValue([Value.bool(b)])), + rewrite(possible_values(Value.from_bool(b))).to(TupleValue([Value.from_bool(b)])), # casting to a type preserves if > 0 rule( eq(v1).to(v.astype(dtype)), @@ -2257,20 +2408,6 @@ def _demand_shape(compound: NDArray, inner: NDArray) -> Command: return rule(eq(__a).to(compound)).then(inner.shape, inner.shape.length()) -@array_api_ruleset.register -def _scalar_math(v: Value, vs: TupleValue, i: Int): - yield rewrite(NDArray.scalar(v).shape).to(TupleInt()) - yield rewrite(NDArray.scalar(v).dtype).to(v.dtype) - yield rewrite(NDArray.scalar(v).index(TupleInt())).to(v) - - -@array_api_ruleset.register -def _vector_math(v: Value, vs: TupleValue, ti: TupleInt): - yield rewrite(NDArray.vector(vs).shape).to(TupleInt([vs.length()])) - yield rewrite(NDArray.vector(vs).dtype).to(vs[Int(0)].dtype) - yield rewrite(NDArray.vector(vs).index(ti)).to(vs[ti[0]]) - - @array_api_ruleset.register def _reshape_math(x: NDArray, shape: TupleInt, copy: OptionalBool): res = reshape(x, shape, copy) @@ -2291,7 +2428,7 @@ def _reshape_math(x: NDArray, shape: TupleInt, copy: OptionalBool): @array_api_ruleset.register def _indexing_pushdown(x: NDArray, shape: TupleInt, copy: OptionalBool, i: Int): # rewrite full getitem to indexec - yield rewrite(x[IndexKey.int(i)]).to(NDArray.scalar(x.index(TupleInt([i])))) + yield rewrite(x[IndexKey.int(i)]).to(NDArray(x.index(TupleInt([i])))) # TODO: Multi index rewrite as well if all are ints @@ -2348,7 +2485,7 @@ def _isfinite(x: NDArray, ti: TupleInt): yield rewrite(x.shape).to(orig_x.shape) yield rewrite(x.dtype).to(orig_x.dtype) yield rewrite(x.index(ti)).to(orig_x.index(ti)) - # But say that any indixed value is finite + # But say that any indexed value is finite yield rewrite(x.index(ti).isfinite()).to(TRUE) @@ -2375,17 +2512,17 @@ def _assume_value_one_of(x: NDArray, v: Value, vs: TupleValue, idx: TupleInt): @array_api_ruleset.register def _ndarray_value_isfinite(arr: NDArray, x: Value, xs: TupleValue, i: Int, f: f64, b: Boolean): - yield rewrite(Value.int(i).isfinite()).to(TRUE) - yield rewrite(Value.bool(b).isfinite()).to(TRUE) - yield rewrite(Value.float(Float(f)).isfinite()).to(TRUE, ne(f).to(f64(math.nan))) + yield rewrite(Value.from_int(i).isfinite()).to(TRUE) + yield rewrite(Value.from_bool(b).isfinite()).to(TRUE) + yield rewrite(Value.from_float(Float(f)).isfinite()).to(TRUE, ne(f).to(f64(math.nan))) # a sum of an array is finite if all the values are finite - yield rewrite(isfinite(sum(arr))).to(NDArray.scalar(Value.bool(arr.index(ALL_INDICES).isfinite()))) + yield rewrite(isfinite(sum(arr))).to(NDArray(Value.from_bool(arr.index(ALL_INDICES).isfinite()))) @array_api_ruleset.register def _unique(xs: TupleValue, a: NDArray, shape: TupleInt, copy: OptionalBool): - yield rewrite(unique_values(x=a)).to(NDArray.vector(possible_values(a.index(ALL_INDICES)))) + yield rewrite(unique_values(x=a)).to(NDArray.from_tuple_value(possible_values(a.index(ALL_INDICES)))) # yield rewrite( # possible_values(reshape(a.index(shape, copy), ALL_INDICES)), # ).to(possible_values(a.index(ALL_INDICES))) @@ -2457,8 +2594,8 @@ def array_api_functional_ruleset( idx_fn: Callable[[TupleInt], Value], ): # TODO: Support -1 in shape like numpy does - yield rewrite(reshape(NDArray(old_shape, dtype, idx_fn), shape, ob), subsume=True).to( - NDArray(shape, dtype, lambda idx: idx_fn(unravel_index(ravel_index(idx, shape), old_shape))) + yield rewrite(reshape(NDArray.fn(old_shape, dtype, idx_fn), shape, ob), subsume=True).to( + NDArray.fn(shape, dtype, lambda idx: idx_fn(unravel_index(ravel_index(idx, shape), old_shape))) ) @@ -2484,35 +2621,50 @@ def _get_current_egraph() -> EGraph: return _CURRENT_EGRAPH or EGraph(save_egglog_string=True) -def try_evaling(egraph: EGraph, schedule: Schedule, expr: Expr, prim_expr: BuiltinExpr) -> Any: +T_co = TypeVar("T_co", covariant=True) + + +class ExprWithValue(Protocol[T_co]): + @property + def value(self) -> T_co: ... + + +def try_evaling(expr: ExprWithValue[T_co]) -> T_co: """ Try evaluating an expression that should produce a primitive (e.g., Bool/i64). If extraction fails, register the expr, run the schedule, and retry. - On egglog panics we dump the .egg program for debugging. - A common failure mode is that no rule ever sets the primitive output - (e.g., `Boolean.to_bool` / `Int.to_i64`), so extraction fails. """ - try: - return egraph.extract(prim_expr).value # type: ignore[attr-defined] - except EggSmolError: - pass + egraph = _get_current_egraph() + egraph.register(expr) # type: ignore[arg-type] + egraph.run(array_api_schedule) + return egraph.extract(expr).value # type: ignore[call-overload] + # try: + # return egraph.extract(prim_expr).value # type: ignore[attr-defined] + # except EggSmolError: + # pass # If this primitive doesn't exist in the egraph, we need to try to create it by # registering the expression and running the schedule - egraph.register(expr) - try: - egraph.run(schedule) - except EggSmolError as e: - # Write out the egraph for debugging - with NamedTemporaryFile(mode="w", suffix=".egg", delete=False) as f: - f.write(egraph.as_egglog_string) - e.add_note(f"EGraph written to {f.name} for debugging") - raise - try: - return egraph.extract(prim_expr).value # type: ignore[attr-defined] - except BaseException as e: - # egraph.display(n_inline_leaves=1, split_primitive_outputs=True) - e.add_note(f"Cannot evaluate {egraph.extract(expr)}") - raise + # egraph.register(expr) + # try: + # _report = egraph.run(schedule) + # # Matching rules? + # # for k, v in _report.num_matches_per_rule.items(): + # # if v > 0: + # # print(f"Applied rule {k} {v} times") + # except EggSmolError as e: + # # Write out the egraph for debugging + # with NamedTemporaryFile(mode="w", suffix=".egg", delete=False) as f: + # f.write(egraph.as_egglog_string) + # e.add_note(f"EGraph written to {f.name} for debugging") + # raise + # try: + # return egraph.extract(prim_expr).value # type: ignore[attr-defined] + # except BaseException as e: + # # egraph.display(n_inline_leaves=1, split_primitive_outputs=True) + # e.add_note(f"Cannot evaluate {egraph.extract(expr)}") + # raise + + # egraph.saturate(array_api_combined_ruleset + run(), n_inline_leaves=2, split_functions=[Int]) ## @@ -2554,7 +2706,7 @@ def to_polynomial_ruleset( mss: MultiSet[MultiSet[Value]], mss1: MultiSet[MultiSet[Value]], ): - yield rewrite(n1 - n2, subsume=True).to(n1 + (Value.int(-1) * n2)) + yield rewrite(n1 - n2, subsume=True).to(n1 + (Value.from_int(-1) * n2)) yield rule( eq(n3).to(n1 + n2), name="add", @@ -2628,9 +2780,9 @@ def from_polynomial_ruleset(mss: MultiSet[MultiSet[Value]]): yield rewrite(polynomial(mss)).to( multiset_fold( Value.__add__, - Value.int(0), + Value.from_int(0), mss.map( - partial(multiset_fold, mul, Value.int(1)), + partial(multiset_fold, mul, Value.from_int(1)), ), ) ) diff --git a/python/egglog/exp/array_api_numba.py b/python/egglog/exp/array_api_numba.py index ddb320cc..dc76e6c9 100644 --- a/python/egglog/exp/array_api_numba.py +++ b/python/egglog/exp/array_api_numba.py @@ -19,7 +19,7 @@ @array_api_numba_ruleset.register def _mean(y: NDArray, x: NDArray, i: Int): axis = OptionalIntOrTuple.some(IntOrTuple.int(i)) - res = sum(x, axis) / NDArray.scalar(Value.int(x.shape[i])) + res = sum(x, axis) / NDArray.scalar(Value.from_int(x.shape[i])) yield rewrite(mean(x, axis, FALSE), subsume=True).to(res) yield rewrite(mean(x, axis, TRUE), subsume=True).to(expand_dims(res, i)) @@ -63,7 +63,7 @@ def _unique_counts(x: NDArray, c: NDArray, tv: TupleValue, v: Value): def _unique_inverse(x: NDArray, i: Int): return [ # Creating a mask array of when the unique inverse is a value is the same as a mask array for when the value is that index of the unique values - rewrite(unique_inverse(x)[Int(1)] == NDArray.scalar(Value.int(i)), subsume=True).to( + rewrite(unique_inverse(x)[Int(1)] == NDArray.scalar(Value.from_int(i)), subsume=True).to( x == NDArray.scalar(unique_values(x).index((i,))) ), ] diff --git a/python/egglog/exp/array_api_program_gen.py b/python/egglog/exp/array_api_program_gen.py index 57027f1c..f76b51e3 100644 --- a/python/egglog/exp/array_api_program_gen.py +++ b/python/egglog/exp/array_api_program_gen.py @@ -15,10 +15,7 @@ array_api_program_gen_eval_ruleset = ruleset(name="array_api_program_gen_eval_ruleset") array_api_program_gen_combined_ruleset = ( - array_api_program_gen_ruleset - | program_gen_ruleset - | array_api_program_gen_eval_ruleset - | array_api_vec_to_cons_ruleset + array_api_program_gen_ruleset | program_gen_ruleset | array_api_program_gen_eval_ruleset ) array_api_program_gen_schedule = (array_api_program_gen_combined_ruleset | eval_program_rulseset).saturate() @@ -139,9 +136,9 @@ def value_program(x: Value) -> Program: ... @array_api_program_gen_ruleset.register def _value_program(i: Int, b: Boolean, f: Float, x: NDArray, v1: Value, v2: Value, xs: NDArray, ti: TupleInt): - yield rewrite(value_program(Value.int(i))).to(int_program(i)) - yield rewrite(value_program(Value.bool(b))).to(bool_program(b)) - yield rewrite(value_program(Value.float(f))).to(float_program(f)) + yield rewrite(value_program(Value.from_int(i))).to(int_program(i)) + yield rewrite(value_program(Value.from_bool(b))).to(bool_program(b)) + yield rewrite(value_program(Value.from_float(f))).to(float_program(f)) # Could add .item() but we usually dont need it. yield rewrite(value_program(x.to_value())).to(ndarray_program(x)) yield rewrite(value_program(v1 < v2)).to(Program("(") + value_program(v1) + " < " + value_program(v2) + ")") diff --git a/python/egglog/exp/vecdot_example.py b/python/egglog/exp/vecdot_example.py index 2ba958c9..ffe19b05 100644 --- a/python/egglog/exp/vecdot_example.py +++ b/python/egglog/exp/vecdot_example.py @@ -1,43 +1,48 @@ from egglog.exp.array_api import * -# v = NDArray.matrix([[0.0, 5.0, 0.0], [0.0, 0.0, 10.0], [0.0, 6.0, 8.0]]) -# n = NDArray.vector([0.0, 0.6, 0.8]) # smaller example -v = NDArray.matrix([[1, 2], [3, 4]]) -n = NDArray.vector([3, 4]) +v = NDArray([[1, 2], [3, 4]]) +n = NDArray([3, 4]) res = vecdot(v, n) + +print(res.eval_numpy("int64")) # This fails with EggSmolError: Panic: Illegal merge attempted for function egglog_exp_array_api_Int_to_i64 # assert str(res.eval_numpy("float64")) == "array([ 3., 8., 10.])" # Trying to debug by inlining the code for eval -egraph = EGraph() -egraph.register(res.shape) -egraph.run(array_api_schedule) -assert eq(egraph.extract(res.shape)).to(TupleInt(Vec(Int(2)))) -idxed = res.index((0,)) -egraph.register(res.index((0,))) - -# This is what fails -# egraph.run(array_api_schedule) -# print(egraph.extract(res.index((0,)))) -# Trying to debug by running step by step - -i = 0 -# egraph.saturate(array_api_combined_ruleset + run(), visualize=True, n_inline_leaves=2, split_primitive_outputs=True) -while (report := egraph.run(array_api_combined_ruleset + run())).updated: - print(f"Step {i}:") - rules_applied = [(k, v) for k, v in report.num_matches_per_rule.items() if v > 0] - for rule, count in rules_applied: - print(f" Applied rule {rule} {count} time(s)") - # print out all e-classes - egraph.debug_print() - # If we want to look at which rules were applied: - # matches = [k for k, v in report.num_matches_per_rule.items() if v > 0] - # print(f"Step {i}: applied rules: {matches}") - - # If we want to see the current extraction: - # print(egraph.extract(res.index((0,)))) - - i += 1 +# egraph = EGraph() +# # egraph.set_report_level(StageInfo()) +# egraph.register(res.index((0,))) +# # Trying to debug by running step by step + +# i = 0 +# prev_int01 = egraph.check_bool(eq(Int(0)).to(Int(1))) +# prev_tf = egraph.check_bool(eq(TRUE).to(FALSE)) +# # egraph.saturate(array_api_combined_ruleset + run(), visualize=True, n_inline_leaves=2, split_primitive_outputs=True) +# while True: +# try: +# report = egraph.run(array_api_combined_ruleset + run()) +# except EggSmolError as e: +# print(f"Step {i}: EggSmolError: {e}") +# print("Int(0) == Int(1)?", egraph.check_bool(eq(Int(0)).to(Int(1)))) +# print("TRUE == FALSE?", egraph.check_bool(eq(TRUE).to(FALSE))) +# egraph.debug_print() +# raise +# if not report.updated: +# break +# print(f"Step {i}:") +# rules_applied = [(k, v) for k, v in report.num_matches_per_rule.items() if v > 0] +# for rule, count in rules_applied: +# print(f" Applied rule {rule} {count} time(s)") +# int01 = egraph.check_bool(eq(Int(0)).to(Int(1))) +# tf = egraph.check_bool(eq(TRUE).to(FALSE)) +# if int01 != prev_int01 or tf != prev_tf: +# print("=== New equality detected ===") +# print("Int(0) == Int(1)?", int01) +# print("TRUE == FALSE?", tf) +# egraph.debug_print() +# prev_int01 = int01 +# prev_tf = tf +# i += 1 diff --git a/python/tests/test_array_api.py b/python/tests/test_array_api.py index 42fe3e8c..d18430c0 100644 --- a/python/tests/test_array_api.py +++ b/python/tests/test_array_api.py @@ -39,9 +39,9 @@ def is_even(x: Int) -> Boolean: class TestTupleValue: def test_includes(self): - x = TupleValue.EMPTY.append(Value.bool(FALSE)) - check_eq(x.contains(Value.bool(FALSE)), TRUE, array_api_schedule) - check_eq(x.contains(Value.bool(TRUE)), FALSE, array_api_schedule) + x = TupleValue.EMPTY.append(Value.from_bool(FALSE)) + check_eq(x.contains(Value.from_bool(FALSE)), TRUE, array_api_schedule) + check_eq(x.contains(Value.from_bool(TRUE)), FALSE, array_api_schedule) class TestTupleInt: @@ -126,9 +126,9 @@ def test_simplify_any_unique(self): any( ( astype(unique_counts(NDArray.var("X"))[Int(1)], DType.float64) - / NDArray.scalar(Value.float(Float(150.0))) + / NDArray.scalar(Value.from_float(Float(150.0))) ) - < NDArray.scalar(Value.int(Int(0))) + < NDArray.scalar(Value.from_int(Int(0))) ) .to_value() .to_bool diff --git a/src/serialize.rs b/src/serialize.rs index a18281ce..29b91554 100644 --- a/src/serialize.rs +++ b/src/serialize.rs @@ -35,7 +35,7 @@ impl SerializedEGraph { serde_json::to_string(&self.egraph).unwrap() } - /// Split all primitive nodes, as well as other ops that match, into seperate e-classes + /// Split all primitive nodes, as well as other ops that match, into separate e-classes fn split_classes(&mut self, egraph: &EGraph, ops: HashSet) { self.egraph.split_classes(|id, node| { egraph.egraph.from_node_id(id).is_primitive() || ops.contains(&node.op) From cfc87e4f894225185867f68cd24fab9332a44d2e Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Wed, 4 Feb 2026 20:31:49 -0800 Subject: [PATCH 27/30] tmp --- python/egglog/bindings.pyi | 1 + python/egglog/egraph.py | 53 +++++++---- python/egglog/egraph_state.py | 2 +- python/egglog/exp/array_api.py | 138 +++++++++++++++++++--------- python/egglog/exp/vecdot_example.py | 38 +++++++- src/egraph.rs | 2 +- src/freeze.rs | 2 + 7 files changed, 169 insertions(+), 67 deletions(-) diff --git a/python/egglog/bindings.pyi b/python/egglog/bindings.pyi index b598336c..2fa4cf60 100644 --- a/python/egglog/bindings.pyi +++ b/python/egglog/bindings.pyi @@ -899,6 +899,7 @@ class FrozenEGraph: class FrozenFunction: input_sorts: list[str] output_sort: str + is_let_binding: bool rows: list[FrozenRow] @final diff --git a/python/egglog/egraph.py b/python/egglog/egraph.py index 0601df16..306145a4 100644 --- a/python/egglog/egraph.py +++ b/python/egglog/egraph.py @@ -1341,29 +1341,42 @@ def debug_print(self) -> None: """ print("=== EGraph Debug Print ===") print("Mapping from functions to their e-class") - for name, fn in self._egraph.freeze().functions.items(): - for row in fn.rows: - call = self._values_to_expr(row.inputs, name) - # None for let calls we cant resolve - if call is None: - continue - res = RuntimeExpr.__from_values__( - self.__egg_decls__, - TypedExprDecl( - tp=call.__egg_typed_expr__.tp, - expr=self._state.value_to_expr(tp=call.__egg_typed_expr__.tp, value=row.output), - ), - ) - equality = eq(call).to(res) - debug_str = str(equality) + # printed_output_sorts = set() + frozen = self._egraph.freeze() + for name, fn in sorted(frozen.functions.items(), key=lambda kv: kv[1].output_sort): + printed_output_values = set() + for row in sorted(fn.rows, key=lambda r: r.output): + if fn.is_let_binding: + call = RuntimeExpr.__from_values__( + self.__egg_decls__, + TypedExprDecl(self._state.egg_sort_to_type_ref[fn.output_sort], LetRefDecl(name)), + ) + else: + call = self._values_to_expr(row.inputs, name) + + # if call.__egg_typed_expr__.tp not in printed_output_sorts: + # printed_output_sorts.add(call.__egg_typed_expr__.tp) + # print(f"\n# {call.__egg_typed_expr__.tp}\n") + + if row.output not in printed_output_values: + printed_output_values.add(row.output) + + res = RuntimeExpr.__from_values__( + self.__egg_decls__, + TypedExprDecl( + tp=call.__egg_typed_expr__.tp, + expr=self._state.value_to_expr(tp=call.__egg_typed_expr__.tp, value=row.output), + ), + ) + print(f"\n## {res}: {call.__egg_typed_expr__.tp}\n") + if row.subsumed: - debug_str += " # subsumed" - print(debug_str) + print(subsume(cast("Expr", call))) + else: + print(call) print("=== End EGraph Debug Print ===") - def _values_to_expr(self, args: list[bindings._Value], name: str) -> RuntimeExpr | None: - if name not in self._state.egg_fn_to_callable_refs: - return None + def _values_to_expr(self, args: list[bindings._Value], name: str) -> RuntimeExpr: (callable_ref,) = self._state.egg_fn_to_callable_refs[name] signature = self.__egg_decls__.get_callable_decl(callable_ref).signature assert isinstance(signature, FunctionSignature) diff --git a/python/egglog/egraph_state.py b/python/egglog/egraph_state.py index f14059a6..8eed25f2 100644 --- a/python/egglog/egraph_state.py +++ b/python/egglog/egraph_state.py @@ -54,7 +54,7 @@ class EGraphState: rulesets: dict[Ident, set[RewriteOrRuleDecl]] = field(default_factory=dict) # Bidirectional mapping between egg function names and python callable references. - # Note that there are possibly mutliple callable references for a single egg function name, like `+` + # Note that there are possibly multiple callable references for a single egg function name, like `+` # for both int and rational classes. egg_fn_to_callable_refs: dict[str, set[CallableRef]] = field( default_factory=lambda: defaultdict(set, {"!=": {FunctionRef(Ident.builtin("!="))}}) diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index 0c282c70..42685690 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -545,12 +545,23 @@ def append(self, i: IntLike) -> TupleInt: >>> ti = TupleInt.range(3) >>> ti2 = ti.append(3) >>> list(ti2) - [i64(0), i64(1), i64(2), i64(3)] + [Int(0), Int(1), Int(2), Int(3)] """ return TupleInt.fn( self.length() + 1, lambda j: Int.if_(j == self.length(), lambda: cast("Int", i), lambda: self[j]) ) + @method(unextractable=True) + def append_start(self, i: IntLike) -> TupleInt: + """ + Prepend an integer to the start of the tuple. + >>> ti = TupleInt.range(3) + >>> ti2 = ti.append_start( -1) + >>> list(ti2) + [Int(-1), Int(0), Int(1), Int(2)] + """ + return TupleInt.fn(self.length() + 1, lambda j: Int.if_(j == 0, lambda: cast("Int", i), lambda: self[j - 1])) + @method(unextractable=True) def __add__(self, other: TupleIntLike) -> TupleInt: """ @@ -826,8 +837,8 @@ def _tuple_int( yield rewrite(TupleInt.fn(i2, idx_fn).length(), subsume=True).to(i2) yield rewrite(TupleInt.fn(i2, idx_fn)[i], subsume=True).to(idx_fn(check_index(i2, i))) - yield rewrite(TupleInt(vs).length(), subsume=True).to(Int(vs.length())) - yield rewrite(TupleInt(vs)[Int(k)], subsume=True).to(vs[k]) + yield rewrite(TupleInt(vs).length()).to(Int(vs.length())) + yield rewrite(TupleInt(vs)[Int(k)]).to(vs[k]) yield rewrite(TupleInt.if_(TRUE, lt, lf), subsume=True).to(lt()) yield rewrite(TupleInt.if_(FALSE, lt, lf), subsume=True).to(lf()) @@ -1488,22 +1499,29 @@ def shape(self) -> TupleInt: [Int(2), Int(1)] """ - # @method(preserve=True) # type: ignore[prop-decorator] - # @property - # def value(self) -> PyTupleValuesRecursive: - # """ - # Unwraps the RecursiveValue into either a Value or a nested tuple of Values. + @method(preserve=True) # type: ignore[prop-decorator] + @property + def value(self) -> PyTupleValuesRecursive: + """ + Unwraps the RecursiveValue into either a Value or a nested tuple of Values. - # >>> convert(((1, 2), (3, 4)), RecursiveValue).value - # ((Value.from_int(Int(1)), Value.from_int(Int(2))), (Value.from_int(Int(3)), Value.from_int(Int(4)))) - # """ - # match get_callable_args(self, RecursiveValue): - # case (value,): - # return cast("Value", value) - # match get_callable_args(self, RecursiveValue.vec): - # case (vec,): - # return tuple(v.value for v in cast("Vec[RecursiveValue]", vec)) - # raise ExprValueError(self, "RecursiveValue or RecursiveValue.vec") + >>> convert(((1, 2), (3, 4)), RecursiveValue).value + ((Value.from_int(Int(1)), Value.from_int(Int(2))), (Value.from_int(Int(3)), Value.from_int(Int(4)))) + """ + match get_callable_args(self, RecursiveValue): + case (value,): + return cast("Value", value) + match get_callable_args(self, RecursiveValue.vec): + case (vec,): + return tuple(v.value for v in cast("Vec[RecursiveValue]", vec)) + raise ExprValueError(self, "RecursiveValue or RecursiveValue.vec") + + @method(preserve=True) + def eval(self) -> PyTupleValuesRecursive: + """ + Evals to a nested tuple of values representing the RecursiveValue. + """ + return try_evaling(self) PyTupleValuesRecursive: TypeAlias = Value | tuple["PyTupleValuesRecursive", ...] @@ -1525,15 +1543,20 @@ def _recursive_value( lt: Callable[[], RecursiveValue], lf: Callable[[], RecursiveValue], vi: Vec[Int], + rv: RecursiveValue, ): yield rewrite(RecursiveValue(v).shape).to(TupleInt(())) yield rewrite(RecursiveValue.vec(vs).shape).to(TupleInt((vs.length(),)) + vs[0].shape, vs.length() > 0) yield rewrite(RecursiveValue.vec(vs).shape).to(TupleInt((0,)), vs.length() == i64(0)) yield rewrite(RecursiveValue(v)[ti], subsume=True).to(v) # Assume ti is empty - yield rewrite(RecursiveValue.vec(vs)[TupleInt(vi)], subsume=True).to( - vs[k][TupleInt(vi.remove(0))], + + yield rule( + eq(v).to(RecursiveValue.vec(vs)[TupleInt(vi)]), + vi.length() > 0, eq(vi[0]).to(Int(k)), + ).then( + union(v).with_(vs[k][TupleInt(vi.remove(0))]), ) @@ -1572,45 +1595,47 @@ def from_tuple_value(cls, tv: TupleValueLike) -> NDArray: lambda idx: tv[idx[0]], ) - @method(preserve=True) - def eval_vecs(self) -> VecValuesRecursive: - """ - Evals to a nested Vec of values representing the array. It will be extracted and simplified by the e-graph. - """ - # Share an e-graph for the computation of shape and eval - egraph = _get_current_egraph() - with set_array_api_egraph(egraph): - shape = self.shape.eval() + def to_recursive_value(self) -> RecursiveValue: ... + + # @method(preserve=True) + # def eval_vecs(self) -> VecValuesRecursive: + # """ + # Evals to a nested Vec of values representing the array. It will be extracted and simplified by the e-graph. + # """ + # # Share an e-graph for the computation of shape and eval + # egraph = _get_current_egraph() + # with set_array_api_egraph(egraph): + # shape = self.shape.eval() - def _inner_values(current_index: tuple[int, ...], remaining_dims: tuple[Int, ...]) -> VecValuesRecursive: - if not remaining_dims: - return self.index(current_index) - return Vec(*(_inner_values((*current_index, i), remaining_dims[1:]) for i in range(remaining_dims[0]))) + # def _inner_values(current_index: tuple[int, ...], remaining_dims: tuple[Int, ...]) -> VecValuesRecursive: + # if not remaining_dims: + # return self.index(current_index) + # return Vec(*(_inner_values((*current_index, i), remaining_dims[1:]) for i in range(remaining_dims[0]))) - res = _inner_values((), shape) - egraph.register(res) - egraph.run(array_api_schedule) - return egraph.extract(res) + # res = _inner_values((), shape) + # egraph.register(res) + # egraph.run(array_api_schedule) + # return egraph.extract(res) @method(preserve=True) def eval(self) -> PyTupleValuesRecursive: """ Evals to a nested tuple of values representing the array. """ + return self.to_recursive_value().eval() - def _to_tuple(v: VecValuesRecursive) -> PyTupleValuesRecursive: - if isinstance(v, Value): - return v - return tuple(_to_tuple(i) for i in v) + # def _to_tuple(v: VecValuesRecursive) -> PyTupleValuesRecursive: + # if isinstance(v, Value): + # return v + # return tuple(_to_tuple(i) for i in v) - return _to_tuple(self.eval_vecs()) + # return _to_tuple(self.eval_vecs()) @method(preserve=True) def eval_numpy(self, dtype: np.dtype | None = None) -> np.ndarray: """ Evals to a numpy ndarray. """ - print(self.eval()[0]) return np.array(self.eval(), dtype=dtype) @method(preserve=True) @@ -1775,6 +1800,17 @@ def index(self, indices: TupleIntLike) -> Value: @classmethod def if_(cls, b: BooleanLike, i: Callable[[], NDArray], j: Callable[[], NDArray]) -> NDArray: ... + def partial_index(self, i: IntLike) -> NDArray: + """ + Partially index into the array, returning a sub-array. + + >>> NDArray(((1, 2), (3, 4))).partial_index(0).eval_numpy("int64") + array([1, 2]) + """ + return NDArray.fn( + self.shape.drop(1), self.dtype, lambda idx: self.index(idx.append_start(check_index(self.shape[0], i))) + ) + VecValuesRecursive: TypeAlias = "Value | Vec[VecValuesRecursive]" @@ -1825,6 +1861,22 @@ def _ndarray( # if_ rewrite(NDArray.if_(TRUE, xt, x1t), subsume=True).to(xt()), rewrite(NDArray.if_(FALSE, xt, x1t), subsume=True).to(x1t()), + # to RecursiveValue + rewrite(NDArray(rv).to_recursive_value(), subsume=True).to(rv), + rewrite(NDArray.fn((), dtype, idx_fn).to_recursive_value(), subsume=True).to( + RecursiveValue(idx_fn(TupleInt(()))) + ), + rule( + eq(x).to(NDArray.fn(TupleInt(vi), dtype, idx_fn)), + x.to_recursive_value(), + vi.length() > i64(0), + eq(vi[0]).to(Int(i)), + ).then( + union(x.to_recursive_value()).with_( + RecursiveValue.vec(i.range().map(lambda j: x.partial_index(j).to_recursive_value())) + ), + subsume(x.to_recursive_value()), + ), ] diff --git a/python/egglog/exp/vecdot_example.py b/python/egglog/exp/vecdot_example.py index ffe19b05..0c98e179 100644 --- a/python/egglog/exp/vecdot_example.py +++ b/python/egglog/exp/vecdot_example.py @@ -1,11 +1,45 @@ from egglog.exp.array_api import * -# smaller example v = NDArray([[1, 2], [3, 4]]) n = NDArray([3, 4]) res = vecdot(v, n) +egraph = EGraph() +egraph.register(res.to_recursive_value()) +egraph.run(array_api_schedule) + +_RecursiveValue_1 = RecursiveValue.vec( + Vec( + RecursiveValue.vec( + Vec( + RecursiveValue(Value.from_int(Int(1))), + RecursiveValue(Value.from_int(Int(2))), + ) + ), + RecursiveValue.vec( + Vec( + RecursiveValue(Value.from_int(Int(3))), + RecursiveValue(Value.from_int(Int(4))), + ) + ), + ) +) +egraph.let("im_value", _RecursiveValue_1[TupleInt(Vec(Int(0), Int(0)))]) +new_res = egraph.extract(res.to_recursive_value()) + + +egraph.debug_print() +print(new_res) + +# new_egraph = EGraph() +# new_egraph.register(new_res) +# new_egraph.run(array_api_schedule) +# print(new_egraph.extract(new_res)) + + +# smaller example + -print(res.eval_numpy("int64")) +# print(res.eval_numpy("int64")) # This fails with EggSmolError: Panic: Illegal merge attempted for function egglog_exp_array_api_Int_to_i64 # assert str(res.eval_numpy("float64")) == "array([ 3., 8., 10.])" diff --git a/src/egraph.rs b/src/egraph.rs index e6291150..a1efff98 100644 --- a/src/egraph.rs +++ b/src/egraph.rs @@ -263,5 +263,5 @@ impl EGraph { /// Wrapper around Egglog Value. Represents either a primitive base value or a reference to an e-class. #[derive(Ord, PartialOrd, Eq, PartialEq, Hash, Debug, Clone)] -#[pyclass(eq, frozen, hash, str = "{0:?}")] +#[pyclass(eq, frozen, ord, hash, str = "{0:?}")] pub struct Value(pub egglog::Value); diff --git a/src/freeze.rs b/src/freeze.rs index 5ce89ba5..c5aa4414 100644 --- a/src/freeze.rs +++ b/src/freeze.rs @@ -20,6 +20,7 @@ pub struct FrozenRow { pub struct FrozenFunction { input_sorts: Vec, output_sort: String, + is_let_binding: bool, rows: Vec, } @@ -56,6 +57,7 @@ impl FrozenEGraph { .collect(), output_sort: func.schema().output.name().to_string(), rows, + is_let_binding: func.is_let_binding(), }; functions.insert(fname.clone(), frozen_function); } From 6afb528ec44620262bef2c8f9c224b7d40975483 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Wed, 4 Feb 2026 21:55:12 -0800 Subject: [PATCH 28/30] simplify --- python/egglog/exp/array_api.py | 13 ++++++------- python/egglog/exp/vecdot_example.py | 17 ----------------- 2 files changed, 6 insertions(+), 24 deletions(-) diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index 42685690..8b6126bc 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -1480,12 +1480,12 @@ def __init__(self, value: ValueLike) -> None: ... @classmethod def vec(cls, vec: VecLike[RecursiveValue, RecursiveValueLike]) -> RecursiveValue: ... - def __getitem__(self, index: TupleIntLike) -> Value: + def __getitem__(self, index: VecLike[Int, IntLike]) -> Value: """ Index into the RecursiveValue with the given indices. It should match the shape. >>> rv = convert(((1, 2), (3, 4)), RecursiveValue) - >>> int(rv[TupleInt([0, 1])]) + >>> int(rv[[0, 1]]) 2 """ @@ -1538,7 +1538,6 @@ def _recursive_value( i2: Int, v: Value, vs: Vec[RecursiveValue], - ti: TupleInt, k: i64, lt: Callable[[], RecursiveValue], lf: Callable[[], RecursiveValue], @@ -1549,14 +1548,14 @@ def _recursive_value( yield rewrite(RecursiveValue.vec(vs).shape).to(TupleInt((vs.length(),)) + vs[0].shape, vs.length() > 0) yield rewrite(RecursiveValue.vec(vs).shape).to(TupleInt((0,)), vs.length() == i64(0)) - yield rewrite(RecursiveValue(v)[ti], subsume=True).to(v) # Assume ti is empty + yield rewrite(RecursiveValue(v)[vi], subsume=True).to(v) # Assume ti is empty yield rule( - eq(v).to(RecursiveValue.vec(vs)[TupleInt(vi)]), + eq(v).to(RecursiveValue.vec(vs)[vi]), vi.length() > 0, eq(vi[0]).to(Int(k)), ).then( - union(v).with_(vs[k][TupleInt(vi.remove(0))]), + union(v).with_(vs[k][vi.remove(0)]), ) @@ -1843,7 +1842,7 @@ def _ndarray( rewrite(NDArray.fn(shape, dtype, idx_fn).dtype, subsume=True).to(dtype), rewrite(NDArray.fn(shape, dtype, idx_fn).index(idx), subsume=True).to(idx_fn(idx)), rewrite(NDArray(rv).shape, subsume=True).to(rv.shape), - rewrite(NDArray(rv).index(idx), subsume=True).to(rv[idx]), + rewrite(NDArray(rv).index(TupleInt(vi)), subsume=True).to(rv[vi]), # TODO: Special case scalar ops for now rewrite(NDArray(v) / NDArray(v), subsume=True).to(NDArray(v / v)), rewrite(NDArray(v) + NDArray(v), subsume=True).to(NDArray(v + v)), diff --git a/python/egglog/exp/vecdot_example.py b/python/egglog/exp/vecdot_example.py index 0c98e179..df388464 100644 --- a/python/egglog/exp/vecdot_example.py +++ b/python/egglog/exp/vecdot_example.py @@ -7,23 +7,6 @@ egraph.register(res.to_recursive_value()) egraph.run(array_api_schedule) -_RecursiveValue_1 = RecursiveValue.vec( - Vec( - RecursiveValue.vec( - Vec( - RecursiveValue(Value.from_int(Int(1))), - RecursiveValue(Value.from_int(Int(2))), - ) - ), - RecursiveValue.vec( - Vec( - RecursiveValue(Value.from_int(Int(3))), - RecursiveValue(Value.from_int(Int(4))), - ) - ), - ) -) -egraph.let("im_value", _RecursiveValue_1[TupleInt(Vec(Int(0), Int(0)))]) new_res = egraph.extract(res.to_recursive_value()) From 338649ac07df51eb6c1d86127ddad7a2aae47ac2 Mon Sep 17 00:00:00 2001 From: Saul Shanabrook Date: Thu, 5 Feb 2026 10:20:01 -0800 Subject: [PATCH 29/30] tmp --- python/egglog/builtins.py | 3 ++ python/egglog/exp/array_api.py | 18 +++++------- python/egglog/exp/vecdot_example.py | 43 ++++++++++++++++++++++++++--- 3 files changed, 49 insertions(+), 15 deletions(-) diff --git a/python/egglog/builtins.py b/python/egglog/builtins.py index 62c1a776..32074bbd 100644 --- a/python/egglog/builtins.py +++ b/python/egglog/builtins.py @@ -115,6 +115,9 @@ def replace(self, old: StringLike, new: StringLike) -> String: ... def __add__(self, other: StringLike) -> String: return join(self, other) + @method(egg_fn="log") + def log(self) -> Unit: ... + StringLike: TypeAlias = String | str diff --git a/python/egglog/exp/array_api.py b/python/egglog/exp/array_api.py index 8b6126bc..edf87917 100644 --- a/python/egglog/exp/array_api.py +++ b/python/egglog/exp/array_api.py @@ -1534,15 +1534,7 @@ def eval(self) -> PyTupleValuesRecursive: @array_api_ruleset.register def _recursive_value( - i: Int, - i2: Int, - v: Value, - vs: Vec[RecursiveValue], - k: i64, - lt: Callable[[], RecursiveValue], - lf: Callable[[], RecursiveValue], - vi: Vec[Int], - rv: RecursiveValue, + v: Value, vs: Vec[RecursiveValue], k: i64, vi: Vec[Int], vi1: Vec[Int], rv: RecursiveValue, rv1: RecursiveValue ): yield rewrite(RecursiveValue(v).shape).to(TupleInt(())) yield rewrite(RecursiveValue.vec(vs).shape).to(TupleInt((vs.length(),)) + vs[0].shape, vs.length() > 0) @@ -1551,11 +1543,15 @@ def _recursive_value( yield rewrite(RecursiveValue(v)[vi], subsume=True).to(v) # Assume ti is empty yield rule( - eq(v).to(RecursiveValue.vec(vs)[vi]), + eq(rv).to(RecursiveValue.vec(vs)), + eq(v).to(rv[vi]), vi.length() > 0, eq(vi[0]).to(Int(k)), + eq(rv1).to(vs[k]), + eq(vi1).to(vi.remove(0)), ).then( - union(v).with_(vs[k][vi.remove(0)]), + union(v).with_(rv1[vi1]), + subsume(rv[vi]), ) diff --git a/python/egglog/exp/vecdot_example.py b/python/egglog/exp/vecdot_example.py index df388464..70414fff 100644 --- a/python/egglog/exp/vecdot_example.py +++ b/python/egglog/exp/vecdot_example.py @@ -1,17 +1,52 @@ from egglog.exp.array_api import * -v = NDArray([[1, 2], [3, 4]]) -n = NDArray([3, 4]) +v = NDArray([[1], [3]]) +n = NDArray([3]) res = vecdot(v, n) -egraph = EGraph() +egraph = EGraph(save_egglog_string=True) egraph.register(res.to_recursive_value()) egraph.run(array_api_schedule) +print(egraph.run(array_api_ruleset).updated) +print(egraph.run(array_api_ruleset).updated) + +print(egraph.extract(res.to_recursive_value())) -new_res = egraph.extract(res.to_recursive_value()) + +@egraph.run +@ruleset +def _recursive_value( + i: Int, + i2: Int, + v: Value, + v1: Value, + vs: Vec[RecursiveValue], + k: i64, + lt: Callable[[], RecursiveValue], + lf: Callable[[], RecursiveValue], + vi: Vec[Int], + vi1: Vec[Int], + rv: RecursiveValue, + rv1: RecursiveValue, +): + yield rule( + eq(rv).to(RecursiveValue.vec(vs)), + eq(v).to(rv[vi]), + vi.length() > 0, + eq(vi[0]).to(Int(k)), + eq(rv1).to(vs[k]), + eq(vi1).to(vi.remove(0)), + ).then( + union(v).with_(rv1[vi1]), + subsume(rv[vi]), + ) egraph.debug_print() +new_res = egraph.extract(res.to_recursive_value()) print(new_res) +# print(egraph.as_egglog_string) +# egraph.debug_print() +# print(new_res) # new_egraph = EGraph() # new_egraph.register(new_res) From 451c93c355f42dcd526ebdd611c356b487a326bc Mon Sep 17 00:00:00 2001 From: "pre-commit-ci[bot]" <66853113+pre-commit-ci[bot]@users.noreply.github.com> Date: Thu, 5 Feb 2026 18:20:15 +0000 Subject: [PATCH 30/30] [pre-commit.ci] auto fixes from pre-commit.com hooks for more information, see https://pre-commit.ci --- docs/conf.py | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/docs/conf.py b/docs/conf.py index 49142405..4d8f159b 100644 --- a/docs/conf.py +++ b/docs/conf.py @@ -1,4 +1,4 @@ -import pathlib # noqa: INP001 +import pathlib import subprocess ##